(original) (raw)

%!PS-Adobe-2.0 %%Creator: dvipsk 5.58f Copyright 1986, 1994 Radical Eye Software %%Title: junk.dvi %%Pages: 33 %%PageOrder: Ascend %%BoundingBox: 0 0 612 792 %%EndComments %DVIPSCommandLine: dvips junk %DVIPSParameters: dpi=300, comments removed %DVIPSSource: TeX output 1996.03.06:1059 %%BeginProcSet: tex.pro /TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} forall round exch round exch]setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ /nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ /sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ 128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff .1 sub]{ch-image}imagemask restore}B /D{/cc X dup type /stringtype ne{]} if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin 0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict /eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley X /rulex X V}B /V {}B /RV statusdict begin /product where{pop product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval(NeXT)eq or}{pop false} ifelse}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail {dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ 4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B /eos{SS restore}B end %%EndProcSet %%BeginProcSet: special.pro TeXDict begin /SDict 200 dict N SDict begin /@SpecialDefaults{/hs 612 N /vs 792 N /ho 0 N /vo 0 N /hsc 1 N /vsc 1 N /ang 0 N /CLIP 0 N /rwiSeen false N /rhiSeen false N /letter{}N /note{}N /a4{}N /legal{}N}B /@scaleunit 100 N /@hscale{@scaleunit div /hsc X}B /@vscale{@scaleunit div /vsc X}B /@hsize{/hs X /CLIP 1 N}B /@vsize{/vs X /CLIP 1 N}B /@clip{ /CLIP 2 N}B /@hoffset{/ho X}B /@voffset{/vo X}B /@angle{/ang X}B /@rwi{ 10 div /rwi X /rwiSeen true N}B /@rhi{10 div /rhi X /rhiSeen true N}B /@llx{/llx X}B /@lly{/lly X}B /@urx{/urx X}B /@ury{/ury X}B /magscale true def end /@MacSetUp{userdict /md known{userdict /md get type /dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N /note{}N /legal{} N /od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{itransform lineto} }{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{ itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{ closepath}}pathforall newpath counttomark array astore /gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}if}N /txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N /cp {pop pop showpage pm restore}N end}if}if}N /normalscale{Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale}if 0 setgray} N /psfts{S 65781.76 div N}N /startTexFig{/psf$SavedState save N userdict maxlength dict begin /magscale true def normalscale currentpoint TR /psf$ury psfts /psf$urx psfts /psf$lly psfts /psf$llx psfts /psf$y psfts /psf$x psfts currentpoint /psf$cy X /psf$cx X /psf$sx psf$x psf$urx psf$llx sub div N /psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR /showpage{}N /erasepage{}N /copypage{}N /p 3 def @MacSetUp}N /doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N /endTexFig{end psf$SavedState restore}N /@beginspecial{SDict begin /SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count /ocount X /dcount countdictstack N}N /@setspecial {CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if /showpage{}N /erasepage{}N /copypage{}N newpath }N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{ end}repeat grestore SpecialSave restore end}N /@defspecial{SDict begin} N /@fedspecial{end}B /li{lineto}B /rl{rlineto}B /rc{rcurveto}B /np{ /SaveX currentpoint /SaveY X N 1 setlinecap newpath}N /st{stroke SaveX SaveY moveto}N /fil{fill SaveX SaveY moveto}N /ellipse{/endangle X /startangle X /yrad X /xrad X /savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet TeXDict begin 40258431 52099146 1000 300 300 (junk.dvi) @start /Fa 15 118 df<0003FE0080001FFF818000FF01E38001F8003F8003E0001F80 07C0000F800F800007801F800007803F000003803F000003807F000001807E000001807E 00000180FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00 000000FE000000007E000000007E000001807F000001803F000001803F000003801F8000 03000F8000030007C000060003F0000C0001F800380000FF00F000001FFFC0000003FE00 0021227DA128>67 D80 D<0FFC003FFF807E07C07E03E07E01E07E01F03C01F00001F00001F0 003FF003FDF01FC1F03F01F07E01F0FC01F0FC01F0FC01F0FC01F07E02F07E0CF81FF87F 07E03F18167E951B>97 DI<00FE0007FF800F87C01E01E03E01F07C00F07C00F8FC 00F8FC00F8FFFFF8FFFFF8FC0000FC0000FC00007C00007C00007E00003E00181F00300F C07003FFC000FF0015167E951A>101 D<01FE0F0007FFBF800F87C7801F03E7801E01E0 003E01F0003E01F0003E01F0003E01F0003E01F0001E01E0001F03E0000F87C0000FFF80 0009FE000018000000180000001C0000001FFFE0000FFFF80007FFFE001FFFFF003C003F 0078000F80F0000780F0000780F0000780F000078078000F003C001E001F007C000FFFF8 0001FFC00019217F951C>103 D<1C003E007F007F007F003E001C000000000000000000 000000000000FF00FF001F001F001F001F001F001F001F001F001F001F001F001F001F00 1F001F001F001F001F00FFE0FFE00B247EA310>105 D108 D110 D<00FE0007FFC00F83E01E 00F03E00F87C007C7C007C7C007CFC007EFC007EFC007EFC007EFC007EFC007EFC007E7C 007C7C007C3E00F81F01F00F83E007FFC000FE0017167E951C>II114 D<0FF3003FFF00781F00600700E00300 E00300F00300FC00007FE0007FF8003FFE000FFF0001FF00000F80C00780C00380E00380 E00380F00700FC0E00EFFC00C7F00011167E9516>I<0180000180000180000180000380 000380000780000780000F80003F8000FFFF00FFFF000F80000F80000F80000F80000F80 000F80000F80000F80000F80000F80000F80000F81800F81800F81800F81800F81800F83 0007C30003FE0000F80011207F9F16>II E /Fb 1 81 df80 D E /Fc 1 106 df<040C00000000003058989830306064 64683006127E910B>105 D E /Fd 7 57 df<07C018303018701C600C600CE00EE00EE0 0EE00EE00EE00EE00EE00EE00E600C600C701C30181C7007C00F157F9412>48 D<06000E00FE000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E 000E000E00FFE00B157D9412>I<0F8030E040708030C038E03840380038007000700060 00C00180030006000C08080810183FF07FF0FFF00D157E9412>I<60307FE07FC0440040 004000400040004F8070E040700030003800384038E038E0388030406020C01F000D157E 9412>53 D<01F00608080C181C301C70006000E000E3E0EC30F018F00CE00EE00EE00E60 0E600E300C3018183007C00F157F9412>I<40007FFE7FFC7FF8C0088010802000400080 00800100030003000200060006000E000E000E000E000E0004000F167E9512>I<07E018 302018600C600C700C78183E101F6007C00FF018F8607C601EC00EC006C006C004600C38 300FE00F157F9412>I E /Fe 4 117 df<60F0F070101020204040040A7D830A>59 D<07C00C20107020706000C000C000C00080008000C010C02060C03F000C0E7E8D0F>99 D<0300038003000000000000000000000000001C002400460046008C000C001800180018 0031003100320032001C0009177F960C>105 D<030003000600060006000600FFC00C00 0C000C001800180018001800300030803080310032001C000A147F930D>116 D E /Ff 1 15 df<0F801FC0306060306030C018C018C018C0186030603030601FC00F80 0D0E7E8E12>14 D E /Fg 5 104 df0 D<800002C0000660000C3000181800300C00600600C003018001830000C600006C000038 00003800006C0000C6000183000301800600C00C006018003030001860000CC000068000 021718789727>2 D<03E0000F0FFC0038181E00E0300F0180200383004003C6004001E4 008000EC0080007800800078008000380080003C0080003C0080006E0040004F004000C7 8060018380200301E0100E00F00E38007F03E0000F20157D9427>47 D<0003C0001E0000380000700000E00000E00000E00000E00000E00000E00000E00000E0 0000E00000E00000E00000E00000E00000E00000E00000E00000E00001C0000380000F00 00F800000F000003800001C00000E00000E00000E00000E00000E00000E00000E00000E0 0000E00000E00000E00000E00000E00000E00000E00000E00000E000007000003800001E 000003C012317DA419>102 DI E /Fh 15 122 df<003F000000E180000380E020070060400E0070401C0030403C0038803C003880 780039007800390078003A00F0003A00F0003C00F0003800F00038007000380070007800 3000B800380318401C1C188007E007001B157E941F>11 D<3C07C0461860472030874038 8780388700388700380E00700E00700E00700E00701C00E01C00E01C00E01C00E03801C0 3801C03801C03801C0700380300380000380000380000700000700000700000700000E00 000E00000E00000E00000C0015207E9418>17 D<000F000031800060C000E0C001C0E001 80E00380E00700E00700E00F00E00E00E01E00E01E00E01C01E03C01E03C01E03C01E07F FFC07803C07803C07803C0700780F00780F00700F00F00F00E00F00E00E01C00601C0060 380070300070600030C0001180000F000013237EA217>I<007FFF8001FFFF8003FFFF80 0783C0000E01C0001C00E0003800E0003800E0007000E0007000E0007000E000E001C000 E001C000E001C000E0038000E003000060070000600E0000301800001870000007C00000 19157E941C>27 D<70F8F8F87005057C840E>58 D<70F8FCFC7404040404080810102040 060F7C840E>I<0000001800000078000001E00000078000001E00000078000003E00000 0F8000003C000000F0000003C000000F0000003C000000F0000000F00000003C0000000F 00000003C0000000F00000003C0000000F80000003E0000000780000001E000000078000 0001E000000078000000181D1C7C9926>I<00FFFFFF80000F000780000F000180000F00 0180001E000180001E000180001E000100001E000100003C000100003C000100003C0101 00003C01000000780200000078020000007806000000780E000000FFFC000000F00C0000 00F00C000000F00C000001E008000001E008000001E008000001E000000003C000000003 C000000003C000000003C000000007800000000780000000078000000007800000000F80 000000FFFC00000021227DA120>70 D<00E000E001E000C0000000000000000000000000 0000000000001E0023004380438083808700870007000E000E000E001C001C001C003820 384070407080308031001E000B227EA111>105 D<01E00FC001C001C001C00380038003 80038007000700070007000E000E000E000E001C001C001C001C00380038003800380070 00700070007080E100E100E100620062003C000B237EA20F>108 D<3C07C04618604720308740388780388700388700380E00700E00700E00700E00701C00 E01C00E01C01C01C01C13801C23803823803843801847001883000F018157E941D>110 D<03C0F004631C04740E08780E08700708700708700F00E00F00E00F00E00F00E00F01C0 1E01C01E01C01E01C03C03803803803803C07003C0E0072180071E000700000700000E00 000E00000E00000E00001C00001C00001C0000FF8000181F819418>112 D<007E0000810003008002018006038006030006000007000007F00003FC0001FF00003F 00000780000380700380F00300F00300E002004004003018000FE00011157E9417>115 D<01E0F006310C081A1C101A3C201C3C201C18201C000038000038000038000038000070 0000700000700000700860E010F0E010F0E020E170404230803C1F0016157E941C>120 D<1E00182300384380384380708380708700708700700700E00E00E00E00E00E00E01C01 C01C01C01C01C01C01C01C03801C03801C07800C0B800E170003E700000700000700000E 00600E00F01C00F01800E0300080600041C0003F0000151F7E9418>I E /Fi 53 123 df<00000FF00000380C0000600E0000C01E0001C01E0001801C00038000 0003800000038000000700000007000000070000000700000007000000FFFFF0000E0070 000E0070000E00E0000E00E0001C00E0001C00E0001C01C0001C01C0001C01C0003801C0 003803800038038000380380003803880070071000700710007007100070071000700320 00E001C000E0000000E0000000C0000000C0000001C0000071800000F1800000F3000000 620000003C0000001F2D82A21B>12 D<0000800001000002000004000008000010000030 0000600000C00000C0000180000300000300000600000600000E00000C00001C00001800 00180000380000300000300000700000700000600000600000E00000E00000E00000C000 00C00000C00000C00000C00000C00000C00000C00000C00000C00000C00000C00000C000 00400000600000600000200000300000100000080000113278A414>40 D<0008000004000006000002000003000003000001000001800001800001800001800001 800001800001800001800001800001800001800001800001800003800003800003800003 00000300000700000700000600000600000E00000C00000C00001C000018000038000030 0000300000600000600000C0000180000180000300000600000400000800001000002000 00400000800000113280A414>I<0E1E1E1E1E02020404080810204080070F7D840F>44 DI<70F8F8F0E005057A840F>I<000F800030C000E06001C0 700380700300700700700F00700E00701E00701E00701C00F03C00F03C00F03C00F07801 E07801E07801E07801E0F003C0F003C0F003C0F00380E00780E00780E00700E00F00E00E 00E01C00E01C00E0380060700030E0001F000014227AA019>48 D<000100030003000600 1E002E03CE001C001C001C001C0038003800380038007000700070007000E000E000E000 E001C001C001C001C003800380038003800780FFFC10217AA019>I<0000180000380000 380000700000700000700000E00000E00000E00000C00001C00001800003800003000003 00000600000600000C00000C000018000010000031800061C00043800083800183800303 800207000407000807003FC700403E00800FF0000E00000E00001C00001C00001C00001C 00003800003800003800003000152B7EA019>52 D<0003E0000C1000300800603800C078 01C0780380300700000700000E00001E00001E00001C7C003C86003D03007A03807C0380 7801C07803C0F803C0F003C0F003C0F003C0E00780E00780E00780E00700E00F00E00E00 E01C0060180060300030E0000F800015227AA019>54 D<02780204FC0407FC040FFC080F 0C181E04701803A03000602000406000C040008080018000038000030000070000060000 0E00000E00001C00001C00003C0000380000780000780000F00000F00000F00001E00001 E00001E00003E00003C00003C000018000172279A019>I<000FC0003060004010008018 01000803000C03000C07001807001807001007803007C06007E0C003F10001FE0000FC00 00FE00033F00061F800C0FC01803C03001C06001C06000C0C000C0C000C0C00080C00180 C00100C00200C006006008003030000FC00016227BA019>I<07000F800F800F000E0000 0000000000000000000000000000000000000000007000F800F800F000E00009157A940F >58 D<0000030000000300000007000000070000000F0000000F0000001F0000002F0000 002F0000004F8000004F8000008780000087800001078000020780000207800004078000 0407800008078000180780001007800020078000200780007FFFC0004003C0008003C001 8003C0010003C0020003C0020003C0040003C0040003C00C0003C03C0007E0FF003FFC1E 237DA224>65 D<00FFFFE0000F0038000F001C000F001E001E000E001E000F001E000F00 1E000F003C000E003C001E003C001E003C003C0078007800780070007801E00078078000 FFFF8000F001E000F000F000F0007801E0007801E0003801E0003C01E0003C03C0007803 C0007803C0007803C000F0078000F0078001E0078003C0078007000F001E00FFFFF00020 227DA122>I<00007F00800003808100000E00630000380027000070001F0000E0000E00 01C0000E000380000E000700000E000F000004000E000004001E000004003C000004003C 00000800780000000078000000007800000000F000000000F000000000F000000000F000 000000F000000000E000000000E000002000E000002000E000004000E000004000F00000 800070000080007000010000380002000018000400001C0008000006003000000381C000 0000FE000000212479A223>I<00FFFFFF80000F000780000F000180000F000180001E00 0180001E000180001E000100001E000100003C000100003C000100003C010100003C0100 0000780200000078020000007806000000780E000000FFFC000000F00C000000F00C0000 00F00C000001E008000001E008000001E008040001E000080003C000080003C000080003 C000100003C000100007800020000780006000078000C000078001C0000F0007C000FFFF FF800021227DA121>69 D<00FFFFFF000F000F000F0003000F0003001E0003001E000300 1E0002001E0002003C0002003C0002003C0102003C010000780200007802000078060000 780E0000FFFC0000F00C0000F00C0000F00C0001E0080001E0080001E0080001E0000003 C0000003C0000003C0000003C00000078000000780000007800000078000000F800000FF F8000020227DA120>I<00FFF87FFC000F000780000F000780000F000780001E000F0000 1E000F00001E000F00001E000F00003C001E00003C001E00003C001E00003C001E000078 003C000078003C000078003C000078003C0000FFFFF80000F000780000F000780000F000 780001E000F00001E000F00001E000F00001E000F00003C001E00003C001E00003C001E0 0003C001E000078003C000078003C000078003C000078003C0000F8007C000FFF07FF800 26227DA124>72 D<00FFF8000F00000F00000F00001E00001E00001E00001E00003C0000 3C00003C00003C0000780000780000780000780000F00000F00000F00000F00001E00001 E00001E00001E00003C00003C00003C00003C0000780000780000780000780000F8000FF F00015227DA113>I<0007FFC000003C0000003C0000003C000000780000007800000078 00000078000000F0000000F0000000F0000000F0000001E0000001E0000001E0000001E0 000003C0000003C0000003C0000003C00000078000000780000007800000078000000F00 00000F0000380F0000780F0000F81E0000F81E0000F03C0000403800004070000021E000 001F8000001A237CA11A>I<00FFFC00000F8000000F0000000F0000001E0000001E0000 001E0000001E0000003C0000003C0000003C0000003C0000007800000078000000780000 0078000000F0000000F0000000F0000000F0000001E0000001E0000001E0002001E00020 03C0004003C0004003C0008003C0008007800180078001000780030007800F000F803E00 FFFFFE001B227DA11F>76 D<00FF800007FC000F80000F80000F80001780000F80001780 001780002F000013C0002F000013C0004F000013C0008F000023C0009E000023C0011E00 0023C0011E000023C0021E000043C0043C000043C0043C000043C0083C000041E0083C00 0081E01078000081E02078000081E02078000081E04078000101E040F0000101E080F000 0101E100F0000101E100F0000200F201E0000200F201E0000200F401E0000200F801E000 0400F803C0000400F003C0000400F003C0000C00E003C0001E00C007C000FF80C07FF800 2E227DA12C>I<00FF000FFC000F8001E0000F800180000FC000800013C001000013C001 000011E001000011E001000021E002000020F002000020F002000020F002000040780400 0040780400004078040000403C040000803C080000803E080000801E080000801E080001 001F100001000F100001000F10000100079000020007A000020007A000020003E0000200 03E000040003C000040001C000040001C0000C0001C0001E00008000FF8000800026227D A124>I<00FFFFE0000F0038000F001E000F000E001E0007001E0007001E0007001E0007 003C000F003C000F003C000F003C001E0078001E0078003C00780078007800E000F003C0 00FFFE0000F0000000F0000001E0000001E0000001E0000001E0000003C0000003C00000 03C0000003C00000078000000780000007800000078000000F800000FFF0000020227DA1 21>80 D<00FFFFC0000F0070000F003C000F001C001E000E001E000E001E000F001E000F 003C001E003C001E003C001E003C003C0078003800780070007801E00078078000FFFC00 00F00E0000F0070000F0038001E003C001E003C001E003C001E003C003C0078003C00780 03C0078003C0078007800F0007800F0107800F01078007020F800702FFF0038C000000F0 20237DA124>82 D<0001F020000E0C40001802C0003001C0006001C000E0018000C00180 01C0018001C0018003C0010003C0010003C0000003C0000003E0000001F8000001FF0000 00FFE000007FF000001FF8000003FC0000007C0000003C0000001E0000001E0000001E00 20001C0020001C0020001C00200018006000380060003000700060007000C000C8018000 C607000081FC00001B247DA21B>I<1FFFFFF81E03C0381803C0183003C0182007801820 0780184007801040078010400F0010800F0010800F0010000F0000001E0000001E000000 1E0000001E0000003C0000003C0000003C0000003C000000780000007800000078000000 78000000F0000000F0000000F0000000F0000001E0000001E0000001E0000001E0000003 E00000FFFF00001D2277A123>I<3FFE03FF03C0007803C0006003C00020078000400780 004007800040078000400F0000800F0000800F0000800F0000801E0001001E0001001E00 01001E0001003C0002003C0002003C0002003C0002007800040078000400780004007800 040070000800F0000800F000100070001000700020007000400030004000380180001802 00000E0C000003F00000202377A124>I<00F8C00185C00705C00E03800E03801C03803C 0380380700780700780700780700F00E00F00E00F00E00F00E10F01C20701C20703C2030 5C40308C400F078014157B9419>97 D<03C01F8003800380038007000700070007000E00 0E000E000E001C001CF81D0C1E0E3C0638073807380F700F700F700F700FE01EE01EE01E E03CE038E038607060E031C01F0010237BA216>I<007E0001C1000301800703800E0780 1C07803C0000380000780000780000780000F00000F00000F00000F00000F00100700100 700200300C001830000FC00011157B9416>I<00003C0003F80000380000380000380000 700000700000700000700000E00000E00000E00000E00001C000F9C00185C00705C00E03 800E03801C03803C0380380700780700780700780700F00E00F00E00F00E00F00E10F01C 20701C20703C20305C40308C400F078016237BA219>I<00F803840E021C023C02380278 04F018FFE0F000F000E000E000E000E000E002E0026004701830600F800F157A9416>I< 00003E0000470000CF00018F000186000380000380000380000700000700000700000700 000700000E0000FFF0000E00000E00000E00001C00001C00001C00001C00001C00003800 00380000380000380000380000700000700000700000700000700000E00000E00000E000 00E00000C00001C00001C000718000F18000F300006200003C0000182D82A20F>I<001F 180030B800E0B801C07001C0700380700780700700E00F00E00F00E00F00E01E01C01E01 C01E01C01E01C01E03800E03800E0780060B8006170001E700000700000700000E00000E 00000E00701C00F01800F0300060E0003F8000151F7E9416>I<00F0000FE00000E00000 E00000E00001C00001C00001C00001C000038000038000038000038000070000071F0007 218007C0C00F00E00F00E00E00E00E00E01C01C01C01C01C01C01C01C038038038038038 0380380704700708700E08700E10700610E006206003C016237DA219>I<00C001E001C0 01C0000000000000000000000000000000001E002300430043008700870087000E000E00 1C001C001C00380038003840708070807080710032001C000B217BA00F>I<00F00007E0 0000E00000E00000E00001C00001C00001C00001C0000380000380000380000380000700 000701E00702100704700E08F00E10F00E20600E40001D80001E00001FC0001C70003838 00383800381C00381C20703840703840703840701880E01880600F0014237DA216>107 D<01E00FC001C001C001C0038003800380038007000700070007000E000E000E000E001C 001C001C001C0038003800380038007000700070007100E200E200E200E200640038000B 237CA20C>I<1C0F80F8002610C10C004760660600878078070087807807008700700700 87007007000E00E00E000E00E00E000E00E00E000E00E00E001C01C01C001C01C01C001C 01C01C001C01C03820380380384038038070403803807080380380308070070031003003 001E0023157B9428>I<380F804C30C04E40608E80708F00708E00708E00701C00E01C00 E01C00E01C00E03801C03801C03801C0380384700388700308700708700310E003106001 E016157B941B>I<007E0001C3000381800701C00E01C01C01E03C01E03801E07801E078 01E07801E0F003C0F003C0F00380F00780700700700E00700C0030180018700007C00013 157B9419>I<01C1F002621804741C08780C08700E08700E08701E00E01E00E01E00E01E 00E01E01C03C01C03C01C03C01C07803807003807003C0E003C1C0072380071E00070000 0700000E00000E00000E00000E00001C00001C00001C0000FFC000171F7F9419>I<1C1F 002620804741C08783C08703C08701808700000E00000E00000E00000E00001C00001C00 001C00001C000038000038000038000038000070000030000012157B9415>114 D<00FC000183000200800401800C03800C03000C00000F00000FF00007FC0003FE00003E 00000F00000700700700F00600F00600E004004008002030001FC00011157D9414>I<00 C001C001C001C001C003800380038003800700FFF8070007000E000E000E000E001C001C 001C001C003800380038003810702070207040708031001E000D1F7C9E10>I<1E006023 00E04380E04381C08381C08701C08701C00703800E03800E03800E03801C07001C07001C 07001C07081C0E10180E101C0E101C1E200C262007C3C015157B941A>I<1C01802603C0 4707C04703C08701C08E00C08E00C00E00801C00801C00801C0080380100380100380100 3802003802003804003808001808000C300007C00012157B9416>I<1E0060E02300E0F0 4380E1F04381C0F08381C0708701C0308701C030070380200E0380200E0380200E038020 1C0700401C0700401C0700401C0700801C0700801C0701001C0F01000C0B020006138400 03E0F8001C157B9420>I<03C1E0046210083470103CF02038F020386020380000700000 700000700000700000E00000E00000E00000E02061C040F1C040F1C080E2C10044620038 3C0014157D9416>I<1E00302300704380704380E08380E08700E08700E00701C00E01C0 0E01C00E01C01C03801C03801C03801C03801C07001C07001C07001C0F000C3E0003CE00 000E00000E00001C00601C00F03800F03000E0600080C0004380003E0000141F7B9418> I<01E02003F06007F8C0041F800801000802000004000008000010000020000040000080 000100000200000400800801001003003F060061FE0040FC0080700013157D9414>I E /Fj 20 123 df<00003FF001800003FFFE0380000FFFFF8780003FF007DF8000FF8001 FF8001FE00007F8003FC00003F8007F000001F800FF000000F801FE0000007801FE00000 07803FC0000007803FC0000003807FC0000003807F80000003807F8000000000FF800000 0000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF800000 0000FF8000000000FF80007FFFFC7F80007FFFFC7F80007FFFFC7FC000007F803FC00000 7F803FC000007F801FE000007F801FE000007F800FF000007F8007F800007F8003FC0000 7F8001FE00007F8000FF8000FF80003FF003DF80000FFFFF8F800003FFFF078000003FF8 01802E297CA836>71 D<03FF80000FFFF0001F01F8003F807E003F807E003F803F001F00 3F800E003F8000003F8000003F8000003F80000FFF8000FFFF8007FC3F800FE03F803F80 3F803F003F807F003F80FE003F80FE003F80FE003F80FE003F807E007F807F00DF803F83 9FFC0FFF0FFC01FC03FC1E1B7E9A21>97 D<003FF80000FFFE0003F01F0007E03F800FC0 3F801F803F803F801F007F000E007F0000007F000000FF000000FF000000FF000000FF00 0000FF000000FF000000FF0000007F0000007F0000007F8000003F8001C01F8001C00FC0 038007E0070003F01E0000FFFC00003FE0001A1B7E9A1F>99 D<00003FF80000003FF800 00003FF800000003F800000003F800000003F800000003F800000003F800000003F80000 0003F800000003F800000003F800000003F800000003F800000003F800001FE3F80000FF FBF80003F83FF80007E00FF8000FC007F8001F8003F8003F8003F8007F0003F8007F0003 F8007F0003F800FF0003F800FF0003F800FF0003F800FF0003F800FF0003F800FF0003F8 00FF0003F8007F0003F8007F0003F8007F0003F8003F8003F8001F8003F8000F8007F800 07C00FF80003F03FFF8000FFF3FF80003FC3FF80212A7EA926>I<003FE00001FFF80003 F07E0007C01F000F801F801F800F803F800FC07F000FC07F0007C07F0007E0FF0007E0FF 0007E0FFFFFFE0FFFFFFE0FF000000FF000000FF0000007F0000007F0000007F0000003F 8000E01F8000E00FC001C007E0038003F81F0000FFFE00001FF0001B1B7E9A20>I<0007 F0003FFC00FE3E01F87F03F87F03F07F07F07F07F03E07F00007F00007F00007F00007F0 0007F00007F000FFFFC0FFFFC0FFFFC007F00007F00007F00007F00007F00007F00007F0 0007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0 0007F00007F0007FFF807FFF807FFF80182A7EA915>I<00FF81F003FFE7F80FC1FE7C1F 80FC7C1F007C383F007E107F007F007F007F007F007F007F007F007F007F007F007F003F 007E001F007C001F80FC000FC1F8001FFFE00018FF800038000000380000003C0000003E 0000003FFFF8001FFFFF001FFFFF800FFFFFC007FFFFE01FFFFFF03C0007F07C0001F8F8 0000F8F80000F8F80000F8F80000F87C0001F03C0001E01F0007C00FC01F8003FFFE0000 7FF0001E287E9A22>II<07000F801FC03FE03FE03FE01FC00F80070000000000000000 00000000000000FFE0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00F E00FE00FE00FE00FE00FE00FE00FE00FE00FE0FFFEFFFEFFFE0F2B7DAA14>I108 DII<003FE00001 FFFC0003F07E000FC01F801F800FC03F800FE03F0007E07F0007F07F0007F07F0007F0FF 0007F8FF0007F8FF0007F8FF0007F8FF0007F8FF0007F8FF0007F8FF0007F87F0007F07F 0007F03F800FE03F800FE01F800FC00FC01F8007F07F0001FFFC00003FE0001D1B7E9A22 >II114 D<03FE300FFFF01E03F03800F0700070F00070F00070F80070FE0000FFE000 7FFE007FFF803FFFE01FFFF007FFF800FFF80007FC6000FCE0007CE0003CF0003CF00038 F80038FC0070FF01E0F7FFC0C1FF00161B7E9A1B>I<00700000700000700000700000F0 0000F00000F00001F00003F00003F00007F0001FFFF0FFFFF0FFFFF007F00007F00007F0 0007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F03807F0 3807F03807F03807F03807F03803F03803F87001F86000FFC0001F8015267FA51B>III<3FFFFF803F FFFF803F007F003C00FE003801FE007803FC007803F8007007F800700FF000700FE00000 1FC000003FC000007F8000007F000000FF000001FE038001FC038003F8038007F803800F F007800FE007801FE007003FC00F003F801F007F007F00FFFFFF00FFFFFF00191B7E9A1F >122 D E /Fk 7 117 df<00000300000000000300000000000300000000000780000000 000780000000000FC0000000000FC0000000000FC00000000017E00000000013E0000000 0013E00000000023F00000000021F00000000021F00000000040F80000000040F8000000 0040F800000000807C00000000807C00000001007E00000001003E00000001003E000000 02003F00000002001F00000002001F00000004000F80000004000F80000004000F800000 080007C00000080007C00000180007E000001FFFFFE000001FFFFFE00000200003F00000 200001F00000200001F00000400000F80000400000F80000400000F800008000007C0000 8000007C00018000007E00010000003E00010000003E00030000003F00030000001F0007 0000001F001F8000003F80FFE00001FFFCFFE00001FFFC2E327EB132>65 D<00FE00000303C0000C00E00010007000100038003C003C003E001C003E001E003E001E 0008001E0000001E0000001E0000001E00000FFE0000FC1E0003E01E000F801E001F001E 003E001E003C001E007C001E00F8001E04F8001E04F8001E04F8003E04F8003E0478003E 047C005E043E008F080F0307F003FC03E01E1F7D9E21>97 D<0780000000FF80000000FF 800000000F80000000078000000007800000000780000000078000000007800000000780 000000078000000007800000000780000000078000000007800000000780000000078000 0000078000000007800000000781FC00000786078000078801C000079000E00007A00070 0007C00038000780003C000780001E000780001E000780001F000780000F000780000F00 0780000F800780000F800780000F800780000F800780000F800780000F800780000F8007 80000F000780000F000780001F000780001E000780001E000780003C0007C00038000720 007000072000E000061801C00006060700000401F8000021327EB125>I<001FC00000F0 300001C00C00078002000F0002000E000F001E001F003C001F003C001F007C0004007800 0000F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8000000F800 0000780000007C0000003C0000003C0000801E0000800E0001000F0001000780020001C0 0C0000F03000001FC000191F7E9E1D>I<0783E0FF8418FF887C0F907C07A07C07A03807 C00007C00007C00007800007800007800007800007800007800007800007800007800007 80000780000780000780000780000780000780000780000780000780000FC000FFFE00FF FE00161F7E9E19>114 D<01FC100E03301800F0300070600030E00030E00010E00010E0 0010F00010F800007E00003FF0001FFF000FFFC003FFE0003FF00001F80000F880003C80 003C80001CC0001CC0001CE0001CE00018F00038F00030CC0060C301C080FE00161F7E9E 1A>I<00400000400000400000400000400000C00000C00000C00001C00001C00003C000 07C0000FC0001FFFE0FFFFE003C00003C00003C00003C00003C00003C00003C00003C000 03C00003C00003C00003C00003C00003C00003C00003C00003C01003C01003C01003C010 03C01003C01003C01003C01001C02001E02000E0400078C0001F00142C7FAB19>I E /Fl 16 123 df<3078F8787005057C840E>46 D<0000FE0100070183001C0046007000 2E00E0001E01C0001E0380000E0780000E0F00000C1E00000C1E0000043E0000043C0000 047C0000047C000000F8000000F8000000F8000000F8000000F8000000F0000000F0003F FFF00001F0F00000F0F00000F0F00000F0F80001E0780001E0780001E0380001E01C0001 E00E0003E0060004C0038008C001E07040003F800020247AA226>71 D86 D<07FC000C06001E03001E03800C01800001C0000380000380007F8003E3800F03 801C0380380700780700F00708F00708F00F08F00F08F017107867A01F83C015157D9418 >97 D<00FE000383800701C00C00E01C00E03800E07800E07000E0FFFFE0F00000F00000 F00000F00000E00000E00000F000407000803000803803000E0C0003F00013157D9416> 101 D<00780003F80000700000700000700000700000700000700000E00000E00000E000 00E00000E00000E00001C3F001CC1801D00C01E00E01E00E01C00E03C01C03801C03801C 03801C03801C03801C0700380700380700380700380700380700380E00700F0078FFE7FF 18237FA21B>104 D<006000F001F001F000E00000000000000000000000000000000001 C00FC001C001C001C001C00380038003800380038003800700070007000700070007000E 000F00FFC00C227FA10E>I<007803F800700070007000700070007000E000E000E000E0 00E000E001C001C001C001C001C001C00380038003800380038003800700070007000700 070007000E000F00FFE00D237FA20E>108 D<01C1F807E00FC60C183001D80E603801E0 07801C01E007801C01C007001C03C00F003803800E003803800E003803800E003803800E 003803800E003807001C007007001C007007001C007007001C007007001C007007001C00 700E003800E00F003C00F0FFE3FF8FFE27157F942A>I<01C3F00FCC1801D00C01E00E01 E00E01C00E03C01C03801C03801C03801C03801C03801C07003807003807003807003807 00380700380E00700F0078FFE7FF18157F941B>I<007E000383800600C00C00E01C0070 380070780078700078F00078F00078F00078F00078E000F0E000F0E000E0F001E07001C0 7003803807001C1C0007F00015157D9418>I<01C3C00FCCE001D1E001E1E001E0C001C0 0003C0000380000380000380000380000380000700000700000700000700000700000700 000E00000F0000FFF00013157F9413>114 D<01F906070C0318031801180118021C001F C00FF807FC007E000E4006400640066006600CE008D83087C010157E9413>I<00800080 0080018001000300030007000F001F00FFFC0E000E000E000E000E001C001C001C001C00 1C001C0038103810381038103810382038201C4007800E1F7C9E13>I<1C00E0FC07E01C 00E01C00E01C00E01C00E03801C03801C03801C03801C03801C03801C070038070038070 0380700380700780700B807017003827800FC7F014157B941B>I<07FFF8078038060070 0C00E00801C0080380080700100E00001C0000380000700000E00001C02003C020038020 0700600E00401C00C03801C0700380FFFF8015157F9416>122 D E /Fm 46 123 df<78FCFCFEFE7A02020202040404080810204007127B8511>44 DI<78FCFCFCFC7806067B8511>I<00100000700000F00007 F000FFF000F8F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000 F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000 F00000F00000F00000F00000F00000F00000F00000F00000F00000F00001F8007FFFE07F FFE013287BA71E>49 D<00FE0007FF800E07E01803F02001F82000F840007C40007CF800 7EFC007EFC003EFC003EFC003E78007E00007E00007C00007C0000F80000F80001F00001 E00003C0000780000700000E00001C0000380000700000600000C0000180020300020600 040C000418000410000C3FFFFC7FFFF8FFFFF8FFFFF817287DA71E>I<00001800000000 180000000018000000003C000000003C000000007E000000007E000000007E00000000BF 000000009F000000009F000000010F800000010F800000010F8000000207C000000207C0 00000207C000000403E000000403E000000C03F000000801F000000801F000001001F800 001000F800001000F8000020007C00003FFFFC00003FFFFC000040003E000040003E0000 40003E000080001F000080001F000180001F800100000F800100000F800200000FC00200 0007C007000007C01F80000FE0FFF000FFFFFFF000FFFF282A7EA92D>65 DI<0000FF 00100007FFE030001FC07830003E000C7000F80006F001F00003F003E00001F007C00000 F00F800000700F800000701F000000303F000000303E000000303E000000107E00000010 7E000000107C00000000FC00000000FC00000000FC00000000FC00000000FC00000000FC 00000000FC00000000FC00000000FC000000007C000000007E000000007E000000103E00 0000103E000000103F000000101F000000200F800000200F8000006007C000004003E000 008001F000018000F8000300003E000E00001FC038000007FFE0000000FF8000242B7DA9 2B>II70 D<0000FF00100007FFE030001FC07830003E000C7000F80006F001F00003F003E00001F0 07C00000F00F800000700F800000701F000000303F000000303E000000303E000000107E 000000107E000000107C00000000FC00000000FC00000000FC00000000FC00000000FC00 000000FC00000000FC00000000FC00000000FC0000FFFF7C0000FFFF7E000003F07E0000 01F03E000001F03E000001F03F000001F01F000001F00F800001F00F800001F007C00001 F003E00001F001F00002F000F80002F0003E000C70001FC038300007FFE0100000FF8000 282B7DA92F>I73 D<01FFFF01FFFF0003F00001F00001F00001F00001F00001F00001F00001F00001F00001 F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001 F00001F00001F00001F00001F00001F00001F00001F03001F07801F0FC01F0FC01F0FC01 E0F803E04003C02007801007000C1E0003F000182A7DA81F>I76 DI80 D82 D<00FE010003FF83000F81E3001E0037003C001F0038000F007800070070000700F00003 00F0000300F0000300F0000100F8000100F8000100FC0000007E0000007F0000003FF000 001FFE00000FFFE00007FFF80003FFFC00007FFE000007FF0000007F0000001F8000000F 80000007C0000007C0800003C0800003C0800003C0800003C0C00003C0C0000380C00003 80E0000780F0000700F8000E00EE001C00C3C07800C1FFF000803FC0001A2B7DA921>I< 7FFFFFFFF87FFFFFFFF87C007C00F870007C003860007C001840007C000840007C0008C0 007C000CC0007C000C80007C000480007C000480007C000480007C000480007C00040000 7C000000007C000000007C000000007C000000007C000000007C000000007C000000007C 000000007C000000007C000000007C000000007C000000007C000000007C000000007C00 0000007C000000007C000000007C000000007C000000007C000000007C000000007C0000 00007C000000007C00000000FE0000007FFFFC00007FFFFC0026297EA82B>I87 D<3FFFFFFC3FFFFFFC3FC000F83E0001F83C0001F0 380003E0300007E0600007C060000F8060001F8040001F0040003E0040003E0040007C00 0000FC000000F8000001F0000003F0000003E0000007C000000FC000000F8000001F0000 003F0000003E0000007C000400FC000400F8000401F0000401F0000403E0000C07E0000C 07C0000C0F8000081F8000181F0000383E0000787E0000F87C0007F8FFFFFFF8FFFFFFF8 1E297DA825>90 D<01FC00000E0780001001C0003C00E0003E00F0003E0078001C007800 08007800000078000000780000007800007FF80003E078000F8078001F0078003E007800 7C00780078007820F8007820F8007820F8007820F800F8207C00F8203C013C401F063FC0 07F80F001B1A7E991E>97 D<0F000000FF000000FF0000001F0000000F0000000F000000 0F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F000000 0F0000000F07E0000F1838000F600E000F8007000F8007800F0003C00F0003C00F0001E0 0F0001E00F0001F00F0001F00F0001F00F0001F00F0001F00F0001F00F0001F00F0001E0 0F0001E00F0003E00F0003C00F0003800F8007800E800F000E401C000C303800080FC000 1C2A7EA921>I<007F8001C0700780080F003C1E007C3C007C3C00387C0010780000F800 00F80000F80000F80000F80000F80000F80000F800007800007C00003C00043C00041E00 080F001007802001C0C0007F00161A7E991B>I<00000F000000FF000000FF0000001F00 00000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F00 00000F0000000F0000000F00003F0F0001C0CF0003802F000F001F001E001F001C000F00 3C000F007C000F0078000F0078000F00F8000F00F8000F00F8000F00F8000F00F8000F00 F8000F00F8000F0078000F0078000F003C000F003C000F001E001F000E002F0007004F80 01C18FF0007E0FF01C2A7EA921>I<007E0003C3800700E00E00F01C00703C00783C0038 78003C78003CF8003CF8003CFFFFFCF80000F80000F80000F80000F800007800007C0000 3C00043C00041E00080E001007002001C0C0007F00161A7E991B>I<001F000070C000E1 E001C3E003C3E00381C00780800780000780000780000780000780000780000780000780 00078000FFFE00FFFE000780000780000780000780000780000780000780000780000780 000780000780000780000780000780000780000780000780000780000780000780000780 0007C0007FFC007FFC00132A7FA912>I<0000078000FC18400787A1C00E01C1C01E01E0 803C00F0003C00F0007C00F8007C00F8007C00F8007C00F8007C00F8003C00F0003C00F0 001E01E0000E01C0001F87800010FC0000100000003000000030000000380000001C0000 001FFFC0000FFFF80007FFFC001C003E0030000F007000070060000380E0000380E00003 80E0000380E0000380700007007000070038000E000C0018000780F00000FF80001A287E 9A1E>I<0F000000FF000000FF0000001F0000000F0000000F0000000F0000000F000000 0F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F07F000 0F1838000F201C000F400E000F400F000F800F000F800F000F000F000F000F000F000F00 0F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F00 0F000F000F000F000F000F000F000F000F000F00FFF0FFF0FFF0FFF01C2A7EA921>I<1E 003F003F003F003F001E000000000000000000000000000000000000000F00FF00FF001F 000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F 000F000F00FFF0FFF00C297EA811>I<007800FC00FC00FC00FC00780000000000000000 00000000000000000000003C07FC07FC007C003C003C003C003C003C003C003C003C003C 003C003C003C003C003C003C003C003C003C003C003C003C003C003C003C003C003C003C 003C7038F838F870F07060C01F800E3582A812>I<07800000FF800000FF8000000F8000 000780000007800000078000000780000007800000078000000780000007800000078000 0007800000078000000780000007803FF007803FF007801F0007801C0007801800078020 000780400007808000078100000782000007870000079F800007A7800007C7C0000783E0 000781E0000781F0000780F8000780780007807C0007803E0007801E0007801F0007801F 80FFFC7FF8FFFC7FF81D2A7FA920>I<0F00FF00FF001F000F000F000F000F000F000F00 0F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F00 0F000F000F000F000F000F000F000F000F000F000F000F00FFF0FFF00C2A7EA911>I<07 81F800FC00FF860E030700FF98070C03800FA0079003C007A003D001E007C003E001E007 C003E001E0078003C001E0078003C001E0078003C001E0078003C001E0078003C001E007 8003C001E0078003C001E0078003C001E0078003C001E0078003C001E0078003C001E007 8003C001E0078003C001E0078003C001E0078003C001E0078003C001E0078003C001E0FF FC7FFE3FFFFFFC7FFE3FFF301A7F9933>I<0F07F000FF183800FF201C001F400E000F40 0F000F800F000F800F000F000F000F000F000F000F000F000F000F000F000F000F000F00 0F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F00 0F000F000F00FFF0FFF0FFF0FFF01C1A7E9921>I<007F000001C1C000070070000E0038 001C001C003C001E003C001E0078000F0078000F00F8000F80F8000F80F8000F80F8000F 80F8000F80F8000F80F8000F80F8000F8078000F0078000F003C001E003C001E001E003C 000E0038000700700001C1C000007F0000191A7E991E>I<0F07E000FF183800FF601E00 0F800F000F8007800F0007C00F0003C00F0003E00F0003E00F0001F00F0001F00F0001F0 0F0001F00F0001F00F0001F00F0001F00F0001E00F0003E00F0003E00F0003C00F000780 0F8007800F800F000F401C000F3078000F0FC0000F0000000F0000000F0000000F000000 0F0000000F0000000F0000000F0000000F0000000F000000FFF00000FFF000001C267E99 21>I<0F0F80FF11C0FF23E01F43E00F83E00F81C00F80000F00000F00000F00000F0000 0F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F0000 0F8000FFF800FFF800131A7E9917>114 D<07F8401C06C03001C06000C06000C0E00040 E00040F00040F800007E00007FF0003FFE000FFF0003FF80003FC00007C08001E08001E0 C000E0C000E0C000E0E000C0F001C0F80180C4070083F800131A7E9918>I<0080000080 000080000080000180000180000180000380000380000780000F80001FFF80FFFF800780 000780000780000780000780000780000780000780000780000780000780000780000780 0007804007804007804007804007804007804007804003C08001C08000E100003E001225 7FA417>I<0F000F00FF00FF00FF00FF001F001F000F000F000F000F000F000F000F000F 000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F 000F000F000F000F000F000F000F001F000F001F0007002F0003804F8001C08FF0007F0F F01C1A7E9921>IIIII<7FFFF87800F06001F04001E04003 C0C007C0800780800F00801F00001E00003C00007C0000780000F00001F00001E00403C0 0407C0040780040F000C1F00081E00083C00187C00387800F8FFFFF8161A7E991B>I E /Fn 26 123 df68 DI<000003FF8001800000 3FFFF003800001FFFFFC0F800007FF007F1F80001FF8000FBF80003FE00003FF8000FF80 0000FF8001FF0000007F8003FE0000003F8007FC0000003F8007FC0000001F800FF80000 001F801FF80000000F801FF00000000F803FF000000007803FF000000007807FF0000000 07807FE000000007807FE000000000007FE00000000000FFE00000000000FFE000000000 00FFE00000000000FFE00000000000FFE00000000000FFE00000000000FFE00000000000 FFE00000000000FFE00007FFFFFE7FE00007FFFFFE7FE00007FFFFFE7FE0000001FF807F F0000001FF803FF0000001FF803FF0000001FF801FF0000001FF801FF8000001FF800FF8 000001FF8007FC000001FF8007FC000001FF8003FE000001FF8001FF000001FF8000FF80 0001FF80003FE00003FF80001FF80007FF800007FF803F3F800001FFFFFE1F8000003FFF F80780000003FFC0018037317BB041>71 D77 D82 D<001FF0018000FFFF038003FFFFC78007F00FFF80 0FC001FF801F00007F803F00001F803E00000F807E00000F807E00000780FE00000780FE 00000780FE00000380FF00000380FF00000380FF80000000FFE00000007FFC0000007FFF E000007FFFFE00003FFFFFC0001FFFFFF0000FFFFFF80007FFFFFC0003FFFFFE0001FFFF FF00007FFFFF80001FFFFF800000FFFFC0000007FFC0000000FFE00000007FE00000003F E00000001FE06000001FE0E000000FE0E000000FE0E000000FE0E000000FC0F000000FC0 F000000FC0F800001F80FC00001F80FF00003F00FFC0007E00FFFC01FC00F1FFFFF800E0 3FFFE000C007FF000023317BB02E>I<007FF8000003FFFF000007FFFFC0000FE01FE000 1FF007F0001FF003F8001FF003FC001FF001FE000FE001FE0007C001FE00010001FE0000 0001FE00000001FE000001FFFE00003FFFFE0001FFF1FE0007FE01FE000FF001FE001FC0 01FE003F8001FE007F8001FE00FF0001FE00FF0001FE00FF0001FE00FF0001FE00FF0003 FE007F8003FE007FC00EFE003FF03CFF000FFFF87FF807FFF03FF800FF800FF825207E9F 28>97 D<0007FF00007FFFE000FFFFF003FC03F807F007FC0FE007FC1FE007FC3FC007FC 3FC003F87FC001F07F8000407F800000FF800000FF800000FF800000FF800000FF800000 FF800000FF800000FF8000007F8000007FC000007FC000003FC0000E3FE0000E1FE0001C 0FF0001C07F8007803FF01F000FFFFE0007FFF800007FC001F207D9F25>99 D<00000007E0000003FFE0000003FFE0000003FFE00000003FE00000001FE00000001FE0 0000001FE00000001FE00000001FE00000001FE00000001FE00000001FE00000001FE000 00001FE00000001FE00000001FE00000001FE0000FF81FE0007FFF1FE001FFFFDFE003FE 03FFE007F800FFE00FE0003FE01FE0001FE03FC0001FE03FC0001FE07F80001FE07F8000 1FE07F80001FE0FF80001FE0FF80001FE0FF80001FE0FF80001FE0FF80001FE0FF80001F E0FF80001FE0FF80001FE07F80001FE07F80001FE07F80001FE03FC0001FE03FC0001FE0 1FC0003FE00FE0007FE007F001FFE003FC07DFF001FFFF9FFF007FFE1FFF000FF01FFF28 327DB12E>I<0007FC0000003FFF800000FFFFE00003FC07F00007F801F8000FE000FC00 1FE0007E003FC0007E003FC0003F007FC0003F007F80003F007F80003F80FF80003F80FF 80003F80FFFFFFFF80FFFFFFFF80FFFFFFFF80FF80000000FF80000000FF800000007F80 0000007F800000003FC00000003FC00003801FC00003801FE00007800FF0000F0007F800 1E0003FE00FC0000FFFFF800003FFFE0000003FF000021207E9F26>I<0000FF000007FF C0001FFFE0003FC7F0007F0FF800FE0FF801FE0FF801FC0FF803FC07F003FC03E003FC01 C003FC000003FC000003FC000003FC000003FC000003FC000003FC0000FFFFFC00FFFFFC 00FFFFFC0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00 0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00 0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00 007FFFF0007FFFF0007FFFF0001D327EB119>I<001FF803E000FFFF1FF001FFFFBFF807 F81FF9F80FE007F1F80FE007F0F01FC003F8601FC003F8003FC003FC003FC003FC003FC0 03FC003FC003FC003FC003FC001FC003F8001FC003F8000FE007F0000FE007F00007F81F E00007FFFF800006FFFF00000E1FF800000E000000001E000000001E000000001F000000 001F800000001FFFFFC0000FFFFFF8000FFFFFFE0007FFFFFF0003FFFFFF8007FFFFFFC0 1FFFFFFFE03F00007FE07E00000FF0FC000007F0FC000003F0FC000003F0FC000003F0FC 000003F07E000007E03F00000FC01FC0003F800FF801FF0007FFFFFE0000FFFFF000001F FF8000252F7E9F29>I<01F800000000FFF800000000FFF800000000FFF8000000000FF8 0000000007F80000000007F80000000007F80000000007F80000000007F80000000007F8 0000000007F80000000007F80000000007F80000000007F80000000007F80000000007F8 0000000007F80000000007F807F8000007F83FFF000007F87FFF800007F8F03FC00007F9 C01FE00007FB000FE00007FE000FF00007FE000FF00007FC000FF00007FC000FF00007F8 000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8 000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8 000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8 000FF000FFFFC1FFFF80FFFFC1FFFF80FFFFC1FFFF8029327DB12E>I<01C00007F0000F F8000FF8001FFC001FFC001FFC000FF8000FF80007F00001C00000000000000000000000 000000000000000000000000000001F800FFF800FFF800FFF80007F80007F80007F80007 F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007 F80007F80007F80007F80007F80007F80007F80007F80007F80007F800FFFF80FFFF80FF FF8011337DB217>I<01F800FFF800FFF800FFF8000FF80007F80007F80007F80007F800 07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 07F80007F800FFFFC0FFFFC0FFFFC012327DB117>108 D<03F007F8000FF000FFF03FFF 007FFE00FFF07FFF80FFFF00FFF0F03FC1E07F800FF1C01FE3803FC007F3000FE6001FC0 07F6000FFC001FE007FE000FFC001FE007FC000FF8001FE007FC000FF8001FE007F8000F F0001FE007F8000FF0001FE007F8000FF0001FE007F8000FF0001FE007F8000FF0001FE0 07F8000FF0001FE007F8000FF0001FE007F8000FF0001FE007F8000FF0001FE007F8000F F0001FE007F8000FF0001FE007F8000FF0001FE007F8000FF0001FE007F8000FF0001FE0 07F8000FF0001FE007F8000FF0001FE007F8000FF0001FE007F8000FF0001FE007F8000F F0001FE0FFFFC1FFFF83FFFFFFFFC1FFFF83FFFFFFFFC1FFFF83FFFF40207D9F45>I<03 F007F80000FFF03FFF0000FFF07FFF8000FFF0F03FC0000FF1C01FE00007F3000FE00007 F6000FF00007FE000FF00007FC000FF00007FC000FF00007F8000FF00007F8000FF00007 F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007 F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007 F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF000FFFFC1FFFF80FF FFC1FFFF80FFFFC1FFFF8029207D9F2E>I<0007FE0000003FFFC00000FFFFF00003FC03 FC0007F000FE000FE0007F001FC0003F803FC0003FC03FC0003FC07F80001FE07F80001F E07F80001FE0FF80001FF0FF80001FF0FF80001FF0FF80001FF0FF80001FF0FF80001FF0 FF80001FF0FF80001FF07F80001FE07F80001FE07F80001FE03FC0003FC03FC0003FC01F E0007F800FE0007F0007F801FE0003FE07FC0001FFFFF800003FFFC0000007FE00002420 7E9F29>I<01F80FF000FFF87FFE00FFF9FFFF80FFFFE07FC00FFF001FE007FE000FF007 F80007F807F80007FC07F80003FC07F80003FE07F80003FE07F80001FE07F80001FF07F8 0001FF07F80001FF07F80001FF07F80001FF07F80001FF07F80001FF07F80001FF07F800 01FE07F80003FE07F80003FE07F80003FC07F80007FC07FC0007F807FE000FF007FF001F E007FBE07FC007F9FFFF0007F87FFE0007F81FE00007F800000007F800000007F8000000 07F800000007F800000007F800000007F800000007F800000007F800000007F800000007 F8000000FFFFC00000FFFFC00000FFFFC00000282E7E9F2E>I<03F03F00FFF07FC0FFF1 FFE0FFF1C7F00FF38FF807F70FF807F60FF807FE0FF807FC07F007FC03E007FC008007F8 000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8 000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F80000FFFF E000FFFFE000FFFFE0001D207E9F22>114 D<00FF870007FFEF001FFFFF003F007F003C 001F0078000F00F8000700F8000700F8000700FC000700FF000000FFF800007FFFC0003F FFF0003FFFFC000FFFFE0007FFFF0001FFFF80001FFF800000FFC000001FC060000FC0E0 0007C0E00007C0F00007C0F8000780F8000F80FE000F00FF803E00FFFFFC00F3FFF800C0 7FC0001A207D9F21>I<001C0000001C0000001C0000001C0000003C0000003C0000003C 0000007C0000007C000000FC000001FC000003FC000007FC00001FFC0000FFFFFF00FFFF FF00FFFFFF0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC 000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC 01C003FC01C003FC01C003FC01C003FC01C003FC01C003FC01C001FC038001FE038000FF 0700007FFE00003FFC000007F0001A2E7FAD20>I<01F80003F000FFF801FFF000FFF801 FFF000FFF801FFF0000FF8001FF00007F8000FF00007F8000FF00007F8000FF00007F800 0FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F800 0FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F8000FF00007F800 0FF00007F8000FF00007F8000FF00007F8000FF00007F8001FF00007F8001FF00003F800 3FF00003F8006FF00001FE03CFF80000FFFF8FFF80007FFF0FFF80000FFC0FFF8029207D 9F2E>II120 D<3FFFFFFC3FFFFFFC3FFFFFFC3FC00FF83E001FF0 3C003FF038003FE078007FC07800FF807001FF807001FF007003FE007007FC00000FF800 000FF800001FF000003FE000007FC00E007FC00E00FF800E01FF000E03FE000E07FE001E 07FC001E0FF8001C1FF0003C3FF0007C3FE000FC7FC007FCFFFFFFFCFFFFFFFCFFFFFFFC 1F207E9F25>122 D E /Fo 88 128 df<000060000000006000000000F000000000F000 000001F80000000178000000027C000000023C000000043E000000041E000000081F0000 00080F000000100F80000010078000002007C000002003C000004003E000004001E00000 8001F000008000F000010000F80001000078000200007C000200003C000400003E000400 001E000800001F000800000F001000000F80100000078020000007C020000003C07FFFFF FFE07FFFFFFFE0FFFFFFFFF024237EA229>1 D<001FC1F00070371800C03E3C01807C3C 0380783C0700380007003800070038000700380007003800070038000700380007003800 07003800FFFFFFC007003800070038000700380007003800070038000700380007003800 070038000700380007003800070038000700380007003800070038000700380007003800 070038000700380007003C007FE1FFC01E2380A21C>11 D<001FC0000070200000C01000 018038000380780007007800070030000700000007000000070000000700000007000000 0700000007000000FFFFF800070078000700380007003800070038000700380007003800 070038000700380007003800070038000700380007003800070038000700380007003800 070038000700380007003800070038007FE1FF80192380A21B>I<001FD8000070380000 C07800018078000380780007003800070038000700380007003800070038000700380007 0038000700380007003800FFFFF800070038000700380007003800070038000700380007 003800070038000700380007003800070038000700380007003800070038000700380007 003800070038000700380007003800070038007FF3FF80192380A21B>I<000FC07F0000 7031C08000E00B004001801E00E003803E01E007003C01E007001C00C007001C00000700 1C000007001C000007001C000007001C000007001C000007001C0000FFFFFFFFE007001C 01E007001C00E007001C00E007001C00E007001C00E007001C00E007001C00E007001C00 E007001C00E007001C00E007001C00E007001C00E007001C00E007001C00E007001C00E0 07001C00E007001C00E007001C00E007001C00E07FF1FFCFFE272380A229>I<7038F87C FC7EFC7E743A04020402040204020804080410081008201040200F0F7EA218>34 D<0780000C001840000C0018200018003010007000701C00B0006013FF6000E008006000 E00800C000E008018000E008018000E008030000E008060000E008060000E0080C000060 1018000070101800003010300000182030000018406000000780C03C000000C042000001 80C1000003018100000303808000060300800006030040000C0700400018070040001807 004000300700400060070040006007004000C00700400180030040018003008003000380 800300018100060000C1000C000042000400003C0022287DA429>37 D<003C000000006200000000C20000000181000000018100000003810000000381000000 03810000000381000000038200000003820000000384000000038800000001C800000001 D000000001E001FF8001C0007C0000E000380001E0003000017000200002700040000478 0040000838008000181C008000301C010000700E020000700F020000F007040000F00388 0000F003C80000F001F00100F000E0010078007001007800B802003C031C06000E0C070C 0003F001F00021257EA326>I<70F8FCFC7404040404080810102040060F7CA20E>I<0020 0040008001000300060004000C000C00180018003000300030007000600060006000E000 E000E000E000E000E000E000E000E000E000E000E000E000E00060006000600070003000 30003000180018000C000C0004000600030001000080004000200B327CA413>I<800040 002000100018000C000400060006000300030001800180018001C000C000C000C000E000 E000E000E000E000E000E000E000E000E000E000E000E000E000C000C000C001C0018001 800180030003000600060004000C00180010002000400080000B327DA413>I<00018000 000180000001800000018000000180000001800000018000000180000001800000018000 000180000001800000018000000180000001800000018000FFFFFFFEFFFFFFFE00018000 000180000001800000018000000180000001800000018000000180000001800000018000 0001800000018000000180000001800000018000000180001F227D9C26>43 D<70F8FCFC7404040404080810102040060F7C840E>II<70F8F8 F87005057C840E>I<000080000180000180000300000300000300000600000600000600 000C00000C00000C00001800001800001800003000003000003000006000006000006000 00C00000C00000C000018000018000018000018000030000030000030000060000060000 0600000C00000C00000C0000180000180000180000300000300000300000600000600000 600000C00000C00000C0000011317DA418>I<01F000071C000C06001803003803803803 807001C07001C07001C07001C0F001E0F001E0F001E0F001E0F001E0F001E0F001E0F001 E0F001E0F001E0F001E0F001E0F001E0F001E07001C07001C07001C07803C03803803803 801C07000C0600071C0001F00013227EA018>I<008003800F80F3800380038003800380 038003800380038003800380038003800380038003800380038003800380038003800380 0380038003800380038007C0FFFE0F217CA018>I<03F0000C1C001007002007804003C0 4003C08003E0F003E0F801E0F801E0F801E02003E00003E00003C00003C0000780000700 000E00001C0000180000300000600000C000018000010000020020040020080020180060 3000403FFFC07FFFC0FFFFC013217EA018>I<03F8000C1E00100F002007804007C07807 C07803C07807C03807C0000780000780000700000F00000C0000380003F000001C00000F 000007800007800003C00003C00003E02003E07003E0F803E0F803E0F003C04003C04007 80200780100F000C1C0003F00013227EA018>I<000300000300000700000700000F0000 170000170000270000670000470000870001870001070002070006070004070008070008 0700100700200700200700400700C00700FFFFF800070000070000070000070000070000 0700000700000F80007FF015217FA018>I<1000801E07001FFF001FFE001FF80017E000 10000010000010000010000010000010000011F800120C001C07001803801003800001C0 0001C00001E00001E00001E00001E07001E0F001E0F001E0E001C08001C04003C0400380 2007001006000C1C0003F00013227EA018>I<007E0001C1000300800601C00C03C01C03 C0180180380000380000780000700000700000F0F800F30C00F40600F40300F80380F801 C0F001C0F001E0F001E0F001E0F001E0F001E07001E07001E07001E03801C03801C01803 801C03000C0600070C0001F00013227EA018>I<4000006000007FFFE07FFFC07FFFC040 0080C0010080010080020080020000040000080000080000100000200000200000600000 400000C00000C00001C00001C00001800003800003800003800003800007800007800007 800007800007800007800007800003000013237DA118>I<01F800060E00080300100180 2001806000C06000C06000C07000C07000C07801803E01003F02001FC4000FF80003F800 01FC00067E00083F00100F803007C06003C06000E0C000E0C00060C00060C00060C00060 6000406000C03000801803000E0E0003F00013227EA018>I<01F000060C000C06001807 00380380700380700380F001C0F001C0F001C0F001E0F001E0F001E0F001E0F001E07001 E07003E03803E01805E00C05E00619E003E1E00001C00001C00001C00003800003803003 80780700780600700C002018001030000FC00013227EA018>I<70F8F8F8700000000000 00000000000070F8F8F87005157C940E>I<70F8F8F870000000000000000000000070F8 F8F87808080808101010204040051F7C940E>I61 D<07E01838201C400E800FF00FF00FF00F000F000E001C00380030006000C000C0 00800080018001000100010001000100010000000000000000000000038007C007C007C0 038010237DA217>63 D<000FE00000701C00008002000300018004000040080000200800 00201007C01020183008203008084060040440C0078441C0038481C00382838003828380 0382838003828380038283800382838003828380038281C0038241C0038240C007824060 078420300B84201831881007C0F00800000008000000040000000300000E008000780070 07C0000FFC001F237DA226>I<0001800000018000000180000003C0000003C0000003C0 000005E0000005E0000009F0000008F0000008F00000107800001078000010780000203C 0000203C0000203C0000401E0000401E0000C01F0000800F0000800F0001FFFF80010007 8001000780020003C0020003C0020003C0040001E0040001E0040001E0080000F01C0000 F03E0001F8FF800FFF20237EA225>II<0007E0100038183000E0063001C00170038000F007 0000F00E0000701E0000701C0000303C0000303C0000307C0000107800001078000010F8 000000F8000000F8000000F8000000F8000000F8000000F8000000F80000007800000078 0000107C0000103C0000103C0000101C0000201E0000200E000040070000400380008001 C0010000E0020000381C000007E0001C247DA223>IIII<0007F008003C0C1800E0021801C001B803 8000F8070000780F0000381E0000381E0000183C0000183C0000187C0000087800000878 000008F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8001FFF78 0000F8780000787C0000783C0000783C0000781E0000781E0000780F0000780700007803 8000B801C000B800E00318003C0C080007F00020247DA226>III<03FFE0001F00000F 00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F 00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00700F 00F80F00F80F00F80E00F01E00401C0020380018700007C00013237EA119>IIIII<000FE00000783C0000E0 0E0003C00780078003C00F0001E00E0000E01E0000F03C0000783C0000787C00007C7C00 007C7800003C7800003CF800003EF800003EF800003EF800003EF800003EF800003EF800 003EF800003EF800003E7800003C7C00007C7C00007C3C0000783E0000F81E0000F00F00 01E00F0001E0078003C003C0078000E00E0000783C00000FE0001F247DA226>II82 D<03F0200C0C601802603001E07000E0600060E00060E00060E00020E00020E00020F000 00F000007800007F00003FF0001FFE000FFF0003FF80003FC00007E00001E00000F00000 F0000070800070800070800070800070C00060C00060E000C0F000C0C80180C6070081FC 0014247DA21B>I<7FFFFFF87807807860078018400780084007800840078008C007800C 800780048007800480078004800780040007800000078000000780000007800000078000 000780000007800000078000000780000007800000078000000780000007800000078000 00078000000780000007800000078000000780000007800000078000000FC00001FFFE00 1E227EA123>IIII<7FF803FF000FE001F80007C000E00003E000C00001E000 800001F001800000F80100000078020000007C040000003E040000001E080000001F1000 00000FB000000007A000000007C000000003E000000001E000000001F000000003F80000 000278000000047C0000000C3E000000081E000000101F000000200F8000002007800000 4007C000008003E000008001E000010001F000030000F800070000F8001F8000FC00FFC0 03FFC022227FA125>II<7FFFFE7E003E78003C7000786000784000F0C000F0C001E08003C08003 C0800780000780000F00001F00001E00003C00003C0000780000780000F00001F00001E0 0103C00103C0010780010780030F00031E00021E00023C00063C000E78001EF8007EFFFF FE18227DA11E>II<0804100820102010 402040208040804080408040B85CFC7EFC7E7C3E381C0F0F7AA218>II<1FE000303800780C00780E003007000007000007000007 0000FF0007C7001E07003C0700780700700700F00708F00708F00708F00F087817083C23 900FC1E015157E9418>97 D<0E0000FE00001E00000E00000E00000E00000E00000E0000 0E00000E00000E00000E00000E00000E00000E1F000E61C00E80600F00300E00380E003C 0E001C0E001E0E001E0E001E0E001E0E001E0E001E0E001E0E001C0E003C0E00380F0070 0C80600C41C0083F0017237FA21B>I<01FE000703000C07801C07803803007800007000 00F00000F00000F00000F00000F00000F00000F000007000007800403800401C00800C01 0007060001F80012157E9416>I<0000E0000FE00001E00000E00000E00000E00000E000 00E00000E00000E00000E00000E00000E00000E001F8E00704E00C02E01C01E03800E078 00E07000E0F000E0F000E0F000E0F000E0F000E0F000E0F000E07000E07800E03800E018 01E00C02E0070CF001F0FE17237EA21B>I<01FC000707000C03801C01C03801C07801E0 7000E0F000E0FFFFE0F00000F00000F00000F00000F000007000007800203800201C0040 0E008007030000FC0013157F9416>I<003E0000E30001C7800387800307800700000700 00070000070000070000070000070000070000070000FFF8000700000700000700000700 000700000700000700000700000700000700000700000700000700000700000700000700 000700000700000780007FF000112380A20F>I<00007003F1980E1E181C0E1838070038 07007807807807807807807807803807003807001C0E001E1C0033F00020000020000030 00003800003FFE001FFFC00FFFE03000F0600030C00018C00018C00018C0001860003060 00303800E00E038003FE0015217F9518>I<0E0000FE00001E00000E00000E00000E0000 0E00000E00000E00000E00000E00000E00000E00000E00000E1F800E60C00E80E00F0070 0F00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E0070 0E00700E00700E00700E0070FFE7FF18237FA21B>I<1C003E003E003E001C0000000000 0000000000000000000000000E007E001E000E000E000E000E000E000E000E000E000E00 0E000E000E000E000E000E000E000E00FFC00A227FA10E>I<00E001F001F001F000E000 000000000000000000000000000000007007F000F0007000700070007000700070007000 700070007000700070007000700070007000700070007000700070007000706070F0E0F0 C061803F000C2C83A10F>I<0E0000FE00001E00000E00000E00000E00000E00000E0000 0E00000E00000E00000E00000E00000E00000E03FC0E01F00E01C00E01800E02000E0400 0E08000E10000E38000EF8000F1C000E1E000E0E000E07000E07800E03C00E01C00E01E0 0E00F00E00F8FFE3FE17237FA21A>I<0E00FE001E000E000E000E000E000E000E000E00 0E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E00 0E000E000E000E000E000E00FFE00B237FA20E>I<0E1FC07F00FE60E183801E807201C0 0F003C00E00F003C00E00E003800E00E003800E00E003800E00E003800E00E003800E00E 003800E00E003800E00E003800E00E003800E00E003800E00E003800E00E003800E00E00 3800E00E003800E00E003800E0FFE3FF8FFE27157F942A>I<0E1F80FE60C01E80E00F00 700F00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00 700E00700E00700E00700E0070FFE7FF18157F941B>I<01FC000707000C01801800C038 00E0700070700070F00078F00078F00078F00078F00078F00078F000787000707800F038 00E01C01C00E038007070001FC0015157F9418>I<0E1F00FE61C00E80600F00700E0038 0E003C0E003C0E001E0E001E0E001E0E001E0E001E0E001E0E001E0E003C0E003C0E0038 0F00700E80E00E41C00E3F000E00000E00000E00000E00000E00000E00000E00000E0000 0E0000FFE000171F7F941B>I<01F8200704600E02601C01603801E07800E07800E0F000 E0F000E0F000E0F000E0F000E0F000E0F000E07800E07800E03801E01C01E00C02E0070C E001F0E00000E00000E00000E00000E00000E00000E00000E00000E00000E0000FFE171F 7E941A>I<0E3CFE461E8F0F0F0F060F000E000E000E000E000E000E000E000E000E000E 000E000E000E000F00FFF010157F9413>I<0F8830786018C018C008C008E008F0007F00 3FE00FF001F8003C801C800C800CC00CC008E018D0308FC00E157E9413>I<0200020002 0002000600060006000E001E003E00FFFC0E000E000E000E000E000E000E000E000E000E 000E000E040E040E040E040E040E040708030801F00E1F7F9E13>I<0E0070FE07F01E00 F00E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00 700E00700E00F00E00F006017003827800FC7F18157F941B>IIIII<3FFFC0 380380300780200700600E00401C00403C0040380000700000E00001E00001C000038040 0700400F00400E00C01C0080380080780180700780FFFF8012157F9416>III<6030F078F8F8F07860300D057BA118>127 D E end %%EndProlog %%BeginSetup %%Feature: *Resolution 300dpi TeXDict begin %%EndSetup %%Page: 1 1 1 0 bop 1926 -60 a Fo(1)10 582 y Fn(Generalization)27 b(to)g(lo)r(cal)h(remappings)e(of)i(the)g(visuomotor)493 673 y(co)r(ordinate)f(transformation)140 808 y Fm(Zoubin)20 b(Ghahramani,)e(Daniel)h(M.)g(W)-5 b(olp)r(ert,)20 b(and)g(Mic)n(hael)e (I.)i(Jordan)393 883 y(Departmen)n(t)f(of)h(Brain)g(and)g(Cognitiv)n(e) f(Sciences)476 957 y(Massac)n(h)n(usetts)g(Institute)g(of)h(T)-5 b(ec)n(hnology)98 1804 y Fo(Corresp)q(ondence)21 b(concerning)f(this)g (article)g(should)h(b)q(e)g(addressed)g(to:)30 b(Zoubin)21 b(Ghahramani,)0 1864 y(Departmen)o(t)c(of)j(Computer)e(Science,)g(Univ) o(ersit)o(y)e(of)k(T)l(oron)o(to,)g(6)g(King's)e(College)h(Rd.)30 b(Pratt)19 b(271,)0 1925 y(T)l(oron)o(to,)28 b(CANAD)o(A)c(M5S)i(1A4.) 48 b(T)l(elephone)25 b(\(416\))i(978-7453,)j(F)l(ax)25 b(\(416\))i(978-1455,)j(E-mail:)0 1985 y(zoubin@cs.toron)o(to.edu)p eop %%Page: 2 2 2 1 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(2)850 94 y Fk(Abstract)0 240 y Fo(T)l(o)15 b(in)o(v)o(estigate)d(the)i(represen)o(tation)f(and)i (plasticit)o(y)d(of)i(the)g(visuomotor)g(co)q(ordinate)g (transformation)0 300 y(w)o(e)j(examined)f(the)h(c)o(hanges)h(in)f(p)q (oin)o(ting)h(b)q(eha)o(vior)g(subsequen)o(t)f(to)h(lo)q(cal)f (remappings.)25 b(The)17 b(visual)0 360 y(feedbac)o(k)h(of)h(\014nger)g (p)q(osition)g(w)o(as)g(limited)d(to)j(one)g(or)h(t)o(w)o(o)e(lo)q (cations)i(in)e(the)h(w)o(orkspace,)g(at)g(whic)o(h)0 420 y(a)j(discrepancy)f(w)o(as)h(in)o(tro)q(duced)g(b)q(et)o(w)o(een)f (the)g(proprio)q(ceptiv)o(ely-)f(and)j(visually-p)q(erceiv)o(ed)c (\014nger)0 480 y(p)q(osition.)29 b(Suc)o(h)18 b(a)h(lo)q(cal)f (remapping)f(induced)h(c)o(hanges)h(in)f(p)q(oin)o(ting)h(whic)o(h)e(w) o(ere)h(largest)h(near)f(the)0 541 y(lo)q(cus)c(of)g(remapping)f(and)h (decreased)f(a)o(w)o(a)o(y)h(from)f(it.)20 b(This)13 b(pattern)h(of)g(spatial)g(generalization)g(highly)0 601 y(constrains)k(mo)q(dels)e(of)h(ho)o(w)g(the)g(cen)o(tral)f(nerv)o (ous)h(system)f(computes)g(the)g(visuomotor)h(transforma-)0 661 y(tion.)k(Ho)o(w)o(ev)o(er,)13 b(a)j(simple)d(mo)q(del,)h(in)h (whic)o(h)g(the)g(transformation)g(is)h(computed)e(via)h(the)g(p)q (opulation)0 721 y(activit)o(y)e(of)i(a)g(set)f(of)h(units)g(with)f (large)h(sensory)g(receptiv)o(e)d(\014elds,)i(is)g(sho)o(wn)i(to)f (capture)f(the)g(observ)o(ed)0 781 y(pattern.)p eop %%Page: 3 3 3 2 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(3)350 94 y Fj(Generalization)21 b(to)i(lo)r(cal)e(remappings)i(of)g(the)402 154 y(visuomotor)g(co)r (ordinate)g(transformation)0 311 y Fo(In)17 b(order)g(to)g(reac)o(h)g (or)g(p)q(oin)o(t)g(to)g(a)h(visually)e(p)q(erceiv)o(ed)f(target,)i (the)g(cen)o(tral)f(nerv)o(ous)h(system)e(\(CNS\))0 371 y(m)o(ust)21 b(transform)h(visual)g(information)f(in)o(to)h(co)q (ordinates)h(appropriate)g(for)g(mo)o(v)o(em)o(en)n(t)d(\(Andersen)0 431 y(et)h(al.,)i(1985;)i(Flanders)d(et)g(al.,)g(1992;)k(Kalask)m(a)c (and)h(Crammond,)e(1992\).)40 b(This)21 b(visuomotor)h(co-)0 491 y(ordinate)g(transformations)g(forms)f(an)i(in)o(tegral)e(part)h (of)h(the)e(planning)i(and)f(on-line)g(execution)f(of)0 552 y(mo)o(v)o(em)o(en)o(t.)d(Both)e(exp)q(erimen)o(tally)o(-im)o(p)q (osed)e(visual)i(p)q(erturbations,)g(suc)o(h)g(as)h(those)f(resulting)g (from)0 612 y(w)o(earing)h(prism)e(glasses)i(\(for)g(a)g(review)e(see)i (W)l(elc)o(h,)d(1986\),)k(and)f(lesions)g(to)g(brain)f(areas)i(suc)o(h) e(as)h(the)0 672 y(p)q(osterior)d(parietal)f(cortex,)h(result)f(in)g (motor)g(de\014cits)g(attributable)g(to)h(inaccuracies)f(in)g (transforming)0 732 y(b)q(et)o(w)o(een)g(visual)g(and)i(motor)e(co)q (ordinate)i(systems)d(\(Andersen,)i(1987\).)22 b(The)14 b(question)f(of)i(ho)o(w)f(the)f(vi-)0 792 y(suomotor)i(co)q(ordinate)h (transformation)g(is)f(learned)f(and)i(represen)o(ted)e(remains)g(of)i (basic)f(imp)q(ortance)0 853 y(to)i(understanding)g(the)f(motor)f (system.)98 956 y(One)f(of)h(the)g(w)o(a)o(ys)f(in)h(whic)o(h)f(the)h (represen)o(tation)f(of)h(the)g(visuomotor)f(transformation)h(has)g(b)q (een)0 1016 y(prob)q(ed)j(relies)f(on)h(the)g(analysis)f(of)h(p)q(oin)o (ting)g(errors.)26 b(Using)18 b(this)f(paradigm,)h(studies)f(b)o(y)g (So)q(ec)o(h)o(ting)0 1076 y(and)d(Flanders)g(\(1989a,)i(1989b\))f(ha)o (v)o(e)e(suggested)i(that)f(the)g(visuomotor)f(transformation)h(from)f (target)0 1136 y(lo)q(cation)24 b(to)g(the)f(orien)o(tation)g(of)h(the) f(arm)g(relies)f(on)i(a)g(linear)f(appro)o(ximation)f(of)i(the)f (nonlinear)0 1196 y(function)f(that)g(relates)f(the)h(t)o(w)o(o)f(co)q (ordinate)i(systems.)36 b(Subsequen)o(t)22 b(studies,)g(also)h(based)f (on)g(the)0 1257 y(analysis)d(of)g(dep)q(endences)g(among)f(errors,)i (suggest)g(that)f(the)g(transformation)f(from)g(elev)m(ation)g(and)0 1317 y(distance)c(of)g(the)f(target)h(to)h(arm)d(elev)m(ation)i(ma)o(y) e(b)q(e)i(computed)e(separately)i(from)e(the)i(transformation)0 1377 y(from)19 b(target)i(azim)o(uth)e(to)i(arm)e(y)o(a)o(w)h(angle)h (\(Flanders)f(and)h(So)q(ec)o(h)o(ting,)g(1990\).)35 b(In)20 b(this)g(pap)q(er)h(w)o(e)0 1437 y(explore)c(the)i(represen)o (tation)e(of)i(the)f(visuomotor)g(transformation)g(through)i(a)e (di\013eren)o(t)g(paradigm,)0 1497 y(whic)o(h)13 b(analyzes)g(the)h (pattern)f(of)h(adaptation)h(arising)f(from)f(a)h(lo)q(cal)f(p)q (erturbation)h(of)g(the)g(visuomotor)0 1558 y(relationship.)23 b(This)18 b(paradigm)e(mak)o(es)g(it)g(p)q(ossible)i(to)f(address)h(t)o (w)o(o)f(questions.)24 b(First,)16 b(what)i(e\013ects)0 1618 y(do)c(remappings)f(at)h(one)f(lo)q(cation)h(in)f(space)h(ha)o(v)o (e)f(on)h(visuomotor)e(b)q(eha)o(vior)i(elsewhere.)19 b(Second,)14 b(ho)o(w)0 1678 y(do)f(these)e(patterns)i(of)f(e\013ects)g (constrain)g(computational)f(mo)q(dels)g(of)i(the)f(visuomotor)f (represen)o(tation.)98 1781 y(The)22 b(visuomotor)g(adaptation)h (paradigm)f(dates)h(bac)o(k)e(to)i(the)f(early)g(da)o(ys)g(of)h(psyc)o (hoph)o(ysics)0 1841 y(\(Helmholtz,)f(1867/1925;)30 b(Stratton,)25 b(1897a,)i(1897b\))d(and)g(has)g(b)q(een)g(pursued)f(extensiv)o(ely)e (since)0 1901 y(then)g(\(for)h(reviews)f(see)g(W)l(elc)o(h,)g(1978)i (and)f(Ho)o(w)o(ard,)f(1982\).)38 b(These)22 b(studies)f(ha)o(v)o(e)g (demonstrated)0 1962 y(the)g(remark)m(able)f(abilit)o(y)h(of)h(sub)s (jects)f(to)h(adapt,)h(at)f(least)g(partially)l(,)f(to)h(a)g(wide)g(v)m (ariet)o(y)e(of)i(alter-)0 2022 y(ations)c(in)f(the)g(relationship)g(b) q(et)o(w)o(een)f(the)h(visual)g(and)h(motor)e(system|the)g(single)g (prerequisite)g(for)0 2082 y(adaptation)i(seems)d(to)h(b)q(e)h(that)g (the)f(remapping)f(b)q(e)i(stable)f(\(Held,)f(1965;)i(Held)f(et)g(al.,) f(1966;)j(W)l(elc)o(h,)0 2142 y(1986\).)27 b(In)17 b(this)h(pap)q(er,)g (w)o(e)f(use)h(a)g(mo)q(dern-da)o(y)f(v)m(arian)o(t)g(of)h(the)g (adaptation)h(paradigm)e(that)h(allo)o(ws)0 2202 y(the)j(p)q (erturbation)i(to)f(b)q(e)g(restricted)e(to)i(a)h(single)e(pairing)h (of)g(visual)f(and)h(motor)f(feedbac)o(k,)h(while)0 2263 y(eliminating)16 b(visuomotor)i(feedbac)o(k)f(elsewhere)g(\(Bedford,)h (1989,)i(1993\).)29 b(This)19 b(paradigm)f(pro)o(vides)0 2323 y(a)g(to)q(ol)g(for)f(exploring)g(the)g(p)q(oin)o(t-b)o(y-p)q(oin) o(t)h(c)o(hanges)f(in)g(the)g(input{output)h(b)q(eha)o(vior)f(of)h(the) f(h)o(uman)0 2383 y(visuomotor)i(transformation)h(whic)o(h)f(arise)g (from)g(the)g(p)q(erturbation)h(\(the)g(in)o(tro)q(duction)f(of)h(a)g (no)o(v)o(el)0 2443 y(input-output)c(pair\).)21 b(W)l(e)14 b(compare)g(these)h(c)o(hanges)h(b)q(oth)g(to)f(the)g(predictions)f(of) i(sev)o(eral)e(qualitativ)o(e)0 2503 y(mo)q(dels)d(of)h(the)g (transformation,)g(as)h(w)o(ell)e(as)h(a)h(mathematical)c(mo)q(del)i (that)h(computes)f(the)h(visuomotor)0 2563 y(transformation)k(using)h (a)f(p)q(opulation)i(of)e(units)g(with)h(lo)q(calized)e(receptiv)o(e)f (\014elds.)98 2667 y(T)l(o)i(understand)g(the)f(nature)h(of)f(the)h(p)q (erturbation,)f(consider)h(a)f(sub)s(ject)g(mo)o(ving)f(his)h(arm)g (while)0 2727 y(w)o(earing)21 b(prisms,)f(but)h(ha)o(ving)g(the)f (visual)g(feedbac)o(k)g(of)h(his)g(arm)f(limited)d(in)k(suc)o(h)f(a)i (w)o(a)o(y)e(that)h(he)p eop %%Page: 4 4 4 3 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(4)0 94 y(receiv)o(es)16 b(concurren)o(t)i (visual)g(and)i(motor)e(information)f(only)i(at)f(a)h(single)g(p)q(oin) o(t.)28 b(Suc)o(h)18 b(a)h(lo)q(cal)g(p)q(er-)0 154 y(turbation)c (induces)f(unconscious)h(comp)q(ensatory)f(c)o(hanges)h(in)f(p)q(oin)o (ting)h(to)g(that)g(lo)q(cation)g(\(i.e.)e(adap-)0 214 y(tation\).)38 b(The)22 b(c)o(hanges)g(in)g(p)q(oin)o(ting)g(to)g (other)g(lo)q(cations)h(in)e(space,)i(the)f Fi(gener)n(alization)p Fo(,)i(are)e(not)0 274 y(constrained)c(b)o(y)g(the)f(task)h(and)h (therefore)e(re\015ect)g(in)o(trinsic)g(constrain)o(ts)h(on)g(the)g (visuomotor)f(trans-)0 334 y(formation.)j(Bedford)13 b(\(1989,)i(1993a,)g(1993b\))g(pioneered)e(suc)o(h)g(generalization)g (studies)g(b)o(y)g(examining)0 395 y(the)19 b(c)o(hanges)g(in)g(p)q (oin)o(ting)g(arising)g(from)f(one-,)i(t)o(w)o(o-)f(and)h(three-p)q (oin)o(t)f(visuomotor)f(remappings)g(in)0 455 y(the)13 b(azim)o(uth.)18 b(The)13 b(results)g(suggest)i(that)e(the)g(remapping) f(generalized)g(linearly;)g(that)i(is,)f(the)g(c)o(hange)0 515 y(in)g(p)q(oin)o(ting)h(resulting)f(from)f(the)h(p)q(erturbation)h (w)o(as)g(a)g(linear)f(function)g(of)h(azim)o(uth.)k(As)13 b(the)g(sub)s(jects)0 575 y(w)o(ere)19 b(tested)g(in)g(only)g(one)h (dimension,)e(along)i(an)g(arc)f(cen)o(tered)f(around)j(the)e(sub)s (jects')g(ey)o(es,)f(these)0 635 y(results)h(cannot)h(pro)o(vide)f(a)h (full)e(picture)h(of)g(ho)o(w)h(the)f(visuomotor)g(transformation)g(is) h(represen)o(ted.)0 696 y(Th)o(us,)i(for)f(example,)f(Bedford's)g (results)h(do)g(not)h(distinguish)f(b)q(et)o(w)o(een)f(translational,)i (rotational,)0 756 y(and)d(man)o(y)e(other)i(p)q(ossible)f(in)o (trinsic)f(constrain)o(ts)i(arising)g(from)e(the)h(neural)h(represen)o (tation)e(of)i(the)0 816 y(visuomotor)d(transformation.)98 919 y(In)j(the)h(presen)o(t)f(study)h(w)o(e)f(ha)o(v)o(e)g(sough)o(t)i (to)f(test)g(ho)o(w)g(the)f(visuomotor)g(co)q(ordinate)i(transfor-)0 979 y(mation)14 b(c)o(hanges)h(in)f(a)i(t)o(w)o(o-dimensional)d(w)o (orkspace)i(after)g(remapping)e(at)i(one)g(and)h(t)o(w)o(o)f (visuomotor)0 1039 y(pairs.)31 b(This)19 b(w)o(as)h(ac)o(hiev)o(ed)e(b) o(y)h(restricting)f(the)h(visual)g(feedbac)o(k)g(of)g(the)g(sub)s (ject's)g(\014nger,)h(as)g(rep-)0 1100 y(resen)o(ted)e(b)o(y)h(a)g (cursor)h(sp)q(ot,)g(to)g(within)e(a)i(few)f(milli)o(m)o(ete)o(rs)e(of) i(the)g(remapp)q(ed)f(p)q(oin)o(ts.)30 b(When)19 b(the)0 1160 y(sub)s(ject)d(w)o(as)i(outside)e(this)h(area)g(the)g(cursor)g(sp) q(ot)h(w)o(as)f(extinguished.)23 b(Before)16 b(and)h(after)g(this)f (exp)q(o-)0 1220 y(sure)h(phase)h(the)f(sub)s(ject's)f(pattern)h(of)h (p)q(oin)o(ting)f(to)g(targets,)h(in)f(the)g(absence)g(of)g(visual)g (feedbac)o(k)f(of)0 1280 y(the)g(\014nger,)g(w)o(as)h(assessed.)p 525 1437 900 7 v 693 1497 a(Insert)f(Figure)g(1)h(ab)q(out)g(here)p 525 1558 V 98 1715 a(W)l(e)e(consider)h(the)g(predictions)g(of)g(six)g (qualitativ)o(e)e(mo)q(dels)h(of)i(the)f(visuomotor)f(transformation)0 1775 y(regarding)e(the)f(pattern)h(of)g(generalization)f(resulting)g (from)g(a)h(p)q(erturbation)g(at)g(a)g(single)f(p)q(oin)o(t)g(\(sho)o (wn)0 1835 y(sc)o(hematically)e(in)k(Figure)f(1,)h(left)f(to)h(righ)o (t\).)20 b(The)14 b(\014rst)g(mo)q(del)e(is)i(based)g(on)g(the)f(h)o (yp)q(othesis)h(that)g(suc)o(h)0 1895 y(limited)h(exp)q(osure)j(is)f (insu\016cien)o(t)f(to)i(c)o(hange)f(the)h(visuomotor)f(relationship.) 