| dbo:abstract |
Clometerone (INN) (developmental code name L-38000), or clometherone (USAN), also known as 6α-chloro-16α-methylprogesterone, is a synthetic pregnane steroid and derivative of progesterone which was reported in 1962 and is described as an antiestrogen and antiandrogen but was never marketed. Clometerone has been found to suppress estrone-induced uterine hypertrophy in mice at oral and parenteral doses in which progesterone is inactive (active at 10 µg with clometerone and progesterone inactive at 10–100 µg in the case of both routes). However, its progestogenic potency in the Clauberg assay is considerably less than that of progesterone. As such, the progestogenic effects of clometerone do not seem to parallel its estrogenic effects. It was also studied as an antiandrogen in men but was found to slightly increase sebum production when given orally and to variably and inconsistently affect sebum production when given as a topical medication. (en) |
| dbo:casNumber |
5591-27-5 |
| dbo:fdaUniiCode |
01L3E93T4C |
| dbo:pubchem |
14515731 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Clometerone.svg?width=300 |
| dbo:wikiPageID |
43151478 (xsd:integer) |
| dbo:wikiPageLength |
4175 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1084541380 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Potency_(pharmacology) dbr:Pregnane dbr:Progesterone_(medication) dbr:Antiestrogen dbr:Derivative_(chemistry) dbc:Abandoned_drugs dbc:Antiestrogens dbc:Chloroarenes dbc:Diketones dbc:Pregnanes dbc:Progestogens dbc:Steroidal_antiandrogens dbr:Oral_administration dbr:Antiandrogen dbr:Steroid dbr:Estrone dbr:Sebum dbr:List_of_steroidal_antiandrogens dbr:Topical_medication dbr:Parenteral dbr:Steroidal_antiandrogen dbr:Synthetic_compound dbr:Clauberg_assay dbr:Uterine_hypertrophy |
| dbp:atcPrefix |
None (en) |
| dbp:c |
22 (xsd:integer) |
| dbp:casNumber |
5591 (xsd:integer) |
| dbp:chemspiderid |
16736897 (xsd:integer) |
| dbp:cl |
1 (xsd:integer) |
| dbp:h |
31 (xsd:integer) |
| dbp:iupacName |
-17 (xsd:integer) |
| dbp:o |
2 (xsd:integer) |
| dbp:pubchem |
14515731 (xsd:integer) |
| dbp:smiles |
C[C@@H]1C[C@H]2[C@@H]3C[C@@H]Cl (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
UMRURYMAPMZKQO-NDKKBYRMSA-N (en) |
| dbp:synonyms |
Clometherone; L-38000; 6α-Chloro-16α-methylprogesterone; 6α-Chloro-16α-methylpregn-4-ene-3,20-dione (en) |
| dbp:unii |
1 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Androgen_receptor_modulators dbt:Distinguish dbt:Drugbox dbt:Genito-urinary-drug-stub dbt:Progesterone_receptor_modulators dbt:Reflist dbt:Short_description dbt:Steroid-stub dbt:Abbrlink dbt:Fdacite |
| dcterms:subject |
dbc:Abandoned_drugs dbc:Antiestrogens dbc:Chloroarenes dbc:Diketones dbc:Pregnanes dbc:Progestogens dbc:Steroidal_antiandrogens |
| gold:hypernym |
dbr:Steroid |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
Clometerone (INN) (developmental code name L-38000), or clometherone (USAN), also known as 6α-chloro-16α-methylprogesterone, is a synthetic pregnane steroid and derivative of progesterone which was reported in 1962 and is described as an antiestrogen and antiandrogen but was never marketed. (en) |
| rdfs:label |
Clometerone (en) |
| owl:differentFrom |
dbr:Clomestrone |
| owl:sameAs |
freebase:Clometerone wikidata:Clometerone https://global.dbpedia.org/id/kb1T |
| prov:wasDerivedFrom |
wikipedia-en:Clometerone?oldid=1084541380&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Clometerone.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Clometerone |
| is dbo:wikiPageRedirects of |
dbr:C22H31ClO2 dbr:Chlometherone dbr:Clometherone |
| is dbo:wikiPageWikiLink of |
dbr:C22H31ClO2 dbr:List_of_steroidal_antiandrogens dbr:List_of_drugs:_Cj–Cl dbr:Chlometherone dbr:Clometherone |
| is owl:differentFrom of |
dbr:Clomestrone |
| is foaf:primaryTopic of |
wikipedia-en:Clometerone |
