5-Sulfosalicylic acid (original) (raw)
From Wikipedia, the free encyclopedia
Sulfosalicylic acid
 |
|
|---|---|
 |
|
 |
|
| Names | |
| IUPAC name 2-Hydroxy-5-sulfobenzoic acid | |
| Identifiers | |
| CAS Number | 97-05-2  Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:68555 |
| ChEMBL | ChEMBL229241 Y |
| ChemSpider | 7046 Y |
| ECHA InfoCard | 100.002.324  |
| EC Number | 202-555-6 |
| KEGG | C16199 Y |
| PubChem CID | 7322 |
| UNII | L8XED79U3U Y |
| CompTox Dashboard (EPA) | DTXSID7059145 |
| InChI InChI=1S/C7H6O6S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3,8H,(H,9,10)(H,11,12,13) YKey: YCPXWRQRBFJBPZ-UHFFFAOYSA-N YInChI=1/C7H6O6S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3,8H,(H,9,10)(H,11,12,13)Key: YCPXWRQRBFJBPZ-UHFFFAOYAD |
|
| SMILES O=C(O)c1cc(ccc1O)S(=O)(=O)O | |
| Properties | |
| Chemical formula | C7H6O6S |
| Molar mass | 218.185 g/mol |
| Melting point | 120 °C (248 °F; 393 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).  Y verify (what is Y N ?) Infobox references |
Chemical compound
Sulfosalicylic acid is used in urine tests to determine urine protein content. The chemical causes the precipitation of dissolved proteins, which is measured from the degree of turbidity.[1]
It is also used for integral colour anodizing.
With water it is used as a shuttle solution for the CAS assay to test for siderophore.
- ^ Sulfosalicylic acid Archived 2008-06-19 at the Wayback Machine, Family Practice Notebook website