25 b(It)17 b(therefore)g(predicts)0 1955 y(that)e(no)f(c)o(hanges)h(in) f(p)q(oin)o(ting)g(will)f(b)q(e)h(observ)o(ed)g(o)o(v)o(er)f(the)h(w)o (orkspace.)21 b(The)14 b(second)h(mo)q(del)d(assumes)0 2016 y(that)k(the)f(visuomotor)g(transformation)g(is)g(represen)o(ted)f (lo)q(cally)l(,)g(i.e.)g(that)i(with)f(eac)o(h)g(lo)q(cation)h(of)f (the)0 2076 y(visual)j(target)h(is)f(asso)q(ciated)h(a)g(single)e (motor)h(pattern)h(for)f(p)q(oin)o(ting.)28 b(In)18 b(a)g(less)g (extreme)e(form)h(this)0 2136 y(mo)q(del)e(assumes)h(that)h(the)g (represen)o(tation)f(of)h(the)f(visuomotor)g(transformation)h(is)f (highly)g(lo)q(calized)0 2196 y(\(A)o(tk)o(eson,)j(1989\),)j(with)e(a)h (resolution)f(higher)f(than)i(the)f(sampling)f(grid)h(used)g(in)g(the)f (exp)q(erimen)o(t.)0 2256 y(This)i(mo)q(del)e(predicts)i(that)g (adaptation)h(will)e(b)q(e)h(observ)o(ed)f(at)h(the)g(lo)q(cation)g(of) g(the)f(p)q(erturbation)0 2317 y(but)c(not)f(at)h(an)o(y)g(other)f(lo)q (cation)h(tested.)k(The)c(third)f(mo)q(del)f(is)h(based)h(on)g(a)g (represen)o(tation)f(in)g(whic)o(h)0 2377 y(the)f(felt)g(direction)g (of)h(gaze)g(pla)o(ys)f(a)h(primary)e(role)i(in)f(visuomotor)g (recalibration)g(\(Harris,)g(1965;)j(Ha)o(y)0 2437 y(and)k(Pic)o(k,)e (1966\).)35 b(F)l(or)20 b(example,)e(the)i(lo)q(cal)g(p)q(erturbation)h (could)f(b)q(e)g(in)o(terpreted)f(b)o(y)g(the)h(cen)o(tral)0 2497 y(nerv)o(ous)14 b(system)f(as)i(a)g(consisten)o(t)f(error)g(in)g (the)g(felt)f(direction)h(of)g(the)h(ey)o(es,)e(resulting)h(in)g(a)g (rotational)0 2557 y(pattern)20 b(of)g(generalization)f(cen)o(tered)f (ab)q(out)j(the)f(ey)o(es.)31 b(The)19 b(fourth)i(mo)q(del)d(places)i (a)g(cen)o(tral)e(role)0 2617 y(on)i(Cartesian)g(or)g(task-related)f (co)q(ordinates.)32 b(The)20 b(predicted)e(pattern)i(of)g (generalization)f(consists)0 2678 y(of)i(colinear)f(shifts)g(of)h (equal)f(magnitude)g(at)h(all)f(p)q(oin)o(ts.)34 b(Suc)o(h)20 b(a)h(pattern)g(w)o(ould)g(also)g(satisfy)f(the)0 2738 y(linearit)o(y)13 b(constrain)o(t)h(suggested)h(b)o(y)f(Bedford)g (\(1989\),)i(although)f(in)f(t)o(w)o(o)h(dimensions)e(this)h(constrain) o(t)p eop %%Page: 5 5 5 4 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(5)0 94 y(can)18 b(also)g(b)q(e)g(expressed)g (in)f(p)q(olar)i(co)q(ordinates,)g(in)e(whic)o(h)g(case)h(a)g (rotational)h(pattern)f(is)g(predicted.)0 154 y(The)e(\014fth)h(mo)q (del)e(assumes)g(a)i(semi-lo)q(cal)e(represen)o(tation)g(in)h(whic)o(h) g(the)g(p)q(erturbation)h(at)f(one)h(p)q(oin)o(t)0 214 y(induces)d(a)h(deca)o(ying)f(pattern)h(of)g(generalization.)20 b(The)15 b(spatial)g(rate)f(of)h(deca)o(y)f(of)h(this)g(generalization) 0 274 y(can)k(b)q(e)g(used)g(to)h(infer)e(the)g(e\013ectiv)o(e)f (receptiv)o(e)g(\014eld)h(size)h(in)f(a)i(net)o(w)o(ork)e(mo)q(del)g (of)h(the)f(co)q(ordinate)0 334 y(transformation.)23 b(Finally)l(,)16 b(man)o(y)f(other)i(non-linear)g(patterns)g(of)h (generalization)e(could)h(result)f(from)0 395 y(h)o(yp)q(otheses)g (based)h(on)g(adaptation)h(in)d(join)o(t-)i(or)f(m)o(uscle-based)f(co)q (ordinates.)553 582 y Fn(Materials)28 b(and)f(Metho)r(ds)0 770 y Fo(In)11 b(order)h(to)f(test)h(these)f(h)o(yp)q(otheses,)h(w)o(e) f(conducted)g(a)h(study)g(in)f(whic)o(h)f(p)q(oin)o(ting)i(errors)g(w)o (ere)e(assessed)0 830 y(prior)20 b(and)h(subsequen)o(t)e(to)h(exp)q (osure)h(to)f(a)g(lo)q(calized)f(visuomotor)h(p)q(erturbation.)33 b(The)20 b(pattern)g(of)0 890 y(p)q(oin)o(ting)e(errors)g(w)o(as)g (compared)e(to)i(the)g(predictions)f(b)q(oth)h(of)g(the)f(ab)q(o)o(v)o (e)h(qualitativ)o(e)e(mo)q(dels,)g(and)0 950 y(of)22 b(an)h(explicit)d(computational)h(mo)q(del)g(in)g(whic)o(h)g(the)h (visuomotor)g(transformation)g(is)f(computed)0 1010 y(via)h(the)f(p)q (opulation)i(activit)o(y)d(of)i(units)g(with)g(lo)q(calized)f(receptiv) o(e)e(\014elds.)38 b(W)l(e)22 b(\014rst)g(describ)q(e)f(the)0 1071 y(exp)q(erimen)o(tal)13 b(pro)q(cedures)k(b)q(efore)f(turning)h (to)f(the)g(details)g(of)g(the)g(mo)q(del.)0 1217 y Fm(Sub)s(jects)p 0 1235 222 2 v 98 1341 a Fo(40)c(righ)o(t-handed)g(undergraduate)h (studen)o(ts)f(participated)f(as)h(sub)s(jects.)20 b(Sub)s(jects)11 b(w)o(ere)g(naiv)o(e)g(to)0 1401 y(the)i(purp)q(ose)h(of)f(the)g(exp)q (erimen)o(t)d(and)k(w)o(ere)e(paid)i(for)f(participation.)20 b(All)12 b(sub)s(jects)g(had)i(self-rep)q(orted)0 1462 y(normal)h(or)i(corrected-to-normal)e(vision.)0 1608 y Fm(Apparatus)p 0 1626 275 2 v 98 1732 a Fo(In)i(order)h(to)h(measure) d(p)q(oin)o(ting)j(b)q(eha)o(vior)e(and)i(to)f(constrain)h(sub)s(jects) e(to)i(exp)q(erience)d(limited)0 1792 y(input-output)23 b(remappings)f(w)o(e)f(used)i(a)g(t)o(w)o(o-dimensional)d(virtual)i (visual)g(feedbac)o(k)f(setup.)40 b(This)0 1852 y(consisted)17 b(of)g(a)g(digitizing)e(tablet)h(to)h(record)g(the)f(\014nger)h(p)q (osition)g(on-line)f(and)i(a)f(pro)s(jection/mirror)0 1913 y(system)g(to)i(generate)g(a)g(cursor)g(sp)q(ot)h(represen)o(ting) e(the)g(\014nger)h(p)q(osition.)30 b(This)19 b(setup)f(allo)o(w)o(ed)g (pro-)0 1973 y(jection)d(of)h(the)f(virtual)g(image)f(of)i(the)f (\014nger)h(\(direct)e(vision)i(of)f(the)h(arm)e(w)o(as)i(prev)o(en)o (ted\),)e(as)i(w)o(ell)e(as)0 2033 y(targets,)19 b(in)o(to)e(the)h (plane)g(of)h(the)f(table.)26 b(The)18 b(exact)g(relation)f(b)q(et)o(w) o(een)h(the)f(cursor)i(sp)q(ot)g(and)g(\014nger)0 2093 y(p)q(osition)d(could)f(b)q(e)h(con)o(trolled)e(on-line)h(so)h(as)g(to) f(generate)h(alterations)f(in)g(the)g(visuomotor)g(transfor-)0 2153 y(mation.)22 b(F)l(urthermore,)15 b(the)i(cursor)g(sp)q(ot)h (could)f(b)q(e)g(illuminated)d(and)k(extinguished)e(so)h(as)h(to)f (allo)o(w)0 2214 y(concurren)o(t)d(visual-proprio)q(ceptiv)o(e)f (feedbac)o(k)g(in)i(restricted)e(areas)i(of)g(the)f(w)o(orkspace.)21 b(This)15 b(setup)f(is)0 2274 y(describ)q(ed)i(in)g(more)f(detail)g(b)q (elo)o(w.)p 525 2419 900 7 v 693 2479 a(Insert)h(Figure)g(2)h(ab)q(out) g(here)p 525 2539 V 98 2684 a(Sub)s(jects)d(sat)i(at)f(a)g(large)g (horizon)o(tal)g(digitizing)f(tablet)h(\(Sup)q(er)g(L)g(I)q(I)g (series,)f(GTCO,)h(MD\))g(with)0 2744 y(their)d(head)h(supp)q(orted)g (b)o(y)f(a)h(c)o(hin)f(and)h(forehead)g(rest)f(\(Figure)h(2\).)20 b(This)13 b(placed)f(the)g(sub)s(jects')g(ey)o(es)f(in)p eop %%Page: 6 6 6 5 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(6)0 94 y(a)13 b(plane)g(appro)o(ximately)d (25)k(cm)d(ab)q(o)o(v)o(e)i(the)f(digitizing)g(tablet.)19 b(The)13 b(sub)s(ject's)f(righ)o(t)h(index)f(\014nger)h(w)o(as)0 154 y(moun)o(ted)18 b(on)i(the)f(cross)h(hairs)f(of)h(a)g(digitizing)e (mouse)g(whic)o(h)h(could)g(b)q(e)h(mo)o(v)o(ed)d(along)j(the)f (surface)0 214 y(of)i(the)f(digitizing)g(tablet;)i(the)f(sub)s(ject's)e (arm)h(w)o(as)h(hidden)g(from)e(direct)h(view)g(b)o(y)g(a)h(screen.)34 b(The)0 274 y(digitizing)18 b(tablet's)g(co)q(ordinates)i(w)o(ere)e (sampled)g(as)i(\()p Fh(x;)8 b(y)r Fo(\))18 b(co)q(ordinate)h(pairs)g (at)h(185)g(Hz)e(b)o(y)h(a)g(PC;)0 334 y(the)d(accuracy)g(of)g(the)g(b) q(oard)i(w)o(as)f(0.25)g(mm.)98 437 y(The)22 b(targets)i(and)f(the)f (feedbac)o(k)g(of)h(\014nger)g(p)q(osition)h(w)o(ere)d(presen)o(ted)h (as)i(virtual)e(images)f(in)0 498 y(the)f(plane)g(of)h(the)f (digitizing)f(tablet)h(\(and)h(therefore)f(in)g(the)g(plane)g(of)h(the) f(\014nger)h(tip\).)33 b(This)21 b(w)o(as)0 558 y(ac)o(hiev)o(ed)e(b)o (y)h(pro)s(jecting)f(a)i(Video)f(Graphics)h(Arra)o(y)e(\(V)o(GA\))h (screen)g(\(640)15 b Fg(\002)e Fo(480)22 b(pixels\))d(with)i(an)0 618 y(LCD)j(pro)s(jector)g(\(Sa)o(y)o(ett)e(Media)h(Sho)o(w\))h(on)o (to)g(a)g(horizon)o(tal)f(rear)h(pro)s(jection)f(screen)f(susp)q(ended) 0 678 y(26)g(cm)d(ab)q(o)o(v)o(e)j(the)f(tablet)f(\(Figure)h(2\).)36 b(One)21 b(pixel)f(measured)g(1.2)i(x)f(1.2)g(mm)d(on)k(the)f(screen.) 35 b(A)0 738 y(horizon)o(tal)19 b(fron)o(t-re\015ecting)f(semi-silv)o (ere)o(d)e(mirror)i(w)o(as)h(placed)g(face)f(up)h(13)h(cm)d(ab)q(o)o(v) o(e)i(the)g(tablet.)0 799 y(The)14 b(sub)s(jects)g(view)o(ed)f(the)h (re\015ected)f(image)f(of)j(the)f(rear)g(pro)s(jection)f(screen)h(b)o (y)g(lo)q(oking)g(do)o(wn)h(at)f(the)0 859 y(mirror.)20 b(By)15 b(matc)o(hing)f(the)h(screen{mirror)f(distance)i(to)g(the)f (mirror{tablet)g(distance,)g(all)g(pro)s(jected)0 919 y(images)i(app)q(eared)i(to)g(b)q(e)g(in)f(the)g(plane)g(of)g(the)h (\014nger)f(when)h(view)o(ed)e(in)h(the)g(mirror.)26 b(T)l(argets)19 b(w)o(ere)0 979 y(presen)o(ted)d(as)h(9)12 b Fg(\002)f Fo(9)17 b(pixel)f(\(10.8)h(mm\))d(hollo)o(w)i(squares)h (and)h(the)e(\014nger)h(p)q(osition)g(w)o(as)h(indicated)e(b)o(y)0 1039 y(a)j(5)13 b Fg(\002)g Fo(5)19 b(pixel)f(\(6)h(mm\))d(\014lled)i (white)g(square)h(\(the)g(cursor)g(sp)q(ot\).)30 b(The)19 b(p)q(osition)h(of)f(the)f(\014nger)i(w)o(as)0 1100 y(used)c(on-line)g (to)h(up)q(date)g(the)f(p)q(osition)h(of)f(this)g(cursor)h(sp)q(ot)g (at)g(50)g(Hz.)98 1203 y(Prior)k(to)h(eac)o(h)f(exp)q(erimen)o(t,)f (the)h(relationship)g(b)q(et)o(w)o(een)g(p)q(osition)h(of)g(the)f (cross-hairs)h(of)g(the)0 1263 y(digitizing)d(mouse)g(and)i(the)f(p)q (osition)h(of)f(the)g(pro)s(jected)f(pixels)h(w)o(as)g(calibrated)g(o)o (v)o(er)f(a)i(grid)f(of)g(16)0 1323 y(p)q(oin)o(ts.)42 b(By)23 b(illumi)o(nating)e(the)i(semi-silv)o(ere)o(d)e(mirror)g(from)h (b)q(elo)o(w,)j(the)d(virtual)h(image)f(and)h(the)0 1383 y(cross-hairs)e(of)g(the)f(digitizing)g(mouse)f(could)h(b)q(e)h(lined)e (up)i(b)o(y)f(ey)o(e.)33 b(A)20 b(quadratic)g(regression)h(of)f Fh(x)0 1443 y Fo(and)d Fh(y)h Fo(pixel)d(p)q(osition)i(on)f Fh(x)g Fo(and)h Fh(y)h Fo(mouse)e(p)q(osition)h(w)o(as)f(p)q(erformed)f (and)i(this)f(w)o(as)h(used)g(on-line)f(to)0 1504 y(p)q(osition)f(the)f (targets)h(and)g(cursor)g(sp)q(ot.)22 b(The)14 b(correlation)g(of)h (the)f(\014t)h(w)o(as)g(alw)o(a)o(ys)f(greater)h(than)g(0.99.)0 1564 y(Cross-v)m(alidation)j(sets)e(ga)o(v)o(e)g(an)g(a)o(v)o(erage)g (calibration)g(error)g(of)h(1.5)f(mm.)0 1710 y Fm(Pro)r(cedure)p 0 1717 266 2 v 98 1834 a Fo(Sub)s(jects)11 b(w)o(ere)f(randomly)h (assigned)h(to)g(one)f(of)h(\014v)o(e)f(groups:)20 b(con)o(trol,)11 b Fh(x)p Fo(-shift,)h Fh(y)r Fo(-shift,)g(t)o(w)o(o-p)q(oin)o(t)0 1894 y(con)o(trol,)h(and)g(t)o(w)o(o-p)q(oin)o(t)g Fh(y)r Fo(-shift.)19 b(W)l(e)12 b(\014rst)h(describ)q(e)f(the)h(pro)q(cedure)f (for)h(the)f(one-p)q(oin)o(t)h(p)q(erturbation)0 1955 y(groups)j(\(con)o(trol,)f Fh(x)p Fo(-shift)g(and)h Fh(y)r Fo(-shift)f(groups\))h(and)g(then)f(outline)g(the)g(di\013erences)f(in) h(pro)q(cedure)h(for)0 2015 y(the)g(t)o(w)o(o-p)q(oin)o(t)g(p)q (erturbation)h(groups)h(\(t)o(w)o(o-p)q(oin)o(t)e(con)o(trol,)g(and)h (t)o(w)o(o-p)q(oin)o(t)f Fh(y)r Fo(-shift\).)98 2118 y(Eac)o(h)23 b(exp)q(erimen)o(tal)d(session)k(consisted)f(of)h(four)f (parts.)43 b(In)23 b(the)g(\014rst)h(part)f(\(familiarization)0 2178 y(phase\),)18 b(the)f(sub)s(ject)g(w)o(as)h(familiarized)d(with)i (the)g(setup)h(b)o(y)f(p)q(oin)o(ting)g(eigh)o(t)g(times)f(to)i(eac)o (h)f(of)h(nine)0 2238 y(randomly)13 b(presen)o(ted)g(targets)h(on)g(a)g (3)6 b Fg(\002)g Fo(3)15 b(grid.)20 b(P)o(oin)o(ting)13 b(mo)o(v)o(emen)n(ts)e(w)o(ere)i(made)g(under)h(full)e(visual)0 2299 y(feedbac)o(k)21 b(of)h(\014nger)g(p)q(osition,)h(as)g(represen)o (ted)d(b)o(y)h(the)h(cursor)g(sp)q(ot.)39 b(The)22 b(target)g(app)q (eared)g(and)0 2359 y(remained)15 b(illuminated)f(un)o(til)i(the)g(sub) s(ject)h(mo)o(v)o(ed)d(the)j(cursor)g(to)g(the)g(target)g(p)q(osition.) 24 b(The)17 b(target)0 2419 y(then)e(disapp)q(eared,)h(and)f(the)g (next)g(target)g(app)q(eared)h(when)f(the)g(sub)s(ject)g(had)g(mo)o(v)o (ed)e(at)j(least)f(15)h(cm)0 2479 y(a)o(w)o(a)o(y)g(from)f(the)h (previous)g(target.)98 2582 y(In)i(the)g(second)g(part)h(\(pre-exp)q (osure)f(phase\),)h(the)f(sub)s(ject's)g(p)q(oin)o(ting)g(accuracy)g(w) o(as)h(assessed)0 2642 y(in)i(the)f(absence)h(of)g(visual)g(feedbac)o (k)f(of)h(\014nger)g(p)q(osition.)36 b(The)21 b(sub)s(ject)f(w)o(as)h (instructed)g(to)g(p)q(oin)o(t)0 2703 y(as)g(accurately)e(as)h(p)q (ossible)g(to)h(visually)e(presen)o(ted)g(targets.)33 b(The)20 b(sub)s(jects)f(indicated)g(when)i(they)p eop %%Page: 7 7 7 6 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(7)0 94 y(though)o(t)12 b(their)f(\014nger)h (w)o(as)g(on)h(target)f(b)o(y)f(pressing)h(a)g(mouse)f(k)o(ey)f(with)i (their)e(left)h(hand.)21 b(Sub)s(jects)11 b(w)o(ere)0 154 y(encouraged)j(to)h(b)q(e)f(as)g(accurate)g(as)g(p)q(ossible)g(and) h(to)f(press)g(the)g(mouse)f(k)o(ey)f(only)i(when)g(they)f(though)o(t)0 214 y(their)i(\014nger)h(p)q(osition)h(matc)o(hed)c(the)j(target)g (exactly)l(.)k(The)c(target)g(then)g(disapp)q(eared,)g(and)g(the)g (next)0 274 y(target)k(app)q(eared)g(when)g(the)f(sub)s(ject)g(had)h (mo)o(v)o(ed)d(15)j(cm)e(a)o(w)o(a)o(y)h(from)f(the)i(previous)f (target.)31 b(This)0 334 y(ensured)19 b(that)h(relativ)o(e)e(direction) h(of)g(the)h(targets)g(could)f(not)h(directly)e(cue)h(the)g(sub)s (ject's)g(p)q(oin)o(ting)0 395 y(mo)o(v)o(em)o(en)o(t.)k(T)l(argets)18 b(w)o(ere)f(presen)o(ted)g(eigh)o(t)g(times)f(eac)o(h)i(in)f(a)h (pseudorandom)g(order)g(on)g(the)g(same)0 455 y(3)12 b Fg(\002)g Fo(3)18 b(grid.)25 b(The)17 b(sub)s(jects)h(receiv)o(ed)d (no)j(information)e(as)i(to)g(their)f(p)q(oin)o(ting)h(p)q(erformance.) 24 b(During)0 515 y(this)16 b(phase,)g(the)g(target)h(and)g(\014nger)f (p)q(ositions)h(w)o(ere)f(recorded)g(for)g(eac)o(h)g(trial.)98 618 y(The)j(third)g(part)g(\(exp)q(osure)h(phase\))f(of)h(the)f(exp)q (erimen)o(t)d(w)o(as)k(designed)f(to)h(pro)o(vide)e(extensiv)o(e)0 678 y(exp)q(osure)k(to)f(either)f(the)h(normal)g(\(con)o(trol)g (group\))h(or)g(an)f(altered)g(mapping)g(\()p Fh(x)p Fo(-shift)g(and)g Fh(y)r Fo(-shift)0 738 y(groups\))d(b)q(et)o(w)o(een) f(the)g(visual)g(and)h(proprio)q(ceptiv)o(e)e(systems)g(at)i(a)f (single)g(lo)q(cation)h(at)g(the)f(cen)o(ter)f(of)0 799 y(the)d(w)o(orkspace.)21 b(Sub)s(jects)13 b(w)o(ere)g(instructed)g(to)h (p)q(oin)o(t)f(to)h(a)g(cen)o(tral,)f(visually)f(presen)o(ted)h (target|the)0 859 y(training)i(p)q(oin)o(t.)21 b(The)14 b(cursor)h(sp)q(ot)h(represen)o(ting)e(their)g(\014nger)h(p)q(osition)g (w)o(as)g(only)g(illuminated)d(when)0 919 y(it)k(w)o(as)g(within)g(0.5) g(cm)e(of)j(the)e(target)i(b)q(o)o(x.)k(This)16 b(allo)o(w)o(ed)g (concurren)o(t)f(visuo-motor)h(feedbac)o(k)e(to)j(b)q(e)0 979 y(limited)c(to)k(the)f(imme)o(diate)d(vicinit)o(y)h(of)j(the)f (target.)98 1082 y(The)g(relationship)f(b)q(et)o(w)o(een)h(the)g (cursor)g(sp)q(ot)h(and)g(actual)f(\014nger)h(p)q(osition)g(w)o(as)f (altered)g(for)g(the)0 1142 y(di\013eren)o(t)i(groups.)29 b(F)l(or)18 b(the)g(con)o(trol)h(group,)g(the)f(\014nger)h(cursor)g (accurately)e(represen)o(ted)h(the)g(\014nger)0 1203 y(p)q(osition.)j(Therefore,)14 b(in)g(order)g(to)h(see)e(the)h(cursor)h (on)g(target)f(their)g(\014nger)g(had)h(also)g(to)f(b)q(e)g(on)h (target.)0 1263 y(F)l(or)20 b(the)g(other)f(t)o(w)o(o)h(groups)h(a)f (discrepancy)f(w)o(as)i(in)o(tro)q(duced)e(b)q(et)o(w)o(een)g(the)h (actual)f(and)i(p)q(erceiv)o(ed)0 1323 y(\014nger)g(p)q(osition)h (\(Figure)e(3a\).)36 b(F)l(or)21 b(the)f Fh(x)p Fo(-shift)h(group)h (the)e(sub)s(ject)h(had)g(to)g(p)q(oin)o(t)g(10)h(cm)d(to)i(the)0 1383 y(righ)o(t)f(of)h(the)f(cen)o(tral)g(target)h(in)f(order)h(to)g (see)f(the)g(cursor)h(sp)q(ot)h(on)f(target)g(\(Figure)f(3b\).)35 b(F)l(or)20 b(the)0 1443 y Fh(y)r Fo(-shift)c(group)h(the)g(sub)s (jects)f(had)h(to)f(p)q(oin)o(t)h(10)g(cm)e(to)o(w)o(ards)i(their)f(b)q (o)q(dy)h(in)f(order)h(to)f(see)g(the)h(cursor)0 1504 y(sp)q(ot)22 b(on)g(target)f(\(Figure)g(3c\).)36 b(Therefore,)21 b(in)g(these)g(t)o(w)o(o)g(groups)h(the)f(sub)s(jects)g(w)o(ere)f(exp)q (osed)i(to)0 1564 y(a)g(remapping)f(of)h(\014nger)h(to)f(visual)f(p)q (osition)i(at)f(a)h(single)e(p)q(oin)o(t.)39 b(A)21 b(10)i(cm)d(p)q (erturbation)j(in)e(the)0 1624 y Fh(x)e Fo(direction)f(corresp)q(onded) i(to)g(appro)o(ximately)d(13)p Fh(:)p Fo(1)1026 1606 y Ff(\016)1065 1624 y Fo(of)j(visual)f(angle,)g(and)h(in)f(the)g Fh(y)h Fo(direction)f(to)0 1684 y(9)p Fh(:)p Fo(5)62 1666 y Ff(\016)100 1684 y Fo(of)f(visual)g(angle.)27 b(Once)17 b(the)h(cen)o(tral)f(target)i(w)o(as)f(reac)o(hed,)g(the)f (sub)s(ject)h(had)g(to)h(main)o(tain)d(the)0 1744 y(\014nger)h(cursor)h (there)f(for)g(2)h(seconds,)f(un)o(til)f(the)h(target)h(turned)f(from)f (white)h(to)h(blue)e(and)i(one)g(of)f(the)0 1805 y(8)f(p)q(eripheral)f (targets)i(b)q(ecame)d(illuminated)f(in)i(a)i(pseudorandom)f(order.)21 b(The)16 b(sub)s(ject)f(then)g(had)i(to)0 1865 y(mo)o(v)o(e)h(to)o(w)o (ards)i(that)h(target;)h(after)d(ha)o(ving)h(mo)o(v)o(ed)e(15)j(cm)d (the)i(cen)o(tral)f(target)h(w)o(ould)g(turn)g(white)0 1925 y(and)c(the)e(cycle)f(w)o(ould)i(rep)q(eat.)21 b(The)15 b(sub)s(ject)f(p)q(oin)o(ted)h(a)h(total)f(of)g(40)h(times)d(to)i(the)g (cen)o(tral)e(target)j(for)0 1985 y(the)g(p)q(erturbation)h(groups)g (and)g(30)g(times)e(for)h(the)g(con)o(trol)g(groups.)p 525 2142 900 7 v 693 2202 a(Insert)g(Figure)g(3)h(ab)q(out)g(here)p 525 2263 V 98 2420 a(Limiting)h(the)i(area)g(of)h(the)f(cursor)g (feedbac)o(k)f(to)i(within)f(0.5)g(cm)f(of)h(the)g(target)h(ensured)f (that)0 2480 y(during)e(the)f(exp)q(osure)h(phase)g(the)g(visual)f(and) h(proprio)q(ceptiv)o(e)f(information)f(on)i(\014nger)g(p)q(osition)h (co-)0 2540 y(o)q(ccurred)f(only)h(within)f(a)h(small)e(region)h(of)h (the)f(w)o(orkspace.)28 b(Ho)o(w)o(ev)o(er,)17 b(this)h(limited)e (feedbac)o(k)h(also)0 2600 y(made)j(the)g(task)i(of)f(p)q(oin)o(ting)g (to)g(the)g(cen)o(tral)e(target)j(di\016cult.)33 b(Sub)s(jects)21 b(w)o(ere)f(w)o(arned)h(that)g(this)0 2660 y(phase)c(of)h(the)e(exp)q (erimen)o(t)e(w)o(ould)j(b)q(e)g(di\016cult)f(and)h(that)g(they)g(w)o (ould)g(ha)o(v)o(e)f(to)h(try)g(mo)o(ving)e(around)0 2721 y(to)k(\014nd)f(the)g(target.)28 b(Sub)s(jects)18 b(w)o(ere)g(not)g(informed)f(of)i(the)f(p)q(erturbation,)h(and)g(p)q (ost-exp)q(erimen)o(tal)p eop %%Page: 8 8 8 7 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(8)0 94 y(questioning)20 b(rev)o(ealed)f(that) i(sub)s(jects)f(w)o(ere)g(una)o(w)o(are)g(of)h(an)o(y)f(p)q (erturbation.)35 b(T)l(o)21 b(aid)f(the)h(sub)s(ject)0 154 y(in)c(\014nding)g(the)g(target,)g(after)g(10)h(seconds,)f(one)g (of)h(the)e(follo)o(wing)h(messages)g(w)o(ould)g(b)q(e)g(displa)o(y)o (ed)f(at)0 214 y(the)f(b)q(ottom)g(of)h(the)f(screen|\\try)g(left",)g (\\try)g(up",)h(\\try)g(righ)o(t")f(or)h(\\try)f(do)o(wn".)22 b(A)15 b(random)g(searc)o(h)0 274 y(strategy)h(suc)o(h)g(as)h (Bedford's,)e(where)h(sub)s(jects)f(w)o(ere)g(told)h(\\try)g(mo)o(ving) f(y)o(our)h(hand)h(bac)o(k)e(and)i(forth)0 334 y(slo)o(wly")i (\(Bedford,)g(1989\))h(could)f(not)h(b)q(e)f(emplo)o(y)o(ed)d(since)j (in)f(a)i(t)o(w)o(o-dimensional)d(w)o(orkspace)j(it)e(is)0 395 y(not)f(guaran)o(teed)g(to)f(lo)q(cate)h(the)f(target.)22 b(The)16 b(time)f(to)h(place)g(the)g(\014nger)h(on)g(target)g(w)o(as)f (recorded)g(as)0 455 y(a)h(measure)e(of)h(visuomotor)g(learning)g (during)g(this)g(exp)q(osure)h(phase.)98 558 y(The)12 b(\014nal)g(phase)h(\(p)q(ost-exp)q(osure)g(phase\))g(w)o(as)g(iden)o (tical)d(in)i(form)f(to)i(the)e(second)i(\(pre-exp)q(osure\))0 618 y(phase;)i(sub)s(jects')d(p)q(oin)o(ting)i(w)o(as)g(again)h (measured,)d(in)i(the)f(absence)h(of)g(cursor)g(feedbac)o(k,)e(on)i (the)g(3)6 b Fg(\002)g Fo(3)0 678 y(grid)12 b(with)f(eigh)o(t)g(rep)q (etitions)g(at)h(eac)o(h)f(p)q(oin)o(t.)20 b(The)12 b(pseudorandom)g (order)f(of)h(the)g(targets)g(w)o(as)g(c)o(hanged)0 738 y(from)j(the)h(second)h(phase.)98 841 y(F)l(or)f(the)g(con)o(trol)g (and)g Fh(x)p Fo(-shift)g(groups)i(the)e(grid)g(p)q(oin)o(ts)g(w)o(ere) g(ev)o(enly)e(spaced)j(on)f(a)h(square)f(from)0 902 y(\({10,)23 b(20\))f(to)g(\(20,)h(50\))f(cm)d(relativ)o(e)g(to)j(the)f(midp)q(oin)o (t)f(b)q(et)o(w)o(een)g(the)h(ey)o(es)f(\(Figure)h(3a\).)37 b(F)l(or)21 b(the)0 962 y Fh(y)r Fo(-shift)e(group)g(the)g(grid)g(w)o (as)g(reduced)g(ev)o(enly)e(in)h(the)h Fh(y)r Fo(-direction)f(b)o(y)g (10)i(cm)d(to)i(\({10,)i(25\))e(to)h(\(20,)0 1022 y(45\))c(cm.)j(This)d (w)o(as)g(necessary)f(b)q(ecause,)g(if)g(the)g(sub)s(ject)f(adapted)i (fully)e(to)i(the)f(10)h(cm)e(p)q(erturbation,)0 1082 y(the)i(closer)f(target)h(p)q(oin)o(ts)h(w)o(ould)f(b)q(e)g(reac)o(hed) f(with)g(mo)o(v)o(emen)n(ts)e(outside)j(the)g(recording)g(area)g(of)g (the)0 1142 y(tablet.)21 b(In)16 b(all)g(cases)g(the)g(p)q(osition)h (of)f(the)g(cen)o(tral)g(target)g(w)o(as)h(main)o(tained)d(at)j(\(5,)f (35\))h(cm.)0 1288 y Fm(Pro)r(cedures)i(for)h(the)g(t)n(w)n(o-p)r(oin)n (t)h(groups)p 0 1307 946 2 v 98 1413 a Fo(The)i(t)o(w)o(o-p)q(oin)o(t)h (p)q(erturbation)h(sub)s(jects)e(w)o(ere)g(randomly)g(assigned)h(to)h (one)f(of)g(t)o(w)o(o)f(groups:)0 1473 y(con)o(trol)13 b(and)h Fh(y)r Fo(-shift.)20 b(The)13 b(paradigm)g(w)o(as)h(iden)o (tical)e(to)h(that)h(of)g(the)f(one-p)q(oin)o(t)h(p)q(erturbation)g (groups)0 1533 y(except)g(that)i(in)f(the)g(pre-)g(and)h(p)q(ost-exp)q (osure)g(phases)g(11)g(p)q(oin)o(ts)g(w)o(ere)e(tested,)h(and)h(in)f (the)g(exp)q(osure)0 1594 y(phase)i(training)f(alternated)g(b)q(et)o(w) o(een)f(t)o(w)o(o)i(targets.)k(These)c(di\013erences)e(are)h(detailed)f (b)q(elo)o(w.)98 1697 y(In)j(the)g(pre-)h(and)g(p)q(ost-exp)q(osure)i (phases,)e(sub)s(ject's)f(p)q(oin)o(ting)h(accuracy)f(w)o(as)h (assessed)h(in)e(the)0 1757 y(absence)f(of)h(visual)f(feedbac)o(k)f(of) i(\014nger)g(p)q(osition)g(at)g(11)g(targets)g(\(Figure)f(3d\).)25 b(As)17 b(in)g(the)g(one-p)q(oin)o(t)0 1817 y(groups,)f(p)q(oin)o(ting) e(consisted)h(of)g(8)g(pseudorandom)g(rep)q(etitions)f(at)h(eac)o(h)f (target.)21 b(Nine)13 b(of)i(the)f(targets)0 1877 y(w)o(ere)h(iden)o (tical)e(in)i(lo)q(cation)h(to)g(those)f(used)h(in)f(the)g(one-p)q(oin) o(t)h(groups.)22 b(The)15 b(other)h(t)o(w)o(o)f(targets)h(w)o(ere)0 1937 y(lo)q(cated)e(to)h(the)e(left)h(and)g(the)g(righ)o(t)g(of)g(the)g (cen)o(tral)f(target)h(and)h(w)o(ere)e(used)i(as)f(training)g(p)q(oin)o (ts)h(during)0 1998 y(the)h(exp)q(osure)h(phase.)98 2101 y(The)j(w)o(orkspace)g(used)h(for)f(the)g(t)o(w)o(o-p)q(oin)o(t)h (groups)h(w)o(as)e(iden)o(tical)f(to)i(that)f(used)h(for)f(the)h(con-)0 2161 y(trol)d(and)h Fh(x)p Fo(-shift)f(one-p)q(oin)o(t)g(groups.)28 b(Based)18 b(on)h(results)f(from)f(the)h(one-p)q(oin)o(t)g(groups,)i(w) o(e)d(realized)0 2221 y(that)h(sub)s(jects)f(did)g(not)g(generally)g (adapt)h(fully)e(to)i(the)f(10)h(cm)d(p)q(erturbation,)j(and)g (therefore)f(it)g(w)o(as)0 2281 y(unnecessary)f(to)h(reduce)e(the)h(w)o (orkspace)h(as)f(w)o(as)h(done)g(for)f(the)g Fh(y)r Fo(-shift)g(one-p)q (oin)o(t)h(group.)98 2384 y(During)e(the)f(exp)q(osure)h(phase)h(of)f (this)f(exp)q(erimen)o(t,)e(t)o(w)o(o)j(training)g(lo)q(cations)g(w)o (ere)f(used:)21 b(one)15 b(on)0 2444 y(the)i(left)g(\(-2.5,)g(35.0\))h (and)g(one)g(on)g(the)f(righ)o(t)g(\(12.5,)h(35.0\))g(of)f(the)h(grid)f (cen)o(ter.)23 b(The)18 b(paradigm)f(w)o(as)0 2505 y(similar)f(to)i (the)f(one)h(p)q(oin)o(t)g(study)g(except)f(that)h(sub)s(jects)f (alternated)h(b)q(et)o(w)o(een)e(p)q(oin)o(ting)i(to)g(the)g(left)0 2565 y(and)g(righ)o(t)g(target)g(for)g(a)g(total)g(of)g(60)g(rep)q (etitions,)f(30)i(rep)q(etitions)e(at)h(eac)o(h)f(target.)26 b(F)l(or)18 b(the)f(con)o(trol)0 2625 y(group)k(the)e(cursor)h (accurately)f(represen)o(ted)g(\014nger)h(p)q(osition.)32 b(F)l(or)20 b(the)f Fh(y)r Fo(-shift)g(group)i(the)f(sub)s(ject)0 2685 y(had)f(to)f(p)q(oin)o(t)h(10)g(cm)d(to)o(w)o(ards)j(the)f(b)q(o)q (dy)h(at)g(the)e(left)h(target)g(and)h(10)g(cm)e(a)o(w)o(a)o(y)g(from)g (the)h(b)q(o)q(dy)i(at)p eop %%Page: 9 9 9 8 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)855 b(Visuomotor)15 b(Generalization)106 b Fo(9)0 94 y(the)16 b(righ)o(t)g(target)g(so)h (as)g(to)g(app)q(ear)g(on)g(target)f(\(arro)o(ws)i(in)d(Figure)h(3d\).) 98 197 y(W)l(e)g(c)o(hose)h(the)g(p)q(erturbations)h(at)g(the)e(t)o(w)o (o)h(p)q(oin)o(ts)h(to)f(b)q(e)h(of)f(opp)q(osite)h(sign)f(in)g(the)g Fh(y)i Fo(\(sagittal\))0 257 y(direction)10 b(to)i(test)f(the)g(h)o(yp) q(othesis)g(that)h(the)e(transformation)i(w)o(as)f(constrained)h(to)f (generalize)f(linearly)l(.)0 317 y(Suc)o(h)23 b(a)i(p)q(erturbation,)h (displa)o(y)o(ed)c(in)i(Figure)f(3d,)j(in)o(tro)q(duces)e(a)g (con\015ict)f(if)g(the)h(transformation)0 377 y(w)o(ere)d(to)g(b)q(e)h (in)o(terpreted)e(in)h(a)g(globally)g(linear)g(w)o(a)o(y)l(.)36 b(That)22 b(is,)g(the)f(Cartesian)h(linear)f(h)o(yp)q(othesis)0 437 y(\(Figure)e(1\))g(w)o(ould)h(predict)e(for)h(eac)o(h)g(p)q (erturbation)h(a)g(globally)f(linear)f(generalization)h(of)g(opp)q (osite)0 498 y(sign,)k(thereb)o(y)d(cancelling)g(to)i(pro)q(duce)g(no)g (generalization.)36 b(On)21 b(the)h(other)f(hand,)i(the)e(Cartesian)0 558 y(deca)o(ying)e(h)o(yp)q(othesis)g(predicts)g(that)g(the)h(t)o(w)o (o)f(p)q(erturbations)h(will)e(eac)o(h)h(generalize)f(to)i(the)f (region)0 618 y(of)f(space)g(around)g(them.)24 b(There)17 b(are)h(man)o(y)e(other)i(p)q(ossible)g(patterns)g(of)f(generalization) g(consisten)o(t)0 678 y(with)g(the)f(p)q(erturbation;)h(for)g(example,) d(a)j(coun)o(terclo)q(c)o(kwise)e(rotation)j(ab)q(out)g(the)e(cen)o (tral)g(target)h(or)0 738 y(a)g(sk)o(ew)e(transform.)0 884 y Fm(Analysis)p 0 903 220 2 v 98 1009 a Fo(T)l(o)e(study)g(the)g (e\013ect)f(of)i(initial)d(p)q(oin)o(ting)i(inaccuracies,)g(the)f (pre-exp)q(osure)i(p)q(oin)o(ting)f(errors)g(w)o(ere)0 1069 y(analyzed)j(in)h(eac)o(h)f(group)i(separately)l(.)23 b(The)17 b(mean)e(\014nger)i(p)q(osition)h(for)f(eac)o(h)f(target)i(w)o (as)f(calculated)0 1129 y(together)12 b(with)h(its)f(co)o(v)m(ariance)g (matrix.)18 b(The)12 b(mean)f(p)q(oin)o(ting)i(lo)q(cations)g(w)o(ere)e (plotted,)i(together)f(with)0 1189 y(their)k(corresp)q(onding)h (targets,)f(as)h(95\045)g(con\014dence)e(ellipses)g(cen)o(tered)g (around)i(the)f(sample)f(mean.)98 1293 y(The)h(mean)g(time)f(to)i(reac) o(h)f(the)h(target)g(o)o(v)o(er)f(batc)o(hes)h(of)g(\014v)o(e)f(trials) h(w)o(as)g(plotted)g(as)g(a)g(measure)0 1353 y(of)g(the)f(impro)o(v)o (em)o(e)o(n)o(t)d(in)j(target)h(acquisition)e(during)i(the)f(exp)q (osure)g(phase.)98 1456 y(T)l(o)d(assess)g(generalization)f(of)h(the)f (visuomotor)g(transformation,)g(the)h(sub)s(jects')e(c)o(hange)i(in)f (p)q(oin)o(t-)0 1516 y(ing)20 b(b)q(eha)o(vior)h(b)q(et)o(w)o(een)e (the)h(pre-exp)q(osure)h(and)g(p)q(ost-exp)q(osure)h(phases)f(w)o(as)g (analyzed.)33 b(F)l(or)21 b(eac)o(h)0 1576 y(sub)s(ject)h(and)h (target,)i(the)d(mean)g(c)o(hange)g(in)h(p)q(oin)o(ting)g(p)q(osition)g (b)q(et)o(w)o(een)f(the)g(pre-exp)q(osure)h(and)0 1636 y(p)q(ost-exp)q(osure)15 b(phases)f(w)o(as)g(calculated,)f(along)h (with)f(the)g(corresp)q(onding)i(co)o(v)m(ariance)e(matrices.)18 b(The)0 1697 y(sub)s(jects')13 b(data)j(w)o(as)e(com)o(bined)e(within)i (eac)o(h)g(group)h(and)g(target,)g(yielding)d(the)i(mean)g(c)o(hange)g (for)g(the)0 1757 y(group)i(and)g(the)g(co)o(v)m(ariance)f(matrix)e (for)j(eac)o(h)f(target.)21 b(Eac)o(h)16 b(v)o(ector)e(c)o(hange)i(and) g(co)o(v)m(ariance)f(matrix)0 1817 y(is)e(based)h(on)f(128)h(data)g(p)q (oin)o(ts)g(\(8)f(sub)s(jects)g Fg(\002)g Fo(8)g(rep)q(etitions)g Fg(\002)g Fo(pre-)g(and)h(p)q(ost-exp)q(osure)g(conditions\).)0 1877 y(The)g(mean)f(c)o(hange)h(in)f(p)q(oin)o(ting)h(p)q(osition)h (for)f(eac)o(h)f(target)i(w)o(as)f(plotted)g(at)g(that)h(target)f(as)g (an)h(arro)o(w,)0 1937 y(with)h(the)g(95\045)g(con\014dence)g(region)g (around)h(the)f(mean)f(sho)o(wn)i(as)f(an)h(ellipse.)i(These)d(plots)h (therefore)0 1998 y(sho)o(w)f(the)f(c)o(hange)h(in)f(the)g(p)q(oin)o (ting)g(b)q(eha)o(vior)h(subsequen)o(t)f(to)h(the)f(exp)q(osure)g (phase,)h(while)f(factoring)0 2058 y(out)20 b(an)o(y)f(consisten)o(t)h (initial)e(inaccuracies)g(in)i(p)q(oin)o(ting.)31 b(The)19 b(signi\014cance)g(of)h(the)g(o)o(v)o(erall)e(c)o(hanges)0 2118 y(in)e(p)q(oin)o(ting)h(errors)g(w)o(as)g(assessed)g(through)h (separate)f(ANO)o(V)-5 b(As)14 b(for)j(eac)o(h)f(group,)h(with)g(phase) g(\(pre-)0 2178 y(and)g(p)q(ost-exp)q(osure\))h(and)e(target)h(as)g (within-sub)s(ject)e(factors.)98 2281 y(Tw)o(o)c(represen)o(tations)g (w)o(ere)f(used)i(to)f(displa)o(y)g(the)g(data.)20 b(First,)11 b(an)h(in)o(terp)q(olated)f(v)o(ector)f(\014eld)h(w)o(as)0 2341 y(obtained)i(from)e(the)h(mean)g(c)o(hange)g(v)o(ectors)g(b)o(y)g (k)o(ernel)f(smo)q(othing)i(\(Gaussian)g(k)o(ernels)e(with)i(standard)0 2402 y(deviation)e(of)h(7.0)h(cm\).)18 b(Second,)12 b(the)g(smo)q (othed)f(v)o(ector)g(\014elds)h(w)o(ere)f(used)h(to)g(estimate)e(the)i (prop)q(ortion)0 2462 y(adaptation)h(in)e(the)g(direction)f(of)i(the)f (p)q(erturbation,)h(whic)o(h)f(w)o(ere)g(plotted)g(as)h(gra)o(yscale)f (con)o(tour)g(plots.)0 2522 y(These)20 b(con)o(tour)h(plots,)g (therefore,)f(displa)o(y)g(an)h(estimate)d(of)j(the)f(prop)q(ortion)h (adaptation)h(o)o(v)o(er)d(the)0 2582 y(w)o(orkspace.)98 2685 y(The)d(analysis)g(for)h(the)f(t)o(w)o(o-p)q(oin)o(t)h(p)q (erturbation)f(groups)i(w)o(as)f(iden)o(tical)d(to)j(that)g(p)q (erformed)e(for)p eop %%Page: 10 10 10 9 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(10)0 94 y(the)14 b(one-p)q(oin)o(t)h(groups,) g(except)e(for)i(the)f(increased)f(n)o(um)o(b)q(er)g(of)h(targets.)21 b(T)l(o)15 b(obtain)g(the)f(in)o(terp)q(olated)0 154 y(v)o(ector)j(\014elds)g(and)i(con)o(tour)f(plots,)g(the)g(Gaussian)h (k)o(ernel)d(width)i(of)g(the)g(smo)q(othing)g(algorithm)f(w)o(as)0 214 y(reduced)h(to)g(3.5)h(cm,)e(since)g(there)h(w)o(as)h(a)g(higher)f (densit)o(y)f(of)i(data)g(p)q(oin)o(ts)g(collected)e(o)o(v)o(er)g(the)h (same)0 274 y(w)o(orkspace.)j(F)l(or)16 b(the)f(t)o(w)o(o-p)q(oin)o(t)h (p)q(erturbation)g(groups)h(the)e(time)f(to)i(reac)o(h)f(the)g(target)h (w)o(as)g(batc)o(hed)0 334 y(o)o(v)o(er)f(10)i(trials.)0 480 y Fm(Computational)i(Mo)r(del)p 0 499 575 2 v 98 605 a Fo(A)11 b(simple)f(computational)h(mo)q(del)g(of)i(the)f (visuomotor)f(transformation)h(w)o(as)h(dev)o(elop)q(ed)e(in)h(whic)o (h)0 665 y(adaptation)19 b(to)g(a)g(lo)q(cal)f(p)q(erturbation)g(could) g(b)q(e)h(sim)o(ulated.)24 b(This)19 b(mo)q(del)e(is)h(used)g(to)g (examine)e(the)0 725 y(prop)q(erties)k(of)h(a)g(net)o(w)o(ork)e(of)i (sensorimotor)f(units)g(with)g(lo)q(calized)f(sensory)i(receptiv)o(e)d (\014elds.)33 b(The)0 785 y(p)q(opulation)16 b(activit)o(y)d(of)j (these)e(units)h(determines)e(the)i(motor)f(output)i(of)f(the)g(net)o (w)o(ork.)20 b(Rather)15 b(than)0 846 y(to)k(mo)q(del)d(the)i(detailed) f(neuroph)o(ysiology)i(of)f(the)g(sensorimotor)g(transformation,)g(the) g(goal)h(of)f(this)0 906 y(mo)q(deling)e(e\013ort)i(w)o(as)h(to)f (o\013er)g(a)g(simple,)d(in)o(tuitiv)o(e)g(mo)q(del)h(whic)o(h)h(can)h (capture)f(the)h(psyc)o(hoph)o(ysics)0 966 y(of)f(the)f(phenomenon.)98 1069 y(The)h(mo)q(del)f(consists)i(of)g(a)f(la)o(y)o(er)f(of)i(units,)f (organized)h(in)f(a)h(map,)e(whic)o(h)h(computes)f(the)h(trans-)0 1129 y(formation)h(from)h(Cartesian)g(co)q(ordinates)h(of)g(the)f (target,)g(denoted)h(b)o(y)e(\()p Fh(x)1440 1136 y Fe(t)1455 1129 y Fh(;)8 b(y)1501 1136 y Fe(t)1515 1129 y Fo(\))19 b(to)h(the)f(join)o(t)g(angles)0 1189 y(required)12 b(for)i(a)g(t)o(w)o (o-join)o(t)f(arm)g(to)h(reac)o(h)f(that)h(target,)g(\()p Fh(\022)1082 1196 y Fd(1)1101 1189 y Fh(;)8 b(\022)1146 1196 y Fd(2)1166 1189 y Fo(\).)20 b(Eac)o(h)14 b(unit)f Fh(i)g Fo(has)h(a)g(sensory)g(receptiv)o(e)0 1250 y(\014eld)i(in)h (Cartesian)h(space)f(with)g(cen)o(ter)e(\()p Fh(x)820 1257 y Fe(c)835 1262 y Fc(i)850 1250 y Fh(;)8 b(y)896 1257 y Fe(c)911 1262 y Fc(i)927 1250 y Fo(\))17 b(and)g(width)g Fh(\033)1225 1257 y Fe(i)1239 1250 y Fo(.)23 b(The)17 b(\014ring)h(rate)f(of)g(eac)o(h)f(unit,)h Fh(F)1923 1257 y Fe(i)1936 1250 y Fo(,)0 1310 y(falls)f(o\013)h(in)f(a)h (Gaussian)g(manner)e(with)h(distance)g(from)f(the)h(receptiv)o(e)e (\014eld)i(cen)o(ter:)530 1439 y Fh(F)562 1446 y Fe(i)589 1439 y Fg(/)e Fo(exp)o Fg(f\000)810 1406 y Fo(1)p 785 1428 74 2 v 785 1473 a(2)p Fh(\033)839 1456 y Fd(2)837 1485 y Fe(i)864 1439 y Fo([\()p Fh(x)925 1446 y Fe(t)950 1439 y Fg(\000)d Fh(x)1028 1446 y Fe(c)1043 1451 y Fc(i)1058 1439 y Fo(\))1077 1419 y Fd(2)1108 1439 y Fo(+)g(\()p Fh(y)1200 1446 y Fe(t)1225 1439 y Fg(\000)g Fh(y)1299 1446 y Fe(c)1314 1451 y Fc(i)1329 1439 y Fo(\))1348 1419 y Fd(2)1368 1439 y Fo(])p Fg(g)p Fh(:)467 b Fo(\(1\))0 1576 y(Eac)o(h)15 b(unit)g(also)h(has)g(a)g(motor)e(output,)i(represen) o(ted)e(b)o(y)h(its)g(preferred)f(join)o(t)h(con\014guration)h(\()p Fh(\022)1807 1583 y Fd(1)1825 1588 y Fc(i)1840 1576 y Fh(;)8 b(\022)1885 1583 y Fd(2)1903 1588 y Fc(i)1917 1576 y Fo(\).)0 1636 y(The)21 b(actual)h(motor)f(output)h(arises)f (from)g(the)g(p)q(opulation)h(activit)o(y)e(of)i(the)f(en)o(tire)f (map,)h(whic)o(h)g(is)0 1697 y(computed)15 b(through)i(a)g(normalized)d (w)o(eigh)o(ted)h(a)o(v)o(erage:)832 1829 y Fh(\022)855 1836 y Fd(1)889 1829 y Fo(=)945 1762 y Fb(P)989 1805 y Fe(i)1011 1795 y Fh(F)1043 1802 y Fe(i)1057 1795 y Fh(\022)1080 1802 y Fd(1)1098 1807 y Fc(i)p 945 1817 168 2 v 973 1830 a Fb(P)1017 1873 y Fe(i)1039 1863 y Fh(F)1071 1870 y Fe(i)1888 1829 y Fo(\(2\))0 1962 y(and)i(similarly)c (for)k Fh(\022)392 1969 y Fd(2)411 1962 y Fo(.)98 2065 y(Learning)j(\(or)g(adaptation\))h(tak)o(es)f(place)f(in)g(an)i(unsup)q (ervised)f(manner)e(b)o(y)i(using)g(concurren)o(t)0 2125 y(sensory)d(and)g(motor)f(inputs)h(to)g(mo)q(dify)e(the)h(preferred)g (motor)g(output)h(of)g(eac)o(h)f(unit.)22 b(By)16 b(randomly)0 2185 y(mo)o(ving)10 b(the)i(arm)f(to)h(di\013eren)o(t)f(lo)q(cations)i (and)f(observing)g(pairs)h(of)f(actual)g(join)o(t)f(co)q(ordinates)i (\(through)0 2245 y(proprio)q(ception\))j(and)g(Cartesian)g(co)q (ordinates)g(\(through)g(vision\),)f(eac)o(h)g(unit)g(mo)q(di\014es)g (its)g(preferred)0 2306 y(motor)i(output)g(in)g(the)g(direction)f(of)i (the)f(observ)o(ed)f(join)o(t)h(co)q(ordinates)h(b)o(y)f(an)g(amoun)o (t)g(prop)q(ortional)0 2366 y(to)g(its)f(\014ring)g(rate:)753 2426 y(\001)p Fh(\022)817 2433 y Fd(1)835 2438 y Fc(i)863 2426 y Fo(=)e Fh(\021)r(F)973 2433 y Fe(i)986 2426 y Fo(\()p Fh(\022)1028 2433 y Fd(1)1059 2426 y Fg(\000)d Fh(\022)1132 2433 y Fd(1)1150 2438 y Fc(i)1164 2426 y Fo(\))p Fh(:)691 b Fo(\(3\))0 2513 y(Here,)12 b(\001)p Fh(\022)190 2520 y Fd(1)208 2525 y Fc(i)236 2513 y Fo(denotes)h(the)g (c)o(hange)g(in)g(preferred)f(motor)h(output)h(of)f(unit)g Fh(i)g Fo(for)g(the)g(\014rst)h(arm)e(angle,)h(and)0 2573 y Fh(\021)18 b Fo(is)e(the)g(learning)g(rate.)21 b(A)16 b(similar)e(equation)i(describ)q(es)g(the)g(learning)g(rule)g (for)g Fh(\022)1567 2580 y Fd(2)1585 2585 y Fc(i)1600 2573 y Fo(.)21 b(W)l(e)16 b(discuss)g(the)0 2633 y(limitations)f(of)i (this)g(mo)q(del)e(and)j(its)e(relation)h(to)g(other)g(mo)q(dels)f(of)h (the)g(visuomotor)f(transformation)p eop %%Page: 11 11 11 10 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(11)0 94 y(in)16 b(the)g(Discussion.)0 240 y Fm(T)-5 b(raining)20 b(Proto)r(col)f(for)h(the)g(Mo)r(del)p 0 258 840 2 v 98 364 a Fo(W)l(e)12 b(attempted)f(to)j(repro)q(duce)e (the)h(conditions)g(of)g(the)f(psyc)o(hoph)o(ysical)g(exp)q(erimen)o (ts)e(in)j(the)f(pro-)0 424 y(to)q(col)h(for)g(training)g(and)g (testing)f(the)h(mo)q(del.)18 b(The)13 b(units)g(in)f(the)g(mo)q(del)g (w)o(ere)g(initialized)e(with)i(random)0 484 y(preferred)k(motor)g (outputs)h(\(sampled)f(uniformly)e(from)i(the)g(join)o(t)h(angles)g(co) o(v)o(ering)e(the)h(w)o(orkspace\).)0 545 y(T)l(o)e(accoun)o(t)f(for)g (the)g(fact)g(that)h(sub)s(jects)f(start)h(the)f(exp)q(erimen)o(t)d (with)j(a)h(roughly)f(unp)q(erturb)q(ed)h(visuo-)0 605 y(motor)h(map,)g(the)h(mo)q(del)f(w)o(as)i(trained)e(with)h(1000)i (pairs)e(of)h(unp)q(erturb)q(ed)f(inputs)h(using)f(equation)g(3.)0 665 y(This)e(represen)o(ts)e(the)i(normal)e(visuomotor)h(exp)q(erience) f(with)h(whic)o(h)g(sub)s(jects)g(en)o(ter)g(the)g(exp)q(erimen)o(t.)98 768 y(The)19 b(pre-exp)q(osure)g(p)q(oin)o(ting)g(errors)h(w)o(as)f (assessed)h(in)f(the)g(mo)q(del)f(b)o(y)g(stim)o(ulating)g(the)g (visual)0 828 y(arra)o(y)h(at)h(eac)o(h)f(of)g(the)g(9)h(\(11,)g(for)g (the)f(t)o(w)o(o-p)q(oin)o(t)g(exp)q(erimen)o(t\))d(target)k(lo)q (cations,)g(and)g(computing)0 889 y(the)15 b(p)q(opulation)h(motor)f (activit)o(y)f(using)i(equation)f(2,)g(obtaining)h(join)o(t)f(angles)h (\()p Fh(\022)1542 896 y Fd(1)1561 889 y Fh(;)8 b(\022)1606 896 y Fd(2)1625 889 y Fo(\).)21 b(These)16 b(angles)0 949 y(w)o(ere)j(con)o(v)o(erted)f(in)o(to)h(Cartesian)h(co)q(ordinates) h(of)f(the)f(hand)i(using)f(the)f(kinematic)e(equations)j(of)g(a)0 1009 y(t)o(w)o(o-join)o(t)c(planar)h(arm,)659 1069 y Fh(x)c Fo(=)h Fh(l)767 1076 y Fd(1)795 1069 y Fo(cos\()p Fh(\022)902 1076 y Fd(1)921 1069 y Fo(\))d(+)g Fh(l)1015 1076 y Fd(2)1043 1069 y Fo(cos\()p Fh(\022)1150 1076 y Fd(1)1181 1069 y Fo(+)g Fh(\022)1253 1076 y Fd(2)1272 1069 y Fo(\))659 1150 y Fh(y)k Fo(=)f Fh(l)765 1157 y Fd(1)792 1150 y Fo(sin\()p Fh(\022)894 1157 y Fd(1)914 1150 y Fo(\))d(+)g Fh(l)1008 1157 y Fd(2)1035 1150 y Fo(sin\()p Fh(\022)1137 1157 y Fd(1)1168 1150 y Fo(+)g Fh(\022)1240 1157 y Fd(2)1259 1150 y Fo(\))p Fh(:)0 1231 y Fo(The)21 b(pre-exp)q(osure)f(p)q(oin)o(ting)h(errors)g(w)o(ere)f (then)g(computed)g(b)o(y)g(subtracting)h(the)f(Cartesian)h(hand)0 1291 y(p)q(osition)c(from)e(the)h(target)h(p)q(osition.)22 b(The)16 b(parameters)f(for)i(the)f(mo)q(del)f(are)h(sho)o(wn)h(in)f(T) l(able)g(1.)p 525 1431 900 7 v 703 1491 a(Insert)g(T)l(able)g(1)h(ab)q (out)g(here)p 525 1552 V 98 1692 a(Exp)q(osure)g(to)g(the)g(p)q (erturbation)h(w)o(as)f(sim)o(ulated)e(b)o(y)h(sim)o(ultaneously)f (presen)o(ting)h(the)h(net)o(w)o(ork)0 1752 y(with)j(the)h(target)g(in) f(Cartesian)h(co)q(ordinates)g(and)h(the)e(p)q(erturb)q(ed)h(join)o(t)f (angles)h(corresp)q(onding)h(to)0 1812 y(the)17 b(target.)23 b(The)17 b(magnitude)f(of)h(the)g(p)q(erturbations)g(and)h(the)e(n)o (um)o(b)q(er)g(of)h(exp)q(osures)g(\(applications)0 1872 y(of)j(equation)g(3\))g(used)g(in)f(the)g(sim)o(ulations)f(w)o(ere)h (equal)g(to)i(those)f(used)f(in)h(the)f(three)g(p)q(erturbation)0 1932 y(groups.)j(P)o(ost-exp)q(osure)15 b(p)q(oin)o(ting)f(w)o(as)h (assessed)g(in)e(a)i(manner)e(iden)o(tical)f(to)j(pre-exp)q(osure)f(p)q (oin)o(ting.)0 1993 y(F)l(rom)d(the)h(pre-)g(and)h(p)q(ost-exp)q(osure) h(p)q(oin)o(ting,)f(a)g(v)o(ector)e(\014eld)h(of)h(c)o(hanges)f(in)g(p) q(oin)o(ting)h(w)o(as)f(computed)0 2053 y(and)17 b(the)f(pattern)g(of)h (generalization)e(in)h(the)g(mo)q(del)f(w)o(as)i(compared)e(to)i(that)g (observ)o(ed)e(in)h(h)o(umans.)586 2236 y Fn(Exp)r(erimen)n(tal)26 b(Results)0 2462 y Fm(Pre-exp)r(osure)18 b(errors)p 0 2480 511 2 v 525 2623 900 7 v 693 2684 a Fo(Insert)e(Figure)g(4)h(ab)q (out)g(here)p 525 2744 V eop %%Page: 12 12 12 11 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(12)98 94 y(Sub)s(jects)15 b(sho)o(w)o(ed)g(a) h(consisten)o(t)g(pattern)f(of)h(p)q(oin)o(ting)g(errors)g(in)f(the)h (pre-exp)q(osure)f(phase.)22 b(The)0 154 y(pattern)17 b(of)g(inaccuracies)f(in)g(initial)f(p)q(oin)o(ting)i(w)o(as)h(similar) c(b)q(et)o(w)o(een)i(groups)i(and)f(generally)f(sho)o(w)o(ed)0 214 y(a)i(bias)g(a)o(w)o(a)o(y)g(and)g(to)g(the)g(left)e(of)j(the)e (targets)h(\(Figure)g(4\).)26 b(In)17 b(particular,)h(p)q(oin)o(ting)f (at)i(the)e(cen)o(tral)0 274 y(training)d(p)q(oin)o(t)g(w)o(as)g (biased)g(a)o(w)o(a)o(y)f(\(in)h(the)g(p)q(ositiv)o(e)f Fh(y)i Fo(direction\))e(and)h(to)g(the)g(left)f(for)h(all)f(\014v)o(e)g (groups;)0 334 y(the)k(bias)h(a)o(w)o(a)o(y)g(w)o(as)g(generally)f (larger)g(for)h(the)g(three)f(targets)h(on)g(the)g(righ)o(t,)f(and)h (the)g(left)o(w)o(ard)f(bias)0 395 y(w)o(as)g(generally)e(larger)h(for) h(the)f(targets)h(on)f(the)g(left.)0 541 y Fm(Learning)k(during)h(the)e (exp)r(osure)g(phase)p 0 559 939 2 v 525 718 900 7 v 693 778 a Fo(Insert)d(Figure)g(5)h(ab)q(out)g(here)p 525 838 V 98 994 a(Due)f(to)h(the)g(limited)c(visual)k(feedbac)o(k,)e (the)h(target)h(w)o(as)g(di\016cult)f(to)h(\014nd)g(during)f(the)h(exp) q(osure)0 1054 y(phase.)35 b(F)l(or)21 b(all)f(three)g(p)q(erturbation) h(groups,)i(the)d(target)h(initially)e(to)q(ok)i(longer)g(to)g(acquire) e(than)0 1114 y(in)f(their)f(resp)q(ectiv)o(e)g(con)o(trols)h(\(Figure) f(5\).)27 b(Ov)o(er)17 b(the)h(course)h(of)f(the)g(exp)q(osure)g (phase,)h(the)f(time)e(to)0 1174 y(acquire)f(the)h(targets)h(dropp)q (ed)g(to)g(lev)o(els)d(not)j(signi\014can)o(tly)e(di\013eren)o(t)h (from)f(the)h(con)o(trols.)0 1320 y Fm(Generalization)p 0 1327 380 2 v 0 1515 a Fa(Con)n(trol)j(groups)0 1650 y Fo(The)g(pattern)h(of)g(generalization)f(for)g(the)h(con)o(trols)f (is)g(sho)o(wn)h(in)f(Figure)g(6.)32 b(The)19 b(\014gure)h(represen)o (ts)0 1710 y(the)f(c)o(hange)g(in)g(p)q(oin)o(ting)g(b)q(et)o(w)o(een)g (pre-)g(and)h(p)q(ost-exp)q(osure)g(phases)g(plotted)f(as)h(v)o(ectors) f(cen)o(tered)0 1770 y(at)i(eac)o(h)e(target.)34 b(F)l(or)20 b(example,)e(a)j(1)f(cm)f(left)o(w)o(ard-p)q(oin)o(ting)h(arro)o(w)g(w) o(ould)h(signify)e(that)i(sub)s(jects')0 1830 y(p)q(oin)o(ting)h(to)g (that)g(target)g(c)o(hanged)g(b)o(y)f(1)h(cm)f(to)h(the)f(left)g(b)q (et)o(w)o(een)g(the)g(pre-)h(and)g(p)q(ost-exp)q(osure)0 1891 y(sessions.)g(The)15 b(ellipses)f(cen)o(tered)f(at)j(the)f(arro)o (w)h(tip)f(are)g(95\045)h(con\014dence)f(ellipses)f(for)h(the)g(c)o (hange)g(in)0 1951 y(the)g(sample)f(mean.)20 b(The)c(p)q(er)g(target)f (ANO)o(V)-5 b(As)14 b(rev)o(eal)g(that)i(none)g(of)g(these)f(c)o (hanges)h(are)f(signi\014can)o(t)0 2011 y(at)i(the)g Fh(\013)e Fo(=)f(0)p Fh(:)p Fo(05)k(lev)o(el.)j(The)16 b(in)o(terp)q(olated)h(v)o(ector)f(\014eld)g(of)h(c)o(hanges)g(sho)o (ws)g(a)h(small)d(trend)h(to)o(w)o(ards)0 2071 y(the)g(left)f(for)h (the)g(one-p)q(oin)o(t)h(con)o(trol)f(\(Figure)f(6b\),)h(whic)o(h)g(is) g(not)g(presen)o(t)g(for)g(the)g(t)o(w)o(o-p)q(oin)o(t)g(con)o(trol)0 2131 y(\(Figure)g(6d\).)p 525 2287 900 7 v 693 2347 a(Insert)g(Figure)g (6)h(ab)q(out)g(here)p 525 2407 V 98 2563 a(The)12 b(ANO)o(V)-5 b(A)10 b(\(summarized)g(in)i(T)l(able)h(2\))g(sho)o(ws)h(no)f (signi\014can)o(t)f(main)g(a\013ect)h(of)g(phase)g(for)g(the)f Fh(x)0 2623 y Fo(or)k Fh(y)i Fo(directions.)i(The)c(main)f(e\013ect)g (of)h(phase)h(indicates)e(the)h(global)g(comp)q(onen)o(t)f(of)h(c)o (hange)g(b)q(et)o(w)o(een)0 2684 y(the)21 b(pre-)g(and)g(p)q(ost-exp)q (osure)i(phases.)36 b(Therefore,)22 b(the)e(con)o(trol)h(sub)s(jects,)g (as)h(exp)q(ected,)f(did)g(not)0 2744 y(c)o(hange)16 b(their)g(p)q(oin)o(ting)g(b)q(eha)o(vior)g(in)g(either)f(the)h Fh(x)g Fo(or)h(the)f Fh(y)i Fo(direction.)p eop %%Page: 13 13 13 12 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(13)p 525 94 900 7 v 703 154 a(Insert)16 b(T)l(able)g(2)h(ab)q(out)g(here)p 525 214 V 0 385 a Fa(P)n(erturbation)i(groups)0 520 y Fo(W)l(e)13 b(no)o(w)g(consider)f(the)h(e\013ect)f(of)h(in)o(tro)q(ducing)g(a)g (remapping)f(at)h(one)g(input-output)g(pair.)20 b(The)13 b(general)0 581 y(e\013ect)18 b(of)h(in)o(tro)q(ducing)g(suc)o(h)f(a)h (p)q(erturbation)h(w)o(as)f(to)g(induce)f(signi\014can)o(t)g(c)o (hanges)h(in)f(the)h(p)q(oin)o(ting)0 641 y(b)q(eha)o(vior)e(not)g (only)f(at)h(the)g(remapp)q(ed)f(p)q(oin)o(t)g(but)h(at)g(neigh)o(b)q (oring)g(p)q(oin)o(ts)g(as)h(w)o(ell.)j(The)c(pattern)g(of)0 701 y(generalization)h(for)h(the)f Fh(x)p Fo(-shift)h(group)g(is)g(sho) o(wn)g(in)f(Figure)h(7a;)h(the)e(c)o(hange)h(in)f(p)q(oin)o(ting)h(b)q (et)o(w)o(een)0 761 y(the)d(pre-)h(and)g(p)q(ost-exp)q(osure)i(phases)e (w)o(as)g(signi\014can)o(t)f(at)i(6)f(out)g(of)g(the)f(9)h(targets)g (\(left)f(and)h(middle)0 821 y(columns)g(of)i(targets\))g(in)f(the)g Fh(x)g Fo(direction)g(and)h(at)f(1)h(out)g(of)g(9)g(targets)g(\(top)f (righ)o(t)g(target\))h(in)f(the)g Fh(y)0 882 y Fo(direction.)i(The)c (shift)f(w)o(as)h(greatest)g(at)g(the)g(training)g(p)q(oin)o(t)f(\(4.9) h(cm\))e(and)j(decreased)e(in)g(magnitude)0 942 y(a)o(w)o(a)o(y)22 b(from)e(this)i(p)q(oin)o(t.)38 b(The)22 b(o)o(v)o(erall)f(ANO)o(V)-5 b(A)19 b(\(summarized)g(in)i(T)l(able)h(2\))g(sho)o(ws)h(a)f (signi\014can)o(t)0 1002 y(main)e(e\013ect)h(of)h(phase)g(for)f(the)h Fh(x)f Fo(direction)f(indicating)h(a)h(global)g(c)o(hange)f(b)q(et)o(w) o(een)g(the)g(pre-)g(and)0 1062 y(p)q(ost-exp)q(osure)d(phases.)98 1165 y(The)12 b(in)o(terp)q(olated)f(v)o(ector)g(\014eld)h(of)g(c)o (hanges)h(for)f(the)g Fh(x)p Fo(-shift)g(group)h(\(Figure)f(7d\))g(sho) o(ws)h(a)g(pattern)0 1225 y(of)23 b(deca)o(ying)g(righ)o(t)o(w)o(ard)f (c)o(hanges)h(with)g(a)h(do)o(wn)o(w)o(ard)f Fh(y)i Fo(trend)e(further) f(from)g(the)h(sub)s(ject.)41 b(The)0 1286 y(prop)q(ortion)19 b(adaptation)f(in)f(the)g(direction)f(of)i(the)f(p)q(erturbation)h (computed)e(from)g(the)h(v)o(ector)f(\014elds)0 1346 y(is)21 b(depicted)g(in)g(Figure)g(7g)i(as)f(a)g(gra)o(yscale)f(con)o (tour)h(plot.)37 b(This)22 b(sho)o(ws)h(the)e(pattern)h(of)g(greatest)0 1406 y(c)o(hange)16 b(o)q(ccurs)h(at)g(the)f(training)g(p)q(oin)o(t)g (and)h(deca)o(ys)f(with)g(distance)g(a)o(w)o(a)o(y)g(from)f(it.)p 525 1550 V 693 1611 a(Insert)h(Figure)g(7)h(ab)q(out)g(here)p 525 1671 V 98 1815 a(The)g(pattern)h(of)g(generalization)f(for)h(the)g Fh(y)r Fo(-shift)f(group)i(is)e(sho)o(wn)i(in)e(Figure)g(7b.)26 b(The)18 b(c)o(hange)0 1876 y(in)f(p)q(oin)o(ting)g(b)q(et)o(w)o(een)f (the)h(pre-)g(and)h(p)q(ost-exp)q(osure)g(phases)g(w)o(as)f (signi\014can)o(t)g(at)h(1)f(out)h(of)f(9)g(targets)0 1936 y(\(target)f(8\))g(in)f(the)g Fh(x)g Fo(direction)g(and)h(at)g(3)g (out)g(of)f(9)h(targets)g(\(targets)h(1,)e(2)h(and)g(5\))g(in)f(the)g Fh(y)i Fo(direction.)0 1996 y(As)e(in)f(the)h Fh(x)p Fo(-shift)g(group,)h(the)e(shift)h(w)o(as)g(again)h(greatest)f(at)h (the)e(training)h(p)q(oin)o(t)h(\(2.2)f(cm\).)k(Changes)0 2056 y(w)o(ere)10 b(most)h(pronounced)g(at)h(the)e(t)o(w)o(o)h(ro)o(ws) h(closest)f(to)g(the)g(sub)s(ject;)h(there)e(w)o(ere)g(no)i (signi\014can)o(t)f(c)o(hanges)0 2116 y(in)19 b(the)h(ro)o(w)g(of)g (targets)g(furthest)f(from)g(the)g(sub)s(ject.)31 b(The)20 b(o)o(v)o(erall)e(ANO)o(V)-5 b(A)17 b(indicates)i(that)h(the)f Fh(y)0 2176 y Fo(direction)c(of)i(c)o(hange)f(in)g(the)g Fh(y)i Fo(shift)e(group)h(w)o(as)g(marginally)d(signi\014can)o(t)i(\()p Fh(F)1470 2183 y Fd(1)p Fe(;)p Fd(7)1531 2176 y Fo(=)d(3)p Fh(:)p Fo(75)p Fh(;)8 b(p)15 b Fo(=)f(0)p Fh(:)p Fo(09\).)98 2280 y(The)f(in)o(terp)q(olated)g(v)o(ector)f(\014eld)h(of)g(c)o (hanges)h(for)f(the)h Fh(y)r Fo(-shift)e(group)j(is)e(sho)o(wn)h(in)f (Figure)g(7e.)20 b(This)0 2340 y(highligh)o(ts)15 b(the)g(pattern)h(of) g(do)o(wn)o(w)o(ard)g(\(i.e.)d(to)o(w)o(ards)j(the)g(b)q(o)q(dy\))g(c)o (hanges)g(deca)o(ying)f(a)o(w)o(a)o(y)g(from)f(the)0 2400 y(training)d(p)q(oin)o(t.)20 b(The)11 b(prop)q(ortion)h (adaptation)g(con)o(tour)g(plot)f(\(Figure)f(7h\))i(again)g(highligh)o (ts)e(a)i(pattern)0 2460 y(of)17 b(adaptation)g(that)g(is)f(greatest)g (near)h(the)f(training)g(p)q(oin)o(t)g(and)h(deca)o(ys)f(a)o(w)o(a)o(y) g(from)f(it.)98 2563 y(Figure)22 b(7a)i(sho)o(ws)g(the)f(pattern)h(of)f (generalization)g(for)h(the)f Fh(y)r Fo(-shift)f(t)o(w)o(o-p)q(oin)o(t) i(group.)43 b(The)0 2623 y(c)o(hange)16 b(in)f(p)q(oin)o(ting)g(b)q(et) o(w)o(een)g(the)g(pre-)h(and)g(p)q(ost-exp)q(osure)h(phases)f(w)o(as)g (signi\014can)o(t)g(at)f(2)h(out)g(of)g(11)0 2684 y(targets)g (\(targets)f(3)h(and)f(6\))h(in)e(the)h Fh(x)g Fo(direction)f(and)i(at) f(4)g(out)h(of)f(11)h(targets)g(\(targets)f(8{11\))i(in)e(the)f Fh(y)0 2744 y Fo(direction.)20 b(Additional)14 b(marginally)g (signi\014can)o(t)h(\()p Fh(p)f(<)g Fo(0)p Fh(:)p Fo(10\))i(c)o(hanges) f(o)q(ccurred)h(at)f(1)h(target)f(\(targets)p eop %%Page: 14 14 14 13 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(14)0 94 y(4\))15 b(in)f(the)g Fh(x)g Fo(direction)g(and)h(at)g(4)g(out)g(of)f(11)i(targets)f (\(targets)g(1,)f(2,)h(4)g(and)g(6\))g(in)f(the)g Fh(y)i Fo(direction.)k(The)0 154 y(c)o(hange)15 b(w)o(as)h(greatest)f(at)g (the)g(righ)o(t)g(training)g(p)q(oin)o(t)g(\(6.2)g(cm\),)f(follo)o(w)o (ed)g(b)o(y)g(the)h(target)h(imm)o(ediatel)o(y)0 214 y(to)h(its)f(righ)o(t)g(\(4.9)g(cm\),)e(and)j(then)f(at)h(the)f(left)f (training)h(p)q(oin)o(t)h(\(4.7)f(cm\).)98 317 y(The)e(in)o(terp)q (olated)h(v)o(ector)f(\014eld)g(for)h(the)g Fh(y)r Fo(-shift)f(t)o(w)o (o-p)q(oin)o(t)h(group)h(\(Figure)e(7f)s(\))i(sho)o(ws)g(a)f(c)o(hange) 0 377 y(in)k(p)q(oin)o(ting)g(a)o(w)o(a)o(y)g(from)f(the)g(b)q(o)q(dy)i (in)f(the)g(upp)q(er)g(righ)o(t)g(half)g(of)g(the)g(w)o(orkspace)g(and) h(to)o(w)o(ards)f(the)0 437 y(b)q(o)q(dy)13 b(in)f(the)g(lo)o(w)o(er)f (left)h(half.)20 b(The)12 b(ANO)o(V)-5 b(A)10 b(\(T)l(able)i(2\))g(sho) o(w)o(ed)g(no)h(signi\014can)o(t)f(main)f(e\013ects)h(of)h(phase)0 498 y(but)i(a)g(highly)f(signi\014can)o(t)g(in)o(teraction)g(of)h (phase)g(and)g(target)g(in)f(the)g Fh(y)j Fo(direction,)c(re\015ecting) h(the)g(non-)0 558 y(linear)19 b(e\013ect.)32 b(The)20 b(corresp)q(onding)h(grey-scale)e(con)o(tour)i(plot)f(sho)o(ws)g(t)o(w) o(o)g(areas)h(of)f(adaptation)h(in)0 618 y(opp)q(osite)c(directions)e (cen)o(tered)g(ab)q(out)j(eac)o(h)e(of)g(the)g(t)o(w)o(o)g(targets)h (\(Figure)f(7i\).)635 824 y Fn(Sim)n(ulation)27 b(Results)0 1024 y Fo(When)15 b(exp)q(osed)g(to)g(eac)o(h)f(of)h(the)g(three)f(exp) q(erimen)o(tal)e(p)q(erturbations,)j(the)g(p)q(oin)o(ting)g(b)q(eha)o (vior)f(of)h(the)0 1084 y(mo)q(del)e(adapts)i(in)f(the)g(comp)q (ensatory)f(direction.)20 b(Adaptation)15 b(is)e(largest)i(at)f(the)g (training)g(p)q(oin)o(t)g(and)0 1144 y(deca)o(ys)i(a)o(w)o(a)o(y)h (from)f(it)g(\(Figure)g(8a,)i(b,)e(&)h(c\).)23 b(The)16 b(deca)o(y)h(is)f(symmetric)d(ab)q(out)18 b(the)f(training)g(p)q(oin)o (ts)0 1205 y(in)f(Cartesian)h(co)q(ordinates)g(\(Figure)e(8d,)i(e,)e(&) h(f)s(\).)p 525 1362 900 7 v 693 1422 a(Insert)g(Figure)g(8)h(ab)q(out) g(here)p 525 1482 V 787 1736 a Fn(Discussion)98 1979 y Fo(Summarizi)o(ng)h(the)i(results,)g(a)g(remapping)f(of)i(one)f(and)h (t)o(w)o(o)f(p)q(oin)o(ts)g(in)g(the)g(h)o(uman)f(visuomo-)0 2039 y(tor)f(transformation)g(induced)f(signi\014can)o(t)g(c)o(hanges)h (in)g(p)q(oin)o(ting)f(o)o(v)o(er)g(the)h(w)o(orkspace.)25 b(Changes)19 b(in)0 2099 y(p)q(oin)o(ting)j(w)o(ere)g(greatest)g(at)g (the)g(site)g(of)g(the)g(p)q(erturbation)h(and)f(deca)o(y)o(ed)f(a)o(w) o(a)o(y)h(from)f(it.)38 b(When)0 2159 y(opp)q(osite)21 b(p)q(erturbation)f(w)o(ere)f(imp)q(osed)g(at)h(t)o(w)o(o)f(p)q(oin)o (ts)i(in)e(the)g(visuomotor)h(map,)f(the)g(c)o(hanges)h(in)0 2219 y(p)q(oin)o(ting)g(deca)o(y)o(ed)f(a)o(w)o(a)o(y)h(from)g(eac)o(h) f(p)q(oin)o(t.)34 b(The)20 b(pattern)h(of)f(generalization)g(resulting) g(from)f(the)0 2280 y(t)o(w)o(o)g(p)q(oin)o(t)h(remapping)e(suggests)j (that)f(the)f(e\013ect)g(of)h(a)g(p)q(erturbation)g(at)g(m)o(ultiple)c (p)q(oin)o(ts)k(ma)o(y)e(b)q(e)0 2340 y(the)e(sup)q(erp)q(osition)h(of) g(the)f(e\013ects)g(at)g(eac)o(h)g(p)q(oin)o(t.)98 2443 y(Referring)h(bac)o(k)h(to)h(the)g(qualitativ)o(e)e(mo)q(dels)g (discussed)i(in)f(the)h(in)o(tro)q(duction)f(\(Figure)g(1\),)h(the)0 2503 y(pattern)i(of)f(generalization,)h(although)g(broadly)g (classi\014able)e(as)i(nonlinear,)g(closely)e(resem)o(bles)f(the)0 2563 y(Cartesian)j(deca)o(ying)g(pattern.)35 b(Sev)o(eral)20 b(sp)q(eci\014c)g(mo)q(dels)g(can)h(b)q(e)g(ruled)f(out.)36 b(First,)21 b(the)g(pattern)0 2623 y(of)d(generalization)e(in)h(all)g (three)g(exp)q(erimen)o(tal)e(groups)j(w)o(as)g(nonlinear,)f(and)h (therefore)f(inconsisten)o(t)0 2684 y(with)c(mo)q(dels)f(in)h(whic)o(h) g(adaptation)h(is)f(constrained)h(to)f(b)q(e)h(linear)e(\(Bedford,)h (1989;)i(Bedford,)f(1993a\).)0 2744 y(Tw)o(o)22 b(factors)g(could)f (accoun)o(t)g(for)h(the)f(discrepancy)f(b)q(et)o(w)o(een)g(our)i (results)f(and)h(Bedford's.)36 b(First,)p eop %%Page: 15 15 15 14 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(15)0 94 y(Bedford)19 b(examined)d(adaptation) 21 b(along)f(a)f(constan)o(t)g(depth)g(arc,)h(while)e(our)h(exp)q (erimen)o(t)d(examined)0 154 y(adaptation)22 b(in)e(the)g(plane.)34 b(Nonlinear)20 b(adaptation,)j(when)d(pro)s(jected)g(on)o(to)h(a)g(lo)o (w)o(er)f(dimensional)0 214 y(subspace,)c(ma)o(y)f(app)q(ear)i(linear.) k(Second,)16 b(di\013erences)f(in)h(metho)q(dology)g(could)h(ha)o(v)o (e)e(con)o(tributed)h(to)0 274 y(this)j(discrepancy:)25 b(Our)19 b(exp)q(erimen)o(tal)d(setup)j(allo)o(w)o(ed)f(the)g(\014nger) h(and)g(visual)g(feedbac)o(k)f(cursor)h(to)0 334 y(b)q(e)d(collo)q (cated)g(in)g(space,)f(whereas)i(in)e(Bedford's)h(setup)g(the)g(target) g(feedbac)o(k)f(w)o(as)h(distan)o(t)g(from)f(the)0 395 y(\014nger.)21 b(Bedford)14 b(\(1993b\))i(has)f(subsequen)o(tly)e (examined)f(adaptation)k(in)e(the)g(horizon)o(tal)g(plane)g(using)0 455 y(a)j(setup)g(in)g(whic)o(h)f(the)g(sub)s(ject)g(mo)o(v)o(ed)f(a)i (p)q(en)g(on)h(a)f(tablet,)f(while)g(viewing)g(a)h(cursor)g(on)h(a)f (monitor)0 515 y(.)k(Her)14 b(results)i(suggest)g(that)g(certain)e (linear)h(transformations,)g(suc)o(h)g(as)h(c)o(hanges)g(in)f(scale,)f (are)i(easier)0 575 y(to)i(learn)g(than)g(other)g(transformations,)g (suc)o(h)g(as)g(those)h(that)f(do)g(not)h(preserv)o(e)d(shap)q(e.)27 b(Her)17 b(results)0 635 y(do)g(not,)f(ho)o(w)o(ev)o(er,)f(address)h Fi(gener)n(alization)i Fo(from)d(one)i(p)q(oin)o(t)f(to)h(another)f(in) g(the)g(plane.)98 738 y(The)d(data)g(from)f(the)h(one-p)q(oin)o(t)h (groups)g(is)f(also)g(not)h(consisten)o(t)e(with)h(a)h(mo)q(del)d(in)i (whic)o(h)f(adapta-)0 799 y(tion)f(is)g(represen)o(ted)g(as)h(a)f(c)o (hange)h(in)f(felt)f(direction)g(of)i(gaze)f(\(Harris,)h(1965\).)21 b(Due)11 b(to)h(the)f(arrangemen)o(t)0 859 y(of)17 b(the)g(c)o(hinrest) f(and)h(table,)f(the)h(sub)s(jects')f(ey)o(es)g(are)h(sagittally)f(a)o (w)o(a)o(y)h(from)f(\(b)o(y)g(35)h(cm\))f(and)h(ab)q(o)o(v)o(e)0 919 y(\(b)o(y)f(25)i(cm\))e(the)g(p)q(osition)i(of)f(the)g(training)g (p)q(oin)o(t.)24 b(If)16 b(adaptation)i(w)o(ere)f(represen)o(ted)e(as)j (a)g(constan)o(t)0 979 y(angular)e(o\013set)h(in)e(the)g(felt)g (direction)g(of)g(gaze,)h(one)g(w)o(ould)f(ha)o(v)o(e)g(exp)q(ected)g (larger)g(shifts)h(in)f(p)q(oin)o(ting)0 1039 y(at)g(the)g(more)e (distan)o(t)i(targets)h(for)f(b)q(oth)h(the)e Fh(x)p Fo(-)h(and)g Fh(y)r Fo(-shift)g(groups|in)g(fact)g(these)g(shifts)g(w)o (ere)f(gen-)0 1100 y(erally)j(smaller.)26 b(The)19 b(opp)q(osite)g (direction)e(p)q(erturbations)j(in)e(the)g(t)o(w)o(o-p)q(oin)o(t)h (remapping)e(condition)0 1160 y(could)f(ha)o(v)o(e)f(b)q(een)h(in)o (terpreted)e(b)o(y)h(the)h(visuomotor)f(system)g(as)h(a)h(single)e (coun)o(terclo)q(c)o(kwise)f(rotation)0 1220 y(ab)q(out)22 b(the)f(cen)o(tral)e(target.)35 b(Ho)o(w)o(ev)o(er,)20 b(this)h(h)o(yp)q(othesis)f(is)h(also)g(not)h(supp)q(orted)f(b)o(y)g (the)f(data,)i(as)0 1280 y(it)f(predicts)g(large)g(opp)q(osite-sign)i Fh(x)p Fo(-shifts)e(at)h(the)f(middle-top)f(and)i(middle-b)q(ottom)d (targets,)j(and)0 1340 y(neither)15 b(these)g(nor)i(the)e(other)h(p)q (eripheral)f(targets)i(demonstrate)e(this)h(rotatory)g(pattern)g(of)g (c)o(hanges.)0 1486 y Fm(Assumptions)i(and)i(Limitations)e(of)i(the)g (Mo)r(del)p 0 1505 1125 2 v 98 1611 a Fo(The)c(e\013ects)f(of)i(lo)q (cally)e(p)q(erturbing)h(the)g(visuomotor)g(transformation)g(w)o(ere)f (qualitativ)o(ely)f(cap-)0 1671 y(tured)19 b(b)o(y)g(a)g(simple)e(net)o (w)o(ork)h(mo)q(del)g(consisting)i(of)f(sensorimotor)g(units)g(with)g (lo)q(calized)f(Gaussian)0 1731 y(receptiv)o(e)10 b(\014elds.)19 b(In)12 b(this)g(mo)q(del)f(the)h(p)q(opulation)h(activit)o(y)e(of)h (the)g(units)g(determined)e(the)i(motor)f(com-)0 1791 y(mand)k(in)h(resp)q(onse)h(to)g(a)g(visual)e(target.)22 b(Learning)17 b(to)q(ok)g(place)f(through)h(pairing)f(motor)g(commands) 0 1852 y(with)g(visual)g(lo)q(cations)h(of)f(the)g(hand.)98 1955 y(The)i(mo)q(del)f(simpli\014es)f(the)i(sensorimotor)g (transformation)g(in)g(sev)o(eral)f(w)o(a)o(ys.)27 b(A)o(t)18 b(the)g(sensory)0 2015 y(side)g(the)h(inputs)g(to)g(the)g(visuomotor)f (system)f(clearly)h(do)h(not)h(arriv)o(e)d(in)i(Cartesian)g(b)q(o)q (dy-cen)o(tered)0 2075 y(co)q(ordinates,)g(but)f(are)g(transformed)g (from)f(retinotopic)g(co)q(ordinates)i(using)f(ey)o(e)f(p)q(osition)i (and)g(head)0 2135 y(orien)o(tation)k(information.)41 b(The)23 b(neuroph)o(ysiological)g(results)g(suggest)h(that)g(at)g (this)f(lev)o(el)e(of)i(the)0 2195 y(sensorimotor)e(transformation)g (neurons)h(ha)o(v)o(e)e(large)i(retinotopic)e(receptiv)o(e)f(\014elds)i (mo)q(dulated)g(b)o(y)0 2256 y(ey)o(e)16 b(p)q(osition)i(and)g(head)g (orien)o(tation)f(inputs)h(\(Andersen,)f(1987;)i(Sn)o(yder)e(et)g(al.,) g(1993\).)26 b(It)17 b(is)g(still)g(a)0 2316 y(topic)d(of)i(debate)e (whether)h(this)f(represen)o(tation)h(is)f(b)q(o)q(dy-cen)o(tered)h (\(Zipser)f(and)h(Andersen,)f(1988\))j(or)0 2376 y(some)g(distributed)g (com)o(bination)f(of)i(co)q(ordinates)g(\(P)o(ouget)g(and)g(Sejno)o (wski,)g(1995\).)27 b(In)17 b(either)f(case,)0 2436 y(this)21 b(represen)o(tation)f(con)o(tains)h(enough)h(information)e(to)h (extract)g(the)f(b)q(o)q(dy-cen)o(tered)h(co)q(ordinates)0 2496 y(used)16 b(in)g(our)h(mo)q(del.)98 2599 y(This)g(mo)q(del)g(also) h(simpli\014es)d(the)j(motor)f(pro)q(cess.)26 b(The)18 b(motor)f(output)h(of)g(the)f(CNS)h(is)f(clearly)0 2660 y(not)22 b(a)f(set)g(of)h(join)o(t)f(co)q(ordinates,)h(but)g(rather)f (a)h(complex)d(dynamic)g(pattern)i(m)o(uscle)e(activ)m(ations.)0 2720 y(Giv)o(en)f(that)h(the)f(exp)q(erimen)o(t)e(w)o(as)j(based)g(on)g (a)g(static)g(p)q(oin)o(ting)f(task)h(w)o(e)f(c)o(hose)h(not)g(to)g(mo) q(del)e(the)p eop %%Page: 16 16 16 15 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(16)0 94 y(forces)23 b(and)h(dynamical)d (equations)i(leading)g(the)g(hand)h(to)g(equilibrium)c(at)j(the)g (target.)42 b(Instead,)0 154 y(w)o(e)17 b(the)g(visuomotor)f (transformation)h(mo)q(deled)f(could)h(b)q(e)g(view)o(ed)f(as)i(the)f (transformation)g(b)q(et)o(w)o(een)0 214 y(visual)d(target)h(and)f (planned)h(endp)q(oin)o(t)f(of)h(mo)o(v)o(em)o(en)n(t.)j(If,)c(as)h (suggested)g(b)o(y)f(sev)o(eral)f(researc)o(hers,)g(the)0 274 y(cen)o(tral)19 b(motor)f(command)g(is)h(an)h(equilibrium)c(p)q (oin)o(t)k(or)g(tra)s(jectory)f(of)h(the)f(arm)f(\(Bizzi,)g(F)l (eldman,)0 334 y(etc\),)e(the)g(relation)h(b)q(et)o(w)o(een)f(suc)o(h)g (a)h(motor)f(plan)h(in)g(join)o(t)f(co)q(ordinates)i(and)f(the)g(motor) f(commands)0 395 y(w)o(ould)g(b)q(e)h(relativ)o(ely)c(simple.)19 b(Ho)o(w)o(ev)o(er,)14 b(in)i(general,)g(this)g(ma)o(y)f(not)h(b)q(e)h (the)f(case.)98 498 y(The)e(mo)q(del)f(obtains)i(the)f(output)h(of)g (the)f(sensorimotor)g(transformation)g(through)h(a)g(p)q(opulation)0 558 y(a)o(v)o(erage)22 b(of)g(the)g(units')g(outputs.)41 b(This)22 b(feature)g(of)h(the)f(mo)q(del)f(w)o(as)h(motiv)m(ated)f(b)o (y)h(evidence)f(for)0 618 y(p)q(opulation)13 b(co)q(ding)g(in)f(the)h (motor)e(cortex)h(\(Georgop)q(oulos)j(et)d(al.,)g(1983;)j(Georgop)q (oulos)g(et)d(al.,)g(1986\).)0 678 y(Evidence)h(from)g(the)h(same)f (group)i(suggests)g(that)f(this)g(p)q(opulation)h(activit)o(y)e(co)q (des)h(mo)o(v)o(em)o(en)o(t)d(v)o(ector)0 738 y(in)19 b(extrinsic)e(\(task\))j(co)q(ordinates.)30 b(Ho)o(w)o(ev)o(er,)17 b(in)i(the)g(mo)q(del)f(w)o(e)g(adopt)i(an)g(output)g(represen)o (tation)0 799 y(in)j(join)o(t)f(co)q(ordinates.)42 b(This)23 b(is)g(more)e(in)i(line)f(with)h(recen)o(t)e(results)i(suggesting)h (that)f(mo)o(v)o(eme)o(n)o(t)0 859 y(represen)o(tation)16 b(in)f(primary)g(motor)h(cortex)f(is)h(mo)q(dulated)g(b)o(y)f(initial)g (join)o(t)h(co)q(ordinates)h(\(Scott)f(and)0 919 y(Kalask)m(a,)h (1995\).)98 1022 y(In)g(the)g(exp)q(erimen)o(tal)d(data,)k(the)f(one-p) q(oin)o(t)h(p)q(erturbation)g(in)f(the)g Fh(x)g Fo(direction)f(induced) h(larger)0 1082 y(c)o(hanges)i(in)g(p)q(oin)o(ting)h(than)f(the)g (one-p)q(oin)o(t)h(p)q(erturbation)g(in)f(the)g Fh(y)i Fo(direction.)29 b(This)19 b(di\013erence)f(in)0 1142 y(magnitude)k(of)h(adaptation)h(w)o(as)f(not)g(predicted)f(b)o(y)g(the) g(mo)q(del,)h(whic)o(h)f(assumes)g(that)i(b)q(oth)f(the)0 1203 y(learning)f(rates)g(and)h(receptiv)o(e)c(\014elds)j(sizes)g(are)g (isotropic.)38 b(Tw)o(o)23 b(factors)f(could)g(accoun)o(t)g(for)g(the)0 1263 y(anisotrop)o(y)16 b(observ)o(ed)g(in)g(the)g(h)o(uman)f(data.)22 b(First,)15 b(the)g(visuomotor)h(map)f(ma)o(y)f(b)q(e)j(more)d (adaptable)0 1323 y(to)24 b(shifts)g(in)g(the)f Fh(x)h Fo(\(transv)o(erse\))f(direction,)h(than)h(to)f(shifts)g(in)f(the)h Fh(y)h Fo(\(com)o(bined)d(sagittal)i(and)0 1383 y(depth\))d(direction.) 