Fedotozine (original) (raw)
From Wikipedia, the free encyclopedia
Chemical compound
Pharmaceutical compound
Fedotozine
 |
|
|---|---|
| Clinical data | |
| Routes of administration | Oral |
| ATC code | None |
| Legal status | |
| Legal status | In general: non-regulated |
| Identifiers | |
| IUPAC name (2_R_)-N,_N_-dimethyl-2-phenyl-1-[(3,4,5-trimethoxybenzyl)oxy]-2-butanamine | |
| CAS Number | 123618-00-8 133267-27-3 (tartrate) |
| PubChem CID | 6918160 |
| ChemSpider | 5293373 |
| UNII | F45VW2087W |
| ChEMBL | ChEMBL2106275 |
| CompTox Dashboard (EPA) | DTXSID901318556  |
| Chemical and physical data | |
| Formula | C22H31NO4 |
| Molar mass | 373.493 g·mol−1 |
| 3D model (JSmol) | Interactive image |
| SMILES O(c1cc(cc(OC)c1OC)COC[C@@](c2ccccc2)(N(C)C)CC)C | |
| InChI InChI=1S/C22H31NO4/c1-7-22(23(2)3,18-11-9-8-10-12-18)16-27-15-17-13-19(24-4)21(26-6)20(14-17)25-5/h8-14H,7,15-16H2,1-6H3/t22-/m0/s1Key:MVKIWCDXKCUDEH-QFIPXVFZSA-N |
Fedotozine (INN; JO 1196 for the (-) tartrate salt) is an opioid drug which acts as a peripherally specific selective κ1-opioid receptor agonist with preference for the κ1A subtype.[1] It was under investigation for the treatment of gastrointestinal conditions like irritable bowel syndrome and functional dyspepsia and made it to phase III clinical trials,[1][2][3] but ultimately development was discontinued and it was never marketed.
- ^ a b Delvaux M (January 2001). "Pharmacology and clinical experience with fedotozine". Expert Opinion on Investigational Drugs. 10 (1): 97–110. doi:10.1517/13543784.10.1.97. PMID 11116283. S2CID 41361900.
- ^ Barber A, Gottschlich R (October 1997). "Novel developments with selective, non-peptidic kappa-opioid receptor agonists". Expert Opinion on Investigational Drugs. 6 (10): 1351–68. doi:10.1517/13543784.6.10.1351. PMID 15989506.
- ^ Lembo A (2006). "Peripheral opioids for functional GI disease: a reappraisal". Digestive Diseases. 24 (1–2): 91–8. doi:10.1159/000090312. PMID 16699267. S2CID 29627937.