DMDNB (original) (raw)
From Wikipedia, the free encyclopedia
DMDNB[1]
 |
|
|---|---|
 |
|
| Names | |
| Preferred IUPAC name 2,3-Dimethyl-2,3-dinitrobutane | |
| Other names2,3-Dimethyl-2,3-dinitro-n-butane, DMDNB, DMNB | |
| Identifiers | |
| CAS Number | 3964-18-9 |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 69982 |
| ECHA InfoCard | 100.021.428  |
| PubChem CID | 77577 |
| CompTox Dashboard (EPA) | DTXSID4063248 |
| InChI InChI=1/C6H12N2O4/c1-5(2,7(9)10)6(3,4)8(11)12/h1-4H3Key: DWCLXOREGBLXTD-UHFFFAOYAA | |
| SMILES CC(C)(C(C)(C)[N+](=O)[O-])[N+](=O)[O-] | |
| Properties | |
| Chemical formula | C6H12N2O4 |
| Molar mass | 176.172 g·mol−1 |
| Melting point | 210 to 214 °C (410 to 417 °F; 483 to 487 K) |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Chemical compound
DMDNB, or also DMNB, chemically 2,3-dimethyl-2,3-dinitrobutane, is a volatile organic compound used as a detection taggant for explosives, mostly in the United States where it is virtually the only such taggant in use. Dogs are very sensitive to it and can detect as little as 0.5 parts per billion in the air, as can specialised ion mobility spectrometers. Its presence allows more reliable explosive detection.