33 b(Suc)o(h)21 b(a)g(di\013erence)e(in)i(adaptabilit)o(y)f(could)g(b)q (e)h(accommo)q(dated)e(in)i(the)f(mo)q(del)0 1443 y(b)o(y)e(di\013eren) o(t)g(learning)g(rates.)28 b(Second,)19 b(the)f(e\013ect)g(could)g(b)q (e)h(p)q(erceptual|i.e.)d(a)j(less)f(p)q(erceptually)0 1504 y(salien)o(t)e(p)q(erturbation)i(could)g(result)f(in)g(smaller)e (adaptation.)26 b(In)17 b(fact,)g(although)h(the)f(magnitude)g(of)0 1564 y(the)i(p)q(erturbations)h(w)o(as)f(equal)f(in)h(extrinsic)f (space,)h(the)g(visual)f(angle)h(subtended)g(w)o(as)h(smaller)d(for)0 1624 y(the)f Fh(y)i Fo(p)q(erturbation)f(than)g(for)f(the)g Fh(x)g Fo(p)q(erturbation.)0 1770 y Fm(The)k(F)-5 b(unction)20 b(Appro)n(ximation)e(F)-5 b(ramew)n(ork)p 0 1788 1077 2 v 98 1894 a Fo(Both)22 b(the)h(exp)q(erimen)o(tal)d(results)i(and)h (the)g(mo)q(del)e(can)i(b)q(e)g(in)o(terpreted)e(within)h(the)h(compu-) 0 1955 y(tational)18 b(framew)o(ork)f(of)h(function)g(appro)o (ximation.)25 b(In)17 b(this)h(framew)o(ork,)e(learning)i(the)g (visuomotor)0 2015 y(transformation)11 b(consists)h(of)f(appro)o (ximating)g(the)g(mapping)f(b)q(et)o(w)o(een)g(visual)h(and)h(motor)f (co)q(ordinates.)0 2075 y(As)j(there)f(are)h(in\014nitely)f(man)o(y)f (p)q(ossible)j(mappings)e(consisten)o(t)h(with)g(an)o(y)g(\014nite)f (set)h(of)g(input-output)0 2135 y(pairs,)j(the)g(problem)e(is)i (clearly)f(ill-p)q(osed.)23 b(The)17 b(mathematical)d(theory)j(of)g (function)g(appro)o(ximation)0 2195 y(states)h(that,)f(to)g(obtain)h(a) f(solution)h(to)f(this)g(ill-p)q(osed)g(problem,)f(constrain)o(ts)h(ha) o(v)o(e)f(to)i(b)q(e)f(placed)g(on)0 2256 y(the)f(function)g(appro)o (ximator)g(\(Tikhono)o(v)g(and)g(Arsenin,)f(1977\).)98 2359 y(F)l(or)20 b(our)h(exp)q(erimen)o(t,)e(the)h(\\function)h(appro)o (ximator")f(is)g(the)h(visuomotor)f(system,)f(whic)o(h)h(is)0 2419 y(faced)i(with)g(the)g(ill-p)q(osed)g(problem)e(of)j (recalibrating)e(its)h(mapping)f(based)i(on)f(one)h(or)f(t)o(w)o(o)g (no)o(v)o(el)0 2479 y(visuomotor)14 b(pairings.)21 b(The)15 b(pattern)g(of)g(recalibration,)e(i.e.)g(the)i(generalization,)f(whic)o (h)g(results)g(from)0 2539 y(this)i(limited)d(exp)q(osure,)j (re\015ects)f(the)h(structure)g(and)h(constrain)o(ts)f(underlying)g (the)f(visuomotor)h(map)0 2599 y(\(Sanger,)22 b(1994\).)36 b(F)l(or)21 b(example,)e(if)h(the)h(visuomotor)f(map)g(w)o(ere)g (represen)o(ted)f(as)j(a)f(lo)q(ok-up)g(table)0 2660 y(in)h(whic)o(h)g(corresp)q(onding)h(input-output)g(pairs)g(are)f (stored)h(\(A)o(tk)o(eson,)f(1989;)k(Rosen)o(baum)c(et)g(al.,)0 2720 y(1993\),)h(training)e(at)g(one)g(p)q(oin)o(t)g(w)o(ould)g(simply) d(c)o(hange)j(the)g(pairing)g(at)g(that)g(p)q(oin)o(t)g(while)f(lea)o (ving)p eop %%Page: 17 17 17 16 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(17)0 94 y(unaltered)15 b(previously)g (learned)g(pairings.)21 b(A)o(t)15 b(the)g(other)h(extreme,)c(the)j (visuomotor)g(mapping)g(could)0 154 y(b)q(e)j(represen)o(ted)g (parametrically)l(,)d(for)k(example)d(b)o(y)i(v)o(ectorially)e(com)o (bining)g(the)j(retinal)e(lo)q(cation)i(of)0 214 y(the)c(target)g(with) f(estimates)g(of)h(ey)o(e-p)q(osition)f(and)i(head-p)q(osition)g(to)f (pro)q(duce)g(b)q(o)q(dy-cen)o(tered)g(target)0 274 y(co)q(ordinates.) 46 b(Adaptation)25 b(in)f(suc)o(h)g(a)g(system)f(w)o(ould)h(constitute) g(a)h(recalibration,)g(suc)o(h)f(as)h(an)0 334 y(added)c(bias)g(or)h (scaling,)f(of)g(these)g(estimated)e(sensory)i(inputs)g(\(e.g.)f (Harris,)h(1965;)j(Crask)o(e,)e(1967;)0 395 y(Lac)o(kner,)d(1973\).)30 b(A)18 b(sensory)h(recalibration)g(in)f(suc)o(h)h(a)g(v)o(ectorial)e (represen)o(tation)h(generalizes)g(o)o(v)o(er)0 455 y(the)e(en)o(tire)f (w)o(orkspace.)21 b(The)c(pattern)f(of)h(generalization)f(observ)o(ed)f (in)h(our)h(exp)q(erimen)o(t)d(is)i(therefore)0 515 y(neither)23 b(consisten)o(t)h(with)g(the)g(lo)q(cal)g(lo)q(ok-up)h(table)e (represen)o(tation)h(nor)g(the)g(global)h(parametric)0 575 y(represen)o(tation.)98 678 y(The)18 b(mo)q(del)f(presen)o(ted)h (in)g(this)g(pap)q(er)h(is)f(an)h(instance)f(of)g(a)h(class)g(of)f (function)h(appro)o(ximators)0 738 y(kno)o(wn)f(as)f(radial)h(basis)g (function)f(net)o(w)o(orks)g(\(Bro)q(omhead)f(and)i(Lo)o(w)o(e,)f (1988;)i(Mo)q(o)q(dy)g(and)f(Dark)o(en,)0 799 y(1989\).)29 b(These)18 b(mo)q(dels,)f(whic)o(h)h(appro)o(ximate)f(the)h(function)g (via)g(a)h(sup)q(erp)q(osition)g(of)g(bases)g(\(in)f(our)0 859 y(case)e(Gaussians\),)h(can)f(b)q(e)g(deriv)o(ed)e(b)o(y)h (assuming)h(that)g(the)f(function)h(appro)o(ximator)f(trades)h(o\013)h (ho)o(w)0 919 y(closely)f(it)h(\014ts)g(the)g(input-output)h(data)g (with)e(ho)o(w)i(smo)q(oth)f(the)g(resulting)g(function)g(is)f(\(P)o (oggio)i(and)0 979 y(Girosi,)e(1989\).)22 b(In)16 b(other)g(w)o(ords,)g (suc)o(h)g(a)h(system)d(is)i(in)o(trinsically)d(biased)k(to)o(w)o(ards) f(learning)g(smo)q(oth)0 1039 y(mappings.)0 1185 y Fm(Related)j (Generalization)f(Studies)p 0 1192 809 2 v 98 1310 a Fo(Other)13 b(than)i(Bedford's)f(\(1989,)i(1993\))f(studies)f(men)o (tioned)e(in)i(the)g(in)o(tro)q(duction,)g(sev)o(eral)f(recen)o(t)0 1370 y(studies)k(ha)o(v)o(e)e(addressed)i(visuomotor)f(generalization.) 22 b(Using)17 b(a)g(setup)f(in)h(whic)o(h)f(hand)h(mo)o(v)o(em)o(en)o (ts)0 1430 y(pro)q(duced)h(cursor)h(mo)o(v)o(em)o(en)o(ts)c(on)j(a)h (monitor,)e(Imamiz)o(u)e(et)j(al.)g(\(1994\))h(examined)d(p)q(oin)o (ting)i(under)0 1490 y(a)g(75)90 1472 y Ff(\016)128 1490 y Fo(rotatory)g(p)q(erturbation.)26 b(The)17 b(sub)s(jects')g(goal)h(w) o(as)g(to)g(acquire)e(targets)i(randomly)f(presen)o(ted)0 1551 y(in)k(a)h(circle)e(ab)q(out)j(the)f(initial)e(cursor)i(lo)q (cation)g(as)g(rapidly)g(as)g(p)q(ossible,)h(where)e(the)g(duration)i (of)0 1611 y(the)e(ballistic)f(p)q(ortion)i(of)g(the)f(mo)o(v)o(eme)o (n)o(t)d(w)o(as)k(used)g(as)g(a)g(measure)e(of)i(learning.)36 b(The)22 b(results)f(of)0 1671 y(their)d(study)i(indicate)e(that)h (learning)g(this)g(rotation)h(on)g(mo)o(v)o(em)o(en)o(ts)c(in)j(one)g (direction)f(generalized)0 1731 y(to)f(mo)o(v)o(em)o(en)o(ts)d(in)i (another)h(direction.)k(Sub)s(jects)16 b(w)o(ere)g(fully)g(informed)f (of)h(the)h(nature)g(and)g(amoun)o(t)0 1791 y(of)i(the)g(p)q (erturbation;)i(therefore,)d(the)h(exp)q(erimen)o(t)d(confounds)k(p)q (erceptual)f(and)g(cognitiv)o(e)f(comp)q(o-)0 1852 y(nen)o(ts)g(of)g (the)g(task)g(and)h(the)f(study)g(ma)o(y)e(consequen)o(tly)h(b)q(ear)i (more)d(on)j(task)f(learning)g(than)h(on)f(the)0 1912 y(represen)o(tation)e(of)g(the)g(visuomotor)g(mapping.)98 2015 y(Shadmehr)21 b(and)i(Mussa-Iv)m(aldi)f(\(1994\))i(studied)e (adaptation)i(and)f(generalization)e(to)i(viscous)0 2075 y(\(v)o(elo)q(cit)o(y-dep)q(enden)o(t\))15 b(force)i(\014elds)g(during) g(target)h(directed)e(mo)o(v)o(em)o(en)o(t)o(s.)22 b(They)17 b(found)h(that)f(exp)q(o-)0 2135 y(sure)e(to)g(suc)o(h)f(a)h(force)f (\014eld)g(in)h(the)f(left)g(p)q(ortion)h(of)g(the)f(w)o(orkspace)h (generalized)f(to)h(the)f(righ)o(t)g(p)q(ortion)0 2195 y(of)g(the)f(w)o(orkspace)h(in)f(join)o(t-based,)h(rather)f(than)h (Cartesian,)g(co)q(ordinates.)21 b(Our)14 b(results)f(suggest)i(that)0 2256 y(visuomotor)d(\(kinematic\))e(learning)i(generalizes)f(in)h (extrinsic)f(Cartesian)i(co)q(ordinates.)21 b(F)l(urthermore,)0 2316 y(evidence)d(from)h(studies)h(of)h(adaptation)g(to)f(visual)g (distortions)h(of)f(p)q(oin)o(t-to-p)q(oin)o(t)h(mo)o(v)o(eme)o(n)o(t)c (sug-)0 2376 y(gests)12 b(that)g(the)f(kinematics)e(of)j(arm)f(mo)o(v)o (em)o(en)n(t)e(is)i(planned)h(in)f(extrinsic)f(co)q(ordinates)i(\(W)l (olp)q(ert)g(et)f(al.,)0 2436 y(1995\).)31 b(These)19 b(results)g(ma)o(y)f(indicate)g(an)h(in)o(teresting)f(dic)o(hotom)o(y)f (b)q(et)o(w)o(een)h(the)h(represen)o(tation)g(of)0 2496 y(kinematics,)13 b(in)j(extrinsic)f(co)q(ordinates,)i(and)f(dynamics,)f (in)h(in)o(trinsic)e(join)o(t-based)j(co)q(ordinates.)98 2599 y(A)i(relev)m(an)o(t)g(series)g(of)h(studies)f(has)i(also)f(b)q (een)f(conducted)h(in)f(the)h(purely)f(p)q(erceptual)g(domain)0 2660 y(of)g(ob)s(ject)f(recognition)h(b)o(y)f(B)q(\177)-26 b(ultho\013)20 b(and)f(Edelman)f(\(1992\).)30 b(Sub)s(jects)18 b(w)o(ere)g(trained)h(to)g(recognize)0 2720 y(2D)e(views)f(of)h(amo)q (eba-lik)o(e)d(ob)s(jects,)i(after)g(whic)o(h)g(generalization)g(to)g (other)h(p)q(oses)g(\(2D)g(pro)s(jections\))p eop %%Page: 18 18 18 17 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(18)0 94 y(of)20 b(the)f(ob)s(ject)f(w)o(as)i (assessed.)31 b(Recognition)19 b(w)o(as)h(found)g(to)g(fall)f(o\013)h (smo)q(othly)l(,)f(in)g(a)g(Gaussian-lik)o(e)0 154 y(manner,)12 b(with)i(distance)f(from)f(the)i(presen)o(ted)e(viewp)q(oin)o(t.)20 b(This)13 b(\014nding)h(has)g(b)q(een)g(tak)o(en)f(as)h(supp)q(ort)0 214 y(for)20 b(a)g(theory)g(of)g(ob)s(ject)f(recognition)g(based)i(on)f (the)f(sup)q(erp)q(osition)i(of)f(Gaussian)h(basis)f(functions,)0 274 y(eac)o(h)c(of)g(whic)o(h)g(represen)o(ts)f(a)i(2D)g(ob)s(ject)f (view)f(\(P)o(oggio)i(and)g(Hurlb)q(ert,)e(1994\).)98 377 y(It)f(is)h(in)o(teresting)f(that)i(our)f(studies)g(of)h (visuomotor)e(generalization)h(sho)o(w)g(qualitativ)o(ely)e(similar)0 437 y(e\013ects)20 b(to)g(B)q(\177)-26 b(ultho\013)21 b(and)f(Edelman's)f(\(1992\))i(purely)e(p)q(erceptual)h(study)l(.)32 b(It)19 b(ma)o(y)g(b)q(e)h(that)g(similar)0 498 y(represen)o(tational)g (sc)o(hemes)f(are)h(used)h(in)f(di\013eren)o(t)g(p)q(erceptual)g(and)h (motor)f(systems)g(in)g(the)h(CNS.)0 558 y(It)d(is)h(kno)o(wn)f(that)h (maps)f(of)h(visual)f(and)h(auditory)g(space)g(are)g(k)o(ept)e(in)h (alignmen)o(t)f(in)h(the)h(midbrain)0 618 y(tectum)e(of)i(o)o(wls)g (\(Kn)o(udsen,)g(1982\),)h(cats)f(\(Harris)g(et)f(al.,)g(1980;)k(Stein) c(and)h(Meredith,)f(1993\),)i(and)0 678 y(primates)h(\(Ja)o(y)h(and)h (Sparks,)g(1984\))h(and)f(that)f(prismatically)e(imp)q(osed)h (displacemen)o(ts)f(of)i(visual)0 738 y(space)f(alter)g(the)g(corresp)q (onding)h(map)f(of)g(auditory)h(space)f(\(Kn)o(udsen)g(and)h(Kn)o (udsen,)g(1989\).)37 b(An)0 799 y(in)o(teresting,)17 b(as)h(y)o(et)f(unansw)o(ered,)h(empirical)d(question)i(is)h(whether)f (the)h(generalization)f(that)h(arises)0 859 y(to)f(lo)q(cal)f (visuo-auditory)h(remappings)e(sho)o(ws)i(a)g(similar)d(pattern.)0 1005 y Fm(Conclusion)p 0 1012 286 2 v 98 1129 a Fo(When)19 b(w)o(e)g(reac)o(h)g(to)h(a)g(visually-p)q(erceiv)o(ed)d(ob)s(ject,)j (our)g(cen)o(tral)f(nerv)o(ous)g(system)f(transforms)0 1189 y(visual)h(information)f(in)o(to)h(co)q(ordinates)i(appropriate)f (for)f(mo)o(v)o(eme)o(n)o(t.)28 b(Lo)q(cal)20 b(p)q(erturbations)h(of)e (the)0 1250 y(relationship)g(b)q(et)o(w)o(een)f(visual)h(and)h(proprio) q(ceptiv)o(e)e(space)h(rev)o(eal)f(the)h(pattern)h(b)o(y)f(whic)o(h)f (learning)0 1310 y(in)k(this)h(visuomotor)f(transformation)h (generalizes)f(o)o(v)o(er)g(space.)41 b(This)23 b(pattern)g(of)g (generalization)0 1370 y(highly)17 b(constrains)i(the)f(p)q(ossible)g (computational)f(sc)o(hemes)f(b)o(y)h(whic)o(h)g(the)h(cen)o(tral)f (nerv)o(ous)g(system)0 1430 y(could)24 b(b)q(e)g(computing)g(the)f (visuomotor)h(transformation.)45 b(In)24 b(this)g(study)g(w)o(e)g(ha)o (v)o(e)g(sho)o(wn)h(that)0 1490 y(visuomotor)13 b(generalization)f (deca)o(ys)h(gradually)h(from)e(the)h(lo)q(ci)g(of)h(p)q(erturbations.) 21 b(A)13 b(mo)q(del)f(in)h(whic)o(h)0 1551 y(the)i(transformation)g (is)g(computed)f(though)i(the)f(p)q(opulation)h(activit)o(y)d(of)j (units)f(with)g(large)g(Gaussian)0 1611 y(receptiv)o(e)f(\014elds)i (captures)g(this)g(b)q(eha)o(vior.)p eop %%Page: 19 19 19 18 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(19)0 94 y Fn(References)0 224 y Fo(Andersen,)16 b(R.)h(\(1987\).)25 b(Inferior)16 b(parietal)h (lobule)f(function)h(in)g(spatial)g(p)q(erception)g(and)h(visuomotor)98 284 y(in)o(tegration.)33 b(In)20 b(Plum,)f(F.)h(and)h(Moun)o(tcastle,)f (V.,)g(editors,)h Fi(Handb)n(o)n(ok)g(of)h(Physiolo)n(gy:)29 b(The)98 344 y(Nervous)c(System.)f(Higher)h(F)l(unctions)h(of)e(the)h (Br)n(ain)p Fo(,)g(pages)g(483{518.)h(Am.)c(Ph)o(ysiol.)g(So)q(c.,)98 404 y(Ro)q(c)o(kville,)13 b(MD.)0 506 y(Andersen,)19 b(R.,)g(Essic)o(k,)g(C.,)g(and)h(Siegel,)e(R.)h(\(1985\).)31 b(Enco)q(ding)20 b(of)g(spatial)f(lo)q(cation)h(b)o(y)e(p)q(osterior)98 566 y(parietal)d(neurons.)22 b Fi(Scienc)n(e)p Fo(,)c(230:456{458.)0 668 y(A)o(tk)o(eson,)12 b(C.)g(\(1989\).)17 b(Learning)c(arm)e (kinematics)f(and)k(dynamics.)f Fi(A)o(nn.R)n(ev.Neur)n(osci.)p Fo(,)g(12:157{183.)0 770 y(Bedford,)j(F.)g(\(1989\).)25 b(Constrain)o(ts)17 b(on)h(learning)e(new)h(mappings)g(b)q(et)o(w)o (een)e(p)q(erceptual)i(dimensions.)98 830 y Fi(J.)g(of)g(Exp)n (erimental)h(Psycholo)n(gy:)k(Human)c(Per)n(c)n(eption)g(and)g (Performanc)n(e)p Fo(,)d(15\(2\):232{248)q(.)0 932 y(Bedford,)g(F.)h (\(1993a\).)22 b(P)o(erceptual)15 b(and)i(cognitiv)o(e)e(spatial)h (learning.)k Fi(J.)d(of)g(Exp)n(erimental)h(Psychol-)98 992 y(o)n(gy:)j(Human)d(Per)n(c)n(eption)g(and)g(Performanc)n(e)p Fo(,)d(19\(3\):517{530)q(.)0 1094 y(Bedford,)g(F.)g(\(1993b\).)22 b(P)o(erceptual)15 b(learning.)20 b(In)15 b(Medin,)g(D.,)g(editor,)g Fi(The)i(Psycholo)n(gy)g(of)f(L)n(e)n(arning)98 1154 y(and)h(Motivation)p Fo(,)f(v)o(olume)e(30,)j(pages)g(1{60.)0 1255 y(Bro)q(omhead,)i(D.)h(and)g(Lo)o(w)o(e,)g(D.)f(\(1988\).)33 b(Multiv)m(ariable)18 b(functional)h(in)o(terp)q(olation)g(and)h (adaptiv)o(e)98 1316 y(net)o(w)o(orks.)g Fi(Complex)f(Systems)p Fo(,)d(2\(3\):321{355.)0 1417 y(B)q(\177)-26 b(ultho\013,)22 b(H.)d(and)h(Edelman,)f(S.)h(\(1992\).)34 b(Psyc)o(hoph)o(ysical)19 b(supp)q(ort)i(for)f(a)g(t)o(w)o(o-dimensional)f(view)98 1477 y(in)o(terp)q(olation)k(theory)h(of)h(ob)s(ject)e(recognition.)44 b Fi(Pr)n(o)n(c)n(e)n(e)n(dings)24 b(of)g(the)i(National)f(A)n(c)n (ademy)f(of)98 1538 y(Scienc)n(es)19 b(\(USA\))p Fo(,)d(89:60{64.)0 1639 y(Crask)o(e,)c(B.)e(\(1967\).)k(Adaptation)d(to)h(prisms:)17 b(Change)12 b(in)f(in)o(ternally)e(registered)h(ey)o(e-p)q(osition.)i Fi(British)98 1700 y(Journal)17 b(of)g(Psycholo)n(gy)p Fo(,)f(58:329{335.)0 1801 y(Flanders,)g(M.)g(and)h(So)q(ec)o(h)o(ting,) e(J.)h(\(1990\).)24 b(P)o(arcellation)15 b(of)i(sensorimotor)f (transformation)g(for)h(arm)98 1861 y(mo)o(v)o(em)o(en)n(ts.)i Fi(J.Neur)n(osci.)p Fo(,)c(10:2420{2427)q(.)0 1963 y(Flanders,)h(M.,)f (So)q(ec)o(h)o(ting,)h(J.,)f(and)i(Tillery)l(,)d(S.)i(H.)g(\(1992\).)23 b(Early)16 b(stages)h(in)f(a)h(sensorimotor)f(trans-)98 2023 y(formation.)k Fi(Behavior)n(al)e(and)f(Br)n(ain)g(Scienc)n(es)p Fo(,)h(15:309{362.)0 2125 y(Georgop)q(oulos,)f(A.,)d(Caminiti,)f(R.,)h (Kalask)m(a,)i(J.,)f(and)g(Massey)l(,)g(J.)g(\(1983\).)21 b(Spatial)15 b(co)q(ding)h(of)f(mo)o(v)o(e-)98 2185 y(men)o(t:)33 b(a)24 b(h)o(yp)q(othesis)f(concerning)g(the)g(co)q(ding)h(of)g(mo)o(v) o(em)o(en)o(t)c(direction)i(b)o(y)h(motor)g(cortical)98 2245 y(p)q(opulations.)f Fi(Exp.Br)n(ain)17 b(R)n(es.suppl.)p Fo(,)f(7:327{336.)0 2347 y(Georgop)q(oulos,)24 b(A.,)e(Sc)o(h)o(w)o (artz,)f(A.,)h(and)g(Kettner,)f(R.)g(\(1986\).)38 b(Neuronal)21 b(p)q(opulation)i(co)q(ding)f(of)98 2407 y(mo)o(v)o(em)o(en)n(t)14 b(direction.)20 b Fi(Scienc)n(e)p Fo(,)d(233:1416{14)q(19)q(.)0 2509 y(Harris,)i(C.)f(\(1965\).)30 b(P)o(erceptual)18 b(adaptation)i(to)f(in)o(v)o(erted,)e(rev)o(ersed,)g(and)j(displaced)e (vision.)28 b Fi(Psy-)98 2569 y(cholo)n(gic)n(al)18 b(R)n(eview)p Fo(,)e(72:419{444.)0 2671 y(Harris,)e(L.,)g(Blak)o(emore,)e(C.,)h(and)i (Donagh)o(y)l(,)g(M.)f(\(1980\).)19 b(In)o(tegration)14 b(of)h(visual)f(and)g(auditory)h(space)98 2731 y(in)g(the)h(mammali)o (an)e(sup)q(erior)j(colliculus.)i Fi(Natur)n(e)p Fo(,)d(288:56{59.)p eop %%Page: 20 20 20 19 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(20)0 94 y(Ha)o(y)l(,)15 b(J.)h(and)h(Pic)o (k,)d(H.)i(\(1966\).)22 b(Gaze-con)o(tingen)o(t)16 b(prism)f (adaptation:)22 b(Optical)16 b(and)g(motor)g(factors.)98 154 y Fi(J.)h(of)g(Exp)n(erimental)h(Psycholo)n(gy)p Fo(,)e(72:640{648.)0 255 y(Held,)f(R.)g(\(1965\).)23 b(Plasticit)o(y)15 b(in)h(sensory-motor)g(systems.)k Fi(Scienti\014c)g(A)o(meric)n(an)p Fo(,)c(213:84{94.)0 357 y(Held,)d(R.,)g(Efstathiou,)h(A.,)f(and)i(Greene,)e(M.)g(\(1966\).) 18 b(Adaptation)d(to)f(displaced)f(and)h(dela)o(y)o(ed)e(visual)98 417 y(feedbac)o(k)j(from)g(the)h(hand.)22 b Fi(J.)17 b(Exp.)g(Psychol.)p Fo(,)g(72:887{891.)0 519 y(Ho)o(w)o(ard,)f(I.)f (\(1982\).)23 b Fi(Human)18 b(visual)g(orientation)p Fo(.)k(Wiley)l(,)14 b(Chic)o(hester,)h(England.)0 621 y(Imamizu,)10 b(H.,)i(Uno,)h(Y.,)f(and)i(Ka)o(w)o(ato,)f(M.)f (\(1994\).)17 b(In)o(ternal)12 b(represen)o(tations)h(of)g(the)f(motor) g(appara-)98 681 y(tus:)21 b(Implication)14 b(from)h(generalization)h (in)g(visuo-motor)f(learning.)21 b Fi(Unpublishe)n(d)e(Manuscript)p Fo(.)0 783 y(Ja)o(y)l(,)d(M.)f(and)i(Sparks,)f(D.)g(\(1984\).)23 b(Auditory)15 b(receptiv)o(e)f(\014elds)i(in)g(primate)e(sup)q(erior)j (colliculus)d(shift)98 843 y(with)i(c)o(hanges)g(in)g(ey)o(e)f(p)q (osition.)22 b Fi(Natur)n(e)p Fo(,)16 b(309:345{347.)0 945 y(Kalask)m(a,)e(J.)e(and)h(Crammond,)e(D.)h(\(1992\).)17 b(Cerebral)12 b(cortical)f(mec)o(hanisms)f(of)i(reac)o(hing)g(mo)o(v)o (emen)n(ts.)98 1005 y Fi(Scienc)n(e)p Fo(,)17 b(255:1517{15)q(23.)0 1106 y(Kn)o(udsen,)g(E.)h(\(1982\).)27 b(Auditory)17 b(and)h(visual)f(maps)g(of)h(space)g(in)f(the)h(optic)f(tectum)f(of)i (the)f(o)o(wl.)25 b Fi(J.)98 1167 y(Neur)n(osci.)p Fo(,)15 b(2:1177{1194)q(.)0 1268 y(Kn)o(udsen,)e(E.)h(and)g(Kn)o(udsen,)f(P)l (.)g(\(1989\).)18 b(Vision)13 b(calibrates)g(sound)h(lo)q(calization)f (in)g(dev)o(eloping)f(barn)98 1329 y(o)o(wls.)21 b Fi(J.)c(Neur)n (oscienc)n(e)p Fo(,)g(9\(9\):3306{3313.)0 1430 y(Lac)o(kner,)j(J.)g (\(1973\).)34 b(Visual)20 b(rearrangemen)o(t)f(a\013ects)h(auditory)h (lo)q(calization.)32 b Fi(Neur)n(opsycholo)n(gia)p Fo(,)98 1490 y(11:29{32.)0 1592 y(Mo)q(o)q(dy)l(,)24 b(J.)e(and)g(Dark)o(en,)h (C.)f(\(1989\).)40 b(F)l(ast)22 b(learning)g(in)g(net)o(w)o(orks)g(of)g (lo)q(cally-tuned)f(pro)q(cessing)98 1652 y(units.)g Fi(Neur)n(al)c(Computation)p Fo(,)f(1\(2\):281{294.)0 1754 y(P)o(oggio,)h(T.)f(and)i(Girosi,)e(F.)g(\(1989\).)23 b(A)16 b(theory)h(of)g(net)o(w)o(orks)f(for)h(appro)o(ximation)e(and)i (learning.)22 b Fi(AI)98 1814 y(L)n(ab)16 b(Memo)i(1140,)f(MIT)p Fo(.)0 1916 y(P)o(oggio,)h(T.)f(and)h(Hurlb)q(ert,)e(A.)g(\(1994\).)26 b(Observ)m(ations)17 b(on)h(cortical)e(mec)o(hanisms)f(for)i(ob)s(ject) g(recog-)98 1976 y(nition)f(and)h(learning.)23 b(In)16 b(Ko)q(c)o(h,)h(C.)g(and)g(Da)o(vis,)f(J.,)g(editors,)h Fi(L)n(ar)n(ge-Sc)n(ale)h(Neur)n(onal)h(The)n(ories)98 2036 y(of)e(the)h(Br)n(ain)p Fo(,)d(pages)i(153{182.)i(MIT)d(Press,)g (Cam)o(bridge,)e(MA.)0 2138 y(P)o(ouget,)j(A.)f(and)i(Sejno)o(wski,)e (T.)h(\(1995\).)25 b(Spatial)17 b(represen)o(tation)g(in)g(the)f (parietal)h(cortex)f(ma)o(y)g(use)98 2198 y(basis)c(functions.)j(In)d (T)l(esauro,)h(G.,)g(T)l(ouretzky)l(,)f(D.,)g(and)h(Leen,)g(T.,)f (editors,)g Fi(A)n(dvanc)n(es)j(in)f(Neur)n(al)98 2258 y(Information)j(Pr)n(o)n(c)n(essing)g(Systems)g(7)p Fo(.)f(MIT)g (Press,)g(Cam)o(bridge,)f(MA.)0 2360 y(Rosen)o(baum,)f(D.,)h(Engelbrec) o(h)o(t,)f(S.,)h(Bushe,)g(M.,)g(and)h(Louk)o(op)q(oulos,)h(L.)f (\(1993\).)21 b(Kno)o(wledge)15 b(mo)q(del)98 2420 y(for)e(selecting)e (and)j(pro)q(ducing)f(reac)o(hing)g(mo)o(v)o(em)o(en)o(ts.)f Fi(Journal)j(of)f(Motor)f(Behavior)p Fo(,)h(25\(3\):217{)98 2480 y(227.)0 2582 y(Sanger,)22 b(T.)e(\(1994\).)36 b(Using)21 b(the)f(genereralization)g(prop)q(erties)h(of)g(a)g(neural)f(net)o(w)o (ork)g(to)h(infer)f(the)98 2642 y(n)o(um)o(b)q(er)14 b(and)j(shap)q(e)g(of)g(its)f(hidden)f(units.)22 b Fi(Unpublishe)n(d)c (manuscript)p Fo(.)p eop %%Page: 21 21 21 20 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(21)0 94 y(Scott,)12 b(S.)e(and)i(Kalask)m(a,) g(J.)f(\(1995\).)j(Changes)e(in)f(motor)f(cortex)g(activit)o(y)f (during)j(reac)o(hing)e(mo)o(v)o(em)o(en)o(ts)98 154 y(with)20 b(similar)f(hand)i(paths)h(but)f(di\013eren)o(t)f(arm)f(p)q (ostures.)36 b Fi(J.)21 b(Neur)n(ophysiolo)n(gy)p Fo(,)f(73\(6\):2563{) 98 214 y(2567.)0 316 y(Shadmehr,)i(R.)g(and)h(Mussa-Iv)m(aldi,)g(F.)f (\(1994\).)41 b(Adaptiv)o(e)21 b(represen)o(tation)g(of)i(dynamics)e (during)98 376 y(learning)16 b(of)g(a)h(motor)e(task.)22 b Fi(J.)17 b(Neur)n(osci.)p Fo(,)f(14\(5\):3208{3224)q(.)0 478 y(Sn)o(yder,)i(L.,)g(Brotc)o(hie,)f(P)l(.,)h(and)h(Andersen,)f(R.)g (\(1993\).)28 b(W)l(orld-cen)o(tered)17 b(enco)q(ding)i(of)g(lo)q (cation)f(in)98 538 y(p)q(osterior)d(parietal)g(cortex)f(of)h(monk)o (ey)l(.)i Fi(So)n(ciety)g(F)l(or)f(Neur)n(oscienc)n(e)h(A)o(bstr)n (acts.)p Fo(,)e(19\(\(1-3\)\):770.)0 639 y(So)q(ec)o(h)o(ting,)21 b(J.)f(and)h(Flanders,)g(M.)e(\(1989a\).)36 b(Errors)21 b(in)f(p)q(oin)o(ting)h(are)g(due)f(to)h(appro)o(ximations)e(in)98 700 y(sensorimotor)c(transformations.)22 b Fi(J.Neur)n(ophysiol.)p Fo(,)14 b(62:595{608.)0 801 y(So)q(ec)o(h)o(ting,)f(J.)h(and)g (Flanders,)g(M.)f(\(1989b\).)19 b(Sensorimotor)13 b(represen)o(tations) h(for)g(p)q(oin)o(ting)g(to)g(targets)98 862 y(in)h(three-dimensional)g (space.)21 b Fi(J.Neur)n(ophysiol.)p Fo(,)15 b(62:582{594.)0 963 y(Stein,)f(B.)f(and)i(Meredith,)d(M.)i(\(1993\).)19 b Fi(The)d(Mer)n(ging)g(of)f(the)h(Senses)p Fo(.)j(MIT)14 b(Press,)g(Cam)o(bridge,)f(MA.)0 1065 y(Stratton,)h(G.)g(\(1897a\).)19 b(Uprigh)o(t)12 b(vision)i(and)g(the)f(retinal)g(image.)i Fi(Psycholo)n(gic)n(al)h(R)n(eview)p Fo(,)e(4:182{187.)98 1125 y(Cited)h(in)h(W)l(elc)o(h)f(\(1978\)and)k(Blauert)c(\(1983\).)0 1227 y(Stratton,)k(G.)f(\(1897b\).)28 b(Vision)18 b(without)g(in)o(v)o (ersion)f(of)h(the)g(retinal)f(image.)25 b Fi(Psycholo)n(gic)n(al)20 b(R)n(eview)p Fo(,)98 1287 y(4:341{360,)e(463{481.)24 b(Cited)16 b(in)g(Blauert)f(\(1983\))j(and)f(W)l(elc)o(h)e(&)h(W)l (arren)g(\(1986\).)0 1389 y(Tikhono)o(v,)24 b(A.)e(and)h(Arsenin,)h(V.) e(\(1977\).)42 b Fi(Solutions)25 b(of)e(Il)r(l-Pose)n(d)i(Pr)n(oblems)p Fo(.)41 b(W.H.)22 b(Winston,)98 1449 y(W)l(ashington,)17 b(D.C.)0 1551 y(v)o(on)11 b(Helmholtz,)e(H.)h(\(1925\).)k Fi(T)l(r)n(e)n(atise)e(on)h(physiolo)n(gic)n(al)f(optics)h(\(1867\))p Fo(.)f(Optical)f(So)q(ciet)o(y)f(of)h(America,)98 1611 y(Ro)q(c)o(hester,)k(New)h(Y)l(ork.)0 1713 y(W)l(elc)o(h,)f(R.)g (\(1978\).)23 b Fi(Per)n(c)n(eptual)18 b(Mo)n(di\014c)n(ation)p Fo(.)j(Academic)13 b(Press,)j(New)g(Y)l(ork.)0 1814 y(W)l(elc)o(h,)11 b(R.)h(\(1986\).)j(Adaptation)e(to)f(space)g(p)q(erception.)i(In)e (Bo\013,)h(K.,)f(Kaufman,)f(L.,)i(and)f(Thomas,)h(J.,)98 1874 y(editors,)j Fi(Handb)n(o)n(ok)i(of)g(p)n(er)n(c)n(eption)g(and)g (p)n(erformanc)n(e)p Fo(,)e(v)o(olume)f(1,)i(pages)h(24{1{24{45.)i (Wiley{)98 1935 y(In)o(terscience,)13 b(New)j(Y)l(ork.)0 2036 y(W)l(olp)q(ert,)25 b(D.,)f(Ghahramani,)g(Z.,)g(and)g(Jordan,)i (M.)c(\(1995\).)44 b(Are)22 b(arm)h(tra)s(jectories)f(planned)h(in)98 2096 y(kinematic)9 b(or)j(dynamic)e(co)q(ordinates?)21 b(An)11 b(adaptation)j(study)e(.)i Fi(Exp)n(erimental)g(Br)n(ain)f(R)n (ese)n(ar)n(ch)p Fo(,)98 2157 y(103\(3\):460{470.)0 2258 y(Zipser,)f(D.)g(and)g(Andersen,)g(R.)f(\(1988\).)16 b(A)c(bac)o(k-propagation)h(programmed)d(net)o(w)o(ork)i(that)g(sim)o (ulates)98 2319 y(resp)q(onse)17 b(prop)q(erties)f(of)g(a)h(subset)g (of)f(p)q(osterior)h(parietal)f(neurons.)22 b Fi(Natur)n(e)p Fo(,)15 b(331:679{684)q(.)p eop %%Page: 22 22 22 21 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(22)742 94 y Fm(Ac)n(kno)n(wledgmen)n(ts)98 197 y Fo(This)14 b(pro)s(ject)g(w)o(as)h(supp)q(orted)g(in)g(part)f(b)o (y)g(a)h(gran)o(t)g(from)f(the)g(McDonnell-P)o(ew)f(F)l(oundation,)j(b) o(y)0 257 y(a)j(gran)o(t)f(from)g(A)l(TR)g(Human)f(Information)g(Pro)q (cessing)i(Researc)o(h)f(Lab)q(oratories,)i(b)o(y)e(a)g(gran)o(t)h (from)0 317 y(Siemens)12 b(Corp)q(oration,)k(b)o(y)e(a)g(gran)o(t)h (IRI-9013991)h(from)d(the)h(National)g(Science)f(F)l(oundation,)i(and)g (b)o(y)0 377 y(gran)o(t)h(N00014-94-1-0)q(77)q(7)j(from)14 b(the)h(O\016ce)g(of)h(Na)o(v)m(al)f(Researc)o(h.)20 b(Zoubin)c(Ghahramani)f(and)h(Daniel)0 437 y(M.)f(W)l(olp)q(ert)g(w)o (ere)g(supp)q(orted)h(b)o(y)f(fello)o(wships)g(from)g(the)g (McDonnell-P)o(ew)f(F)l(oundation.)22 b(Mic)o(hael)14 b(I.)0 498 y(Jordan)j(is)f(a)h(NSF)f(Presiden)o(tial)f(Y)l(oung)h(In)o (v)o(estigator.)p eop %%Page: 23 23 23 22 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(23)878 94 y Fm(T)-5 b(able)19 b(1)p 563 207 825 2 v 780 248 a Fo(Mo)q(del)d(P)o(arameters)p 563 268 V 787 310 a(Units)249 b(8)12 b Fg(\002)e Fo(8)17 b(grid)588 370 y(Receptiv)o(e)d(Field)h(Size)g(\()p Fh(\033)r Fo(\))103 b(5)16 b(cm)653 430 y(Learning)h(Rate)f(\()p Fh(\021)r Fo(\))188 b(0.5)595 490 y(Upp)q(er)16 b(Arm)f(Length)i(\()p Fh(l)1057 497 y Fd(1)1076 490 y Fo(\))98 b(30)18 b(cm)598 550 y(Lo)o(w)o(er)e(Arm)e(Length)j(\()p Fh(l)1054 557 y Fd(2)1074 550 y Fo(\))100 b(43)18 b(cm)p 563 570 V 396 704 a(T)l(able)e(1:)22 b(P)o(arameters)15 b(of)i(the)f(mo)q(del)f (used)h(in)g(sim)o(ulations.)878 870 y Fm(T)-5 b(able)19 b(2)p 0 988 1989 2 v 776 1028 a Fo(Analysis)d(of)h(V)l(ariance)p 0 1048 V 25 1090 a(Group)313 b(Dir)186 b(Phase)353 b(T)l(arget)274 b(Phase)16 b Fg(\002)g Fo(T)l(arget)p 618 1110 350 2 v 1077 1110 401 2 v 1587 1110 V 675 1150 a Fh(F)707 1157 y Fd(1)p Fe(;)p Fd(7)917 1150 y Fh(p)178 b(F)1151 1157 y Fd(8)p Fe(;)p Fd(56)1428 1150 y Fh(p)g(F)1662 1157 y Fd(8)p Fe(;)p Fd(56)1939 1150 y Fh(p)p 0 1170 1989 2 v 25 1212 a Fo(One-p)q(oin)o(t)16 b(Con)o(trol)494 1272 y Fh(x)145 b Fo(2)p Fh(:)p Fo(16)137 b Fh(ns)187 b Fo(3)p Fh(:)p Fo(75)99 b Fh(<)14 b Fo(0)p Fh(:)p Fo(01)198 b Fh(<)14 b Fo(1)185 b Fh(ns)495 1332 y(y)158 b(<)14 b Fo(1)137 b Fh(ns)187 b Fo(2)p Fh(:)p Fo(57)99 b Fh(<)14 b Fo(0)p Fh(:)p Fo(05)187 b(1)p Fh(:)p Fo(61)f Fh(ns)25 1393 y Fo(One-p)q(oin)o(t)16 b(X)g(Shift)494 1453 y Fh(x)120 b Fo(15)p Fh(:)p Fo(83)51 b Fh(<)14 b Fo(0)p Fh(:)p Fo(01)188 b(5)p Fh(:)p Fo(96)75 b Fh(<)13 b Fo(0)p Fh(:)p Fo(001)188 b(2)p Fh(:)p Fo(06)e Fh(ns)495 1513 y(y)148 b Fo(1.96)137 b Fh(ns)187 b Fo(9.51)75 b Fh(<)13 b Fo(0)p Fh(:)p Fo(001)188 b(1)p Fh(:)p Fo(36)e Fh(ns)25 1573 y Fo(One-p)q(oin)o(t)16 b(Y)g(Shift)494 1633 y Fh(x)155 b(<)14 b Fo(1)137 b Fh(ns)187 b Fo(1)p Fh(:)p Fo(35)e Fh(ns)i Fo(2.11)100 b Fh(<)14 b Fo(0)p Fh(:)p Fo(05)495 1694 y Fh(y)148 b Fo(3.75)137 b Fh(ns)197 b(<)14 b Fo(1)185 b Fh(ns)i Fo(1.87)f Fh(ns)p 0 1713 V 675 1755 a(F)707 1762 y Fd(1)p Fe(;)p Fd(7)917 1755 y Fh(p)160 b(F)1133 1762 y Fd(10)p Fe(;)p Fd(70)1428 1755 y Fh(p)g(F)1644 1762 y Fd(10)p Fe(;)p Fd(70)1939 1755 y Fh(p)p 0 1775 V 25 1817 a Fo(Tw)o(o-p)q(oin)o(t)17 b(Con)o(trol)494 1877 y Fh(x)155 b(<)14 b Fo(1)137 b Fh(ns)187 b Fo(6)p Fh(:)p Fo(73)50 b Fh(<)14 b Fo(0)p Fh(:)p Fo(0001)188 b(2)p Fh(:)p Fo(22)100 b Fh(<)14 b Fo(0)p Fh(:)p Fo(05)495 1938 y Fh(y)158 b(<)14 b Fo(1)137 b Fh(ns)187 b Fo(9)p Fh(:)p Fo(73)50 b Fh(<)14 b Fo(0)p Fh(:)p Fo(0001)188 b(1)p Fh(:)p Fo(54)e Fh(ns)25 1998 y Fo(Tw)o(o-p)q(oin)o(t)17 b(Y)f(Shift)494 2058 y Fh(x)155 b(<)14 b Fo(1)137 b Fh(ns)162 b Fo(12)p Fh(:)p Fo(66)51 b Fh(<)14 b Fo(0)p Fh(:)p Fo(0001)188 b(1.82)e Fh(ns)495 2118 y(y)158 b(<)14 b Fo(1)137 b Fh(ns)162 b Fo(16)p Fh(:)p Fo(54)51 b Fh(<)14 b Fo(0)p Fh(:)p Fo(0001)164 b(12.73)51 b Fh(<)14 b Fo(0)p Fh(:)p Fo(0001)p 0 2138 V 0 2272 a(T)l(able)e(2:)19 b(Summary)10 b(of)i(the)f(t)o(w)o(o-factor) i(within-sub)s(ject)e(ANO)o(V)-5 b(As)9 b(for)j(the)g(\014v)o(e)f(exp)q (erimen)o(tal)e(groups)0 2332 y(and)17 b(t)o(w)o(o)f(directions)f (\(Dir\).)21 b(Non-signi\014can)o(t)c(e\013ects)f(at)g(the)g Fh(\013)e Fo(=)g(0)p Fh(:)p Fo(05)j(lev)o(el)d(are)j(denoted)f(b)o(y)g Fh(ns)p Fo(.)p eop %%Page: 24 24 24 23 bop 0 -60 a Fl(Ghahramani)16 b(et)g(al.)830 b(Visuomotor)16 b(Generalization)105 b Fo(24)764 94 y Fm(Figure)20 b(Captions)98 197 y Fo(Figure)15 b(1.)p 98 213 192 2 v 12 w(Sc)o(hematic)10 b(of)i(some)f(p)q(ossible)h(patterns)h(of)f(generalization)f(arising)i (from)e(a)h(remapping)0 257 y(of)g(the)g(cen)o(tral)f(visual)h(target)g (to)g(a)h(\014nger)f(p)q(osition)g(to)h(the)e(righ)o(t)h(of)g(the)g (target.)20 b(The)12 b(arro)o(ws)h(represen)o(t)0 317 y(p)q(ossible)i(c)o(hanges)g(in)g(p)q(oin)o(ting)g(b)q(eha)o(vior)g (after)g(exp)q(osure)g(to)g(this)g(remapping.)20 b(A)14 b(righ)o(t)o(w)o(ard)h(c)o(hange)0 377 y(in)f(p)q(oin)o(ting)g(\(arro)o (w)g(to)h(the)e(righ)o(t\))h(at)g(the)g(cen)o(tral)f(target)h(corresp)q (onds)h(to)g(direct)e(adaptiv)o(e)g(e\013ects)h(of)0 437 y(the)e(p)q(erturbation;)i(an)o(y)f(c)o(hanges)g(at)g(the)f(other)h (eigh)o(t)f(targets)h(corresp)q(ond)g(to)g(indirect)f(generalization)0 498 y(e\013ects.)98 601 y(Figure)j(2.)p 98 617 V 14 w(Apparatus)g(used) e(to)i(in)o(tro)q(duce)e(limited)e(visuo-motor)i(remappings.)20 b(The)13 b(p)q(osition)i(of)0 661 y(the)d(\014nger)h(w)o(as)f(captured) h(on-line)e(b)o(y)h(a)h(computer)e(whic)o(h)g(calculated)h(the)g(p)q (erturb)q(ed)g(\014nger)h(p)q(osition.)0 721 y(The)j(feedbac)o(k)f(of)h (\014nger)g(p)q(osition)g(w)o(as)h(pro)s(jected)e(on)o(to)h(a)g(screen) f(as)i(a)f(cursor)g(sp)q(ot.)22 b(Lo)q(oking)c(do)o(wn)0 781 y(at)k(the)f(mirror,)g(the)g(sub)s(jects)g(sa)o(w)h(the)f(virtual)f (image)g(of)i(the)f(cursor)h(sp)q(ot,)h(in)e(the)g(plane)h(of)f(the)0 841 y(\014nger|the)g(actual)h(\014nger)g(lo)q(cation)g(w)o(as)g(hidden) f(from)g(view.)36 b(By)21 b(con)o(trolling)g(the)h(illumination)0 902 y(of)f(the)f(cursor)h(sp)q(ot,)h(the)f(visual)f(feedbac)o(k,)g(and) h(therefore)f(the)g(remapping,)g(could)g(b)q(e)h(limited)d(to)0 962 y(particular)e(areas)h(of)f(the)g(w)o(orkspace.)98 1065 y(Figure)f(3.)p 98 1081 V 19 w(a\))k(The)g(p)q(osition)h(of)f(the) f(grid)h(of)g(targets)h(is)e(sho)o(wn)i(relativ)o(e)d(to)i(the)g(sub)s (ject.)28 b(Also)0 1125 y(sho)o(wn,)15 b(for)g(the)f Fh(x)p Fo(-shift)g(condition,)g(is)g(the)g(p)q(erceiv)o(ed)f(and)i (actual)f(\014nger)h(p)q(osition)g(when)f(p)q(oin)o(ting)h(to)0 1185 y(the)c(cen)o(tral)g(training)g(target.)20 b(The)11 b(visually)g(p)q(erceiv)o(ed)e(\014nger)j(p)q(osition)g(is)f(indicated) g(b)o(y)f(a)i(cursor)g(sp)q(ot)0 1246 y(whic)o(h)i(is)h(displaced)g (from)f(the)h(actual)g(\014nger)g(p)q(osition.)21 b(b\))16 b(A)e(sc)o(hematic)f(sho)o(wing)j(the)e(p)q(erturbation)0 1306 y(for)i(the)g Fh(x)p Fo(-shift)g(group.)23 b(T)l(o)16 b(see)g(the)g(cursor)h(sp)q(ot)g(on)g(the)f(cen)o(tral)f(target)h(the)g (sub)s(jects)g(had)h(to)g(place)0 1366 y(their)d(\014nger)i(at)f(the)g (p)q(osition)h(indicated)e(b)o(y)g(the)h(tip)g(of)g(the)g(arro)o(w|a)h (10)g(cm)d(one-p)q(oin)o(t)j(visuomotor)0 1426 y(remapping.)22 b(c\))16 b(A)g(sc)o(hematic)f(similar)f(to)j(b\))g(sho)o(wing)h(the)e (p)q(erturbation)i(for)f(the)f(one-p)q(oin)o(t)h Fh(y)r Fo(-shift)0 1486 y(group.)22 b(d\))16 b(A)g(sc)o(hematic)e(sho)o(wing)j (the)f(p)q(erturbation)h(for)f(the)g(t)o(w)o(o-p)q(oin)o(t)h Fh(y)r Fo(-shift)f(group.)98 1589 y(Figure)f(4.)p 98 1606 V 14 w(The)f(targets)h(\(solid)f(squares\))g(and)h(pre-exp)q (osure)f(p)q(oin)o(ting)g(lo)q(cations)h(are)f(sho)o(wn,)h(for)0 1650 y(all)h(\014v)o(e)f(groups,)i(as)g(95\045)g(con\014dence)e (ellipses)g(cen)o(tered)g(around)i(the)f(mean.)98 1753 y(Figure)f(5.)p 98 1769 V 14 w(T)l(arget)f(acquisition)e(time)f(as)j(a) g(function)f(of)h(trial)f(during)g(the)g(exp)q(osure)h(phase)g(for)f (the)0 1813 y(a\))20 b(one-p)q(oin)o(t)g Fh(x)p Fo(-shift,)g(b\))f (one-p)q(oin)o(t)h Fh(y)r Fo(-shift,)g(and)g(c\))f(t)o(w)o(o-p)q(oin)o (t)h Fh(y)r Fo(-shift)f(groups,)j(plotted)d(relativ)o(e)0 1873 y(to)f(their)f(resp)q(ectiv)o(e)f(con)o(trols.)25 b(F)l(or)17 b(clarit)o(y)l(,)f(the)i(standard)g(error)g(bars)g(are)g (sho)o(wn)g(in)f(one)h(direction)0 1933 y(only)l(.)98 2036 y(Figure)d(6.)p 98 2053 V 24 w(Av)o(erage)23 b(c)o(hange)h(in)g(p) q(oin)o(ting)g(for)g(the)f(a\))i(one-p)q(oin)o(t)f(and)h(c\))e(t)o(w)o (o-p)q(oin)o(t)h(con)o(trol)0 2096 y(groups.)30 b(The)19 b(arro)o(ws)h(sho)o(w)f(the)g(c)o(hange)g(cen)o(tered)e(on)j(the)e (visually)g(presen)o(ted)g(target)h(along)h(with)0 2157 y(95\045)e(con\014dence)f(ellipses.)23 b(V)l(ector)17 b(\014eld)g(of)h(c)o(hanges)f(smo)q(othed)h(with)f(Gaussian)i(k)o (ernels)d(for)i(the)f(b\))0 2217 y(one-p)q(oin)o(t)g(and)g(d\))f(t)o(w) o(o-p)q(oin)o(t)g(con)o(trol)g(groups.)98 2320 y(Figure)f(7.)p 98 2336 V 18 w(Av)o(erage)h(c)o(hange)i(in)f(p)q(oin)o(ting)g(for)h (the)f(a\))h(one-p)q(oin)o(t)g Fh(x)p Fo(-shift,)f(b\))h(one-p)q(oin)o (t)g Fh(y)r Fo(-shift,)0 2380 y(and)h(c\))f(t)o(w)o(o-p)q(oin)o(t)g Fh(y)r Fo(-shift)g(groups.)28 b(Smo)q(othed)18 b(v)o(ector)f(\014eld)h (of)g(c)o(hanges)g(for)h(d\))f(one-p)q(oin)o(t)h Fh(x)p Fo(-shift,)0 2440 y(e\))e(one-p)q(oin)o(t)h Fh(y)r Fo(-shift,)f(and)i (f)s(\))e(t)o(w)o(o-p)q(oin)o(t)h Fh(y)r Fo(-shift)f(groups.)27 b(Prop)q(ortion)19 b(adaptation)g(relativ)o(e)c(to)j(the)0 2501 y(size)g(of)h(the)g(p)q(erturbation)g(for)h(the)e(g\))h(one-p)q (oin)o(t)h Fh(x)p Fo(-shift,)f(h\))g(one-p)q(oin)o(t)g Fh(y)r Fo(-shift,)g(and)g(i\))g(t)o(w)o(o-p)q(oin)o(t)0 2561 y Fh(y)r Fo(-shift)g(groups.)31 b(In)19 b(g\))h(ligh)o(test)e (shade)i(corresp)q(onds)g(to)g(40\045)f(adaptation)i(and)f(the)f(dark)o (est)g(shade)0 2621 y(corresp)q(onds)j(to)g(11\045)g(adaptation;)i(in)d (h\))g(the)g(ligh)o(test)g(shade)g(corresp)q(onds)i(corresp)q(onds)f (to)g(16\045)0 2681 y(adaptation)h(and)e(the)g(dark)o(est)h(shade)f (corresp)q(onds)i(to)e(6\045)h(adaptation;)i(in)d(i\))g(the)g(ligh)o (test)g(shade)0 2741 y(corresp)q(onds)15 b(to)f(58\045)g(adaptation)h (in)f(the)f(p)q(ositiv)o(e)g Fh(y)j Fo(direction)c(and)j(the)e(dark)o (est)h(shade)g(corresp)q(onds)p eop %%Page: 25 25 25 24 bop 0 94 a Fo(to)17 b(42\045)f(adaptation)i(in)e(the)g(negativ)o (e)f Fh(y)j Fo(direction.)98 197 y(Figure)d(8.)p 98 213 192 2 v 19 w(P)o(attern)j(of)h(generalization)e(for)i(the)f(mo)q(del)f (under)h(eac)o(h)g(of)h(the)f(three)g(di\013eren)o(t)f(ex-)0 257 y(p)q(erimen)o(tal)c(conditions.)21 b(Av)o(erage)14 b(c)o(hange)i(in)f(p)q(oin)o(ting)g(for)h(the)f(a\))g(one-p)q(oin)o(t)h Fh(x)p Fo(-shift,)f(b\))g(one-p)q(oin)o(t)0 317 y Fh(y)r Fo(-shift,)22 b(and)g(c\))f(t)o(w)o(o-p)q(oin)o(t)h Fh(y)r Fo(-shift)f(condition.)36 b(This)22 b(w)o(as)g(computed)e(b)o(y)h (subtracting)h(pre-)f(from)0 377 y(p)q(ost-exp)q(osure)f(p)q(oin)o (ting)e(of)h(the)f(mo)q(del)f(to)h(targets)h(at)g(5)g(cm)d(in)o(terv)m (als)i(o)o(v)o(er)f(the)h(w)o(orkspace.)27 b(Pro-)0 437 y(p)q(ortion)21 b(adaptation)g(relativ)o(e)d(to)i(the)f(size)g(of)i (the)e(p)q(erturbation)i(for)f(the)f(d\))h(one-p)q(oin)o(t)g Fh(x)p Fo(-shift,)g(e\))0 498 y(one-p)q(oin)o(t)d Fh(y)r Fo(-shift,)e(and)i(f)s(\))g(t)o(w)o(o-p)q(oin)o(t)f Fh(y)r Fo(-shift)g(conditions.)p eop %%Page: 26 26 26 25 bop 868 119 a Fo(Figure)16 b(1:)8 148 y 30785863 22165818 0 23023616 40258437 52099153 startTexFig 8 148 a %%BeginDocument: poss.ps save userdict /IslandDrawDict 300 dict dup begin put /ncpoint errordict /nocurrentpoint get def errordict begin /nocurrentpoint { dup /pathbbox load eq { pop 0 0 1 1 } { ncpoint } ifelse } bind def end /image_raster { %% sw sh dw dh xs ys translate scale /sh exch def /sw exch def /imagebuf sw 7 add 8 idiv string def sw sh 1 [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } image } bind def /m {moveto} bind def /l {lineto} bind def /c {curveto} bind def /n {newpath} bind def /cl {closepath} bind def /ar { %% sa ea sx sy rot tx ty matrix currentmatrix 8 1 roll translate rotate scale n 0 0 1 5 3 roll arc setmatrix } bind def /arn { %% sa ea sx sy rot tx ty matrix currentmatrix 8 1 roll translate rotate scale n 0 0 1 5 3 roll arcn setmatrix } bind def /el { %% sx sy rot tx ty matrix currentmatrix 6 1 roll translate rotate scale n 0 0 1 0 360 arc setmatrix cl } bind def /bp {setlinejoin setlinewidth setrgbcolor} bind def /bpbw {setlinejoin setlinewidth setgray} bind def /lw {setlinewidth} bind def /lj {setlinejoin} bind def /gr {setgray} bind def /BPSIDE 32 def %% pixels per pattern side /PATFREQ 3.0 def %% pattern pixels per mm /dp_mat [PATFREQ 0 0 PATFREQ 0 0] def /dp_pw BPSIDE def %% pattern pixel width /dp_ph BPSIDE def %% pattern pixel height /dp_w dp_pw PATFREQ div def %% pattern mm width /dp_h dp_ph PATFREQ div def %% pattern mm height /dp_bs 1 def %% pattern bits per pixel /savemat matrix def /topmat matrix def /patmat matrix def /patpath { /inv exch def topmat setmatrix pathbbox %% get lo - hi indecies /hy exch dp_h div floor cvi def /hx exch dp_w div floor cvi def /ly exch dp_h div floor cvi def /lx exch dp_w div floor cvi def lx 1 hx { dp_w mul ly 1 hy { dp_h mul exch dup 3 1 roll exch patmat currentmatrix pop translate dp_pw dp_ph inv dp_mat dp_proc imagemask patmat setmatrix } for pop } for } bind def % setpattern brush of patterns instead of gray /setpattern { /blue exch def /green exch def /red exch def /freq exch def /bwidth exch def /bpside exch def /bstring exch def /onbits 0 def /offbits 0 def freq 0 {/y exch def /x exch def /xindex x 1 add 2 div bpside mul cvi def /yindex y 1 add 2 div bpside mul cvi def bstring yindex bwidth mul xindex 8 idiv add get not 1 7 xindex 8 mod sub bitshift and 0 ne {/onbits onbits 1 add def 1} {/offbits offbits 1 add def 0} ifelse } setscreen {} settransfer systemdict /setcmykcolor known { /fact 1 onbits offbits onbits add div sub def 1 red sub fact mul 1 green sub fact mul 1 blue sub fact mul 0 setcmykcolor } { offbits offbits onbits add div setgray } ifelse } bind def /dmatrix matrix def /dpi 72 0 dmatrix defaultmatrix dtransform dup mul exch dup mul add sqrt def /B {gsave bp stroke grestore} bind def %% brush: gr lw lj /Bbw {gsave bpbw stroke grestore} bind def %% brush: gr lw lj /F {gsave setrgbcolor eofill grestore} bind def %% fill: gr /Fbw {gsave setgray eofill grestore} bind def %% fill: gr /PB {gsave setlinejoin setlinewidth setpattern stroke grestore} bind def /PF {gsave eoclip patpath grestore} bind def /BB { gsave setrgbcolor setlinejoin setlinewidth strokepath clip patpath grestore } bind def /BLACK { 0.0 } bind def /CP {closepath} bind def /FI {eofill} bind def /E {exch} bind def /FF {findfont} bind def /GR {grestore} bind def /GS {gsave} bind def /MF {makefont} bind def /NP {newpath} bind def /RO {rotate} bind def /ST {stroke} bind def /SC {scale} bind def /SF {setfont} bind def /SG {setgray} bind def /SLC {setlinecap} bind def /SLJ {setlinejoin} bind def /SLW {setlinewidth} bind def /TR {translate} bind def /WHITE { 1.0 } bind def /m {moveto} bind def /r {rmoveto} bind def /l {lineto} bind def /sp {x 0 rmoveto} bind def /rl {rlineto} bind def /s {show} bind def /box { NP m l l l CP } bind def /pageboundary { NP m l l l CP } bind def /BS { % black stroke GS SLJ SLW BLACK SG ST GR } bind def /WS { % white stroke GS SLJ SLW WHITE SG ST GR } bind def /reencode_small_dict 12 dict def /ReencodeSmall { reencode_small_dict begin /new_codes_and_names E def /new_font_name E def /base_font_name E def /base_font_dict base_font_name FF def /newfont base_font_dict maxlength dict def base_font_dict { E dup /FID ne { dup /Encoding eq { E dup length array copy newfont 3 1 roll put } { E newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall newfont /FontName new_font_name put new_codes_and_names aload pop new_codes_and_names length 2 idiv { newfont /Encoding get 3 1 roll put } repeat new_font_name newfont definefont pop end %reencode_small_dict } def /extended_Zapf [ 8#223 /a89 8#224 /a90 8#225 /a93 8#226 /a94 8#227 /a91 8#230 /a92 8#231 /a205 8#232 /a85 8#233 /a206 8#234 /a86 8#235 /a87 8#236 /a88 8#237 /a95 8#240 /a96 ] def /extended_Standard [ 29 /thorn 30 /yacute 31 /divide 128 /Acircumflex 129 /Adieresis 130 /Agrave 131 /Aring 132 /Atilde 133 /Ccedilla 134 /Eacute 135 /Ecircumflex 136 /Edieresis 137 /Egrave 138 /Iacute 139 /Icircumflex 140 /Idieresis 141 /Igrave 142 /Ntilde 143 /Oacute 144 /Ocircumflex 145 /Odieresis 146 /Ograve 147 /Otilde 148 /Scaron 149 /Uacute 150 /Ucircumflex 151 /Udieresis 152 /Ugrave 153 /Ydieresis 154 /Zcaron 155 /aacute 156 /acircumflex 157 /adieresis 158 /agrave 159 /aring 160 /atilde 161 /exclamdown 162 /cent 163 /sterling 164 /fraction 165 /yen 166 /florin 167 /section 168 /currency 169 /quotesingle 170 /quotedblleft 171 /guillemotleft 172 /guilsinglleft 173 /guilsinglright 174 /fi 175 /fl 176 /plusminus 177 /endash 178 /dagger 179 /daggerdbl 180 /periodcentered 181 /twosuperior 182 /paragraph 183 /bullet 184 /quotesinglebase 185 /quotedblbase 186 /quotedblright 187 /guillemotright 188 /ellipsis 189 /perthousand 190 /threesuperior 191 /questiondown 192 /mu 193 /grave 194 /acute 195 /circumflex 196 /tilde 197 /macron 198 /breve 199 /dotaccent 200 /dieresis 201 /onesuperior 202 /ring 203 /cedilla 204 /onequarter 205 /hungarumlaut 206 /ogonek 207 /caron 208 /emdash 209 /ccedilla 210 /copyright 211 /eacute 212 /ecircumflex 213 /edieresis 214 /egrave 215 /iacute 216 /icircumflex 217 /idieresis 218 /igrave 219 /logicalnot 220 /minus 221 /ntilde 222 /oacute 223 /ocircumflex 224 /odieresis 225 /AE 226 /onehalf 227 /ordfeminine 228 /ograve 229 /otilde 230 /registered 231 /scaron 232 /Lslash 233 /Oslash 234 /OE 235 /ordmasculine 236 /trademark 237 /uacute 238 /ucircumflex 239 /udieresis 240 /ugrave 241 /ae 242 /ydieresis 243 /zcaron 244 /Aacute 245 /dotlessi 246 /threequarters 247 /Eth 248 /lslash 249 /oslash 250 /oe 251 /germandbls 252 /multiply 253 /Yacute 254 /Thorn 255 /eth ] def /extended_Symbol [ ] def /extend_font { % stack: fontname newfontname E dup (ZapfDingbats) eq { cvn E cvn extended_Zapf ReencodeSmall } { dup (Symbol) eq { cvn E cvn extended_Symbol ReencodeSmall } { cvn E cvn extended_Standard ReencodeSmall } ifelse } ifelse } bind def /getfont { /f E def f cvn where % { begin f cvx cvn exec SF end } { begin f cvn load exec SF end } % { f 0 f length 8 sub getinterval (LocalFont) extend_font %/LocalFont FF { f 0 f length 8 sub getinterval dup dup length 1 add string /localfont exch def localfont exch 0 exch putinterval localfont dup length 1 sub (X) putinterval localfont extend_font localfont FF /xsz f f length 4 sub 4 getinterval cvi def /ysz f f length 8 sub 4 getinterval cvi def [ xsz 0 0 ysz neg 0 0 ] MF dup f cvn E def SF } ifelse } bind def /ul { % space drop thickness GS currentpoint currentlinewidth currentpoint NP m 6 -3 roll SLW 0 E r 0 rl ST SLW m GR } bind def /ss { currentpoint pop E m } bind def /image_raster { % sw sh dw dh xs ys TR SC /sh E def /sw E def /imagebuf sw 7 add 8 idiv string def sw sh 1 [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } image } bind def /imagemask_raster { TR SC /sh E def /sw E def /imagebuf sw 7 add 8 idiv string def sw sh false [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } imagemask } bind def /image_color_raster { % sw sh sd dw dh xs ys systemdict /colorimage known not { /colorimage /colimg load def } if TR SC /sd E def /sh E def /sw E def /imagebuf sw 3 mul sd mul 7 add 8 idiv string def sw sh sd [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } false 3 colorimage } bind def /nx { /x E def } bind def 0. nx gsave 2.83465 -2.83465 scale 0 -279.4 translate topmat currentmatrix pop % Group n 20.124 45.323 m 21.267 45.323 l 21.267 46.466 l 20.124 46.466 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 49.247 45.323 m 50.39 45.323 l 50.39 46.466 l 49.247 46.466 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 34.773 45.277 m 35.916 45.277 l 35.916 46.421 l 34.773 46.421 l cl gsave 0 0.176 1 Bbw grestore n 20.124 30.883 m 21.267 30.883 l 21.267 32.026 l 20.124 32.026 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 49.247 30.883 m 50.39 30.883 l 50.39 32.026 l 49.247 32.026 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 34.652 30.883 m 35.795 30.883 l 35.795 32.026 l 34.652 32.026 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 20.124 59.976 m 21.267 59.976 l 21.267 61.12 l 20.124 61.12 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 49.247 59.976 m 50.39 59.976 l 50.39 61.12 l 49.247 61.12 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 34.652 59.976 m 35.795 59.976 l 35.795 61.12 l 34.652 61.12 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 9.3289 20.782 m 61.186 20.782 l 61.186 72.329 l 9.3289 72.329 l cl gsave 0 0 1 Bbw grestore n 160.22 45.323 m 161.36 45.323 l 161.36 46.466 l 160.22 46.466 l cl gsave 0 0.176 1 Bbw grestore n 189.34 45.323 m 190.49 45.323 l 190.49 46.466 l 189.34 46.466 l cl gsave 0 0.176 1 Bbw grestore n 174.87 45.277 m 176.01 45.277 l 176.01 46.421 l 174.87 46.421 l cl gsave 0 0.176 1 Bbw grestore n 160.22 30.883 m 161.36 30.883 l 161.36 32.026 l 160.22 32.026 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 189.34 30.883 m 190.49 30.883 l 190.49 32.026 l 189.34 32.026 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 174.75 30.883 m 175.89 30.883 l 175.89 32.026 l 174.75 32.026 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 160.22 59.976 m 161.36 59.976 l 161.36 61.12 l 160.22 61.12 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 189.34 59.976 m 190.49 59.976 l 190.49 61.12 l 189.34 61.12 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 174.75 59.976 m 175.89 59.976 l 175.89 61.12 l 174.75 61.12 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 149.43 20.782 m 201.28 20.782 l 201.28 72.329 l 149.43 72.329 l cl gsave 0 0 1 Bbw grestore n 180.98 63.07 m 176.15 62.421 l 177.51 59.656 l cl 0 Fbw n 175.94 60.602 m 176.83 61.038 l gsave 0 0.706 1 Bbw grestore n 166.42 60.809 m 161.8 62.348 l 161.8 59.269 l cl 0 Fbw n 161.24 60.809 m 161.8 60.809 l gsave 0 0.706 1 Bbw grestore n 195.2 62.672 m 190.35 62.243 l 191.58 59.419 l cl 0 Fbw n 190.44 60.602 m 190.96 60.831 l gsave 0 0.706 1 Bbw grestore n 196.23 49.006 m 191.49 47.896 l 193.11 45.274 l cl 0 Fbw n 190.85 45.693 m 192.3 46.585 l gsave 0 0.706 1 Bbw grestore n 167.45 45.9 m 162.83 47.44 l 162.83 44.361 l cl 0 Fbw n 161.24 45.9 m 162.83 45.9 l gsave 0 0.706 1 Bbw grestore n 173.46 32.234 m 168.81 33.695 l 168.87 30.616 l cl 0 Fbw n 161.24 32.027 m 168.84 32.155 l gsave 0 0.706 1 Bbw grestore n 186.29 34.304 m 181.45 34.745 l 182.15 31.748 l cl 0 Fbw n 175.73 31.82 m 181.8 33.247 l gsave 0 0.706 1 Bbw grestore n 199.34 36.789 m 194.57 35.799 l 196.12 33.137 l cl 0 Fbw n 190.44 31.613 m 195.35 34.468 l gsave 0 0.706 1 Bbw grestore n 185.16 46.521 m 180.43 47.641 l 180.7 44.575 l cl 0 Fbw n 175.94 45.693 m 180.56 46.108 l gsave 0 0.706 1 Bbw grestore n 20.234 113.92 m 21.378 113.92 l 21.378 115.06 l 20.234 115.06 l cl gsave 0 0.176 1 Bbw grestore n 49.358 113.92 m 50.501 113.92 l 50.501 115.06 l 49.358 115.06 l cl gsave 0 0.176 1 Bbw grestore n 34.883 113.87 m 36.026 113.87 l 36.026 115.02 l 34.883 115.02 l cl gsave 0 0.176 1 Bbw grestore n 20.234 99.48 m 21.378 99.48 l 21.378 100.62 l 20.234 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 49.358 99.48 m 50.501 99.48 l 50.501 100.62 l 49.358 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 34.762 99.48 m 35.905 99.48 l 35.905 100.62 l 34.762 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 20.234 128.57 m 21.378 128.57 l 21.378 129.72 l 20.234 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 49.358 128.57 m 50.501 128.57 l 50.501 129.72 l 49.358 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 34.762 128.57 m 35.905 128.57 l 35.905 129.72 l 34.762 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 9.4392 89.379 m 61.297 89.379 l 61.297 140.93 l 9.4392 140.93 l cl gsave 0 0 1 Bbw grestore n 29.501 99.968 m 24.883 101.51 l 24.883 98.429 l cl 0 Fbw n 20.805 99.968 m 24.883 99.968 l gsave 0 0.706 1 Bbw grestore n 28.88 100.18 m 24.262 101.71 l 24.262 98.636 l cl 0 Fbw n 20.184 100.18 m 24.262 100.18 l gsave 0 0.706 1 Bbw grestore n 44.237 100.21 m 39.619 101.75 l 39.619 98.67 l cl 0 Fbw n 35.541 100.21 m 39.619 100.21 l gsave 0 0.706 1 Bbw grestore n 58.352 99.83 m 53.734 101.37 l 53.734 98.29 l cl 0 Fbw n 49.656 99.83 m 53.734 99.83 l gsave 0 0.706 1 Bbw grestore n 29.604 114.77 m 24.986 116.31 l 24.986 113.23 l cl 0 Fbw n 20.908 114.77 m 24.986 114.77 l gsave 0 0.706 1 Bbw grestore n 44.133 114.19 m 39.515 115.73 l 39.515 112.65 l cl 0 Fbw n 35.437 114.19 m 39.515 114.19 l gsave 0 0.706 1 Bbw grestore n 58.869 114.43 m 54.251 115.97 l 54.251 112.89 l cl 0 Fbw n 50.173 114.43 m 54.251 114.43 l gsave 0 0.706 1 Bbw grestore n 43.787 128.96 m 39.169 130.5 l 39.169 127.42 l cl 0 Fbw n 35.091 128.96 m 39.169 128.96 l gsave 0 0.706 1 Bbw grestore n 30.155 128.78 m 25.537 130.32 l 25.537 127.24 l cl 0 Fbw n 21.459 128.78 m 25.537 128.78 l gsave 0 0.706 1 Bbw grestore n 58.49 129.16 m 53.872 130.7 l 53.872 127.63 l cl 0 Fbw n 49.794 129.16 m 53.872 129.16 l gsave 0 0.706 1 Bbw grestore n 160.58 113.92 m 161.72 113.92 l 161.72 115.06 l 160.58 115.06 l cl gsave 0 0.176 1 Bbw grestore n 189.7 113.92 m 190.84 113.92 l 190.84 115.06 l 189.7 115.06 l cl gsave 0 0.176 1 Bbw grestore n 175.23 113.87 m 176.37 113.87 l 176.37 115.02 l 175.23 115.02 l cl gsave 0 0.176 1 Bbw grestore n 160.58 99.48 m 161.72 99.48 l 161.72 100.62 l 160.58 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 189.7 99.48 m 190.84 99.48 l 190.84 100.62 l 189.7 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 175.11 99.48 m 176.25 99.48 l 176.25 100.62 l 175.11 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 160.58 128.57 m 161.72 128.57 l 161.72 129.72 l 160.58 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 189.7 128.57 m 190.84 128.57 l 190.84 129.72 l 189.7 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 175.11 128.57 m 176.25 128.57 l 176.25 129.72 l 175.11 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 149.78 89.379 m 201.64 89.379 l 201.64 140.93 l 149.78 140.93 l cl gsave 0 0 1 Bbw grestore n 161.22 100.24 m 170.38 97.228 l 0 Fbw n 170.38 97.228 m 166.47 100.13 l 165.51 97.21 l cl 0 Fbw n 161.22 100.24 m 165.99 98.672 l gsave 0 0.706 1 Bbw grestore n 175.09 100.04 m 187.27 102.8 l 0 Fbw n 187.27 102.8 m 182.43 103.28 l 183.11 100.28 l cl 0 Fbw n 175.09 100.04 m 182.77 101.78 l gsave 0 0.706 1 Bbw grestore n 190.21 100.04 m 197.48 96.097 l 0 Fbw n 197.48 96.097 m 194.15 99.651 l 192.68 96.944 l cl 0 Fbw n 190.21 100.04 m 193.42 98.298 l gsave 0 0.706 1 Bbw grestore n 161.42 114.53 m 168.37 111.29 l 0 Fbw n 168.37 111.29 m 164.83 114.64 l 163.53 111.85 l cl 0 Fbw n 161.42 114.53 m 164.18 113.24 l gsave 0 0.706 1 Bbw grestore n 175.5 114.53 m 186.69 114.32 l 0 Fbw n 186.69 114.32 m 182.1 115.95 l 182.04 112.87 l cl 0 Fbw n 175.5 114.53 m 182.07 114.41 l gsave 0 0.706 1 Bbw grestore n 190.21 114.74 m 196.42 110.69 l 0 Fbw n 196.42 110.69 m 193.39 114.5 l 191.71 111.92 l cl 0 Fbw n 190.21 114.74 m 192.55 113.21 l gsave 0 0.706 1 Bbw grestore n 161.22 129.03 m 168.82 125.43 l 0 Fbw n 168.82 125.43 m 165.31 128.79 l 163.99 126.01 l cl 0 Fbw n 161.22 129.03 m 164.65 127.4 l gsave 0 0.706 1 Bbw grestore n 190 128.82 m 195.88 125.61 l 0 Fbw n 195.88 125.61 m 192.57 129.17 l 191.09 126.47 l cl 0 Fbw n 190 128.82 m 191.83 127.82 l gsave 0 0.706 1 Bbw grestore n 175.92 129.23 m 184.16 132.73 l 0 Fbw n 184.16 132.73 m 179.3 132.34 l 180.51 129.51 l cl 0 Fbw n 175.92 129.23 m 179.9 130.92 l gsave 0 0.706 1 Bbw grestore n savemat currentmatrix pop [0.5625 0 0 0.5625 106.386 17.9623] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -712 0 m 0 ss (Helvetica06000600) getfont () s 0.00 SG (Local) s savemat setmatrix n 90.764 45.323 m 91.907 45.323 l 91.907 46.466 l 90.764 46.466 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 119.89 45.323 m 121.03 45.323 l 121.03 46.466 l 119.89 46.466 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 105.41 45.277 m 106.56 45.277 l 106.56 46.421 l 105.41 46.421 l cl gsave 0 0.176 1 Bbw grestore n 90.764 30.883 m 91.907 30.883 l 91.907 32.026 l 90.764 32.026 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 119.89 30.883 m 121.03 30.883 l 121.03 32.026 l 119.89 32.026 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 105.29 30.883 m 106.43 30.883 l 106.43 32.026 l 105.29 32.026 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 90.764 59.976 m 91.907 59.976 l 91.907 61.12 l 90.764 61.12 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 119.89 59.976 m 121.03 59.976 l 121.03 61.12 l 119.89 61.12 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 105.29 59.976 m 106.43 59.976 l 106.43 61.12 l 105.29 61.12 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore n 79.969 20.782 m 131.83 20.782 l 131.83 72.329 l 79.969 72.329 l cl gsave 0 0 1 Bbw grestore n 115.47 45.837 m 110.85 47.376 l 110.85 44.297 l cl 0 Fbw n 105.94 45.837 m 110.85 45.837 l gsave 0 0.706 1 Bbw grestore n 89.988 113.92 m 91.131 113.92 l 91.131 115.06 l 89.988 115.06 l cl gsave 0 0.176 1 Bbw grestore n 119.11 113.92 m 120.25 113.92 l 120.25 115.06 l 119.11 115.06 l cl gsave 0 0.176 1 Bbw grestore n 104.64 113.88 m 105.78 113.88 l 105.78 115.02 l 104.64 115.02 l cl gsave 0 0.176 1 Bbw grestore n 89.988 99.481 m 91.131 99.481 l 91.131 100.62 l 89.988 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 119.11 99.481 m 120.25 99.481 l 120.25 100.62 l 119.11 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 104.51 99.481 m 105.66 99.481 l 105.66 100.62 l 104.51 100.62 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 89.988 128.57 m 91.131 128.57 l 91.131 129.72 l 89.988 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 119.11 128.57 m 120.25 128.57 l 120.25 129.72 l 119.11 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 104.51 128.57 m 105.66 128.57 l 105.66 129.72 l 104.51 129.72 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 79.193 89.379 m 131.05 89.379 l 131.05 140.93 l 79.193 140.93 l cl gsave 0 0 1 Bbw grestore n 94.241 100.04 m 91.741 100.88 l 91.741 99.211 l cl 0 Fbw n 90.86 100.04 m 91.741 100.04 l gsave 0 0 1 Bbw grestore n 109.53 100.13 m 106.5 101.14 l 106.5 99.125 l cl 0 Fbw n 105.25 100.13 m 106.5 100.13 l gsave 0 0.176 1 Bbw grestore n 122.78 100.05 m 120.28 100.88 l 120.28 99.216 l cl 0 Fbw n 119.72 100.05 m 120.28 100.05 l gsave 0 0 1 Bbw grestore n 95.011 114.4 m 91.983 115.41 l 91.983 113.4 l cl 0 Fbw n 90.645 114.4 m 91.983 114.4 l gsave 0 0.176 1 Bbw grestore n 124.58 114.5 m 121.55 115.51 l 121.55 113.49 l cl 0 Fbw n 119.57 114.5 m 121.55 114.5 l gsave 0 0.176 1 Bbw grestore n 110.59 129.26 m 107.56 130.27 l 107.56 128.25 l cl 0 Fbw n 104.95 129.26 m 107.56 129.26 l gsave 0 0.176 1 Bbw grestore n 93.755 129.16 m 91.255 130 l 91.255 128.33 l cl 0 Fbw n 90.453 129.16 m 91.255 129.16 l gsave 0 0 1 Bbw grestore n 122.3 129.17 m 119.8 130 l 119.8 128.33 l cl 0 Fbw n 119.39 129.17 m 119.8 129.17 l gsave 0 0 1 Bbw grestore n 113.95 114.55 m 109.33 116.09 l 109.33 113.01 l cl 0 Fbw n 105.25 114.55 m 109.33 114.55 l gsave 0 0.706 1 Bbw grestore n savemat currentmatrix pop [1 0 0 1 35.7072 17.6696] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1008 0 m 0 ss (Helvetica03200320) getfont () s 0.00 SG (No Adaptation) s savemat setmatrix n savemat currentmatrix pop [1 0 0 1 37.1797 85.4029] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1166 0 m 0 ss (Helvetica03200320) getfont () s 0.00 SG (Cartesian Linear) s savemat setmatrix n savemat currentmatrix pop [1 0 0 1 106.386 85.4029] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1387 0 m 0 ss (Helvetica03200320) getfont () s 0.00 SG (Cartesian Decaying) s savemat setmatrix n savemat currentmatrix pop [1 0 0 1 175.591 85.4029] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1122 0 m 0 ss (Helvetica03200320) getfont () s 0.00 SG (Other Nonlinear) s savemat setmatrix n savemat currentmatrix pop [1 0 0 1 174.487 17.6696] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -716 0 m 0 ss (Helvetica03200320) getfont () s 0.00 SG (Rotational) s savemat setmatrix userdict /#copies 1 put showpage grestore end restore %%EndDocument endTexFig eop %%Page: 27 27 27 26 bop 868 119 a Fo(Figure)16 b(2:)8 148 y 30785863 22165818 0 23023616 40258437 52099153 startTexFig 8 148 a %%BeginDocument: setup.ps save userdict /IslandDrawDict 300 dict dup begin put /ncpoint errordict /nocurrentpoint get def errordict begin /nocurrentpoint { dup /pathbbox load eq { pop 0 0 1 1 } { ncpoint } ifelse } bind def end /image_raster { %% sw sh dw dh xs ys translate scale /sh exch def /sw exch def /imagebuf sw 7 add 8 idiv string def sw sh 1 [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } image } bind def /m {moveto} bind def /l {lineto} bind def /c {curveto} bind def /n {newpath} bind def /cl {closepath} bind def /ar { %% sa ea sx sy rot tx ty matrix currentmatrix 8 1 roll translate rotate scale n 0 0 1 5 3 roll arc setmatrix } bind def /arn { %% sa ea sx sy rot tx ty matrix currentmatrix 8 1 roll translate rotate scale n 0 0 1 5 3 roll arcn setmatrix } bind def /el { %% sx sy rot tx ty matrix currentmatrix 6 1 roll translate rotate scale n 0 0 1 0 360 arc setmatrix cl } bind def /bp {setlinejoin setlinewidth setrgbcolor} bind def /bpbw {setlinejoin setlinewidth setgray} bind def /lw {setlinewidth} bind def /lj {setlinejoin} bind def /gr {setgray} bind def /BPSIDE 32 def %% pixels per pattern side /PATFREQ 3.0 def %% pattern pixels per mm /dp_mat [PATFREQ 0 0 PATFREQ 0 0] def /dp_pw BPSIDE def %% pattern pixel width /dp_ph BPSIDE def %% pattern pixel height /dp_w dp_pw PATFREQ div def %% pattern mm width /dp_h dp_ph PATFREQ div def %% pattern mm height /dp_bs 1 def %% pattern bits per pixel /savemat matrix def /topmat matrix def /patmat matrix def /patpath { /inv exch def topmat setmatrix pathbbox %% get lo - hi indecies /hy exch dp_h div floor cvi def /hx exch dp_w div floor cvi def /ly exch dp_h div floor cvi def /lx exch dp_w div floor cvi def lx 1 hx { dp_w mul ly 1 hy { dp_h mul exch dup 3 1 roll exch patmat currentmatrix pop translate dp_pw dp_ph inv dp_mat dp_proc imagemask patmat setmatrix } for pop } for } bind def % setpattern brush of patterns instead of gray /setpattern { /blue exch def /green exch def /red exch def /freq exch def /bwidth exch def /bpside exch def /bstring exch def /onbits 0 def /offbits 0 def freq 0 {/y exch def /x exch def /xindex x 1 add 2 div bpside mul cvi def /yindex y 1 add 2 div bpside mul cvi def bstring yindex bwidth mul xindex 8 idiv add get not 1 7 xindex 8 mod sub bitshift and 0 ne {/onbits onbits 1 add def 1} {/offbits offbits 1 add def 0} ifelse } setscreen {} settransfer systemdict /setcmykcolor known { /fact 1 onbits offbits onbits add div sub def 1 red sub fact mul 1 green sub fact mul 1 blue sub fact mul 0 setcmykcolor } { offbits offbits onbits add div setgray } ifelse } bind def /dmatrix matrix def /dpi 72 0 dmatrix defaultmatrix dtransform dup mul exch dup mul add sqrt def /B {gsave bp stroke grestore} bind def %% brush: gr lw lj /Bbw {gsave bpbw stroke grestore} bind def %% brush: gr lw lj /F {gsave setrgbcolor eofill grestore} bind def %% fill: gr /Fbw {gsave setgray eofill grestore} bind def %% fill: gr /PB {gsave setlinejoin setlinewidth setpattern stroke grestore} bind def /PF {gsave eoclip patpath grestore} bind def /BB { gsave setrgbcolor setlinejoin setlinewidth strokepath clip patpath grestore } bind def /BLACK { 0.0 } bind def /CP {closepath} bind def /FI {eofill} bind def /E {exch} bind def /FF {findfont} bind def /GR {grestore} bind def /GS {gsave} bind def /MF {makefont} bind def /NP {newpath} bind def /RO {rotate} bind def /ST {stroke} bind def /SC {scale} bind def /SF {setfont} bind def /SG {setgray} bind def /SLC {setlinecap} bind def /SLJ {setlinejoin} bind def /SLW {setlinewidth} bind def /TR {translate} bind def /WHITE { 1.0 } bind def /m {moveto} bind def /r {rmoveto} bind def /l {lineto} bind def /sp {x 0 rmoveto} bind def /rl {rlineto} bind def /s {show} bind def /box { NP m l l l CP } bind def /pageboundary { NP m l l l CP } bind def /BS { % black stroke GS SLJ SLW BLACK SG ST GR } bind def /WS { % white stroke GS SLJ SLW WHITE SG ST GR } bind def /reencode_small_dict 12 dict def /ReencodeSmall { reencode_small_dict begin /new_codes_and_names E def /new_font_name E def /base_font_name E def /base_font_dict base_font_name FF def /newfont base_font_dict maxlength dict def base_font_dict { E dup /FID ne { dup /Encoding eq { E dup length array copy newfont 3 1 roll put } { E newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall newfont /FontName new_font_name put new_codes_and_names aload pop new_codes_and_names length 2 idiv { newfont /Encoding get 3 1 roll put } repeat new_font_name newfont definefont pop end %reencode_small_dict } def /extended_Zapf [ 8#223 /a89 8#224 /a90 8#225 /a93 8#226 /a94 8#227 /a91 8#230 /a92 8#231 /a205 8#232 /a85 8#233 /a206 8#234 /a86 8#235 /a87 8#236 /a88 8#237 /a95 8#240 /a96 ] def /extended_Standard [ 29 /thorn 30 /yacute 31 /divide 128 /Acircumflex 129 /Adieresis 130 /Agrave 131 /Aring 132 /Atilde 133 /Ccedilla 134 /Eacute 135 /Ecircumflex 136 /Edieresis 137 /Egrave 138 /Iacute 139 /Icircumflex 140 /Idieresis 141 /Igrave 142 /Ntilde 143 /Oacute 144 /Ocircumflex 145 /Odieresis 146 /Ograve 147 /Otilde 148 /Scaron 149 /Uacute 150 /Ucircumflex 151 /Udieresis 152 /Ugrave 153 /Ydieresis 154 /Zcaron 155 /aacute 156 /acircumflex 157 /adieresis 158 /agrave 159 /aring 160 /atilde 161 /exclamdown 162 /cent 163 /sterling 164 /fraction 165 /yen 166 /florin 167 /section 168 /currency 169 /quotesingle 170 /quotedblleft 171 /guillemotleft 172 /guilsinglleft 173 /guilsinglright 174 /fi 175 /fl 176 /plusminus 177 /endash 178 /dagger 179 /daggerdbl 180 /periodcentered 181 /twosuperior 182 /paragraph 183 /bullet 184 /quotesinglebase 185 /quotedblbase 186 /quotedblright 187 /guillemotright 188 /ellipsis 189 /perthousand 190 /threesuperior 191 /questiondown 192 /mu 193 /grave 194 /acute 195 /circumflex 196 /tilde 197 /macron 198 /breve 199 /dotaccent 200 /dieresis 201 /onesuperior 202 /ring 203 /cedilla 204 /onequarter 205 /hungarumlaut 206 /ogonek 207 /caron 208 /emdash 209 /ccedilla 210 /copyright 211 /eacute 212 /ecircumflex 213 /edieresis 214 /egrave 215 /iacute 216 /icircumflex 217 /idieresis 218 /igrave 219 /logicalnot 220 /minus 221 /ntilde 222 /oacute 223 /ocircumflex 224 /odieresis 225 /AE 226 /onehalf 227 /ordfeminine 228 /ograve 229 /otilde 230 /registered 231 /scaron 232 /Lslash 233 /Oslash 234 /OE 235 /ordmasculine 236 /trademark 237 /uacute 238 /ucircumflex 239 /udieresis 240 /ugrave 241 /ae 242 /ydieresis 243 /zcaron 244 /Aacute 245 /dotlessi 246 /threequarters 247 /Eth 248 /lslash 249 /oslash 250 /oe 251 /germandbls 252 /multiply 253 /Yacute 254 /Thorn 255 /eth ] def /extended_Symbol [ ] def /extend_font { % stack: fontname newfontname E dup (ZapfDingbats) eq { cvn E cvn extended_Zapf ReencodeSmall } { dup (Symbol) eq { cvn E cvn extended_Symbol ReencodeSmall } { cvn E cvn extended_Standard ReencodeSmall } ifelse } ifelse } bind def /getfont { /f E def f cvn where % { begin f cvx cvn exec SF end } { begin f cvn load exec SF end } % { f 0 f length 8 sub getinterval (LocalFont) extend_font %/LocalFont FF { f 0 f length 8 sub getinterval dup dup length 1 add string /localfont exch def localfont exch 0 exch putinterval localfont dup length 1 sub (X) putinterval localfont extend_font localfont FF /xsz f f length 4 sub 4 getinterval cvi def /ysz f f length 8 sub 4 getinterval cvi def [ xsz 0 0 ysz neg 0 0 ] MF dup f cvn E def SF } ifelse } bind def /ul { % space drop thickness GS currentpoint currentlinewidth currentpoint NP m 6 -3 roll SLW 0 E r 0 rl ST SLW m GR } bind def /ss { currentpoint pop E m } bind def /image_raster { % sw sh dw dh xs ys TR SC /sh E def /sw E def /imagebuf sw 7 add 8 idiv string def sw sh 1 [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } image } bind def /imagemask_raster { TR SC /sh E def /sw E def /imagebuf sw 7 add 8 idiv string def sw sh false [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } imagemask } bind def /image_color_raster { % sw sh sd dw dh xs ys systemdict /colorimage known not { /colorimage /colimg load def } if TR SC /sd E def /sh E def /sw E def /imagebuf sw 3 mul sd mul 7 add 8 idiv string def sw sh sd [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } false 3 colorimage } bind def /nx { /x E def } bind def 0. nx gsave 2.83465 -2.83465 scale 0 -279.4 translate topmat currentmatrix pop % Irpoly n 57.819 92.87 m 117.51 92.87 l 117.51 90.148 l 57.819 90.148 l cl 0 Fbw % Curves n 57.819 79.264 m 117.55 79.264 l 1 Fbw gsave 0 0.352 0 Bbw grestore % Curves n 57.819 68.38 m 118.16 68.38 l 0.55 Fbw gsave 0 0.352 0 Bbw grestore % Curves n 87.751 30.284 m 63.262 68.38 l 1 Fbw gsave [2 1 2 1] 0 setdash 0 0.352 0 Bbw grestore % Curves n 90.473 30.284 m 114.96 68.38 l 1 Fbw gsave [2 1 2 1] 0 setdash 0 0.352 0 Bbw grestore % Curves n 87.751 30.284 m 80.886 66.428 l 1 Fbw n 80.886 66.428 m 80.385 62.713 l 82.714 63.156 l cl 0 Fbw n 87.751 30.284 m 81.55 62.934 l gsave [1 1 1 1] 0 setdash 0 0.352 0 Bbw grestore % Curves n 80.62 68.546 m 65.926 79.264 l 1 Fbw n 65.926 79.264 m 68.1 76.211 l 69.497 78.126 l cl 0 Fbw n 80.62 68.546 m 68.799 77.168 l gsave [2 1 2 1] 0 setdash 0 0.352 0 Bbw grestore % Curves n 65.76 79.264 m 53.823 71.521 l 1 Fbw n 53.823 71.521 m 57.451 72.462 l 56.161 74.451 l cl 0 Fbw n 65.76 79.264 m 56.806 73.456 l gsave [2 1 2 1] 0 setdash 0 0.352 0 Bbw grestore % Irpoly n 74.069 88.902 m 82.063 88.902 l 82.063 89.902 l 74.069 89.902 l cl gsave 0 0.352 0 Bbw grestore % Curves n 64.521 138.83 m 64.355 138.14 63.945 131.64 63.693 121.66 c 62.67 116.66 65.642 114.82 61.864 114.75 c 52.41 114.58 44.982 115.37 45.027 113.71 c 43.734 112.52 41.624 104.41 41.695 102.92 c 41.92 98.129 40.788 95.017 41.11 90.433 c 41.559 84.05 45.522 79.253 45.298 78.766 c 44.715 77.497 43.752 75.055 43.566 73.161 c 43.378 71.266 43.423 70.831 44.505 69.27 c 45.588 67.709 46.518 67.441 48.121 67.232 c 49.724 67.024 51.575 67.122 52.803 68.35 c 54.032 69.579 53.184 71.061 53.766 72.497 c 54.349 73.933 54.86 73.951 54.423 74.472 c 53.961 75.022 54.234 74.695 53.735 75.132 c 53.357 75.464 53.641 76.506 53.589 77.343 c 53.539 78.18 53.712 77.642 53.478 78.838 c 53.357 79.459 51.296 78.849 50.661 79.381 c 49.953 79.974 49.505 82.338 49.901 83.524 c 50.295 84.712 51.899 85.524 52.648 87.397 c 53.397 89.271 52.808 91.477 53.265 94.767 c 53.724 98.056 53.182 101.8 53.265 105.03 c 53.349 108.25 62.377 108.46 64.223 108.8 c 66.866 109.28 69.958 108.77 70.01 112.21 c 70.113 119.04 70.441 119.37 70.398 124.29 c 70.379 126.7 69.816 135.72 69.816 135.72 c 69.816 135.72 74.836 136.37 75.52 137.46 c 77.358 140.39 75.599 138.01 72.08 138.93 c 69.672 138.83 68.619 139.05 64.513 138.94 c 1 Fbw gsave 0 0.352 0 Bbw grestore % Curves n 49.769 84.159 m 51.087 85.988 53.146 84.832 56.877 85.556 c 60.54 85.099 62.767 85.248 64.875 85.606 c 68.37 85.498 69.894 86.465 71.193 86.65 