| dbo:abstract |
يستخدم في علم الوراثة الخلوية، كولسميد (colcemid)، المعروف أيضا باسم ديمكولسين (demecolcine)، وهو أحد مشتقات الكولشيسين (colchicine) لكنه أقل سمّية. يقوم هذا المركب بتفكيك الأنابيب الدقيقة ويعطل تشكيل ألياف المغزل، وبالتالي يكبح الخلايا في الطور الاستوائي مما يسمح جمع الخلايا وعمل نمط نووي لها. (ar) Demecolcin ist ein giftiges Alkaloid der Herbstzeitlosen (Colchicum autumnale). (de) Demecolcine (INN; also known as colcemid) is a drug used in chemotherapy. It is closely related to the natural alkaloid colchicine with the replacement of the acetyl group on the amino moiety with methyl, but it is less toxic. It depolymerises microtubules and limits microtubule formation (inactivates spindle fibre formation), thus arresting cells in metaphase and allowing cell harvest and karyotyping to be performed. During cell division, demecolcine inhibits mitosis at metaphase by inhibiting spindle formation. Medically, demecolcine has been used to improve the results of cancer radiotherapy by synchronising tumour cells at metaphase, the radiosensitive stage of the cell cycle. In animal cloning procedures, demecolcine makes an ovum eject its nucleus, creating space for insertion of a new nucleus. (en) |
| dbo:casNumber |
477-30-5 |
| dbo:chEMBL |
312862 |
| dbo:fdaUniiCode |
Z01IVE25KI |
| dbo:pubchem |
220401 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Demecolcine.png?width=300 |
| dbo:wikiPageID |
20362448 (xsd:integer) |
| dbo:wikiPageLength |
6396 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1075460219 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Metaphase dbr:Alkaloid dbr:DNA_fragmentation dbr:Vinblastine dbr:Depolymerization dbc:Amines dbr:Colchicine dbc:Tropolones dbr:Micronucleus dbr:Cell_(biology) dbr:Acetyl dbr:Aneuploidy dbc:Pyrogallol_ethers dbr:Amino dbc:Microtubule_inhibitors dbr:International_Nonproprietary_Name dbr:Chemotherapy dbr:Karyotyping dbc:Heptalenes dbr:Mitosis dbr:Methyl dbr:Microtubules dbr:Microtubule dbr:Spindle_fibre |
| dbp:alt |
Ball-and-stick model of the demecolcine molecule (en) Skeletal formula of demecolcine (en) |
| dbp:atcPrefix |
L01 (en) |
| dbp:atcSuffix |
CC01 (en) |
| dbp:c |
21 (xsd:integer) |
| dbp:casNumber |
477 (xsd:integer) |
| dbp:chembl |
312862 (xsd:integer) |
| dbp:chemspiderid |
191135 (xsd:integer) |
| dbp:h |
25 (xsd:integer) |
| dbp:image |
Demecolcine 3D ball.png (en) |
| dbp:iupacName |
-12310 (xsd:integer) |
| dbp:n |
1 (xsd:integer) |
| dbp:o |
5 (xsd:integer) |
| dbp:pubchem |
220401 (xsd:integer) |
| dbp:smiles |
O=C/1C=C/C=C2\C[C@@H]CCc3c2cccc3 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
NNJPGOLRFBJNIW-HNNXBMFYSA-N (en) |
| dbp:synonyms |
Colcemid (en) |
| dbp:unii |
Z01IVE25KI (en) |
| dbp:verifiedrevid |
414414817 (xsd:integer) |
| dbp:watchedfields |
changed (en) |
| dbp:wikiPageUsesTemplate |
dbt:Chemotherapeutic_agents dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Cascite dbt:Chemspidercite dbt:Drugbankcite dbt:Ebicite dbt:Fdacite dbt:Stdinchicite dbt:Xenobiotic-sensing_receptor_modulators |
| dcterms:subject |
dbc:Amines dbc:Tropolones dbc:Pyrogallol_ethers dbc:Microtubule_inhibitors dbc:Heptalenes |
| gold:hypernym |
dbr:Drug |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:Abstraction100002137 yago:Alkaloid114712692 yago:Chemical114806838 yago:Compound114818238 yago:Element114840755 yago:Ketone114926294 yago:Material114580897 yago:Matter100020827 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:Quintessence114847103 yago:Relation100031921 yago:WikicatKetones dbo:Drug yago:Substance100019613 yago:WikicatAlkaloids yago:WikicatPhenolEthers umbel-rc:DrugProduct |
| rdfs:comment |
يستخدم في علم الوراثة الخلوية، كولسميد (colcemid)، المعروف أيضا باسم ديمكولسين (demecolcine)، وهو أحد مشتقات الكولشيسين (colchicine) لكنه أقل سمّية. يقوم هذا المركب بتفكيك الأنابيب الدقيقة ويعطل تشكيل ألياف المغزل، وبالتالي يكبح الخلايا في الطور الاستوائي مما يسمح جمع الخلايا وعمل نمط نووي لها. (ar) Demecolcin ist ein giftiges Alkaloid der Herbstzeitlosen (Colchicum autumnale). (de) Demecolcine (INN; also known as colcemid) is a drug used in chemotherapy. It is closely related to the natural alkaloid colchicine with the replacement of the acetyl group on the amino moiety with methyl, but it is less toxic. It depolymerises microtubules and limits microtubule formation (inactivates spindle fibre formation), thus arresting cells in metaphase and allowing cell harvest and karyotyping to be performed. In animal cloning procedures, demecolcine makes an ovum eject its nucleus, creating space for insertion of a new nucleus. (en) |
| rdfs:label |
كولسميد (ar) Demecolcin (de) Demecolcine (en) |
| owl:sameAs |
freebase:Demecolcine yago-res:Demecolcine wikidata:Demecolcine dbpedia-ar:Demecolcine dbpedia-bar:Demecolcine dbpedia-de:Demecolcine dbpedia-hu:Demecolcine dbpedia-sh:Demecolcine dbpedia-sr:Demecolcine dbpedia-vi:Demecolcine https://global.dbpedia.org/id/53ji4 |
| prov:wasDerivedFrom |
wikipedia-en:Demecolcine?oldid=1075460219&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Demecolcine.png wiki-commons:Special:FilePath/Demecolcine_3D_ball.png |
| foaf:isPrimaryTopicOf |
wikipedia-en:Demecolcine |
| is dbo:wikiPageRedirects of |
dbr:ATC_code_L01CC01 dbr:ATCvet_code_QL01CC01 dbr:Colcemid |
| is dbo:wikiPageWikiLink of |
dbr:Cytoskeletal_drugs dbr:C21H25NO5 dbr:Tropolone dbr:List_of_MeSH_codes_(D03) dbr:ATC_code_L01CC01 dbr:ATCvet_code_QL01CC01 dbr:ATC_code_L01 dbr:List_of_drugs:_De dbr:Colcemid |
| is foaf:primaryTopic of |
wikipedia-en:Demecolcine |
