LR-5182 (original) (raw)
LR-5182 is a stimulant drug which acts as a norepinephrine–dopamine reuptake inhibitor, structurally related to the better known drug fencamfamine. It was developed by the pharmaceutical company Eli Lilly in the 1970s, and researched for potential use as an antidepressant, although never marketed. LR-5182 has two stereoisomers, both of which are active, although one isomer blocks reuptake of only dopamine and noradrenaline, while the other blocks reuptake of serotonin as well. is planar and contains a Bicyclo-octene. This itself is fully active: DA 9nM, NE 27nM, SER 0.6 μM.
| Property | Value |
|---|---|
| dbo:abstract | LR-5182 is a stimulant drug which acts as a norepinephrine–dopamine reuptake inhibitor, structurally related to the better known drug fencamfamine. It was developed by the pharmaceutical company Eli Lilly in the 1970s, and researched for potential use as an antidepressant, although never marketed. LR-5182 has two stereoisomers, both of which are active, although one isomer blocks reuptake of only dopamine and noradrenaline, while the other blocks reuptake of serotonin as well. While LR-5182 itself never proceeded beyond initial animal studies, discovery of monoamine reuptake inhibition activity and stimulant effects in drugs of this type has subsequently led to the development of many other stimulant drugs of related chemical structure, primarily developed as potential antidepressants, or as substitute drugs for the treatment of cocaine abuse. is planar and contains a Bicyclo-octene. This itself is fully active: DA 9nM, NE 27nM, SER 0.6 μM. (en) |
| dbo:casNumber | 62373-97-1 |
| dbo:chEMBL | 322067 |
| dbo:pubchem | 44024 |
| dbo:thumbnail | wiki-commons:Special:FilePath/LR-5182.svg?width=300 |
| dbo:wikiPageID | 17648221 (xsd:integer) |
| dbo:wikiPageLength | 5882 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID | 1103993197 (xsd:integer) |
| dbo:wikiPageWikiLink | dbc:Chloroarenes dbc:Stimulants dbr:Cocaine dbr:Eli_Lilly_and_Company dbr:Antidepressant dbr:Stimulant dbc:Norepinephrine–dopamine_reuptake_inhibitors dbr:Norepinephrine–dopamine_reuptake_inhibitor dbr:Fencamfamine dbc:Eli_Lilly_and_Company_brands dbr:Stereoisomerism dbr:LR-5659 |
| dbp:c | 17 (xsd:integer) |
| dbp:casNumber | 62373 (xsd:integer) |
| dbp:chembl | 322067 (xsd:integer) |
| dbp:chemspiderid | 40075 (xsd:integer) 40076 (xsd:integer) |
| dbp:cl | 2 (xsd:integer) |
| dbp:h | 23 (xsd:integer) |
| dbp:index2Label | HCl (en) |
| dbp:iupacName | 1 (xsd:integer) |
| dbp:n | 1 (xsd:integer) |
| dbp:pubchem | 44023 (xsd:integer) 44024 (xsd:integer) |
| dbp:smiles | CNC[C@@H]1C2CCC[C@@H]1c3ccccc3 (en) [Cl-].C[NH+]C[C@@H]1C2CCC[C@@H]1c3ccccc3 (en) |
| dbp:stdinchi | 1 (xsd:integer) |
| dbp:stdinchikey | CWRRQXXGIKGNJA-PQTJMFGHSA-N (en) JOQQHMGSIKNGAF-HLFYOVGASA-N (en) |
| dbp:synonyms | -LR-5182, -LR-5182 hydrochloride (en) |
| dbp:verifiedrevid | 415309432 (xsd:integer) |
| dbp:wikiPageUsesTemplate | dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Stimulants dbt:Drugbankcite dbt:Antidepressants dbt:Monoamine_reuptake_inhibitors |
| dcterms:subject | dbc:Chloroarenes dbc:Stimulants dbc:Norepinephrine–dopamine_reuptake_inhibitors dbc:Eli_Lilly_and_Company_brands |
| gold:hypernym | dbr:Drug |
| rdf:type | owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatStimulants yago:Abstraction100002137 yago:Cognition100023271 yago:Information105816287 yago:PsychologicalFeature100023100 dbo:Drug yago:Stimulation105827684 umbel-rc:DrugProduct |
| rdfs:comment | LR-5182 is a stimulant drug which acts as a norepinephrine–dopamine reuptake inhibitor, structurally related to the better known drug fencamfamine. It was developed by the pharmaceutical company Eli Lilly in the 1970s, and researched for potential use as an antidepressant, although never marketed. LR-5182 has two stereoisomers, both of which are active, although one isomer blocks reuptake of only dopamine and noradrenaline, while the other blocks reuptake of serotonin as well. is planar and contains a Bicyclo-octene. This itself is fully active: DA 9nM, NE 27nM, SER 0.6 μM. (en) |
| rdfs:label | LR-5182 (en) |
| owl:sameAs | freebase:LR-5182 yago-res:LR-5182 wikidata:LR-5182 dbpedia-sh:LR-5182 dbpedia-sr:LR-5182 https://global.dbpedia.org/id/4pxKz |
| prov:wasDerivedFrom | wikipedia-en:LR-5182?oldid=1103993197&ns=0 |
| foaf:depiction | wiki-commons:Special:FilePath/LR-5182.svg |
| foaf:isPrimaryTopicOf | wikipedia-en:LR-5182 |
| is dbo:wikiPageWikiLink of | dbr:List_of_adrenergic_drugs dbr:List_of_dopaminergic_drugs dbr:O-2390 dbr:3,4-Dichloromethylphenidate dbr:Serotonin–norepinephrine–dopamine_reuptake_inhibitor |
| is foaf:primaryTopic of | wikipedia-en:LR-5182 |
