Belzutifan, sold under the brand name Welireg, is a medication used for the treatment of von Hippel–Lindau disease-associated renal cell carcinoma. It is taken by mouth. The most common side effects include decreased hemoglobin, anemia, fatigue, increased creatinine, headache, dizziness, increased glucose, and nausea. Belzutifan is an hypoxia-inducible factor-2 alpha (HIF-2α) inhibitor.
| Property |
Value |
| dbo:abstract |
Belzutifan, sold under the brand name Welireg, is a medication used for the treatment of von Hippel–Lindau disease-associated renal cell carcinoma. It is taken by mouth. The most common side effects include decreased hemoglobin, anemia, fatigue, increased creatinine, headache, dizziness, increased glucose, and nausea. Belzutifan is an hypoxia-inducible factor-2 alpha (HIF-2α) inhibitor. Belzutifan is the first drug to be awarded an "innovation passport" from the UK Medicines and Healthcare products Regulatory Agency (MHRA). Belzutifan was approved for medical use in the United States in August 2021. Belzutifan is the first hypoxia-inducible factor-2 alpha inhibitor therapy approved in the U.S. (en) |
| dbo:alternativeName |
Welireg (en) |
| dbo:casNumber |
1672668-24-4 |
| dbo:chEMBL |
4585668 |
| dbo:class |
dbr:Antineoplastic |
| dbo:drugbank |
DB15463 |
| dbo:fdaUniiCode |
7K28NB895L |
| dbo:kegg |
D11954 |
| dbo:pubchem |
117947097 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Belzutifan.png?width=300 |
| dbo:wikiPageExternalLink |
https://druginfo.nlm.nih.gov/drugportal/name/belzutifan |
| dbo:wikiPageID |
67502502 (xsd:integer) |
| dbo:wikiPageLength |
9651 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1113573897 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Hypoxia-inducible_factor dbr:Renal_cell_carcinoma dbr:Von_Hippel–Lindau_disease dbr:Indication_(medicine) dbc:Benzonitriles dbc:Fluoroarenes dbc:Indanes dbr:Medicines_and_Healthcare_products_Regulatory_Agency dbr:Oral_administration dbr:Antineoplastic dbc:Diphenyl_ethers dbc:Orphan_drugs dbc:Sulfonates dbc:Breakthrough_therapy dbr:Medication dbr:Pacak–Zhuang_syndrome |
| dbp:atcPrefix |
L01 (en) |
| dbp:atcSuffix |
XX74 (en) |
| dbp:c |
17 (xsd:integer) |
| dbp:casNumber |
1672668 (xsd:integer) |
| dbp:chembl |
4585668 (xsd:integer) |
| dbp:chemspiderid |
59053536 (xsd:integer) |
| dbp:class |
dbr:Antineoplastic |
| dbp:dailymedid |
Belzutifan (en) |
| dbp:drugbank |
DB15463 (en) |
| dbp:f |
3 (xsd:integer) |
| dbp:h |
12 (xsd:integer) |
| dbp:iupacName |
3 (xsd:integer) |
| dbp:kegg |
D11954 (en) |
| dbp:legalCa |
Rx-only (en) |
| dbp:legalUs |
Rx-only (en) |
| dbp:n |
1 (xsd:integer) |
| dbp:o |
4 (xsd:integer) |
| dbp:pdbLigand |
72 (xsd:integer) |
| dbp:pronounce |
bell-ZOO-ti-fan (en) |
| dbp:pubchem |
117947097 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Oral_administration |
| dbp:s |
1 (xsd:integer) |
| dbp:smiles |
CSc1cccc2c1[C@H][C@H][C@@H]2F (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
LOMMPXLFBTZENJ-ZACQAIPSSA-N (en) |
| dbp:synonyms |
MK-6482, PT2977 (en) |
| dbp:tradename |
Welireg (en) |
| dbp:unii |
7 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Chemotherapeutic_agents dbt:Antineoplastic-drug-stub dbt:Cite_web dbt:Infobox_drug dbt:Portal_bar dbt:Reflist dbt:Short_description dbt:Use_American_English dbt:Use_dmy_dates dbt:Cascite dbt:ClinicalTrialsGov |
| dcterms:subject |
dbc:Benzonitriles dbc:Fluoroarenes dbc:Indanes dbc:Diphenyl_ethers dbc:Orphan_drugs dbc:Sulfonates dbc:Breakthrough_therapy |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
Belzutifan, sold under the brand name Welireg, is a medication used for the treatment of von Hippel–Lindau disease-associated renal cell carcinoma. It is taken by mouth. The most common side effects include decreased hemoglobin, anemia, fatigue, increased creatinine, headache, dizziness, increased glucose, and nausea. Belzutifan is an hypoxia-inducible factor-2 alpha (HIF-2α) inhibitor. (en) |
| rdfs:label |
Belzutifan (en) |
| owl:sameAs |
wikidata:Belzutifan https://global.dbpedia.org/id/2ZKEJ |
| prov:wasDerivedFrom |
wikipedia-en:Belzutifan?oldid=1113573897&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Belzutifan.png |
| foaf:isPrimaryTopicOf |
wikipedia-en:Belzutifan |
| is dbo:wikiPageRedirects of |
dbr:Welireg |
| is dbo:wikiPageWikiLink of |
dbr:Hypoxia-inducible_factor dbr:Von_Hippel–Lindau_disease dbr:ATC_code_L01 dbr:Pacak–Zhuang_syndrome dbr:Welireg |
| is foaf:primaryTopic of |
wikipedia-en:Belzutifan |
