Rhc80267 (original) (raw)
From Wikipedia, the free encyclopedia
Rhc80267
 |
|
|---|---|
| Names | |
| Preferred IUPAC name _N_′,_N_′′′-(Hexane-1,6-diyl)bis(_N_-cyclohexylidenehydroxylamine-_O_-carboxamide) | |
| Other namesRHC 80267, RG 80267, U 57908 | |
| Identifiers | |
| CAS Number | 83654-05-1  Y |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 4887  N |
| IUPHAR/BPS | 5255 |
| MeSH | 1,6-bis(cyclohexyloximinocarbonyl)hexane |
| PubChem CID | 5063 |
| UNII | 9VB68H5WIT Y |
| CompTox Dashboard (EPA) | DTXSID90232494  |
| InChI InChI=1S/C20H34N4O4/c25-19(27-23-17-11-5-3-6-12-17)21-15-9-1-2-10-16-22-20(26)28-24-18-13-7-4-8-14-18/h1-16H2,(H,21,25)(H,22,26) NKey: RXSVYGIGWRDVQC-UHFFFAOYSA-N N |
|
| SMILES C1CCC(=NOC(=O)NCCCCCCNC(=O)ON=C2CCCCC2)CC1 | |
| Properties | |
| Chemical formula | C20H34N4O4 |
| Molar mass | 394.26 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).  N verify (what is YN ?) Infobox references |
Chemical compound
RHC80267 is an inhibitor of diacylglycerol lipase.[1] Diacylglycerol lipase generates the endocannabinoid 2-arachidonoylglycerol from diacylglycerol.