| dbo:abstract |
ECPLA (N-ethyl-N-cyclopropyllysergamide) is an analog of lysergic acid diethylamide (LSD) developed by Synex Synthetics. In studies in mice, it was found to have approximately 40% the potency of LSD. (en) |
| dbo:thumbnail |
wiki-commons:Special:FilePath/ECPLA.svg?width=300 |
| dbo:wikiPageID |
62426877 (xsd:integer) |
| dbo:wikiPageLength |
2526 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1088221355 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:ETFELA dbr:Structural_analog dbr:Lysergic_acid_diethylamide dbc:Lysergamides dbr:Methylisopropyllysergamide |
| dbp:c |
21 (xsd:integer) |
| dbp:h |
25 (xsd:integer) |
| dbp:iupacName |
-N-Cyclopropyl-N-ethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (en) |
| dbp:legalDe |
NpSG (en) |
| dbp:legalStatus |
Illegal in France (en) |
| dbp:legalUk |
PSA (en) |
| dbp:n |
3 (xsd:integer) |
| dbp:o |
1 (xsd:integer) |
| dbp:smiles |
CCNC[C@@H]3C=C2c4cccc5nccc45 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
UNUJKEQFYPYXBK-AUUYWEPGSA-N (en) |
| dbp:synonyms |
ECYPLA (en) |
| dbp:width |
180 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Reflist dbt:Ergolines dbt:Hallucinogen-stub dbt:Hallucinogenic_lysergamides |
| dct:subject |
dbc:Lysergamides |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
ECPLA (N-ethyl-N-cyclopropyllysergamide) is an analog of lysergic acid diethylamide (LSD) developed by Synex Synthetics. In studies in mice, it was found to have approximately 40% the potency of LSD. (en) |
| rdfs:label |
ECPLA (en) |
| owl:sameAs |
wikidata:ECPLA https://global.dbpedia.org/id/BE9ch |
| prov:wasDerivedFrom |
wikipedia-en:ECPLA?oldid=1088221355&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/ECPLA.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:ECPLA |
| is dbo:wikiPageWikiLink of |
dbr:ETFELA dbr:LAMPA dbr:Lysergamides dbr:C21H25N3O |
| is foaf:primaryTopic of |
wikipedia-en:ECPLA |