c 73.221 86.557 75.621 85.315 75.621 85.315 c 78.924 86.228 l 78.924 86.228 80.34 87.704 80.749 88.265 c 81.16 88.828 81.381 89.425 81.241 89.53 c 81.1 89.635 80.76 89.425 80.398 89.179 c 80.035 88.933 79.954 88.64 79.485 88.195 c 79.017 87.75 78.078 86.791 78.078 86.791 c 75.761 85.877 l 78.22 86.86 l 78.22 86.86 79.392 88.183 79.554 88.546 c 79.719 88.91 79.543 89.179 79.203 89.038 c 78.864 88.899 77.517 87.704 77.517 87.704 c 75.41 86.579 l 77.517 87.844 l 77.517 87.844 78.267 88.676 78.29 88.899 c 78.314 89.122 77.997 89.308 77.658 89.179 c 77.319 89.05 76.253 88.126 76.253 88.126 c 75.129 87.493 l 76.323 88.265 l 76.323 88.265 76.991 88.828 76.956 89.038 c 76.92 89.25 76.112 89.53 76.112 89.53 c 76.112 89.53 74.415 89.237 74.215 89.038 c 74.016 88.839 74.919 88.336 74.919 88.336 c 75.761 88.688 l 74.919 88.265 l 74.637 88.616 l 74.637 88.616 73.571 89.131 72.951 89.109 c 72.33 89.086 71.193 88.546 71.193 88.546 c 71.193 88.546 67.066 89.005 64.735 89.086 c 63.678 89.124 59.722 89.282 56.544 89.833 c 53.664 89.425 51.024 88.677 49.429 88.288 c 1 Fbw gsave 0 0.352 0 Bbw grestore % Irpoly n 44.757 114.05 m 62.244 114.05 l 62.244 117.72 l 44.757 117.72 l cl 0 Fbw % Irpoly n 52.219 117.72 m 55.249 117.72 l 55.249 138.64 l 52.219 138.64 l cl 0 Fbw % Irpoly n 87.751 27.564 m 85.031 30.284 l 93.194 30.284 l 90.473 27.564 l cl 1 Fbw gsave 0 0.352 0 Bbw grestore % Irpoly n 84.862 92.593 m 90.104 92.593 l 90.104 138.57 l 84.862 138.57 l cl 0 Fbw % Curves n 13.119 138.88 m 204.51 138.88 l 1 Fbw gsave 0 0.352 1 Bbw grestore % Curves n 113.23 91.431 m 178.63 91.431 l 1 Fbw gsave 0 0.352 1 Bbw grestore % Curves n 178.87 20.645 m 93.337 20.645 l 1 Fbw n 93.337 20.645 m 96.893 19.46 l 96.893 21.83 l cl 0 Fbw n 178.87 20.645 m 96.893 20.645 l gsave 0 0.352 0 Bbw grestore % Curves n 178.85 91.399 m 178.85 56.926 l 1 Fbw n 178.85 56.926 m 180.04 60.482 l 177.67 60.482 l cl 0 Fbw n 178.85 91.399 m 178.85 60.482 l gsave 0 0.352 1 Bbw grestore % Irpoly n 166.39 38.785 m 191.48 38.785 l 191.48 56.97 l 166.39 56.97 l cl 1 Fbw gsave 0 0.352 0 Bbw grestore % Curves n 178.85 38.785 m 178.85 20.645 l 1 Fbw gsave 0 0.352 0 Bbw grestore % Text n savemat currentmatrix pop [0.726 0 0 0.726 168.231 49.336] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m 0 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Computer) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 177.864 97.26] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -552 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Actual) s -1325 0 m 467 ss (Helvetica04000400) getfont (Finger Position) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 176.933 13.497] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -872 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Perturbed) s -1325 0 m 467 ss (Helvetica04000400) getfont (Finger Position) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 114.609 99.912] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1414 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Digitizing Tablet) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 67.758 20.521] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1105 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (VGA Screen) s -795 0 m 467 ss (Helvetica04000400) getfont (Projector) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 147.009 70.13] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1999 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Rear projection screen) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 143.832 81.306] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1777 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Semi-silvered mirror) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 124.003 40.633] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1425 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Finger feedback) s -541 0 m 467 ss (Helvetica04000400) getfont (image) s savemat setmatrix % Text n savemat currentmatrix pop [0.726 0 0 0.726 107.097 85.255] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -1159 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Virtual image) s savemat setmatrix % Curves n 81.241 89.419 m 65.795 79.264 l 1 Fbw gsave [1 1 1 1] 0 setdash 0 0.352 0 Bbw grestore % Text n savemat currentmatrix pop [0.726 0 0 0.726 74.498 103.539] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -806 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Digitizing) s -596 0 m 467 ss (Helvetica04000400) getfont (Mouse) s savemat setmatrix % Curves n 92.181 83.713 m 82.441 87.61 l 0 Fbw n 82.441 87.61 m 85.302 85.189 l 86.183 87.39 l cl 0 Fbw n 92.181 83.713 m 85.743 86.289 l gsave 0 0.352 1 Bbw grestore % Curves n 110.85 46.481 m 82.594 67.002 l 0 Fbw n 82.594 67.002 m 84.775 63.953 l 86.168 65.872 l cl 0 Fbw n 110.86 46.481 m 85.471 64.913 l gsave 0 0.352 1 Bbw grestore % Curves n 77.549 98.815 m 77.507 93.193 l 1 Fbw n 77.507 93.193 m 78.719 96.74 l 76.348 96.758 l cl 0 Fbw n 77.549 98.815 m 77.534 96.749 l gsave 0 0.352 1 Bbw grestore % Irpoly n 79.937 66.537 m 81.722 66.537 l 81.722 68.286 l 79.937 68.286 l cl 0 Fbw gsave 0 0.352 1 Bbw grestore % Irpoly n 51.688 71.095 m 52.459 70.656 l 53.339 70.821 l 52.514 71.866 l 52.514 71.316 l cl 0.5 Fbw gsave 0 0.352 1 Bbw grestore % Curves n 47.946 82.262 m 48.753 81.73 49.341 82.501 50.477 83.142 c 51.613 83.785 56.697 84.285 56.418 85.563 c 56.032 87.322 56.436 88.111 55.097 89.853 c 54.08 91.177 46.389 88.222 45.087 87.543 c 1 Fbw gsave 0 0.352 1 Bbw grestore % Rfrm n 93.591 26.015 m 93.593 26.416 93.428 26.814 93.143 27.097 c 92.86 27.382 92.462 27.547 92.061 27.545 c 86.463 27.545 l 86.062 27.547 85.664 27.382 85.381 27.097 c 85.096 26.814 84.931 26.416 84.933 26.015 c 84.933 18.808 l 84.931 18.407 85.096 18.009 85.381 17.726 c 85.664 17.441 86.062 17.276 86.463 17.278 c 92.061 17.278 l 92.462 17.276 92.86 17.441 93.143 17.726 c 93.428 18.009 93.593 18.407 93.591 18.808 c 93.591 26.015 l cl 1 Fbw gsave 0 0.352 0 Bbw grestore % Irpoly n 87.768 27.047 m 90.488 27.047 l 90.488 28.043 l 87.768 28.043 l cl 1 Fbw gsave 1 0.352 1 Bbw grestore % Irpoly n 80.185 87.565 m 81.97 87.565 l 81.97 89.314 l 80.185 89.314 l cl 0 Fbw gsave 0 0.352 1 Bbw grestore userdict /#copies 1 put showpage grestore end restore %%EndDocument endTexFig eop %%Page: 28 28 28 27 bop 868 119 a Fo(Figure)16 b(3:)8 148 y 30785863 21242238 0 24010342 40258437 52099153 startTexFig 8 148 a %%BeginDocument: gensetupnew.ps save userdict /IslandDrawDict 300 dict dup begin put /ncpoint errordict /nocurrentpoint get def errordict begin /nocurrentpoint { dup /pathbbox load eq { pop 0 0 1 1 } { ncpoint } ifelse } bind def end /image_raster { %% sw sh dw dh xs ys translate scale /sh exch def /sw exch def /imagebuf sw 7 add 8 idiv string def sw sh 1 [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } image } bind def /m {moveto} bind def /l {lineto} bind def /c {curveto} bind def /n {newpath} bind def /cl {closepath} bind def /ar { %% sa ea sx sy rot tx ty matrix currentmatrix 8 1 roll translate rotate scale n 0 0 1 5 3 roll arc setmatrix } bind def /arn { %% sa ea sx sy rot tx ty matrix currentmatrix 8 1 roll translate rotate scale n 0 0 1 5 3 roll arcn setmatrix } bind def /el { %% sx sy rot tx ty matrix currentmatrix 6 1 roll translate rotate scale n 0 0 1 0 360 arc setmatrix cl } bind def /bp {setlinejoin setlinewidth setrgbcolor} bind def /bpbw {setlinejoin setlinewidth setgray} bind def /lw {setlinewidth} bind def /lj {setlinejoin} bind def /gr {setgray} bind def /BPSIDE 32 def %% pixels per pattern side /PATFREQ 3.0 def %% pattern pixels per mm /dp_mat [PATFREQ 0 0 PATFREQ 0 0] def /dp_pw BPSIDE def %% pattern pixel width /dp_ph BPSIDE def %% pattern pixel height /dp_w dp_pw PATFREQ div def %% pattern mm width /dp_h dp_ph PATFREQ div def %% pattern mm height /dp_bs 1 def %% pattern bits per pixel /savemat matrix def /topmat matrix def /patmat matrix def /patpath { /inv exch def topmat setmatrix pathbbox %% get lo - hi indecies /hy exch dp_h div floor cvi def /hx exch dp_w div floor cvi def /ly exch dp_h div floor cvi def /lx exch dp_w div floor cvi def lx 1 hx { dp_w mul ly 1 hy { dp_h mul exch dup 3 1 roll exch patmat currentmatrix pop translate dp_pw dp_ph inv dp_mat dp_proc imagemask patmat setmatrix } for pop } for } bind def % setpattern brush of patterns instead of gray /setpattern { /blue exch def /green exch def /red exch def /freq exch def /bwidth exch def /bpside exch def /bstring exch def /onbits 0 def /offbits 0 def freq 0 {/y exch def /x exch def /xindex x 1 add 2 div bpside mul cvi def /yindex y 1 add 2 div bpside mul cvi def bstring yindex bwidth mul xindex 8 idiv add get not 1 7 xindex 8 mod sub bitshift and 0 ne {/onbits onbits 1 add def 1} {/offbits offbits 1 add def 0} ifelse } setscreen {} settransfer systemdict /setcmykcolor known { /fact 1 onbits offbits onbits add div sub def 1 red sub fact mul 1 green sub fact mul 1 blue sub fact mul 0 setcmykcolor } { offbits offbits onbits add div setgray } ifelse } bind def /dmatrix matrix def /dpi 72 0 dmatrix defaultmatrix dtransform dup mul exch dup mul add sqrt def /B {gsave bp stroke grestore} bind def %% brush: gr lw lj /Bbw {gsave bpbw stroke grestore} bind def %% brush: gr lw lj /F {gsave setrgbcolor eofill grestore} bind def %% fill: gr /Fbw {gsave setgray eofill grestore} bind def %% fill: gr /PB {gsave setlinejoin setlinewidth setpattern stroke grestore} bind def /PF {gsave eoclip patpath grestore} bind def /BB { gsave setrgbcolor setlinejoin setlinewidth strokepath clip patpath grestore } bind def /BLACK { 0.0 } bind def /CP {closepath} bind def /FI {eofill} bind def /E {exch} bind def /FF {findfont} bind def /GR {grestore} bind def /GS {gsave} bind def /MF {makefont} bind def /NP {newpath} bind def /RO {rotate} bind def /ST {stroke} bind def /SC {scale} bind def /SF {setfont} bind def /SG {setgray} bind def /SLC {setlinecap} bind def /SLJ {setlinejoin} bind def /SLW {setlinewidth} bind def /TR {translate} bind def /WHITE { 1.0 } bind def /m {moveto} bind def /r {rmoveto} bind def /l {lineto} bind def /sp {x 0 rmoveto} bind def /rl {rlineto} bind def /s {show} bind def /box { NP m l l l CP } bind def /pageboundary { NP m l l l CP } bind def /BS { % black stroke GS SLJ SLW BLACK SG ST GR } bind def /WS { % white stroke GS SLJ SLW WHITE SG ST GR } bind def /reencode_small_dict 12 dict def /ReencodeSmall { reencode_small_dict begin /new_codes_and_names E def /new_font_name E def /base_font_name E def /base_font_dict base_font_name FF def /newfont base_font_dict maxlength dict def base_font_dict { E dup /FID ne { dup /Encoding eq { E dup length array copy newfont 3 1 roll put } { E newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall newfont /FontName new_font_name put new_codes_and_names aload pop new_codes_and_names length 2 idiv { newfont /Encoding get 3 1 roll put } repeat new_font_name newfont definefont pop end %reencode_small_dict } def /extended_Zapf [ 8#223 /a89 8#224 /a90 8#225 /a93 8#226 /a94 8#227 /a91 8#230 /a92 8#231 /a205 8#232 /a85 8#233 /a206 8#234 /a86 8#235 /a87 8#236 /a88 8#237 /a95 8#240 /a96 ] def /extended_Standard [ 29 /thorn 30 /yacute 31 /divide 128 /Acircumflex 129 /Adieresis 130 /Agrave 131 /Aring 132 /Atilde 133 /Ccedilla 134 /Eacute 135 /Ecircumflex 136 /Edieresis 137 /Egrave 138 /Iacute 139 /Icircumflex 140 /Idieresis 141 /Igrave 142 /Ntilde 143 /Oacute 144 /Ocircumflex 145 /Odieresis 146 /Ograve 147 /Otilde 148 /Scaron 149 /Uacute 150 /Ucircumflex 151 /Udieresis 152 /Ugrave 153 /Ydieresis 154 /Zcaron 155 /aacute 156 /acircumflex 157 /adieresis 158 /agrave 159 /aring 160 /atilde 161 /exclamdown 162 /cent 163 /sterling 164 /fraction 165 /yen 166 /florin 167 /section 168 /currency 169 /quotesingle 170 /quotedblleft 171 /guillemotleft 172 /guilsinglleft 173 /guilsinglright 174 /fi 175 /fl 176 /plusminus 177 /endash 178 /dagger 179 /daggerdbl 180 /periodcentered 181 /twosuperior 182 /paragraph 183 /bullet 184 /quotesinglebase 185 /quotedblbase 186 /quotedblright 187 /guillemotright 188 /ellipsis 189 /perthousand 190 /threesuperior 191 /questiondown 192 /mu 193 /grave 194 /acute 195 /circumflex 196 /tilde 197 /macron 198 /breve 199 /dotaccent 200 /dieresis 201 /onesuperior 202 /ring 203 /cedilla 204 /onequarter 205 /hungarumlaut 206 /ogonek 207 /caron 208 /emdash 209 /ccedilla 210 /copyright 211 /eacute 212 /ecircumflex 213 /edieresis 214 /egrave 215 /iacute 216 /icircumflex 217 /idieresis 218 /igrave 219 /logicalnot 220 /minus 221 /ntilde 222 /oacute 223 /ocircumflex 224 /odieresis 225 /AE 226 /onehalf 227 /ordfeminine 228 /ograve 229 /otilde 230 /registered 231 /scaron 232 /Lslash 233 /Oslash 234 /OE 235 /ordmasculine 236 /trademark 237 /uacute 238 /ucircumflex 239 /udieresis 240 /ugrave 241 /ae 242 /ydieresis 243 /zcaron 244 /Aacute 245 /dotlessi 246 /threequarters 247 /Eth 248 /lslash 249 /oslash 250 /oe 251 /germandbls 252 /multiply 253 /Yacute 254 /Thorn 255 /eth ] def /extended_Symbol [ ] def /extend_font { % stack: fontname newfontname E dup (ZapfDingbats) eq { cvn E cvn extended_Zapf ReencodeSmall } { dup (Symbol) eq { cvn E cvn extended_Symbol ReencodeSmall } { cvn E cvn extended_Standard ReencodeSmall } ifelse } ifelse } bind def /getfont { /f E def f cvn where % { begin f cvx cvn exec SF end } { begin f cvn load exec SF end } % { f 0 f length 8 sub getinterval (LocalFont) extend_font %/LocalFont FF { f 0 f length 8 sub getinterval dup dup length 1 add string /localfont exch def localfont exch 0 exch putinterval localfont dup length 1 sub (X) putinterval localfont extend_font localfont FF /xsz f f length 4 sub 4 getinterval cvi def /ysz f f length 8 sub 4 getinterval cvi def [ xsz 0 0 ysz neg 0 0 ] MF dup f cvn E def SF } ifelse } bind def /ul { % space drop thickness GS currentpoint currentlinewidth currentpoint NP m 6 -3 roll SLW 0 E r 0 rl ST SLW m GR } bind def /ss { currentpoint pop E m } bind def /image_raster { % sw sh dw dh xs ys TR SC /sh E def /sw E def /imagebuf sw 7 add 8 idiv string def sw sh 1 [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } image } bind def /imagemask_raster { TR SC /sh E def /sw E def /imagebuf sw 7 add 8 idiv string def sw sh false [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } imagemask } bind def /image_color_raster { % sw sh sd dw dh xs ys systemdict /colorimage known not { /colorimage /colimg load def } if TR SC /sd E def /sh E def /sw E def /imagebuf sw 3 mul sd mul 7 add 8 idiv string def sw sh sd [sw 0 0 sh 0 0] { currentfile imagebuf readhexstring pop } false 3 colorimage } bind def /nx { /x E def } bind def 0. nx gsave 2.83465 -2.83465 scale 0 -279.4 translate topmat currentmatrix pop % Text n savemat currentmatrix pop [1.11149 0 0 1.11149 152.57 14.0849] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -211 0 m 0 ss (Helvetica04800480) getfont () s 0.00 SG (b\)) s savemat setmatrix % Text n savemat currentmatrix pop [1.11149 0 0 1.11149 152.57 64.9468] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -198 0 m 0 ss (Helvetica04800480) getfont () s 0.00 SG (c\)) s savemat setmatrix % Group n 160.8 6.5786 m 203.19 6.5786 l 203.19 48.965 l 160.8 48.965 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 165.91 27.002 m 167.13 27.002 l 167.13 28.217 l 165.91 28.217 l cl gsave 0 0.176 1 Bbw grestore n 165.91 11.706 m 167.13 11.706 l 167.13 12.921 l 165.91 12.921 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.86 11.706 m 198.08 11.706 l 198.08 12.921 l 196.86 12.921 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 181.35 11.706 m 182.57 11.706 l 182.57 12.921 l 181.35 12.921 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 165.91 42.622 m 167.13 42.622 l 167.13 43.838 l 165.91 43.838 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.86 42.622 m 198.08 42.622 l 198.08 43.838 l 196.86 43.838 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 181.35 42.622 m 182.57 42.622 l 182.57 43.838 l 181.35 43.838 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 181.48 27.002 m 182.7 27.002 l 182.7 28.217 l 181.48 28.217 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.86 27.002 m 198.07 27.002 l 198.07 28.217 l 196.86 28.217 l cl gsave 0 0.176 1 Bbw grestore % Path n 181.97 27.545 m 193.15 27.545 l 1 Fbw n 193.15 27.545 m 189.6 28.73 l 189.6 26.36 l cl 0 Fbw n 181.97 27.545 m 189.6 27.545 l gsave 0 0.352 1 Bbw grestore % Irpoly n 160.8 57.844 m 203.19 57.844 l 203.19 100.23 l 160.8 100.23 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Group n 165.91 67.377 m 167.13 67.377 l 167.13 68.593 l 165.91 68.593 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.86 67.377 m 198.08 67.377 l 198.08 68.593 l 196.86 68.593 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 181.35 67.377 m 182.57 67.377 l 182.57 68.593 l 181.35 68.593 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Group n 165.91 89.122 m 167.13 89.122 l 167.13 90.335 l 165.91 90.335 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.86 89.122 m 198.08 89.122 l 198.08 90.335 l 196.86 90.335 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 181.35 89.122 m 182.57 89.122 l 182.57 90.335 l 181.35 90.335 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Group n 165.92 78.268 m 167.13 78.268 l 167.13 79.481 l 165.92 79.481 l cl gsave 0 0.176 1 Bbw grestore n 181.49 78.268 m 182.7 78.268 l 182.7 79.481 l 181.49 79.481 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.86 78.268 m 198.08 78.268 l 198.08 79.481 l 196.86 79.481 l cl gsave 0 0.176 1 Bbw grestore % Path n 182.05 78.583 m 182.05 89.768 l 1 Fbw n 182.05 89.768 m 180.86 86.212 l 183.24 86.212 l cl 0 Fbw n 182.05 78.583 m 182.05 86.212 l gsave 0 0.352 1 Bbw grestore % Irpoly n 160.64 109.69 m 203.35 109.69 l 203.35 152.39 l 160.64 152.39 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Irpoly n 165.79 130.43 m 167.02 130.43 l 167.02 131.65 l 165.79 131.65 l cl gsave 0 0.176 1 Bbw grestore % Group n 165.79 115.02 m 167.02 115.02 l 167.02 116.24 l 165.79 116.24 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.98 115.02 m 198.2 115.02 l 198.2 116.24 l 196.98 116.24 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 181.35 115.02 m 182.57 115.02 l 182.57 116.24 l 181.35 116.24 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Group n 165.79 146.17 m 167.02 146.17 l 167.02 147.39 l 165.79 147.39 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 196.98 146.17 m 198.2 146.17 l 198.2 147.39 l 196.98 147.39 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 181.35 146.17 m 182.57 146.17 l 182.57 147.39 l 181.35 147.39 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Irpoly n 181.48 130.43 m 182.7 130.43 l 182.7 131.65 l 181.48 131.65 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Irpoly n 196.97 130.43 m 198.19 130.43 l 198.19 131.65 l 196.97 131.65 l cl gsave 0 0.176 1 Bbw grestore % Path n 173.8 131.05 m 173.8 142.32 l 1 Fbw n 173.8 142.32 m 172.61 138.76 l 174.98 138.76 l cl 0 Fbw n 173.8 131.05 m 173.8 138.76 l gsave 0 0.352 1 Bbw grestore % Irpoly n 173.26 130.43 m 174.48 130.43 l 174.48 131.65 l 173.26 131.65 l cl gsave 0 0.176 1 Bbw grestore % Irpoly n 189.2 130.43 m 190.43 130.43 l 190.43 131.65 l 189.2 131.65 l cl gsave 0 0.176 1 Bbw grestore % Path n 189.8 130.9 m 189.8 119.63 l 1 Fbw n 189.8 119.63 m 190.99 123.18 l 188.62 123.18 l cl 0 Fbw n 189.8 130.9 m 189.8 123.18 l gsave 0 0.352 1 Bbw grestore % Text n savemat currentmatrix pop [1.11149 0 0 1.11149 152.57 117.156] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -211 0 m 0 ss (Helvetica04800480) getfont () s 0.00 SG (d\)) s savemat setmatrix % Path n 102.4 123.75 m 103.17 123.25 104.87 122.54 105.85 121.64 c 106.83 120.75 108.29 119.65 109.86 118.71 c 111.44 117.77 113.13 117 115.26 115.92 c 117.39 114.84 119.97 113.45 122.04 112.21 c 124.1 110.97 125.65 109.88 127.22 108.41 c 128.8 106.94 130.39 105.08 131.54 103.78 c 132.69 102.48 133.41 101.73 133.79 100.92 c 134.18 100.12 136.22 96.902 136.38 95.961 c 136.55 95.02 130.95 85.389 128.31 81.013 c 126.21 77.516 123.18 75.445 121.53 73.502 c 119.88 71.56 119.06 70.15 117.02 68.504 c 115.2 67.036 110.3 62.116 107.77 60.179 c 1 Fbw gsave 0 0.706 0 Bbw grestore % Path n 93.184 62.098 m 91.839 60.773 93.331 62.416 91.828 60.643 c 90.324 58.873 90.207 56.535 88.52 54.421 c 87.306 52.904 85.91 49.634 83.231 49.647 c 81.656 49.653 83.935 51.27 83.935 51.27 c 83.935 51.27 81.997 50.225 81.803 50.544 c 80.824 52.144 83.053 53.037 83.053 53.037 c 83.053 53.037 80.545 51.022 80.104 51.563 c 79.141 52.739 80.576 53.548 80.1 53.862 c 79.624 54.173 74.155 48.536 73.238 49.614 c 72.266 50.755 78.733 56.851 78.733 56.851 c 78.733 56.851 78.274 55.662 77.242 57.118 c 76.825 57.711 76.793 57.933 78.865 59.99 c 80.934 62.046 83.587 63.656 85.278 63.561 c 86.969 63.469 87.234 64.563 88.535 65.769 c 89.246 67.372 92.401 61.034 92.877 61.762 c 1 Fbw gsave [1 1 1 1] 0 setdash 0 0.176 0 Bbw grestore % Irpoly n 97.176 49.247 m 99.105 49.247 l 99.105 51.174 l 97.176 51.174 l cl gsave 0 0.176 1 Bbw grestore % Irpoly n 71.712 48.171 m 75.741 48.171 l 75.741 52.094 l 71.712 52.094 l cl gsave [1 1 1 1] 0 setdash 0 0.176 1 Bbw grestore % Path n 95.97 110.27 m 95.917 110.35 95.867 110.42 95.818 110.48 c 95.435 111.01 95.242 111.2 95.102 111.25 c 94.957 111.3 94.861 111.2 94.624 111.2 c 94.383 111.2 94.001 111.3 93.236 111.2 c 92.469 111.1 91.323 110.82 90.174 110.53 c 89.025 110.24 87.879 109.96 86.395 109.77 c 84.911 109.58 83.094 109.48 81.993 109.48 c 80.893 109.48 80.51 109.58 79.794 109.72 c 79.076 109.86 78.023 110.05 76.971 109.91 c 75.917 109.77 74.867 109.29 74.387 109.19 c 73.909 109.1 74.005 109.38 73.668 109.53 c 73.335 109.67 72.572 109.67 71.807 109.67 c 71.038 109.67 70.273 109.67 69.558 109.67 c 68.839 109.67 68.17 109.67 67.596 109.58 c 67.022 109.48 66.544 109.29 65.921 109.33 c 65.299 109.38 64.534 109.67 63.387 109.72 c 62.238 109.77 60.706 109.58 59.273 109.62 c 57.839 109.67 56.496 109.96 54.154 110.05 c 51.811 110.15 48.463 110.05 46.068 110.15 c 43.678 110.24 42.244 110.53 40.616 110.82 c 38.99 111.1 37.172 111.39 34.829 111.68 c 32.486 111.96 29.614 112.25 28.323 113.35 c 27.03 114.45 27.317 116.37 27.701 117.8 c 28.084 119.24 28.562 120.19 28.945 121.58 c 29.327 122.97 29.614 124.79 31.767 126.31 c 33.919 127.85 37.937 129.09 41.811 129.67 c 45.686 130.24 49.419 130.14 51.859 130 c 54.299 129.86 55.445 129.67 57.407 129.57 c 59.367 129.47 62.142 129.47 64.437 129.43 c 66.736 129.38 68.554 129.28 70.178 129.28 c 71.807 129.28 73.24 129.38 75.058 129.24 c 76.875 129.09 79.076 128.71 81.276 128.47 c 83.477 128.23 85.676 128.14 88.166 127.75 c 90.652 127.37 93.427 126.7 96.009 125.93 c 98.592 125.17 100.99 124.31 102.66 123.64 c 1 Fbw gsave 0 0.706 0 Bbw grestore % Path n 48.054 112.26 m 48.102 111.66 48.247 111.32 48.389 111.25 c 48.534 111.18 48.676 111.37 48.771 111.66 c 48.867 111.95 48.915 112.33 48.938 112.76 c 48.963 113.19 48.963 113.67 49.034 114.17 c 49.108 114.68 49.249 115.2 49.13 115.37 c 49.012 115.53 48.63 115.34 48.46 115.25 c 48.293 115.15 48.341 115.15 48.341 115.15 c 48.341 115.15 48.293 115.15 48.247 114.96 c 48.197 114.77 48.15 114.39 48.126 114.29 c 48.102 114.2 48.102 114.39 48.076 114.05 c 48.054 113.72 48.006 112.86 48.054 112.26 c 1 Fbw % Path n 108.08 60.516 m 106.74 59.191 108.23 60.834 106.73 59.061 c 105.22 57.289 105.11 54.953 103.42 52.837 c 102.2 51.322 100.81 48.052 98.13 48.065 c 96.554 48.071 98.832 49.688 98.832 49.688 c 98.832 49.688 96.895 48.643 96.7 48.962 c 95.722 50.562 97.951 51.455 97.951 51.455 c 97.951 51.455 95.442 49.441 95.002 49.981 c 94.036 51.157 95.476 51.966 94.998 52.278 c 94.52 52.589 89.055 46.954 88.136 48.03 c 87.166 49.173 93.631 55.269 93.631 55.269 c 93.631 55.269 93.169 54.078 92.141 55.538 c 91.723 56.129 91.691 56.351 93.762 58.408 c 95.831 60.464 98.486 62.074 100.18 61.979 c 101.87 61.885 102.13 62.981 103.43 64.187 c 104.14 65.788 108.42 75.94 108.9 76.668 c 109.69 77.825 110.42 78.926 111.14 79.782 c 111.87 80.641 112.58 81.252 113.25 81.999 c 113.92 82.749 114.54 83.637 115.16 84.522 c 115.79 85.409 116.41 86.297 117.02 87.229 c 117.63 88.164 118.23 89.144 118.76 90.013 c 119.29 90.884 119.74 91.643 120.73 92.353 c 121.72 93.062 123.26 93.722 122.54 94.761 c 121.82 95.8 118.85 97.221 116.79 98.166 c 114.73 99.114 113.58 99.592 112.34 100.01 c 111.1 100.42 109.77 100.77 108.34 101.44 c 106.91 102.11 105.38 103.1 104.4 103.7 c 103.42 104.31 102.99 104.53 102.15 105.16 c 101.31 105.78 100.06 106.83 99.212 107.5 c 98.364 108.18 97.919 108.49 97.341 109.02 c 96.836 109.48 96.226 110.11 95.767 110.57 c 1 Fbw gsave 0 0.706 0 Bbw grestore % Path n 62.928 103.57 m 62.368 103.01 62.509 101.89 63.207 100.7 c 63.907 99.514 65.167 98.255 66.147 98.325 c 67.127 98.394 67.827 99.794 68.316 100.84 c 68.805 101.89 69.087 102.59 68.737 103.08 c 68.387 103.57 67.405 103.85 66.847 103.99 c 66.286 104.13 66.147 104.13 65.447 104.13 c 64.747 104.13 63.487 104.13 62.928 103.57 c 1 Fbw gsave 0 0.706 0 Bbw grestore % Path n 80.124 119.47 m 80.124 109.33 73.752 101.11 65.892 101.11 c 58.031 101.11 51.659 109.33 51.659 119.47 c 51.659 129.61 58.031 137.83 65.892 137.83 c 73.752 137.83 80.124 129.61 80.124 119.47 c 1 Fbw gsave 0 0.706 0 Bbw grestore % Path n 42.096 34.953 m 71.612 48.176 l 1 Fbw n 71.612 48.176 m 68.436 47.859 l 69.261 46.017 l cl 0 Fbw n 42.096 34.953 m 68.849 46.938 l gsave 0 0.176 1 Bbw grestore % Path n 119.84 33.316 m 90.309 46.946 l 1 Fbw n 90.309 46.946 m 92.635 44.761 l 93.481 46.594 l cl 0 Fbw n 119.84 33.316 m 93.058 45.677 l gsave 0 0.176 1 Bbw grestore % Path n 72.596 79.42 m 69.04 80.606 l 69.04 78.235 l cl 0 Fbw n 47.748 79.42 m 51.304 78.235 l 51.304 80.606 l cl 0 Fbw n 69.04 79.42 m 51.304 79.42 l gsave 0 0.352 1 Bbw grestore % Irpoly n 48.056 49.247 m 49.984 49.247 l 49.984 51.174 l 48.056 51.174 l cl gsave 0 0.176 1 Bbw grestore % Group n 48.056 24.89 m 49.984 24.89 l 49.984 26.819 l 48.056 26.819 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 97.176 24.89 m 99.105 24.89 l 99.105 26.819 l 97.176 26.819 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 72.56 24.89 m 74.487 24.89 l 74.487 26.819 l 72.56 26.819 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Group n 48.056 73.961 m 49.984 73.961 l 49.984 75.889 l 48.056 75.889 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 97.176 73.961 m 99.105 73.961 l 99.105 75.889 l 97.176 75.889 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore n 72.56 73.961 m 74.487 73.961 l 74.487 75.889 l 72.56 75.889 l cl 1 Fbw gsave 0 0.176 1 Bbw grestore % Irpoly n 72.762 49.169 m 74.691 49.169 l 74.691 51.098 l 72.762 51.098 l cl 0 Fbw gsave 0 0.176 1 Bbw grestore % Text n savemat currentmatrix pop [1.11149 0 0 1.11149 16.7301 14.0849] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -211 0 m 0 ss (Helvetica04800480) getfont () s 0.00 SG (a\)) s savemat setmatrix % Text n savemat currentmatrix pop [0.755816 0 0 0.755816 28.3082 26.5039] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -884 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Perceived) s -1325 0 m 467 ss (Helvetica04000400) getfont (Finger Position) s savemat setmatrix % Text n savemat currentmatrix pop [0.755816 0 0 0.755816 121.435 25.0812] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -552 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (Actual) s -1325 0 m 467 ss (Helvetica04000400) getfont (Finger Position) s savemat setmatrix % Text n savemat currentmatrix pop [0.755816 0 0 0.755816 59.7727 88.0881] concat 25.4 1440 div 1.000000 mul dup scale 0 0 m -541 0 m 0 ss (Helvetica04000400) getfont () s 0.00 SG (15 cm) s savemat setmatrix userdict /#copies 1 put showpage grestore end restore %%EndDocument endTexFig eop %%Page: 29 29 29 28 bop 868 119 a Fo(Figure)16 b(4:)-158 156 y 11840716 12669565 2105016 10525081 36114186 47231303 startTexFig -158 156 a %%BeginDocument: c.pre.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 791 4590 translate 14 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2139 1536 13732 1536 2139 1536 2139 1376 3588 1536 3588 1376 5037 1536 5037 1376 6486 1536 6486 1376 7935 1536 7935 1376 9384 1536 9384 1376 10833 1536 10833 1376 12282 1536 12282 1376 13732 1536 13732 1376 10 dopairs 1883 2173 1883 13766 1883 2173 1724 2173 1883 3622 1724 3622 1883 5071 1724 5071 1883 6520 1724 6520 1883 7970 1724 7970 1883 9419 1724 9419 1883 10868 1724 10868 1883 12317 1724 12317 1883 13766 1724 13766 10 dopairs % Data Set 1: 28 setlinewidth none setdash /linestyle {none} def 28 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 81 def /symbsiz 81 def /symbw 162 def /symbh 162 def /ori 0.00 def /showmark {plotsymb} def /symbary [81 81 -162 0 0 -162 162 0 0 162] def % Square % Draw error Bars with solid line 28 setlinewidth none setdash /linestyle {none} def % Draw data line 28 setlinewidth solid setdash /linestyle {solid} def 3588 2173 3588 6520 3588 10868 7935 2173 7935 6520 7935 10868 12282 2173 12282 6520 12282 10868 9 {showmark} repeat % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 149 def /symbsiz 149 def /symbw 298 def /symbh 582 def /ori -31.64 def /ratio 1.953020 def /showmark {doellipse} def 2790 2549 1 {showmark} repeat /patternw 241 def /symbsiz 241 def /symbw 482 def /symbh 582 def /ori -6.44 def /ratio 1.207469 def /showmark {doellipse} def 2627 7197 1 {showmark} repeat /patternw 240 def /symbsiz 240 def /symbw 480 def /symbh 580 def /ori 125.20 def /ratio 1.208333 def /showmark {doellipse} def 2934 11535 1 {showmark} repeat /patternw 152 def /symbsiz 152 def /symbw 304 def /symbh 514 def /ori 69.26 def /ratio 1.690789 def /showmark {doellipse} def 7700 2609 1 {showmark} repeat /patternw 222 def /symbsiz 222 def /symbw 444 def /symbh 480 def /ori 68.15 def /ratio 1.081081 def /showmark {doellipse} def 7551 7117 1 {showmark} repeat /patternw 253 def /symbsiz 253 def /symbw 506 def /symbh 690 def /ori 83.89 def /ratio 1.363636 def /showmark {doellipse} def 7373 12093 1 {showmark} repeat /patternw 153 def /symbsiz 153 def /symbw 306 def /symbh 478 def /ori 37.59 def /ratio 1.562091 def /showmark {doellipse} def 12243 2436 1 {showmark} repeat /patternw 185 def /symbsiz 185 def /symbw 370 def /symbh 628 def /ori -35.25 def /ratio 1.697297 def /showmark {doellipse} def 12359 7221 1 {showmark} repeat /patternw 267 def /symbsiz 267 def /symbw 534 def /symbh 704 def /ori 59.61 def /ratio 1.318352 def /showmark {doellipse} def 12345 12222 1 {showmark} repeat /fontsiz 799 def /spacesiz 53 def /fontsiz 799 def /spacesiz 53 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 66 def /txtpos [0.50 0.00] def 325 8133 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8235 -51 (X \(cm\)) sprnt /fontsiz 857 def /spacesiz 57 def /fontsiz 857 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def 7564 15244 (One-point Control) sprnt /txtpos [0.00 0.00] def /fontsiz 570 def /spacesiz 38 def /fontsiz 570 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2139 1231 (-15) sprnt 3588 1231 (-10) sprnt 5037 1231 (-5) sprnt 6486 1231 (0) sprnt 7935 1231 (5) sprnt 9384 1231 (10) sprnt 10833 1231 (15) sprnt 12282 1231 (20) sprnt 13732 1231 (25) sprnt /txtpos [1.00 0.35] def 1579 2173 (20) sprnt 1579 3622 (25) sprnt 1579 5071 (30) sprnt 1579 6520 (35) sprnt 1579 7970 (40) sprnt 1579 9419 (45) sprnt 1579 10868 (50) sprnt 1579 12317 (55) sprnt 1579 13766 (60) sprnt -791 -4590 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 608 156 a 11840716 12669565 2105016 10525081 36114186 47231303 startTexFig 608 156 a %%BeginDocument: x.pre.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 791 4590 translate 14 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2139 1536 13732 1536 2139 1536 2139 1376 3588 1536 3588 1376 5037 1536 5037 1376 6486 1536 6486 1376 7935 1536 7935 1376 9384 1536 9384 1376 10833 1536 10833 1376 12282 1536 12282 1376 13732 1536 13732 1376 10 dopairs 1883 2173 1883 13766 1883 2173 1724 2173 1883 3622 1724 3622 1883 5071 1724 5071 1883 6520 1724 6520 1883 7970 1724 7970 1883 9419 1724 9419 1883 10868 1724 10868 1883 12317 1724 12317 1883 13766 1724 13766 10 dopairs % Data Set 1: 28 setlinewidth none setdash /linestyle {none} def 28 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 81 def /symbsiz 81 def /symbw 162 def /symbh 162 def /ori 0.00 def /showmark {plotsymb} def /symbary [81 81 -162 0 0 -162 162 0 0 162] def % Square % Draw error Bars with solid line 28 setlinewidth none setdash /linestyle {none} def % Draw data line 28 setlinewidth solid setdash /linestyle {solid} def 3588 2173 3588 6520 3588 10868 7935 2173 7935 6520 7935 10868 12282 2173 12282 6520 12282 10868 9 {showmark} repeat % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 182 def /symbsiz 182 def /symbw 364 def /symbh 656 def /ori 59.90 def /ratio 1.802198 def /showmark {doellipse} def 2268 7304 1 {showmark} repeat /patternw 157 def /symbsiz 157 def /symbw 314 def /symbh 412 def /ori 78.38 def /ratio 1.312102 def /showmark {doellipse} def 3065 11641 1 {showmark} repeat /patternw 115 def /symbsiz 115 def /symbw 230 def /symbh 488 def /ori 64.04 def /ratio 2.121739 def /showmark {doellipse} def 7445 2476 1 {showmark} repeat /patternw 168 def /symbsiz 168 def /symbw 336 def /symbh 486 def /ori 66.32 def /ratio 1.446429 def /showmark {doellipse} def 7240 7392 1 {showmark} repeat /patternw 158 def /symbsiz 158 def /symbw 316 def /symbh 508 def /ori 51.89 def /ratio 1.607595 def /showmark {doellipse} def 7546 12485 1 {showmark} repeat /patternw 190 def /symbsiz 190 def /symbw 380 def /symbh 686 def /ori 17.89 def /ratio 1.805263 def /showmark {doellipse} def 12424 2522 1 {showmark} repeat /patternw 197 def /symbsiz 197 def /symbw 394 def /symbh 832 def /ori -0.46 def /ratio 2.111675 def /showmark {doellipse} def 12594 7257 1 {showmark} repeat /patternw 187 def /symbsiz 187 def /symbw 374 def /symbh 758 def /ori -19.49 def /ratio 2.026738 def /showmark {doellipse} def 12656 12844 1 {showmark} repeat /patternw 176 def /symbsiz 176 def /symbw 352 def /symbh 488 def /ori 72.86 def /ratio 1.386364 def /showmark {doellipse} def 2321 2584 1 {showmark} repeat /fontsiz 799 def /spacesiz 53 def /fontsiz 799 def /spacesiz 53 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 66 def /txtpos [0.50 0.00] def 325 8133 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8235 -51 (X \(cm\)) sprnt /fontsiz 857 def /spacesiz 57 def /fontsiz 857 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def 7248 15243 (One-point X shift) sprnt /txtpos [0.00 0.00] def /fontsiz 570 def /spacesiz 38 def /fontsiz 570 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2139 1231 (-15) sprnt 3588 1231 (-10) sprnt 5037 1231 (-5) sprnt 6486 1231 (0) sprnt 7935 1231 (5) sprnt 9384 1231 (10) sprnt 10833 1231 (15) sprnt 12282 1231 (20) sprnt 13732 1231 (25) sprnt /txtpos [1.00 0.35] def 1579 2173 (20) sprnt 1579 3622 (25) sprnt 1579 5071 (30) sprnt 1579 6520 (35) sprnt 1579 7970 (40) sprnt 1579 9419 (45) sprnt 1579 10868 (50) sprnt 1579 12317 (55) sprnt 1579 13766 (60) sprnt -791 -4590 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 1374 148 a 11840716 12787972 2105016 10525081 36114186 47494430 startTexFig 1374 148 a %%BeginDocument: y.pre.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 791 4590 translate 14 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2139 1536 13732 1536 2139 1536 2139 1376 3588 1536 3588 1376 5037 1536 5037 1376 6486 1536 6486 1376 7935 1536 7935 1376 9384 1536 9384 1376 10833 1536 10833 1376 12282 1536 12282 1376 13732 1536 13732 1376 10 dopairs 1883 2173 1883 13766 1883 2173 1724 2173 1883 3622 1724 3622 1883 5071 1724 5071 1883 6520 1724 6520 1883 7970 1724 7970 1883 9419 1724 9419 1883 10868 1724 10868 1883 12317 1724 12317 1883 13766 1724 13766 10 dopairs % Data Set 1: 28 setlinewidth none setdash /linestyle {none} def 28 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 81 def /symbsiz 81 def /symbw 162 def /symbh 162 def /ori 0.00 def /showmark {plotsymb} def /symbary [81 81 -162 0 0 -162 162 0 0 162] def % Square % Draw error Bars with solid line 28 setlinewidth none setdash /linestyle {none} def % Draw data line 28 setlinewidth solid setdash /linestyle {solid} def 3588 3622 3588 6520 3588 9419 7935 3622 7935 6520 7935 9419 12282 3622 12282 6520 12282 9419 9 {showmark} repeat % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 234 def /symbsiz 234 def /symbw 468 def /symbh 708 def /ori 38.83 def /ratio 1.512820 def /showmark {doellipse} def 3044 7156 1 {showmark} repeat /patternw 244 def /symbsiz 244 def /symbw 488 def /symbh 690 def /ori 128.78 def /ratio 1.413934 def /showmark {doellipse} def 3270 9836 1 {showmark} repeat /patternw 183 def /symbsiz 183 def /symbw 366 def /symbh 528 def /ori -9.62 def /ratio 1.442623 def /showmark {doellipse} def 7509 4311 1 {showmark} repeat /patternw 242 def /symbsiz 242 def /symbw 484 def /symbh 570 def /ori 6.43 def /ratio 1.177686 def /showmark {doellipse} def 7350 7494 1 {showmark} repeat /patternw 251 def /symbsiz 251 def /symbw 502 def /symbh 814 def /ori 110.78 def /ratio 1.621514 def /showmark {doellipse} def 7471 10066 1 {showmark} repeat /patternw 233 def /symbsiz 233 def /symbw 466 def /symbh 578 def /ori 134.69 def /ratio 1.240343 def /showmark {doellipse} def 12081 4426 1 {showmark} repeat /patternw 274 def /symbsiz 274 def /symbw 548 def /symbh 644 def /ori 131.85 def /ratio 1.175182 def /showmark {doellipse} def 12097 7422 1 {showmark} repeat /patternw 240 def /symbsiz 240 def /symbw 480 def /symbh 744 def /ori 88.37 def /ratio 1.550000 def /showmark {doellipse} def 12280 10368 1 {showmark} repeat /patternw 204 def /symbsiz 204 def /symbw 408 def /symbh 540 def /ori 14.36 def /ratio 1.323529 def /showmark {doellipse} def 2801 4322 1 {showmark} repeat /fontsiz 799 def /spacesiz 53 def /fontsiz 799 def /spacesiz 53 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 66 def /txtpos [0.50 0.00] def 325 8133 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8235 -51 (X \(cm\)) sprnt /fontsiz 857 def /spacesiz 57 def /fontsiz 857 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def 7319 15349 (One-point Y shift) sprnt /txtpos [0.00 0.00] def /fontsiz 570 def /spacesiz 38 def /fontsiz 570 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2139 1231 (-15) sprnt 3588 1231 (-10) sprnt 5037 1231 (-5) sprnt 6486 1231 (0) sprnt 7935 1231 (5) sprnt 9384 1231 (10) sprnt 10833 1231 (15) sprnt 12282 1231 (20) sprnt 13732 1231 (25) sprnt /txtpos [1.00 0.35] def 1579 2173 (20) sprnt 1579 3622 (25) sprnt 1579 5071 (30) sprnt 1579 6520 (35) sprnt 1579 7970 (40) sprnt 1579 9419 (45) sprnt 1579 10868 (50) sprnt 1579 12317 (55) sprnt 1579 13766 (60) sprnt -791 -4590 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 225 963 a 11840716 13143194 2433925 10525081 36311531 48283811 startTexFig 225 963 a %%BeginDocument: c2.pre.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 791 4590 translate 14 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2243 1646 13836 1646 2243 1646 2243 1487 3692 1646 3692 1487 5141 1646 5141 1487 6590 1646 6590 1487 8039 1646 8039 1487 9488 1646 9488 1487 10938 1646 10938 1487 12387 1646 12387 1487 13836 1646 13836 1487 10 dopairs 1883 2173 1883 13766 1883 2173 1724 2173 1883 3622 1724 3622 1883 5071 1724 5071 1883 6520 1724 6520 1883 7970 1724 7970 1883 9419 1724 9419 1883 10868 1724 10868 1883 12317 1724 12317 1883 13766 1724 13766 10 dopairs % Data Set 1: 28 setlinewidth none setdash /linestyle {none} def 28 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 81 def /symbsiz 81 def /symbw 162 def /symbh 162 def /ori 0.00 def /showmark {plotsymb} def /symbary [81 81 -162 0 0 -162 162 0 0 162] def % Square % Draw error Bars with solid line 28 setlinewidth none setdash /linestyle {none} def % Draw data line 28 setlinewidth solid setdash /linestyle {solid} def 3692 3622 3692 7970 3692 12317 8039 3622 8039 7970 8039 12317 12387 3622 12387 7970 12387 12317 5866 7970 10213 7970 11 {showmark} repeat % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 147 def /symbsiz 147 def /symbw 294 def /symbh 558 def /ori 92.90 def /ratio 1.897959 def /showmark {doellipse} def 2970 3021 1 {showmark} repeat /patternw 210 def /symbsiz 210 def /symbw 420 def /symbh 604 def /ori 83.52 def /ratio 1.438095 def /showmark {doellipse} def 3120 7904 1 {showmark} repeat /patternw 194 def /symbsiz 194 def /symbw 388 def /symbh 500 def /ori 104.15 def /ratio 1.288660 def /showmark {doellipse} def 3631 12363 1 {showmark} repeat /patternw 150 def /symbsiz 150 def /symbw 300 def /symbh 464 def /ori 103.94 def /ratio 1.546667 def /showmark {doellipse} def 7990 3119 1 {showmark} repeat /patternw 206 def /symbsiz 206 def /symbw 412 def /symbh 608 def /ori 111.36 def /ratio 1.475728 def /showmark {doellipse} def 7879 8111 1 {showmark} repeat /patternw 215 def /symbsiz 215 def /symbw 430 def /symbh 552 def /ori 3.30 def /ratio 1.283721 def /showmark {doellipse} def 8200 13139 1 {showmark} repeat /patternw 224 def /symbsiz 224 def /symbw 448 def /symbh 490 def /ori 101.21 def /ratio 1.093750 def /showmark {doellipse} def 12531 2925 1 {showmark} repeat /patternw 205 def /symbsiz 205 def /symbw 410 def /symbh 600 def /ori 32.32 def /ratio 1.463415 def /showmark {doellipse} def 12616 8178 1 {showmark} repeat /patternw 192 def /symbsiz 192 def /symbw 384 def /symbh 588 def /ori 3.99 def /ratio 1.531250 def /showmark {doellipse} def 12794 13617 1 {showmark} repeat /patternw 222 def /symbsiz 222 def /symbw 444 def /symbh 570 def /ori 86.55 def /ratio 1.283784 def /showmark {doellipse} def 5197 8135 1 {showmark} repeat /patternw 221 def /symbsiz 221 def /symbw 442 def /symbh 594 def /ori 120.78 def /ratio 1.343891 def /showmark {doellipse} def 10364 7978 1 {showmark} repeat /fontsiz 799 def /spacesiz 53 def /fontsiz 799 def /spacesiz 53 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 66 def /txtpos [0.50 0.00] def 490 8102 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7882 -48 (X \(cm\)) sprnt /fontsiz 857 def /spacesiz 57 def /fontsiz 857 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def 7460 15701 (Two-point Control) sprnt /txtpos [0.00 0.00] def /fontsiz 570 def /spacesiz 38 def /fontsiz 570 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2243 1342 (-15) sprnt 3692 1342 (-10) sprnt 5141 1342 (-5) sprnt 6590 1342 (0) sprnt 8039 1342 (5) sprnt 9488 1342 (10) sprnt 10938 1342 (15) sprnt 12387 1342 (20) sprnt 13836 1342 (25) sprnt /txtpos [1.00 0.35] def 1579 2173 (15) sprnt 1579 3622 (20) sprnt 1579 5071 (25) sprnt 1579 6520 (30) sprnt 1579 7970 (35) sprnt 1579 9419 (40) sprnt 1579 10868 (45) sprnt 1579 12317 (50) sprnt 1579 13766 (55) sprnt -791 -4590 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 991 970 a 11840716 13024787 2433925 10525081 36311531 47889121 startTexFig 991 970 a %%BeginDocument: y2.pre.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 791 4590 translate 14 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2243 1646 13836 1646 2243 1646 2243 1487 3692 1646 3692 1487 5141 1646 5141 1487 6590 1646 6590 1487 8039 1646 8039 1487 9488 1646 9488 1487 10938 1646 10938 1487 12387 1646 12387 1487 13836 1646 13836 1487 10 dopairs 1883 2173 1883 13766 1883 2173 1724 2173 1883 3622 1724 3622 1883 5071 1724 5071 1883 6520 1724 6520 1883 7970 1724 7970 1883 9419 1724 9419 1883 10868 1724 10868 1883 12317 1724 12317 1883 13766 1724 13766 10 dopairs % Data Set 1: 28 setlinewidth none setdash /linestyle {none} def 28 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 81 def /symbsiz 81 def /symbw 162 def /symbh 162 def /ori 0.00 def /showmark {plotsymb} def /symbary [81 81 -162 0 0 -162 162 0 0 162] def % Square % Draw error Bars with solid line 28 setlinewidth none setdash /linestyle {none} def % Draw data line 28 setlinewidth solid setdash /linestyle {solid} def 3692 3622 3692 7970 3692 12317 8039 3622 8039 7970 8039 12317 12387 3622 12387 7970 12387 12317 5866 7970 10213 7970 11 {showmark} repeat % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 198 def /symbsiz 198 def /symbw 396 def /symbh 534 def /ori 70.80 def /ratio 1.348485 def /showmark {doellipse} def 2643 8127 1 {showmark} repeat /patternw 159 def /symbsiz 159 def /symbw 318 def /symbh 418 def /ori 53.72 def /ratio 1.314465 def /showmark {doellipse} def 3348 12147 1 {showmark} repeat /patternw 140 def /symbsiz 140 def /symbw 280 def /symbh 412 def /ori 68.26 def /ratio 1.471429 def /showmark {doellipse} def 7451 3950 1 {showmark} repeat /patternw 168 def /symbsiz 168 def /symbw 336 def /symbh 514 def /ori 82.86 def /ratio 1.529762 def /showmark {doellipse} def 7506 8408 1 {showmark} repeat /patternw 174 def /symbsiz 174 def /symbw 348 def /symbh 390 def /ori 70.97 def /ratio 1.120690 def /showmark {doellipse} def 7454 13177 1 {showmark} repeat /patternw 172 def /symbsiz 172 def /symbw 344 def /symbh 378 def /ori 71.23 def /ratio 1.098837 def /showmark {doellipse} def 12044 4115 1 {showmark} repeat /patternw 183 def /symbsiz 183 def /symbw 366 def /symbh 584 def /ori 75.17 def /ratio 1.595628 def /showmark {doellipse} def 12498 8510 1 {showmark} repeat /patternw 161 def /symbsiz 161 def /symbw 322 def /symbh 388 def /ori -20.63 def /ratio 1.204969 def /showmark {doellipse} def 12832 13590 1 {showmark} repeat /patternw 206 def /symbsiz 206 def /symbw 412 def /symbh 552 def /ori 80.53 def /ratio 1.339806 def /showmark {doellipse} def 4903 8310 1 {showmark} repeat /patternw 163 def /symbsiz 163 def /symbw 326 def /symbh 558 def /ori 70.49 def /ratio 1.711656 def /showmark {doellipse} def 9976 8492 1 {showmark} repeat /patternw 185 def /symbsiz 185 def /symbw 370 def /symbh 518 def /ori 68.59 def /ratio 1.400000 def /showmark {doellipse} def 2540 3657 1 {showmark} repeat /fontsiz 799 def /spacesiz 53 def /fontsiz 799 def /spacesiz 53 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 66 def /txtpos [0.50 0.00] def 490 8102 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7882 -48 (X \(cm\)) sprnt /fontsiz 857 def /spacesiz 57 def /fontsiz 857 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def 7355 15526 (Two-point Y shift) sprnt /txtpos [0.00 0.00] def /fontsiz 570 def /spacesiz 38 def /fontsiz 570 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2243 1342 (-15) sprnt 3692 1342 (-10) sprnt 5141 1342 (-5) sprnt 6590 1342 (0) sprnt 8039 1342 (5) sprnt 9488 1342 (10) sprnt 10938 1342 (15) sprnt 12387 1342 (20) sprnt 13836 1342 (25) sprnt /txtpos [1.00 0.35] def 1579 2173 (15) sprnt 1579 3622 (20) sprnt 1579 5071 (25) sprnt 1579 6520 (30) sprnt 1579 7970 (35) sprnt 1579 9419 (40) sprnt 1579 10868 (45) sprnt 1579 12317 (50) sprnt 1579 13766 (55) sprnt -791 -4590 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig eop %%Page: 30 30 30 29 bop 868 119 a Fo(Figure)16 b(5:)-158 223 y 11840716 11011860 1644544 6512394 40455782 42889707 startTexFig -158 223 a %%BeginDocument: durx.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 388 2270 translate 16 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2400 2080 15200 2080 2400 2080 2400 1904 5600 2080 5600 1904 8800 2080 8800 1904 12000 2080 12000 1904 15200 2080 15200 1904 6 dopairs 2080 2400 2080 15200 2080 2400 1904 2400 2080 4533 1904 4533 2080 6666 1904 6666 2080 8800 1904 8800 2080 10933 1904 10933 2080 13066 1904 13066 2080 15200 1904 15200 8 dopairs % Data Set 1: 32 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {1.0 1.0 1.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def % Draw error Bars with solid line 3200 7307 3200 6415 3360 6415 3040 6415 4800 6521 4800 5499 4960 5499 4640 5499 6400 4157 6400 3549 6560 3549 6240 3549 8000 4646 8000 3965 8160 3965 7840 3965 9600 5557 9600 4679 9760 4679 9440 4679 11200 5690 11200 4825 11360 4825 11040 4825 12 dopairs % Draw data line newpath 3200 7307 4800 6521 6400 4157 8000 4646 9600 5557 11200 5690 6 doline 3200 7307 4800 6521 6400 4157 8000 4646 9600 5557 11200 5690 6 {showmark} repeat % Data Set 2: /fillcolor {0.0 0.0 0.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def % Draw error Bars with solid line 3200 10448 3200 9146 3360 10448 3040 10448 4800 9298 4800 7806 4960 9298 4640 9298 6400 9747 6400 8679 6560 9747 6240 9747 8000 8155 8000 7141 8160 8155 7840 8155 9600 6791 9600 5963 9760 6791 9440 6791 11200 6963 11200 6110 11360 6963 11040 6963 12800 8352 12800 7383 12960 8352 12640 8352 14400 5792 14400 5186 14560 5792 14240 5792 16 dopairs % Draw data line newpath 3200 9146 4800 7806 6400 8679 8000 7141 9600 5963 11200 6110 12800 7383 14400 5186 8 doline 3200 9146 4800 7806 6400 8679 8000 7141 9600 5963 11200 6110 12800 7383 14400 5186 8 {showmark} repeat /fontsiz 768 def /spacesiz 51 def /fontsiz 768 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 63 def /txtpos [0.50 0.00] def 544 9117 (Time to target \(sec\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8438 523 (Trial) sprnt /txtpos [0.50 1.00] def 819 17200 (a\)) sprnt /txtpos [0.00 0.00] def /fontsiz 628 def /spacesiz 41 def /fontsiz 628 def /spacesiz 41 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 52 def /txtpos [0.50 1.00] def 2400 1744 (0) sprnt 5600 1744 (10) sprnt 8800 1744 (20) sprnt 12000 1744 (30) sprnt 15200 1744 (40) sprnt /txtpos [1.00 0.35] def 1744 2400 (6) sprnt 1744 4533 (8) sprnt 1744 6666 (10) sprnt 1744 8800 (12) sprnt 1744 10933 (14) sprnt 1744 13066 (16) sprnt 1744 15200 (18) sprnt /fontsiz 512 def /spacesiz 34 def /fontsiz 512 def /spacesiz 34 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 42 def /txtpos [1.00 0.00] def /nlin 5 def /fillcolor {1.0 1.0 1.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def /showkey {showkeyline solid setdash /linestyle {solid} def /offx 0 def showkeysymb solid setdash /linestyle {solid} def /offx 1600 def showkeysymb pop pop} def 12771 11856 (Control ) (Control ) stringmark 12771 11856 (Control ) sprnt /nlin 5 def /fillcolor {0.0 0.0 0.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def /showkey {showkeyline solid setdash /linestyle {solid} def /offx 0 def showkeysymb solid setdash /linestyle {solid} def /offx 1600 def showkeysymb pop pop} def 12771 12742 (One-point X Shift ) (One-point X Shift ) stringmark 12771 12742 (One-point X Shift ) sprnt -388 -2270 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 608 156 a 11840716 12077530 1644544 6512394 40455782 46376140 startTexFig 608 156 a %%BeginDocument: dury.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 388 2270 translate 16 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2400 2080 15200 2080 2400 2080 2400 1904 5600 2080 5600 1904 8800 2080 8800 1904 12000 2080 12000 1904 15200 2080 15200 1904 6 dopairs 2080 2400 2080 15200 2080 2400 1904 2400 2080 4533 1904 4533 2080 6666 1904 6666 2080 8800 1904 8800 2080 10933 1904 10933 2080 13066 1904 13066 2080 15200 1904 15200 8 dopairs % Data Set 1: 32 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {1.0 1.0 1.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def % Draw error Bars with solid line 3200 7307 3200 6415 3360 6415 3040 6415 4800 6521 4800 5499 4960 5499 4640 5499 6400 4157 6400 3549 6560 3549 6240 3549 8000 4646 8000 3965 8160 3965 7840 3965 9600 5557 9600 4679 9760 4679 9440 4679 11200 5690 11200 4825 11360 4825 11040 4825 12 dopairs % Draw data line newpath 3200 7307 4800 6521 6400 4157 8000 4646 9600 5557 11200 5690 6 doline 3200 7307 4800 6521 6400 4157 8000 4646 9600 5557 11200 5690 6 {showmark} repeat % Data Set 2: /fillcolor {0.0 0.0 0.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def % Draw error Bars with solid line 3200 14894 3200 13373 3360 14894 3040 14894 4800 8832 4800 7756 4960 8832 4640 8832 6400 8335 6400 7190 6560 8335 6240 8335 8000 8298 8000 7146 8160 8298 7840 8298 9600 6962 9600 6200 9760 6962 9440 6962 11200 8368 11200 7414 11360 8368 11040 8368 12800 7039 12800 6089 12960 7039 12640 7039 14400 6664 14400 5756 14560 6664 14240 6664 16 dopairs % Draw data line newpath 3200 13373 4800 7756 6400 7190 8000 7146 9600 6200 11200 7414 12800 6089 14400 5756 8 doline 3200 13373 4800 7756 6400 7190 8000 7146 9600 6200 11200 7414 12800 6089 14400 5756 8 {showmark} repeat /fontsiz 768 def /spacesiz 51 def /fontsiz 768 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 63 def /txtpos [0.50 0.00] def 544 9117 (Time to target \(sec\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8438 523 (Trial) sprnt /fontsiz 771 def /spacesiz 51 def /fontsiz 771 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 64 def /txtpos [0.50 1.00] def 819 17200 (b\)) sprnt /txtpos [0.00 0.00] def /fontsiz 628 def /spacesiz 41 def /fontsiz 628 def /spacesiz 41 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 52 def /txtpos [0.50 1.00] def 2400 1744 (0) sprnt 5600 1744 (10) sprnt 8800 1744 (20) sprnt 12000 1744 (30) sprnt 15200 1744 (40) sprnt /txtpos [1.00 0.35] def 1744 2400 (6) sprnt 1744 4533 (8) sprnt 1744 6666 (10) sprnt 1744 8800 (12) sprnt 1744 10933 (14) sprnt 1744 13066 (16) sprnt 1744 15200 (18) sprnt /fontsiz 512 def /spacesiz 34 def /fontsiz 512 def /spacesiz 34 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 42 def /txtpos [1.00 0.00] def /nlin 5 def /fillcolor {1.0 1.0 1.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def /showkey {showkeyline solid setdash /linestyle {solid} def /offx 0 def showkeysymb solid setdash /linestyle {solid} def /offx 1600 def showkeysymb pop pop} def 12806 11856 (Control ) (Control ) stringmark 12806 11856 (Control ) sprnt /nlin 5 def /fillcolor {0.0 0.0 0.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def /showkey {showkeyline solid setdash /linestyle {solid} def /offx 0 def showkeysymb solid setdash /linestyle {solid} def /offx 1600 def showkeysymb pop pop} def 12771 12742 (One-point Y Shift ) (One-point Y Shift ) stringmark 12771 12742 (One-point Y Shift ) sprnt -388 -2270 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 1374 148 a 11840716 12195937 1973452 6512394 40455782 46376140 startTexFig 1374 148 a %%BeginDocument: dur2.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 388 2270 translate 16 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2400 2080 15200 2080 2400 2080 2400 1904 6666 2080 6666 1904 10933 2080 10933 1904 15200 2080 15200 1904 5 dopairs 2080 2329 2080 15200 2080 2329 1904 2329 2080 4474 1904 4474 2080 6619 1904 6619 2080 8764 1904 8764 2080 10909 1904 10909 2080 13054 1904 13054 2080 15200 1904 15200 8 dopairs % Data Set 1: 32 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def % Draw error Bars with solid line 3467 16025 3467 15063 3467 15063 3467 14100 3627 16025 3307 16025 3627 14100 3307 14100 5600 13595 5600 12820 5600 12820 5600 12045 5760 13595 5440 13595 5760 12045 5440 12045 7733 12112 7733 11386 7733 11386 7733 10660 7893 12112 7573 12112 7893 10660 7573 10660 9867 9179 9867 8467 9867 8467 9867 7754 10027 9179 9707 9179 10027 7754 9707 7754 12000 9681 12000 8902 12000 8902 12000 8122 12160 9681 11840 9681 12160 8122 11840 8122 14133 6986 14133 6308 14133 6308 14133 5630 14293 6986 13973 6986 14293 5630 13973 5630 24 dopairs % Draw data line newpath 3467 15063 5600 12820 7733 11386 9867 8467 12000 8902 14133 6308 6 doline 3467 15063 5600 12820 7733 11386 9867 8467 12000 8902 14133 6308 6 {showmark} repeat % Data Set 2: /fillcolor {1.0 1.0 1.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def % Draw error Bars with solid line 3467 5861 3467 4696 3467 4696 3467 3532 3627 5861 3307 5861 3627 3532 3307 3532 5600 6223 5600 5157 5600 5157 5600 4091 5760 6223 5440 6223 5760 4091 5440 4091 7733 6580 7733 5422 7733 5422 7733 4263 7893 6580 7573 6580 7893 4263 7573 4263 9867 7557 9867 6308 9867 6308 9867 5058 10027 7557 9707 7557 10027 5058 9707 5058 12000 4957 12000 3944 12000 3944 12000 2931 12160 4957 11840 4957 12160 2931 11840 2931 14133 5853 14133 4940 14133 4940 14133 4028 14293 5853 13973 5853 14293 4028 13973 4028 24 dopairs % Draw data line newpath 3467 4696 5600 5157 7733 5422 9867 6308 12000 3944 14133 4940 6 doline 3467 4696 5600 5157 7733 5422 9867 6308 12000 3944 14133 4940 6 {showmark} repeat /fontsiz 768 def /spacesiz 51 def /fontsiz 768 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 63 def /txtpos [0.50 0.00] def 684 8830 (Time to target \(sec\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8438 523 (Trial) sprnt /txtpos [0.50 1.00] def 819 17200 (c\)) sprnt /txtpos [0.00 0.00] def /fontsiz 628 def /spacesiz 41 def /fontsiz 628 def /spacesiz 41 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 52 def /txtpos [0.50 1.00] def 2400 1744 (0) sprnt 6666 1744 (20) sprnt 10933 1744 (40) sprnt 15200 1744 (60) sprnt /txtpos [1.00 0.35] def 1744 2329 (8) sprnt 1744 4474 (10) sprnt 1744 6619 (12) sprnt 1744 8764 (14) sprnt 1744 10909 (16) sprnt 1744 13054 (18) sprnt 1744 15200 (20) sprnt /fontsiz 512 def /spacesiz 34 def /fontsiz 512 def /spacesiz 34 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 42 def /txtpos [1.00 0.00] def /nlin 5 def /fillcolor {0.0 0.0 0.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def /showkey {showkeyline solid setdash /linestyle {solid} def /offx 0 def showkeysymb solid setdash /linestyle {solid} def /offx 1600 def showkeysymb pop pop} def 14145 14215 (Two-point Y Shift ) (Two-point Y Shift ) stringmark 14145 14215 (Two-point Y Shift ) sprnt /nlin 5 def /fillcolor {1.0 1.0 1.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 320 def /ori 0.00 def /showmark {docircle} def /showkey {showkeyline solid setdash /linestyle {solid} def /offx 0 def showkeysymb solid setdash /linestyle {solid} def /offx 1600 def showkeysymb pop pop} def 14144 13376 (Control ) (Control ) stringmark 14144 13376 (Control ) sprnt -388 -2270 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig eop %%Page: 31 31 31 30 bop 868 119 a Fo(Figure)16 b(6:)225 148 y 11840716 11840716 1973452 9209446 36311531 43876433 startTexFig 225 148 a %%BeginDocument: ca.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 13337 1048 2157 894 2157 1048 4020 894 4020 1048 5883 894 5883 1048 7747 894 7747 1048 9610 894 9610 1048 11473 894 11473 1048 13337 894 13337 8 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 26 def /symbsiz 26 def /symbw 52 def /symbh 194 def /ori 2.32 def /showmark {plotsymb} def /symbary [0 0 26 62 -18 0 0 132 -16 0 0 -132 -18 0 26 -62] def % Arrow /fillcolor {0.0 0.0 0.0} def 1809 2149 1 {showmark} repeat /patternw 37 def /symbsiz 37 def /symbw 74 def /symbh 270 def /ori 51.43 def /showmark {plotsymb} def /symbary [0 0 37 88 -25 0 0 182 -24 0 0 -182 -25 0 37 -88] def % Arrow 1835 7536 1 {showmark} repeat /patternw 60 def /symbsiz 60 def /symbw 120 def /symbh 440 def /ori 33.69 def /showmark {plotsymb} def /symbary [0 0 60 144 -40 0 0 296 -40 0 0 -296 -40 0 60 -144] def % Arrow 1636 13093 1 {showmark} repeat /patternw 48 def /symbsiz 48 def /symbw 96 def /symbh 352 def /ori 355.74 def /showmark {plotsymb} def /symbary [0 0 48 115 -32 0 0 237 -32 0 0 -237 -32 0 48 -115] def % Arrow 7241 2183 1 {showmark} repeat /patternw 43 def /symbsiz 43 def /symbw 86 def /symbh 318 def /ori 350.02 def /showmark {plotsymb} def /symbary [0 0 43 103 -29 0 0 215 -28 0 0 -215 -29 0 43 -103] def % Arrow 7281 7802 1 {showmark} repeat /patternw 45 def /symbsiz 45 def /symbw 90 def /symbh 332 def /ori 358.64 def /showmark {plotsymb} def /symbary [0 0 45 108 -30 0 0 224 -30 0 0 -224 -30 0 45 -108] def % Arrow 7261 13345 1 {showmark} repeat /patternw 42 def /symbsiz 42 def /symbw 84 def /symbh 308 def /ori 327.34 def /showmark {plotsymb} def /symbary [0 0 42 100 -28 0 0 208 -28 0 0 -208 -28 0 42 -100] def % Arrow 12923 2324 1 {showmark} repeat /patternw 28 def /symbsiz 28 def /symbw 56 def /symbh 202 def /ori 337.74 def /showmark {plotsymb} def /symbary [0 0 28 67 -19 0 0 135 -18 0 0 -135 -19 0 28 -67] def % Arrow 12996 7824 1 {showmark} repeat /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 302 def /ori 318.75 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 204 -26 0 0 -204 -28 0 41 -98] def % Arrow 12956 13536 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 263 def /symbsiz 263 def /symbw 526 def /symbh 656 def /ori 45.56 def /ratio 1.247148 def /showmark {doellipse} def 12956 13536 1 {showmark} repeat /patternw 177 def /symbsiz 177 def /symbw 354 def /symbh 434 def /ori 3.63 def /ratio 1.225989 def /showmark {doellipse} def 1809 2149 1 {showmark} repeat /patternw 206 def /symbsiz 206 def /symbw 412 def /symbh 506 def /ori 125.79 def /ratio 1.228155 def /showmark {doellipse} def 1835 7536 1 {showmark} repeat /patternw 204 def /symbsiz 204 def /symbw 408 def /symbh 530 def /ori 14.18 def /ratio 1.299020 def /showmark {doellipse} def 1636 13093 1 {showmark} repeat /patternw 163 def /symbsiz 163 def /symbw 326 def /symbh 408 def /ori 33.70 def /ratio 1.251534 def /showmark {doellipse} def 7241 2183 1 {showmark} repeat /patternw 214 def /symbsiz 214 def /symbw 428 def /symbh 570 def /ori 133.48 def /ratio 1.331776 def /showmark {doellipse} def 7281 7802 1 {showmark} repeat /patternw 221 def /symbsiz 221 def /symbw 442 def /symbh 588 def /ori 20.63 def /ratio 1.330317 def /showmark {doellipse} def 12923 2324 1 {showmark} repeat /patternw 236 def /symbsiz 236 def /symbw 472 def /symbh 558 def /ori 49.79 def /ratio 1.182203 def /showmark {doellipse} def 12996 7824 1 {showmark} repeat /patternw 240 def /symbsiz 240 def /symbw 480 def /symbh 546 def /ori 104.73 def /ratio 1.137500 def /showmark {doellipse} def 7261 13345 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -345 7813 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7725 -391 (X \(cm\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4020 (25) sprnt 754 5883 (30) sprnt 754 7747 (35) sprnt 754 9610 (40) sprnt 754 11473 (45) sprnt 754 13337 (50) sprnt /fontsiz 856 def /spacesiz 57 def /fontsiz 856 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -813 14115 (a\)) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 991 148 a 11840716 11840716 2105016 9209446 36311531 43744870 startTexFig 991 148 a %%BeginDocument: cb.