CP-122,288 (original) (raw)
CP-122,288 is a drug which acts as a potent and selective agonist for the 5-HT1B, 5-HT1D and 5-HT1F serotonin receptor subtypes. It is a derivative of the migraine medication sumatriptan, but while CP-122,288 is 40,000 times more potent than sumatriptan as an inhibitor of neurogenic inflammation and plasma protein extravasation, it is only twice as potent as a constrictor of blood vessels. In human trials, CP-122,288 was not found to be effective as a treatment for migraine, but its selectivity for neurogenic anti-inflammatory action over vasoconstriction has made it useful for research into the underlying causes of migraine.
| Property | Value |
|---|---|
| dbo:abstract | CP-122,288 is a drug which acts as a potent and selective agonist for the 5-HT1B, 5-HT1D and 5-HT1F serotonin receptor subtypes. It is a derivative of the migraine medication sumatriptan, but while CP-122,288 is 40,000 times more potent than sumatriptan as an inhibitor of neurogenic inflammation and plasma protein extravasation, it is only twice as potent as a constrictor of blood vessels. In human trials, CP-122,288 was not found to be effective as a treatment for migraine, but its selectivity for neurogenic anti-inflammatory action over vasoconstriction has made it useful for research into the underlying causes of migraine. (en) |
| dbo:casNumber | 143321-74-8 |
| dbo:fdaUniiCode | 59E9WCT6EM |
| dbo:pubchem | 132552 |
| dbo:thumbnail | wiki-commons:Special:FilePath/CP-122,288_Structure.svg?width=300 |
| dbo:wikiPageID | 46919927 (xsd:integer) |
| dbo:wikiPageLength | 4333 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID | 1107937269 (xsd:integer) |
| dbo:wikiPageWikiLink | dbc:5-HT1B_agonists dbc:Amines dbc:Pyrrolidines dbc:Tryptamines dbr:Eletriptan dbr:CP-135807 dbr:5-MeO-MPMI dbr:Agonist dbc:5-HT1D_agonists dbc:5-HT1F_agonists dbr:Sumatriptan dbr:Migraine dbr:Serotonin_receptor dbr:5-HT1B dbr:5-HT1D dbr:5-HT1F |
| dbp:c | 16 (xsd:integer) |
| dbp:casNumber | 143321 (xsd:integer) |
| dbp:chemspiderid | 117032 (xsd:integer) |
| dbp:h | 23 (xsd:integer) |
| dbp:iupacName | N-methyl-1-[3--1H-indol-5-yl]methanesulfonamide (en) |
| dbp:iupharLigand | 110 (xsd:integer) |
| dbp:n | 3 (xsd:integer) |
| dbp:o | 2 (xsd:integer) |
| dbp:pubchem | 132552 (xsd:integer) |
| dbp:s | 1 (xsd:integer) |
| dbp:smiles | CNSCc1ccc2ccC[C@H]3CCCN3C (en) |
| dbp:stdinchi | 1 (xsd:integer) |
| dbp:stdinchikey | BWQZTHPHLITOOZ-CQSZACIVSA-N (en) |
| dbp:unii | 59000000000 (xsd:decimal) |
| dbp:width | 220 (xsd:integer) |
| dbp:wikiPageUsesTemplate | dbt:Drugbox dbt:Nervous-system-drug-stub dbt:Reflist dbt:Serotonin_receptor_modulators dbt:Short_description dbt:Cascite dbt:Fdacite |
| dcterms:subject | dbc:5-HT1B_agonists dbc:Amines dbc:Pyrrolidines dbc:Tryptamines dbc:5-HT1D_agonists dbc:5-HT1F_agonists |
| gold:hypernym | dbr:Drug |
| rdf:type | owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment | CP-122,288 is a drug which acts as a potent and selective agonist for the 5-HT1B, 5-HT1D and 5-HT1F serotonin receptor subtypes. It is a derivative of the migraine medication sumatriptan, but while CP-122,288 is 40,000 times more potent than sumatriptan as an inhibitor of neurogenic inflammation and plasma protein extravasation, it is only twice as potent as a constrictor of blood vessels. In human trials, CP-122,288 was not found to be effective as a treatment for migraine, but its selectivity for neurogenic anti-inflammatory action over vasoconstriction has made it useful for research into the underlying causes of migraine. (en) |
| rdfs:label | CP-122,288 (en) |
| owl:sameAs | yago-res:CP-122,288 wikidata:CP-122,288 https://global.dbpedia.org/id/y3rG |
| prov:wasDerivedFrom | wikipedia-en:CP-122,288?oldid=1107937269&ns=0 |
| foaf:depiction | wiki-commons:Special:FilePath/CP-122,288_Structure.svg |
| foaf:isPrimaryTopicOf | wikipedia-en:CP-122,288 |
| is dbo:wikiPageRedirects of | dbr:C16H23N3O2S |
| is dbo:wikiPageWikiLink of | dbr:C16H23N3O2S dbr:5-HT1B_receptor |
| is foaf:primaryTopic of | wikipedia-en:CP-122,288 |
