Dimethyllysergamide (original) (raw)
From Wikipedia, the free encyclopedia
Chemical compound
Dimethyllysergamide
 |
|
|---|---|
| Clinical data | |
| Other names | DAM-57, Lysergic acid dimethylamide |
| Routes of administration | Oral |
| Legal status | |
| Legal status | US: Schedule I Controlled in the United States via the Federal Analog Act but only if it is intended for human consumption. |
| Pharmacokinetic data | |
| Metabolism | hepatic |
| Excretion | renal |
| Identifiers | |
| IUPAC name (6a_R_,9_R_)-N,_N_-dimethyl-7-methyl-4,6,6a,7,8,9- hexahydroindolo- [4,3-fg] quinoline- 9-carboxamide | |
| CAS Number | 4238-84-0  Y |
| PubChem CID | 199478 |
| ChemSpider | 172668 Y |
| CompTox Dashboard (EPA) | DTXSID30962445  |
| Chemical and physical data | |
| Formula | C18H21N3O |
| Molar mass | 295.386 g·mol−1 |
| 3D model (JSmol) | Interactive image |
| SMILES O=C(N(C)C)[C@@H]3C=C2c4cccc1c4c(c[nH]1)C[C@H]2N(C3)C | |
| InChI InChI=1S/C18H21N3O/c1-20(2)18(22)12-7-14-13-5-4-6-15-17(13)11(9-19-15)8-16(14)21(3)10-12/h4-7,9,12,16,19H,8,10H2,1-3H3/t12-,16-/m1/s1 YKey:FWHSERNVTGTIJE-MLGOLLRUSA-N Y |
|
| (verify) |
_N,N_-Dimethyllysergamide or _N,N_-dimethyl-D-lysergamide (DAM-57) is a derivative of ergine. There has been a single report of observing N,N-dimethyl-D-lysergamide in the illicit drug market.[1] This compound did induce autonomic disturbances at oral levels of some ten times the dosage required for LSD, presumably in the high hundreds of micrograms. There is some disagreement as to whether there were psychic changes observed.[2]
- ^ Clark AB (1973). "Lysergic Acid Diethylamide and Lysergic Acid Dimethylamide". Microgram. 6: 37.
- ^ Shulgin A, Shulgin A (September 1997). TiHKAL: The Continuation. Berkeley, California: Transform Press. p. 26. ISBN 0-9630096-9-9. OCLC 38503252.; "#26. LSD-25". Erowid.