| dbo:abstract |
Histrelin acetate, sold under the brand names Vantas and Supprelin LA among others, is a nonapeptide analogue of gonadotropin-releasing hormone (GnRH) with added potency. When present in the bloodstream, it acts on particular cells of the pituitary gland called gonadotropes. Histrelin stimulates these cells to release luteinizing hormone and follicle-stimulating hormone. Thus it is considered a gonadotropin-releasing hormone agonist or GnRH agonist. (en) |
| dbo:alternativeName |
Vantas, Supprelin LA, others (en) |
| dbo:bioavailability |
92.000000 (xsd:float) |
| dbo:casNumber |
76712-82-8 |
| dbo:chEMBL |
1201255 |
| dbo:class |
dbr:Antigonadotropin dbr:GnRH_agonist dbr:GnRH_analogue |
| dbo:fdaUniiCode |
H50H3S3W74 |
| dbo:kegg |
D02369 |
| dbo:medlinePlus |
a601146 |
| dbo:pubchem |
25077993 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Histrelin.svg?width=300 |
| dbo:wikiPageExternalLink |
https://web.archive.org/web/20110716164540/http:/www.supprelinla.com/aboutcpp/index.html |
| dbo:wikiPageID |
8316042 (xsd:integer) |
| dbo:wikiPageLength |
7638 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1096789552 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Desensitization_(medicine) dbr:Androgen dbr:Antigonadotropin dbr:Libido dbr:Estrogen dbr:Gonadotropin-releasing_hormone_agonist dbr:Erectile_dysfunction dbr:Liver dbr:Prostate_cancer dbr:Agonist dbr:Follicle-stimulating_hormone dbr:Food_and_Drug_Administration dbr:Gonad dbr:Gonadotropin-releasing_hormone dbr:Gonadotropin-releasing_hormone_receptor dbr:Precocious_puberty dbc:Peptides dbr:Uterine_fibroids dbc:GnRH_agonists dbc:Puberty_blockers dbr:Sex_steroid dbr:Luteinizing_hormone dbr:Off-label_use dbr:Subcutaneous_implant dbr:Pituitary_gland dbr:Hot_flashes dbr:GnRH_agonist dbr:GnRH_analogue dbr:Downregulation dbr:Gonadotrope |
| dbp:atcPrefix |
L02 (en) |
| dbp:atcSuffix |
AE05 (en) |
| dbp:bioavailability |
92.0 |
| dbp:c |
66 (xsd:integer) |
| dbp:casNumber |
76712 (xsd:integer) |
| dbp:chembl |
1201255 (xsd:integer) |
| dbp:chemspiderid |
10482012 (xsd:integer) |
| dbp:class |
dbr:Antigonadotropin dbr:GnRH_agonist dbr:GnRH_analogue |
| dbp:eliminationHalfLife |
14400.0 |
| dbp:h |
86 (xsd:integer) |
| dbp:iupacName |
5 (xsd:integer) |
| dbp:iupharLigand |
3884 (xsd:integer) |
| dbp:kegg |
D02369 (en) |
| dbp:legalUs |
Rx-only (en) |
| dbp:medlineplus |
a601146 (en) |
| dbp:metabolism |
dbr:Liver |
| dbp:n |
18 (xsd:integer) |
| dbp:o |
12 (xsd:integer) |
| dbp:pregnancyUs |
X (en) |
| dbp:proteinBound |
70.0 |
| dbp:pubchem |
25077993 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Subcutaneous_implant |
| dbp:smiles |
CCNC[C@@H]1CCCN1C[C@H]NC[C@H]NC[C@@H]NC[C@H]NC[C@H]NC[C@H]NC[C@H]NC[C@@H]1CCCN1 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
HHXHVIJIIXKSOE-QILQGKCVSA-N (en) |
| dbp:tradename |
Vantas, Supprelin LA, others (en) |
| dbp:unii |
H50H3S3W74 (en) |
| dbp:verifiedfields |
changed (en) |
| dbp:verifiedrevid |
461769932 (xsd:integer) |
| dbp:watchedfields |
changed (en) |
| dbp:width |
225 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:GnRH_and_gonadotropin_receptor_modulators dbt:Drugbox dbt:Reflist dbt:Cascite dbt:Chemspidercite dbt:Drugbankcite dbt:Ebicite dbt:Fdacite dbt:Keggcite dbt:Stdinchicite dbt:Drugs.com dbt:GnRH_and_gonadotropins |
| dcterms:subject |
dbc:Peptides dbc:GnRH_agonists dbc:Puberty_blockers |
| gold:hypernym |
dbr:Analog |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug umbel-rc:DrugProduct |
| rdfs:comment |
Histrelin acetate, sold under the brand names Vantas and Supprelin LA among others, is a nonapeptide analogue of gonadotropin-releasing hormone (GnRH) with added potency. When present in the bloodstream, it acts on particular cells of the pituitary gland called gonadotropes. Histrelin stimulates these cells to release luteinizing hormone and follicle-stimulating hormone. Thus it is considered a gonadotropin-releasing hormone agonist or GnRH agonist. (en) |
| rdfs:label |
Histrelin (en) |
| owl:sameAs |
freebase:Histrelin wikidata:Histrelin dbpedia-sh:Histrelin dbpedia-sr:Histrelin dbpedia-vi:Histrelin https://global.dbpedia.org/id/4mfwE |
| prov:wasDerivedFrom |
wikipedia-en:Histrelin?oldid=1096789552&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Histrelin.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Histrelin |
| is dbo:wikiPageRedirects of |
dbr:ATC_code_H01CA03 dbr:ATC_code_L02AE05 dbr:ATCvet_code_QH01CA03 dbr:ATCvet_code_QL02AE05 dbr:Histrelin_acetate dbr:Supprelin_LA dbr:Supprelin |
| is dbo:wikiPageWikiLink of |
dbr:List_of_compounds_with_carbon_numbers_50+ dbr:Androgen_deprivation_therapy dbr:List_of_Punahou_School_alumni dbr:Gonadotropin-releasing_hormone_agonist dbr:Puberty_blocker dbr:Gonadotropin-releasing_hormone_modulator dbr:Gonadotropin-releasing_hormone_receptor dbr:Precocious_puberty dbr:ATC_code_H01CA03 dbr:ATC_code_L02AE05 dbr:ATCvet_code_QH01CA03 dbr:ATCvet_code_QL02AE05 dbr:ATC_code_L02 dbr:List_of_drugs:_Hf–Hz dbr:Histrelin_acetate dbr:Supprelin_LA dbr:Vantas dbr:Supprelin |
| is foaf:primaryTopic of |
wikipedia-en:Histrelin |
