BU72 (original) (raw)
BU72 is an extremely potent opioid, with one of the highest known affinities for the μ-opioid receptor. In animal studies, it was found to be a potent analgesic, with a slow onset and long duration of action, but was not considered suitable to develop for medical use. It was used to produce the first crystal structure of the active μ-opioid receptor, and is now widely used to model the activation process. The stereochemistry has recently been revised, with the phenyl group in the (R) configuration, which has been accepted by the authors of the crystal structure.
| Property | Value |
|---|---|
| dbo:abstract | BU72 is an extremely potent opioid, with one of the highest known affinities for the μ-opioid receptor. In animal studies, it was found to be a potent analgesic, with a slow onset and long duration of action, but was not considered suitable to develop for medical use. It was used to produce the first crystal structure of the active μ-opioid receptor, and is now widely used to model the activation process. The stereochemistry has recently been revised, with the phenyl group in the (R) configuration, which has been accepted by the authors of the crystal structure. (en) |
| dbo:casNumber | 173265-76-4 |
| dbo:chEMBL | 4649916 |
| dbo:fdaUniiCode | KVN8RP2FQX |
| dbo:pubchem | 137348291 |
| dbo:thumbnail | wiki-commons:Special:FilePath/BU72beta_structure.png?width=300 |
| dbo:wikiPageID | 66281876 (xsd:integer) |
| dbo:wikiPageLength | 5418 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID | 1108867853 (xsd:integer) |
| dbo:wikiPageWikiLink | dbc:Mu-opioid_receptor_agonists dbc:Nitrogen_heterocycles dbr:Stereochemistry dbr:Crystal_structure dbr:Phenyl_group dbr:Buprenorphine dbr:7-PET dbr:Analgesic dbr:BU-48 dbr:BU08028 dbr:Μ-opioid_receptor dbr:Absolute_configuration dbc:Heterocyclic_compounds_with_6_rings dbr:Opioid dbr:File:BU72_structure.png |
| dbp:c | 28 (xsd:integer) |
| dbp:casNumber | 173265 (xsd:integer) |
| dbp:chembl | 4649916 (xsd:integer) |
| dbp:chemspiderid | 9662011 (xsd:integer) |
| dbp:h | 32 (xsd:integer) |
| dbp:iupacName | -3 (xsd:integer) |
| dbp:iupharLigand | 9363 (xsd:integer) |
| dbp:n | 2 (xsd:integer) |
| dbp:o | 2 (xsd:integer) |
| dbp:pdbLigand | VF1 (en) |
| dbp:pubchem | 137348291 (xsd:integer) |
| dbp:smiles | CO[C@]12C=C[C@]34C[C@@]1[C@H]c7ccccc7 (en) |
| dbp:stdinchi | InChI=1S/C28H32N2O2/c1-25-17-26-11-12-28242713-14-302215-19-9-10-2016-2127/h4-12,16,22-24,29,31H,13-15,17H2,1-3H3/t22-,23-,24+,25+,26-,27+,28+/m1/s1 (en) |
| dbp:stdinchikey | RGJHUVJQGAAZLK-GKTFKBBASA-N (en) |
| dbp:unii | KVN8RP2FQX (en) |
| dbp:wikiPageUsesTemplate | dbt:Clear-left dbt:Drugbox dbt:Pharm-stub dbt:Reflist dbt:Short_description dbt:Technical dbt:Cascite dbt:Fdacite |
| dcterms:subject | dbc:Mu-opioid_receptor_agonists dbc:Nitrogen_heterocycles dbc:Heterocyclic_compounds_with_6_rings |
| rdf:type | owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment | BU72 is an extremely potent opioid, with one of the highest known affinities for the μ-opioid receptor. In animal studies, it was found to be a potent analgesic, with a slow onset and long duration of action, but was not considered suitable to develop for medical use. It was used to produce the first crystal structure of the active μ-opioid receptor, and is now widely used to model the activation process. The stereochemistry has recently been revised, with the phenyl group in the (R) configuration, which has been accepted by the authors of the crystal structure. (en) |
| rdfs:label | BU72 (en) |
| owl:sameAs | wikidata:BU72 https://global.dbpedia.org/id/FXPak |
| prov:wasDerivedFrom | wikipedia-en:BU72?oldid=1108867853&ns=0 |
| foaf:depiction | wiki-commons:Special:FilePath/BU72_structure.png wiki-commons:Special:FilePath/BU72beta_structure.png |
| foaf:isPrimaryTopicOf | wikipedia-en:BU72 |
| is dbo:wikiPageWikiLink of | dbr:7-PET dbr:BU-48 dbr:BU08028 dbr:Μ-opioid_receptor |
| is foaf:primaryTopic of | wikipedia-en:BU72 |
