Binospirone (original) (raw)
From Wikipedia, the free encyclopedia
Anxiolytic drug
Binospirone
 |
|
|---|---|
 |
|
| Clinical data | |
| ATC code | none |
| Identifiers | |
| IUPAC name 8-[2-(2,3-dihydro-1,4-benzodioxin-2-ylmethylamino)ethyl]-8-azaspiro[4.5]decane-7,9-dione | |
| CAS Number | 102908-59-8  Ymesylate: 124756-23-6 Y |
| PubChem CID | 60769 |
| ChemSpider | 54766 |
| UNII | T3M5D109V5mesylate: 155R3B9K8H Y |
| ChEMBL | ChEMBL1487115 |
| CompTox Dashboard (EPA) | DTXSID50861284  |
| Chemical and physical data | |
| Formula | C20H26N2O4 |
| Molar mass | 358.438 g·mol−1 |
| 3D model (JSmol) | Interactive image |
| SMILES O=C1N(C(=O)CC2(C1)CCCC2)CCNCC3Oc4ccccc4OC3 | |
| InChI InChI=1S/C20H26N2O4/c23-18-11-20(7-3-4-8-20)12-19(24)22(18)10-9-21-13-15-14-25-16-5-1-2-6-17(16)26-15/h1-2,5-6,15,21H,3-4,7-14H2Key:BVMYCHKQPGEOSI-UHFFFAOYSA-N | |
| (verify) |
Binospirone (MDL-73,005-EF) is a drug which acts as a partial agonist at 5-HT1A somatodendritic autoreceptors but as an antagonist at postsynaptic 5-HT1A receptors.[1] It has anxiolytic effects.[2]
- ^ Bertrand F, Lehmann O, Galani R, Lazarus C, Jeltsch H, Cassel JC (April 2001). "Effects of MDL 73005 on water-maze performances and locomotor activity in scopolamine-treated rats". Pharmacology, Biochemistry, and Behavior. 68 (4): 647–60. doi:10.1016/S0091-3057(01)00448-8. PMID 11526961. S2CID 8595441.
- ^ Moser PC, Tricklebank MD, Middlemiss DN, Mir AK, Hibert MF, Fozard JR (February 1990). "Characterization of MDL 73005EF as a 5-HT1A selective ligand and its effects in animal models of anxiety: comparison with buspirone, 8-OH-DPAT and diazepam". British Journal of Pharmacology. 99 (2): 343–9. doi:10.1111/j.1476-5381.1990.tb14706.x. PMC 1917389. PMID 1970269.