Formetanate (original) (raw)
From Wikipedia, the free encyclopedia
Formetanate
 |
|
|---|---|
| Names | |
| IUPAC name 3-{(E)-[(Dimethylamino)methylene]amino}phenyl methylcarbamate | |
| Other namesCarzol | |
| Identifiers | |
| CAS Number | 22259-30-9  Y23422-53-9 (HCl) Y |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 28856 |
| ECHA InfoCard | 100.040.784  |
| PubChem CID | 31099 |
| UNII | 532HEC1KKM YW0Y3OP0N2Z (HCl) Y |
| CompTox Dashboard (EPA) | DTXSID9041990 |
| InChI InChI=1S/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/b13-8+Key: RMFNNCGOSPBBAD-MDWZMJQESA-NInChI=1/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/b13-8+Key: RMFNNCGOSPBBAD-MDWZMJQEBJ | |
| SMILES O=C(Oc1cccc(\N=C\N(C)C)c1)NC | |
| Properties | |
| Chemical formula | C11H15N3O2 |
| Molar mass | 221.260 g·mol−1 |
| Melting point | 102 °C |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references |
Chemical compound
Formetanate is an insecticide and acaricide. It is used on alfalfa grown for seed and on some fruits, including citrus, pome, and stone fruits.[1]
- ^ Formetanate HCL (Carzol) Chemical Fact Sheet, Pesticide Management Education Program
- Formetanate in the Pesticide Properties DataBase (PPDB)