| dbo:abstract |
(+)-Morphine also known as dextro-morphine is the "unnatural" enantiomer of the opioid drug (-)-morphine. Unlike "natural" levo-morphine, unnatural dextro-morphine is not present in Papaver somniferum and is the product of laboratory synthesis. In contrast to natural morphine, the unnatural enantiomer has no affinity or efficacy for the mu opioid receptor and therefore has no analgesic effects. To the contrary, in rats, (+)-morphine acts as an antianalgesic and is approximately 71,000 times more potent as an antianalgesic than (-)-morphine is as an analgesic. (+)-Morphine derives its antianalgesic effects by being a selective-agonist of the Toll-like receptor 4 (TLR4), which due to not binding to opioid receptors allows it to effectively reverse the analgesic properties of (-)-morphine. TLR4 is involved in immune system responses, and activation of TLR4 induces glial activation and release of inflammatory mediators such as TNF-α and Interleukin-1. (en) |
| dbo:pubchem |
5479215 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Unnatural_Morphine.png?width=300 |
| dbo:wikiPageID |
69155769 (xsd:integer) |
| dbo:wikiPageLength |
3556 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1059786973 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Enantiomer dbr:Antianalgesia dbr:(+)-Naloxone dbc:Cyclohexenols dbc:Ethers dbc:Morphine dbc:Phenols dbr:Morphine dbr:TLR4 dbr:Tumor_necrosis_factor-alpha dbr:Papaver_somniferum dbr:Glia dbr:Dextromethorphan dbr:IL1B dbr:Immune_system dbr:Mu_opioid_receptor |
| dbp:c |
17 (xsd:integer) |
| dbp:chemspiderid |
4586177 (xsd:integer) |
| dbp:h |
19 (xsd:integer) |
| dbp:iupacName |
-3 (xsd:integer) |
| dbp:n |
1 (xsd:integer) |
| dbp:o |
3 (xsd:integer) |
| dbp:pubchem |
5479215 (xsd:integer) |
| dbp:smiles |
CN1CC[C@@]23[C@H]4[C@@H]1CC5=C2CO[C@@H]3[C@@H]O (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
BQJCRHHNABKAKU-QHQPWPDESA-N (en) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Reflist dbt:Chemspidercite dbt:Stdinchicite |
| dcterms:subject |
dbc:Cyclohexenols dbc:Ethers dbc:Morphine dbc:Phenols |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
(+)-Morphine also known as dextro-morphine is the "unnatural" enantiomer of the opioid drug (-)-morphine. Unlike "natural" levo-morphine, unnatural dextro-morphine is not present in Papaver somniferum and is the product of laboratory synthesis. (en) |
| rdfs:label |
(+)-Morphine (en) |
| owl:sameAs |
wikidata:(+)-Morphine https://global.dbpedia.org/id/G6T53 |
| prov:wasDerivedFrom |
wikipedia-en:(+)-Morphine?oldid=1059786973&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Unnatural_Morphine.png |
| foaf:isPrimaryTopicOf |
wikipedia-en:(+)-Morphine |
| is foaf:primaryTopic of |
wikipedia-en:(+)-Morphine |
