| dbo:abstract |
Epicriptine or beta-dihydroergocryptine is a dopamine agonist of the ergoline class. It constitutes one third of the mixture known as dihydroergocryptine, the other two thirds consisting of alpha-dihydroergocryptine. The alpha differs from the beta form only in the position of a single methyl group, which is a consequence of the biosynthesis in which the proteinogenic amino acid isoleucine is replaced by leucine. (en) |
| dbo:atcCode |
(alpha/beta) |
| dbo:casNumber |
88660-47-3 |
| dbo:chEBI |
59925 |
| dbo:chEMBL |
1378681 |
| dbo:fdaUniiCode |
5M64643B5U |
| dbo:pubchem |
3084313 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Epicriptine_skeletal.svg?width=300 |
| dbo:wikiPageID |
34397835 (xsd:integer) |
| dbo:wikiPageLength |
2407 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
998721708 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Dopamine_agonist dbc:Isopropyl_compounds dbc:Lactams dbr:Leucine dbc:Ergot_alkaloids dbr:Ergoline dbc:Oxazolopyrrolopyrazines dbc:Dopamine_agonists dbc:Lysergamides dbr:Isoleucine dbr:Biosynthesis dbr:Dihydroergocryptine dbr:Methyl dbr:Proteinogenic_amino_acid |
| dbp:atcPrefix |
N04 (en) |
| dbp:atcSuffix |
BC03 (en) |
| dbp:atcSupplemental |
(en) |
| dbp:c |
32 (xsd:integer) |
| dbp:casNumber |
88660 (xsd:integer) |
| dbp:chebi |
59925 (xsd:integer) |
| dbp:chembl |
1378681 (xsd:integer) |
| dbp:chemspiderid |
2341400 (xsd:integer) |
| dbp:h |
43 (xsd:integer) |
| dbp:iupacName |
-N- [- 2-hydroxy- 7--- 5,8-dioxo- 4-- 3-oxa- 6,9-diazatricyclo [7.3.0.02,6]dodecan-4-yl]- 6-methyl- 6,11-diazatetracyclo [7.6.1.02,7.012,16] hexadeca- 1,9,12,14-tetraene- 4-carboxamide (en) |
| dbp:legalStatus |
Rx-only (en) |
| dbp:n |
5 (xsd:integer) |
| dbp:o |
5 (xsd:integer) |
| dbp:pregnancyCategory |
Contraindicated (en) |
| dbp:pubchem |
3084313 (xsd:integer) |
| dbp:routesOfAdministration |
Oral (en) |
| dbp:smiles |
CCC[C@H]1CN2CCC[C@H]2[C@]3O (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
SBFXHXZNBNFPHV-CROXOCCCSA-N (en) |
| dbp:synonyms |
beta-Dihydroergocryptine (en) |
| dbp:unii |
5 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Dopaminergics dbt:Drugbox dbt:Main dbt:Nervous-system-drug-stub dbt:Reflist dbt:Ergolines |
| dcterms:subject |
dbc:Isopropyl_compounds dbc:Lactams dbc:Ergot_alkaloids dbc:Oxazolopyrrolopyrazines dbc:Dopamine_agonists dbc:Lysergamides |
| gold:hypernym |
dbr:Agonist |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:Abstraction100002137 yago:Alkaloid114712692 yago:Chemical114806838 yago:Compound114818238 yago:Material114580897 yago:Matter100020827 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:Relation100031921 dbo:Drug yago:Substance100019613 yago:WikicatErgotAlkaloids |
| rdfs:comment |
Epicriptine or beta-dihydroergocryptine is a dopamine agonist of the ergoline class. It constitutes one third of the mixture known as dihydroergocryptine, the other two thirds consisting of alpha-dihydroergocryptine. The alpha differs from the beta form only in the position of a single methyl group, which is a consequence of the biosynthesis in which the proteinogenic amino acid isoleucine is replaced by leucine. (en) |
| rdfs:label |
Epicriptine (en) |
| owl:sameAs |
freebase:Epicriptine yago-res:Epicriptine wikidata:Epicriptine dbpedia-sh:Epicriptine dbpedia-sr:Epicriptine https://global.dbpedia.org/id/4jGk9 |
| prov:wasDerivedFrom |
wikipedia-en:Epicriptine?oldid=998721708&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Epicriptine_skeletal.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Epicriptine |
| is dbo:wikiPageRedirects of |
dbr:Beta-Dihydroergocryptine dbr:Beta-dihydroergocryptine |
| is dbo:wikiPageWikiLink of |
dbr:Dopamine_agonist dbr:Beta-Dihydroergocryptine dbr:Beta-dihydroergocryptine dbr:Dihydroergocryptine dbr:C32H43N5O5 dbr:List_of_drugs:_Em–Ep |
| is foaf:primaryTopic of |
wikipedia-en:Epicriptine |
