2,2'-Biphenylene phosphorochloridite (original) (raw)
From Wikipedia, the free encyclopedia
2,2′-Biphenylene phosphorochloridite
 |
|
|---|---|
| Names | |
| Preferred IUPAC name 6-Chloro-6_H_-dibenzo[d,_f_][1,3,2]dioxaphosphepine | |
| Other names1,1′-Biphenyl-2,2′-diyl phosphorochloridite | |
| Identifiers | |
| CAS Number | 16611-68-0 |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 532081 |
| EC Number | 929-115-2 |
| PubChem CID | 612102 |
| CompTox Dashboard (EPA) | DTXSID20884920 |
| InChI InChI=1S/C12H8ClO2P/c13-16-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15-16/h1-8HKey: RKNWJMHQLOIGIH-UHFFFAOYSA-N | |
| SMILES C1=CC=C2C(=C1)C3=CC=CC=C3OP(O2)Cl | |
| Properties | |
| Chemical formula | C12H8ClO0P |
| Molar mass | 218.62 g·mol−1 |
| Appearance | white solid |
| Melting point | 63 °C (145 °F; 336 K) |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Chemical compound
2,2′-Biphenylene phosphorochloridite is the name for a polycyclic organophosphorus compound with the formula C12H8O2PCl. It is a precursor to diphosphite ligands such as BiPhePhos by reaction with suitable diols. 2,2′-Biphenylene phosphorochloridites, which is a white solid, is prepared from 2,2′-biphenol and phosphorus trichloride. It is prepared by the reaction of 2,2′-biphenol and phosphorus trichloride.[1][2]
- ^ Cuny, Gregory D.; Buchwald, Stephen L. (1993). "Practical, High-Yield, Regioselective, Rhodium-Catalyzed Hydroformylation of Functionalized α-Olefins". Journal of the American Chemical Society. 115 (5): 2066–2068. doi:10.1021/ja00058a079.
- ^ Van Rooy, Annemiek; Kamer, Paul C. J.; Van Leeuwen, Piet W. N. M.; Goubitz, Kees; Fraanje, Jan; Veldman, Nora; Spek, Anthony L. (1996). "Bulky Diphosphite-Modified Rhodium Catalysts: Hydroformylation and Characterization". Organometallics. 15 (2): 835–847. doi:10.1021/OM950549K.