| dbo:abstract |
(–)-2β-Carbomethoxy-3β-(4'-chlorophenyl)tropane (RTI-4229-31) is a synthetic analog of cocaine that acts as a stimulant. Semi-synthesis of this compound is dependent upon the availability of cocaine starting material. According to the article, RTI-31 is 64 x the strength of cocaine in terms of its potency to elicit self-administration in monkeys. WIN 35428 was 6 x weaker than RTI-31, whereas RTI-51 was 2.6 x weaker than RTI-31. A further advantage, in addition to potency of this compound, is that its duration of activity is longer than for cocaine. It could therefore be considered within the context as an agonist based therapy for treating cocaine addiction, although it is actually RTI-336 that entered into clinical trials with this in mind. RTI-31 is already completely psychoactive in its own right meaning that further chemical manipulation should be viewed as an option that is not strictly necessary. RTI-336 is actually made using RTI-31 as starting material. RTI-31 is not an entirely selective DRI in that it also has appreciable SERT and NET blocking affinity. RTI-31 can easily be "cleaned" though, as is done, for instance, by replacing the carbomethoxy ester with a more sterically occluded substituent such as is done for RTI-113. (en) |
| dbo:casNumber |
130342-80-2 |
| dbo:fdaUniiCode |
XGP6NM44D2 |
| dbo:pubchem |
644015 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Phenyltropane_11c.svg?width=300 |
| dbo:wikiPageID |
23715160 (xsd:integer) |
| dbo:wikiPageLength |
7875 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1123080123 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Structural_analog dbr:(+)-CPCA dbr:(-)-2β-(3-(4-Methylphenyl)isoxazol-5-yl)-3β-(4-chlorophenyl)tropane dbc:Chlorobenzenes dbc:Dopamine_reuptake_inhibitors dbc:Tropanes dbr:RTI-32 dbr:Stereochemistry dbr:Cocaine dbr:Stimulant dbr:Troparil dbr:Dissociation_constant dbr:Nisoxetine dbr:Norepinephrine dbr:Paroxetine dbc:RTI_compounds dbc:Sympathomimetic_amines dbr:Cf. dbr:Binding_constant dbr:Dichloropane dbr:Dopamine dbr:RTI-113 dbr:RTI-51 dbr:RTI-55 dbr:Serotonin dbr:IC50 dbr:WIN_35428 dbr:Monoamine_transporter dbr:Phenyltropanes dbr:Radiotracer |
| dbp:c |
16 (xsd:integer) |
| dbp:casNumber |
130342 (xsd:integer) |
| dbp:chemspiderid |
559091 (xsd:integer) |
| dbp:cl |
1 (xsd:integer) |
| dbp:h |
20 (xsd:integer) |
| dbp:iupacName |
Methyl -3--8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (en) |
| dbp:n |
1 (xsd:integer) |
| dbp:o |
2 (xsd:integer) |
| dbp:pubchem |
644015 (xsd:integer) |
| dbp:smiles |
CN1[C@H]2CC[C@@H]1[C@H]COC (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
ZEOHVQFWFVMPGM-YJNKXOJESA-N (en) |
| dbp:unii |
XGP6NM44D2 (en) |
| dbp:verifiedfields |
changed (en) |
| dbp:verifiedrevid |
449586151 (xsd:integer) |
| dbp:watchedfields |
changed (en) |
| dbp:wikiPageUsesTemplate |
dbt:Dopaminergics dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Stimulants dbt:Cascite dbt:Chemspidercite dbt:Fdacite dbt:Stdinchicite dbt:Phenyltropanes |
| dcterms:subject |
dbc:Chlorobenzenes dbc:Dopamine_reuptake_inhibitors dbc:Tropanes dbc:RTI_compounds dbc:Sympathomimetic_amines |
| gold:hypernym |
dbr:Analog |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:Abstraction100002137 yago:AliphaticCompound114601294 yago:Amine114739004 yago:Chemical114806838 yago:Cognition100023271 yago:Compound105870180 yago:Compound114818238 yago:Concept105835747 yago:Content105809192 yago:Idea105833840 yago:Material114580897 yago:Matter100020827 yago:MethaneSeries114951377 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:PsychologicalFeature100023100 yago:Relation100031921 dbo:Drug yago:Substance100019613 yago:Whole105869584 yago:WikicatRTICompounds yago:WikicatSympathomimeticAmines |
| rdfs:comment |
(–)-2β-Carbomethoxy-3β-(4'-chlorophenyl)tropane (RTI-4229-31) is a synthetic analog of cocaine that acts as a stimulant. Semi-synthesis of this compound is dependent upon the availability of cocaine starting material. According to the article, RTI-31 is 64 x the strength of cocaine in terms of its potency to elicit self-administration in monkeys. WIN 35428 was 6 x weaker than RTI-31, whereas RTI-51 was 2.6 x weaker than RTI-31. (en) |
| rdfs:label |
RTI-31 (en) |
| owl:sameAs |
freebase:RTI-31 yago-res:RTI-31 wikidata:RTI-31 dbpedia-sh:RTI-31 dbpedia-sr:RTI-31 https://global.dbpedia.org/id/4tbh4 |
| prov:wasDerivedFrom |
wikipedia-en:RTI-31?oldid=1123080123&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Phenyltropane_11c.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:RTI-31 |
| is dbo:wikiPageRedirects of |
dbr:(-)-2β-Carbomethoxy-3β-(4-chlorophenyl)tropane |
| is dbo:wikiPageWikiLink of |
dbr:List_of_phenyltropanes dbr:(+)-CPCA dbr:RTI-32 dbr:4-Chloro-alpha-pyrrolidinovalerophenone dbr:RTI-113 dbr:RTI-51 dbr:RTI-55 dbr:Serotonin–norepinephrine–dopamine_reuptake_inhibitor dbr:(-)-2β-Carbomethoxy-3β-(4-chlorophenyl)tropane |
| is foaf:primaryTopic of |
wikipedia-en:RTI-31 |
