| dbo:abstract |
غونادوريلين (بالإنجليزية: Gonadorelin) هو دواء يُستعمل في علاج: * انقطاع الحيض (ar) Gonadorelin is a gonadotropin-releasing hormone agonist (GnRH agonist) which is used in fertility medicine and to treat amenorrhea and hypogonadism. It is also used in veterinary medicine. The medication is a form of the endogenous GnRH and is identical to it in chemical structure. It is given by injection into a blood vessel or fat or as a nasal spray. (en) |
| dbo:alternativeName |
Factrel, HRF, Kryptocur, Lutrelef, Lutrepulse, Relefact, others (en) |
| dbo:casNumber |
33515-09-2 51952-41-1 (hydrochloride) 71447-49-9 (diacetate) |
| dbo:chEBI |
5520 |
| dbo:chEMBL |
1007 |
| dbo:class |
dbr:Progonadotropin dbr:GnRH_agonist dbr:GnRH_analogue |
| dbo:drugbank |
DB00644 |
| dbo:fdaUniiCode |
9O7312W37G |
| dbo:kegg |
C07607 |
| dbo:pubchem |
638793 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/gonadorelin.svg?width=300 |
| dbo:wikiPageID |
1936844 (xsd:integer) |
| dbo:wikiPageLength |
11786 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1120523666 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Canada dbr:Amenorrhea dbr:Progonadotropin dbc:Progonadotropins dbr:Hypothalamus dbr:United_Kingdom dbr:United_States dbr:Veterinary_medicine dbr:Delayed_puberty dbr:Infusion_pump dbr:Intravenous_injection dbr:Cryptorchidism dbr:Chemical_structure dbr:Gonadotropin-releasing_hormone_agonist dbr:Subcutaneous_injection dbr:Nasal_spray dbr:Australia dbr:Acetate dbr:Agonist dbr:Alcohol_(chemistry) dbr:Europe dbr:Follicle-stimulating_hormone dbr:Gonad dbr:Gonadotropin dbr:Gonadotropin-releasing_hormone_receptor dbr:Endogenous dbr:Generic_term dbr:Ireland dbr:Japan dbr:Hydrochloride dbr:Hydrolysis dbr:Hypogonadism dbr:Hypogonadotropic_hypogonadism dbc:Peptides dbc:Veterinary_drugs dbr:Kallmann_syndrome dbr:Biosynthesis dbr:Taiwan dbc:GnRH_agonists dbr:South_Africa dbr:Infertility dbr:Injection_(medicine) dbr:Metabolism dbr:New_Zealand dbr:Sex_hormone dbr:Salt_(chemistry) dbr:Solution_(chemistry) dbr:Luteinizing_hormone dbr:Secretion dbr:Terminal_half-life dbr:Pituitary_gland dbr:Fertility_medicine dbr:Diagnostic_agent dbr:GnRH_agonist dbr:GnRH_analogue dbr:Distribution_half-life dbr:GnRH_receptor dbr:Primary_amenorrhea |
| dbp:atcPrefix |
H01 (en) |
| dbp:atcSuffix |
CA01 (en) |
| dbp:c |
55 (xsd:integer) |
| dbp:casNumber |
33515 (xsd:integer) |
| dbp:casSupplemental |
51952 (xsd:integer) 71447 (xsd:integer) |
| dbp:chebi |
5520 (xsd:integer) |
| dbp:chembl |
1007 (xsd:integer) |
| dbp:chemspiderid |
33562 (xsd:integer) |
| dbp:class |
dbr:Progonadotropin dbr:GnRH_agonist dbr:GnRH_analogue |
| dbp:drugbank |
DB00644 (en) |
| dbp:eliminationHalfLife |
-2400.0 |
| dbp:h |
75 (xsd:integer) |
| dbp:iupacName |
-N-[-1-[[-1-[[-1-[[-1-[[2-[[-1-[[-1-[-2-[carbamoyl]pyrrolidin-1-yl]-5--1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3--1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3--1-oxopropan-2-yl]amino]-3--1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide (en) |
| dbp:kegg |
7607.0 |
| dbp:metabolism |
dbr:Hydrolysis |
| dbp:n |
17 (xsd:integer) |
| dbp:o |
13 (xsd:integer) |
| dbp:pubchem |
638793 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Intravenous_injection dbr:Subcutaneous_injection |
