Bisphenol Z (original) (raw)
From Wikipedia, the free encyclopedia
Bisphenol Z
 |
|
|---|---|
| Names | |
| Preferred IUPAC name 23,24,25,26-Tetrahydro-22_H_-[11,21:21,31-terphenyl]-14,34-diol | |
| Other namesBis(4-hydroxyphenyl)cyclohexane | |
| Identifiers | |
| CAS Number | 843-55-0688035-61-2 (hydrate) |
| 3D model (JSmol) | Interactive image |
| ChEMBL | ChEMBL1231453 |
| ChemSpider | 202599 |
| ECHA InfoCard | 100.011.525  |
| EC Number | 212-677-1 |
| PubChem CID | 232446 |
| UNII | 64ZF6464QY |
| CompTox Dashboard (EPA) | DTXSID4047963 |
| InChI InChI=1S/C18H20O2/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15/h4-11,19-20H,1-3,12-13H2Key: SDDLEVPIDBLVHC-UHFFFAOYSA-N | |
| SMILES C1CCC(CC1)(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O | |
| Properties | |
| Chemical formula | C18H20O2 |
| Molar mass | 268.356 g·mol−1 |
| Appearance | White solid |
| Melting point | 188 °C (370 °F; 461 K) |
| Hazards | |
| GHS labelling: | |
| Pictograms |  |
| Signal word | Warning |
| Hazard statements | H315, H319, H335 |
| Precautionary statements | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Chemical compound
Bisphenol Z is an organic compound with the formula (HOC6H4)2C(CH2)5. This white, water-insoluble solid is classified as a bisphenol. It is a precursor to specialty polycarbonate plastics.[1]It is prepared by the condensation on phenol and cyclohexanone:
- ^ Helmut Fiege; Heinz-Werner Voges; Toshikazu Hamamoto; Sumio Umemura; Tadao Iwata; Hisaya Miki; Yasuhiro Fujita; Hans-Josef Buysch; Dorothea Garbe; Wilfried Paulus (2002). "Phenol Derivatives". Ullmann's Encyclopedia of Industrial Chemistry. Weinheim: Wiley-VCH. doi:10.1002/14356007.a19_313. ISBN 978-3-527-30673-2..