Aurantinidin (original) (raw)
From Wikipedia, the free encyclopedia
Aurantinidin
 |
|
|---|---|
| Names | |
| IUPAC name 3,4′,5,6,7-Pentahydroxyflavylium | |
| Systematic IUPAC name 3,5,6,7-Tetrahydroxy-2-(4-hydroxyphenyl)-1λ4-benzopyran-1-ylium | |
| Other names6-Hydroxypelargonidine | |
| Identifiers | |
| CAS Number | 25041-66-1  Y |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 390278 Y |
| PubChem CID | 441648 |
| UNII | D53KRD9FB8 Y |
| CompTox Dashboard (EPA) | DTXSID40331603  |
| InChI InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)15-11(18)5-9-12(21-15)6-10(17)14(20)13(9)19/h1-6H,(H4-,16,17,18,19,20)/p+1 YKey: VGONRPRFJVEJKB-UHFFFAOYSA-O YInChI=1/C15H10O6/c16-8-3-1-7(2-4-8)15-11(18)5-9-12(21-15)6-10(17)14(20)13(9)19/h1-6H,(H4-,16,17,18,19,20)/p+1Key: VGONRPRFJVEJKB-IKLDFBCSAP |
|
| SMILES Oc1ccc(cc1)c3[o+]c2cc(O)c(O)c(O)c2cc3O | |
| Properties | |
| Chemical formula | C15H11O6+ |
| Molar mass | 287.24 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).  Y verify (what is Y N ?) Infobox references |
Chemical compound
Aurantinidin is a water-soluble, red plant dye. It is a member of the class of compounds known as anthocyanidins and is a hydroxy derivative of pelargonidin. Aurantinidin has been reported to occur in Impatiens aurantiaca (Balsaminaceae), and also in cultivars from genus Alstroemeria.[1]
- ^ FLAVONOIDS: Chemistry, biochemistry and applications by Oyvind M. Andersen and Kenneth R.Markham