| dbo:abstract |
SDZ SER-082 is a drug which acts as a mixed antagonist for the 5-HT2B and 5-HT2C serotonin receptors, with good selectivity over other serotonin receptor subtypes and slight preference for 5-HT2C over 5-HT2B. It has been used in animal studies into the behavioural effects of the different 5-HT2 subtypes, and how they influence the effects of other drugs such as cocaine. (en) |
| dbo:casNumber |
141474-54-6 |
| dbo:fdaUniiCode |
M7FHF24Q22 |
| dbo:pubchem |
9859407 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/SDZ_SER-082.svg?width=300 |
| dbo:wikiPageID |
23135664 (xsd:integer) |
| dbo:wikiPageLength |
4277 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1105027834 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Cocaine dbc:Indolonaphthyridines dbr:Receptor_antagonist dbr:5-HT2B_receptor dbr:5-HT2C_receptor dbr:Receptor_(biochemistry) dbc:5-HT2_antagonists dbr:Serotonin dbr:Serotonin_receptor |
| dbp:c |
15 (xsd:integer) |
| dbp:casNumber |
141474 (xsd:integer) |
| dbp:chemspiderid |
8035107 (xsd:integer) |
| dbp:h |
20 (xsd:integer) |
| dbp:iupacName |
-cis 4,5,7a,8,9,10,11,11a-octahydro-7H-10-methylindolo[1,7-bc][2,6]-naphthyridine (en) |
| dbp:iupharLigand |
195 (xsd:integer) |
| dbp:n |
2 (xsd:integer) |
| dbp:pubchem |
9859407 (xsd:integer) |
| dbp:smiles |
CN1CC[C@@H]2CN3CCC4=C3C[C@@H]2C1 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
YASBOGFWAMXINH-TZMCWYRMSA-N (en) |
| dbp:unii |
M7FHF24Q22 (en) |
| dbp:verifiedfields |
changed (en) |
| dbp:verifiedrevid |
449587176 (xsd:integer) |
| dbp:watchedfields |
changed (en) |
| dbp:width |
170 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Nervous-system-drug-stub dbt:Reflist dbt:Serotonergics dbt:Short_description dbt:Cascite dbt:Chemspidercite dbt:Fdacite dbt:Stdinchicite |
| dct:subject |
dbc:Indolonaphthyridines dbc:5-HT2_antagonists |
| gold:hypernym |
dbr:Drug |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:Adversary109773245 yago:CausalAgent100007347 yago:LivingThing100004258 yago:Object100002684 yago:Organism100004475 yago:Person100007846 yago:PhysicalEntity100001930 yago:YagoLegalActor yago:YagoLegalActorGeo dbo:Drug yago:Whole100003553 yago:Wikicat5-HT2Antagonists |
| rdfs:comment |
SDZ SER-082 is a drug which acts as a mixed antagonist for the 5-HT2B and 5-HT2C serotonin receptors, with good selectivity over other serotonin receptor subtypes and slight preference for 5-HT2C over 5-HT2B. It has been used in animal studies into the behavioural effects of the different 5-HT2 subtypes, and how they influence the effects of other drugs such as cocaine. (en) |
| rdfs:label |
SDZ SER-082 (en) |
| owl:sameAs |
freebase:SDZ SER-082 wikidata:SDZ SER-082 dbpedia-sh:SDZ SER-082 dbpedia-sr:SDZ SER-082 https://global.dbpedia.org/id/49fbK yago-res:SDZ SER-082 |
| prov:wasDerivedFrom |
wikipedia-en:SDZ_SER-082?oldid=1105027834&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/SDZ_SER-082.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:SDZ_SER-082 |
| is dbo:wikiPageWikiLink of |
dbr:5-HT2B_receptor dbr:5-HT2C_receptor dbr:C15H20N2 |
| is foaf:primaryTopic of |
wikipedia-en:SDZ_SER-082 |
