Chloromorphide (original) (raw)
Chloromorphide (α-chloromorphide) is an opiate analog that is a derivative of morphine, where the 6-hydroxy group has been replaced by chlorine. Developed in 1933 in Germany, it has approximately ten times the potency of morphine. It has similar effects to morphine, such as sedation, analgesia, and respiratory depression. During the 1930s, the entire series of alpha- and beta-halogenated codides, morphides, dihydromorphides, and dihydrocodides were produced and described, and α-bromomorphide and α-iodomorphide are sometimes currently used in research and manufacturing.
| Property | Value |
|---|---|
| dbo:abstract | Chloromorphide (α-chloromorphide) is an opiate analog that is a derivative of morphine, where the 6-hydroxy group has been replaced by chlorine. Developed in 1933 in Germany, it has approximately ten times the potency of morphine. It has similar effects to morphine, such as sedation, analgesia, and respiratory depression. Chloromorphide does not appear specifically in the Controlled Substances Act 1970 in the United States, but is presumably Schedule II controlled substance as a form of morphine or an analogue of morphine or morphinan. When halogenated morphides and codides are used for research or industrial uses, they are often synthesised on-site. Chloromorphide is one of a series of opioids known as morphides and codides, which are important precursors and intermediates in the synthesis of semi-synthetic opioid analgesic drugs, especially those with additions, substitutions, or other modifications at the 7, 8, and/or 14 positions on the morphine carbon skeleton. Semisynthetics with changes at other positions can also be made from these compounds. The codeine analog of chloromorphide is α-chlorocodide (alphachlorcodide), an intermediate in one method of desomorphine synthesis which uses codeine as precursor. During the 1930s, the entire series of alpha- and beta-halogenated codides, morphides, dihydromorphides, and dihydrocodides were produced and described, and α-bromomorphide and α-iodomorphide are sometimes currently used in research and manufacturing. (en) |
| dbo:casNumber | 63783-53-9 |
| dbo:fdaUniiCode | Q35VX87X79 |
| dbo:pubchem | 5745724 |
| dbo:thumbnail | wiki-commons:Special:FilePath/Chloromorphide.svg?width=300 |
| dbo:wikiPageID | 17013754 (xsd:integer) |
| dbo:wikiPageLength | 3816 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID | 1108877002 (xsd:integer) |
| dbo:wikiPageWikiLink | dbr:Desomorphine dbr:Α-chlorocodide dbr:Structural_analog dbc:4,5-Epoxymorphinans dbc:Mu-opioid_receptor_agonists dbc:Organochlorides dbc:Phenols dbc:Semisynthetic_opioids dbr:Opiate dbr:Codeine dbr:Morphine dbr:Analgesia dbr:Sedation dbr:Respiratory_depression |
| dbp:atcPrefix | none (en) |
| dbp:c | 17 (xsd:integer) |
| dbp:casNumber | 63783 (xsd:integer) |
| dbp:chemspiderid | 4676779 (xsd:integer) |
| dbp:cl | 1 (xsd:integer) |
| dbp:h | 18 (xsd:integer) |
| dbp:iupacName | 3 (xsd:integer) |
| dbp:n | 1 (xsd:integer) |
| dbp:o | 2 (xsd:integer) |
| dbp:pubchem | 5745724 (xsd:integer) |
| dbp:smiles | Cl[C@H]2\C=C/[C@H]5[C@@H]4NC (en) |
| dbp:stdinchi | 1 (xsd:integer) |
| dbp:stdinchikey | URUOTSLJEBANHA-ZFDIKFDDSA-N (en) |
| dbp:synonyms | α-Chloromorphide (en) |
| dbp:unii | Q35VX87X79 (en) |
| dbp:verifiedfields | changed (en) |
| dbp:verifiedrevid | 423378340 (xsd:integer) |
| dbp:watchedfields | changed (en) |
| dbp:width | 180 (xsd:integer) |
| dbp:wikiPageUsesTemplate | dbt:Citation_needed dbt:Drugbox dbt:Opioidergics dbt:Reflist dbt:Cascite dbt:Chemspidercite dbt:Drugbankcite dbt:Fdacite dbt:Stdinchicite |
| dct:subject | dbc:4,5-Epoxymorphinans dbc:Mu-opioid_receptor_agonists dbc:Organochlorides dbc:Phenols dbc:Semisynthetic_opioids |
| gold:hypernym | dbr:Analog |
| rdf:type | owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatMolecularFormulas yago:Abstraction100002137 yago:Chemical114806838 yago:Communication100033020 yago:Compound114818238 yago:Formula106816935 yago:Material114580897 yago:Matter100020827 yago:Message106598915 yago:MolecularFormula106817173 yago:OrganicCompound114727670 yago:Part113809207 yago:Phenol114989545 yago:PhysicalEntity100001930 yago:Relation100031921 dbo:Drug yago:Statement106722453 yago:Substance100019613 yago:WikicatPhenols umbel-rc:DrugProduct |
| rdfs:comment | Chloromorphide (α-chloromorphide) is an opiate analog that is a derivative of morphine, where the 6-hydroxy group has been replaced by chlorine. Developed in 1933 in Germany, it has approximately ten times the potency of morphine. It has similar effects to morphine, such as sedation, analgesia, and respiratory depression. During the 1930s, the entire series of alpha- and beta-halogenated codides, morphides, dihydromorphides, and dihydrocodides were produced and described, and α-bromomorphide and α-iodomorphide are sometimes currently used in research and manufacturing. (en) |
| rdfs:label | Chloromorphide (en) |
| owl:sameAs | freebase:Chloromorphide yago-res:Chloromorphide wikidata:Chloromorphide dbpedia-sh:Chloromorphide dbpedia-sr:Chloromorphide https://global.dbpedia.org/id/4hthG |
| prov:wasDerivedFrom | wikipedia-en:Chloromorphide?oldid=1108877002&ns=0 |
| foaf:depiction | wiki-commons:Special:FilePath/Chloromorphide.svg |
| foaf:isPrimaryTopicOf | wikipedia-en:Chloromorphide |
| is dbo:wikiPageRedirects of | dbr:C17H18ClNO2 dbr:Α-chloromorphide |
| is dbo:wikiPageWikiLink of | dbr:List_of_opioids dbr:Α-Chlorocodide dbr:C17H18ClNO2 dbr:Opioid dbr:Α-chloromorphide |
| is foaf:primaryTopic of | wikipedia-en:Chloromorphide |
