| dbo:abstract |
LY-2452473 (TT-701) is a drug which acts as a selective androgen receptor modulator (SARM). It has been investigated for the treatment of erectile dysfunction and symptoms associated with benign prostate hyperplasia. (en) |
| dbo:casNumber |
1029692-15-6 |
| dbo:fdaUniiCode |
XKW9MYF94Y |
| dbo:pubchem |
24963749 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/LY-2452473_structure.png?width=300 |
| dbo:wikiPageID |
63844912 (xsd:integer) |
| dbo:wikiPageLength |
2258 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1119900975 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Enobosarm dbr:Erectile_dysfunction dbr:Ligandrol dbr:JNJ-28330835 dbc:Selective_androgen_receptor_modulators dbr:Selective_androgen_receptor_modulator dbr:Benign_prostate_hyperplasia |
| dbp:c |
22 (xsd:integer) |
| dbp:casNumber |
1029692 (xsd:integer) |
| dbp:h |
22 (xsd:integer) |
| dbp:iupacName |
propan-2-yl N-[-7-cyano-4--2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate (en) |
| dbp:legalUs |
Investigational drug (en) |
| dbp:molecularWeight |
374.400000 (xsd:double) |
| dbp:n |
4 (xsd:integer) |
| dbp:o |
2 (xsd:integer) |
| dbp:pubchem |
24963749 (xsd:integer) |
| dbp:smiles |
CCOCN[C@H]1CC2=CNCC4=CC=CC=N4 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
IHIWYQYVBNODSV-KRWDZBQOSA-N (en) |
| dbp:unii |
XKW9MYF94Y (en) |
| dbp:wikiPageUsesTemplate |
dbt:Androgen_receptor_modulators dbt:Drugbox dbt:Genito-urinary-drug-stub dbt:Reflist dbt:Short_description dbt:Cascite dbt:Fdacite |
| dct:subject |
dbc:Selective_androgen_receptor_modulators |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
LY-2452473 (TT-701) is a drug which acts as a selective androgen receptor modulator (SARM). It has been investigated for the treatment of erectile dysfunction and symptoms associated with benign prostate hyperplasia. (en) |
| rdfs:label |
LY-2452473 (en) |
| owl:sameAs |
wikidata:LY-2452473 https://global.dbpedia.org/id/2Yzor |
| prov:wasDerivedFrom |
wikipedia-en:LY-2452473?oldid=1119900975&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/LY-2452473_structure.png |
| foaf:isPrimaryTopicOf |
wikipedia-en:LY-2452473 |
| is dbo:wikiPageRedirects of |
dbr:C22H22N4O2 dbr:TT-701 |
| is dbo:wikiPageWikiLink of |
dbr:C22H22N4O2 dbr:JNJ-28330835 dbr:TT-701 |
| is foaf:primaryTopic of |
wikipedia-en:LY-2452473 |
