Azapropazone (original) (raw)
From Wikipedia, the free encyclopedia
Nonsteroidal anti-inflammatory drug (NSAID)
Pharmaceutical compound
Azapropazone
 |
|
|---|---|
 |
|
| Clinical data | |
| Trade names | Rheumox |
| AHFS/Drugs.com | International Drug Names |
| ATC code | M01AX04 (WHO) |
| Legal status | |
| Legal status | UK: POM (Prescription only) |
| Pharmacokinetic data | |
| Elimination half-life | 20 hours |
| Identifiers | |
| IUPAC name (RS)-5-(Dimethylamino)-9-methyl-2-propyl-1H-pyrazolo[1,2-a][1,2,4]benzotriazine-1,3(2H)-dione | |
| CAS Number | 13539-59-8  N |
| PubChem CID | 26098 |
| ChemSpider | 24310  Y |
| UNII | K2VOT966ZI |
| KEGG | D02966 Y |
| ChEBI | CHEBI:38010 Y |
| ChEMBL | ChEMBL1231131 N |
| CompTox Dashboard (EPA) | DTXSID6045408  |
| ECHA InfoCard | 100.033.543 |
| Chemical and physical data | |
| Formula | C16H20N4O2 |
| Molar mass | 300.362 g·mol−1 |
| 3D model (JSmol) | Interactive image |
| Chirality | Racemic mixture |
| SMILES O=C3N/1N(c2c(\N=C\1N(C)C)ccc(c2)C)C(=O)C3CCC | |
| InChI InChI=1S/C16H20N4O2/c1-5-6-11-14(21)19-13-9-10(2)7-8-12(13)17-16(18(3)4)20(19)15(11)22/h7-9,11H,5-6H2,1-4H3 YKey:MPHPHYZQRGLTBO-UHFFFAOYSA-N Y |
|
| NY (what is this?) (verify) |
Azapropazone is a nonsteroidal anti-inflammatory drug (NSAID). It is manufactured by Goldshield under the tradename Rheumox.[1]
It was available in the UK as a prescription-only drug, with restrictions due to certain contra-indications and side-effects.[2] Azopropazone has now been discontinued in the British National Formulary.
Azapropazone has a half-life of approximately 20 hours in humans and is not extensively metabolized.[3]
- ^ "Rheumox Capsules". South Africa Electronic Package Inserts. Archived from the original on 2008-05-15. Retrieved 2008-08-18.
- ^ "Azapropazone". Patient UK. Archived from the original on 12 April 2009.
- ^ Jones CJ (1976). "The pharmacology and pharmacokinetics of azapropazone - a review". Current Medical Research and Opinion. 4 (1): 3–16. doi:10.1185/03007997609109277. PMID 770078.