| dbo:abstract |
D-Lysergic acid ethylamide (LAE-32) is a derivative of ergine. It is reported to have some LSD-like effects but is weaker and shorter lasting, with an active dose reported to be between 0.5 and 1.5 milligrams. It was studied by the CIA as part of Project MKULTRA. Documents published by the CIA under the Freedom of Information Act suggest it causes "a schizophrenia-like condition" but it allows people with schizophrenia to remain indifferent to their disorder. (en) |
| dbo:casNumber |
478-99-9 |
| dbo:fdaUniiCode |
72370WPF0J |
| dbo:pubchem |
101704 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/LAE-32.svg?width=300 |
| dbo:wikiPageID |
6026273 (xsd:integer) |
| dbo:wikiPageLength |
2410 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1122875697 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Schizophrenia dbr:Oral_administration dbr:Freedom_of_Information_Act_(United_States) dbr:Project_MKULTRA dbr:CIA dbr:Ergine dbc:Lysergamides dbr:LSD |
| dbp:c |
18 (xsd:integer) |
| dbp:casNumber |
478 (xsd:integer) |
| dbp:chemspiderid |
19975296 (xsd:integer) |
| dbp:excretion |
Renal (en) |
| dbp:h |
21 (xsd:integer) |
| dbp:iupacName |
-N-Ethyl-6-methyl-9,10-didehydroergoline-8-carboxamide (en) |
| dbp:metabolism |
Hepatic (en) |
| dbp:n |
3 (xsd:integer) |
| dbp:o |
1 (xsd:integer) |
| dbp:pubchem |
101704 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Oral_administration |
| dbp:smiles |
CCNC[C@@H]2C=C1c3cccc4[nH]ccc34 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
VEBWTGYUIBTVNR-MLGOLLRUSA-N (en) |
| dbp:synonyms |
LAE; Lysergic acid ethylamide; d-Lysergic acid ethylamide; d-Ethyllysergamide, (en) |
| dbp:unii |
72370 (xsd:integer) |
| dbp:verifiedrevid |
447574092 (xsd:integer) |
| dbp:watchedfields |
changed (en) |
| dbp:width |
200 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Hallucinogens dbt:Multiple_issues dbt:Notability dbt:Refimprove dbt:Reflist dbt:Cascite dbt:Chemspidercite dbt:Fdacite dbt:Stdinchicite dbt:Ergolines dbt:Hallucinogen-stub |
| dct:subject |
dbc:Lysergamides |
| gold:hypernym |
dbr:Derivative |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug umbel-rc:DrugProduct |
| rdfs:comment |
D-Lysergic acid ethylamide (LAE-32) is a derivative of ergine. It is reported to have some LSD-like effects but is weaker and shorter lasting, with an active dose reported to be between 0.5 and 1.5 milligrams. It was studied by the CIA as part of Project MKULTRA. Documents published by the CIA under the Freedom of Information Act suggest it causes "a schizophrenia-like condition" but it allows people with schizophrenia to remain indifferent to their disorder. (en) |
| rdfs:label |
LAE-32 (en) |
| owl:sameAs |
freebase:LAE-32 http://www4.wiwiss.fu-berlin.de/drugbank/resource/drugs/DB04829 wikidata:LAE-32 dbpedia-sh:LAE-32 dbpedia-sr:LAE-32 https://global.dbpedia.org/id/4pws5 |
| prov:wasDerivedFrom |
wikipedia-en:LAE-32?oldid=1122875697&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/LAE-32.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:LAE-32 |
| is dbo:wikiPageDisambiguates of |
dbr:LAE |
| is dbo:wikiPageRedirects of |
dbr:Lysergic_acid_ethylamide |
| is dbo:wikiPageWikiLink of |
dbr:Lysergamides dbr:C18H21N3O dbr:LAE dbr:Lysergic_acid_ethylamide |
| is foaf:primaryTopic of |
wikipedia-en:LAE-32 |
