1,4-Dinitrobenzene (original) (raw)
From Wikipedia, the free encyclopedia
1,4-Dinitrobenzene
 |
|
|---|---|
  |
|
| Names | |
| Preferred IUPAC name 1,4-Dinitrobenzene | |
| Other namespara-dinitrobenzene | |
| Identifiers | |
| CAS Number | 100-25-4 |
| 3D model (JSmol) | Interactive image |
| Beilstein Reference | 1105828 |
| ChemSpider | 7211 |
| ECHA InfoCard | 100.002.576  |
| EC Number | 202-833-7 |
| PubChem CID | 7492 |
| RTECS number | CZ7525000 |
| UNII | 784Q9O56S9 |
| UN number | 3443 1597 |
| CompTox Dashboard (EPA) | DTXSID0021836 |
| InChI InChI=1S/C6H4N2O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4HKey: FYFDQJRXFWGIBS-UHFFFAOYSA-N | |
| SMILES C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-] | |
| Properties | |
| Chemical formula | C6H4N2O4 |
| Molar mass | 168.108 g·mol−1 |
| Appearance | pale yellow solid |
| Density | 1.625 g/cm3 |
| Melting point | 173 °C (343 °F; 446 K) |
| Boiling point | 299 °C (570 °F; 572 K) |
| Solubility in water | 69 mg/L |
| Hazards | |
| GHS labelling: | |
| Pictograms |    |
| Signal word | Danger |
| Hazard statements | H300, H310, H330, H373, H410 |
| Precautionary statements | P260, P262, P264, P270, P271, P273, P280, P284, P301+P310, P302+P350, P304+P340, P310, P314, P320, P321, P322, P330, P361, P363, P391, P403+P233, P405, P501 |
| Flash point | 150 °C (302 °F; 423 K) |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Chemical compound
1,4-Dinitrobenzene is one of three isomers of dinitrobenzene, with the formula C6H4(NO2)2. The 1,4-isomer is most symmetrical. The compound is a yellow solid that is soluble in organic solvents. It is prepared from 4-nitroaniline by diazotization followed by treatment with sodium nitrite in the presence of a copper catalyst.[1]
- ^ E. B. Starkey (1939). "_p_-Dinitrobenzene". Org. Synth. 19: 40. doi:10.15227/orgsyn.019.0040.