Perhydropyrene (original) (raw)
From Wikipedia, the free encyclopedia
Perhydropyrene
 |
|
|---|---|
 |
|
| Names | |
| Preferred IUPAC name Hexadecahydropyrene | |
| Identifiers | |
| CAS Number | 2435-85-0  Y |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 68050 Y |
| ECHA InfoCard | 100.017.663  |
| PubChem CID | 75524 |
| UNII | K5UZS47HQS Y |
| CompTox Dashboard (EPA) | DTXSID70873304 |
| InChI InChI=1S/C16H26/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-16H,1-10H2 YKey: BYBPEZLZCGOWIS-UHFFFAOYSA-N YInChI=1S/C16H26/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-16H,1-10H2 |
|
| SMILES C2CCC3CCC1C4C(CCC1)CCC2C34 | |
| Properties | |
| Chemical formula | C16H26 |
| Molar mass | 218.384 g·mol−1 |
| Density | 0.962 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).  N verify (what is YN ?) Infobox references |
Chemical compound
Perhydropyrene is a hydrocarbon similar to pyrene. Single bonds with hydrogen replace the double bonds in the benzene rings.
- Ayub, Khurshid; Zhang, Rui; Robinson, Stephen G.; Twamley, Brendan; Williams, Richard Vaughan; Mitchell, Reginald H. (2008). "Suppressing the Thermal Metacyclophanediene to Dihydropyrene Isomerization: Synthesis and Rearrangement of 8,16-Dicyano(2.2)metacyclophane-1,9-diene and Evidence Supporting the Proposed Biradicaloid Mechanism". The Journal of Organic Chemistry. 73 (2): 451–6. doi:10.1021/jo7019459. PMID 18154301.
- Mitchell, R (1996). "Synthesis of the elusive dibenzannelated dihydropyrene dibenzo(e,l)dimethyldihydropyrene, a molecular photo-switch". Tetrahedron Letters. 37 (30): 5239–5242. doi:10.1016/0040-4039(96)01074-X.