Cyclopentobarbital (original) (raw)
From Wikipedia, the free encyclopedia
Chemical compound
Pharmaceutical compound
Cyclopentobarbital
 |
|
|---|---|
| Clinical data | |
| Other names | Allylpental, Cyclopental, 5-Allyl-5-Δ2-Cyclopentenyl Barbituric Acid |
| ATC code | None |
| Legal status | |
| Legal status | CA: Schedule IV |
| Identifiers | |
| IUPAC name 5-(1-cyclopent-2-enyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione | |
| CAS Number | 76-68-6 302-34-1 (sodium salt) |
| PubChem CID | 6454 |
| ChemSpider | 6212  Y |
| UNII | 2230XWG55Q |
| CompTox Dashboard (EPA) | DTXSID90871549  |
| ECHA InfoCard | 100.000.891 |
| Chemical and physical data | |
| Formula | C12H14N2O3 |
| Molar mass | 234.255 g·mol−1 |
| 3D model (JSmol) | Interactive image |
| SMILES O=C1NC(=O)NC(=O)C1(C2/C=C\CC2)C\C=C | |
| InChI InChI=1S/C12H14N2O3/c1-2-7-12(8-5-3-4-6-8)9(15)13-11(17)14-10(12)16/h2-3,5,8H,1,4,6-7H2,(H2,13,14,15,16,17) YKey:XOVJAYNMQDTIJD-UHFFFAOYSA-N Y |
|
| (verify) |
Cyclopentobarbital sodium (Cyclopal, Dormisan) is a barbiturate derivative invented in the 1940s.[1] It has sedative and anticonvulsant properties, and was used primarily as an anaesthetic in veterinary medicine.[2] Cyclopal is considered similar in effects to phenobarbital but lasts almost three times as long, and is considered a long-acting barbiturate with a fairly slow onset of action.
- ^ Martin JR, Godel T, Hunkeler W, Jenck F, Moreau JL, Sleight AJ, Widmer U (December 2000). "Psychopharmacological agents.". Kirk-Othmer Encyclopedia of Chemical Technology. doi:10.1002/0471238961.1619250313011820.a01. ISBN 0471238961.
- ^ Vander Brook MJ, Cartland GF (1944). "A Pharmacologic Study of 5-Allyl-5-Cyclopentenyl Barbituric Acid (Cyclopal)". Journal of Pharmacology and Experimental Therapeutics. 80 (2): 119–125. CiteSeerX 10.1.1.983.6071.