Fluometuron (original) (raw)
From Wikipedia, the free encyclopedia
Fluometuron
 |
|
|---|---|
| Names | |
| Preferred IUPAC name N,_N_-Dimethyl-_N_′-[3-(trifluoromethyl)phenyl]urea | |
| Other names1,1-Dimethyl-3-[3-(trifluoromethyl)phenyl]urea; 1,1-Dimethyl-3-(α,α,α-trifluoro-_m_-tolyl)-urea; 3-(3-Trifluoromethylphenyl)-1,1-dimethylurea; 3-(_m_-Trifluoromethylphenyl)-1,1-dimethylurea; C 2059; Ciba 2059; Cotoran; Cotoran 85DF; Fluomethuron; Lanex; _N_-(3-Trifluoromethylphenyl)-_N_′,_N_′-Dimethylurea; _N_-(_m_-Trifluoromethylphenyl)-_N_′,_N_′-Dimethylurea; Pakhtaran | |
| Identifiers | |
| CAS Number | 2164-17-2  Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:82012 |
| ChemSpider | 15702 |
| ECHA InfoCard | 100.016.819  |
| PubChem CID | 16562 |
| UNII | 296378G1S8 Y |
| CompTox Dashboard (EPA) | DTXSID8020628 |
| InChI InChI=1S/C10H11F3N2O/c1-15(2)9(16)14-8-5-3-4-7(6-8)10(11,12)13/h3-6H,1-2H3,(H,14,16) | |
| SMILES O=C(Nc1cc(ccc1)C(F)(F)F)N(C)C | |
| Properties | |
| Chemical formula | C10H11F3N2O |
| Molar mass | 232.206 g·mol−1 |
| Density | 1.39 g/cm3[1] |
| Melting point | 163 to 164 °C (325 to 327 °F; 436 to 437 K)[1] |
| Solubility in water | 90 ppm (0.0105%) at 20 °C[1] |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Chemical compound
Fluometuron is an herbicide. In the United States it was approved for use on cotton and sugarcane crops in 1974, but since 1986 is only approved for use on cotton.[2]
- ^ a b c Fluometuron, Pesticide Information Profile
- ^ Reregistration Eligibility Decision (RED) for Fluometuron, US Environmental Protection Agency
- Fluometuron in the Pesticide Properties DataBase (PPDB)