| dbo:abstract |
Binaltorphimine (BNI) is a selective antagonist of the κ-opioid receptor (KOR). BNI and norbinaltorphimine (nor-BNI) were the first highly selective KOR antagonists to be discovered. (en) |
| dbo:casNumber |
105618-27-7 |
| dbo:chEMBL |
610001 |
| dbo:fdaUniiCode |
94L0JAS27S |
| dbo:pubchem |
5484197 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Binaltorphimine.svg?width=300 |
| dbo:wikiPageID |
41469100 (xsd:integer) |
| dbo:wikiPageLength |
2809 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1090160083 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbc:4,5-Epoxymorphinans dbc:Phenols dbc:Tertiary_alcohols dbr:Receptor_antagonist dbr:5'-Guanidinonaltrindole dbc:Kappa-opioid_receptor_antagonists dbr:Norbinaltorphimine dbr:JDTic dbr:Κ-opioid_receptor |
| dbp:atcPrefix |
None (en) |
| dbp:c |
41 (xsd:integer) |
| dbp:casNumber |
105618 (xsd:integer) |
| dbp:chembl |
610001 (xsd:integer) |
| dbp:chemspiderid |
24673307 (xsd:integer) |
| dbp:h |
45 (xsd:integer) |
| dbp:iupacName |
-1133 (xsd:integer) |
| dbp:n |
3 (xsd:integer) |
| dbp:o |
6 (xsd:integer) |
| dbp:pubchem |
5484197 (xsd:integer) |
| dbp:smiles |
CN1C2=CC8=C1[C@H]9[C@@]12CCNCC1CC1 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
DKIVQMBUHVYDFC-IWRYZOJTSA-N (en) |
| dbp:unii |
94 (xsd:integer) |
| dbp:width |
200 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Nervous-system-drug-stub dbt:Opioidergics dbt:Reflist dbt:Short_description dbt:Cascite dbt:Fdacite |
| dct:subject |
dbc:4,5-Epoxymorphinans dbc:Phenols dbc:Tertiary_alcohols dbc:Kappa-opioid_receptor_antagonists |
| gold:hypernym |
dbr:Antagonist |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatChemicalSubstances yago:Abstraction100002137 yago:Chemical114806838 yago:Material114580897 yago:Matter100020827 yago:Part113809207 yago:PhysicalEntity100001930 yago:Relation100031921 dbo:Drug yago:Substance100019613 |
| rdfs:comment |
Binaltorphimine (BNI) is a selective antagonist of the κ-opioid receptor (KOR). BNI and norbinaltorphimine (nor-BNI) were the first highly selective KOR antagonists to be discovered. (en) |
| rdfs:label |
Binaltorphimine (en) |
| owl:sameAs |
freebase:Binaltorphimine yago-res:Binaltorphimine wikidata:Binaltorphimine https://global.dbpedia.org/id/ZMhj |
| prov:wasDerivedFrom |
wikipedia-en:Binaltorphimine?oldid=1090160083&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Binaltorphimine.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Binaltorphimine |
| is dbo:wikiPageRedirects of |
dbr:C41H45N3O6 |
| is dbo:wikiPageWikiLink of |
dbr:List_of_opioids dbr:C41H45N3O6 dbr:5'-Guanidinonaltrindole dbr:Norbinaltorphimine dbr:Opioid dbr:Κ-opioid_receptor |
| is foaf:primaryTopic of |
wikipedia-en:Binaltorphimine |
