Methyl dihydrojasmonate (original) (raw)
From Wikipedia, the free encyclopedia
Methyl dihydrojasmonate
 |
|
|---|---|
| Names | |
| Preferred IUPAC name Methyl 2-(3-oxo-2-pentylcyclopentyl)acetate | |
| Other namesHedioneKharismalCepionate | |
| Identifiers | |
| CAS Number | 24851-98-7  Y |
| 3D model (JSmol) | Interactive image |
| ECHA InfoCard | 100.042.254  |
| PubChem CID | 102861 |
| UNII | 3GW44CIE3Y Y |
| CompTox Dashboard (EPA) | DTXSID2029325 |
| SMILES O=C(OC)CC1C(C(=O)CC1)CCCCC | |
| Properties | |
| Chemical formula | C13H22O3 |
| Molar mass | 226.316 g·mol−1 |
| Appearance | Clear to pale yellow oily liquid |
| Boiling point | 307.8 °C (586.0 °F; 581.0 K) |
| Hazards | |
| Occupational safety and health (OHS/OSH): | |
| Main hazards | Flammable |
| Flash point | 113 °C (235 °F; 386 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).  N verify (what is Y N ?) Infobox references |
Chemical compound
Methyl dihydrojasmonate is an aroma compound that smells similar to jasmine. In racemic mixtures the odor is floral and citrus while epimerized mixtures exhibit a dense buttery-floral odor with odor recognition thresholds of 15 parts per billion.[1]
The compound is also known as hedione or kharismal. Its boiling point is 110°C at 0.2 mmHg and it has an refractive Index: 1.45800 to 1.46200 (20.00°C).
- ^ Leffingwell, John C. (2001), The Methyl dihydrojasmonates, Leffingwell & Associates