| dbp:smiles |
CCC[C@@H]NCCNC[C@H]NC[C@H]NC[C@H]NC[C@H]NC[C@@H]6CCCN6 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
XLXSAKCOAKORKW-AQJXLSMYSA-N (en) |
| dbp:synonyms |
Abbott 41070; AY-24031; Hoe-471; RU-19847 (en) |
| dbp:tradename |
Factrel, HRF, Kryptocur, Lutrelef, Lutrepulse, Relefact, others (en) |
| dbp:unii |
9 (xsd:integer) |
| dbp:width |
250 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:GnRH_and_gonadotropin_receptor_modulators dbt:About dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Abbrlink dbt:ATC dbt:ATCvet dbt:GnRH_and_gonadotropins |
| dcterms:subject |
dbc:Progonadotropins dbc:Peptides dbc:Veterinary_drugs dbc:GnRH_agonists |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
غونادوريلين (بالإنجليزية: Gonadorelin) هو دواء يُستعمل في علاج: * انقطاع الحيض (ar) Gonadorelin is a gonadotropin-releasing hormone agonist (GnRH agonist) which is used in fertility medicine and to treat amenorrhea and hypogonadism. It is also used in veterinary medicine. The medication is a form of the endogenous GnRH and is identical to it in chemical structure. It is given by injection into a blood vessel or fat or as a nasal spray. (en) |
| rdfs:label |
غونادوريلين (ar) Gonadorelin (en) |
| owl:sameAs |
wikidata:Gonadorelin dbpedia-ar:Gonadorelin dbpedia-fa:Gonadorelin https://global.dbpedia.org/id/yWny |
| prov:wasDerivedFrom |
wikipedia-en:Gonadorelin?oldid=1120523666&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/gonadorelin.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Gonadorelin |
| is dbo:wikiPageRedirects of |
dbr:Factrel dbr:Synthetic_Gn-RH dbr:Synthetic_LH-RF dbr:Synthetic_LH-RH dbr:Synthetic_LRF dbr:Synthetic_gonadoliberin dbr:Cystorelin dbr:Gonadorelin_Hydrochloride dbr:ATC_code_H01CA01 dbr:ATC_code_V04CM01 dbr:ATCvet_code_QH01CA01 dbr:ATCvet_code_QV04CM01 dbr:Fertagyl dbr:Hypocrine dbr:Dirigestran dbr:Dirigestran_Spofa dbr:Lutal dbr:Lutamin dbr:Lutrefact dbr:Lutrepulse dbr:Lutrepulse_KIT dbr:Luforan dbr:Relisorm dbr:Relisorm_L dbr:GnRH_(medication) dbr:Gonadorelin_acetate dbr:Gonadorelin_diacetate dbr:Gonadorelin_hydrochloride |
| is dbo:wikiPageWikiLink of |
dbr:Factrel dbr:Custom_peptide_synthesis dbr:Index_of_biochemistry_articles dbr:Gonadotropin-releasing_hormone_agonist dbr:Synthetic_Gn-RH dbr:Synthetic_LH-RF dbr:Synthetic_LH-RH dbr:Synthetic_LRF dbr:Synthetic_gonadoliberin dbr:Bachem_Holding dbr:Triptorelin dbr:Cystorelin dbr:Gonadotropin-releasing_hormone dbr:Gonadotropin-releasing_hormone_modulator dbr:Gonadotropin-releasing_hormone_receptor dbr:List_of_MeSH_codes_(D06) dbr:List_of_MeSH_codes_(D12.644) dbr:List_of_MeSH_codes_(D12.776.641) dbr:Gonadorelin_Hydrochloride dbr:ATC_code_H01CA01 dbr:ATC_code_V04CM01 dbr:ATCvet_code_QH01CA01 dbr:ATCvet_code_QV04CM01 dbr:Fertagyl dbr:ATC_code_H01 dbr:ATC_code_V04 dbr:Hypocrine dbr:Medication dbr:Estrous_cycle dbr:Dirigestran dbr:Dirigestran_Spofa dbr:Lutal dbr:Lutamin dbr:Lutrefact dbr:Lutrepulse dbr:Lutrepulse_KIT dbr:List_of_drugs:_G dbr:Luforan dbr:Relisorm dbr:Relisorm_L dbr:GnRH_(medication) dbr:Gonadorelin_acetate dbr:Gonadorelin_diacetate dbr:Gonadorelin_hydrochloride |
| is foaf:primaryTopic of |
wikipedia-en:Gonadorelin |
