3-Hydroxypicolinic acid (original) (raw)
From Wikipedia, the free encyclopedia
3-Hydroxypicolinic acid
 |
|
|---|---|
 |
|
| Names | |
| Preferred IUPAC name 3-Hydroxypyridine-2-carboxylic acid | |
| Other names3-Hydroxypicolinic acid3-Hydroxy-2-pyridinecarboxylic acid | |
| Identifiers | |
| CAS Number | 874-24-8  Y |
| 3D model (JSmol) | Interactive imageInteractive image |
| ChEBI | CHEBI:63432  N |
| ChemSpider | 12827 Y |
| ECHA InfoCard | 100.011.690  |
| PubChem CID | 13401 |
| UNII | XV7XP64JR5 Y |
| CompTox Dashboard (EPA) | DTXSID80236320 |
| InChI InChI=1S/C6H5NO3/c8-4-2-1-3-7-5(4)6(9)10/h1-3,8H,(H,9,10) YKey: BRARRAHGNDUELT-UHFFFAOYSA-N YInChI=1/C6H5NO3/c8-4-2-1-3-7-5(4)6(9)10/h1-3,8H,(H,9,10)Key: BRARRAHGNDUELT-UHFFFAOYAC |
|
| SMILES C1=CC(=C(N=C1)C(=O)O)Oc1cc(c(nc1)C(=O)O)O | |
| Properties | |
| Chemical formula | C6H5NO3 |
| Molar mass | 139.109 |
| Appearance | Light yellow needles |
| Melting point | 208 to 212 °C (406 to 414 °F; 481 to 485 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).  N verify (what is YN ?) Infobox references |
Chemical compound
3-Hydroxy picolinic acid is a picolinic acid derivative and is a member of the pyridine family. It is used as a matrix for nucleotides in MALDI mass spectrometry analyses[1] and the synthesis of favipiravir.
- Matrix-assisted laser desorption/ionization
- Sinapinic acid
- Picolinic acid
- α-Cyano-4-hydroxycinnamic acid
- ^ Wu KJ, Steding A, Becker CH (1993). "Matrix-assisted laser desorption time-of-flight mass spectrometry of oligonucleotides using 3-hydroxypicolinic acid as an ultraviolet-sensitive matrix". Rapid Commun. Mass Spectrom. 7 (2): 142–6. Bibcode:1993RCMS....7..142W. doi:10.1002/rcm.1290070206. PMID 8457722.