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 13337 1048 2157 894 2157 1048 4020 894 4020 1048 5883 894 5883 1048 7747 894 7747 1048 9610 894 9610 1048 11473 894 11473 1048 13337 894 13337 8 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 28 def /symbsiz 28 def /symbw 56 def /symbh 206 def /ori 6.31 def /showmark {plotsymb} def /symbary [0 0 28 67 -19 0 0 139 -18 0 0 -139 -19 0 28 -67] def % Arrow /fillcolor {0.0 0.0 0.0} def 1798 2134 1 {showmark} repeat /patternw 29 def /symbsiz 29 def /symbw 58 def /symbh 210 def /ori 17.38 def /showmark {plotsymb} def /symbary [0 0 29 69 -20 0 0 141 -18 0 0 -141 -20 0 29 -69] def % Arrow 1802 3957 1 {showmark} repeat /patternw 32 def /symbsiz 32 def /symbw 64 def /symbh 234 def /ori 34.05 def /showmark {plotsymb} def /symbary [0 0 32 76 -22 0 0 158 -20 0 0 -158 -22 0 32 -76] def % Arrow 1809 5753 1 {showmark} repeat /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 264 def /ori 41.65 def /showmark {plotsymb} def /symbary [0 0 36 86 -24 0 0 178 -24 0 0 -178 -24 0 36 -86] def % Arrow 1806 7572 1 {showmark} repeat /patternw 42 def /symbsiz 42 def /symbw 84 def /symbh 306 def /ori 39.12 def /showmark {plotsymb} def /symbary [0 0 42 100 -28 0 0 206 -28 0 0 -206 -28 0 42 -100] def % Arrow 1765 9416 1 {showmark} repeat /patternw 50 def /symbsiz 50 def /symbw 100 def /symbh 370 def /ori 34.33 def /showmark {plotsymb} def /symbary [0 0 50 119 -34 0 0 251 -32 0 0 -251 -34 0 50 -119] def % Arrow 1698 11265 1 {showmark} repeat /patternw 56 def /symbsiz 56 def /symbw 112 def /symbh 408 def /ori 31.89 def /showmark {plotsymb} def /symbary [0 0 56 134 -38 0 0 274 -36 0 0 -274 -38 0 56 -134] def % Arrow 1656 13122 1 {showmark} repeat /patternw 33 def /symbsiz 33 def /symbw 66 def /symbh 242 def /ori 1.86 def /showmark {plotsymb} def /symbary [0 0 33 79 -22 0 0 163 -22 0 0 -163 -22 0 33 -79] def % Arrow 3624 2149 1 {showmark} repeat /patternw 32 def /symbsiz 32 def /symbw 64 def /symbh 236 def /ori 8.91 def /showmark {plotsymb} def /symbary [0 0 32 76 -22 0 0 160 -20 0 0 -160 -22 0 32 -76] def % Arrow 3632 3983 1 {showmark} repeat /patternw 33 def /symbsiz 33 def /symbw 66 def /symbh 242 def /ori 20.65 def /showmark {plotsymb} def /symbary [0 0 33 79 -22 0 0 163 -22 0 0 -163 -22 0 33 -79] def % Arrow 3639 5798 1 {showmark} repeat /patternw 35 def /symbsiz 35 def /symbw 70 def /symbh 256 def /ori 27.79 def /showmark {plotsymb} def /symbary [0 0 35 83 -24 0 0 173 -22 0 0 -173 -24 0 35 -83] def % Arrow 3639 7627 1 {showmark} repeat /patternw 40 def /symbsiz 40 def /symbw 80 def /symbh 290 def /ori 28.25 def /showmark {plotsymb} def /symbary [0 0 40 95 -27 0 0 195 -26 0 0 -195 -27 0 40 -95] def % Arrow 3610 9472 1 {showmark} repeat /patternw 47 def /symbsiz 47 def /symbw 94 def /symbh 344 def /ori 26.31 def /showmark {plotsymb} def /symbary [0 0 47 112 -32 0 0 232 -30 0 0 -232 -32 0 47 -112] def % Arrow 3557 11321 1 {showmark} repeat /patternw 51 def /symbsiz 51 def /symbw 102 def /symbh 378 def /ori 25.02 def /showmark {plotsymb} def /symbary [0 0 51 122 -34 0 0 256 -34 0 0 -256 -34 0 51 -122] def % Arrow 3524 13177 1 {showmark} repeat /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 298 def /ori 357.15 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 200 -26 0 0 -200 -28 0 41 -98] def % Arrow 5432 2172 1 {showmark} repeat /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 290 def /ori 359.14 def /showmark {plotsymb} def /symbary [0 0 39 93 -26 0 0 197 -26 0 0 -197 -26 0 39 -93] def % Arrow 5439 4024 1 {showmark} repeat /patternw 38 def /symbsiz 38 def /symbw 76 def /symbh 280 def /ori 3.04 def /showmark {plotsymb} def /symbary [0 0 38 91 -26 0 0 189 -24 0 0 -189 -26 0 38 -91] def % Arrow 5451 5869 1 {showmark} repeat /patternw 38 def /symbsiz 38 def /symbw 76 def /symbh 276 def /ori 5.42 def /showmark {plotsymb} def /symbary [0 0 38 91 -26 0 0 185 -24 0 0 -185 -26 0 38 -91] def % Arrow 5454 7721 1 {showmark} repeat /patternw 40 def /symbsiz 40 def /symbw 80 def /symbh 294 def /ori 8.03 def /showmark {plotsymb} def /symbary [0 0 40 96 -27 0 0 198 -26 0 0 -198 -27 0 40 -96] def % Arrow 5439 9569 1 {showmark} repeat /patternw 44 def /symbsiz 44 def /symbw 88 def /symbh 322 def /ori 10.00 def /showmark {plotsymb} def /symbary [0 0 44 105 -30 0 0 217 -28 0 0 -217 -30 0 44 -105] def % Arrow 5413 11418 1 {showmark} repeat /patternw 46 def /symbsiz 46 def /symbw 92 def /symbh 340 def /ori 10.76 def /showmark {plotsymb} def /symbary [0 0 46 110 -31 0 0 230 -30 0 0 -230 -31 0 46 -110] def % Arrow 5395 13273 1 {showmark} repeat /patternw 45 def /symbsiz 45 def /symbw 90 def /symbh 328 def /ori 354.21 def /showmark {plotsymb} def /symbary [0 0 45 108 -30 0 0 220 -30 0 0 -220 -30 0 45 -108] def % Arrow 7266 2190 1 {showmark} repeat /patternw 44 def /symbsiz 44 def /symbw 88 def /symbh 318 def /ori 353.87 def /showmark {plotsymb} def /symbary [0 0 44 105 -30 0 0 213 -28 0 0 -213 -30 0 44 -105] def % Arrow 7276 4054 1 {showmark} repeat /patternw 42 def /symbsiz 42 def /symbw 84 def /symbh 304 def /ori 353.73 def /showmark {plotsymb} def /symbary [0 0 42 100 -28 0 0 204 -28 0 0 -204 -28 0 42 -100] def % Arrow 7291 5917 1 {showmark} repeat /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 300 def /ori 353.64 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 202 -26 0 0 -202 -28 0 41 -98] def % Arrow 7296 7780 1 {showmark} repeat /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 304 def /ori 355.04 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 206 -26 0 0 -206 -28 0 41 -98] def % Arrow 7291 9636 1 {showmark} repeat /patternw 43 def /symbsiz 43 def /symbw 86 def /symbh 318 def /ori 358.11 def /showmark {plotsymb} def /symbary [0 0 43 103 -29 0 0 215 -28 0 0 -215 -29 0 43 -103] def % Arrow 7276 11485 1 {showmark} repeat /patternw 44 def /symbsiz 44 def /symbw 88 def /symbh 324 def /ori 359.38 def /showmark {plotsymb} def /symbary [0 0 44 105 -30 0 0 219 -28 0 0 -219 -30 0 44 -105] def % Arrow 7269 13341 1 {showmark} repeat /patternw 44 def /symbsiz 44 def /symbw 88 def /symbh 324 def /ori 347.99 def /showmark {plotsymb} def /symbary [0 0 44 105 -30 0 0 219 -28 0 0 -219 -30 0 44 -105] def % Arrow 9140 2224 1 {showmark} repeat /patternw 42 def /symbsiz 42 def /symbw 84 def /symbh 312 def /ori 347.59 def /showmark {plotsymb} def /symbary [0 0 42 100 -28 0 0 212 -28 0 0 -212 -28 0 42 -100] def % Arrow 9151 4087 1 {showmark} repeat /patternw 40 def /symbsiz 40 def /symbw 80 def /symbh 292 def /ori 347.62 def /showmark {plotsymb} def /symbary [0 0 40 96 -27 0 0 196 -26 0 0 -196 -27 0 40 -96] def % Arrow 9170 5947 1 {showmark} repeat /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 286 def /ori 348.00 def /showmark {plotsymb} def /symbary [0 0 39 93 -26 0 0 193 -26 0 0 -193 -26 0 39 -93] def % Arrow 9177 7807 1 {showmark} repeat /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 286 def /ori 347.83 def /showmark {plotsymb} def /symbary [0 0 39 93 -26 0 0 193 -26 0 0 -193 -26 0 39 -93] def % Arrow 9177 9670 1 {showmark} repeat /patternw 40 def /symbsiz 40 def /symbw 80 def /symbh 296 def /ori 347.76 def /showmark {plotsymb} def /symbary [0 0 40 96 -27 0 0 200 -26 0 0 -200 -27 0 40 -96] def % Arrow 9166 11537 1 {showmark} repeat /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 304 def /ori 347.92 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 206 -26 0 0 -206 -28 0 41 -98] def % Arrow 9159 13401 1 {showmark} repeat /patternw 42 def /symbsiz 42 def /symbw 84 def /symbh 306 def /ori 337.90 def /showmark {plotsymb} def /symbary [0 0 42 100 -28 0 0 206 -28 0 0 -206 -28 0 42 -100] def % Arrow 11037 2272 1 {showmark} repeat /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 288 def /ori 338.71 def /showmark {plotsymb} def /symbary [0 0 39 93 -26 0 0 195 -26 0 0 -195 -26 0 39 -93] def % Arrow 11051 4125 1 {showmark} repeat /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 260 def /ori 340.84 def /showmark {plotsymb} def /symbary [0 0 36 86 -24 0 0 174 -24 0 0 -174 -24 0 36 -86] def % Arrow 11074 5970 1 {showmark} repeat /patternw 34 def /symbsiz 34 def /symbw 68 def /symbh 248 def /ori 341.50 def /showmark {plotsymb} def /symbary [0 0 34 81 -23 0 0 167 -22 0 0 -167 -23 0 34 -81] def % Arrow 11085 7826 1 {showmark} repeat /patternw 35 def /symbsiz 35 def /symbw 70 def /symbh 256 def /ori 338.60 def /showmark {plotsymb} def /symbary [0 0 35 84 -24 0 0 172 -22 0 0 -172 -24 0 35 -84] def % Arrow 11082 9704 1 {showmark} repeat /patternw 37 def /symbsiz 37 def /symbw 74 def /symbh 274 def /ori 335.22 def /showmark {plotsymb} def /symbary [0 0 37 88 -25 0 0 186 -24 0 0 -186 -25 0 37 -88] def % Arrow 11071 11589 1 {showmark} repeat /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 288 def /ori 333.20 def /showmark {plotsymb} def /symbary [0 0 39 93 -26 0 0 195 -26 0 0 -195 -26 0 39 -93] def % Arrow 11063 13467 1 {showmark} repeat /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 298 def /ori 330.96 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 200 -26 0 0 -200 -28 0 41 -98] def % Arrow 12922 2302 1 {showmark} repeat /patternw 38 def /symbsiz 38 def /symbw 76 def /symbh 278 def /ori 331.99 def /showmark {plotsymb} def /symbary [0 0 38 91 -26 0 0 187 -24 0 0 -187 -26 0 38 -91] def % Arrow 12937 4151 1 {showmark} repeat /patternw 33 def /symbsiz 33 def /symbw 66 def /symbh 242 def /ori 335.47 def /showmark {plotsymb} def /symbary [0 0 33 79 -22 0 0 163 -22 0 0 -163 -22 0 33 -79] def % Arrow 12963 5984 1 {showmark} repeat /patternw 31 def /symbsiz 31 def /symbw 62 def /symbh 226 def /ori 336.89 def /showmark {plotsymb} def /symbary [0 0 31 74 -21 0 0 152 -20 0 0 -152 -21 0 31 -74] def % Arrow 12975 7836 1 {showmark} repeat /patternw 32 def /symbsiz 32 def /symbw 64 def /symbh 238 def /ori 332.97 def /showmark {plotsymb} def /symbary [0 0 32 76 -22 0 0 162 -20 0 0 -162 -22 0 32 -76] def % Arrow 12971 9719 1 {showmark} repeat /patternw 37 def /symbsiz 37 def /symbw 74 def /symbh 268 def /ori 326.41 def /showmark {plotsymb} def /symbary [0 0 37 88 -25 0 0 180 -24 0 0 -180 -25 0 37 -88] def % Arrow 12960 11623 1 {showmark} repeat /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 290 def /ori 323.92 def /showmark {plotsymb} def /symbary [0 0 39 93 -26 0 0 197 -26 0 0 -197 -26 0 39 -93] def % Arrow 12949 13508 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -345 7813 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7725 -391 (X \(cm\)) sprnt /fontsiz 856 def /spacesiz 57 def /fontsiz 856 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -720 14050 (b\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4020 (25) sprnt 754 5883 (30) sprnt 754 7747 (35) sprnt 754 9610 (40) sprnt 754 11473 (45) sprnt 754 13337 (50) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 225 918 a 11840716 11840716 1973452 9143664 36574658 43810652 startTexFig 0 rotate 225 918 a %%BeginDocument: c2a.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 13337 1048 2157 894 2157 1048 4020 894 4020 1048 5883 894 5883 1048 7747 894 7747 1048 9610 894 9610 1048 11473 894 11473 1048 13337 894 13337 8 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 16 def /symbsiz 16 def /symbw 32 def /symbh 120 def /ori 250.12 def /showmark {plotsymb} def /symbary [0 0 16 38 -11 0 0 82 -10 0 0 -82 -11 0 16 -38] def % Arrow /fillcolor {0.0 0.0 0.0} def 2044 2271 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 25 def /symbsiz 25 def /symbw 50 def /symbh 180 def /ori 150.84 def /showmark {plotsymb} def /symbary [0 0 25 60 -17 0 0 120 -16 0 0 -120 -17 0 25 -60] def % Arrow /fillcolor {0.0 0.0 0.0} def 2161 7659 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 59 def /symbsiz 59 def /symbw 118 def /symbh 436 def /ori 143.86 def /showmark {plotsymb} def /symbary [0 0 59 141 -40 0 0 295 -38 0 0 -295 -40 0 59 -141] def % Arrow /fillcolor {0.0 0.0 0.0} def 2356 13080 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 302 def /ori 331.88 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 204 -26 0 0 -204 -28 0 41 -98] def % Arrow /fillcolor {0.0 0.0 0.0} def 7327 2299 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 7 def /symbsiz 7 def /symbw 14 def /symbh 48 def /ori 247.07 def /showmark {plotsymb} def /symbary [0 0 7 16 -5 0 0 32 -4 0 0 -32 -5 0 7 -16] def % Arrow /fillcolor {0.0 0.0 0.0} def 7613 7793 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 266 def /ori 34.58 def /showmark {plotsymb} def /symbary [0 0 36 86 -24 0 0 180 -24 0 0 -180 -24 0 36 -86] def % Arrow /fillcolor {0.0 0.0 0.0} def 7374 13186 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 288 def /ori 283.49 def /showmark {plotsymb} def /symbary [0 0 39 93 -26 0 0 195 -26 0 0 -195 -26 0 39 -93] def % Arrow /fillcolor {0.0 0.0 0.0} def 13116 2437 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 43 def /symbsiz 43 def /symbw 86 def /symbh 314 def /ori 195.97 def /showmark {plotsymb} def /symbary [0 0 43 103 -29 0 0 211 -28 0 0 -211 -29 0 43 -103] def % Arrow /fillcolor {0.0 0.0 0.0} def 13486 7834 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 268 def /ori 68.37 def /showmark {plotsymb} def /symbary [0 0 36 86 -24 0 0 182 -24 0 0 -182 -24 0 36 -86] def % Arrow /fillcolor {0.0 0.0 0.0} def 13085 13088 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 69 def /symbsiz 69 def /symbw 138 def /symbh 510 def /ori 138.40 def /showmark {plotsymb} def /symbary [0 0 69 165 -46 0 0 345 -46 0 0 -345 -46 0 69 -165] def % Arrow /fillcolor {0.0 0.0 0.0} def 5180 7408 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 59 def /symbsiz 59 def /symbw 118 def /symbh 430 def /ori 303.17 def /showmark {plotsymb} def /symbary [0 0 59 141 -40 0 0 289 -38 0 0 -289 -40 0 59 -141] def % Arrow /fillcolor {0.0 0.0 0.0} def 10153 8108 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 196 def /symbsiz 196 def /symbw 392 def /symbh 518 def /ori -12.47 def /ratio 1.321429 def /showmark {doellipse} def 2044 2271 1 {showmark} repeat /patternw 285 def /symbsiz 285 def /symbw 570 def /symbh 710 def /ori -32.79 def /ratio 1.245614 def /showmark {doellipse} def 2161 7659 1 {showmark} repeat /patternw 219 def /symbsiz 219 def /symbw 438 def /symbh 572 def /ori -13.65 def /ratio 1.305936 def /showmark {doellipse} def 2356 13080 1 {showmark} repeat /patternw 177 def /symbsiz 177 def /symbw 354 def /symbh 482 def /ori -6.32 def /ratio 1.361582 def /showmark {doellipse} def 7327 2299 1 {showmark} repeat /patternw 263 def /symbsiz 263 def /symbw 526 def /symbh 636 def /ori 100.48 def /ratio 1.209126 def /showmark {doellipse} def 7613 7793 1 {showmark} repeat /patternw 265 def /symbsiz 265 def /symbw 530 def /symbh 754 def /ori 7.73 def /ratio 1.422642 def /showmark {doellipse} def 7374 13186 1 {showmark} repeat /patternw 167 def /symbsiz 167 def /symbw 334 def /symbh 628 def /ori 29.28 def /ratio 1.880239 def /showmark {doellipse} def 13116 2437 1 {showmark} repeat /patternw 245 def /symbsiz 245 def /symbw 490 def /symbh 634 def /ori 36.58 def /ratio 1.293878 def /showmark {doellipse} def 13486 7834 1 {showmark} repeat /patternw 244 def /symbsiz 244 def /symbw 488 def /symbh 606 def /ori 29.79 def /ratio 1.241803 def /showmark {doellipse} def 13085 13088 1 {showmark} repeat /patternw 272 def /symbsiz 272 def /symbw 544 def /symbh 686 def /ori 103.20 def /ratio 1.261029 def /showmark {doellipse} def 5180 7408 1 {showmark} repeat /patternw 216 def /symbsiz 216 def /symbw 432 def /symbh 688 def /ori 111.11 def /ratio 1.592593 def /showmark {doellipse} def 10153 8108 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -345 7813 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7725 -391 (X \(cm\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4020 (25) sprnt 754 5883 (30) sprnt 754 7747 (35) sprnt 754 9610 (40) sprnt 754 11473 (45) sprnt 754 13337 (50) sprnt /fontsiz 856 def /spacesiz 57 def /fontsiz 856 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -814 14083 (c\)) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 991 903 a 11840716 12077530 2433925 9143664 36311531 43744870 startTexFig 0 rotate 991 903 a %%BeginDocument: c2b.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 13337 1048 2157 894 2157 1048 4020 894 4020 1048 5883 894 5883 1048 7747 894 7747 1048 9610 894 9610 1048 11473 894 11473 1048 13337 894 13337 8 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 12 def /symbsiz 12 def /symbw 24 def /symbh 88 def /ori 242.43 def /showmark {plotsymb} def /symbary [0 0 12 28 -8 0 0 60 -8 0 0 -60 -8 0 12 -28] def % Arrow /fillcolor {0.0 0.0 0.0} def 2044 2236 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 14 def /symbsiz 14 def /symbw 28 def /symbh 100 def /ori 180.00 def /showmark {plotsymb} def /symbary [0 0 14 33 -10 0 0 67 -8 0 0 -67 -10 0 14 -33] def % Arrow /fillcolor {0.0 0.0 0.0} def 2104 4020 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 27 def /symbsiz 27 def /symbw 54 def /symbh 202 def /ori 150.01 def /showmark {plotsymb} def /symbary [0 0 27 64 -18 0 0 138 -18 0 0 -138 -18 0 27 -64] def % Arrow /fillcolor {0.0 0.0 0.0} def 2179 5783 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 264 def /ori 144.68 def /showmark {plotsymb} def /symbary [0 0 36 86 -24 0 0 178 -24 0 0 -178 -24 0 36 -86] def % Arrow /fillcolor {0.0 0.0 0.0} def 2219 7594 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 296 def /ori 143.23 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 198 -26 0 0 -198 -28 0 41 -98] def % Arrow /fillcolor {0.0 0.0 0.0} def 2242 9432 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 47 def /symbsiz 47 def /symbw 94 def /symbh 342 def /ori 141.52 def /showmark {plotsymb} def /symbary [0 0 47 112 -32 0 0 230 -30 0 0 -230 -32 0 47 -112] def % Arrow /fillcolor {0.0 0.0 0.0} def 2271 11261 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 51 def /symbsiz 51 def /symbw 102 def /symbh 376 def /ori 140.65 def /showmark {plotsymb} def /symbary [0 0 51 122 -34 0 0 254 -34 0 0 -254 -34 0 51 -122] def % Arrow /fillcolor {0.0 0.0 0.0} def 2294 13099 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 11 def /symbsiz 11 def /symbw 22 def /symbh 78 def /ori 277.59 def /showmark {plotsymb} def /symbary [0 0 11 26 -8 0 0 52 -6 0 0 -52 -8 0 11 -26] def % Arrow /fillcolor {0.0 0.0 0.0} def 3856 2236 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 10 def /symbsiz 10 def /symbw 20 def /symbh 76 def /ori 172.06 def /showmark {plotsymb} def /symbary [0 0 10 23 -7 0 0 53 -6 0 0 -53 -7 0 10 -23] def % Arrow /fillcolor {0.0 0.0 0.0} def 3941 4010 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 27 def /symbsiz 27 def /symbw 54 def /symbh 200 def /ori 146.31 def /showmark {plotsymb} def /symbary [0 0 27 64 -18 0 0 136 -18 0 0 -136 -18 0 27 -64] def % Arrow /fillcolor {0.0 0.0 0.0} def 4034 5772 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 35 def /symbsiz 35 def /symbw 70 def /symbh 260 def /ori 143.17 def /showmark {plotsymb} def /symbary [0 0 35 84 -24 0 0 176 -22 0 0 -176 -24 0 35 -84] def % Arrow /fillcolor {0.0 0.0 0.0} def 4075 7591 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 37 def /symbsiz 37 def /symbw 74 def /symbh 276 def /ori 140.66 def /showmark {plotsymb} def /symbary [0 0 37 88 -25 0 0 188 -24 0 0 -188 -25 0 37 -88] def % Arrow /fillcolor {0.0 0.0 0.0} def 4079 9436 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 38 def /symbsiz 38 def /symbw 76 def /symbh 276 def /ori 134.49 def /showmark {plotsymb} def /symbary [0 0 38 91 -26 0 0 185 -24 0 0 -185 -26 0 38 -91] def % Arrow /fillcolor {0.0 0.0 0.0} def 4060 11277 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 38 def /symbsiz 38 def /symbw 76 def /symbh 280 def /ori 129.69 def /showmark {plotsymb} def /symbary [0 0 38 91 -26 0 0 189 -24 0 0 -189 -26 0 38 -91] def % Arrow /fillcolor {0.0 0.0 0.0} def 4045 13122 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 20 def /symbsiz 20 def /symbw 40 def /symbh 148 def /ori 319.07 def /showmark {plotsymb} def /symbary [0 0 20 47 -14 0 0 101 -12 0 0 -101 -14 0 20 -47] def % Arrow /fillcolor {0.0 0.0 0.0} def 5618 2254 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 3 def /symbsiz 3 def /symbw 6 def /symbh 20 def /ori 292.25 def /showmark {plotsymb} def /symbary [0 0 3 7 -2 0 0 13 -2 0 0 -13 -2 0 3 -7] def % Arrow /fillcolor {0.0 0.0 0.0} def 5722 4039 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 16 def /symbsiz 16 def /symbw 32 def /symbh 120 def /ori 149.89 def /showmark {plotsymb} def /symbary [0 0 16 38 -11 0 0 82 -10 0 0 -82 -11 0 16 -38] def % Arrow /fillcolor {0.0 0.0 0.0} def 5834 5824 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 24 def /symbsiz 24 def /symbw 48 def /symbh 174 def /ori 146.23 def /showmark {plotsymb} def /symbary [0 0 24 57 -16 0 0 117 -16 0 0 -117 -16 0 24 -57] def % Arrow /fillcolor {0.0 0.0 0.0} def 5875 7650 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 24 def /symbsiz 24 def /symbw 48 def /symbh 172 def /ori 136.83 def /showmark {plotsymb} def /symbary [0 0 24 57 -16 0 0 115 -16 0 0 -115 -16 0 24 -57] def % Arrow /fillcolor {0.0 0.0 0.0} def 5857 9491 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 22 def /symbsiz 22 def /symbw 44 def /symbh 158 def /ori 112.16 def /showmark {plotsymb} def /symbary [0 0 22 52 -15 0 0 106 -14 0 0 -106 -15 0 22 -52] def % Arrow /fillcolor {0.0 0.0 0.0} def 5790 11328 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 23 def /symbsiz 23 def /symbw 46 def /symbh 172 def /ori 88.54 def /showmark {plotsymb} def /symbary [0 0 23 55 -16 0 0 117 -14 0 0 -117 -16 0 23 -55] def % Arrow /fillcolor {0.0 0.0 0.0} def 5726 13166 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 30 def /symbsiz 30 def /symbw 60 def /symbh 220 def /ori 323.99 def /showmark {plotsymb} def /symbary [0 0 30 72 -20 0 0 148 -20 0 0 -148 -20 0 30 -72] def % Arrow /fillcolor {0.0 0.0 0.0} def 7414 2287 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 17 def /symbsiz 17 def /symbw 34 def /symbh 126 def /ori 314.72 def /showmark {plotsymb} def /symbary [0 0 17 40 -12 0 0 86 -10 0 0 -86 -12 0 17 -40] def % Arrow /fillcolor {0.0 0.0 0.0} def 7504 4110 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 7 def /symbsiz 7 def /symbw 14 def /symbh 48 def /ori 260.71 def /showmark {plotsymb} def /symbary [0 0 7 16 -5 0 0 32 -4 0 0 -32 -5 0 7 -16] def % Arrow /fillcolor {0.0 0.0 0.0} def 7601 5932 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 6 def /symbsiz 6 def /symbw 12 def /symbh 46 def /ori 208.95 def /showmark {plotsymb} def /symbary [0 0 6 14 -4 0 0 32 -4 0 0 -32 -4 0 6 -14] def % Arrow /fillcolor {0.0 0.0 0.0} def 7634 7770 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 3 def /symbsiz 3 def /symbw 6 def /symbh 20 def /ori 150.26 def /showmark {plotsymb} def /symbary [0 0 3 7 -2 0 0 13 -2 0 0 -13 -2 0 3 -7] def % Arrow /fillcolor {0.0 0.0 0.0} def 7612 9600 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 13 def /symbsiz 13 def /symbw 26 def /symbh 96 def /ori 54.58 def /showmark {plotsymb} def /symbary [0 0 13 31 -9 0 0 65 -8 0 0 -65 -9 0 13 -31] def % Arrow /fillcolor {0.0 0.0 0.0} def 7537 11396 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 25 def /symbsiz 25 def /symbw 50 def /symbh 186 def /ori 47.46 def /showmark {plotsymb} def /symbary [0 0 25 60 -17 0 0 126 -16 0 0 -126 -17 0 25 -60] def % Arrow /fillcolor {0.0 0.0 0.0} def 7467 13199 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 33 def /symbsiz 33 def /symbw 66 def /symbh 244 def /ori 313.12 def /showmark {plotsymb} def /symbary [0 0 33 79 -22 0 0 165 -22 0 0 -165 -22 0 33 -79] def % Arrow /fillcolor {0.0 0.0 0.0} def 9289 2336 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 27 def /symbsiz 27 def /symbw 54 def /symbh 200 def /ori 302.64 def /showmark {plotsymb} def /symbary [0 0 27 64 -18 0 0 136 -18 0 0 -136 -18 0 27 -64] def % Arrow /fillcolor {0.0 0.0 0.0} def 9349 4188 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 21 def /symbsiz 21 def /symbw 42 def /symbh 154 def /ori 286.70 def /showmark {plotsymb} def /symbary [0 0 21 50 -14 0 0 104 -14 0 0 -104 -14 0 21 -50] def % Arrow /fillcolor {0.0 0.0 0.0} def 9412 6032 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 18 def /symbsiz 18 def /symbw 36 def /symbh 136 def /ori 279.22 def /showmark {plotsymb} def /symbary [0 0 18 43 -12 0 0 93 -12 0 0 -93 -12 0 18 -43] def % Arrow /fillcolor {0.0 0.0 0.0} def 9435 7882 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 13 def /symbsiz 13 def /symbw 26 def /symbh 94 def /ori 295.62 def /showmark {plotsymb} def /symbary [0 0 13 31 -9 0 0 63 -8 0 0 -63 -9 0 13 -31] def % Arrow /fillcolor {0.0 0.0 0.0} def 9415 9696 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 13 def /symbsiz 13 def /symbw 26 def /symbh 96 def /ori 15.80 def /showmark {plotsymb} def /symbary [0 0 13 31 -9 0 0 65 -8 0 0 -65 -9 0 13 -31] def % Arrow /fillcolor {0.0 0.0 0.0} def 9364 11448 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 26 def /symbsiz 26 def /symbw 52 def /symbh 192 def /ori 41.14 def /showmark {plotsymb} def /symbary [0 0 26 62 -18 0 0 130 -16 0 0 -130 -18 0 26 -62] def % Arrow /fillcolor {0.0 0.0 0.0} def 9311 13211 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 34 def /symbsiz 34 def /symbw 68 def /symbh 256 def /ori 295.08 def /showmark {plotsymb} def /symbary [0 0 34 81 -23 0 0 175 -22 0 0 -175 -23 0 34 -81] def % Arrow /fillcolor {0.0 0.0 0.0} def 11212 2388 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 30 def /symbsiz 30 def /symbw 60 def /symbh 226 def /ori 286.40 def /showmark {plotsymb} def /symbary [0 0 30 72 -20 0 0 154 -20 0 0 -154 -20 0 30 -72] def % Arrow /fillcolor {0.0 0.0 0.0} def 11257 4237 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 27 def /symbsiz 27 def /symbw 54 def /symbh 198 def /ori 274.30 def /showmark {plotsymb} def /symbary [0 0 27 64 -18 0 0 134 -18 0 0 -134 -18 0 27 -64] def % Arrow /fillcolor {0.0 0.0 0.0} def 11306 6081 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 24 def /symbsiz 24 def /symbw 48 def /symbh 176 def /ori 268.86 def /showmark {plotsymb} def /symbary [0 0 24 57 -16 0 0 119 -16 0 0 -119 -16 0 24 -57] def % Arrow /fillcolor {0.0 0.0 0.0} def 11324 7923 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 15 def /symbsiz 15 def /symbw 30 def /symbh 112 def /ori 277.57 def /showmark {plotsymb} def /symbary [0 0 15 35 -10 0 0 77 -10 0 0 -77 -10 0 15 -35] def % Arrow /fillcolor {0.0 0.0 0.0} def 11306 9722 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 10 def /symbsiz 10 def /symbw 20 def /symbh 72 def /ori 21.29 def /showmark {plotsymb} def /symbary [0 0 10 23 -7 0 0 49 -6 0 0 -49 -7 0 10 -23] def % Arrow /fillcolor {0.0 0.0 0.0} def 11253 11448 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 26 def /symbsiz 26 def /symbw 52 def /symbh 188 def /ori 53.82 def /showmark {plotsymb} def /symbary [0 0 26 62 -18 0 0 126 -16 0 0 -126 -18 0 26 -62] def % Arrow /fillcolor {0.0 0.0 0.0} def 11209 13184 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 262 def /ori 283.02 def /showmark {plotsymb} def /symbary [0 0 36 86 -24 0 0 176 -24 0 0 -176 -24 0 36 -86] def % Arrow /fillcolor {0.0 0.0 0.0} def 13124 2414 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 31 def /symbsiz 31 def /symbw 62 def /symbh 228 def /ori 271.97 def /showmark {plotsymb} def /symbary [0 0 31 74 -21 0 0 154 -20 0 0 -154 -21 0 31 -74] def % Arrow /fillcolor {0.0 0.0 0.0} def 13176 4248 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 27 def /symbsiz 27 def /symbw 54 def /symbh 202 def /ori 253.92 def /showmark {plotsymb} def /symbary [0 0 27 64 -18 0 0 138 -18 0 0 -138 -18 0 27 -64] def % Arrow /fillcolor {0.0 0.0 0.0} def 13239 6078 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 24 def /symbsiz 24 def /symbw 48 def /symbh 176 def /ori 242.29 def /showmark {plotsymb} def /symbary [0 0 24 57 -16 0 0 119 -16 0 0 -119 -16 0 24 -57] def % Arrow /fillcolor {0.0 0.0 0.0} def 13266 7903 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 13 def /symbsiz 13 def /symbw 26 def /symbh 94 def /ori 236.31 def /showmark {plotsymb} def /symbary [0 0 13 31 -9 0 0 63 -8 0 0 -63 -9 0 13 -31] def % Arrow /fillcolor {0.0 0.0 0.0} def 13236 9689 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 10 def /symbsiz 10 def /symbw 20 def /symbh 70 def /ori 71.34 def /showmark {plotsymb} def /symbary [0 0 10 23 -7 0 0 47 -6 0 0 -47 -7 0 10 -23] def % Arrow /fillcolor {0.0 0.0 0.0} def 13161 11407 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 28 def /symbsiz 28 def /symbw 56 def /symbh 202 def /ori 66.19 def /showmark {plotsymb} def /symbary [0 0 28 67 -19 0 0 135 -18 0 0 -135 -19 0 28 -67] def % Arrow /fillcolor {0.0 0.0 0.0} def 13101 13151 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -345 7813 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7725 -391 (X \(cm\)) sprnt /fontsiz 855 def /spacesiz 57 def /fontsiz 855 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -580 14050 (d\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4020 (25) sprnt 754 5883 (30) sprnt 754 7747 (35) sprnt 754 9610 (40) sprnt 754 11473 (45) sprnt 754 13337 (50) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig eop %%Page: 32 32 32 31 bop 868 119 a Fo(Figure)16 b(7:)-143 170 y 11840716 11248674 2368143 9209446 40455782 45718323 startTexFig -143 170 a %%BeginDocument: xa.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 13337 1048 2157 894 2157 1048 4020 894 4020 1048 5883 894 5883 1048 7747 894 7747 1048 9610 894 9610 1048 11473 894 11473 1048 13337 894 13337 8 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 131 def /symbsiz 131 def /symbw 262 def /symbh 966 def /ori 166.25 def /showmark {plotsymb} def /symbary [0 0 131 314 -88 0 0 652 -86 0 0 -652 -88 0 131 -314] def % Arrow /fillcolor {0.0 0.0 0.0} def 2942 1927 1 {showmark} repeat /patternw 181 def /symbsiz 181 def /symbw 362 def /symbh 1328 def /ori 162.12 def /showmark {plotsymb} def /symbary [0 0 181 434 -121 0 0 894 -120 0 0 -894 -121 0 181 -434] def % Arrow 3268 7339 1 {showmark} repeat /patternw 149 def /symbsiz 149 def /symbw 298 def /symbh 1098 def /ori 172.15 def /showmark {plotsymb} def /symbary [0 0 149 357 -100 0 0 741 -98 0 0 -741 -100 0 149 -357] def % Arrow 3092 13187 1 {showmark} repeat /patternw 118 def /symbsiz 118 def /symbw 236 def /symbh 868 def /ori 182.19 def /showmark {plotsymb} def /symbary [0 0 118 283 -79 0 0 585 -78 0 0 -585 -79 0 118 -283] def % Arrow 8461 2190 1 {showmark} repeat /patternw 251 def /symbsiz 251 def /symbw 502 def /symbh 1844 def /ori 160.09 def /showmark {plotsymb} def /symbary [0 0 251 602 -168 0 0 1242 -166 0 0 -1242 -168 0 251 -602] def % Arrow 9327 7119 1 {showmark} repeat /patternw 139 def /symbsiz 139 def /symbw 278 def /symbh 1018 def /ori 151.15 def /showmark {plotsymb} def /symbary [0 0 139 333 -93 0 0 685 -92 0 0 -685 -93 0 139 -333] def % Arrow 8486 12846 1 {showmark} repeat /patternw 47 def /symbsiz 47 def /symbw 94 def /symbh 344 def /ori 154.15 def /showmark {plotsymb} def /symbary [0 0 47 112 -32 0 0 232 -30 0 0 -232 -32 0 47 -112] def % Arrow 13494 2007 1 {showmark} repeat /patternw 118 def /symbsiz 118 def /symbw 236 def /symbh 864 def /ori 178.32 def /showmark {plotsymb} def /symbary [0 0 118 283 -79 0 0 581 -78 0 0 -581 -79 0 118 -283] def % Arrow 14047 7722 1 {showmark} repeat /patternw 142 def /symbsiz 142 def /symbw 284 def /symbh 1048 def /ori 129.25 def /showmark {plotsymb} def /symbary [0 0 142 340 -95 0 0 708 -94 0 0 -708 -95 0 142 -340] def % Arrow 13846 12526 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 319 def /symbsiz 319 def /symbw 638 def /symbh 844 def /ori -0.14 def /ratio 1.322884 def /showmark {doellipse} def 13846 12526 1 {showmark} repeat /patternw 280 def /symbsiz 280 def /symbw 560 def /symbh 628 def /ori 9.97 def /ratio 1.121429 def /showmark {doellipse} def 2942 1927 1 {showmark} repeat /patternw 273 def /symbsiz 273 def /symbw 546 def /symbh 850 def /ori 54.47 def /ratio 1.556777 def /showmark {doellipse} def 3268 7339 1 {showmark} repeat /patternw 268 def /symbsiz 268 def /symbw 536 def /symbh 614 def /ori -39.58 def /ratio 1.145522 def /showmark {doellipse} def 3092 13187 1 {showmark} repeat /patternw 229 def /symbsiz 229 def /symbw 458 def /symbh 694 def /ori 92.25 def /ratio 1.515284 def /showmark {doellipse} def 8461 2190 1 {showmark} repeat /patternw 295 def /symbsiz 295 def /symbw 590 def /symbh 914 def /ori 126.08 def /ratio 1.549152 def /showmark {doellipse} def 9327 7119 1 {showmark} repeat /patternw 294 def /symbsiz 294 def /symbw 588 def /symbh 642 def /ori -24.22 def /ratio 1.091837 def /showmark {doellipse} def 8486 12846 1 {showmark} repeat /patternw 240 def /symbsiz 240 def /symbw 480 def /symbh 652 def /ori 127.17 def /ratio 1.358333 def /showmark {doellipse} def 13494 2007 1 {showmark} repeat /patternw 278 def /symbsiz 278 def /symbw 556 def /symbh 920 def /ori 16.57 def /ratio 1.654676 def /showmark {doellipse} def 14047 7722 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -345 7813 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7725 -391 (X \(cm\)) sprnt /fontsiz 856 def /spacesiz 57 def /fontsiz 856 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -474 14927 (a\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4020 (25) sprnt 754 5883 (30) sprnt 754 7747 (35) sprnt 754 9610 (40) sprnt 754 11473 (45) sprnt 754 13337 (50) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 623 163 a 11840716 11367081 2302361 9143664 40455782 45849886 startTexFig 623 163 a %%BeginDocument: xb.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 13337 1048 2157 894 2157 1048 4020 894 4020 1048 5883 894 5883 1048 7747 894 7747 1048 9610 894 9610 1048 11473 894 11473 1048 13337 894 13337 8 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 135 def /symbsiz 135 def /symbw 270 def /symbh 992 def /ori 166.76 def /showmark {plotsymb} def /symbary [0 0 135 323 -90 0 0 669 -90 0 0 -669 -90 0 135 -323] def % Arrow /fillcolor {0.0 0.0 0.0} def 2968 1930 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 148 def /symbsiz 148 def /symbw 296 def /symbh 1086 def /ori 165.33 def /showmark {plotsymb} def /symbary [0 0 148 355 -99 0 0 731 -98 0 0 -731 -99 0 148 -355] def % Arrow /fillcolor {0.0 0.0 0.0} def 3054 3745 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 168 def /symbsiz 168 def /symbw 336 def /symbh 1240 def /ori 163.39 def /showmark {plotsymb} def /symbary [0 0 168 403 -112 0 0 837 -112 0 0 -837 -112 0 168 -403] def % Arrow /fillcolor {0.0 0.0 0.0} def 3192 5529 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 179 def /symbsiz 179 def /symbw 358 def /symbh 1314 def /ori 162.84 def /showmark {plotsymb} def /symbary [0 0 179 429 -120 0 0 885 -118 0 0 -885 -120 0 179 -429] def % Arrow /fillcolor {0.0 0.0 0.0} def 3259 7359 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 174 def /symbsiz 174 def /symbw 348 def /symbh 1278 def /ori 164.29 def /showmark {plotsymb} def /symbary [0 0 174 417 -116 0 0 861 -116 0 0 -861 -116 0 174 -417] def % Arrow /fillcolor {0.0 0.0 0.0} def 3233 9264 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 160 def /symbsiz 160 def /symbw 320 def /symbh 1176 def /ori 167.18 def /showmark {plotsymb} def /symbary [0 0 160 383 -107 0 0 793 -106 0 0 -793 -107 0 160 -383] def % Arrow /fillcolor {0.0 0.0 0.0} def 3151 11213 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 151 def /symbsiz 151 def /symbw 302 def /symbh 1110 def /ori 169.35 def /showmark {plotsymb} def /symbary [0 0 151 362 -101 0 0 748 -100 0 0 -748 -101 0 151 -362] def % Arrow /fillcolor {0.0 0.0 0.0} def 3095 13132 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 133 def /symbsiz 133 def /symbw 266 def /symbh 978 def /ori 169.65 def /showmark {plotsymb} def /symbary [0 0 133 319 -89 0 0 659 -88 0 0 -659 -89 0 133 -319] def % Arrow /fillcolor {0.0 0.0 0.0} def 4828 1981 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 150 def /symbsiz 150 def /symbw 300 def /symbh 1102 def /ori 166.90 def /showmark {plotsymb} def /symbary [0 0 150 359 -100 0 0 743 -100 0 0 -743 -100 0 150 -359] def % Arrow /fillcolor {0.0 0.0 0.0} def 4940 3770 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 177 def /symbsiz 177 def /symbw 354 def /symbh 1306 def /ori 163.57 def /showmark {plotsymb} def /symbary [0 0 177 424 -118 0 0 882 -118 0 0 -882 -118 0 177 -424] def % Arrow /fillcolor {0.0 0.0 0.0} def 5119 5515 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 191 def /symbsiz 191 def /symbw 382 def /symbh 1406 def /ori 162.09 def /showmark {plotsymb} def /symbary [0 0 191 458 -128 0 0 948 -126 0 0 -948 -128 0 191 -458] def % Arrow /fillcolor {0.0 0.0 0.0} def 5204 7315 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 183 def /symbsiz 183 def /symbw 366 def /symbh 1348 def /ori 162.47 def /showmark {plotsymb} def /symbary [0 0 183 439 -122 0 0 909 -122 0 0 -909 -122 0 183 -439] def % Arrow /fillcolor {0.0 0.0 0.0} def 5152 9204 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 162 def /symbsiz 162 def /symbw 324 def /symbh 1194 def /ori 164.03 def /showmark {plotsymb} def /symbary [0 0 162 388 -108 0 0 806 -108 0 0 -806 -108 0 162 -388] def % Arrow /fillcolor {0.0 0.0 0.0} def 5014 11146 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 149 def /symbsiz 149 def /symbw 298 def /symbh 1098 def /ori 165.26 def /showmark {plotsymb} def /symbary [0 0 149 357 -100 0 0 741 -98 0 0 -741 -100 0 149 -357] def % Arrow /fillcolor {0.0 0.0 0.0} def 4928 13058 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 129 def /symbsiz 129 def /symbw 258 def /symbh 950 def /ori 174.15 def /showmark {plotsymb} def /symbary [0 0 129 309 -86 0 0 641 -86 0 0 -641 -86 0 129 -309] def % Arrow /fillcolor {0.0 0.0 0.0} def 6676 2060 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 152 def /symbsiz 152 def /symbw 304 def /symbh 1124 def /ori 169.11 def /showmark {plotsymb} def /symbary [0 0 152 364 -102 0 0 760 -100 0 0 -760 -102 0 152 -364] def % Arrow /fillcolor {0.0 0.0 0.0} def 6833 3808 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 191 def /symbsiz 191 def /symbw 382 def /symbh 1404 def /ori 163.82 def /showmark {plotsymb} def /symbary [0 0 191 458 -128 0 0 946 -126 0 0 -946 -128 0 191 -458] def % Arrow /fillcolor {0.0 0.0 0.0} def 7079 5493 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 210 def /symbsiz 210 def /symbw 420 def /symbh 1546 def /ori 161.31 def /showmark {plotsymb} def /symbary [0 0 210 503 -140 0 0 1043 -140 0 0 -1043 -140 0 210 -503] def % Arrow /fillcolor {0.0 0.0 0.0} def 7194 7252 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 198 def /symbsiz 198 def /symbw 396 def /symbh 1454 def /ori 160.23 def /showmark {plotsymb} def /symbary [0 0 198 475 -132 0 0 979 -132 0 0 -979 -132 0 198 -475] def % Arrow /fillcolor {0.0 0.0 0.0} def 7098 9118 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 167 def /symbsiz 167 def /symbw 334 def /symbh 1228 def /ori 159.02 def /showmark {plotsymb} def /symbary [0 0 167 400 -112 0 0 828 -110 0 0 -828 -112 0 167 -400] def % Arrow /fillcolor {0.0 0.0 0.0} def 6878 11034 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 148 def /symbsiz 148 def /symbw 296 def /symbh 1084 def /ori 158.02 def /showmark {plotsymb} def /symbary [0 0 148 355 -99 0 0 729 -98 0 0 -729 -99 0 148 -355] def % Arrow /fillcolor {0.0 0.0 0.0} def 6737 12931 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 123 def /symbsiz 123 def /symbw 246 def /symbh 898 def /ori 176.44 def /showmark {plotsymb} def /symbary [0 0 123 295 -82 0 0 603 -82 0 0 -603 -82 0 123 -295] def % Arrow /fillcolor {0.0 0.0 0.0} def 8491 2101 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 149 def /symbsiz 149 def /symbw 298 def /symbh 1092 def /ori 170.38 def /showmark {plotsymb} def /symbary [0 0 149 357 -100 0 0 735 -98 0 0 -735 -100 0 149 -357] def % Arrow /fillcolor {0.0 0.0 0.0} def 8670 3837 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 192 def /symbsiz 192 def /symbw 384 def /symbh 1412 def /ori 164.22 def /showmark {plotsymb} def /symbary [0 0 192 460 -128 0 0 952 -128 0 0 -952 -128 0 192 -460] def % Arrow /fillcolor {0.0 0.0 0.0} def 8953 5500 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 214 def /symbsiz 214 def /symbw 428 def /symbh 1578 def /ori 161.27 def /showmark {plotsymb} def /symbary [0 0 214 513 -143 0 0 1065 -142 0 0 -1065 -143 0 214 -513] def % Arrow /fillcolor {0.0 0.0 0.0} def 9088 7240 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 201 def /symbsiz 201 def /symbw 402 def /symbh 1480 def /ori 159.05 def /showmark {plotsymb} def /symbary [0 0 201 482 -134 0 0 998 -134 0 0 -998 -134 0 201 -482] def % Arrow /fillcolor {0.0 0.0 0.0} def 8976 9081 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 168 def /symbsiz 168 def /symbw 336 def /symbh 1232 def /ori 155.51 def /showmark {plotsymb} def /symbary [0 0 168 403 -112 0 0 829 -112 0 0 -829 -112 0 168 -403] def % Arrow /fillcolor {0.0 0.0 0.0} def 8715 10963 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 147 def /symbsiz 147 def /symbw 294 def /symbh 1078 def /ori 152.67 def /showmark {plotsymb} def /symbary [0 0 147 352 -98 0 0 726 -98 0 0 -726 -98 0 147 -352] def % Arrow /fillcolor {0.0 0.0 0.0} def 8552 12842 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 104 def /symbsiz 104 def /symbw 208 def /symbh 766 def /ori 174.97 def /showmark {plotsymb} def /symbary [0 0 104 249 -70 0 0 517 -68 0 0 -517 -70 0 104 -249] def % Arrow /fillcolor {0.0 0.0 0.0} def 10221 2090 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 129 def /symbsiz 129 def /symbw 258 def /symbh 948 def /ori 170.30 def /showmark {plotsymb} def /symbary [0 0 129 309 -86 0 0 639 -86 0 0 -639 -86 0 129 -309] def % Arrow /fillcolor {0.0 0.0 0.0} def 10392 3860 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 170 def /symbsiz 170 def /symbw 340 def /symbh 1246 def /ori 165.64 def /showmark {plotsymb} def /symbary [0 0 170 408 -114 0 0 838 -112 0 0 -838 -114 0 170 -408] def % Arrow /fillcolor {0.0 0.0 0.0} def 10664 5575 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 190 def /symbsiz 190 def /symbw 380 def /symbh 1400 def /ori 162.81 def /showmark {plotsymb} def /symbary [0 0 190 455 -127 0 0 945 -126 0 0 -945 -127 0 190 -455] def % Arrow /fillcolor {0.0 0.0 0.0} def 10795 7333 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 181 def /symbsiz 181 def /symbw 362 def /symbh 1332 def /ori 159.04 def /showmark {plotsymb} def /symbary [0 0 181 434 -121 0 0 898 -120 0 0 -898 -121 0 181 -434] def % Arrow /fillcolor {0.0 0.0 0.0} def 10701 9133 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 157 def /symbsiz 157 def /symbw 314 def /symbh 1158 def /ori 152.35 def /showmark {plotsymb} def /symbary [0 0 157 376 -105 0 0 782 -104 0 0 -782 -105 0 157 -376] def % Arrow /fillcolor {0.0 0.0 0.0} def 10482 10937 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 143 def /symbsiz 143 def /symbw 286 def /symbh 1054 def /ori 147.01 def /showmark {plotsymb} def /symbary [0 0 143 343 -96 0 0 711 -94 0 0 -711 -96 0 143 -343] def % Arrow /fillcolor {0.0 0.0 0.0} def 10340 12763 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 76 def /symbsiz 76 def /symbw 152 def /symbh 558 def /ori 169.25 def /showmark {plotsymb} def /symbary [0 0 76 182 -51 0 0 376 -50 0 0 -376 -51 0 76 -182] def % Arrow /fillcolor {0.0 0.0 0.0} def 11868 2053 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 96 def /symbsiz 96 def /symbw 192 def /symbh 704 def /ori 169.08 def /showmark {plotsymb} def /symbary [0 0 96 230 -64 0 0 474 -64 0 0 -474 -64 0 96 -230] def % Arrow /fillcolor {0.0 0.0 0.0} def 12013 3886 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 129 def /symbsiz 129 def /symbw 258 def /symbh 950 def /ori 168.65 def /showmark {plotsymb} def /symbary [0 0 129 309 -86 0 0 641 -86 0 0 -641 -86 0 129 -309] def % Arrow /fillcolor {0.0 0.0 0.0} def 12252 5697 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 147 def /symbsiz 147 def /symbw 294 def /symbh 1080 def /ori 166.63 def /showmark {plotsymb} def /symbary [0 0 147 352 -98 0 0 728 -98 0 0 -728 -98 0 147 -352] def % Arrow /fillcolor {0.0 0.0 0.0} def 12371 7497 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 145 def /symbsiz 145 def /symbw 290 def /symbh 1070 def /ori 159.88 def /showmark {plotsymb} def /symbary [0 0 145 347 -97 0 0 723 -96 0 0 -723 -97 0 145 -347] def % Arrow /fillcolor {0.0 0.0 0.0} def 12327 9242 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 139 def /symbsiz 139 def /symbw 278 def /symbh 1026 def /ori 147.45 def /showmark {plotsymb} def /symbary [0 0 139 333 -93 0 0 693 -92 0 0 -693 -93 0 139 -333] def % Arrow /fillcolor {0.0 0.0 0.0} def 12185 10922 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 139 def /symbsiz 139 def /symbw 278 def /symbh 1020 def /ori 139.45 def /showmark {plotsymb} def /symbary [0 0 139 333 -93 0 0 687 -92 0 0 -687 -93 0 139 -333] def % Arrow /fillcolor {0.0 0.0 0.0} def 12095 12674 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 59 def /symbsiz 59 def /symbw 118 def /symbh 434 def /ori 162.55 def /showmark {plotsymb} def /symbary [0 0 59 141 -40 0 0 293 -38 0 0 -293 -40 0 59 -141] def % Arrow /fillcolor {0.0 0.0 0.0} def 13598 2027 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 76 def /symbsiz 76 def /symbw 152 def /symbh 560 def /ori 167.76 def /showmark {plotsymb} def /symbary [0 0 76 182 -51 0 0 378 -50 0 0 -378 -51 0 76 -182] def % Arrow /fillcolor {0.0 0.0 0.0} def 13731 3901 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 104 def /symbsiz 104 def /symbw 208 def /symbh 764 def /ori 171.85 def /showmark {plotsymb} def /symbary [0 0 104 249 -70 0 0 515 -68 0 0 -515 -70 0 104 -249] def % Arrow /fillcolor {0.0 0.0 0.0} def 13940 5776 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 120 def /symbsiz 120 def /symbw 240 def /symbh 884 def /ori 170.56 def /showmark {plotsymb} def /symbary [0 0 120 288 -80 0 0 596 -80 0 0 -596 -80 0 120 -288] def % Arrow /fillcolor {0.0 0.0 0.0} def 14055 7602 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 123 def /symbsiz 123 def /symbw 246 def /symbh 904 def /ori 160.55 def /showmark {plotsymb} def /symbary [0 0 123 295 -82 0 0 609 -82 0 0 -609 -82 0 123 -295] def % Arrow /fillcolor {0.0 0.0 0.0} def 14037 9309 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 129 def /symbsiz 129 def /symbw 258 def /symbh 950 def /ori 143.94 def /showmark {plotsymb} def /symbary [0 0 129 309 -86 0 0 641 -86 0 0 -641 -86 0 129 -309] def % Arrow /fillcolor {0.0 0.0 0.0} def 13951 10915 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 137 def /symbsiz 137 def /symbw 274 def /symbh 1008 def /ori 134.58 def /showmark {plotsymb} def /symbary [0 0 137 328 -92 0 0 680 -90 0 0 -680 -92 0 137 -328] def % Arrow /fillcolor {0.0 0.0 0.0} def 13892 12618 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -345 7813 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7725 -391 (X \(cm\)) sprnt /fontsiz 855 def /spacesiz 57 def /fontsiz 855 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -649 14965 (d\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4020 (25) sprnt 754 5883 (30) sprnt 754 7747 (35) sprnt 754 9610 (40) sprnt 754 11473 (45) sprnt 754 13337 (50) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 1389 148 a 11367059 11594399 4736286 9867264 35522150 41442508 startTexFig 1389 148 a %%BeginDocument: xc.ps /Mathdict 100 dict def Mathdict begin /Mlmarg 1.0 72 mul def /Mrmarg 1.0 72 mul def /Mbmarg 1.0 72 mul def /Mtmarg 1.0 72 mul def /Mwidth 8.5 72 mul def /Mheight 11 72 mul def /Mtransform { } bind def /Mnodistort true def /Mfixwid false def /Mfixdash false def /Mrot 0 def /Mpstart { MathPictureStart } bind def /Mpend { MathPictureEnd } bind def /Mscale { 0 1 0 1 5 -1 roll MathScale } bind def /ISOLatin1Encoding dup where { pop pop } { [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def } ifelse /MFontDict 50 dict def /MStrCat { exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval } def /MCreateEncoding { 1 index 255 string cvs (-) MStrCat 1 index MStrCat cvn exch (Encoding) MStrCat cvn dup where { exch get } { pop StandardEncoding } ifelse 3 1 roll dup MFontDict exch known not { 1 index findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put } if exch pop exch pop } def /ISOLatin1 { (ISOLatin1) MCreateEncoding } def /ISO8859 { (ISOLatin1) MCreateEncoding } def /Mcopyfont { dup maxlength dict exch { 1 index /FID eq { pop pop } { 2 index 3 1 roll put } ifelse } forall } def /Plain /Helvetica findfont Mcopyfont definefont pop /Bold /Helvetica-Bold findfont Mcopyfont definefont pop /Italic /Helvetica-Oblique findfont Mcopyfont definefont pop /MathPictureStart { gsave Mtransform Mlmarg Mbmarg translate /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def } bind def /MathPictureEnd { grestore } bind def /MathSubStart { Momatrix Mgmatrix Mtmatrix Mlmarg Mrmarg Mbmarg Mtmarg Mwidth Mheight 11 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 13 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def } bind def /MathSubEnd { /Mheight exch def /Mwidth exch def /Mtmarg exch def /Mbmarg exch def /Mrmarg exch def /Mlmarg exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def } bind def /Mdot { moveto 0 0 rlineto stroke } bind def /Mtetra { moveto lineto lineto lineto fill } bind def /Metetra { moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke } bind def /Mistroke { flattenpath 0 0 0 { 4 2 roll pop pop } { 4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll } { stop } { stop } pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash } bind def /Mfstroke { stroke currentdash pop 0 setdash } bind def /Mrotsboxa { gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def } bind def /Msboxa { newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot [ 7 -2 roll 2 copy [ 3 1 roll 10 -1 roll 9 -1 roll ] 6 1 roll 5 -2 roll ] } bind def /Msboxa1 { sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul } bind def /Mvboxa { Mfixwid { Mvboxa1 } { dup Mwidthcal 0 exch { add } forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll } ifelse } bind def /Mvboxa1 { gsave newpath [ true 3 -1 roll { Mbbox 5 -1 roll { 0 5 1 roll } { 7 -1 roll exch sub (m) stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll } ifelse false } forall { stop } if counttomark 1 add 4 roll ] grestore } bind def /Mbbox { 1 dict begin 0 0 moveto /temp (T) def { gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto} forall pathbbox newpath end } bind def /Mmin { 2 copy gt { exch } if pop } bind def /Mmax { 2 copy lt { exch } if pop } bind def /Mrotshowa { dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def } bind def /Mshowa { 4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid { Mshowax } { Mshoway } ifelse pop pop pop pop Mgmatrix setmatrix } bind def /Mshowax { 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash { Mfixdashp } if show } for } bind def /Mfixdashp { dup length 1 gt 1 index true exch { 45 eq and } forall and { gsave (--) stringwidth pop (-) stringwidth pop sub 2 div 0 rmoveto dup length 1 sub { (-) show } repeat grestore } if } bind def /Mshoway { 3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get [ 6 index aload length 2 add -1 roll { pop Strform stringwidth pop neg exch add 0 rmoveto } exch kshow cleartomark } for pop } bind def /Mwidthcal { [ exch { Mwidthcal1 } forall ] [ exch dup Maxlen -1 add 0 1 3 -1 roll { [ exch 2 index { 1 index Mget exch } forall pop Maxget exch } for pop ] Mreva } bind def /Mreva { [ exch aload length -1 1 {1 roll} for ] } bind def /Mget { 1 index length -1 add 1 index ge { get } { pop pop 0 } ifelse } bind def /Maxlen { [ exch { length } forall Maxget } bind def /Maxget { counttomark -1 add 1 1 3 -1 roll { pop Mmax } for exch pop } bind def /Mwidthcal1 { [ exch { Strform stringwidth pop } forall ] } bind def /Strform { /tem (x) def tem 0 3 -1 roll put tem } bind def /Mshowa1 { 2 copy add 4 1 roll sub mul sub -2 div } bind def /MathScale { Mwidth Mlmarg Mrmarg add sub Mheight Mbmarg Mtmarg add sub 0 0 moveto 1 index 0 lineto 2 copy lineto 0 1 index lineto clip newpath Mlp translate dup /Mathabs exch def scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def } bind def /Mlp { 3 copy Mlpfirst { Mnodistort { Mmin dup } if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and { exit } if 3 -1 roll pop pop } loop exch 3 1 roll 7 -3 roll pop pop pop } bind def /Mlpfirst { 3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div } bind def /Mlprun { 2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll { 3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll } forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll } bind def /Mlprun1 { aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add } bind def /Mlprun2 { 2 copy add 2 div 3 1 roll exch sub } bind def /Mlpminmax { cvx 2 index 6 index 2 index exec { 7 -3 roll 4 -1 roll } if 1 index 5 index 3 -1 roll exec { 4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop [ 8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll ] 4 1 roll pop } { pop pop pop } ifelse } bind def /Mlp1 { 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not { 1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll } if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch } bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner { outflag 1 eq { /outflag 0 def /intop 0 def /inrht 0 def } if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt { /intop exch def } { pop } ifelse dup inrht gt { /inrht exch def } { pop } ifelse pop /inflag 1 def } bind def /Mouter { /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq { dup 0 lt { dup intop mul neg /yadtop exch def } if dup 0 gt { dup intop mul /yadbot exch def } if pop dup 0 lt { dup inrht mul neg /xadrht exch def } if dup 0 gt { dup inrht mul /xadlft exch def } if pop /outflag 1 def } { pop pop} ifelse /inflag 0 def /inrht 0 def /intop 0 def } bind def /Mboxout { outflag 1 eq { 4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def } if } bind def /leadjust { (m) stringwidth pop .5 mul } bind def /Mrotcheck { dup 90 eq { yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def } if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop } bind def /Checkaux { 4 index exch 4 index mul 3 1 roll mul add 4 1 roll } bind def /Mboxrot { Mrot 90 eq { brotaux 4 2 roll } if Mrot 180 eq { 4 2 roll brotaux 4 2 roll brotaux } if Mrot 270 eq { 4 2 roll brotaux } if } bind def /brotaux { neg exch neg } bind def /Mabswid { Mathabs div setlinewidth } bind def /Mabsdash { exch Mathabs [ 3 1 roll exch { exch dup 3 -1 roll exch div exch } forall pop ] exch setdash } bind def /MBeginOrig { Momatrix concat} bind def /MEndOrig { Mgmatrix setmatrix} bind def /colorimage where { pop } { /colorimage { 3 1 roll pop pop 5 -1 roll mul 4 1 roll { currentfile 1 index readhexstring pop } image } bind def } ifelse /sampledsound where { pop} { /sampledsound { exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def { Mtempproc pop} repeat } bind def } ifelse /setcmykcolor where { pop} { /setcmykcolor { 4 1 roll [ 4 1 roll ] { 1 index sub 1 sub neg dup 0 lt { pop 0 } if dup 1 gt { pop 1 } if exch } forall pop setrgbcolor } bind def } ifelse MathPictureStart /Helvetica findfont 25 scalefont setfont % Scaling calculations 0.00320513 0.0160256 0.00320513 0.0160256 [ [(-10)] 0.03526 0 0 2 0 Minner Mrotsboxa [(0)] .32372 0 0 2 0 Minner Mrotsboxa [(10)] .64423 0 0 2 0 Minner Mrotsboxa [(20)] .96474 0 0 2 0 Minner Mrotsboxa [(X \(cm\))] .5 0.07 0 2 0 0 -1 Mouter Mrotsboxa [(20)] -0.0125 0.03526 1 0 0 Minner Mrotsboxa [(30)] -0.0125 .32372 1 0 0 Minner Mrotsboxa [(40)] -0.0125 .64423 1 0 0 Minner Mrotsboxa [(50)] -0.0125 .96474 1 0 0 Minner Mrotsboxa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotsboxa [(g\) )] .12 .93 0 -4 Msboxa [ -0.001 -0.001 0 0 ] [ 1.001 1.001 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 setgray gsave gsave gsave 0.002 setlinewidth 0.03526 0 moveto 0.03526 0.00625 lineto stroke grestore [(-10)] 0.03526 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .32372 0 moveto .32372 0.00625 lineto stroke grestore [(0)] .32372 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .64423 0 moveto .64423 0.00625 lineto stroke grestore [(10)] .64423 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .96474 0 moveto .96474 0.00625 lineto stroke grestore [(20)] .96474 0 0 2 0 Minner Mrotshowa [(X \(cm\))] .5 0.07 0 2 0 0 -1 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 1 0 lineto stroke grestore gsave 0.002 setlinewidth 0 0.03526 moveto 0.00625 0.03526 lineto stroke grestore [(20)] -0.0125 0.03526 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .32372 moveto 0.00625 .32372 lineto stroke grestore [(30)] -0.0125 .32372 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .64423 moveto 0.00625 .64423 lineto stroke grestore [(40)] -0.0125 .64423 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .96474 moveto 0.00625 .96474 lineto stroke grestore [(50)] -0.0125 .96474 1 0 0 Minner Mrotshowa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 0 1 lineto stroke grestore grestore gsave gsave 0.002 setlinewidth 0.03526 .99375 moveto 0.03526 1 lineto stroke grestore gsave 0.002 setlinewidth .32372 .99375 moveto .32372 1 lineto stroke grestore gsave 0.002 setlinewidth .64423 .99375 moveto .64423 1 lineto stroke grestore gsave 0.002 setlinewidth .96474 .99375 moveto .96474 1 lineto stroke grestore [(g\) )] 0.12 0.93 0 -4 Mshowa gsave 0.002 setlinewidth 0 1 moveto 1 1 lineto stroke grestore gsave 0.002 setlinewidth .99375 0.03526 moveto 1 0.03526 lineto stroke grestore gsave 0.002 setlinewidth .99375 .32372 moveto 1 .32372 lineto stroke grestore gsave 0.002 setlinewidth .99375 .64423 moveto 1 .64423 lineto stroke grestore gsave 0.002 setlinewidth .99375 .96474 moveto 1 .96474 lineto stroke grestore gsave 0.002 setlinewidth 1 0 moveto 1 1 lineto stroke grestore grestore gsave grestore grestore 0 0 moveto 1 0 lineto 1 1 lineto 0 1 lineto closepath clip newpath gsave gsave .459 setgray 0.01923 0.01923 moveto 0.08791 0.01923 lineto 0.08791 0.08791 lineto fill grestore gsave .459 setgray 0.01923 0.01923 moveto 0.08791 0.08791 lineto 0.01923 0.08791 lineto fill grestore gsave .459 setgray .15659 0.01923 moveto 0.08791 0.01923 lineto .15659 0.08791 lineto fill grestore gsave .459 setgray 0.08791 0.01923 moveto .15659 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave .459 setgray .22527 0.01923 moveto .15659 0.01923 lineto .22527 0.08791 lineto fill grestore gsave .459 setgray .15659 0.01923 moveto .15659 0.08791 lineto .22527 0.08791 lineto fill grestore gsave .459 setgray .29396 0.01923 moveto .22527 0.01923 lineto .29396 0.08791 lineto fill grestore gsave .459 setgray .22527 0.01923 moveto .29396 0.08791 lineto .22527 0.08791 lineto fill grestore gsave .459 setgray .36264 0.01923 moveto .29396 0.01923 lineto .36264 0.08791 lineto fill grestore gsave .459 setgray .29396 0.01923 moveto .36264 0.08791 lineto .29396 0.08791 lineto fill grestore gsave .459 setgray .43132 0.01923 moveto .36264 0.01923 lineto .43132 0.08791 lineto fill grestore gsave .459 setgray .36264 0.01923 moveto .43132 0.08791 lineto .36264 0.08791 lineto fill grestore gsave .377 setgray .5 0.01923 moveto .5 0.02265 lineto .49202 0.01923 lineto fill grestore gsave .459 setgray .5 0.02265 moveto .49202 0.01923 lineto .43132 0.01923 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .5 0.02265 moveto .49202 0.01923 lineto stroke grestore gsave .459 setgray .43132 0.01923 moveto .5 0.08791 lineto .43132 0.08791 lineto fill grestore gsave .377 setgray .56868 0.08152 moveto .52393 0.04316 lineto .5 0.01923 lineto .56868 0.01923 lineto fill grestore gsave .459 setgray .56868 0.08152 moveto .52393 0.04316 lineto .56868 0.08791 lineto fill grestore gsave 0.001 setlinewidth .56868 0.08152 moveto .52393 0.04316 lineto stroke grestore gsave .377 setgray .5 0.01923 moveto .5 0.02265 lineto .52393 0.04316 lineto fill grestore gsave .459 setgray .5 0.02265 moveto .52393 0.04316 lineto .56868 0.08791 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .5 0.02265 moveto .52393 0.04316 lineto stroke grestore gsave .295 setgray .63736 0.01923 moveto .6326 0.01923 lineto .63736 0.0251 lineto fill grestore gsave .377 setgray .6326 0.01923 moveto .63736 0.0251 lineto .63736 0.08791 lineto .56868 0.01923 lineto fill grestore gsave 0.001 setlinewidth .6326 0.01923 moveto .63736 0.0251 lineto stroke grestore gsave .377 setgray .57395 0.08791 moveto .56868 0.08152 lineto .56868 0.01923 lineto .63736 0.08791 lineto fill grestore gsave .459 setgray .57395 0.08791 moveto .56868 0.08152 lineto .56868 0.08791 lineto fill grestore gsave 0.001 setlinewidth .57395 0.08791 moveto .56868 0.08152 lineto stroke grestore gsave .295 setgray .70604 0.01923 moveto .70604 0.08791 lineto .63736 0.01923 lineto fill grestore gsave .295 setgray .67625 0.08791 moveto .63736 0.0251 lineto .63736 0.01923 lineto .70604 0.08791 lineto fill grestore gsave .377 setgray .67625 0.08791 moveto .63736 0.0251 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .67625 0.08791 moveto .63736 0.0251 lineto stroke grestore gsave .214 setgray .71858 0.01923 moveto .72694 0.04012 lineto .77473 0.08791 lineto .77473 0.01923 lineto fill grestore gsave .295 setgray .71858 0.01923 moveto .72694 0.04012 lineto .70604 0.01923 lineto fill grestore gsave 0.001 setlinewidth .71858 0.01923 moveto .72694 0.04012 lineto stroke grestore gsave .214 setgray .77473 0.08791 moveto .74698 0.08791 lineto .72694 0.04012 lineto fill grestore gsave .295 setgray .74698 0.08791 moveto .72694 0.04012 lineto .70604 0.01923 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .74698 0.08791 moveto .72694 0.04012 lineto stroke grestore gsave .132 setgray .78429 0.01923 moveto .79385 0.03835 lineto .84341 0.08791 lineto .84341 0.01923 lineto fill grestore gsave .214 setgray .78429 0.01923 moveto .79385 0.03835 lineto .77473 0.01923 lineto fill grestore gsave 0.001 setlinewidth .78429 0.01923 moveto .79385 0.03835 lineto stroke grestore gsave .132 setgray .84341 0.08791 moveto .8197 0.08791 lineto .79385 0.03835 lineto fill grestore gsave .214 setgray .8197 0.08791 moveto .79385 0.03835 lineto .77473 0.01923 lineto .77473 0.08791 lineto fill grestore gsave 0.001 setlinewidth .8197 0.08791 moveto .79385 0.03835 lineto stroke grestore gsave 0.05 setgray .91209 0.01923 moveto .87835 0.01923 lineto .91209 0.07659 lineto fill grestore gsave .132 setgray .87835 0.01923 moveto .91209 0.07659 lineto .91209 0.08791 lineto .84341 0.01923 lineto fill grestore gsave 0.001 setlinewidth .87835 0.01923 moveto .91209 0.07659 lineto stroke grestore gsave .132 setgray .91209 0.08791 moveto .84341 0.01923 lineto .84341 0.08791 lineto fill grestore gsave 0.05 setgray .98077 0.01923 moveto .98077 0.08791 lineto .91209 0.01923 lineto fill grestore gsave 0.05 setgray .92238 0.08791 moveto .91209 0.07659 lineto .91209 0.01923 lineto .98077 0.08791 lineto fill grestore gsave .132 setgray .92238 0.08791 moveto .91209 0.07659 lineto .91209 0.08791 lineto fill grestore gsave 0.001 setlinewidth .92238 0.08791 moveto .91209 0.07659 lineto stroke grestore gsave .459 setgray 0.05222 .1209 moveto 0.08791 .1209 lineto 0.08791 0.08791 lineto 0.01923 0.08791 lineto fill grestore gsave .541 setgray 0.05222 .1209 moveto 0.08791 .1209 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.05222 .1209 moveto 0.08791 .1209 lineto stroke grestore gsave .459 setgray 0.01923 0.08791 moveto 0.05222 .1209 lineto 0.01923 .1242 lineto fill grestore gsave .541 setgray 0.05222 .1209 moveto 0.01923 .1242 lineto 0.01923 .15659 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.05222 .1209 moveto 0.01923 .1242 lineto stroke grestore gsave .459 setgray .11582 .11582 moveto .15659 .11582 lineto .15659 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave .541 setgray .11582 .11582 moveto .15659 .11582 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth .11582 .11582 moveto .15659 .11582 lineto stroke grestore gsave .459 setgray 0.08791 0.08791 moveto .11582 .11582 lineto 0.08791 .1209 lineto fill grestore gsave .541 setgray .11582 .11582 moveto 0.08791 .1209 lineto 0.08791 .15659 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth .11582 .11582 moveto 0.08791 .1209 lineto stroke grestore gsave .459 setgray .18078 .1121 moveto .22527 .10892 lineto .22527 0.08791 lineto .15659 0.08791 lineto fill grestore gsave .541 setgray .18078 .1121 moveto .22527 .10892 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .18078 .1121 moveto .22527 .10892 lineto stroke grestore gsave .459 setgray .15659 0.08791 moveto .18078 .1121 lineto .15659 .11582 lineto fill grestore gsave .541 setgray .18078 .1121 moveto .15659 .11582 lineto .15659 .15659 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .18078 .1121 moveto .15659 .11582 lineto stroke grestore gsave .459 setgray .29396 .10926 moveto .24366 .1063 lineto .22527 0.08791 lineto .29396 0.08791 lineto fill grestore gsave .541 setgray .29396 .10926 moveto .24366 .1063 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .29396 .10926 moveto .24366 .1063 lineto stroke grestore gsave .459 setgray .22527 0.08791 moveto .24366 .1063 lineto .22527 .10892 lineto fill grestore gsave .541 setgray .24366 .1063 moveto .22527 .10892 lineto .22527 .15659 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .24366 .1063 moveto .22527 .10892 lineto stroke grestore gsave .459 setgray .36264 .11062 moveto .31411 .10807 lineto .29396 0.08791 lineto .36264 0.08791 lineto fill grestore gsave .541 setgray .36264 .11062 moveto .31411 .10807 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .36264 .11062 moveto .31411 .10807 lineto stroke grestore gsave .459 setgray .29396 0.08791 moveto .31411 .10807 lineto .29396 .10926 lineto fill grestore gsave .541 setgray .31411 .10807 moveto .29396 .10926 lineto .29396 .15659 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .31411 .10807 moveto .29396 .10926 lineto stroke grestore gsave .459 setgray .43132 .11636 moveto .38661 .11189 lineto .36264 0.08791 lineto .43132 0.08791 lineto fill grestore gsave .541 setgray .43132 .11636 moveto .38661 .11189 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .43132 .11636 moveto .38661 .11189 lineto stroke grestore gsave .459 setgray .36264 0.08791 moveto .36264 .11062 lineto .38661 .11189 lineto fill grestore gsave .541 setgray .36264 .11062 moveto .38661 .11189 lineto .43132 .15659 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .36264 .11062 moveto .38661 .11189 lineto stroke grestore gsave .459 setgray .5 .13463 moveto .46925 .12584 lineto .43132 0.08791 lineto .5 0.08791 lineto fill grestore gsave .541 setgray .5 .13463 moveto .46925 .12584 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .5 .13463 moveto .46925 .12584 lineto stroke grestore gsave .459 setgray .43132 0.08791 moveto .43132 .11636 lineto .46925 .12584 lineto fill grestore gsave .541 setgray .43132 .11636 moveto .46925 .12584 lineto .5 .15659 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .43132 .11636 moveto .46925 .12584 lineto stroke grestore gsave .459 setgray .56868 0.08791 moveto .5 0.08791 lineto .56868 .15659 lineto fill grestore gsave .459 setgray .5 .13463 moveto .53844 .15659 lineto .56868 .15659 lineto .5 0.08791 lineto fill grestore gsave .541 setgray .5 .13463 moveto .53844 .15659 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .5 .13463 moveto .53844 .15659 lineto stroke grestore gsave .377 setgray .63736 0.08791 moveto .63736 .13925 lineto .57395 0.08791 lineto fill grestore gsave .459 setgray .63736 .13925 moveto .57395 0.08791 lineto .56868 0.08791 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .63736 .13925 moveto .57395 0.08791 lineto stroke grestore gsave .459 setgray .56868 0.08791 moveto .63736 .15659 lineto .56868 .15659 lineto fill grestore gsave .295 setgray .70604 0.08791 moveto .67625 0.08791 lineto .70604 .12084 lineto fill grestore gsave .377 setgray .67625 0.08791 moveto .70604 .12084 lineto .70604 .15659 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .67625 0.08791 moveto .70604 .12084 lineto stroke grestore gsave .377 setgray .6532 .15659 moveto .63736 .13925 lineto .63736 0.08791 lineto .70604 .15659 lineto fill grestore gsave .459 setgray .6532 .15659 moveto .63736 .13925 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .6532 .15659 moveto .63736 .13925 lineto stroke grestore gsave .214 setgray .77473 0.08791 moveto .74698 0.08791 lineto .77473 .1357 lineto fill grestore gsave .295 setgray .74698 0.08791 moveto .77473 .1357 lineto .77473 .15659 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .74698 0.08791 moveto .77473 .1357 lineto stroke grestore gsave .295 setgray .72727 .15659 moveto .70604 .12084 lineto .70604 0.08791 lineto .77473 .15659 lineto fill grestore gsave .377 setgray .72727 .15659 moveto .70604 .12084 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .72727 .15659 moveto .70604 .12084 lineto stroke grestore gsave .132 setgray .84341 0.08791 moveto .8197 0.08791 lineto .84341 .11998 lineto fill grestore gsave .214 setgray .8197 0.08791 moveto .84341 .11998 lineto .84341 .15659 lineto .77473 0.08791 lineto fill grestore gsave 0.001 setlinewidth .8197 0.08791 moveto .84341 .11998 lineto stroke grestore gsave .214 setgray .7904 .15659 moveto .77473 .1357 lineto .77473 0.08791 lineto .84341 .15659 lineto fill grestore gsave .295 setgray .7904 .15659 moveto .77473 .1357 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .7904 .15659 moveto .77473 .1357 lineto stroke grestore gsave .132 setgray .91209 0.08791 moveto .91209 .15659 lineto .84341 0.08791 lineto fill grestore gsave .132 setgray .87798 .15659 moveto .84341 .11998 lineto .84341 0.08791 lineto .91209 .15659 lineto fill grestore gsave .214 setgray .87798 .15659 moveto .84341 .11998 lineto .84341 .15659 lineto fill grestore gsave 0.001 setlinewidth .87798 .15659 moveto .84341 .11998 lineto stroke grestore gsave 0.05 setgray .98077 0.08791 moveto .98077 .13073 lineto .92238 0.08791 lineto fill grestore gsave .132 setgray .98077 .13073 moveto .92238 0.08791 lineto .91209 0.08791 lineto .98077 .15659 lineto fill grestore gsave 0.001 setlinewidth .98077 .13073 moveto .92238 0.08791 lineto stroke grestore gsave .132 setgray .91209 0.08791 moveto .98077 .15659 lineto .91209 .15659 lineto fill grestore gsave .541 setgray 0.01923 .15659 moveto 0.08791 .15659 lineto 0.08791 .22527 lineto fill grestore gsave .541 setgray 0.01923 .15659 moveto 0.01923 .22527 lineto 0.08791 .22527 lineto fill grestore gsave .541 setgray 0.08791 .15659 moveto .15659 .15659 lineto .15659 .22527 lineto fill grestore gsave .541 setgray 0.08791 .15659 moveto 0.08791 .22527 lineto .15659 .22527 lineto fill grestore gsave .541 setgray .22158 .22158 moveto .22527 .22119 lineto .22527 .15659 lineto .15659 .15659 lineto fill grestore gsave .623 setgray .22158 .22158 moveto .22527 .22119 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .22158 .22158 moveto .22527 .22119 lineto stroke grestore gsave .541 setgray .22158 .22158 moveto .20975 .22527 lineto .15659 .22527 lineto .15659 .15659 lineto fill grestore gsave .623 setgray .22158 .22158 moveto .20975 .22527 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .22158 .22158 moveto .20975 .22527 lineto stroke grestore gsave .541 setgray .27437 .20569 moveto .29396 .20398 lineto .29396 .15659 lineto .22527 .15659 lineto fill grestore gsave .623 setgray .27437 .20569 moveto .29396 .20398 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .27437 .20569 moveto .29396 .20398 lineto stroke grestore gsave .541 setgray .22527 .15659 moveto .27437 .20569 lineto .22527 .22119 lineto fill grestore gsave .623 setgray .27437 .20569 moveto .22527 .22119 lineto .22527 .22527 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .27437 .20569 moveto .22527 .22119 lineto stroke grestore gsave .541 setgray .33588 .19851 moveto .36264 .19744 lineto .36264 .15659 lineto .29396 .15659 lineto fill grestore gsave .623 setgray .33588 .19851 moveto .36264 .19744 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .33588 .19851 moveto .36264 .19744 lineto stroke grestore gsave .541 setgray .29396 .15659 moveto .33588 .19851 lineto .29396 .20398 lineto fill grestore gsave .623 setgray .33588 .19851 moveto .29396 .20398 lineto .29396 .22527 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .33588 .19851 moveto .29396 .20398 lineto stroke grestore gsave .541 setgray .43132 .19696 moveto .40192 .19587 lineto .36264 .15659 lineto .43132 .15659 lineto fill grestore gsave .623 setgray .43132 .19696 moveto .40192 .19587 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .43132 .19696 moveto .40192 .19587 lineto stroke grestore gsave .541 setgray .36264 .15659 moveto .40192 .19587 lineto .36264 .19744 lineto fill grestore gsave .623 setgray .40192 .19587 moveto .36264 .19744 lineto .36264 .22527 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .40192 .19587 moveto .36264 .19744 lineto stroke grestore gsave .541 setgray .5 .20778 moveto .47871 .20398 lineto .43132 .15659 lineto .5 .15659 lineto fill grestore gsave .623 setgray .5 .20778 moveto .47871 .20398 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .5 .20778 moveto .47871 .20398 lineto stroke grestore gsave .541 setgray .43132 .15659 moveto .43132 .19696 lineto .47871 .20398 lineto fill grestore gsave .623 setgray .43132 .19696 moveto .47871 .20398 lineto .5 .22527 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .43132 .19696 moveto .47871 .20398 lineto stroke grestore gsave .459 setgray .56868 .15659 moveto .56868 .16955 lineto .53844 .15659 lineto fill grestore gsave .541 setgray .56868 .16955 moveto .53844 .15659 lineto .5 .15659 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .56868 .16955 moveto .53844 .15659 lineto stroke grestore gsave .541 setgray .5 .20778 moveto .54081 .22527 lineto .56868 .22527 lineto .5 .15659 lineto fill grestore gsave .623 setgray .5 .20778 moveto .54081 .22527 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .5 .20778 moveto .54081 .22527 lineto stroke grestore gsave .459 setgray .63736 .21328 moveto .60497 .19288 lineto .56868 .15659 lineto .63736 .15659 lineto fill grestore gsave .541 setgray .63736 .21328 moveto .60497 .19288 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .63736 .21328 moveto .60497 .19288 lineto stroke grestore gsave .459 setgray .56868 .15659 moveto .56868 .16955 lineto .60497 .19288 lineto fill grestore gsave .541 setgray .56868 .16955 moveto .60497 .19288 lineto .63736 .22527 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .56868 .16955 moveto .60497 .19288 lineto stroke grestore gsave .377 setgray .70604 .15659 moveto .70604 .20161 lineto .6532 .15659 lineto fill grestore gsave .459 setgray .70604 .20161 moveto .6532 .15659 lineto .63736 .15659 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .70604 .20161 moveto .6532 .15659 lineto stroke grestore gsave .459 setgray .63736 .21328 moveto .65145 .22527 lineto .70604 .22527 lineto .63736 .15659 lineto fill grestore gsave .541 setgray .63736 .21328 moveto .65145 .22527 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .63736 .21328 moveto .65145 .22527 lineto stroke grestore gsave .295 setgray .77473 .15659 moveto .72727 .15659 lineto .77473 .21987 lineto fill grestore gsave .377 setgray .72727 .15659 moveto .77473 .21987 lineto .77473 .22527 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .72727 .15659 moveto .77473 .21987 lineto stroke grestore gsave .377 setgray .7243 .22527 moveto .70604 .20161 lineto .70604 .15659 lineto .77473 .22527 lineto fill grestore gsave .459 setgray .7243 .22527 moveto .70604 .20161 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .7243 .22527 moveto .70604 .20161 lineto stroke grestore gsave .214 setgray .84341 .15659 moveto .7904 .15659 lineto .84341 .21191 lineto fill grestore gsave .295 setgray .7904 .15659 moveto .84341 .21191 lineto .84341 .22527 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .7904 .15659 moveto .84341 .21191 lineto stroke grestore gsave .295 setgray .77992 .22527 moveto .77473 .21987 lineto .77473 .15659 lineto .84341 .22527 lineto fill grestore gsave .377 setgray .77992 .22527 moveto .77473 .21987 lineto .77473 .22527 lineto fill grestore gsave 0.001 setlinewidth .77992 .22527 moveto .77473 .21987 lineto stroke grestore gsave .132 setgray .91209 .15659 moveto .91209 .18582 lineto .87798 .15659 lineto fill grestore gsave .214 setgray .91209 .18582 moveto .87798 .15659 lineto .84341 .15659 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .18582 moveto .87798 .15659 lineto stroke grestore gsave .214 setgray .84341 .21191 moveto .85878 .22527 lineto .91209 .22527 lineto .84341 .15659 lineto fill grestore gsave .295 setgray .84341 .21191 moveto .85878 .22527 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .84341 .21191 moveto .85878 .22527 lineto stroke grestore gsave .132 setgray .98077 .15659 moveto .91209 .15659 lineto .98077 .22527 lineto fill grestore gsave .132 setgray .91209 .18582 moveto .97582 .22527 lineto .98077 .22527 lineto .91209 .15659 lineto fill grestore gsave .214 setgray .91209 .18582 moveto .97582 .22527 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .18582 moveto .97582 .22527 lineto stroke grestore gsave .541 setgray 0.0487 .25475 moveto 0.08791 .24887 lineto 0.08791 .22527 lineto 0.01923 .22527 lineto fill grestore gsave .623 setgray 0.0487 .25475 moveto 0.08791 .24887 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.0487 .25475 moveto 0.08791 .24887 lineto stroke grestore gsave .541 setgray 0.01923 .22527 moveto 0.0487 .25475 lineto 0.01923 .26095 lineto fill grestore gsave .623 setgray 0.0487 .25475 moveto 0.01923 .26095 lineto 0.01923 .29396 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.0487 .25475 moveto 0.01923 .26095 lineto stroke grestore gsave .541 setgray .10606 .24342 moveto .15659 .23683 lineto .15659 .22527 lineto 0.08791 .22527 lineto fill grestore gsave .623 setgray .10606 .24342 moveto .15659 .23683 lineto .15659 .29396 lineto fill grestore gsave 0.001 setlinewidth .10606 .24342 moveto .15659 .23683 lineto stroke grestore gsave .541 setgray 0.08791 .22527 moveto .10606 .24342 lineto 0.08791 .24887 lineto fill grestore gsave .623 setgray .10606 .24342 moveto 0.08791 .24887 lineto 0.08791 .29396 lineto .15659 .29396 lineto fill grestore gsave 0.001 setlinewidth .10606 .24342 moveto 0.08791 .24887 lineto stroke grestore gsave .541 setgray .15659 .22527 moveto .16517 .23385 lineto .20975 .22527 lineto fill grestore gsave .623 setgray .16517 .23385 moveto .20975 .22527 lineto .22527 .22527 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .16517 .23385 moveto .20975 .22527 lineto stroke grestore gsave .541 setgray .15659 .22527 moveto .16517 .23385 lineto .15659 .23683 lineto fill grestore gsave .623 setgray .16517 .23385 moveto .15659 .23683 lineto .15659 .29396 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .16517 .23385 moveto .15659 .23683 lineto stroke grestore gsave .623 setgray .27438 .27438 moveto .29396 .2706 lineto .29396 .22527 lineto .22527 .22527 lineto fill grestore gsave .705 setgray .27438 .27438 moveto .29396 .2706 lineto .29396 .29396 lineto fill grestore gsave 0.001 setlinewidth .27438 .27438 moveto .29396 .2706 lineto stroke grestore gsave .623 setgray .27438 .27438 moveto .22812 .29396 lineto .22527 .29396 lineto .22527 .22527 lineto fill grestore gsave .705 setgray .27438 .27438 moveto .22812 .29396 lineto .29396 .29396 lineto fill grestore gsave 0.001 setlinewidth .27438 .27438 moveto .22812 .29396 lineto stroke grestore gsave .623 setgray .33093 .26225 moveto .36264 .25953 lineto .36264 .22527 lineto .29396 .22527 lineto fill grestore gsave .705 setgray .33093 .26225 moveto .36264 .25953 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .33093 .26225 moveto .36264 .25953 lineto stroke grestore gsave .623 setgray .29396 .22527 moveto .33093 .26225 lineto .29396 .2706 lineto fill grestore gsave .705 setgray .33093 .26225 moveto .29396 .2706 lineto .29396 .29396 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .33093 .26225 moveto .29396 .2706 lineto stroke grestore gsave .623 setgray .39419 .25682 moveto .43132 .25582 lineto .43132 .22527 lineto .36264 .22527 lineto fill grestore gsave .705 setgray .39419 .25682 moveto .43132 .25582 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .39419 .25682 moveto .43132 .25582 lineto stroke grestore gsave .623 setgray .36264 .22527 moveto .39419 .25682 lineto .36264 .25953 lineto fill grestore gsave .705 setgray .39419 .25682 moveto .36264 .25953 lineto .36264 .29396 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .39419 .25682 moveto .36264 .25953 lineto stroke grestore gsave .623 setgray .5 .2613 moveto .46361 .25757 lineto .43132 .22527 lineto .5 .22527 lineto fill grestore gsave .705 setgray .5 .2613 moveto .46361 .25757 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .5 .2613 moveto .46361 .25757 lineto stroke grestore gsave .623 setgray .43132 .22527 moveto .43132 .25582 lineto .46361 .25757 lineto fill grestore gsave .705 setgray .43132 .25582 moveto .46361 .25757 lineto .5 .29396 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .43132 .25582 moveto .46361 .25757 lineto stroke grestore gsave .541 setgray .56868 .22527 moveto .56868 .23385 lineto .54081 .22527 lineto fill grestore gsave .623 setgray .56868 .23385 moveto .54081 .22527 lineto .5 .22527 lineto .55203 .27731 lineto .56868 .28243 lineto fill grestore gsave 0.001 setlinewidth .56868 .23385 moveto .54081 .22527 lineto stroke grestore gsave .705 setgray .56868 .28243 moveto .55203 .27731 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56868 .28243 moveto .55203 .27731 lineto stroke grestore gsave .623 setgray .5 .22527 moveto .5 .2613 lineto .55203 .27731 lineto fill grestore gsave .705 setgray .5 .2613 moveto .55203 .27731 lineto .56868 .29396 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .5 .2613 moveto .55203 .27731 lineto stroke grestore gsave .541 setgray .63736 .26555 moveto .58461 .2412 lineto .56868 .22527 lineto .63736 .22527 lineto fill grestore gsave .623 setgray .63736 .26555 moveto .58461 .2412 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .63736 .26555 moveto .58461 .2412 lineto stroke grestore gsave .541 setgray .56868 .22527 moveto .56868 .23385 lineto .58461 .2412 lineto fill grestore gsave .623 setgray .56868 .23385 moveto .58461 .2412 lineto .63736 .29396 lineto .59365 .29396 lineto .56868 .28243 lineto fill grestore gsave 0.001 setlinewidth .56868 .23385 moveto .58461 .2412 lineto stroke grestore gsave .705 setgray .56868 .28243 moveto .59365 .29396 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56868 .28243 moveto .59365 .29396 lineto stroke grestore gsave .459 setgray .70604 .22527 moveto .70604 .25921 lineto .65145 .22527 lineto fill grestore gsave .541 setgray .70604 .25921 moveto .65145 .22527 lineto .63736 .22527 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70604 .25921 moveto .65145 .22527 lineto stroke grestore gsave .541 setgray .63736 .26555 moveto .68168 .29396 lineto .70604 .29396 lineto .63736 .22527 lineto fill grestore gsave .623 setgray .63736 .26555 moveto .68168 .29396 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .63736 .26555 moveto .68168 .29396 lineto stroke grestore gsave .377 setgray .77473 .22527 moveto .7243 .22527 lineto .77473 .27718 lineto fill grestore gsave .459 setgray .7243 .22527 moveto .77473 .27718 lineto .77473 .29396 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .7243 .22527 moveto .77473 .27718 lineto stroke grestore gsave .459 setgray .73987 .29396 moveto .70604 .25921 lineto .70604 .22527 lineto .77473 .29396 lineto fill grestore gsave .541 setgray .73987 .29396 moveto .70604 .25921 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .73987 .29396 moveto .70604 .25921 lineto stroke grestore gsave .295 setgray .84341 .22527 moveto .84341 .27488 lineto .77992 .22527 lineto fill grestore gsave .377 setgray .84341 .27488 moveto .77992 .22527 lineto .77473 .22527 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .27488 moveto .77992 .22527 lineto stroke grestore gsave .377 setgray .77473 .27718 moveto .79585 .29396 lineto .84341 .29396 lineto .77473 .22527 lineto fill grestore gsave .459 setgray .77473 .27718 moveto .79585 .29396 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .77473 .27718 moveto .79585 .29396 lineto stroke grestore gsave .214 setgray .91209 .22527 moveto .91209 .25967 lineto .85878 .22527 lineto fill grestore gsave .295 setgray .91209 .25967 moveto .85878 .22527 lineto .84341 .22527 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .25967 moveto .85878 .22527 lineto stroke grestore gsave .295 setgray .84341 .27488 moveto .87248 .29396 lineto .91209 .29396 lineto .84341 .22527 lineto fill grestore gsave .377 setgray .84341 .27488 moveto .87248 .29396 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .27488 moveto .87248 .29396 lineto stroke grestore gsave .132 setgray .98077 .22527 moveto .98077 .22742 lineto .97582 .22527 lineto fill grestore gsave .214 setgray .98077 .22742 moveto .97582 .22527 lineto .91209 .22527 lineto .97481 .28799 lineto .98077 .29058 lineto fill grestore gsave 0.001 setlinewidth .98077 .22742 moveto .97582 .22527 lineto stroke grestore gsave .295 setgray .98077 .29058 moveto .97481 .28799 lineto .98077 .29396 lineto fill grestore gsave 0.001 setlinewidth .98077 .29058 moveto .97481 .28799 lineto stroke grestore gsave .214 setgray .91209 .22527 moveto .91209 .25967 lineto .97481 .28799 lineto fill grestore gsave .295 setgray .91209 .25967 moveto .97481 .28799 lineto .98077 .29396 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .25967 moveto .97481 .28799 lineto stroke grestore gsave .623 setgray 0.08595 .36067 moveto 0.08791 .36015 lineto 0.08791 .29396 lineto 0.01923 .29396 lineto fill grestore gsave .705 setgray 0.08595 .36067 moveto 0.08791 .36015 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.08595 .36067 moveto 0.08791 .36015 lineto stroke grestore gsave .623 setgray 0.08595 .36067 moveto 0.08044 .36264 lineto 0.01923 .36264 lineto 0.01923 .29396 lineto fill grestore gsave .705 setgray 0.08595 .36067 moveto 0.08044 .36264 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.08595 .36067 moveto 0.08044 .36264 lineto stroke grestore gsave .623 setgray .13108 .33712 moveto .15659 .32812 lineto .15659 .29396 lineto 0.08791 .29396 lineto fill grestore gsave .705 setgray .13108 .33712 moveto .15659 .32812 lineto .15659 .36264 lineto fill grestore gsave 0.001 setlinewidth .13108 .33712 moveto .15659 .32812 lineto stroke grestore gsave .623 setgray 0.08791 .29396 moveto .13108 .33712 lineto 0.08791 .36015 lineto fill grestore gsave .705 setgray .13108 .33712 moveto 0.08791 .36015 lineto 0.08791 .36264 lineto .15659 .36264 lineto fill grestore gsave 0.001 setlinewidth .13108 .33712 moveto 0.08791 .36015 lineto stroke grestore gsave .623 setgray .1781 .31547 moveto .22527 .2956 lineto .22527 .29396 lineto .15659 .29396 lineto fill grestore gsave .705 setgray .1781 .31547 moveto .22527 .2956 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .1781 .31547 moveto .22527 .2956 lineto stroke grestore gsave .623 setgray .15659 .29396 moveto .1781 .31547 lineto .15659 .32812 lineto fill grestore gsave .705 setgray .1781 .31547 moveto .15659 .32812 lineto .15659 .36264 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .1781 .31547 moveto .15659 .32812 lineto stroke grestore gsave .623 setgray .22527 .29396 moveto .2262 .29488 lineto .22812 .29396 lineto fill grestore gsave .705 setgray .2262 .29488 moveto .22812 .29396 lineto .29396 .29396 lineto .29396 .34485 lineto .28192 .3506 lineto fill grestore gsave 0.001 setlinewidth .2262 .29488 moveto .22812 .29396 lineto stroke grestore gsave .786 setgray .28192 .3506 moveto .29396 .34485 lineto .29396 .36264 lineto fill grestore gsave 0.001 setlinewidth .28192 .3506 moveto .29396 .34485 lineto stroke grestore gsave .623 setgray .22527 .29396 moveto .2262 .29488 lineto .22527 .2956 lineto fill grestore gsave .705 setgray .2262 .29488 moveto .22527 .2956 lineto .22527 .36264 lineto .26668 .36264 lineto .28192 .3506 lineto fill grestore gsave 0.001 setlinewidth .2262 .29488 moveto .22527 .2956 lineto stroke grestore gsave .786 setgray .28192 .3506 moveto .26668 .36264 lineto .29396 .36264 lineto fill grestore gsave 0.001 setlinewidth .28192 .3506 moveto .26668 .36264 lineto stroke grestore gsave .705 setgray .33053 .33053 moveto .36264 .32154 lineto .36264 .29396 lineto .29396 .29396 lineto fill grestore gsave .786 setgray .33053 .33053 moveto .36264 .32154 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .33053 .33053 moveto .36264 .32154 lineto stroke grestore gsave .705 setgray .29396 .29396 moveto .33053 .33053 lineto .29396 .34485 lineto fill grestore gsave .786 setgray .33053 .33053 moveto .29396 .34485 lineto .29396 .36264 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .33053 .33053 moveto .29396 .34485 lineto stroke grestore gsave .705 setgray .38563 .31695 moveto .43132 .31187 lineto .43132 .29396 lineto .36264 .29396 lineto fill grestore gsave .786 setgray .38563 .31695 moveto .43132 .31187 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .38563 .31695 moveto .43132 .31187 lineto stroke grestore gsave .705 setgray .36264 .29396 moveto .38563 .31695 lineto .36264 .32154 lineto fill grestore gsave .786 setgray .38563 .31695 moveto .36264 .32154 lineto .36264 .36264 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .38563 .31695 moveto .36264 .32154 lineto stroke grestore gsave .705 setgray .5 .31614 moveto .44992 .31256 lineto .43132 .29396 lineto .5 .29396 lineto fill grestore gsave .786 setgray .5 .31614 moveto .44992 .31256 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .5 .31614 moveto .44992 .31256 lineto stroke grestore gsave .705 setgray .43132 .29396 moveto .43132 .31187 lineto .44992 .31256 lineto fill grestore gsave .786 setgray .43132 .31187 moveto .44992 .31256 lineto .5 .36264 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .43132 .31187 moveto .44992 .31256 lineto stroke grestore gsave .705 setgray .56868 .34557 moveto .53881 .33277 lineto .5 .29396 lineto .56868 .29396 lineto fill grestore gsave .786 setgray .56868 .34557 moveto .53881 .33277 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .56868 .34557 moveto .53881 .33277 lineto stroke grestore gsave .705 setgray .5 .29396 moveto .5 .31614 lineto .53881 .33277 lineto fill grestore gsave .786 setgray .5 .31614 moveto .53881 .33277 lineto .56868 .36264 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .5 .31614 moveto .53881 .33277 lineto stroke grestore gsave .623 setgray .63736 .29396 moveto .63736 .32206 lineto .59365 .29396 lineto fill grestore gsave .705 setgray .63736 .32206 moveto .59365 .29396 lineto .56868 .29396 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .63736 .32206 moveto .59365 .29396 lineto stroke grestore gsave .705 setgray .56868 .34557 moveto .59523 .36264 lineto .63736 .36264 lineto .56868 .29396 lineto fill grestore gsave .786 setgray .56868 .34557 moveto .59523 .36264 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .56868 .34557 moveto .59523 .36264 lineto stroke grestore gsave .541 setgray .70604 .29396 moveto .70604 .31739 lineto .68168 .29396 lineto fill grestore gsave .623 setgray .70604 .31739 moveto .68168 .29396 lineto .63736 .29396 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .70604 .31739 moveto .68168 .29396 lineto stroke grestore gsave .623 setgray .63736 .32206 moveto .67945 .36264 lineto .70604 .36264 lineto .63736 .29396 lineto fill grestore gsave .705 setgray .63736 .32206 moveto .67945 .36264 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .63736 .32206 moveto .67945 .36264 lineto stroke grestore gsave .459 setgray .77473 .29396 moveto .73987 .29396 lineto .77473 .34693 lineto fill grestore gsave .541 setgray .73987 .29396 moveto .77473 .34693 lineto .77473 .36264 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .73987 .29396 moveto .77473 .34693 lineto stroke grestore gsave .541 setgray .73621 .36264 moveto .70604 .31739 lineto .70604 .29396 lineto .77473 .36264 lineto fill grestore gsave .623 setgray .73621 .36264 moveto .70604 .31739 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .73621 .36264 moveto .70604 .31739 lineto stroke grestore gsave .377 setgray .84341 .29396 moveto .79585 .29396 lineto .84341 .34979 lineto fill grestore gsave .459 setgray .79585 .29396 moveto .84341 .34979 lineto .84341 .36264 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .79585 .29396 moveto .84341 .34979 lineto stroke grestore gsave .459 setgray .78826 .36264 moveto .77473 .34693 lineto .77473 .29396 lineto .84341 .36264 lineto fill grestore gsave .541 setgray .78826 .36264 moveto .77473 .34693 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .78826 .36264 moveto .77473 .34693 lineto stroke grestore gsave .295 setgray .91209 .29396 moveto .91209 .33176 lineto .87248 .29396 lineto fill grestore gsave .377 setgray .91209 .33176 moveto .87248 .29396 lineto .84341 .29396 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .33176 moveto .87248 .29396 lineto stroke grestore gsave .377 setgray .84341 .34979 moveto .85684 .36264 lineto .91209 .36264 lineto .84341 .29396 lineto fill grestore gsave .459 setgray .84341 .34979 moveto .85684 .36264 lineto .84341 .36264 lineto fill grestore gsave 0.001 setlinewidth .84341 .34979 moveto .85684 .36264 lineto stroke grestore gsave .295 setgray .98077 .29396 moveto .91209 .29396 lineto .98077 .36264 lineto fill grestore gsave .295 setgray .91209 .33176 moveto .95737 .36264 lineto .98077 .36264 lineto .91209 .29396 lineto fill grestore gsave .377 setgray .91209 .33176 moveto .95737 .36264 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .33176 moveto .95737 .36264 lineto stroke grestore gsave .623 setgray 0.01923 .36264 moveto 0.03963 .38304 lineto 0.08044 .36264 lineto fill grestore gsave .705 setgray 0.03963 .38304 moveto 0.08044 .36264 lineto 0.08791 .36264 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.03963 .38304 moveto 0.08044 .36264 lineto stroke grestore gsave .623 setgray 0.01923 .36264 moveto 0.03963 .38304 lineto 0.01923 .39664 lineto fill grestore gsave .705 setgray 0.03963 .38304 moveto 0.01923 .39664 lineto 0.01923 .43132 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.03963 .38304 moveto 0.01923 .39664 lineto stroke grestore gsave .705 setgray 0.08791 .36264 moveto .15659 .36264 lineto .15659 .43132 lineto fill grestore gsave .705 setgray 0.08791 .36264 moveto 0.08791 .43132 lineto .15659 .43132 lineto fill grestore gsave .705 setgray .21109 .41713 moveto .22527 .407 lineto .22527 .36264 lineto .15659 .36264 lineto fill grestore gsave .786 setgray .21109 .41713 moveto .22527 .407 lineto .22527 .43132 lineto fill grestore gsave 0.001 setlinewidth .21109 .41713 moveto .22527 .407 lineto stroke grestore gsave .705 setgray .21109 .41713 moveto .1969 .43132 lineto .15659 .43132 lineto .15659 .36264 lineto fill grestore gsave .786 setgray .21109 .41713 moveto .1969 .43132 lineto .22527 .43132 lineto fill grestore gsave 0.001 setlinewidth .21109 .41713 moveto .1969 .43132 lineto stroke grestore gsave .705 setgray .22527 .36264 moveto .24531 .38267 lineto .26668 .36264 lineto fill grestore gsave .786 setgray .24531 .38267 moveto .26668 .36264 lineto .29396 .36264 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .24531 .38267 moveto .26668 .36264 lineto stroke grestore gsave .705 setgray .22527 .36264 moveto .24531 .38267 lineto .22527 .407 lineto fill grestore gsave .786 setgray .24531 .38267 moveto .22527 .407 lineto .22527 .43132 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .24531 .38267 moveto .22527 .407 lineto stroke grestore gsave .786 setgray .34897 .41766 moveto .36264 .41082 lineto .36264 .36264 lineto .29396 .36264 lineto fill grestore gsave .868 setgray .34897 .41766 moveto .36264 .41082 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .34897 .41766 moveto .36264 .41082 lineto stroke grestore gsave .786 setgray .34897 .41766 moveto .3291 .43132 lineto .29396 .43132 lineto .29396 .36264 lineto fill grestore gsave .868 setgray .34897 .41766 moveto .3291 .43132 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .34897 .41766 moveto .3291 .43132 lineto stroke grestore gsave .786 setgray .39878 .39878 moveto .43132 .39021 lineto .43132 .36264 lineto .36264 .36264 lineto fill grestore gsave .868 setgray .39878 .39878 moveto .43132 .39021 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .39878 .39878 moveto .43132 .39021 lineto stroke grestore gsave .786 setgray .36264 .36264 moveto .39878 .39878 lineto .36264 .41082 lineto fill grestore gsave .868 setgray .39878 .39878 moveto .36264 .41082 lineto .36264 .43132 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .39878 .39878 moveto .36264 .41082 lineto stroke grestore gsave .786 setgray .5 .39227 moveto .45889 .39021 lineto .43132 .36264 lineto .5 .36264 lineto fill grestore gsave .868 setgray .5 .39227 moveto .45889 .39021 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .5 .39227 moveto .45889 .39021 lineto stroke grestore gsave .786 setgray .43132 .36264 moveto .43132 .39021 lineto .45889 .39021 lineto fill grestore gsave .868 setgray .43132 .39021 moveto .45889 .39021 lineto .5 .43132 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .43132 .39021 moveto .45889 .39021 lineto stroke grestore gsave .786 setgray .56868 .36264 moveto .5 .36264 lineto .56868 .43132 lineto fill grestore gsave .786 setgray .5 .39227 moveto .56508 .43132 lineto .56868 .43132 lineto .5 .36264 lineto fill grestore gsave .868 setgray .5 .39227 moveto .56508 .43132 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .5 .39227 moveto .56508 .43132 lineto stroke grestore gsave .705 setgray .63736 .36264 moveto .63736 .40255 lineto .59523 .36264 lineto fill grestore gsave .786 setgray .63736 .40255 moveto .59523 .36264 lineto .56868 .36264 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .63736 .40255 moveto .59523 .36264 lineto stroke grestore gsave .786 setgray .56868 .36264 moveto .63736 .43132 lineto .56868 .43132 lineto fill grestore gsave .623 setgray .70604 .36264 moveto .67945 .36264 lineto .70604 .40043 lineto fill grestore gsave .705 setgray .67945 .36264 moveto .70604 .40043 lineto .70604 .43132 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .67945 .36264 moveto .70604 .40043 lineto stroke grestore gsave .705 setgray .65761 .43132 moveto .63736 .40255 lineto .63736 .36264 lineto .70604 .43132 lineto fill grestore gsave .786 setgray .65761 .43132 moveto .63736 .40255 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .65761 .43132 moveto .63736 .40255 lineto stroke grestore gsave .541 setgray .73621 .36264 moveto .76207 .41866 lineto .77473 .43132 lineto .77473 .36264 lineto fill grestore gsave .623 setgray .73621 .36264 moveto .76207 .41866 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .73621 .36264 moveto .76207 .41866 lineto stroke grestore gsave .541 setgray .77473 .43132 moveto .76808 .43132 lineto .76207 .41866 lineto fill grestore gsave .623 setgray .76808 .43132 moveto .76207 .41866 lineto .70604 .36264 lineto .70604 .40043 lineto .72071 .43132 lineto fill grestore gsave 0.001 setlinewidth .76808 .43132 moveto .76207 .41866 lineto stroke grestore gsave .705 setgray .72071 .43132 moveto .70604 .40043 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .72071 .43132 moveto .70604 .40043 lineto stroke grestore gsave .459 setgray .78826 .36264 moveto .80745 .39536 lineto .84341 .43132 lineto .84341 .36264 lineto fill grestore gsave .541 setgray .78826 .36264 moveto .80745 .39536 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .78826 .36264 moveto .80745 .39536 lineto stroke grestore gsave .459 setgray .84341 .43132 moveto .82902 .43132 lineto .80745 .39536 lineto fill grestore gsave .541 setgray .82902 .43132 moveto .80745 .39536 lineto .77473 .36264 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .82902 .43132 moveto .80745 .39536 lineto stroke grestore gsave .377 setgray .85684 .36264 moveto .89266 .4119 lineto .91209 .43132 lineto .91209 .36264 lineto fill grestore gsave .459 setgray .85684 .36264 moveto .89266 .4119 lineto .84341 .36264 lineto fill grestore gsave 0.001 setlinewidth .85684 .36264 moveto .89266 .4119 lineto stroke grestore gsave .377 setgray .91209 .43132 moveto .90702 .43132 lineto .89266 .4119 lineto fill grestore gsave .459 setgray .90702 .43132 moveto .89266 .4119 lineto .84341 .36264 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .90702 .43132 moveto .89266 .4119 lineto stroke grestore gsave .295 setgray .98077 .36264 moveto .98077 .38457 lineto .95737 .36264 lineto fill grestore gsave .377 setgray .98077 .38457 moveto .95737 .36264 lineto .91209 .36264 lineto .98077 .43132 lineto fill grestore gsave 0.001 setlinewidth .98077 .38457 moveto .95737 .36264 lineto stroke grestore gsave .377 setgray .91209 .36264 moveto .98077 .43132 lineto .91209 .43132 lineto fill grestore gsave .705 setgray 0.01923 .43132 moveto 0.08791 .43132 lineto 0.08791 .5 lineto fill grestore gsave .705 setgray 0.01923 .43132 moveto 0.01923 .5 lineto 0.08791 .5 lineto fill grestore gsave .705 setgray 0.08791 .43132 moveto .15659 .43132 lineto .15659 .5 lineto fill grestore gsave .705 setgray 0.08791 .43132 moveto 0.08791 .5 lineto .15659 .5 lineto fill grestore gsave .705 setgray .15659 .43132 moveto .18346 .45819 lineto .1969 .43132 lineto fill grestore gsave .786 setgray .18346 .45819 moveto .1969 .43132 lineto .22527 .43132 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .18346 .45819 moveto .1969 .43132 lineto stroke grestore gsave .705 setgray .18346 .45819 moveto .16256 .5 lineto .15659 .5 lineto .15659 .43132 lineto fill grestore gsave .786 setgray .18346 .45819 moveto .16256 .5 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .18346 .45819 moveto .16256 .5 lineto stroke grestore gsave .786 setgray .29003 .49608 moveto .29396 .48654 lineto .29396 .43132 lineto .22527 .43132 lineto fill grestore gsave .868 setgray .29003 .49608 moveto .29396 .48654 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .29003 .49608 moveto .29396 .48654 lineto stroke grestore gsave .786 setgray .29003 .49608 moveto .28872 .5 lineto .22527 .5 lineto .22527 .43132 lineto fill grestore gsave .868 setgray .29003 .49608 moveto .28872 .5 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .29003 .49608 moveto .28872 .5 lineto stroke grestore gsave .786 setgray .29396 .43132 moveto .3143 .45167 lineto .3291 .43132 lineto fill grestore gsave .868 setgray .3143 .45167 moveto .3291 .43132 lineto .36264 .43132 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .3143 .45167 moveto .3291 .43132 lineto stroke grestore gsave .786 setgray .29396 .43132 moveto .3143 .45167 lineto .29396 .48654 lineto fill grestore gsave .868 setgray .3143 .45167 moveto .29396 .48654 lineto .29396 .5 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .3143 .45167 moveto .29396 .48654 lineto stroke grestore gsave .868 setgray .36264 .43132 moveto .43132 .43132 lineto .43132 .5 lineto fill grestore gsave .868 setgray .36264 .43132 moveto .36264 .5 lineto .43132 .5 lineto fill grestore gsave .868 setgray .43132 .43132 moveto .5 .43132 lineto .5 .5 lineto fill grestore gsave .868 setgray .43132 .43132 moveto .5 .5 lineto .43132 .5 lineto fill grestore gsave .786 setgray .56868 .43132 moveto .56508 .43132 lineto .56868 .43612 lineto fill grestore gsave .868 setgray .56508 .43132 moveto .56868 .43612 lineto .56868 .5 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .56508 .43132 moveto .56868 .43612 lineto stroke grestore gsave .868 setgray .56868 .5 moveto .5 .43132 lineto .5 .5 lineto fill grestore gsave .786 setgray .63736 .43132 moveto .63736 .5 lineto .56868 .43132 lineto fill grestore gsave .786 setgray .59894 .5 moveto .56868 .43612 lineto .56868 .43132 lineto .63736 .5 lineto fill grestore gsave .868 setgray .59894 .5 moveto .56868 .43612 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .59894 .5 moveto .56868 .43612 lineto stroke grestore gsave .705 setgray .65761 .43132 moveto .66773 .46168 lineto .70604 .5 lineto .70604 .43132 lineto fill grestore gsave .786 setgray .65761 .43132 moveto .66773 .46168 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .65761 .43132 moveto .66773 .46168 lineto stroke grestore gsave .705 setgray .70604 .5 moveto .6805 .5 lineto .66773 .46168 lineto fill grestore gsave .786 setgray .6805 .5 moveto .66773 .46168 lineto .63736 .43132 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .6805 .5 moveto .66773 .46168 lineto stroke grestore gsave .541 setgray .77473 .43132 moveto .76808 .43132 lineto .77473 .46085 lineto fill grestore gsave .623 setgray .76808 .43132 moveto .77473 .46085 lineto .77473 .5 lineto .72497 .45025 lineto .72071 .43132 lineto fill grestore gsave 0.001 setlinewidth .76808 .43132 moveto .77473 .46085 lineto stroke grestore gsave .705 setgray .72071 .43132 moveto .72497 .45025 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .72071 .43132 moveto .72497 .45025 lineto stroke grestore gsave .623 setgray .77473 .5 moveto .73617 .5 lineto .72497 .45025 lineto fill grestore gsave .705 setgray .73617 .5 moveto .72497 .45025 lineto .70604 .43132 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .73617 .5 moveto .72497 .45025 lineto stroke grestore gsave .459 setgray .84341 .43132 moveto .82902 .43132 lineto .84341 .47927 lineto fill grestore gsave .541 setgray .82902 .43132 moveto .84341 .47927 lineto .84341 .5 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .82902 .43132 moveto .84341 .47927 lineto stroke grestore gsave .541 setgray .78647 .5 moveto .77473 .46085 lineto .77473 .43132 lineto .84341 .5 lineto fill grestore gsave .623 setgray .78647 .5 moveto .77473 .46085 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .78647 .5 moveto .77473 .46085 lineto stroke grestore gsave .377 setgray .91209 .43132 moveto .90702 .43132 lineto .91209 .44427 lineto fill grestore gsave .459 setgray .90702 .43132 moveto .91209 .44427 lineto .91209 .5 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .90702 .43132 moveto .91209 .44427 lineto stroke grestore gsave .459 setgray .85152 .5 moveto .84341 .47927 lineto .84341 .43132 lineto .91209 .5 lineto fill grestore gsave .541 setgray .85152 .5 moveto .84341 .47927 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .85152 .5 moveto .84341 .47927 lineto stroke grestore gsave .377 setgray .98077 .43132 moveto .98077 .5 lineto .91209 .43132 lineto fill grestore gsave .377 setgray .94553 .5 moveto .91209 .44427 lineto .91209 .43132 lineto .98077 .5 lineto fill grestore gsave .459 setgray .94553 .5 moveto .91209 .44427 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .94553 .5 moveto .91209 .44427 lineto stroke grestore gsave .705 setgray 0.01923 .5 moveto 0.08791 .5 lineto 0.08791 .56868 lineto fill grestore gsave .705 setgray 0.01923 .56868 moveto 0.01923 .5 lineto 0.08791 .56868 lineto fill grestore gsave .705 setgray 0.08791 .5 moveto .15659 .56868 lineto .15659 .5 lineto fill grestore gsave .705 setgray 0.08791 .56868 moveto 0.08791 .5 lineto .15659 .56868 lineto fill grestore gsave .705 setgray .15659 .5 moveto .16256 .5 lineto .1631 .50651 lineto fill grestore gsave .786 setgray .16256 .5 moveto .1631 .50651 lineto .22527 .56868 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .16256 .5 moveto .1631 .50651 lineto stroke grestore gsave .705 setgray .16828 .56868 moveto .1631 .50651 lineto .15659 .5 lineto .15659 .56868 lineto fill grestore gsave .786 setgray .16828 .56868 moveto .1631 .50651 lineto .22527 .56868 lineto fill grestore gsave 0.001 setlinewidth .16828 .56868 moveto .1631 .50651 lineto stroke grestore gsave .786 setgray .28872 .5 moveto .29396 .54709 lineto .29396 .56868 lineto .22527 .5 lineto fill grestore gsave .868 setgray .28872 .5 moveto .29396 .54709 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .28872 .5 moveto .29396 .54709 lineto stroke grestore gsave .786 setgray .22527 .56868 moveto .22527 .5 lineto .29396 .56868 lineto fill grestore gsave .868 setgray .29396 .5 moveto .36264 .56868 lineto .36264 .5 lineto fill grestore gsave .786 setgray .29396 .56868 moveto .29788 .56868 lineto .29396 .54709 lineto fill grestore gsave .868 setgray .29788 .56868 moveto .29396 .54709 lineto .29396 .5 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .29788 .56868 moveto .29396 .54709 lineto stroke grestore gsave .868 setgray .36264 .5 moveto .43132 .56868 lineto .43132 .5 lineto fill grestore gsave .868 setgray .36264 .56868 moveto .36264 .5 lineto .43132 .56868 lineto fill grestore gsave .868 setgray .5 .56868 moveto .5 .5 lineto .43132 .5 lineto fill grestore gsave .868 setgray .5 .56868 moveto .43132 .56868 lineto .43132 .5 lineto fill grestore gsave .868 setgray .56868 .56868 moveto .56868 .5 lineto .5 .5 lineto fill grestore gsave .868 setgray .56868 .56868 moveto .5 .56868 lineto .5 .5 lineto fill grestore gsave .786 setgray .59482 .52613 moveto .59894 .5 lineto .63736 .5 lineto .63736 .56868 lineto fill grestore gsave .868 setgray .59482 .52613 moveto .59894 .5 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .59482 .52613 moveto .59894 .5 lineto stroke grestore gsave .786 setgray .63736 .56868 moveto .59482 .52613 lineto .5881 .56868 lineto fill grestore gsave .868 setgray .59482 .52613 moveto .5881 .56868 lineto .56868 .56868 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .59482 .52613 moveto .5881 .56868 lineto stroke grestore gsave .705 setgray .67752 .54016 moveto .6805 .5 lineto .70604 .5 lineto .70604 .56868 lineto fill grestore gsave .786 setgray .67752 .54016 moveto .6805 .5 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .67752 .54016 moveto .6805 .5 lineto stroke grestore gsave .705 setgray .70604 .56868 moveto .67752 .54016 lineto .67423 .56868 lineto fill grestore gsave .786 setgray .67752 .54016 moveto .67423 .56868 lineto .63736 .56868 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .67752 .54016 moveto .67423 .56868 lineto stroke grestore gsave .623 setgray .73617 .5 moveto .73617 .53012 lineto .77473 .56868 lineto .77473 .5 lineto fill grestore gsave .705 setgray .73617 .5 moveto .73617 .53012 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .73617 .5 moveto .73617 .53012 lineto stroke grestore gsave .623 setgray .77473 .56868 moveto .73617 .53012 lineto .73414 .56868 lineto fill grestore gsave .705 setgray .73617 .53012 moveto .73414 .56868 lineto .70604 .56868 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .73617 .53012 moveto .73414 .56868 lineto stroke grestore gsave .541 setgray .78647 .5 moveto .78688 .51215 lineto .84341 .56868 lineto .84341 .5 lineto fill grestore gsave .623 setgray .78647 .5 moveto .78688 .51215 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .78647 .5 moveto .78688 .51215 lineto stroke grestore gsave .541 setgray .84341 .56868 moveto .78688 .51215 lineto .78688 .56868 lineto fill grestore gsave .623 setgray .78688 .51215 moveto .78688 .56868 lineto .77473 .56868 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .78688 .51215 moveto .78688 .56868 lineto stroke grestore gsave .459 setgray .85152 .5 moveto .85274 .50933 lineto .91209 .56868 lineto .91209 .5 lineto fill grestore gsave .541 setgray .85152 .5 moveto .85274 .50933 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .85152 .5 moveto .85274 .50933 lineto stroke grestore gsave .459 setgray .91209 .56868 moveto .85556 .56868 lineto .85274 .50933 lineto fill grestore gsave .541 setgray .85556 .56868 moveto .85274 .50933 lineto .84341 .5 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .85556 .56868 moveto .85274 .50933 lineto stroke grestore gsave .377 setgray .94553 .5 moveto .95389 .5418 lineto .98077 .56868 lineto .98077 .5 lineto fill grestore gsave .459 setgray .94553 .5 moveto .95389 .5418 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .94553 .5 moveto .95389 .5418 lineto stroke grestore gsave .377 setgray .98077 .56868 moveto .95926 .56868 lineto .95389 .5418 lineto fill grestore gsave .459 setgray .95926 .56868 moveto .95389 .5418 lineto .91209 .5 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .95926 .56868 moveto .95389 .5418 lineto stroke grestore gsave .705 setgray 0.01923 .56868 moveto 0.08791 .63736 lineto 0.08791 .56868 lineto fill grestore gsave .705 setgray 0.01923 .63736 moveto 0.01923 .56868 lineto 0.08791 .63736 lineto fill grestore gsave .705 setgray 0.08791 .56868 moveto .15659 .63736 lineto .15659 .56868 lineto fill grestore gsave .705 setgray 0.08791 .63736 moveto 0.08791 .56868 lineto .15659 .63736 lineto fill grestore gsave .705 setgray .15659 .56868 moveto .16828 .56868 lineto .19166 .60375 lineto fill grestore gsave .786 setgray .16828 .56868 moveto .19166 .60375 lineto .22527 .63736 lineto .22527 .56868 lineto fill grestore gsave 0.001 setlinewidth .16828 .56868 moveto .19166 .60375 lineto stroke grestore gsave .705 setgray .21183 .63736 moveto .19166 .60375 lineto .15659 .56868 lineto .15659 .63736 lineto fill grestore gsave .786 setgray .21183 .63736 moveto .19166 .60375 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .21183 .63736 moveto .19166 .60375 lineto stroke grestore gsave .786 setgray .22527 .56868 moveto .29396 .63736 lineto .29396 .56868 lineto fill grestore gsave .786 setgray .22527 .63736 moveto .22527 .56868 lineto .29396 .63736 lineto fill grestore gsave .786 setgray .36264 .62348 moveto .29788 .56868 lineto .29396 .56868 lineto .36264 .63736 lineto fill grestore gsave .868 setgray .36264 .62348 moveto .29788 .56868 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .36264 .62348 moveto .29788 .56868 lineto stroke grestore gsave .786 setgray .29396 .63736 moveto .36264 .63736 lineto .29396 .56868 lineto fill grestore gsave .868 setgray .43132 .63736 moveto .36264 .56868 lineto .43132 .56868 lineto fill grestore gsave .786 setgray .36264 .63736 moveto .36264 .62348 lineto .40777 .63736 lineto fill grestore gsave .868 setgray .36264 .62348 moveto .40777 .63736 lineto .43132 .63736 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .36264 .62348 moveto .40777 .63736 lineto stroke grestore gsave .868 setgray .5 .63736 moveto .43132 .56868 lineto .5 .56868 lineto fill grestore gsave .868 setgray .5 .63736 moveto .43132 .63736 lineto .43132 .56868 lineto fill grestore gsave .786 setgray .56868 .63736 moveto .54325 .61193 lineto .56868 .59328 lineto fill grestore gsave .868 setgray .54325 .61193 moveto .56868 .59328 lineto .56868 .56868 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .54325 .61193 moveto .56868 .59328 lineto stroke grestore gsave .786 setgray .56868 .63736 moveto .54325 .61193 lineto .50856 .63736 lineto fill grestore gsave .868 setgray .54325 .61193 moveto .50856 .63736 lineto .5 .63736 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .54325 .61193 moveto .50856 .63736 lineto stroke grestore gsave .786 setgray .58021 .58021 moveto .5881 .56868 lineto .63736 .56868 lineto .63736 .63736 lineto fill grestore gsave .868 setgray .58021 .58021 moveto .5881 .56868 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .58021 .58021 moveto .5881 .56868 lineto stroke grestore gsave .786 setgray .58021 .58021 moveto .56868 .59328 lineto .56868 .63736 lineto .63736 .63736 lineto fill grestore gsave .868 setgray .58021 .58021 moveto .56868 .59328 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .58021 .58021 moveto .56868 .59328 lineto stroke grestore gsave .705 setgray .66327 .59459 moveto .67423 .56868 lineto .70604 .56868 lineto .70604 .63736 lineto fill grestore gsave .786 setgray .66327 .59459 moveto .67423 .56868 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .66327 .59459 moveto .67423 .56868 lineto stroke grestore gsave .705 setgray .70604 .63736 moveto .66327 .59459 lineto .6401 .63736 lineto fill grestore gsave .786 setgray .66327 .59459 moveto .6401 .63736 lineto .63736 .63736 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .66327 .59459 moveto .6401 .63736 lineto stroke grestore gsave .541 setgray .77473 .63736 moveto .76907 .63171 lineto .77473 .60783 lineto fill grestore gsave .623 setgray .76907 .63171 moveto .77473 .60783 lineto .77473 .56868 lineto .73414 .56868 lineto .72876 .5914 lineto fill grestore gsave 0.001 setlinewidth .76907 .63171 moveto .77473 .60783 lineto stroke grestore gsave .705 setgray .72876 .5914 moveto .73414 .56868 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .72876 .5914 moveto .73414 .56868 lineto stroke grestore gsave .541 setgray .77473 .63736 moveto .76907 .63171 lineto .76734 .63736 lineto fill grestore gsave .623 setgray .76907 .63171 moveto .76734 .63736 lineto .71471 .63736 lineto .72876 .5914 lineto fill grestore gsave 0.001 setlinewidth .76907 .63171 moveto .76734 .63736 lineto stroke grestore gsave .705 setgray .72876 .5914 moveto .71471 .63736 lineto .70604 .63736 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .72876 .5914 moveto .71471 .63736 lineto stroke grestore gsave .459 setgray .84341 .63736 moveto .83893 .63288 lineto .84341 .61123 lineto fill grestore gsave .541 setgray .83893 .63288 moveto .84341 .61123 lineto .84341 .56868 lineto .78688 .56868 lineto .78479 .57875 lineto fill grestore gsave 0.001 setlinewidth .83893 .63288 moveto .84341 .61123 lineto stroke grestore gsave .623 setgray .78479 .57875 moveto .78688 .56868 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .78479 .57875 moveto .78688 .56868 lineto stroke grestore gsave .459 setgray .84341 .63736 moveto .83893 .63288 lineto .83738 .63736 lineto fill grestore gsave .541 setgray .83893 .63288 moveto .83738 .63736 lineto .77473 .63736 lineto .77473 .60783 lineto .78479 .57875 lineto fill grestore gsave 0.001 setlinewidth .83893 .63288 moveto .83738 .63736 lineto stroke grestore gsave .623 setgray .78479 .57875 moveto .77473 .60783 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .78479 .57875 moveto .77473 .60783 lineto stroke grestore gsave .459 setgray .85322 .5785 moveto .85556 .56868 lineto .91209 .56868 lineto .91209 .63736 lineto fill grestore gsave .541 setgray .85322 .5785 moveto .85556 .56868 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .85322 .5785 moveto .85556 .56868 lineto stroke grestore gsave .459 setgray .85322 .5785 moveto .84341 .61123 lineto .84341 .63736 lineto .91209 .63736 lineto fill grestore gsave .541 setgray .85322 .5785 moveto .84341 .61123 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .85322 .5785 moveto .84341 .61123 lineto stroke grestore gsave .377 setgray .94933 .60593 moveto .95926 .56868 lineto .98077 .56868 lineto .98077 .63736 lineto fill grestore gsave .459 setgray .94933 .60593 moveto .95926 .56868 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .94933 .60593 moveto .95926 .56868 lineto stroke grestore gsave .377 setgray .98077 .63736 moveto .94933 .60593 lineto .9381 .63736 lineto fill grestore gsave .459 setgray .94933 .60593 moveto .9381 .63736 lineto .91209 .63736 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .94933 .60593 moveto .9381 .63736 lineto stroke grestore gsave .705 setgray 0.08791 .70604 moveto 0.01923 .63736 lineto 0.08791 .63736 lineto fill grestore gsave .623 setgray 0.01923 .70604 moveto 0.01923 .70157 lineto 0.02967 .70604 lineto fill grestore gsave .705 setgray 0.01923 .70157 moveto 0.02967 .70604 lineto 0.08791 .70604 lineto 0.01923 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .70157 moveto 0.02967 .70604 lineto stroke grestore gsave .705 setgray .15659 .70604 moveto 0.08791 .63736 lineto .15659 .63736 lineto fill grestore gsave .705 setgray 0.08791 .70604 moveto .15659 .70604 lineto 0.08791 .63736 lineto fill grestore gsave .705 setgray .22527 .64697 moveto .21183 .63736 lineto .15659 .63736 lineto .22527 .70604 lineto fill grestore gsave .786 setgray .22527 .64697 moveto .21183 .63736 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .22527 .64697 moveto .21183 .63736 lineto stroke grestore gsave .705 setgray .15659 .70604 moveto .22527 .70604 lineto .15659 .63736 lineto fill grestore gsave .705 setgray .29396 .70604 moveto .29396 .69825 lineto .25889 .67098 lineto fill grestore gsave .786 setgray .29396 .69825 moveto .25889 .67098 lineto .22527 .63736 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .29396 .69825 moveto .25889 .67098 lineto stroke grestore gsave .705 setgray .22527 .64697 moveto .25889 .67098 lineto .29396 .70604 lineto .22527 .70604 lineto fill grestore gsave .786 setgray .22527 .64697 moveto .25889 .67098 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .22527 .64697 moveto .25889 .67098 lineto stroke grestore gsave .786 setgray .36264 .70604 moveto .29396 .63736 lineto .36264 .63736 lineto fill grestore gsave .705 setgray .29396 .70604 moveto .29396 .69825 lineto .31733 .70604 lineto fill grestore gsave .786 setgray .29396 .69825 moveto .31733 .70604 lineto .36264 .70604 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .29396 .69825 moveto .31733 .70604 lineto stroke grestore gsave .786 setgray .43132 .64164 moveto .40777 .63736 lineto .36264 .63736 lineto .43132 .70604 lineto fill grestore gsave .868 setgray .43132 .64164 moveto .40777 .63736 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .43132 .64164 moveto .40777 .63736 lineto stroke grestore gsave .786 setgray .36264 .70604 moveto .43132 .70604 lineto .36264 .63736 lineto fill grestore gsave .786 setgray .5 .70604 moveto .5 .64129 lineto .43524 .64129 lineto fill grestore gsave .868 setgray .5 .64129 moveto .43524 .64129 lineto .43132 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .5 .64129 moveto .43524 .64129 lineto stroke grestore gsave .786 setgray .43524 .64129 moveto .43132 .64164 lineto .43132 .70604 lineto .5 .70604 lineto fill grestore gsave .868 setgray .43524 .64129 moveto .43132 .64164 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .43524 .64129 moveto .43132 .64164 lineto stroke grestore gsave .705 setgray .56868 .70604 moveto .5585 .69586 lineto .56868 .69099 lineto fill grestore gsave .786 setgray .5585 .69586 moveto .56868 .69099 lineto .56868 .63736 lineto .50856 .63736 lineto .50277 .64013 lineto fill grestore gsave 0.001 setlinewidth .5585 .69586 moveto .56868 .69099 lineto stroke grestore gsave .868 setgray .50277 .64013 moveto .50856 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .50277 .64013 moveto .50856 .63736 lineto stroke grestore gsave .705 setgray .56868 .70604 moveto .5585 .69586 lineto .53405 .70604 lineto fill grestore gsave .786 setgray .5585 .69586 moveto .53405 .70604 lineto .5 .70604 lineto .5 .64129 lineto .50277 .64013 lineto fill grestore gsave 0.001 setlinewidth .5585 .69586 moveto .53405 .70604 lineto stroke grestore gsave .868 setgray .50277 .64013 moveto .5 .64129 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .50277 .64013 moveto .5 .64129 lineto stroke grestore gsave .705 setgray .63736 .70604 moveto .60114 .66982 lineto .63736 .64049 lineto fill grestore gsave .786 setgray .60114 .66982 moveto .63736 .64049 lineto .63736 .63736 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .60114 .66982 moveto .63736 .64049 lineto stroke grestore gsave .705 setgray .60114 .66982 moveto .56868 .69099 lineto .56868 .70604 lineto .63736 .70604 lineto fill grestore gsave .786 setgray .60114 .66982 moveto .56868 .69099 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .60114 .66982 moveto .56868 .69099 lineto stroke grestore gsave .623 setgray .70604 .70604 moveto .68295 .68295 lineto .70604 .65379 lineto fill grestore gsave .705 setgray .68295 .68295 moveto .70604 .65379 lineto .70604 .63736 lineto .6401 .63736 lineto .63889 .63889 lineto fill grestore gsave 0.001 setlinewidth .68295 .68295 moveto .70604 .65379 lineto stroke grestore gsave .786 setgray .63889 .63889 moveto .6401 .63736 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .63889 .63889 moveto .6401 .63736 lineto stroke grestore gsave .623 setgray .70604 .70604 moveto .68295 .68295 lineto .66091 .70604 lineto fill grestore gsave .705 setgray .68295 .68295 moveto .66091 .70604 lineto .63736 .70604 lineto .63736 .64049 lineto .63889 .63889 lineto fill grestore gsave 0.001 setlinewidth .68295 .68295 moveto .66091 .70604 lineto stroke grestore gsave .786 setgray .63889 .63889 moveto .63736 .64049 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .63889 .63889 moveto .63736 .64049 lineto stroke grestore gsave .541 setgray .75018 .6815 moveto .76734 .63736 lineto .77473 .63736 lineto .77473 .70604 lineto fill grestore gsave .623 setgray .75018 .6815 moveto .76734 .63736 lineto .71471 .63736 lineto .71229 .6436 lineto fill grestore gsave 0.001 setlinewidth .75018 .6815 moveto .76734 .63736 lineto stroke grestore gsave .705 setgray .71229 .6436 moveto .71471 .63736 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .71229 .6436 moveto .71471 .63736 lineto stroke grestore gsave .541 setgray .77473 .70604 moveto .75018 .6815 lineto .73513 .70604 lineto fill grestore gsave .623 setgray .75018 .6815 moveto .73513 .70604 lineto .70604 .70604 lineto .70604 .65379 lineto .71229 .6436 lineto fill grestore gsave 0.001 setlinewidth .75018 .6815 moveto .73513 .70604 lineto stroke grestore gsave .705 setgray .71229 .6436 moveto .70604 .65379 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .71229 .6436 moveto .70604 .65379 lineto stroke grestore gsave .459 setgray .81759 .68023 moveto .83738 .63736 lineto .84341 .63736 lineto .84341 .70604 lineto fill grestore gsave .541 setgray .81759 .68023 moveto .83738 .63736 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .81759 .68023 moveto .83738 .63736 lineto stroke grestore gsave .459 setgray .84341 .70604 moveto .81759 .68023 lineto .80253 .70604 lineto fill grestore gsave .541 setgray .81759 .68023 moveto .80253 .70604 lineto .77473 .70604 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .81759 .68023 moveto .80253 .70604 lineto stroke grestore gsave .377 setgray .91209 .70604 moveto .90134 .69529 lineto .91209 .67379 lineto fill grestore gsave .459 setgray .90134 .69529 moveto .91209 .67379 lineto .91209 .63736 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .90134 .69529 moveto .91209 .67379 lineto stroke grestore gsave .377 setgray .91209 .70604 moveto .90134 .69529 lineto .89417 .70604 lineto fill grestore gsave .459 setgray .90134 .69529 moveto .89417 .70604 lineto .84341 .70604 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .90134 .69529 moveto .89417 .70604 lineto stroke grestore gsave .377 setgray .92864 .65392 moveto .9381 .63736 lineto .98077 .63736 lineto .98077 .70604 lineto fill grestore gsave .459 setgray .92864 .65392 moveto .9381 .63736 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .92864 .65392 moveto .9381 .63736 lineto stroke grestore gsave .377 setgray .92864 .65392 moveto .91209 .67379 lineto .91209 .70604 lineto .98077 .70604 lineto fill grestore gsave .459 setgray .92864 .65392 moveto .91209 .67379 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .92864 .65392 moveto .91209 .67379 lineto stroke grestore gsave .623 setgray 0.08791 .71948 moveto 0.02967 .70604 lineto 0.01923 .70604 lineto 0.08791 .77473 lineto fill grestore gsave .705 setgray 0.08791 .71948 moveto 0.02967 .70604 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .71948 moveto 0.02967 .70604 lineto stroke grestore gsave .623 setgray 0.01923 .77473 moveto 0.08791 .77473 lineto 0.01923 .70604 lineto fill grestore gsave .623 setgray .15659 .77473 moveto .15659 .74056 lineto .1038 .72193 lineto fill grestore gsave .705 setgray .15659 .74056 moveto .1038 .72193 lineto 0.08791 .70604 lineto .15659 .70604 lineto fill grestore gsave 0.001 setlinewidth .15659 .74056 moveto .1038 .72193 lineto stroke grestore gsave .623 setgray 0.08791 .71948 moveto .1038 .72193 lineto .15659 .77473 lineto 0.08791 .77473 lineto fill grestore gsave .705 setgray 0.08791 .71948 moveto .1038 .72193 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .71948 moveto .1038 .72193 lineto stroke grestore gsave .623 setgray .22527 .77473 moveto .22527 .75688 lineto .19851 .74796 lineto fill grestore gsave .705 setgray .22527 .75688 moveto .19851 .74796 lineto .15659 .70604 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .22527 .75688 moveto .19851 .74796 lineto stroke grestore gsave .623 setgray .15659 .74056 moveto .19851 .74796 lineto .22527 .77473 lineto .15659 .77473 lineto fill grestore gsave .705 setgray .15659 .74056 moveto .19851 .74796 lineto .15659 .70604 lineto fill grestore gsave 0.001 setlinewidth .15659 .74056 moveto .19851 .74796 lineto stroke grestore gsave .623 setgray .29396 .77473 moveto .29396 .7687 lineto .28459 .76535 lineto fill grestore gsave .705 setgray .29396 .7687 moveto .28459 .76535 lineto .22527 .70604 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .29396 .7687 moveto .28459 .76535 lineto stroke grestore gsave .623 setgray .22527 .75688 moveto .28459 .76535 lineto .29396 .77473 lineto .22527 .77473 lineto fill grestore gsave .705 setgray .22527 .75688 moveto .28459 .76535 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .22527 .75688 moveto .28459 .76535 lineto stroke grestore gsave .623 setgray .36264 .77473 moveto .36264 .77375 lineto .36143 .77352 lineto fill grestore gsave .705 setgray .36264 .77375 moveto .36143 .77352 lineto .29396 .70604 lineto .31733 .70604 lineto .36264 .71454 lineto fill grestore gsave 0.001 setlinewidth .36264 .77375 moveto .36143 .77352 lineto stroke grestore gsave .786 setgray .36264 .71454 moveto .31733 .70604 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .36264 .71454 moveto .31733 .70604 lineto stroke grestore gsave .623 setgray .29396 .7687 moveto .36143 .77352 lineto .36264 .77473 lineto .29396 .77473 lineto fill grestore gsave .705 setgray .29396 .7687 moveto .36143 .77352 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .29396 .7687 moveto .36143 .77352 lineto stroke grestore gsave .623 setgray .43132 .77473 moveto .43132 .77383 lineto .43034 .77375 lineto fill grestore gsave .705 setgray .43132 .77383 moveto .43034 .77375 lineto .37113 .71454 lineto .43132 .7197 lineto fill grestore gsave 0.001 setlinewidth .43132 .77383 moveto .43034 .77375 lineto stroke grestore gsave .786 setgray .43132 .7197 moveto .37113 .71454 lineto .36264 .70604 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .43132 .7197 moveto .37113 .71454 lineto stroke grestore gsave .623 setgray .43034 .77375 moveto .36264 .77375 lineto .36264 .77473 lineto .43132 .77473 lineto fill grestore gsave .705 setgray .43034 .77375 moveto .36264 .77375 lineto .36264 .71454 lineto .37113 .71454 lineto fill grestore gsave 0.001 setlinewidth .43034 .77375 moveto .36264 .77375 lineto stroke grestore gsave .786 setgray .37113 .71454 moveto .36264 .71454 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .37113 .71454 moveto .36264 .71454 lineto stroke grestore gsave .623 setgray .5 .77473 moveto .49375 .76848 lineto .5 .76813 lineto fill grestore gsave .705 setgray .49375 .76848 moveto .5 .76813 lineto .5 .7155 lineto .44389 .71862 lineto fill grestore gsave 0.001 setlinewidth .49375 .76848 moveto .5 .76813 lineto stroke grestore gsave .786 setgray .44389 .71862 moveto .5 .7155 lineto .5 .70604 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .44389 .71862 moveto .5 .7155 lineto stroke grestore gsave .623 setgray .49375 .76848 moveto .43132 .77383 lineto .43132 .77473 lineto .5 .77473 lineto fill grestore gsave .705 setgray .49375 .76848 moveto .43132 .77383 lineto .43132 .7197 lineto .44389 .71862 lineto fill grestore gsave 0.001 setlinewidth .49375 .76848 moveto .43132 .77383 lineto stroke grestore gsave .786 setgray .44389 .71862 moveto .43132 .7197 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .44389 .71862 moveto .43132 .7197 lineto stroke grestore gsave .623 setgray .56868 .77473 moveto .54967 .75571 lineto .56868 .75028 lineto fill grestore gsave .705 setgray .54967 .75571 moveto .56868 .75028 lineto .56868 .70604 lineto .53405 .70604 lineto .50757 .71361 lineto fill grestore gsave 0.001 setlinewidth .54967 .75571 moveto .56868 .75028 lineto stroke grestore gsave .786 setgray .50757 .71361 moveto .53405 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .50757 .71361 moveto .53405 .70604 lineto stroke grestore gsave .623 setgray .54967 .75571 moveto .5 .76813 lineto .5 .77473 lineto .56868 .77473 lineto fill grestore gsave .705 setgray .54967 .75571 moveto .5 .76813 lineto .5 .7155 lineto .50757 .71361 lineto fill grestore gsave 0.001 setlinewidth .54967 .75571 moveto .5 .76813 lineto stroke grestore gsave .786 setgray .50757 .71361 moveto .5 .7155 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .50757 .71361 moveto .5 .7155 lineto stroke grestore gsave .623 setgray .63736 .77473 moveto .60094 .7383 lineto .63736 .72175 lineto fill grestore gsave .705 setgray .60094 .7383 moveto .63736 .72175 lineto .63736 .70604 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .60094 .7383 moveto .63736 .72175 lineto stroke grestore gsave .623 setgray .60094 .7383 moveto .56868 .75028 lineto .56868 .77473 lineto .63736 .77473 lineto fill grestore gsave .705 setgray .60094 .7383 moveto .56868 .75028 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .60094 .7383 moveto .56868 .75028 lineto stroke