Cetadiol, also known as androst-5-ene-3β,16α-diol, is a drug described as a "steroid tranquilizer" which was briefly investigated as a treatment for alcoholism in the 1950s. It is an androstane steroid and analogue of 5-androstenediol (androst-5-ene-3β,17β-diol) and 16α-hydroxy-DHEA (androst-5-ene-3β,16α-diol-17-one), but showed no androgenic or myotrophic activity in animal bioassays. The drug was reported in 1956 and studied until 1958.
| Property |
Value |
| dbo:abstract |
Cetadiol, also known as androst-5-ene-3β,16α-diol, is a drug described as a "steroid tranquilizer" which was briefly investigated as a treatment for alcoholism in the 1950s. It is an androstane steroid and analogue of 5-androstenediol (androst-5-ene-3β,17β-diol) and 16α-hydroxy-DHEA (androst-5-ene-3β,16α-diol-17-one), but showed no androgenic or myotrophic activity in animal bioassays. The drug was reported in 1956 and studied until 1958. (en) |
| dbo:casNumber |
3642-89-5 |
| dbo:chEBI |
34452 |
| dbo:kegg |
C14631 |
| dbo:pubchem |
19274 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Cetadiol.svg?width=300 |
| dbo:wikiPageID |
54184567 (xsd:integer) |
| dbo:wikiPageLength |
4100 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1084541698 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:5-androstenediol dbr:Androgen dbr:Androstadienol dbr:Cyclopregnol dbr:Structural_analog dbc:Abandoned_drugs dbc:Androstanes dbc:Diols dbr:Oral_administration dbc:Drug_rehabilitation dbr:Androstane dbr:Androstenol dbr:Steroid dbr:Drug dbr:4-Androstadienol dbr:Alcoholism dbc:Anxiolytics dbc:Alcohol_abuse dbc:Drugs_with_unknown_mechanisms_of_action dbr:Bioassay dbr:Tranquilizer dbr:16α-hydroxy-DHEA dbr:Myotrophic |
| dbp:c |
19 (xsd:integer) |
| dbp:casNumber |
3642 (xsd:integer) |
| dbp:chebi |
34452 (xsd:integer) |
| dbp:chemspiderid |
18185 (xsd:integer) |
| dbp:h |
30 (xsd:integer) |
| dbp:iupacName |
-1013 (xsd:integer) |
| dbp:kegg |
14631.0 |
| dbp:o |
2 (xsd:integer) |
| dbp:pubchem |
19274 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Oral_administration |
| dbp:smiles |
C[C@]12CC[C@H]3[C@H]CC=C4[C@@]3C (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
CVCDJRPXEWJAAY-UVSUZTNJSA-N (en) |
| dbp:synonyms |
Androst-5-ene-3β,16α-diol; 3β,16α-Dihydroxy-5-androstene (en) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Reflist dbt:See_also dbt:Short_description dbt:Steroid-stub |
| dcterms:subject |
dbc:Abandoned_drugs dbc:Androstanes dbc:Diols dbc:Drug_rehabilitation dbc:Anxiolytics dbc:Alcohol_abuse dbc:Drugs_with_unknown_mechanisms_of_action |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
Cetadiol, also known as androst-5-ene-3β,16α-diol, is a drug described as a "steroid tranquilizer" which was briefly investigated as a treatment for alcoholism in the 1950s. It is an androstane steroid and analogue of 5-androstenediol (androst-5-ene-3β,17β-diol) and 16α-hydroxy-DHEA (androst-5-ene-3β,16α-diol-17-one), but showed no androgenic or myotrophic activity in animal bioassays. The drug was reported in 1956 and studied until 1958. (en) |
| rdfs:label |
Cetadiol (en) |
| rdfs:seeAlso |
dbr:List_of_neurosteroids |
| owl:sameAs |
wikidata:Cetadiol https://global.dbpedia.org/id/2Y1kX |
| prov:wasDerivedFrom |
wikipedia-en:Cetadiol?oldid=1084541698&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Cetadiol.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Cetadiol |
| is dbo:wikiPageRedirects of |
dbr:Androst-5-ene-3β,16α-diol dbr:3β,16α-Dihydroxy-5-androstene dbr:3β,16α-Dihydroxyandrost-5-ene dbr:5-Androstene-3β,16α-diol; |
| is dbo:wikiPageWikiLink of |
dbr:Androst-5-ene-3β,16α-diol dbr:C19H30O2 dbr:List_of_neurosteroids dbr:16α-Hydroxy-DHEA dbr:3β,16α-Dihydroxy-5-androstene dbr:3β,16α-Dihydroxyandrost-5-ene dbr:5-Androstene-3β,16α-diol; |
| is foaf:primaryTopic of |
wikipedia-en:Cetadiol |
