Dimethyllysergamide (original) (raw)
N,N-Dimethyllysergamide or N,N-dimethyl-D-lysergamide (DAM-57) is a derivative of ergine. There has been a single report of observing N,N-dimethyl-D-lysergamide in the illicit drug market. This compound did induce autonomic disturbances at oral levels of some ten times the dosage required for LSD, presumably in the high hundreds of micrograms. There is some disagreement as to whether there were psychic changes observed.
| Property | Value |
|---|---|
| dbo:abstract | N,N-Dimethyllysergamide or N,N-dimethyl-D-lysergamide (DAM-57) is a derivative of ergine. There has been a single report of observing N,N-dimethyl-D-lysergamide in the illicit drug market. This compound did induce autonomic disturbances at oral levels of some ten times the dosage required for LSD, presumably in the high hundreds of micrograms. There is some disagreement as to whether there were psychic changes observed. (en) |
| dbo:casNumber | 4238-84-0 |
| dbo:pubchem | 199478 |
| dbo:thumbnail | wiki-commons:Special:FilePath/DAM-57.svg?width=300 |
| dbo:wikiPageID | 6026470 (xsd:integer) |
| dbo:wikiPageLength | 2188 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID | 1096116752 (xsd:integer) |
| dbo:wikiPageWikiLink | dbr:Derivative_(chemistry) dbr:Ergine dbc:Lysergamides dbr:Federal_Analog_Act dbr:LSD dbr:Wiktionary:oral |
| dbp:c | 18 (xsd:integer) |
| dbp:casNumber | 4238 (xsd:integer) |
| dbp:chemspiderid | 172668 (xsd:integer) |
| dbp:excretion | renal (en) |
| dbp:h | 21 (xsd:integer) |
| dbp:iupacName | -N,N-dimethyl-7-methyl-4,6,6a,7,8,9- hexahydroindolo- [4,3-fg] quinoline- 9-carboxamide (en) |
| dbp:legalUs | Schedule I (en) |
| dbp:legalUsComment | Controlled in the United States via the Federal Analog Act but only if it is intended for human consumption. (en) |
| dbp:metabolism | hepatic (en) |
| dbp:n | 3 (xsd:integer) |
| dbp:o | 1 (xsd:integer) |
| dbp:pubchem | 199478 (xsd:integer) |
| dbp:routesOfAdministration | dbr:Wiktionary:oral |
| dbp:smiles | O=C[C@@H]3C=C2c4cccc1c4cC[C@H]2NC (en) |
| dbp:stdinchi | 1 (xsd:integer) |
| dbp:stdinchikey | FWHSERNVTGTIJE-MLGOLLRUSA-N (en) |
| dbp:synonyms | DAM-57, Lysergic acid dimethylamide (en) |
| dbp:verifiedrevid | 447574383 (xsd:integer) |
| dbp:watchedfields | changed (en) |
| dbp:wikiPageUsesTemplate | dbt:Drugbox dbt:Hallucinogens dbt:Reflist dbt:Cascite dbt:Chemspidercite dbt:Stdinchicite dbt:Ergolines dbt:Hallucinogen-stub |
| dcterms:subject | dbc:Lysergamides |
| gold:hypernym | dbr:Derivative |
| rdf:type | owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug umbel-rc:DrugProduct |
| rdfs:comment | N,N-Dimethyllysergamide or N,N-dimethyl-D-lysergamide (DAM-57) is a derivative of ergine. There has been a single report of observing N,N-dimethyl-D-lysergamide in the illicit drug market. This compound did induce autonomic disturbances at oral levels of some ten times the dosage required for LSD, presumably in the high hundreds of micrograms. There is some disagreement as to whether there were psychic changes observed. (en) |
| rdfs:label | Dimethyllysergamide (en) |
| owl:sameAs | freebase:Dimethyllysergamide wikidata:Dimethyllysergamide dbpedia-sh:Dimethyllysergamide dbpedia-sr:Dimethyllysergamide https://global.dbpedia.org/id/4ixW2 |
| prov:wasDerivedFrom | wikipedia-en:Dimethyllysergamide?oldid=1096116752&ns=0 |
| foaf:depiction | wiki-commons:Special:FilePath/DAM-57.svg |
| foaf:isPrimaryTopicOf | wikipedia-en:Dimethyllysergamide |
| is dbo:wikiPageRedirects of | dbr:DAM-57 dbr:N,N-Dimethyllysergamide |
| is dbo:wikiPageWikiLink of | dbr:List_of_psychedelic_drugs dbr:C18H21N3O dbr:DAM-57 dbr:N,N-Dimethyllysergamide |
| is foaf:primaryTopic of | wikipedia-en:Dimethyllysergamide |
