Cis-Inositol (original) (raw)
From Wikipedia, the free encyclopedia
Chemical compound
_cis_-Inositol
 |
|
|---|---|
| Names | |
| IUPAC name _cis_-Inositol[1] | |
| Systematic IUPAC name (1_s_,2_s_,3_s_,4_s_,5_s_,6_s_)-Cyclohexane-1,2,3,4,5,6-hexol | |
| Identifiers | |
| CAS Number | 488-59-5  Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:23311 Y |
| ChemSpider | 16736992 Y |
| UNII | 1VS4X81277 Y |
| InChI InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2+,3-,4+,5-,6+ YKey: CDAISMWEOUEBRE-JMVOWJSSSA-N Y |
|
| SMILES O[C@@H]1[C@H](O)[C@H](O)[C@H](O)[C@H](O)[C@@H]1O | |
| Properties | |
| Chemical formula | C6H12O6 |
| Molar mass | 180.156 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).  Y verify (what is Y N ?) Infobox references |
Chemical compound
_cis_-Inositol is one of the isomers of inositol.
- _allo_-Inositol
- D-_chiro_-Inositol
- L-_chiro_-Inositol
- _epi_-Inositol
- _muco_-Inositol
- _neo_-Inositol
- _scyllo_-Inositol
- _myo_-Inositol
- ^ International Union of Pure and Applied Chemistry (2014). Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013. The Royal Society of Chemistry. p. 1415. doi:10.1039/9781849733069. ISBN 978-0-85404-182-4.