| dbo:abstract |
Faldaprevir was an experimental drug for the treatment of hepatitis C (HCV). It was being developed by Boehringer-Ingelheim and reached Phase III clinical trials in 2011. Boehringer announced in 2014 that it would not pursue approval of the drug any more because of better HCV treatments having become available. (en) |
| dbo:casNumber |
801283-95-4 |
| dbo:chEMBL |
1241348 |
| dbo:drugbank |
DB11808 |
| dbo:fdaUniiCode |
958X4J301A |
| dbo:pubchem |
42601552 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Faldaprevir.svg?width=300 |
| dbo:wikiPageExternalLink |
http://chem.sis.nlm.nih.gov/chemidplus/sid/f123000000 http://www.chemicalregister.com/Faldaprevir/Suppliers/pid1538825.htm |
| dbo:wikiPageID |
38750476 (xsd:integer) |
| dbo:wikiPageLength |
4100 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1048079154 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Deleobuvir dbr:Ribavirin dbc:Abandoned_drugs dbc:Bromoarenes dbc:Carbamates dbc:Cyclopropanes dbc:Pyrrolidines dbc:Vinyl_compounds dbr:Oral_administration dbr:Clinical_trial dbr:Protease_inhibitor_(pharmacology) dbc:Cyclopentyl_compounds dbc:Carboxamides dbc:Thiazoles dbr:Drug_development dbc:Quinolines dbc:Tert-butyl_compounds dbr:AASLD dbr:Hepatitis_C dbc:NS3/4A_protease_inhibitors dbr:Hepatitis_C_virus dbr:Pegylated_interferon dbr:Boehringer-Ingelheim |
| dbp:atcPrefix |
J05 (en) |
| dbp:atcSuffix |
AP04 (en) |
| dbp:br |
1 (xsd:integer) |
| dbp:c |
40 (xsd:integer) |
| dbp:casNumber |
801283 (xsd:integer) |
| dbp:chembl |
1241348 (xsd:integer) |
| dbp:chemspiderid |
26327117 (xsd:integer) |
| dbp:drugbank |
DB11808 (en) |
| dbp:h |
49 (xsd:integer) |
| dbp:iupacName |
N-[carbonyl]-3-methyl-(L)-valyl--4--N-[-1-carboxy-2-vinylcyclopropyl]-(L)-prolinamide (en) |
| dbp:legalStatus |
Abandoned (en) |
| dbp:n |
6 (xsd:integer) |
| dbp:o |
9 (xsd:integer) |
| dbp:pubchem |
42601552 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Oral_administration |
| dbp:s |
1 (xsd:integer) |
| dbp:smiles |
CCCNc1ncc2ccO[C@@H]4C[C@H]CN[C@@]6CO (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
LLGDPTDZOVKFDU-XUHJSTDZSA-N (en) |
| dbp:synonyms |
BI 201335 (en) |
| dbp:unii |
958 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Reflist dbt:RNA_antivirals |
| dcterms:subject |
dbc:Abandoned_drugs dbc:Bromoarenes dbc:Carbamates dbc:Cyclopropanes dbc:Pyrrolidines dbc:Vinyl_compounds dbc:Cyclopentyl_compounds dbc:Carboxamides dbc:Thiazoles dbc:Quinolines dbc:Tert-butyl_compounds dbc:NS3/4A_protease_inhibitors |
| gold:hypernym |
dbr:Drug |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatAnti-RNAVirusDrugs yago:Agent114778436 yago:Antiviral102725367 yago:CausalAgent100007347 yago:Drug103247620 yago:Matter100020827 yago:Medicine103740161 yago:PhysicalEntity100001930 yago:ProteaseInhibitor104013993 dbo:Drug yago:Substance100020090 yago:WikicatProteaseInhibitors |
| rdfs:comment |
Faldaprevir was an experimental drug for the treatment of hepatitis C (HCV). It was being developed by Boehringer-Ingelheim and reached Phase III clinical trials in 2011. Boehringer announced in 2014 that it would not pursue approval of the drug any more because of better HCV treatments having become available. (en) |
| rdfs:label |
Faldaprevir (en) |
| owl:sameAs |
freebase:Faldaprevir yago-res:Faldaprevir wikidata:Faldaprevir dbpedia-fa:Faldaprevir dbpedia-sh:Faldaprevir dbpedia-sr:Faldaprevir dbpedia-vi:Faldaprevir https://global.dbpedia.org/id/YQDb |
| prov:wasDerivedFrom |
wikipedia-en:Faldaprevir?oldid=1048079154&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Faldaprevir.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Faldaprevir |
| is dbo:wikiPageRedirects of |
dbr:BI_201335 |
| is dbo:wikiPageWikiLink of |
dbr:BI_201335 dbr:Boehringer_Ingelheim dbr:Deleobuvir dbr:ATC_code_J05 |
| is foaf:primaryTopic of |
wikipedia-en:Faldaprevir |