grestore gsave .541 setgray .70604 .77473 moveto .68467 .75335 lineto .70604 .73714 lineto fill grestore gsave .623 setgray .68467 .75335 moveto .70604 .73714 lineto .70604 .70604 lineto .66091 .70604 lineto .64752 .7162 lineto fill grestore gsave 0.001 setlinewidth .68467 .75335 moveto .70604 .73714 lineto stroke grestore gsave .705 setgray .64752 .7162 moveto .66091 .70604 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .64752 .7162 moveto .66091 .70604 lineto stroke grestore gsave .541 setgray .70604 .77473 moveto .68467 .75335 lineto .64549 .77473 lineto fill grestore gsave .623 setgray .68467 .75335 moveto .64549 .77473 lineto .63736 .77473 lineto .63736 .72175 lineto .64752 .7162 lineto fill grestore gsave 0.001 setlinewidth .68467 .75335 moveto .64549 .77473 lineto stroke grestore gsave .705 setgray .64752 .7162 moveto .63736 .72175 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .64752 .7162 moveto .63736 .72175 lineto stroke grestore gsave .459 setgray .77473 .77473 moveto .75783 .75783 lineto .77473 .73506 lineto fill grestore gsave .541 setgray .75783 .75783 moveto .77473 .73506 lineto .77473 .70604 lineto .73513 .70604 lineto .72274 .72274 lineto fill grestore gsave 0.001 setlinewidth .75783 .75783 moveto .77473 .73506 lineto stroke grestore gsave .623 setgray .72274 .72274 moveto .73513 .70604 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .72274 .72274 moveto .73513 .70604 lineto stroke grestore gsave .459 setgray .77473 .77473 moveto .75783 .75783 lineto .73823 .77473 lineto fill grestore gsave .541 setgray .75783 .75783 moveto .73823 .77473 lineto .70604 .77473 lineto .70604 .73714 lineto .72274 .72274 lineto fill grestore gsave 0.001 setlinewidth .75783 .75783 moveto .73823 .77473 lineto stroke grestore gsave .623 setgray .72274 .72274 moveto .70604 .73714 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .72274 .72274 moveto .70604 .73714 lineto stroke grestore gsave .377 setgray .84341 .77473 moveto .83573 .76704 lineto .84341 .7568 lineto fill grestore gsave .459 setgray .83573 .76704 moveto .84341 .7568 lineto .84341 .70604 lineto .80253 .70604 lineto .79061 .72193 lineto fill grestore gsave 0.001 setlinewidth .83573 .76704 moveto .84341 .7568 lineto stroke grestore gsave .541 setgray .79061 .72193 moveto .80253 .70604 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .79061 .72193 moveto .80253 .70604 lineto stroke grestore gsave .377 setgray .84341 .77473 moveto .83573 .76704 lineto .82643 .77473 lineto fill grestore gsave .459 setgray .83573 .76704 moveto .82643 .77473 lineto .77473 .77473 lineto .77473 .73506 lineto .79061 .72193 lineto fill grestore gsave 0.001 setlinewidth .83573 .76704 moveto .82643 .77473 lineto stroke grestore gsave .541 setgray .79061 .72193 moveto .77473 .73506 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .79061 .72193 moveto .77473 .73506 lineto stroke grestore gsave .377 setgray .87109 .73373 moveto .89417 .70604 lineto .91209 .70604 lineto .91209 .77473 lineto fill grestore gsave .459 setgray .87109 .73373 moveto .89417 .70604 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .87109 .73373 moveto .89417 .70604 lineto stroke grestore gsave .377 setgray .87109 .73373 moveto .84341 .7568 lineto .84341 .77473 lineto .91209 .77473 lineto fill grestore gsave .459 setgray .87109 .73373 moveto .84341 .7568 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .87109 .73373 moveto .84341 .7568 lineto stroke grestore gsave .295 setgray .98077 .77473 moveto .97759 .77155 lineto .98077 .76837 lineto fill grestore gsave .377 setgray .97759 .77155 moveto .98077 .76837 lineto .98077 .70604 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .97759 .77155 moveto .98077 .76837 lineto stroke grestore gsave .295 setgray .98077 .77473 moveto .97759 .77155 lineto .9723 .77473 lineto fill grestore gsave .377 setgray .97759 .77155 moveto .9723 .77473 lineto .91209 .77473 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .97759 .77155 moveto .9723 .77473 lineto stroke grestore gsave .623 setgray 0.08791 .84341 moveto 0.01923 .77473 lineto 0.08791 .77473 lineto fill grestore gsave .623 setgray 0.08791 .84341 moveto 0.01923 .84341 lineto 0.01923 .77473 lineto fill grestore gsave .623 setgray .15659 .84341 moveto 0.08791 .77473 lineto .15659 .77473 lineto fill grestore gsave .623 setgray .15659 .84341 moveto 0.08791 .84341 lineto 0.08791 .77473 lineto fill grestore gsave .623 setgray .22527 .84341 moveto .15659 .77473 lineto .22527 .77473 lineto fill grestore gsave .623 setgray .22527 .84341 moveto .15659 .84341 lineto .15659 .77473 lineto fill grestore gsave .623 setgray .29396 .84341 moveto .22527 .77473 lineto .29396 .77473 lineto fill grestore gsave .623 setgray .29396 .84341 moveto .22527 .84341 lineto .22527 .77473 lineto fill grestore gsave .623 setgray .36264 .84341 moveto .29396 .77473 lineto .36264 .77473 lineto fill grestore gsave .623 setgray .36264 .84341 moveto .29396 .84341 lineto .29396 .77473 lineto fill grestore gsave .623 setgray .43132 .84341 moveto .36264 .77473 lineto .43132 .77473 lineto fill grestore gsave .623 setgray .43132 .84341 moveto .36264 .84341 lineto .36264 .77473 lineto fill grestore gsave .541 setgray .5 .84341 moveto .49343 .83684 lineto .5 .83611 lineto fill grestore gsave .623 setgray .49343 .83684 moveto .5 .83611 lineto .5 .77473 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .49343 .83684 moveto .5 .83611 lineto stroke grestore gsave .541 setgray .5 .84341 moveto .49343 .83684 lineto .45073 .84341 lineto fill grestore gsave .623 setgray .49343 .83684 moveto .45073 .84341 lineto .43132 .84341 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .49343 .83684 moveto .45073 .84341 lineto stroke grestore gsave .541 setgray .56868 .84341 moveto .54604 .82076 lineto .56868 .81321 lineto fill grestore gsave .623 setgray .54604 .82076 moveto .56868 .81321 lineto .56868 .77473 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .54604 .82076 moveto .56868 .81321 lineto stroke grestore gsave .541 setgray .54604 .82076 moveto .5 .83611 lineto .5 .84341 lineto .56868 .84341 lineto fill grestore gsave .623 setgray .54604 .82076 moveto .5 .83611 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .54604 .82076 moveto .5 .83611 lineto stroke grestore gsave .541 setgray .63736 .84341 moveto .59603 .80207 lineto .63736 .78058 lineto fill grestore gsave .623 setgray .59603 .80207 moveto .63736 .78058 lineto .63736 .77473 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .59603 .80207 moveto .63736 .78058 lineto stroke grestore gsave .541 setgray .59603 .80207 moveto .56868 .81321 lineto .56868 .84341 lineto .63736 .84341 lineto fill grestore gsave .623 setgray .59603 .80207 moveto .56868 .81321 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .59603 .80207 moveto .56868 .81321 lineto stroke grestore gsave .459 setgray .70604 .84341 moveto .68839 .82575 lineto .70604 .8113 lineto fill grestore gsave .541 setgray .68839 .82575 moveto .70604 .8113 lineto .70604 .77473 lineto .64549 .77473 lineto .64102 .77838 lineto fill grestore gsave 0.001 setlinewidth .68839 .82575 moveto .70604 .8113 lineto stroke grestore gsave .623 setgray .64102 .77838 moveto .64549 .77473 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .64102 .77838 moveto .64549 .77473 lineto stroke grestore gsave .459 setgray .70604 .84341 moveto .68839 .82575 lineto .65896 .84341 lineto fill grestore gsave .541 setgray .68839 .82575 moveto .65896 .84341 lineto .63736 .84341 lineto .63736 .78058 lineto .64102 .77838 lineto fill grestore gsave 0.001 setlinewidth .68839 .82575 moveto .65896 .84341 lineto stroke grestore gsave .623 setgray .64102 .77838 moveto .63736 .78058 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .64102 .77838 moveto .63736 .78058 lineto stroke grestore gsave .377 setgray .77473 .84341 moveto .76882 .8375 lineto .77473 .8293 lineto fill grestore gsave .459 setgray .76882 .8375 moveto .77473 .8293 lineto .77473 .77473 lineto .73823 .77473 lineto .72476 .79344 lineto fill grestore gsave 0.001 setlinewidth .76882 .8375 moveto .77473 .8293 lineto stroke grestore gsave .541 setgray .72476 .79344 moveto .73823 .77473 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .72476 .79344 moveto .73823 .77473 lineto stroke grestore gsave .377 setgray .77473 .84341 moveto .76882 .8375 lineto .76263 .84341 lineto fill grestore gsave .459 setgray .76882 .8375 moveto .76263 .84341 lineto .70604 .84341 lineto .70604 .8113 lineto .72476 .79344 lineto fill grestore gsave 0.001 setlinewidth .76882 .8375 moveto .76263 .84341 lineto stroke grestore gsave .541 setgray .72476 .79344 moveto .70604 .8113 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .72476 .79344 moveto .70604 .8113 lineto stroke grestore gsave .377 setgray .80449 .80449 moveto .82643 .77473 lineto .84341 .77473 lineto .84341 .84341 lineto fill grestore gsave .459 setgray .80449 .80449 moveto .82643 .77473 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .80449 .80449 moveto .82643 .77473 lineto stroke grestore gsave .377 setgray .80449 .80449 moveto .77473 .8293 lineto .77473 .84341 lineto .84341 .84341 lineto fill grestore gsave .459 setgray .80449 .80449 moveto .77473 .8293 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .80449 .80449 moveto .77473 .8293 lineto stroke grestore gsave .295 setgray .91209 .84341 moveto .90387 .83519 lineto .91209 .82399 lineto fill grestore gsave .377 setgray .90387 .83519 moveto .91209 .82399 lineto .91209 .77473 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .90387 .83519 moveto .91209 .82399 lineto stroke grestore gsave .295 setgray .91209 .84341 moveto .90387 .83519 lineto .89429 .84341 lineto fill grestore gsave .377 setgray .90387 .83519 moveto .89429 .84341 lineto .84341 .84341 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .90387 .83519 moveto .89429 .84341 lineto stroke grestore gsave .295 setgray .94061 .80324 moveto .9723 .77473 lineto .98077 .77473 lineto .98077 .84341 lineto fill grestore gsave .377 setgray .94061 .80324 moveto .9723 .77473 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .94061 .80324 moveto .9723 .77473 lineto stroke grestore gsave .295 setgray .94061 .80324 moveto .91209 .82399 lineto .91209 .84341 lineto .98077 .84341 lineto fill grestore gsave .377 setgray .94061 .80324 moveto .91209 .82399 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .94061 .80324 moveto .91209 .82399 lineto stroke grestore gsave .541 setgray 0.08791 .91209 moveto 0.07365 .89782 lineto 0.08791 .89604 lineto fill grestore gsave .623 setgray 0.07365 .89782 moveto 0.08791 .89604 lineto 0.08791 .84341 lineto 0.01923 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.07365 .89782 moveto 0.08791 .89604 lineto stroke grestore gsave .541 setgray 0.08791 .91209 moveto 0.07365 .89782 lineto 0.02371 .91209 lineto fill grestore gsave .623 setgray 0.07365 .89782 moveto 0.02371 .91209 lineto 0.01923 .91209 lineto 0.01923 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.07365 .89782 moveto 0.02371 .91209 lineto stroke grestore gsave .541 setgray .15659 .91209 moveto .15659 .88551 lineto .13002 .88551 lineto fill grestore gsave .623 setgray .15659 .88551 moveto .13002 .88551 lineto 0.08791 .84341 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .15659 .88551 moveto .13002 .88551 lineto stroke grestore gsave .541 setgray .13002 .88551 moveto 0.08791 .89604 lineto 0.08791 .91209 lineto .15659 .91209 lineto fill grestore gsave .623 setgray .13002 .88551 moveto 0.08791 .89604 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth .13002 .88551 moveto 0.08791 .89604 lineto stroke grestore gsave .541 setgray .22527 .91209 moveto .22527 .87579 lineto .18898 .87579 lineto fill grestore gsave .623 setgray .22527 .87579 moveto .18898 .87579 lineto .15659 .84341 lineto .22527 .84341 lineto fill grestore gsave 0.001 setlinewidth .22527 .87579 moveto .18898 .87579 lineto stroke grestore gsave .541 setgray .18898 .87579 moveto .15659 .88551 lineto .15659 .91209 lineto .22527 .91209 lineto fill grestore gsave .623 setgray .18898 .87579 moveto .15659 .88551 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .18898 .87579 moveto .15659 .88551 lineto stroke grestore gsave .541 setgray .29396 .91209 moveto .25004 .86817 lineto .29396 .86543 lineto fill grestore gsave .623 setgray .25004 .86817 moveto .29396 .86543 lineto .29396 .84341 lineto .22527 .84341 lineto fill grestore gsave 0.001 setlinewidth .25004 .86817 moveto .29396 .86543 lineto stroke grestore gsave .541 setgray .25004 .86817 moveto .22527 .87579 lineto .22527 .91209 lineto .29396 .91209 lineto fill grestore gsave .623 setgray .25004 .86817 moveto .22527 .87579 lineto .22527 .84341 lineto fill grestore gsave 0.001 setlinewidth .25004 .86817 moveto .22527 .87579 lineto stroke grestore gsave .541 setgray .36264 .91209 moveto .31157 .86102 lineto .36264 .85535 lineto fill grestore gsave .623 setgray .31157 .86102 moveto .36264 .85535 lineto .36264 .84341 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .31157 .86102 moveto .36264 .85535 lineto stroke grestore gsave .541 setgray .31157 .86102 moveto .29396 .86543 lineto .29396 .91209 lineto .36264 .91209 lineto fill grestore gsave .623 setgray .31157 .86102 moveto .29396 .86543 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .31157 .86102 moveto .29396 .86543 lineto stroke grestore gsave .541 setgray .43132 .91209 moveto .37241 .85318 lineto .43132 .84729 lineto fill grestore gsave .623 setgray .37241 .85318 moveto .43132 .84729 lineto .43132 .84341 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .37241 .85318 moveto .43132 .84729 lineto stroke grestore gsave .541 setgray .37241 .85318 moveto .36264 .85535 lineto .36264 .91209 lineto .43132 .91209 lineto fill grestore gsave .623 setgray .37241 .85318 moveto .36264 .85535 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .37241 .85318 moveto .36264 .85535 lineto stroke grestore gsave .541 setgray .43442 .84651 moveto .45073 .84341 lineto .5 .84341 lineto .5 .91209 lineto fill grestore gsave .623 setgray .43442 .84651 moveto .45073 .84341 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .43442 .84651 moveto .45073 .84341 lineto stroke grestore gsave .541 setgray .43442 .84651 moveto .43132 .84729 lineto .43132 .91209 lineto .5 .91209 lineto fill grestore gsave .623 setgray .43442 .84651 moveto .43132 .84729 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .43442 .84651 moveto .43132 .84729 lineto stroke grestore gsave .459 setgray .56868 .91209 moveto .55854 .90194 lineto .56868 .89738 lineto fill grestore gsave .541 setgray .55854 .90194 moveto .56868 .89738 lineto .56868 .84341 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .55854 .90194 moveto .56868 .89738 lineto stroke grestore gsave .459 setgray .56868 .91209 moveto .55854 .90194 lineto .53191 .91209 lineto fill grestore gsave .541 setgray .55854 .90194 moveto .53191 .91209 lineto .5 .91209 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .55854 .90194 moveto .53191 .91209 lineto stroke grestore gsave .459 setgray .63736 .91209 moveto .60466 .87939 lineto .63736 .86046 lineto fill grestore gsave .541 setgray .60466 .87939 moveto .63736 .86046 lineto .63736 .84341 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .60466 .87939 moveto .63736 .86046 lineto stroke grestore gsave .459 setgray .60466 .87939 moveto .56868 .89738 lineto .56868 .91209 lineto .63736 .91209 lineto fill grestore gsave .541 setgray .60466 .87939 moveto .56868 .89738 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .60466 .87939 moveto .56868 .89738 lineto stroke grestore gsave .459 setgray .64781 .85386 moveto .65896 .84341 lineto .70604 .84341 lineto .70604 .91209 lineto fill grestore gsave .541 setgray .64781 .85386 moveto .65896 .84341 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .64781 .85386 moveto .65896 .84341 lineto stroke grestore gsave .459 setgray .64781 .85386 moveto .63736 .86046 lineto .63736 .91209 lineto .70604 .91209 lineto fill grestore gsave .541 setgray .64781 .85386 moveto .63736 .86046 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .64781 .85386 moveto .63736 .86046 lineto stroke grestore gsave .377 setgray .741 .87836 moveto .76263 .84341 lineto .77473 .84341 lineto .77473 .91209 lineto fill grestore gsave .459 setgray .741 .87836 moveto .76263 .84341 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .741 .87836 moveto .76263 .84341 lineto stroke grestore gsave .377 setgray .77473 .91209 moveto .741 .87836 lineto .71102 .91209 lineto fill grestore gsave .459 setgray .741 .87836 moveto .71102 .91209 lineto .70604 .91209 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .741 .87836 moveto .71102 .91209 lineto stroke grestore gsave .295 setgray .84341 .91209 moveto .83783 .90651 lineto .84341 .89891 lineto fill grestore gsave .377 setgray .83783 .90651 moveto .84341 .89891 lineto .84341 .84341 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .83783 .90651 moveto .84341 .89891 lineto stroke grestore gsave .295 setgray .84341 .91209 moveto .83783 .90651 lineto .83226 .91209 lineto fill grestore gsave .377 setgray .83783 .90651 moveto .83226 .91209 lineto .77473 .91209 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .83783 .90651 moveto .83226 .91209 lineto stroke grestore gsave .295 setgray .87248 .87248 moveto .89429 .84341 lineto .91209 .84341 lineto .91209 .91209 lineto fill grestore gsave .377 setgray .87248 .87248 moveto .89429 .84341 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .87248 .87248 moveto .89429 .84341 lineto stroke grestore gsave .295 setgray .87248 .87248 moveto .84341 .89891 lineto .84341 .91209 lineto .91209 .91209 lineto fill grestore gsave .377 setgray .87248 .87248 moveto .84341 .89891 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .87248 .87248 moveto .84341 .89891 lineto stroke grestore gsave .295 setgray .98077 .91209 moveto .98077 .84341 lineto .91209 .84341 lineto fill grestore gsave .295 setgray .98077 .91209 moveto .91209 .91209 lineto .91209 .84341 lineto fill grestore gsave .541 setgray 0.02051 .91337 moveto 0.02371 .91209 lineto 0.08791 .91209 lineto 0.08791 .98077 lineto fill grestore gsave .623 setgray 0.02051 .91337 moveto 0.02371 .91209 lineto 0.01923 .91209 lineto fill grestore gsave 0.001 setlinewidth 0.02051 .91337 moveto 0.02371 .91209 lineto stroke grestore gsave .541 setgray 0.02051 .91337 moveto 0.01923 .91388 lineto 0.01923 .98077 lineto 0.08791 .98077 lineto fill grestore gsave .623 setgray 0.02051 .91337 moveto 0.01923 .91388 lineto 0.01923 .91209 lineto fill grestore gsave 0.001 setlinewidth 0.02051 .91337 moveto 0.01923 .91388 lineto stroke grestore gsave .541 setgray .15659 .98077 moveto .15659 .91209 lineto 0.08791 .91209 lineto fill grestore gsave .541 setgray .15659 .98077 moveto 0.08791 .98077 lineto 0.08791 .91209 lineto fill grestore gsave .541 setgray .22527 .98077 moveto .22527 .91209 lineto .15659 .91209 lineto fill grestore gsave .541 setgray .22527 .98077 moveto .15659 .98077 lineto .15659 .91209 lineto fill grestore gsave .541 setgray .29396 .98077 moveto .29396 .91209 lineto .22527 .91209 lineto fill grestore gsave .541 setgray .29396 .98077 moveto .22527 .98077 lineto .22527 .91209 lineto fill grestore gsave .459 setgray .36264 .98077 moveto .36149 .97963 lineto .36264 .97927 lineto fill grestore gsave .541 setgray .36149 .97963 moveto .36264 .97927 lineto .36264 .91209 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .36149 .97963 moveto .36264 .97927 lineto stroke grestore gsave .459 setgray .36264 .98077 moveto .36149 .97963 lineto .3594 .98077 lineto fill grestore gsave .541 setgray .36149 .97963 moveto .3594 .98077 lineto .29396 .98077 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .36149 .97963 moveto .3594 .98077 lineto stroke grestore gsave .459 setgray .43132 .98077 moveto .41116 .96061 lineto .43132 .95485 lineto fill grestore gsave .541 setgray .41116 .96061 moveto .43132 .95485 lineto .43132 .91209 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .41116 .96061 moveto .43132 .95485 lineto stroke grestore gsave .459 setgray .41116 .96061 moveto .36264 .97927 lineto .36264 .98077 lineto .43132 .98077 lineto fill grestore gsave .541 setgray .41116 .96061 moveto .36264 .97927 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .41116 .96061 moveto .36264 .97927 lineto stroke grestore gsave .459 setgray .5 .98077 moveto .46283 .9436 lineto .5 .93032 lineto fill grestore gsave .541 setgray .46283 .9436 moveto .5 .93032 lineto .5 .91209 lineto .43132 .91209 lineto fill grestore gsave 0.001 setlinewidth .46283 .9436 moveto .5 .93032 lineto stroke grestore gsave .459 setgray .46283 .9436 moveto .43132 .95485 lineto .43132 .98077 lineto .5 .98077 lineto fill grestore gsave .541 setgray .46283 .9436 moveto .43132 .95485 lineto .43132 .91209 lineto fill grestore gsave 0.001 setlinewidth .46283 .9436 moveto .43132 .95485 lineto stroke grestore gsave .459 setgray .5116 .92369 moveto .53191 .91209 lineto .56868 .91209 lineto .56868 .98077 lineto fill grestore gsave .541 setgray .5116 .92369 moveto .53191 .91209 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .5116 .92369 moveto .53191 .91209 lineto stroke grestore gsave .459 setgray .5116 .92369 moveto .5 .93032 lineto .5 .98077 lineto .56868 .98077 lineto fill grestore gsave .541 setgray .5116 .92369 moveto .5 .93032 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .5116 .92369 moveto .5 .93032 lineto stroke grestore gsave .459 setgray .63736 .98077 moveto .63736 .91209 lineto .56868 .91209 lineto fill grestore gsave .459 setgray .63736 .98077 moveto .56868 .98077 lineto .56868 .91209 lineto fill grestore gsave .377 setgray .70604 .98077 moveto .67543 .95016 lineto .70604 .91955 lineto fill grestore gsave .459 setgray .67543 .95016 moveto .70604 .91955 lineto .70604 .91209 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .67543 .95016 moveto .70604 .91955 lineto stroke grestore gsave .377 setgray .70604 .98077 moveto .67543 .95016 lineto .63926 .98077 lineto fill grestore gsave .459 setgray .67543 .95016 moveto .63926 .98077 lineto .63736 .98077 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .67543 .95016 moveto .63926 .98077 lineto stroke grestore gsave .377 setgray .70936 .9154 moveto .71102 .91209 lineto .77473 .91209 lineto .77473 .98077 lineto fill grestore gsave .459 setgray .70936 .9154 moveto .71102 .91209 lineto .70604 .91209 lineto fill grestore gsave 0.001 setlinewidth .70936 .9154 moveto .71102 .91209 lineto stroke grestore gsave .377 setgray .70936 .9154 moveto .70604 .91955 lineto .70604 .98077 lineto .77473 .98077 lineto fill grestore gsave .459 setgray .70936 .9154 moveto .70604 .91955 lineto .70604 .91209 lineto fill grestore gsave 0.001 setlinewidth .70936 .9154 moveto .70604 .91955 lineto stroke grestore gsave .295 setgray .81034 .9477 moveto .83226 .91209 lineto .84341 .91209 lineto .84341 .98077 lineto fill grestore gsave .377 setgray .81034 .9477 moveto .83226 .91209 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .81034 .9477 moveto .83226 .91209 lineto stroke grestore gsave .295 setgray .84341 .98077 moveto .81034 .9477 lineto .78554 .98077 lineto fill grestore gsave .377 setgray .81034 .9477 moveto .78554 .98077 lineto .77473 .98077 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .81034 .9477 moveto .78554 .98077 lineto stroke grestore gsave .295 setgray .91209 .98077 moveto .91209 .91209 lineto .84341 .91209 lineto fill grestore gsave .295 setgray .91209 .98077 moveto .84341 .98077 lineto .84341 .91209 lineto fill grestore gsave .295 setgray .98077 .98077 moveto .98077 .91209 lineto .91209 .91209 lineto fill grestore gsave .295 setgray .98077 .98077 moveto .91209 .98077 lineto .91209 .91209 lineto fill grestore grestore % End of Graphics MathPictureEnd end showpage %%EndDocument endTexFig -143 909 a 11840716 11248674 2302361 9143664 36311531 41771417 startTexFig -143 909 a %%BeginDocument: ya.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 11477 1048 2157 894 2157 1048 4021 894 4021 1048 5885 894 5885 1048 7749 894 7749 1048 9613 894 9613 1048 11477 894 11477 7 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 66 def /symbsiz 66 def /symbw 132 def /symbh 484 def /ori 107.22 def /showmark {plotsymb} def /symbary [0 0 66 158 -44 0 0 326 -44 0 0 -326 -44 0 66 -158] def % Arrow /fillcolor {0.0 0.0 0.0} def 2146 3559 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 75 def /symbsiz 75 def /symbw 150 def /symbh 552 def /ori 93.17 def /showmark {plotsymb} def /symbary [0 0 75 180 -50 0 0 372 -50 0 0 -372 -50 0 75 -180] def % Arrow /fillcolor {0.0 0.0 0.0} def 2034 7198 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 40 def /symbsiz 40 def /symbw 80 def /symbh 298 def /ori 108.28 def /showmark {plotsymb} def /symbary [0 0 40 95 -27 0 0 203 -26 0 0 -203 -27 0 40 -95] def % Arrow /fillcolor {0.0 0.0 0.0} def 2097 11194 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 76 def /symbsiz 76 def /symbw 152 def /symbh 562 def /ori 112.98 def /showmark {plotsymb} def /symbary [0 0 76 182 -51 0 0 380 -50 0 0 -380 -51 0 76 -182] def % Arrow /fillcolor {0.0 0.0 0.0} def 7813 3504 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 110 def /symbsiz 110 def /symbw 220 def /symbh 808 def /ori 102.11 def /showmark {plotsymb} def /symbary [0 0 110 263 -74 0 0 545 -72 0 0 -545 -74 0 110 -263] def % Arrow /fillcolor {0.0 0.0 0.0} def 7763 6959 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 8 def /symbsiz 8 def /symbw 16 def /symbh 56 def /ori 242.24 def /showmark {plotsymb} def /symbary [0 0 8 19 -6 0 0 37 -4 0 0 -37 -6 0 8 -19] def % Arrow /fillcolor {0.0 0.0 0.0} def 7620 11527 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 48 def /symbsiz 48 def /symbw 96 def /symbh 350 def /ori 73.15 def /showmark {plotsymb} def /symbary [0 0 48 115 -32 0 0 235 -32 0 0 -235 -32 0 48 -115] def % Arrow /fillcolor {0.0 0.0 0.0} def 13082 3686 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 109 def /symbsiz 109 def /symbw 218 def /symbh 804 def /ori 60.51 def /showmark {plotsymb} def /symbary [0 0 109 261 -73 0 0 543 -72 0 0 -543 -73 0 109 -261] def % Arrow /fillcolor {0.0 0.0 0.0} def 12788 7049 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 48 def /symbsiz 48 def /symbw 96 def /symbh 354 def /ori 43.11 def /showmark {plotsymb} def /symbary [0 0 48 115 -32 0 0 239 -32 0 0 -239 -32 0 48 -115] def % Arrow /fillcolor {0.0 0.0 0.0} def 12924 11234 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 253 def /symbsiz 253 def /symbw 506 def /symbh 780 def /ori 66.52 def /ratio 1.541502 def /showmark {doellipse} def 12924 11234 1 {showmark} repeat /patternw 217 def /symbsiz 217 def /symbw 434 def /symbh 586 def /ori 134.00 def /ratio 1.350230 def /showmark {doellipse} def 2146 3559 1 {showmark} repeat /patternw 242 def /symbsiz 242 def /symbw 484 def /symbh 822 def /ori 127.41 def /ratio 1.698347 def /showmark {doellipse} def 2034 7198 1 {showmark} repeat /patternw 244 def /symbsiz 244 def /symbw 488 def /symbh 866 def /ori 116.79 def /ratio 1.774590 def /showmark {doellipse} def 2097 11194 1 {showmark} repeat /patternw 254 def /symbsiz 254 def /symbw 508 def /symbh 580 def /ori 85.33 def /ratio 1.141732 def /showmark {doellipse} def 7813 3504 1 {showmark} repeat /patternw 224 def /symbsiz 224 def /symbw 448 def /symbh 648 def /ori 72.19 def /ratio 1.446429 def /showmark {doellipse} def 7763 6959 1 {showmark} repeat /patternw 246 def /symbsiz 246 def /symbw 492 def /symbh 904 def /ori 92.24 def /ratio 1.837398 def /showmark {doellipse} def 7620 11527 1 {showmark} repeat /patternw 231 def /symbsiz 231 def /symbw 462 def /symbh 630 def /ori 86.30 def /ratio 1.363636 def /showmark {doellipse} def 13082 3686 1 {showmark} repeat /patternw 225 def /symbsiz 225 def /symbw 450 def /symbh 840 def /ori 78.15 def /ratio 1.866667 def /showmark {doellipse} def 12788 7049 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -414 6864 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7725 -391 (X \(cm\)) sprnt /fontsiz 856 def /spacesiz 57 def /fontsiz 856 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -544 13204 (b\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4021 (25) sprnt 754 5885 (30) sprnt 754 7749 (35) sprnt 754 9613 (40) sprnt 754 11477 (45) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 623 901 a 11840716 11367081 2302361 9143664 36311531 41968762 startTexFig 623 901 a %%BeginDocument: yb.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2003 1263 13184 1263 2003 1263 2003 1110 3866 1263 3866 1110 5729 1263 5729 1110 7593 1263 7593 1110 9456 1263 9456 1110 11320 1263 11320 1110 13184 1263 13184 1110 8 dopairs 1048 2157 1048 11512 1048 2157 894 2157 1048 4028 894 4028 1048 5899 894 5899 1048 7770 894 7770 1048 9641 894 9641 1048 11512 894 11512 7 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 69 def /symbsiz 69 def /symbw 138 def /symbh 508 def /ori 104.01 def /showmark {plotsymb} def /symbary [0 0 69 165 -46 0 0 343 -46 0 0 -343 -46 0 69 -165] def % Arrow /fillcolor {0.0 0.0 0.0} def 2126 3534 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 70 def /symbsiz 70 def /symbw 140 def /symbh 514 def /ori 100.87 def /showmark {plotsymb} def /symbary [0 0 70 168 -47 0 0 346 -46 0 0 -346 -47 0 70 -168] def % Arrow /fillcolor {0.0 0.0 0.0} def 2100 5394 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 66 def /symbsiz 66 def /symbw 132 def /symbh 492 def /ori 98.68 def /showmark {plotsymb} def /symbary [0 0 66 158 -44 0 0 334 -44 0 0 -334 -44 0 66 -158] def % Arrow /fillcolor {0.0 0.0 0.0} def 2077 7283 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 57 def /symbsiz 57 def /symbw 114 def /symbh 424 def /ori 99.58 def /showmark {plotsymb} def /symbary [0 0 57 136 -38 0 0 288 -38 0 0 -288 -38 0 57 -136] def % Arrow /fillcolor {0.0 0.0 0.0} def 2074 9222 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 47 def /symbsiz 47 def /symbw 94 def /symbh 348 def /ori 102.30 def /showmark {plotsymb} def /symbary [0 0 47 112 -32 0 0 236 -30 0 0 -236 -32 0 47 -112] def % Arrow /fillcolor {0.0 0.0 0.0} def 2077 11171 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 72 def /symbsiz 72 def /symbw 144 def /symbh 534 def /ori 105.33 def /showmark {plotsymb} def /symbary [0 0 72 172 -48 0 0 362 -48 0 0 -362 -48 0 72 -172] def % Arrow /fillcolor {0.0 0.0 0.0} def 4008 3512 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 74 def /symbsiz 74 def /symbw 148 def /symbh 544 def /ori 102.34 def /showmark {plotsymb} def /symbary [0 0 74 177 -50 0 0 367 -48 0 0 -367 -50 0 74 -177] def % Arrow /fillcolor {0.0 0.0 0.0} def 3982 5368 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 69 def /symbsiz 69 def /symbw 138 def /symbh 512 def /ori 100.49 def /showmark {plotsymb} def /symbary [0 0 69 165 -46 0 0 347 -46 0 0 -347 -46 0 69 -165] def % Arrow /fillcolor {0.0 0.0 0.0} def 3960 7265 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 56 def /symbsiz 56 def /symbw 112 def /symbh 414 def /ori 100.91 def /showmark {plotsymb} def /symbary [0 0 56 134 -38 0 0 280 -36 0 0 -280 -38 0 56 -134] def % Arrow /fillcolor {0.0 0.0 0.0} def 3945 9233 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 42 def /symbsiz 42 def /symbw 84 def /symbh 308 def /ori 104.08 def /showmark {plotsymb} def /symbary [0 0 42 100 -28 0 0 208 -28 0 0 -208 -28 0 42 -100] def % Arrow /fillcolor {0.0 0.0 0.0} def 3941 11212 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 78 def /symbsiz 78 def /symbw 156 def /symbh 576 def /ori 107.28 def /showmark {plotsymb} def /symbary [0 0 78 187 -52 0 0 389 -52 0 0 -389 -52 0 78 -187] def % Arrow /fillcolor {0.0 0.0 0.0} def 5901 3478 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 80 def /symbsiz 80 def /symbw 160 def /symbh 590 def /ori 104.55 def /showmark {plotsymb} def /symbary [0 0 80 191 -54 0 0 399 -52 0 0 -399 -54 0 80 -191] def % Arrow /fillcolor {0.0 0.0 0.0} def 5879 5327 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 74 def /symbsiz 74 def /symbw 148 def /symbh 544 def /ori 102.25 def /showmark {plotsymb} def /symbary [0 0 74 177 -50 0 0 367 -48 0 0 -367 -50 0 74 -177] def % Arrow /fillcolor {0.0 0.0 0.0} def 5846 7239 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 55 def /symbsiz 55 def /symbw 110 def /symbh 402 def /ori 102.29 def /showmark {plotsymb} def /symbary [0 0 55 131 -37 0 0 271 -36 0 0 -271 -37 0 55 -131] def % Arrow /fillcolor {0.0 0.0 0.0} def 5816 9248 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 33 def /symbsiz 33 def /symbw 66 def /symbh 244 def /ori 104.93 def /showmark {plotsymb} def /symbary [0 0 33 79 -22 0 0 165 -22 0 0 -165 -22 0 33 -79] def % Arrow /fillcolor {0.0 0.0 0.0} def 5793 11276 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 79 def /symbsiz 79 def /symbw 158 def /symbh 584 def /ori 106.30 def /showmark {plotsymb} def /symbary [0 0 79 189 -53 0 0 395 -52 0 0 -395 -53 0 79 -189] def % Arrow /fillcolor {0.0 0.0 0.0} def 7758 3466 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 83 def /symbsiz 83 def /symbw 166 def /symbh 610 def /ori 103.06 def /showmark {plotsymb} def /symbary [0 0 83 199 -56 0 0 411 -54 0 0 -411 -56 0 83 -199] def % Arrow /fillcolor {0.0 0.0 0.0} def 7731 5304 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 76 def /symbsiz 76 def /symbw 152 def /symbh 560 def /ori 100.70 def /showmark {plotsymb} def /symbary [0 0 76 182 -51 0 0 378 -50 0 0 -378 -51 0 76 -182] def % Arrow /fillcolor {0.0 0.0 0.0} def 7697 7220 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 54 def /symbsiz 54 def /symbw 108 def /symbh 394 def /ori 99.80 def /showmark {plotsymb} def /symbary [0 0 54 129 -36 0 0 265 -36 0 0 -265 -36 0 54 -129] def % Arrow /fillcolor {0.0 0.0 0.0} def 7661 9251 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 29 def /symbsiz 29 def /symbw 58 def /symbh 212 def /ori 100.16 def /showmark {plotsymb} def /symbary [0 0 29 69 -20 0 0 143 -18 0 0 -143 -20 0 29 -69] def % Arrow /fillcolor {0.0 0.0 0.0} def 7631 11302 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 73 def /symbsiz 73 def /symbw 146 def /symbh 542 def /ori 98.72 def /showmark {plotsymb} def /symbary [0 0 73 175 -49 0 0 367 -48 0 0 -367 -49 0 73 -175] def % Arrow /fillcolor {0.0 0.0 0.0} def 9539 3492 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 78 def /symbsiz 78 def /symbw 156 def /symbh 578 def /ori 94.85 def /showmark {plotsymb} def /symbary [0 0 78 187 -52 0 0 391 -52 0 0 -391 -52 0 78 -187] def % Arrow /fillcolor {0.0 0.0 0.0} def 9505 5322 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 74 def /symbsiz 74 def /symbw 148 def /symbh 550 def /ori 90.82 def /showmark {plotsymb} def /symbary [0 0 74 177 -50 0 0 373 -48 0 0 -373 -50 0 74 -177] def % Arrow /fillcolor {0.0 0.0 0.0} def 9464 7220 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 55 def /symbsiz 55 def /symbw 110 def /symbh 408 def /ori 86.32 def /showmark {plotsymb} def /symbary [0 0 55 132 -37 0 0 276 -36 0 0 -276 -37 0 55 -132] def % Arrow /fillcolor {0.0 0.0 0.0} def 9430 9233 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 33 def /symbsiz 33 def /symbw 66 def /symbh 242 def /ori 79.46 def /showmark {plotsymb} def /symbary [0 0 33 79 -22 0 0 163 -22 0 0 -163 -22 0 33 -79] def % Arrow /fillcolor {0.0 0.0 0.0} def 9412 11272 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 65 def /symbsiz 65 def /symbw 130 def /symbh 482 def /ori 82.82 def /showmark {plotsymb} def /symbary [0 0 65 156 -44 0 0 326 -42 0 0 -326 -44 0 65 -156] def % Arrow /fillcolor {0.0 0.0 0.0} def 11260 3549 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 74 def /symbsiz 74 def /symbw 148 def /symbh 550 def /ori 78.28 def /showmark {plotsymb} def /symbary [0 0 74 177 -50 0 0 373 -48 0 0 -373 -50 0 74 -177] def % Arrow /fillcolor {0.0 0.0 0.0} def 11209 5360 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 76 def /symbsiz 76 def /symbw 152 def /symbh 562 def /ori 73.39 def /showmark {plotsymb} def /symbary [0 0 76 182 -51 0 0 380 -50 0 0 -380 -51 0 76 -182] def % Arrow /fillcolor {0.0 0.0 0.0} def 11160 7231 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 64 def /symbsiz 64 def /symbw 128 def /symbh 472 def /ori 67.75 def /showmark {plotsymb} def /symbary [0 0 64 153 -43 0 0 319 -42 0 0 -319 -43 0 64 -153] def % Arrow /fillcolor {0.0 0.0 0.0} def 11141 9203 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 48 def /symbsiz 48 def /symbw 96 def /symbh 354 def /ori 59.71 def /showmark {plotsymb} def /symbary [0 0 48 115 -32 0 0 239 -32 0 0 -239 -32 0 48 -115] def % Arrow /fillcolor {0.0 0.0 0.0} def 11141 11205 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 63 def /symbsiz 63 def /symbw 126 def /symbh 468 def /ori 71.97 def /showmark {plotsymb} def /symbary [0 0 63 151 -42 0 0 317 -42 0 0 -317 -42 0 63 -151] def % Arrow /fillcolor {0.0 0.0 0.0} def 13039 3582 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 75 def /symbsiz 75 def /symbw 150 def /symbh 552 def /ori 67.85 def /showmark {plotsymb} def /symbary [0 0 75 180 -50 0 0 372 -50 0 0 -372 -50 0 75 -180] def % Arrow /fillcolor {0.0 0.0 0.0} def 12975 5386 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 80 def /symbsiz 80 def /symbw 160 def /symbh 594 def /ori 63.51 def /showmark {plotsymb} def /symbary [0 0 80 191 -54 0 0 403 -52 0 0 -403 -54 0 80 -191] def % Arrow /fillcolor {0.0 0.0 0.0} def 12919 7239 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 72 def /symbsiz 72 def /symbw 144 def /symbh 534 def /ori 58.86 def /showmark {plotsymb} def /symbary [0 0 72 172 -48 0 0 362 -48 0 0 -362 -48 0 72 -172] def % Arrow /fillcolor {0.0 0.0 0.0} def 12908 9184 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 59 def /symbsiz 59 def /symbw 118 def /symbh 434 def /ori 53.08 def /showmark {plotsymb} def /symbary [0 0 59 141 -40 0 0 293 -38 0 0 -293 -40 0 59 -141] def % Arrow /fillcolor {0.0 0.0 0.0} def 12922 11164 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def -274 7060 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7689 -391 (X \(cm\)) sprnt /fontsiz 855 def /spacesiz 57 def /fontsiz 855 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -650 13275 (e\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 2003 970 (-10) sprnt 3866 970 (-5) sprnt 5729 970 (0) sprnt 7593 970 (5) sprnt 9456 970 (10) sprnt 11320 970 (15) sprnt 13184 970 (20) sprnt /txtpos [1.00 0.35] def 754 2157 (20) sprnt 754 4028 (25) sprnt 754 5899 (30) sprnt 754 7770 (35) sprnt 754 9641 (40) sprnt 754 11512 (45) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 1389 887 a 11367059 11594399 4736286 9867264 35522150 41442508 startTexFig 1389 887 a %%BeginDocument: yc.ps /Mathdict 100 dict def Mathdict begin /Mlmarg 1.0 72 mul def /Mrmarg 1.0 72 mul def /Mbmarg 1.0 72 mul def /Mtmarg 1.0 72 mul def /Mwidth 8.5 72 mul def /Mheight 11 72 mul def /Mtransform { } bind def /Mnodistort true def /Mfixwid false def /Mfixdash false def /Mrot 0 def /Mpstart { MathPictureStart } bind def /Mpend { MathPictureEnd } bind def /Mscale { 0 1 0 1 5 -1 roll MathScale } bind def /ISOLatin1Encoding dup where { pop pop } { [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def } ifelse /MFontDict 50 dict def /MStrCat { exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval } def /MCreateEncoding { 1 index 255 string cvs (-) MStrCat 1 index MStrCat cvn exch (Encoding) MStrCat cvn dup where { exch get } { pop StandardEncoding } ifelse 3 1 roll dup MFontDict exch known not { 1 index findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put } if exch pop exch pop } def /ISOLatin1 { (ISOLatin1) MCreateEncoding } def /ISO8859 { (ISOLatin1) MCreateEncoding } def /Mcopyfont { dup maxlength dict exch { 1 index /FID eq { pop pop } { 2 index 3 1 roll put } ifelse } forall } def /Plain /Helvetica findfont Mcopyfont definefont pop /Bold /Helvetica-Bold findfont Mcopyfont definefont pop /Italic /Helvetica-Oblique findfont Mcopyfont definefont pop /MathPictureStart { gsave Mtransform Mlmarg Mbmarg translate /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def } bind def /MathPictureEnd { grestore } bind def /MathSubStart { Momatrix Mgmatrix Mtmatrix Mlmarg Mrmarg Mbmarg Mtmarg Mwidth Mheight 11 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 13 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def } bind def /MathSubEnd { /Mheight exch def /Mwidth exch def /Mtmarg exch def /Mbmarg exch def /Mrmarg exch def /Mlmarg exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def } bind def /Mdot { moveto 0 0 rlineto stroke } bind def /Mtetra { moveto lineto lineto lineto fill } bind def /Metetra { moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke } bind def /Mistroke { flattenpath 0 0 0 { 4 2 roll pop pop } { 4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll } { stop } { stop } pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash } bind def /Mfstroke { stroke currentdash pop 0 setdash } bind def /Mrotsboxa { gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def } bind def /Msboxa { newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot [ 7 -2 roll 2 copy [ 3 1 roll 10 -1 roll 9 -1 roll ] 6 1 roll 5 -2 roll ] } bind def /Msboxa1 { sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul } bind def /Mvboxa { Mfixwid { Mvboxa1 } { dup Mwidthcal 0 exch { add } forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll } ifelse } bind def /Mvboxa1 { gsave newpath [ true 3 -1 roll { Mbbox 5 -1 roll { 0 5 1 roll } { 7 -1 roll exch sub (m) stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll } ifelse false } forall { stop } if counttomark 1 add 4 roll ] grestore } bind def /Mbbox { 1 dict begin 0 0 moveto /temp (T) def { gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto} forall pathbbox newpath end } bind def /Mmin { 2 copy gt { exch } if pop } bind def /Mmax { 2 copy lt { exch } if pop } bind def /Mrotshowa { dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def } bind def /Mshowa { 4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid { Mshowax } { Mshoway } ifelse pop pop pop pop Mgmatrix setmatrix } bind def /Mshowax { 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash { Mfixdashp } if show } for } bind def /Mfixdashp { dup length 1 gt 1 index true exch { 45 eq and } forall and { gsave (--) stringwidth pop (-) stringwidth pop sub 2 div 0 rmoveto dup length 1 sub { (-) show } repeat grestore } if } bind def /Mshoway { 3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get [ 6 index aload length 2 add -1 roll { pop Strform stringwidth pop neg exch add 0 rmoveto } exch kshow cleartomark } for pop } bind def /Mwidthcal { [ exch { Mwidthcal1 } forall ] [ exch dup Maxlen -1 add 0 1 3 -1 roll { [ exch 2 index { 1 index Mget exch } forall pop Maxget exch } for pop ] Mreva } bind def /Mreva { [ exch aload length -1 1 {1 roll} for ] } bind def /Mget { 1 index length -1 add 1 index ge { get } { pop pop 0 } ifelse } bind def /Maxlen { [ exch { length } forall Maxget } bind def /Maxget { counttomark -1 add 1 1 3 -1 roll { pop Mmax } for exch pop } bind def /Mwidthcal1 { [ exch { Strform stringwidth pop } forall ] } bind def /Strform { /tem (x) def tem 0 3 -1 roll put tem } bind def /Mshowa1 { 2 copy add 4 1 roll sub mul sub -2 div } bind def /MathScale { Mwidth Mlmarg Mrmarg add sub Mheight Mbmarg Mtmarg add sub 0 0 moveto 1 index 0 lineto 2 copy lineto 0 1 index lineto clip newpath Mlp translate dup /Mathabs exch def scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def } bind def /Mlp { 3 copy Mlpfirst { Mnodistort { Mmin dup } if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and { exit } if 3 -1 roll pop pop } loop exch 3 1 roll 7 -3 roll pop pop pop } bind def /Mlpfirst { 3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div } bind def /Mlprun { 2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll { 3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll } forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll } bind def /Mlprun1 { aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add } bind def /Mlprun2 { 2 copy add 2 div 3 1 roll exch sub } bind def /Mlpminmax { cvx 2 index 6 index 2 index exec { 7 -3 roll 4 -1 roll } if 1 index 5 index 3 -1 roll exec { 4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop [ 8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll ] 4 1 roll pop } { pop pop pop } ifelse } bind def /Mlp1 { 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not { 1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll } if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch } bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner { outflag 1 eq { /outflag 0 def /intop 0 def /inrht 0 def } if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt { /intop exch def } { pop } ifelse dup inrht gt { /inrht exch def } { pop } ifelse pop /inflag 1 def } bind def /Mouter { /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq { dup 0 lt { dup intop mul neg /yadtop exch def } if dup 0 gt { dup intop mul /yadbot exch def } if pop dup 0 lt { dup inrht mul neg /xadrht exch def } if dup 0 gt { dup inrht mul /xadlft exch def } if pop /outflag 1 def } { pop pop} ifelse /inflag 0 def /inrht 0 def /intop 0 def } bind def /Mboxout { outflag 1 eq { 4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def } if } bind def /leadjust { (m) stringwidth pop .5 mul } bind def /Mrotcheck { dup 90 eq { yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def } if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop } bind def /Checkaux { 4 index exch 4 index mul 3 1 roll mul add 4 1 roll } bind def /Mboxrot { Mrot 90 eq { brotaux 4 2 roll } if Mrot 180 eq { 4 2 roll brotaux 4 2 roll brotaux } if Mrot 270 eq { 4 2 roll brotaux } if } bind def /brotaux { neg exch neg } bind def /Mabswid { Mathabs div setlinewidth } bind def /Mabsdash { exch Mathabs [ 3 1 roll exch { exch dup 3 -1 roll exch div exch } forall pop ] exch setdash } bind def /MBeginOrig { Momatrix concat} bind def /MEndOrig { Mgmatrix setmatrix} bind def /colorimage where { pop } { /colorimage { 3 1 roll pop pop 5 -1 roll mul 4 1 roll { currentfile 1 index readhexstring pop } image } bind def } ifelse /sampledsound where { pop} { /sampledsound { exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def { Mtempproc pop} repeat } bind def } ifelse /setcmykcolor where { pop} { /setcmykcolor { 4 1 roll [ 4 1 roll ] { 1 index sub 1 sub neg dup 0 lt { pop 0 } if dup 1 gt { pop 1 } if exch } forall pop setrgbcolor } bind def } ifelse MathPictureStart /Helvetica findfont 25 scalefont setfont % Scaling calculations 0.00320513 0.0160256 -0.00480769 0.0240385 [ [(-10)] 0.03526 0 0 2 0 Minner Mrotsboxa [(0)] .32372 0 0 2 0 Minner Mrotsboxa [(10)] .64423 0 0 2 0 Minner Mrotsboxa [(20)] .96474 0 0 2 0 Minner Mrotsboxa [(X \(cm\))] .5 0.07 0 2 0 0 -1 Mouter Mrotsboxa [(25)] -0.0125 0.04327 1 0 0 Minner Mrotsboxa [(30)] -0.0125 .47596 1 0 0 Minner Mrotsboxa [(45)] -0.0125 .95673 1 0 0 Minner Mrotsboxa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotsboxa [(h\) )] .12 0.93 0 -4 Msboxa [ -0.001 -0.001 0 0 ] [ 1.001 1.001 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 setgray gsave gsave gsave 0.002 setlinewidth 0.03526 0 moveto 0.03526 0.00625 lineto stroke grestore [(-10)] 0.03526 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .32372 0 moveto .32372 0.00625 lineto stroke grestore [(0)] .32372 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .64423 0 moveto .64423 0.00625 lineto stroke grestore [(10)] .64423 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .96474 0 moveto .96474 0.00625 lineto stroke grestore [(20)] .96474 0 0 2 0 Minner Mrotshowa [(X \(cm\))] .5 0.07 0 2 0 0 -1 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 1 0 lineto stroke grestore gsave 0.002 setlinewidth 0 0.04327 moveto 0.00625 0.04327 lineto stroke grestore [(25)] -0.0125 0.04327 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .47596 moveto 0.00625 .47596 lineto stroke grestore [(30)] -0.0125 .47596 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .95673 moveto 0.00625 .95673 lineto stroke grestore [(45)] -0.0125 .95673 1 0 0 Minner Mrotshowa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 0 1 lineto stroke grestore grestore gsave gsave 0.002 setlinewidth 0.03526 .99375 moveto 0.03526 1 lineto stroke grestore gsave 0.002 setlinewidth .32372 .99375 moveto .32372 1 lineto stroke grestore gsave 0.002 setlinewidth .64423 .99375 moveto .64423 1 lineto stroke grestore gsave 0.002 setlinewidth .96474 .99375 moveto .96474 1 lineto stroke grestore [(h\) )] .12 0.93 0 -4 Mshowa gsave 0.002 setlinewidth 0 1 moveto 1 1 lineto stroke grestore gsave 0.002 setlinewidth .99375 0.04327 moveto 1 0.04327 lineto stroke grestore gsave 0.002 setlinewidth .99375 .47596 moveto 1 .47596 lineto stroke grestore gsave 0.002 setlinewidth .99375 .95673 moveto 1 .95673 lineto stroke grestore gsave 0.002 setlinewidth 1 0 moveto 1 1 lineto stroke grestore grestore gsave grestore grestore 0 0 moveto 1 0 lineto 1 1 lineto 0 1 lineto closepath clip newpath gsave gsave .623 setgray 0.01923 0.01923 moveto 0.04476 0.04476 lineto 0.05752 0.01923 lineto fill grestore gsave .704 setgray 0.04476 0.04476 moveto 0.05752 0.01923 lineto 0.08791 0.01923 lineto 0.08791 0.08791 lineto fill grestore gsave 0.001 setlinewidth 0.04476 0.04476 moveto 0.05752 0.01923 lineto stroke grestore gsave .623 setgray 0.04476 0.04476 moveto 0.02318 0.08791 lineto 0.01923 0.08791 lineto 0.01923 0.01923 lineto fill grestore gsave .704 setgray 0.04476 0.04476 moveto 0.02318 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave 0.001 setlinewidth 0.04476 0.04476 moveto 0.02318 0.08791 lineto stroke grestore gsave .704 setgray 0.08791 0.01923 moveto .15659 0.01923 lineto .15659 0.08791 lineto fill grestore gsave .704 setgray 0.08791 0.01923 moveto 0.08791 0.08791 lineto .15659 0.08791 lineto fill grestore gsave .704 setgray .15659 0.01923 moveto .22527 0.01923 lineto .22527 0.08791 lineto fill grestore gsave .704 setgray .15659 0.01923 moveto .15659 0.08791 lineto .22527 0.08791 lineto fill grestore gsave .704 setgray .22527 0.01923 moveto .25464 0.04859 lineto .26051 0.01923 lineto fill grestore gsave .786 setgray .25464 0.04859 moveto .26051 0.01923 lineto .29396 0.01923 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .25464 0.04859 moveto .26051 0.01923 lineto stroke grestore gsave .704 setgray .25464 0.04859 moveto .24677 0.08791 lineto .22527 0.08791 lineto .22527 0.01923 lineto fill grestore gsave .786 setgray .25464 0.04859 moveto .24677 0.08791 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .25464 0.04859 moveto .24677 0.08791 lineto stroke grestore gsave .786 setgray .29396 0.01923 moveto .36264 0.01923 lineto .36264 0.08791 lineto fill grestore gsave .786 setgray .29396 0.01923 moveto .29396 0.08791 lineto .36264 0.08791 lineto fill grestore gsave .786 setgray .36264 0.01923 moveto .43132 0.01923 lineto .43132 0.08791 lineto fill grestore gsave .786 setgray .36264 0.01923 moveto .36264 0.08791 lineto .43132 0.08791 lineto fill grestore gsave .786 setgray .47745 0.06536 moveto .5 0.06536 lineto .5 0.01923 lineto .43132 0.01923 lineto fill grestore gsave .868 setgray .47745 0.06536 moveto .5 0.06536 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .47745 0.06536 moveto .5 0.06536 lineto stroke grestore gsave .786 setgray .47745 0.06536 moveto .43235 0.08791 lineto .43132 0.08791 lineto .43132 0.01923 lineto fill grestore gsave .868 setgray .47745 0.06536 moveto .43235 0.08791 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .47745 0.06536 moveto .43235 0.08791 lineto stroke grestore gsave .786 setgray .56868 0.01923 moveto .5 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .786 setgray .5 0.06536 moveto .53383 0.08791 lineto .56868 0.08791 lineto .5 0.01923 lineto fill grestore gsave .868 setgray .5 0.06536 moveto .53383 0.08791 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .5 0.06536 moveto .53383 0.08791 lineto stroke grestore gsave .786 setgray .63736 0.01923 moveto .63736 0.08791 lineto .56868 0.01923 lineto fill grestore gsave .786 setgray .63736 0.08791 moveto .56868 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .704 setgray .70604 0.01923 moveto .67081 0.01923 lineto .70604 0.07795 lineto fill grestore gsave .786 setgray .67081 0.01923 moveto .70604 0.07795 lineto .70604 0.08791 lineto .63736 0.01923 lineto fill grestore gsave 0.001 setlinewidth .67081 0.01923 moveto .70604 0.07795 lineto stroke grestore gsave .786 setgray .70604 0.08791 moveto .63736 0.01923 lineto .63736 0.08791 lineto fill grestore gsave .623 setgray .77473 0.01923 moveto .76515 0.01923 lineto .77473 0.03838 lineto fill grestore gsave .704 setgray .76515 0.01923 moveto .77473 0.03838 lineto .77473 0.08791 lineto .70604 0.01923 lineto fill grestore gsave 0.001 setlinewidth .76515 0.01923 moveto .77473 0.03838 lineto stroke grestore gsave .704 setgray .71031 0.08791 moveto .70604 0.07795 lineto .70604 0.01923 lineto .77473 0.08791 lineto fill grestore gsave .786 setgray .71031 0.08791 moveto .70604 0.07795 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .71031 0.08791 moveto .70604 0.07795 lineto stroke grestore gsave .623 setgray .84341 0.01923 moveto .84341 0.08791 lineto .77473 0.01923 lineto fill grestore gsave .623 setgray .80775 0.08791 moveto .77473 0.03838 lineto .77473 0.01923 lineto .84341 0.08791 lineto fill grestore gsave .704 setgray .80775 0.08791 moveto .77473 0.03838 lineto .77473 0.08791 lineto fill grestore gsave 0.001 setlinewidth .80775 0.08791 moveto .77473 0.03838 lineto stroke grestore gsave .541 setgray .91209 0.01923 moveto .88922 0.01923 lineto .91209 0.04782 lineto fill grestore gsave .623 setgray .88922 0.01923 moveto .91209 0.04782 lineto .91209 0.08791 lineto .84341 0.01923 lineto fill grestore gsave 0.001 setlinewidth .88922 0.01923 moveto .91209 0.04782 lineto stroke grestore gsave .623 setgray .91209 0.08791 moveto .84341 0.01923 lineto .84341 0.08791 lineto fill grestore gsave .541 setgray .98077 0.01923 moveto .91209 0.01923 lineto .98077 0.08791 lineto fill grestore gsave .541 setgray .91209 0.04782 moveto .96554 0.08791 lineto .98077 0.08791 lineto .91209 0.01923 lineto fill grestore gsave .623 setgray .91209 0.04782 moveto .96554 0.08791 lineto .91209 0.08791 lineto fill grestore gsave 0.001 setlinewidth .91209 0.04782 moveto .96554 0.08791 lineto stroke grestore gsave .623 setgray 0.01923 0.08791 moveto 0.02186 0.09054 lineto 0.02318 0.08791 lineto fill grestore gsave .704 setgray 0.02186 0.09054 moveto 0.02318 0.08791 lineto 0.08791 0.08791 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.02186 0.09054 moveto 0.02318 0.08791 lineto stroke grestore gsave .623 setgray 0.01923 0.08791 moveto 0.02186 0.09054 lineto 0.01923 0.09581 lineto fill grestore gsave .704 setgray 0.02186 0.09054 moveto 0.01923 0.09581 lineto 0.01923 .15659 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.02186 0.09054 moveto 0.01923 0.09581 lineto stroke grestore gsave .704 setgray 0.08791 0.08791 moveto .15659 0.08791 lineto .15659 .15659 lineto fill grestore gsave .704 setgray 0.08791 0.08791 moveto 0.08791 .15659 lineto .15659 .15659 lineto fill grestore gsave .704 setgray .2203 .15161 moveto .22527 .14166 lineto .22527 0.08791 lineto .15659 0.08791 lineto fill grestore gsave .786 setgray .2203 .15161 moveto .22527 .14166 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .2203 .15161 moveto .22527 .14166 lineto stroke grestore gsave .704 setgray .2203 .15161 moveto .21781 .15659 lineto .15659 .15659 lineto .15659 0.08791 lineto fill grestore gsave .786 setgray .2203 .15161 moveto .21781 .15659 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .2203 .15161 moveto .21781 .15659 lineto stroke grestore gsave .704 setgray .22527 0.08791 moveto .24063 .10327 lineto .24677 0.08791 lineto fill grestore gsave .786 setgray .24063 .10327 moveto .24677 0.08791 lineto .29396 0.08791 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .24063 .10327 moveto .24677 0.08791 lineto stroke grestore gsave .704 setgray .22527 0.08791 moveto .24063 .10327 lineto .22527 .14166 lineto fill grestore gsave .786 setgray .24063 .10327 moveto .22527 .14166 lineto .22527 .15659 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .24063 .10327 moveto .22527 .14166 lineto stroke grestore gsave .786 setgray .29396 0.08791 moveto .36264 0.08791 lineto .36264 .15659 lineto fill grestore gsave .786 setgray .29396 0.08791 moveto .29396 .15659 lineto .36264 .15659 lineto fill grestore gsave .786 setgray .39032 .11559 moveto .43132 0.08826 lineto .43132 0.08791 lineto .36264 0.08791 lineto fill grestore gsave .868 setgray .39032 .11559 moveto .43132 0.08826 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .39032 .11559 moveto .43132 0.08826 lineto stroke grestore gsave .786 setgray .39032 .11559 moveto .36298 .15659 lineto .36264 .15659 lineto .36264 0.08791 lineto fill grestore gsave .868 setgray .39032 .11559 moveto .36298 .15659 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .39032 .11559 moveto .36298 .15659 lineto stroke grestore gsave .786 setgray .43132 0.08791 moveto .43158 0.08817 lineto .43235 0.08791 lineto fill grestore gsave .868 setgray .43158 0.08817 moveto .43235 0.08791 lineto .5 0.08791 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .43158 0.08817 moveto .43235 0.08791 lineto stroke grestore gsave .786 setgray .43132 0.08791 moveto .43158 0.08817 lineto .43132 0.08826 lineto fill grestore gsave .868 setgray .43158 0.08817 moveto .43132 0.08826 lineto .43132 .15659 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .43158 0.08817 moveto .43132 0.08826 lineto stroke grestore gsave .786 setgray .56868 0.08791 moveto .56868 .11115 lineto .53383 0.08791 lineto fill grestore gsave .868 setgray .56868 .11115 moveto .53383 0.08791 lineto .5 0.08791 lineto .56868 .15659 lineto fill grestore gsave 0.001 setlinewidth .56868 .11115 moveto .53383 0.08791 lineto stroke grestore gsave .868 setgray .5 0.08791 moveto .56868 .15659 lineto .5 .15659 lineto fill grestore gsave .786 setgray .63736 0.08791 moveto .56868 0.08791 lineto .63736 .15659 lineto fill grestore gsave .786 setgray .61413 .15659 moveto .56868 .11115 lineto .56868 0.08791 lineto .63736 .15659 lineto fill grestore gsave .868 setgray .61413 .15659 moveto .56868 .11115 lineto .56868 .15659 lineto fill grestore gsave 0.001 setlinewidth .61413 .15659 moveto .56868 .11115 lineto stroke grestore gsave .786 setgray .70604 0.08791 moveto .70604 .15659 lineto .63736 0.08791 lineto fill grestore gsave .786 setgray .70604 .15659 moveto .63736 0.08791 lineto .63736 .15659 lineto fill grestore gsave .704 setgray .71031 0.08791 moveto .716 0.09787 lineto .77473 .15659 lineto .77473 0.08791 lineto fill grestore gsave .786 setgray .71031 0.08791 moveto .716 0.09787 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .71031 0.08791 moveto .716 0.09787 lineto stroke grestore gsave .704 setgray .77473 .15659 moveto .74956 .15659 lineto .716 0.09787 lineto fill grestore gsave .786 setgray .74956 .15659 moveto .716 0.09787 lineto .70604 0.08791 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .74956 .15659 moveto .716 0.09787 lineto stroke grestore gsave .623 setgray .84341 0.08791 moveto .80775 0.08791 lineto .84341 .1307 lineto fill grestore gsave .704 setgray .80775 0.08791 moveto .84341 .1307 lineto .84341 .15659 lineto .77473 0.08791 lineto fill grestore gsave 0.001 setlinewidth .80775 0.08791 moveto .84341 .1307 lineto stroke grestore gsave .704 setgray .84341 .15659 moveto .77473 0.08791 lineto .77473 .15659 lineto fill grestore gsave .623 setgray .91209 0.08791 moveto .84341 0.08791 lineto .91209 .15659 lineto fill grestore gsave .623 setgray .84341 .1307 moveto .87577 .15659 lineto .91209 .15659 lineto .84341 0.08791 lineto fill grestore gsave .704 setgray .84341 .1307 moveto .87577 .15659 lineto .84341 .15659 lineto fill grestore gsave 0.001 setlinewidth .84341 .1307 moveto .87577 .15659 lineto stroke grestore gsave .541 setgray .98077 0.08791 moveto .98077 0.09552 lineto .96554 0.08791 lineto fill grestore gsave .623 setgray .98077 0.09552 moveto .96554 0.08791 lineto .91209 0.08791 lineto .98077 .15659 lineto fill grestore gsave 0.001 setlinewidth .98077 0.09552 moveto .96554 0.08791 lineto stroke grestore gsave .623 setgray .91209 0.08791 moveto .98077 .15659 lineto .91209 .15659 lineto fill grestore gsave .704 setgray 0.01923 .15659 moveto 0.08791 .15659 lineto 0.08791 .22527 lineto fill grestore gsave .704 setgray 0.01923 .15659 moveto 0.01923 .22527 lineto 0.08791 .22527 lineto fill grestore gsave .704 setgray 0.08791 .15659 moveto .15659 .15659 lineto .15659 .22527 lineto fill grestore gsave .704 setgray 0.08791 .15659 moveto 0.08791 .22527 lineto .15659 .22527 lineto fill grestore gsave .704 setgray .15659 .15659 moveto .20556 .20556 lineto .21781 .15659 lineto fill grestore gsave .786 setgray .20556 .20556 moveto .21781 .15659 lineto .22527 .15659 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .20556 .20556 moveto .21781 .15659 lineto stroke grestore gsave .704 setgray .20556 .20556 moveto .20064 .22527 lineto .15659 .22527 lineto .15659 .15659 lineto fill grestore gsave .786 setgray .20556 .20556 moveto .20064 .22527 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .20556 .20556 moveto .20064 .22527 lineto stroke grestore gsave .786 setgray .22527 .15659 moveto .29396 .15659 lineto .29396 .22527 lineto fill grestore gsave .786 setgray .22527 .15659 moveto .22527 .22527 lineto .29396 .22527 lineto fill grestore gsave .786 setgray .33992 .20255 moveto .36264 .15711 lineto .36264 .15659 lineto .29396 .15659 lineto fill grestore gsave .868 setgray .33992 .20255 moveto .36264 .15711 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .33992 .20255 moveto .36264 .15711 lineto stroke grestore gsave .786 setgray .33992 .20255 moveto .32855 .22527 lineto .29396 .22527 lineto .29396 .15659 lineto fill grestore gsave .868 setgray .33992 .20255 moveto .32855 .22527 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .33992 .20255 moveto .32855 .22527 lineto stroke grestore gsave .786 setgray .36264 .15659 moveto .36284 .1568 lineto .36298 .15659 lineto fill grestore gsave .868 setgray .36284 .1568 moveto .36298 .15659 lineto .43132 .15659 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .36284 .1568 moveto .36298 .15659 lineto stroke grestore gsave .786 setgray .36264 .15659 moveto .36284 .1568 lineto .36264 .15711 lineto fill grestore gsave .868 setgray .36284 .1568 moveto .36264 .15711 lineto .36264 .22527 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .36284 .1568 moveto .36264 .15711 lineto stroke grestore gsave .868 setgray .43132 .15659 moveto .5 .15659 lineto .5 .22527 lineto fill grestore gsave .868 setgray .43132 .15659 moveto .43132 .22527 lineto .5 .22527 lineto fill grestore gsave .868 setgray .56868 .15659 moveto .5 .15659 lineto .56868 .22527 lineto fill grestore gsave .868 setgray .5 .15659 moveto .56868 .22527 lineto .5 .22527 lineto fill grestore gsave .786 setgray .63736 .15659 moveto .63736 .17983 lineto .61413 .15659 lineto fill grestore gsave .868 setgray .63736 .17983 moveto .61413 .15659 lineto .56868 .15659 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .63736 .17983 moveto .61413 .15659 lineto stroke grestore gsave .868 setgray .63736 .22527 moveto .56868 .15659 lineto .56868 .22527 lineto fill grestore gsave .786 setgray .70604 .15659 moveto .70604 .22527 lineto .63736 .15659 lineto fill grestore gsave .786 setgray .67145 .22527 moveto .63736 .17983 lineto .63736 .15659 lineto .70604 .22527 lineto fill grestore gsave .868 setgray .67145 .22527 moveto .63736 .17983 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .67145 .22527 moveto .63736 .17983 lineto stroke grestore gsave .704 setgray .77473 .15659 moveto .74956 .15659 lineto .77473 .20064 lineto fill grestore gsave .786 setgray .74956 .15659 moveto .77473 .20064 lineto .77473 .22527 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .74956 .15659 moveto .77473 .20064 lineto stroke grestore gsave .786 setgray .77473 .22527 moveto .70604 .15659 lineto .70604 .22527 lineto fill grestore gsave .704 setgray .84341 .15659 moveto .77473 .15659 lineto .84341 .22527 lineto fill grestore gsave .704 setgray .79936 .22527 moveto .77473 .20064 lineto .77473 .15659 lineto .84341 .22527 lineto fill grestore gsave .786 setgray .79936 .22527 moveto .77473 .20064 lineto .77473 .22527 lineto fill grestore gsave 0.001 setlinewidth .79936 .22527 moveto .77473 .20064 lineto stroke grestore gsave .623 setgray .91209 .15659 moveto .91209 .18565 lineto .87577 .15659 lineto fill grestore gsave .704 setgray .91209 .18565 moveto .87577 .15659 lineto .84341 .15659 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .18565 moveto .87577 .15659 lineto stroke grestore gsave .704 setgray .84341 .15659 moveto .91209 .22527 lineto .84341 .22527 lineto fill grestore gsave .623 setgray .98077 .21312 moveto .96051 .20501 lineto .91209 .15659 lineto .98077 .15659 lineto fill grestore gsave .704 setgray .98077 .21312 moveto .96051 .20501 lineto .98077 .22527 lineto fill grestore gsave 0.001 setlinewidth .98077 .21312 moveto .96051 .20501 lineto stroke grestore gsave .623 setgray .91209 .15659 moveto .91209 .18565 lineto .96051 .20501 lineto fill grestore gsave .704 setgray .91209 .18565 moveto .96051 .20501 lineto .98077 .22527 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .18565 moveto .96051 .20501 lineto stroke grestore gsave .704 setgray 0.01923 .22527 moveto 0.08791 .22527 lineto 0.08791 .29396 lineto fill grestore gsave .704 setgray 0.01923 .29396 moveto 0.01923 .22527 lineto 0.08791 .29396 lineto fill grestore gsave .704 setgray 0.08791 .22527 moveto .15659 .22527 lineto .15659 .29396 lineto fill grestore gsave .704 setgray 0.08791 .29396 moveto 0.08791 .22527 lineto .15659 .29396 lineto fill grestore gsave .704 setgray .15659 .22527 moveto .20064 .26932 lineto .20064 .22527 lineto fill grestore gsave .786 setgray .20064 .26932 moveto .20064 .22527 lineto .22527 .22527 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .20064 .26932 moveto .20064 .22527 lineto stroke grestore gsave .704 setgray .20064 .29396 moveto .20064 .26932 lineto .15659 .22527 lineto .15659 .29396 lineto fill grestore gsave .786 setgray .20064 .29396 moveto .20064 .26932 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .20064 .29396 moveto .20064 .26932 lineto stroke grestore gsave .786 setgray .22527 .22527 moveto .29396 .22527 lineto .29396 .29396 lineto fill grestore gsave .786 setgray .22527 .29396 moveto .22527 .22527 lineto .29396 .29396 lineto fill grestore gsave .786 setgray .29396 .22527 moveto .32855 .25987 lineto .32855 .22527 lineto fill grestore gsave .868 setgray .32855 .25987 moveto .32855 .22527 lineto .36264 .22527 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .32855 .25987 moveto .32855 .22527 lineto stroke grestore gsave .786 setgray .32855 .29396 moveto .32855 .25987 lineto .29396 .22527 lineto .29396 .29396 lineto fill grestore gsave .868 setgray .32855 .29396 moveto .32855 .25987 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .32855 .29396 moveto .32855 .25987 lineto stroke grestore gsave .868 setgray .36264 .22527 moveto .43132 .22527 lineto .43132 .29396 lineto fill grestore gsave .868 setgray .36264 .29396 moveto .36264 .22527 lineto .43132 .29396 lineto fill grestore gsave .868 setgray .43132 .22527 moveto .5 .22527 lineto .5 .29396 lineto fill grestore gsave .868 setgray .43132 .29396 moveto .43132 .22527 lineto .5 .29396 lineto fill grestore gsave .868 setgray .56868 .22527 moveto .5 .22527 lineto .56868 .29396 lineto fill grestore gsave .868 setgray .56868 .29396 moveto .5 .22527 lineto .5 .29396 lineto fill grestore gsave .868 setgray .63736 .22527 moveto .63736 .29396 lineto .56868 .22527 lineto fill grestore gsave .868 setgray .63736 .29396 moveto .56868 .22527 lineto .56868 .29396 lineto fill grestore gsave .786 setgray .70604 .22527 moveto .67145 .22527 lineto .70604 .27141 lineto fill grestore gsave .868 setgray .67145 .22527 moveto .70604 .27141 lineto .70604 .29396 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .67145 .22527 moveto .70604 .27141 lineto stroke grestore gsave .868 setgray .70604 .29396 moveto .63736 .22527 lineto .63736 .29396 lineto fill grestore gsave .786 setgray .77473 .22527 moveto .77473 .29396 lineto .70604 .22527 lineto fill grestore gsave .786 setgray .71957 .29396 moveto .70604 .27141 lineto .70604 .22527 lineto .77473 .29396 lineto fill grestore gsave .868 setgray .71957 .29396 moveto .70604 .27141 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .71957 .29396 moveto .70604 .27141 lineto stroke grestore gsave .704 setgray .84341 .22527 moveto .84341 .26932 lineto .79936 .22527 lineto fill grestore gsave .786 setgray .84341 .26932 moveto .79936 .22527 lineto .77473 .22527 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .26932 moveto .79936 .22527 lineto stroke grestore gsave .786 setgray .84341 .29396 moveto .77473 .22527 lineto .77473 .29396 lineto fill grestore gsave .704 setgray .91209 .22527 moveto .84341 .22527 lineto .91209 .29396 lineto fill grestore gsave .704 setgray .84341 .26932 moveto .87626 .29396 lineto .91209 .29396 lineto .84341 .22527 lineto fill grestore gsave .786 setgray .84341 .26932 moveto .87626 .29396 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .26932 moveto .87626 .29396 lineto stroke grestore gsave .704 setgray .98077 .22527 moveto .91209 .22527 lineto .98077 .29396 lineto fill grestore gsave .704 setgray .91209 .22527 moveto .98077 .29396 lineto .91209 .29396 lineto fill grestore gsave .704 setgray 0.01923 .29396 moveto 0.08791 .36264 lineto 0.08791 .29396 lineto fill grestore gsave .704 setgray 0.01923 .36264 moveto 0.01923 .29396 lineto 0.08791 .36264 lineto fill grestore gsave .704 setgray 0.08791 .29396 moveto .15659 .36264 lineto .15659 .29396 lineto fill grestore gsave .704 setgray 0.08791 .36264 moveto 0.08791 .29396 lineto .15659 .36264 lineto fill grestore gsave .704 setgray .15659 .29396 moveto .20064 .29396 lineto .21532 .35268 lineto fill grestore gsave .786 setgray .20064 .29396 moveto .21532 .35268 lineto .22527 .36264 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .20064 .29396 moveto .21532 .35268 lineto stroke grestore gsave .704 setgray .21781 .36264 moveto .21532 .35268 lineto .15659 .29396 lineto .15659 .36264 lineto fill grestore gsave .786 setgray .21781 .36264 moveto .21532 .35268 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .21781 .36264 moveto .21532 .35268 lineto stroke grestore gsave .786 setgray .22527 .29396 moveto .29396 .36264 lineto .29396 .29396 lineto fill grestore gsave .786 setgray .22527 .36264 moveto .22527 .29396 lineto .29396 .36264 lineto fill grestore gsave .786 setgray .29396 .29396 moveto .32855 .29396 lineto .34009 .34009 lineto fill grestore gsave .868 setgray .32855 .29396 moveto .34009 .34009 lineto .36264 .36264 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .32855 .29396 moveto .34009 .34009 lineto stroke grestore gsave .786 setgray .34572 .36264 moveto .34009 .34009 lineto .29396 .29396 lineto .29396 .36264 lineto fill grestore gsave .868 setgray .34572 .36264 moveto .34009 .34009 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .34572 .36264 moveto .34009 .34009 lineto stroke grestore gsave .868 setgray .36264 .29396 moveto .43132 .36264 lineto .43132 .29396 lineto fill grestore gsave .868 setgray .36264 .36264 moveto .36264 .29396 lineto .43132 .36264 lineto fill grestore gsave .868 setgray .43132 .29396 moveto .5 .36264 lineto .5 .29396 lineto fill grestore gsave .868 setgray .43132 .36264 moveto .43132 .29396 lineto .5 .36264 lineto fill grestore gsave .868 setgray .56868 .36264 moveto .56868 .29396 lineto .5 .29396 lineto fill grestore gsave .868 setgray .56868 .36264 moveto .5 .36264 lineto .5 .29396 lineto fill grestore gsave .868 setgray .63736 .29396 moveto .63736 .36264 lineto .56868 .29396 lineto fill grestore gsave .868 setgray .63736 .36264 moveto .56868 .36264 lineto .56868 .29396 lineto fill grestore gsave .868 setgray .70604 .29396 moveto .70604 .36264 lineto .63736 .29396 lineto fill grestore gsave .868 setgray .70604 .36264 moveto .63736 .36264 lineto .63736 .29396 lineto fill grestore gsave .786 setgray .71957 .29396 moveto .72296 .31087 lineto .77473 .36264 lineto .77473 .29396 lineto fill grestore gsave .868 setgray .71957 .29396 moveto .72296 .31087 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .71957 .29396 moveto .72296 .31087 lineto stroke grestore gsave .786 setgray .77473 .36264 moveto .72296 .31087 lineto .72296 .36264 lineto fill grestore gsave .868 setgray .72296 .31087 moveto .72296 .36264 lineto .70604 .36264 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .72296 .31087 moveto .72296 .36264 lineto stroke grestore gsave .786 setgray .84341 .29396 moveto .84341 .36264 lineto .77473 .29396 lineto fill grestore gsave .786 setgray .84341 .36264 moveto .77473 .29396 lineto .77473 .36264 lineto fill grestore gsave .704 setgray .91209 .29396 moveto .91209 .32978 lineto .87626 .29396 lineto fill grestore gsave .786 setgray .91209 .32978 moveto .87626 .29396 lineto .84341 .29396 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .32978 moveto .87626 .29396 lineto stroke grestore gsave .786 setgray .91209 .36264 moveto .84341 .29396 lineto .84341 .36264 lineto fill grestore gsave .704 setgray .98077 .29396 moveto .91209 .29396 lineto .98077 .36264 lineto fill grestore gsave .704 setgray .91209 .32978 moveto .96137 .36264 lineto .98077 .36264 lineto .91209 .29396 lineto fill grestore gsave .786 setgray .91209 .32978 moveto .96137 .36264 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .32978 moveto .96137 .36264 lineto stroke grestore gsave .704 setgray 0.01923 .36264 moveto 0.08791 .43132 lineto 0.08791 .36264 lineto fill grestore gsave .623 setgray 0.01923 .43132 moveto 0.01923 .42342 lineto 0.02713 .43132 lineto fill grestore gsave .704 setgray 0.01923 .42342 moveto 0.02713 .43132 lineto 0.08791 .43132 lineto 0.01923 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .42342 moveto 0.02713 .43132 lineto stroke grestore gsave .704 setgray 0.08791 .36264 moveto .15659 .43132 lineto .15659 .36264 lineto fill grestore gsave .704 setgray 0.08791 .43132 moveto 0.08791 .36264 lineto .15659 .43132 lineto fill grestore gsave .704 setgray .21781 .36264 moveto .22527 .37758 lineto .22527 .43132 lineto .15659 .36264 lineto fill grestore gsave .786 setgray .21781 .36264 moveto .22527 .37758 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .21781 .36264 moveto .22527 .37758 lineto stroke grestore gsave .704 setgray .15659 .43132 moveto .15659 .36264 lineto .22527 .43132 lineto fill grestore gsave .786 setgray .22527 .36264 moveto .29396 .43132 lineto .29396 .36264 lineto fill grestore gsave .704 setgray .22527 .43132 moveto .24677 .43132 lineto .22527 .37758 lineto fill grestore gsave .786 setgray .24677 .43132 moveto .22527 .37758 lineto .22527 .36264 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .24677 .43132 moveto .22527 .37758 lineto stroke grestore gsave .786 setgray .34572 .36264 moveto .36264 .38519 lineto .36264 .43132 lineto .29396 .36264 lineto fill grestore gsave .868 setgray .34572 .36264 moveto .36264 .38519 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .34572 .36264 moveto .36264 .38519 lineto stroke grestore gsave .786 setgray .29396 .43132 moveto .29396 .36264 lineto .36264 .43132 lineto fill grestore gsave .786 setgray .43132 .43132 moveto .43132 .43106 lineto .43029 .43029 lineto fill grestore gsave .868 setgray .43132 .43106 moveto .43029 .43029 lineto .36264 .36264 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .43132 .43106 moveto .43029 .43029 lineto stroke grestore gsave .786 setgray .36264 .38519 moveto .43029 .43029 lineto .43132 .43132 lineto .36264 .43132 lineto fill grestore gsave .868 setgray .36264 .38519 moveto .43029 .43029 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .36264 .38519 moveto .43029 .43029 lineto stroke grestore gsave .868 setgray .5 .43132 moveto .43132 .36264 lineto .5 .36264 lineto fill grestore gsave .786 setgray .43132 .43132 moveto .43132 .43106 lineto .43183 .43132 lineto fill grestore gsave .868 setgray .43132 .43106 moveto .43183 .43132 lineto .5 .43132 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .43132 .43106 moveto .43183 .43132 lineto stroke grestore gsave .868 setgray .56868 .43132 moveto .56868 .36264 lineto .5 .36264 lineto fill grestore gsave .868 setgray .56868 .43132 moveto .5 .43132 lineto .5 .36264 lineto fill grestore gsave .868 setgray .63736 .43132 moveto .63736 .36264 lineto .56868 .36264 lineto fill grestore gsave .868 setgray .63736 .43132 moveto .56868 .43132 lineto .56868 .36264 lineto fill grestore gsave .786 setgray .70604 .43132 moveto .6921 .41738 lineto .70604 .39646 lineto fill grestore gsave .868 setgray .6921 .41738 moveto .70604 .39646 lineto .70604 .36264 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .6921 .41738 moveto .70604 .39646 lineto stroke grestore gsave .786 setgray .70604 .43132 moveto .6921 .41738 lineto .67119 .43132 lineto fill grestore gsave .868 setgray .6921 .41738 moveto .67119 .43132 lineto .63736 .43132 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .6921 .41738 moveto .67119 .43132 lineto stroke grestore gsave .786 setgray .71957 .37617 moveto .72296 .36264 lineto .77473 .36264 lineto .77473 .43132 lineto fill grestore gsave .868 setgray .71957 .37617 moveto .72296 .36264 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .71957 .37617 moveto .72296 .36264 lineto stroke grestore gsave .786 setgray .71957 .37617 moveto .70604 .39646 lineto .70604 .43132 lineto .77473 .43132 lineto fill grestore gsave .868 setgray .71957 .37617 moveto .70604 .39646 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .71957 .37617 moveto .70604 .39646 lineto stroke grestore gsave .786 setgray .84341 .36264 moveto .84341 .43132 lineto .77473 .36264 lineto fill grestore gsave .786 setgray .84341 .43132 moveto .77473 .43132 lineto .77473 .36264 lineto fill grestore gsave .786 setgray .91209 .36264 moveto .91209 .43132 lineto .84341 .36264 lineto fill grestore gsave .786 setgray .91209 .43132 moveto .84341 .43132 lineto .84341 .36264 lineto fill grestore gsave .704 setgray .98077 .36264 moveto .98077 .38204 lineto .96137 .36264 lineto fill grestore gsave .786 setgray .98077 .38204 moveto .96137 .36264 lineto .91209 .36264 lineto .98077 .43132 lineto fill grestore gsave 0.001 setlinewidth .98077 .38204 moveto .96137 .36264 lineto stroke grestore gsave .786 setgray .98077 .43132 moveto .91209 .36264 lineto .91209 .43132 lineto fill grestore gsave .623 setgray 0.08791 .45158 moveto 0.02713 .43132 lineto 0.01923 .43132 lineto 0.08791 .5 lineto fill grestore gsave .704 setgray 0.08791 .45158 moveto 0.02713 .43132 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .45158 moveto 0.02713 .43132 lineto stroke grestore gsave .623 setgray 0.01923 .5 moveto 0.08791 .5 lineto 0.01923 .43132 lineto fill grestore gsave .623 setgray .15659 .5 moveto .15659 .49803 lineto .1487 .4921 lineto fill grestore gsave .704 setgray .15659 .49803 moveto .1487 .4921 lineto 0.08791 .43132 lineto .15659 .43132 lineto fill grestore gsave 0.001 setlinewidth .15659 .49803 moveto .1487 .4921 lineto stroke grestore gsave .623 setgray 0.08791 .45158 moveto .1487 .4921 lineto .15659 .5 lineto 0.08791 .5 lineto fill grestore gsave .704 setgray 0.08791 .45158 moveto .1487 .4921 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .45158 moveto .1487 .4921 lineto stroke grestore gsave .704 setgray .22527 .5 moveto .15659 .43132 lineto .22527 .43132 lineto fill grestore gsave .623 setgray .15659 .5 moveto .15659 .49803 lineto .15923 .5 lineto fill grestore gsave .704 setgray .15659 .49803 moveto .15923 .5 lineto .22527 .5 lineto .15659 .43132 lineto fill grestore gsave 0.001 setlinewidth .15659 .49803 moveto .15923 .5 lineto stroke grestore gsave .704 setgray .29396 .47064 moveto .24677 .43132 lineto .22527 .43132 lineto .29396 .5 lineto fill grestore gsave .786 setgray .29396 .47064 moveto .24677 .43132 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .29396 .47064 moveto .24677 .43132 lineto stroke grestore gsave .704 setgray .22527 .5 moveto .29396 .5 lineto .22527 .43132 lineto fill grestore gsave .786 setgray .36264 .5 moveto .29396 .43132 lineto .36264 .43132 lineto fill grestore gsave .704 setgray .29396 .5 moveto .29396 .47064 lineto .35268 .5 lineto fill grestore gsave .786 setgray .29396 .47064 moveto .35268 .5 lineto .36264 .5 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .29396 .47064 moveto .35268 .5 lineto stroke grestore gsave .786 setgray .43132 .5 moveto .36264 .43132 lineto .43132 .43132 lineto fill grestore gsave .786 setgray .36264 .5 moveto .43132 .5 lineto .36264 .43132 lineto fill grestore gsave .786 setgray .5 .45079 moveto .43183 .43132 lineto .43132 .43132 lineto .5 .5 lineto fill grestore gsave .868 setgray .5 .45079 moveto .43183 .43132 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .5 .45079 moveto .43183 .43132 lineto stroke grestore gsave .786 setgray .43132 .5 moveto .5 .5 lineto .43132 .43132 lineto fill grestore gsave .786 setgray .56868 .5 moveto .56868 .45079 lineto .51948 .45079 lineto fill grestore gsave .868 setgray .56868 .45079 moveto .51948 .45079 lineto .5 .43132 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .56868 .45079 moveto .51948 .45079 lineto stroke grestore gsave .786 setgray .51948 .45079 moveto .5 .45079 lineto .5 .5 lineto .56868 .5 lineto fill grestore gsave .868 setgray .51948 .45079 moveto .5 .45079 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .51948 .45079 moveto .5 .45079 lineto stroke grestore gsave .786 setgray .63736 .5 moveto .58816 .45079 lineto .63736 .44259 lineto fill grestore gsave .868 setgray .58816 .45079 moveto .63736 .44259 lineto .63736 .43132 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .58816 .45079 moveto .63736 .44259 lineto stroke grestore gsave .786 setgray .58816 .45079 moveto .56868 .45079 lineto .56868 .5 lineto .63736 .5 lineto fill grestore gsave .868 setgray .58816 .45079 moveto .56868 .45079 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .58816 .45079 moveto .56868 .45079 lineto stroke grestore gsave .786 setgray .64703 .44098 moveto .67119 .43132 lineto .70604 .43132 lineto .70604 .5 lineto fill grestore gsave .868 setgray .64703 .44098 moveto .67119 .43132 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .64703 .44098 moveto .67119 .43132 lineto stroke grestore gsave .786 setgray .64703 .44098 moveto .63736 .44259 lineto .63736 .5 lineto .70604 .5 lineto fill grestore gsave .868 setgray .64703 .44098 moveto .63736 .44259 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .64703 .44098 moveto .63736 .44259 lineto stroke grestore gsave .786 setgray .77473 .5 moveto .77473 .43132 lineto .70604 .43132 lineto fill grestore gsave .786 setgray .77473 .5 moveto .70604 .5 lineto .70604 .43132 lineto fill grestore gsave .786 setgray .84341 .5 moveto .84341 .43132 lineto .77473 .43132 lineto fill grestore gsave .786 setgray .84341 .5 moveto .77473 .5 lineto .77473 .43132 lineto fill grestore gsave .786 setgray .91209 .5 moveto .91209 .43132 lineto .84341 .43132 lineto fill grestore gsave .786 setgray .91209 .5 moveto .84341 .5 lineto .84341 .43132 lineto fill grestore gsave .704 setgray .98077 .5 moveto .96783 .48707 lineto .98077 .4806 lineto fill grestore gsave .786 setgray .96783 .48707 moveto .98077 .4806 lineto .98077 .43132 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .96783 .48707 moveto .98077 .4806 lineto stroke grestore gsave .704 setgray .98077 .5 moveto .96783 .48707 lineto .94196 .5 lineto fill grestore gsave .786 setgray .96783 .48707 moveto .94196 .5 lineto .91209 .5 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .96783 .48707 moveto .94196 .5 lineto stroke grestore gsave .623 setgray 0.08791 .56868 moveto 0.01923 .5 lineto 0.08791 .5 lineto fill grestore gsave .623 setgray 0.01923 .56868 moveto 0.08791 .56868 lineto 0.01923 .5 lineto fill grestore gsave .623 setgray .15659 .56868 moveto 0.08791 .5 lineto .15659 .5 lineto fill grestore gsave .623 setgray 0.08791 .56868 moveto .15659 .56868 lineto 0.08791 .5 lineto fill grestore gsave .623 setgray .22527 .54954 moveto .15923 .5 lineto .15659 .5 lineto .22527 .56868 lineto fill grestore gsave .704 setgray .22527 .54954 moveto .15923 .5 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .22527 .54954 moveto .15923 .5 lineto stroke grestore gsave .623 setgray .15659 .56868 moveto .22527 .56868 lineto .15659 .5 lineto fill grestore gsave .704 setgray .29396 .56868 moveto .22527 .5 lineto .29396 .5 lineto fill grestore gsave .623 setgray .22527 .56868 moveto .22527 .54954 lineto .2508 .56868 lineto fill grestore gsave .704 setgray .22527 .54954 moveto .2508 .56868 lineto .29396 .56868 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .22527 .54954 moveto .2508 .56868 lineto stroke grestore gsave .704 setgray .36264 .50498 moveto .35268 .5 lineto .29396 .5 lineto .36264 .56868 lineto fill grestore gsave .786 setgray .36264 .50498 moveto .35268 .5 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .36264 .50498 moveto .35268 .5 lineto stroke grestore gsave .704 setgray .29396 .56868 moveto .36264 .56868 lineto .29396 .5 lineto fill grestore gsave .704 setgray .43132 .56868 moveto .43132 .52787 lineto .37011 .50747 lineto fill grestore gsave .786 setgray .43132 .52787 moveto .37011 .50747 lineto .36264 .5 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .43132 .52787 moveto .37011 .50747 lineto stroke grestore gsave .704 setgray .36264 .50498 moveto .37011 .50747 lineto .43132 .56868 lineto .36264 .56868 lineto fill grestore gsave .786 setgray .36264 .50498 moveto .37011 .50747 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .36264 .50498 moveto .37011 .50747 lineto stroke grestore gsave .704 setgray .5 .56868 moveto .5 .54351 lineto .46477 .53345 lineto fill grestore gsave .786 setgray .5 .54351 moveto .46477 .53345 lineto .43132 .5 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .5 .54351 moveto .46477 .53345 lineto stroke grestore gsave .704 setgray .43132 .52787 moveto .46477 .53345 lineto .5 .56868 lineto .43132 .56868 lineto fill grestore gsave .786 setgray .43132 .52787 moveto .46477 .53345 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .43132 .52787 moveto .46477 .53345 lineto stroke grestore gsave .704 setgray .56868 .56868 moveto .56868 .55077 lineto .55077 .55077 lineto fill grestore gsave .786 setgray .56868 .55077 moveto .55077 .55077 lineto .5 .5 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .56868 .55077 moveto .55077 .55077 lineto stroke grestore gsave .704 setgray .5 .54351 moveto .55077 .55077 lineto .56868 .56868 lineto .5 .56868 lineto fill grestore gsave .786 setgray .5 .54351 moveto .55077 .55077 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .5 .54351 moveto .55077 .55077 lineto stroke grestore gsave .704 setgray .63736 .56868 moveto .63736 .55077 lineto .61945 .55077 lineto fill grestore gsave .786 setgray .63736 .55077 moveto .61945 .55077 lineto .56868 .5 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .63736 .55077 moveto .61945 .55077 lineto stroke grestore gsave .704 setgray .61945 .55077 moveto .56868 .55077 lineto .56868 .56868 lineto .63736 .56868 lineto fill grestore gsave .786 setgray .61945 .55077 moveto .56868 .55077 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .61945 .55077 moveto .56868 .55077 lineto stroke grestore gsave .704 setgray .70604 .56868 moveto .68813 .55077 lineto .70604 .54718 lineto fill grestore gsave .786 setgray .68813 .55077 moveto .70604 .54718 lineto .70604 .5 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .68813 .55077 moveto .70604 .54718 lineto stroke grestore gsave .704 setgray .68813 .55077 moveto .63736 .55077 lineto .63736 .56868 lineto .70604 .56868 lineto fill grestore gsave .786 setgray .68813 .55077 moveto .63736 .55077 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .68813 .55077 moveto .63736 .55077 lineto stroke grestore gsave .704 setgray .77473 .56868 moveto .75323 .54718 lineto .77473 .54181 lineto fill grestore gsave .786 setgray .75323 .54718 moveto .77473 .54181 lineto .77473 .5 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .75323 .54718 moveto .77473 .54181 lineto stroke grestore gsave .704 setgray .75323 .54718 moveto .70604 .54718 lineto .70604 .56868 lineto .77473 .56868 lineto fill grestore gsave .786 setgray .75323 .54718 moveto .70604 .54718 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .75323 .54718 moveto .70604 .54718 lineto stroke grestore gsave .704 setgray .84341 .56868 moveto .81654 .54181 lineto .84341 .53285 lineto fill grestore gsave .786 setgray .81654 .54181 moveto .84341 .53285 lineto .84341 .5 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .81654 .54181 moveto .84341 .53285 lineto stroke grestore gsave .704 setgray .81654 .54181 moveto .77473 .54181 lineto .77473 .56868 lineto .84341 .56868 lineto fill grestore gsave .786 setgray .81654 .54181 moveto .77473 .54181 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .81654 .54181 moveto .77473 .54181 lineto stroke grestore gsave .704 setgray .91209 .56868 moveto .86805 .52464 lineto .91209 .50996 lineto fill grestore gsave .786 setgray .86805 .52464 moveto .91209 .50996 lineto .91209 .5 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .86805 .52464 moveto .91209 .50996 lineto stroke grestore gsave .704 setgray .86805 .52464 moveto .84341 .53285 lineto .84341 .56868 lineto .91209 .56868 lineto fill grestore gsave .786 setgray .86805 .52464 moveto .84341 .53285 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .86805 .52464 moveto .84341 .53285 lineto stroke grestore gsave .704 setgray .92205 .50996 moveto .94196 .5 lineto .98077 .5 lineto .98077 .56868 lineto fill grestore gsave .786 setgray .92205 .50996 moveto .94196 .5 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .92205 .50996 moveto .94196 .5 lineto stroke grestore gsave .704 setgray .92205 .50996 moveto .91209 .50996 lineto .91209 .56868 lineto .98077 .56868 lineto fill grestore gsave .786 setgray .92205 .50996 moveto .91209 .50996 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .92205 .50996 moveto .91209 .50996 lineto stroke grestore gsave .541 setgray 0.08791 .63736 moveto 0.08791 .6183 lineto 0.06504 .61449 lineto fill grestore gsave .623 setgray 0.08791 .6183 moveto 0.06504 .61449 lineto 0.01923 .56868 lineto 0.08791 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .6183 moveto 0.06504 .61449 lineto stroke grestore gsave .541 setgray 0.06504 .61449 moveto 0.01923 .61449 lineto 0.01923 .63736 lineto 0.08791 .63736 lineto fill grestore gsave .623 setgray 0.06504 .61449 moveto 0.01923 .61449 lineto 0.01923 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.06504 .61449 moveto 0.01923 .61449 lineto stroke grestore gsave .541 setgray .15659 .63736 moveto .15659 .63084 lineto .14746 .62823 lineto fill grestore gsave .623 setgray .15659 .63084 moveto .14746 .62823 lineto 0.08791 .56868 lineto .15659 .56868 lineto fill grestore gsave 0.001 setlinewidth .15659 .63084 moveto .14746 .62823 lineto stroke grestore gsave .541 setgray 0.08791 .6183 moveto .14746 .62823 lineto .15659 .63736 lineto 0.08791 .63736 lineto fill grestore gsave .623 setgray 0.08791 .6183 moveto .14746 .62823 lineto 0.08791 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .6183 moveto .14746 .62823 lineto stroke grestore gsave .623 setgray .22527 .63736 moveto .15659 .56868 lineto .22527 .56868 lineto fill grestore gsave .541 setgray .15659 .63736 moveto .15659 .63084 lineto .20227 .63736 lineto fill grestore gsave .623 setgray .15659 .63084 moveto .20227 .63736 lineto .22527 .63736 lineto .15659 .56868 lineto fill grestore gsave 0.001 setlinewidth .15659 .63084 moveto .20227 .63736 lineto stroke grestore gsave .623 setgray .29396 .58307 moveto .2508 .56868 lineto .22527 .56868 lineto .29396 .63736 lineto fill grestore gsave .704 setgray .29396 .58307 moveto .2508 .56868 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .29396 .58307 moveto .2508 .56868 lineto stroke grestore gsave .623 setgray .22527 .63736 moveto .29396 .63736 lineto .22527 .56868 lineto fill grestore gsave .623 setgray .36264 .63736 moveto .36264 .59536 lineto .31014 .58486 lineto fill grestore gsave .704 setgray .36264 .59536 moveto .31014 .58486 lineto .29396 .56868 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .36264 .59536 moveto .31014 .58486 lineto stroke grestore gsave .623 setgray .29396 .58307 moveto .31014 .58486 lineto .36264 .63736 lineto .29396 .63736 lineto fill grestore gsave .704 setgray .29396 .58307 moveto .31014 .58486 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .29396 .58307 moveto .31014 .58486 lineto stroke grestore gsave .623 setgray .43132 .63736 moveto .43132 .60543 lineto .39228 .59833 lineto fill grestore gsave .704 setgray .43132 .60543 moveto .39228 .59833 lineto .36264 .56868 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .43132 .60543 moveto .39228 .59833 lineto stroke grestore gsave .623 setgray .36264 .59536 moveto .39228 .59833 lineto .43132 .63736 lineto .36264 .63736 lineto fill grestore gsave .704 setgray .36264 .59536 moveto .39228 .59833 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .36264 .59536 moveto .39228 .59833 lineto stroke grestore gsave .623 setgray .5 .63736 moveto .5 .60809 lineto .46806 .60543 lineto fill grestore gsave .704 setgray .5 .60809 moveto .46806 .60543 lineto .43132 .56868 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .5 .60809 moveto .46806 .60543 lineto stroke grestore gsave .623 setgray .46806 .60543 moveto .43132 .60543 lineto .43132 .63736 lineto .5 .63736 lineto fill grestore gsave .704 setgray .46806 .60543 moveto .43132 .60543 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .46806 .60543 moveto .43132 .60543 lineto stroke grestore gsave .623 setgray .56868 .63736 moveto .56868 .61381 lineto .54299 .61167 lineto fill grestore gsave .704 setgray .56868 .61381 moveto .54299 .61167 lineto .5 .56868 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .56868 .61381 moveto .54299 .61167 lineto stroke grestore gsave .623 setgray .5 .60809 moveto .54299 .61167 lineto .56868 .63736 lineto .5 .63736 lineto fill grestore gsave .704 setgray .5 .60809 moveto .54299 .61167 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .5 .60809 moveto .54299 .61167 lineto stroke grestore gsave .623 setgray .63736 .63736 moveto .63736 .61791 lineto .61791 .61791 lineto fill grestore gsave .704 setgray .63736 .61791 moveto .61791 .61791 lineto .56868 .56868 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .63736 .61791 moveto .61791 .61791 lineto stroke grestore gsave .623 setgray .56868 .61381 moveto .61791 .61791 lineto .63736 .63736 lineto .56868 .63736 lineto fill grestore gsave .704 setgray .56868 .61381 moveto .61791 .61791 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .56868 .61381 moveto .61791 .61791 lineto stroke grestore gsave .623 setgray .70604 .63736 moveto .70604 .62284 lineto .69152 .62284 lineto fill grestore gsave .704 setgray .70604 .62284 moveto .69152 .62284 lineto .63736 .56868 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70604 .62284 moveto .69152 .62284 lineto stroke grestore gsave .623 setgray .63736 .61791 moveto .69152 .62284 lineto .70604 .63736 lineto .63736 .63736 lineto fill grestore gsave .704 setgray .63736 .61791 moveto .69152 .62284 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .63736 .61791 moveto .69152 .62284 lineto stroke grestore gsave .623 setgray .77473 .63736 moveto .77473 .63638 lineto .77374 .63638 lineto fill grestore gsave .704 setgray .77473 .63638 moveto .77374 .63638 lineto .70604 .56868 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .77473 .63638 moveto .77374 .63638 lineto stroke grestore gsave .623 setgray .70604 .62284 moveto .77374 .63638 lineto .77473 .63736 lineto .70604 .63736 lineto fill grestore gsave .704 setgray .70604 .62284 moveto .77374 .63638 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70604 .62284 moveto .77374 .63638 lineto stroke grestore gsave .704 setgray .84341 .63736 moveto .77473 .56868 lineto .84341 .56868 lineto fill grestore gsave .623 setgray .77473 .63736 moveto .77473 .63638 lineto .78262 .63736 lineto fill grestore gsave .704 setgray .77473 .63638 moveto .78262 .63736 lineto .84341 .63736 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .77473 .63638 moveto .78262 .63736 lineto stroke grestore gsave .704 setgray .91209 .63736 moveto .91209 .56868 lineto .84341 .56868 lineto fill grestore gsave .704 setgray .91209 .63736 moveto .84341 .63736 lineto .84341 .56868 lineto fill grestore gsave .704 setgray .98077 .63736 moveto .91209 .56868 lineto .98077 .56868 lineto fill grestore gsave .704 setgray .91209 .63736 moveto .98077 .63736 lineto .91209 .56868 lineto fill grestore gsave .541 setgray 0.08791 .70604 moveto 0.01923 .63736 lineto 0.08791 .63736 lineto fill grestore gsave .541 setgray 0.08791 .70604 moveto 0.01923 .70604 lineto 0.01923 .63736 lineto fill grestore gsave .541 setgray .15659 .70604 moveto 0.08791 .63736 lineto .15659 .63736 lineto fill grestore gsave .541 setgray .15659 .70604 moveto 0.08791 .70604 lineto 0.08791 .63736 lineto fill grestore gsave .541 setgray .22527 .63992 moveto .20227 .63736 lineto .15659 .63736 lineto .22527 .70604 lineto fill grestore gsave .623 setgray .22527 .63992 moveto .20227 .63736 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .22527 .63992 moveto .20227 .63736 lineto stroke grestore gsave .541 setgray .22527 .70604 moveto .15659 .70604 lineto .15659 .63736 lineto fill grestore gsave .459 setgray .29396 .70604 moveto .29396 .70481 lineto .29248 .70457 lineto fill grestore gsave .541 setgray .29396 .70481 moveto .29248 .70457 lineto .22758 .63966 lineto .29396 .65073 lineto fill grestore gsave 0.001 setlinewidth .29396 .70481 moveto .29248 .70457 lineto stroke grestore gsave .623 setgray .29396 .65073 moveto .22758 .63966 lineto .22527 .63736 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .29396 .65073 moveto .22758 .63966 lineto stroke grestore gsave .459 setgray .29396 .70604 moveto .29248 .70457 lineto .27919 .70604 lineto fill grestore gsave .541 setgray .29248 .70457 moveto .27919 .70604 lineto .22527 .70604 lineto .22527 .63992 lineto .22758 .63966 lineto fill grestore gsave 0.001 setlinewidth .29248 .70457 moveto .27919 .70604 lineto stroke grestore gsave .623 setgray .22758 .63966 moveto .22527 .63992 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .22758 .63966 moveto .22527 .63992 lineto stroke grestore gsave .459 setgray .36264 .70604 moveto .36264 .70491 lineto .36141 .70481 lineto fill grestore gsave .541 setgray .36264 .70491 moveto .36141 .70481 lineto .30732 .65073 lineto .36264 .65498 lineto fill grestore gsave 0.001 setlinewidth .36264 .70491 moveto .36141 .70481 lineto stroke grestore gsave .623 setgray .36264 .65498 moveto .30732 .65073 lineto .29396 .63736 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .36264 .65498 moveto .30732 .65073 lineto stroke grestore gsave .459 setgray .36141 .70481 moveto .29396 .70481 lineto .29396 .70604 lineto .36264 .70604 lineto fill grestore gsave .541 setgray .36141 .70481 moveto .29396 .70481 lineto .29396 .65073 lineto .30732 .65073 lineto fill grestore gsave 0.001 setlinewidth .36141 .70481 moveto .29396 .70481 lineto stroke grestore gsave .623 setgray .30732 .65073 moveto .29396 .65073 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .30732 .65073 moveto .29396 .65073 lineto stroke grestore gsave .459 setgray .43132 .70604 moveto .43132 .70499 lineto .43018 .70491 lineto fill grestore gsave .541 setgray .43132 .70499 moveto .43018 .70491 lineto .38026 .65498 lineto .43132 .65863 lineto fill grestore gsave 0.001 setlinewidth .43132 .70499 moveto .43018 .70491 lineto stroke grestore gsave .623 setgray .43132 .65863 moveto .38026 .65498 lineto .36264 .63736 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .43132 .65863 moveto .38026 .65498 lineto stroke grestore gsave .459 setgray .43018 .70491 moveto .36264 .70491 lineto .36264 .70604 lineto .43132 .70604 lineto fill grestore gsave .541 setgray .43018 .70491 moveto .36264 .70491 lineto .36264 .65498 lineto .38026 .65498 lineto fill grestore gsave 0.001 setlinewidth .43018 .70491 moveto .36264 .70491 lineto stroke grestore gsave .623 setgray .38026 .65498 moveto .36264 .65498 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .38026 .65498 moveto .36264 .65498 lineto stroke grestore gsave .459 setgray .5 .70604 moveto .5 .70499 lineto .49895 .70499 lineto fill grestore gsave .541 setgray .5 .70499 moveto .49895 .70499 lineto .45259 .65863 lineto .5 .65863 lineto fill grestore gsave 0.001 setlinewidth .5 .70499 moveto .49895 .70499 lineto stroke grestore gsave .623 setgray .5 .65863 moveto .45259 .65863 lineto .43132 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .5 .65863 moveto .45259 .65863 lineto stroke grestore gsave .459 setgray .49895 .70499 moveto .43132 .70499 lineto .43132 .70604 lineto .5 .70604 lineto fill grestore gsave .541 setgray .49895 .70499 moveto .43132 .70499 lineto .43132 .65863 lineto .45259 .65863 lineto fill grestore gsave 0.001 setlinewidth .49895 .70499 moveto .43132 .70499 lineto stroke grestore gsave .623 setgray .45259 .65863 moveto .43132 .65863 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .45259 .65863 moveto .43132 .65863 lineto stroke grestore gsave .541 setgray .56868 .70604 moveto .56868 .66555 lineto .52481 .66217 lineto fill grestore gsave .623 setgray .56868 .66555 moveto .52481 .66217 lineto .5 .63736 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .56868 .66555 moveto .52481 .66217 lineto stroke grestore gsave .459 setgray .5 .70604 moveto .5 .70499 lineto .50738 .70604 lineto fill grestore gsave .541 setgray .5 .70499 moveto .50738 .70604 lineto .56868 .70604 lineto .52481 .66217 lineto .5 .65863 lineto fill grestore gsave 0.001 setlinewidth .5 .70499 moveto .50738 .70604 lineto stroke grestore gsave .623 setgray .5 .65863 moveto .52481 .66217 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .5 .65863 moveto .52481 .66217 lineto stroke grestore gsave .541 setgray .63736 .70604 moveto .63736 .67083 lineto .59922 .6679 lineto fill grestore gsave .623 setgray .63736 .67083 moveto .59922 .6679 lineto .56868 .63736 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .63736 .67083 moveto .59922 .6679 lineto stroke grestore gsave .541 setgray .56868 .66555 moveto .59922 .6679 lineto .63736 .70604 lineto .56868 .70604 lineto fill grestore gsave .623 setgray .56868 .66555 moveto .59922 .6679 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .56868 .66555 moveto .59922 .6679 lineto stroke grestore gsave .541 setgray .70604 .70604 moveto .70604 .67934 lineto .67692 .67692 lineto fill grestore gsave .623 setgray .70604 .67934 moveto .67692 .67692 lineto .63736 .63736 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .70604 .67934 moveto .67692 .67692 lineto stroke grestore gsave .541 setgray .63736 .67083 moveto .67692 .67692 lineto .70604 .70604 lineto .63736 .70604 lineto fill grestore gsave .623 setgray .63736 .67083 moveto .67692 .67692 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .63736 .67083 moveto .67692 .67692 lineto stroke grestore gsave .541 setgray .77473 .70604 moveto .77473 .69565 lineto .76202 .69334 lineto fill grestore gsave .623 setgray .77473 .69565 moveto .76202 .69334 lineto .70604 .63736 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .77473 .69565 moveto .76202 .69334 lineto stroke grestore gsave .541 setgray .70604 .67934 moveto .76202 .69334 lineto .77473 .70604 lineto .70604 .70604 lineto fill grestore gsave .623 setgray .70604 .67934 moveto .76202 .69334 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .70604 .67934 moveto .76202 .69334 lineto stroke grestore gsave .623 setgray .84341 .64412 moveto .78262 .63736 lineto .77473 .63736 lineto .84341 .70604 lineto fill grestore gsave .704 setgray .84341 .64412 moveto .78262 .63736 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .84341 .64412 moveto .78262 .63736 lineto stroke grestore gsave .541 setgray .77473 .70604 moveto .77473 .69565 lineto .81284 .70604 lineto fill grestore gsave .623 setgray .77473 .69565 moveto .81284 .70604 lineto .84341 .70604 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .77473 .69565 moveto .81284 .70604 lineto stroke grestore gsave .623 setgray .91209 .70604 moveto .91209 .64496 lineto .851 .64496 lineto fill grestore gsave .704 setgray .91209 .64496 moveto .851 .64496 lineto .84341 .63736 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .91209 .64496 moveto .851 .64496 lineto stroke grestore gsave .623 setgray .84341 .64412 moveto .851 .64496 lineto .91209 .70604 lineto .84341 .70604 lineto fill grestore gsave .704 setgray .84341 .64412 moveto .851 .64496 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .84341 .64412 moveto .851 .64496 lineto stroke grestore gsave .623 setgray .98077 .70604 moveto .98077 .65355 lineto .92077 .64605 lineto fill grestore gsave .704 setgray .98077 .65355 moveto .92077 .64605 lineto .91209 .63736 lineto .98077 .63736 lineto fill grestore gsave 0.001 setlinewidth .98077 .65355 moveto .92077 .64605 lineto stroke grestore gsave .623 setgray .91209 .64496 moveto .92077 .64605 lineto .98077 .70604 lineto .91209 .70604 lineto fill grestore gsave .704 setgray .91209 .64496 moveto .92077 .64605 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .91209 .64496 moveto .92077 .64605 lineto stroke grestore gsave .459 setgray 0.08791 .77473 moveto 0.08791 .72137 lineto 0.03456 .72137 lineto fill grestore gsave .541 setgray 0.08791 .72137 moveto 0.03456 .72137 lineto 0.01923 .70604 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .72137 moveto 0.03456 .72137 lineto stroke grestore gsave .459 setgray 0.03456 .72137 moveto 0.01923 .72356 lineto 0.01923 .77473 lineto 0.08791 .77473 lineto fill grestore gsave .541 setgray 0.03456 .72137 moveto 0.01923 .72356 lineto 0.01923 .70604 lineto fill grestore gsave 0.001 setlinewidth 0.03456 .72137 moveto 0.01923 .72356 lineto stroke grestore gsave .459 setgray .15659 .77473 moveto .10153 .71967 lineto .15659 .71278 lineto fill grestore gsave .541 setgray .10153 .71967 moveto .15659 .71278 lineto .15659 .70604 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth .10153 .71967 moveto .15659 .71278 lineto stroke grestore gsave .459 setgray .10153 .71967 moveto 0.08791 .72137 lineto 0.08791 .77473 lineto .15659 .77473 lineto fill grestore gsave .541 setgray .10153 .71967 moveto 0.08791 .72137 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth .10153 .71967 moveto 0.08791 .72137 lineto stroke grestore gsave .459 setgray .22527 .77473 moveto .22527 .71144 lineto .16198 .71144 lineto fill grestore gsave .541 setgray .22527 .71144 moveto .16198 .71144 lineto .15659 .70604 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .22527 .71144 moveto .16198 .71144 lineto stroke grestore gsave .459 setgray .16198 .71144 moveto .15659 .71278 lineto .15659 .77473 lineto .22527 .77473 lineto fill grestore gsave .541 setgray .16198 .71144 moveto .15659 .71278 lineto .15659 .70604 lineto fill grestore gsave 0.001 setlinewidth .16198 .71144 moveto .15659 .71278 lineto stroke grestore gsave .377 setgray .29396 .77473 moveto .27935 .76012 lineto .29396 .7589 lineto fill grestore gsave .459 setgray .27935 .76012 moveto .29396 .7589 lineto .29396 .70604 lineto .27919 .70604 lineto .22942 .71019 lineto fill grestore gsave 0.001 setlinewidth .27935 .76012 moveto .29396 .7589 lineto stroke grestore gsave .541 setgray .22942 .71019 moveto .27919 .70604 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .22942 .71019 moveto .27919 .70604 lineto stroke grestore gsave .377 setgray .29396 .77473 moveto .27935 .76012 lineto .23065 .77473 lineto fill grestore gsave .459 setgray .27935 .76012 moveto .23065 .77473 lineto .22527 .77473 lineto .22527 .71144 lineto .22942 .71019 lineto fill grestore gsave 0.001 setlinewidth .27935 .76012 moveto .23065 .77473 lineto stroke grestore gsave .541 setgray .22942 .71019 moveto .22527 .71144 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .22942 .71019 moveto .22527 .71144 lineto stroke grestore gsave .377 setgray .36264 .77473 moveto .36264 .75483 lineto .34275 .75483 lineto fill grestore gsave .459 setgray .36264 .75483 moveto .34275 .75483 lineto .29396 .70604 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .36264 .75483 moveto .34275 .75483 lineto stroke grestore gsave .377 setgray .34275 .75483 moveto .29396 .7589 lineto .29396 .77473 lineto .36264 .77473 lineto fill grestore gsave .459 setgray .34275 .75483 moveto .29396 .7589 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .34275 .75483 moveto .29396 .7589 lineto stroke grestore gsave .377 setgray .43132 .77473 moveto .43132 .74833 lineto .40492 .74833 lineto fill grestore gsave .459 setgray .43132 .74833 moveto .40492 .74833 lineto .36264 .70604 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .43132 .74833 moveto .40492 .74833 lineto stroke grestore gsave .377 setgray .40492 .74833 moveto .36264 .75483 lineto .36264 .77473 lineto .43132 .77473 lineto fill grestore gsave .459 setgray .40492 .74833 moveto .36264 .75483 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .40492 .74833 moveto .36264 .75483 lineto stroke grestore gsave .377 setgray .5 .77473 moveto .5 .74833 lineto .4736 .74833 lineto fill grestore gsave .459 setgray .5 .74833 moveto .4736 .74833 lineto .43132 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .5 .74833 moveto .4736 .74833 lineto stroke grestore gsave .377 setgray .4736 .74833 moveto .43132 .74833 lineto .43132 .77473 lineto .5 .77473 lineto fill grestore gsave .459 setgray .4736 .74833 moveto .43132 .74833 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .4736 .74833 moveto .43132 .74833 lineto stroke grestore gsave .377 setgray .56868 .77473 moveto .56868 .75427 lineto .54531 .75135 lineto fill grestore gsave .459 setgray .56868 .75427 moveto .54531 .75135 lineto .5 .70604 lineto .50738 .70604 lineto .56868 .71371 lineto fill grestore gsave 0.001 setlinewidth .56868 .75427 moveto .54531 .75135 lineto stroke grestore gsave .541 setgray .56868 .71371 moveto .50738 .70604 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .56868 .71371 moveto .50738 .70604 lineto stroke grestore gsave .377 setgray .5 .74833 moveto .54531 .75135 lineto .56868 .77473 lineto .5 .77473 lineto fill grestore gsave .459 setgray .5 .74833 moveto .54531 .75135 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .5 .74833 moveto .54531 .75135 lineto stroke grestore gsave .377 setgray .63736 .77473 moveto .63736 .76607 lineto .62804 .7654 lineto fill grestore gsave .459 setgray .63736 .76607 moveto .62804 .7654 lineto .57811 .71547 lineto .63736 .71971 lineto fill grestore gsave 0.001 setlinewidth .63736 .76607 moveto .62804 .7654 lineto stroke grestore gsave .541 setgray .63736 .71971 moveto .57811 .71547 lineto .56868 .70604 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .63736 .71971 moveto .57811 .71547 lineto stroke grestore gsave .377 setgray .56868 .75427 moveto .62804 .7654 lineto .63736 .77473 lineto .56868 .77473 lineto fill grestore gsave .459 setgray .56868 .75427 moveto .62804 .7654 lineto .57811 .71547 lineto .56868 .71371 lineto fill grestore gsave 0.001 setlinewidth .56868 .75427 moveto .62804 .7654 lineto stroke grestore gsave .541 setgray .56868 .71371 moveto .57811 .71547 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .56868 .71371 moveto .57811 .71547 lineto stroke grestore gsave .459 setgray .70604 .77473 moveto .70604 .73132 lineto .65475 .72343 lineto fill grestore gsave .541 setgray .70604 .73132 moveto .65475 .72343 lineto .63736 .70604 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .70604 .73132 moveto .65475 .72343 lineto stroke grestore gsave .377 setgray .63736 .77473 moveto .63736 .76607 lineto .67777 .77473 lineto fill grestore gsave .459 setgray .63736 .76607 moveto .67777 .77473 lineto .70604 .77473 lineto .65475 .72343 lineto .63736 .71971 lineto fill grestore gsave 0.001 setlinewidth .63736 .76607 moveto .67777 .77473 lineto stroke grestore gsave .541 setgray .63736 .71971 moveto .65475 .72343 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .63736 .71971 moveto .65475 .72343 lineto stroke grestore gsave .459 setgray .77473 .77473 moveto .77473 .75465 lineto .74712 .74712 lineto fill grestore gsave .541 setgray .77473 .75465 moveto .74712 .74712 lineto .70604 .70604 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .77473 .75465 moveto .74712 .74712 lineto stroke grestore gsave .459 setgray .70604 .73132 moveto .74712 .74712 lineto .77473 .77473 lineto .70604 .77473 lineto fill grestore gsave .541 setgray .70604 .73132 moveto .74712 .74712 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .70604 .73132 moveto .74712 .74712 lineto stroke grestore gsave .459 setgray .84341 .77473 moveto .84341 .77338 lineto .84156 .77288 lineto fill grestore gsave .541 setgray .84341 .77338 moveto .84156 .77288 lineto .77473 .70604 lineto .81284 .70604 lineto .84341 .71438 lineto fill grestore gsave 0.001 setlinewidth .84341 .77338 moveto .84156 .77288 lineto stroke grestore gsave .623 setgray .84341 .71438 moveto .81284 .70604 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .84341 .71438 moveto .81284 .70604 lineto stroke grestore gsave .459 setgray .77473 .75465 moveto .84156 .77288 lineto .84341 .77473 lineto .77473 .77473 lineto fill grestore gsave .541 setgray .77473 .75465 moveto .84156 .77288 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .77473 .75465 moveto .84156 .77288 lineto stroke grestore gsave .541 setgray .91209 .77473 moveto .91209 .72386 lineto .85487 .71751 lineto fill grestore gsave .623 setgray .91209 .72386 moveto .85487 .71751 lineto .84341 .70604 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .91209 .72386 moveto .85487 .71751 lineto stroke grestore gsave .459 setgray .84341 .77473 moveto .84341 .77338 lineto .84833 .77473 lineto fill grestore gsave .541 setgray .84341 .77338 moveto .84833 .77473 lineto .91209 .77473 lineto .85487 .71751 lineto .84341 .71438 lineto fill grestore gsave 0.001 setlinewidth .84341 .77338 moveto .84833 .77473 lineto stroke grestore gsave .623 setgray .84341 .71438 moveto .85487 .71751 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .84341 .71438 moveto .85487 .71751 lineto stroke grestore gsave .541 setgray .98077 .77473 moveto .98077 .73468 lineto .935 .72895 lineto fill grestore gsave .623 setgray .98077 .73468 moveto .935 .72895 lineto .91209 .70604 lineto .98077 .70604 lineto fill grestore gsave 0.001 setlinewidth .98077 .73468 moveto .935 .72895 lineto stroke grestore gsave .541 setgray .91209 .72386 moveto .935 .72895 lineto .98077 .77473 lineto .91209 .77473 lineto fill grestore gsave .623 setgray .91209 .72386 moveto .935 .72895 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .91209 .72386 moveto .935 .72895 lineto stroke grestore gsave .377 setgray 0.08791 .84341 moveto 0.05559 .81108 lineto 0.08791 .80647 lineto fill grestore gsave .459 setgray 0.05559 .81108 moveto 0.08791 .80647 lineto 0.08791 .77473 lineto 0.01923 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.05559 .81108 moveto 0.08791 .80647 lineto stroke grestore gsave .377 setgray 0.05559 .81108 moveto 0.01923 .8232 lineto 0.01923 .84341 lineto 0.08791 .84341 lineto fill grestore gsave .459 setgray 0.05559 .81108 moveto 0.01923 .8232 lineto 0.01923 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.05559 .81108 moveto 0.01923 .8232 lineto stroke grestore gsave .377 setgray .15659 .84341 moveto .11013 .79694 lineto .15659 .79178 lineto fill grestore gsave .459 setgray .11013 .79694 moveto .15659 .79178 lineto .15659 .77473 lineto 0.08791 .77473 lineto fill grestore gsave 0.001 setlinewidth .11013 .79694 moveto .15659 .79178 lineto stroke grestore gsave .377 setgray .11013 .79694 moveto 0.08791 .80647 lineto 0.08791 .84341 lineto .15659 .84341 lineto fill grestore gsave .459 setgray .11013 .79694 moveto 0.08791 .80647 lineto 0.08791 .77473 lineto fill grestore gsave 0.001 setlinewidth .11013 .79694 moveto 0.08791 .80647 lineto stroke grestore gsave .295 setgray .22527 .84341 moveto .22347 .8416 lineto .22527 .84124 lineto fill grestore gsave .377 setgray .22347 .8416 moveto .22527 .84124 lineto .22527 .77634 lineto .16939 .78752 lineto fill grestore gsave 0.001 setlinewidth .22347 .8416 moveto .22527 .84124 lineto stroke grestore gsave .459 setgray .16939 .78752 moveto .22527 .77634 lineto .22527 .77473 lineto .15659 .77473 lineto fill grestore gsave 0.001 setlinewidth .16939 .78752 moveto .22527 .77634 lineto stroke grestore gsave .295 setgray .22527 .84341 moveto .22347 .8416 lineto .21806 .84341 lineto fill grestore gsave .377 setgray .22347 .8416 moveto .21806 .84341 lineto .15659 .84341 lineto .15659 .79178 lineto .16939 .78752 lineto fill grestore gsave 0.001 setlinewidth .22347 .8416 moveto .21806 .84341 lineto stroke grestore gsave .459 setgray .16939 .78752 moveto .15659 .79178 lineto .15659 .77473 lineto fill grestore gsave 0.001 setlinewidth .16939 .78752 moveto .15659 .79178 lineto stroke grestore gsave .295 setgray .29396 .84341 moveto .26962 .81907 lineto .29396 .81299 lineto fill grestore gsave .377 setgray .26962 .81907 moveto .29396 .81299 lineto .29396 .77473 lineto .23065 .77473 lineto .22635 .7758 lineto fill grestore gsave 0.001 setlinewidth .26962 .81907 moveto .29396 .81299 lineto stroke grestore gsave .459 setgray .22635 .7758 moveto .23065 .77473 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .22635 .7758 moveto .23065 .77473 lineto stroke grestore gsave .295 setgray .26962 .81907 moveto .22527 .84124 lineto .22527 .84341 lineto .29396 .84341 lineto fill grestore gsave .377 setgray .26962 .81907 moveto .22527 .84124 lineto .22527 .77634 lineto .22635 .7758 lineto fill grestore gsave 0.001 setlinewidth .26962 .81907 moveto .22527 .84124 lineto stroke grestore gsave .459 setgray .22635 .7758 moveto .22527 .77634 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .22635 .7758 moveto .22527 .77634 lineto stroke grestore gsave .295 setgray .36264 .84341 moveto .32457 .80533 lineto .36264 .80261 lineto fill grestore gsave .377 setgray .32457 .80533 moveto .36264 .80261 lineto .36264 .77473 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .32457 .80533 moveto .36264 .80261 lineto stroke grestore gsave .295 setgray .32457 .80533 moveto .29396 .81299 lineto .29396 .84341 lineto .36264 .84341 lineto fill grestore gsave .377 setgray .32457 .80533 moveto .29396 .81299 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .32457 .80533 moveto .29396 .81299 lineto stroke grestore gsave .214 setgray .43132 .84341 moveto .42761 .83969 lineto .43132 .83916 lineto fill grestore gsave .295 setgray .42761 .83969 moveto .43132 .83916 lineto .43132 .7928 lineto .38704 .79913 lineto fill grestore gsave 0.001 setlinewidth .42761 .83969 moveto .43132 .83916 lineto stroke grestore gsave .377 setgray .38704 .79913 moveto .43132 .7928 lineto .43132 .77473 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .38704 .79913 moveto .43132 .7928 lineto stroke grestore gsave .214 setgray .43132 .84341 moveto .42761 .83969 lineto .40161 .84341 lineto fill grestore gsave .295 setgray .42761 .83969 moveto .40161 .84341 lineto .36264 .84341 lineto .36264 .80261 lineto .38704 .79913 lineto fill grestore gsave 0.001 setlinewidth .42761 .83969 moveto .40161 .84341 lineto stroke grestore gsave .377 setgray .38704 .79913 moveto .36264 .80261 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .38704 .79913 moveto .36264 .80261 lineto stroke grestore gsave .214 setgray .5 .84341 moveto .5 .83487 lineto .49146 .83487 lineto fill grestore gsave .295 setgray .5 .83487 moveto .49146 .83487 lineto .44819 .7916 lineto .5 .7916 lineto fill grestore gsave 0.001 setlinewidth .5 .83487 moveto .49146 .83487 lineto stroke grestore gsave .377 setgray .5 .7916 moveto .44819 .7916 lineto .43132 .77473 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .5 .7916 moveto .44819 .7916 lineto stroke grestore gsave .214 setgray .49146 .83487 moveto .43132 .83916 lineto .43132 .84341 lineto .5 .84341 lineto fill grestore gsave .295 setgray .49146 .83487 moveto .43132 .83916 lineto .43132 .7928 lineto .44819 .7916 lineto fill grestore gsave 0.001 setlinewidth .49146 .83487 moveto .43132 .83916 lineto stroke grestore gsave .377 setgray .44819 .7916 moveto .43132 .7928 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .44819 .7916 moveto .43132 .7928 lineto stroke grestore gsave .214 setgray .56868 .84341 moveto .56868 .83945 lineto .56444 .83916 lineto fill grestore gsave .295 setgray .56868 .83945 moveto .56444 .83916 lineto .51808 .7928 lineto .56868 .79618 lineto fill grestore gsave 0.001 setlinewidth .56868 .83945 moveto .56444 .83916 lineto stroke grestore gsave .377 setgray .56868 .79618 moveto .51808 .7928 lineto .5 .77473 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .56868 .79618 moveto .51808 .7928 lineto stroke grestore gsave .214 setgray .5 .83487 moveto .56444 .83916 lineto .56868 .84341 lineto .5 .84341 lineto fill grestore gsave .295 setgray .5 .83487 moveto .56444 .83916 lineto .51808 .7928 lineto .5 .7916 lineto fill grestore gsave 0.001 setlinewidth .5 .83487 moveto .56444 .83916 lineto stroke grestore gsave .377 setgray .5 .7916 moveto .51808 .7928 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .5 .7916 moveto .51808 .7928 lineto stroke grestore gsave .295 setgray .63736 .84341 moveto .63736 .80991 lineto .5955 .80154 lineto fill grestore gsave .377 setgray .63736 .80991 moveto .5955 .80154 lineto .56868 .77473 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .63736 .80991 moveto .5955 .80154 lineto stroke grestore gsave .214 setgray .56868 .84341 moveto .56868 .83945 lineto .58848 .84341 lineto fill grestore gsave .295 setgray .56868 .83945 moveto .58848 .84341 lineto .63736 .84341 lineto .5955 .80154 lineto .56868 .79618 lineto fill grestore gsave 0.001 setlinewidth .56868 .83945 moveto .58848 .84341 lineto stroke grestore gsave .377 setgray .56868 .79618 moveto .5955 .80154 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .56868 .79618 moveto .5955 .80154 lineto stroke grestore gsave .295 setgray .70604 .84341 moveto .70604 .82714 lineto .68535 .82271 lineto fill grestore gsave .377 setgray .70604 .82714 moveto .68535 .82271 lineto .63736 .77473 lineto .67777 .77473 lineto .70604 .78078 lineto fill grestore gsave 0.001 setlinewidth .70604 .82714 moveto .68535 .82271 lineto stroke grestore gsave .459 setgray .70604 .78078 moveto .67777 .77473 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .70604 .78078 moveto .67777 .77473 lineto stroke grestore gsave .295 setgray .63736 .80991 moveto .68535 .82271 lineto .70604 .84341 lineto .63736 .84341 lineto fill grestore gsave .377 setgray .63736 .80991 moveto .68535 .82271 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .63736 .80991 moveto .68535 .82271 lineto stroke grestore gsave .377 setgray .77473 .84341 moveto .77473 .81041 lineto .71816 .78684 lineto fill grestore gsave .459 setgray .77473 .81041 moveto .71816 .78684 lineto .70604 .77473 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .77473 .81041 moveto .71816 .78684 lineto stroke grestore gsave .295 setgray .70604 .84341 moveto .70604 .82714 lineto .73857 .84341 lineto fill grestore gsave .377 setgray .70604 .82714 moveto .73857 .84341 lineto .77473 .84341 lineto .71816 .78684 lineto .70604 .78078 lineto fill grestore gsave 0.001 setlinewidth .70604 .82714 moveto .73857 .84341 lineto stroke grestore gsave .459 setgray .70604 .78078 moveto .71816 .78684 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .70604 .78078 moveto .71816 .78684 lineto stroke grestore gsave .377 setgray .84341 .84341 moveto .84341 .83239 lineto .82825 .82825 lineto fill grestore gsave .459 setgray .84341 .83239 moveto .82825 .82825 lineto .77473 .77473 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .84341 .83239 moveto .82825 .82825 lineto stroke grestore gsave .377 setgray .77473 .81041 moveto .82825 .82825 lineto .84341 .84341 lineto .77473 .84341 lineto fill grestore gsave .459 setgray .77473 .81041 moveto .82825 .82825 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .77473 .81041 moveto .82825 .82825 lineto stroke grestore gsave .459 setgray .91209 .79385 moveto .84833 .77473 lineto .84341 .77473 lineto .91209 .84341 lineto fill grestore gsave .541 setgray .91209 .79385 moveto .84833 .77473 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .91209 .79385 moveto .84833 .77473 lineto stroke grestore gsave .377 setgray .84341 .84341 moveto .84341 .83239 lineto .87371 .84341 lineto fill grestore gsave .459 setgray .84341 .83239 moveto .87371 .84341 lineto .91209 .84341 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .84341 .83239 moveto .87371 .84341 lineto stroke grestore gsave .459 setgray .98077 .84341 moveto .98077 .81124 lineto .93941 .80205 lineto fill grestore gsave .541 setgray .98077 .81124 moveto .93941 .80205 lineto .91209 .77473 lineto .98077 .77473 lineto fill grestore gsave 0.001 setlinewidth .98077 .81124 moveto .93941 .80205 lineto stroke grestore gsave .459 setgray .91209 .79385 moveto .93941 .80205 lineto .98077 .84341 lineto .91209 .84341 lineto fill grestore gsave .541 setgray .91209 .79385 moveto .93941 .80205 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .91209 .79385 moveto .93941 .80205 lineto stroke grestore gsave .295 setgray 0.08791 .91209 moveto 0.07788 .90205 lineto 0.08791 .89919 lineto fill grestore gsave .377 setgray 0.07788 .90205 moveto 0.08791 .89919 lineto 0.08791 .84341 lineto 0.01923 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.07788 .90205 moveto 0.08791 .89919 lineto stroke grestore gsave .295 setgray 0.08791 .91209 moveto 0.07788 .90205 lineto 0.05781 .91209 lineto fill grestore gsave .377 setgray 0.07788 .90205 moveto 0.05781 .91209 lineto 0.01923 .91209 lineto 0.01923 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.07788 .90205 moveto 0.05781 .91209 lineto stroke grestore gsave .295 setgray .15659 .91209 moveto .12341 .8789 lineto .15659 .86646 lineto fill grestore gsave .377 setgray .12341 .8789 moveto .15659 .86646 lineto .15659 .84341 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth .12341 .8789 moveto .15659 .86646 lineto stroke grestore gsave .295 setgray .12341 .8789 moveto 0.08791 .89919 lineto 0.08791 .91209 lineto .15659 .91209 lineto fill grestore gsave .377 setgray .12341 .8789 moveto 0.08791 .89919 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth .12341 .8789 moveto 0.08791 .89919 lineto stroke grestore gsave .214 setgray .22527 .91209 moveto .2207 .90752 lineto .22527 .90615 lineto fill grestore gsave .295 setgray .2207 .90752 moveto .22527 .90615 lineto .22527 .84341 lineto .21806 .84341 lineto .17078 .85759 lineto fill grestore gsave 0.001 setlinewidth .2207 .90752 moveto .22527 .90615 lineto stroke grestore gsave .377 setgray .17078 .85759 moveto .21806 .84341 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .17078 .85759 moveto .21806 .84341 lineto stroke grestore gsave .214 setgray .22527 .91209 moveto .2207 .90752 lineto .21339 .91209 lineto fill grestore gsave .295 setgray .2207 .90752 moveto .21339 .91209 lineto .15659 .91209 lineto .15659 .86646 lineto .17078 .85759 lineto fill grestore gsave 0.001 setlinewidth .2207 .90752 moveto .21339 .91209 lineto stroke grestore gsave .377 setgray .17078 .85759 moveto .15659 .86646 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .17078 .85759 moveto .15659 .86646 lineto stroke grestore gsave .214 setgray .29396 .91209 moveto .26218 .88031 lineto .29396 .86707 lineto fill grestore gsave .295 setgray .26218 .88031 moveto .29396 .86707 lineto .29396 .84341 lineto .22527 .84341 lineto fill grestore gsave 0.001 setlinewidth .26218 .88031 moveto .29396 .86707 lineto stroke grestore gsave .214 setgray .26218 .88031 moveto .22527 .90615 lineto .22527 .91209 lineto .29396 .91209 lineto fill grestore gsave .295 setgray .26218 .88031 moveto .22527 .90615 lineto .22527 .84341 lineto fill grestore gsave 0.001 setlinewidth .26218 .88031 moveto .22527 .90615 lineto stroke grestore gsave .132 setgray .36264 .91209 moveto .35227 .90172 lineto .36264 .89933 lineto fill grestore gsave .214 setgray .35227 .90172 moveto .36264 .89933 lineto .36264 .8494 lineto .31171 .86116 lineto fill grestore gsave 0.001 setlinewidth .35227 .90172 moveto .36264 .89933 lineto stroke grestore gsave .295 setgray .31171 .86116 moveto .36264 .8494 lineto .36264 .84341 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .31171 .86116 moveto .36264 .8494 lineto stroke grestore gsave .132 setgray .36264 .91209 moveto .35227 .90172 lineto .32117 .91209 lineto fill grestore gsave .214 setgray .35227 .90172 moveto .32117 .91209 lineto .29396 .91209 lineto .29396 .86707 lineto .31171 .86116 lineto fill grestore gsave 0.001 setlinewidth .35227 .90172 moveto .32117 .91209 lineto stroke grestore gsave .295 setgray .31171 .86116 moveto .29396 .86707 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .31171 .86116 moveto .29396 .86707 lineto stroke grestore gsave .132 setgray .43132 .91209 moveto .4054 .88617 lineto .43132 .88272 lineto fill grestore gsave .214 setgray .4054 .88617 moveto .43132 .88272 lineto .43132 .84341 lineto .40161 .84341 lineto .36722 .84799 lineto fill grestore gsave 0.001 setlinewidth .4054 .88617 moveto .43132 .88272 lineto stroke grestore gsave .295 setgray .36722 .84799 moveto .40161 .84341 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36722 .84799 moveto .40161 .84341 lineto stroke grestore gsave .132 setgray .4054 .88617 moveto .36264 .89933 lineto .36264 .91209 lineto .43132 .91209 lineto fill grestore gsave .214 setgray .4054 .88617 moveto .36264 .89933 lineto .36264 .8494 lineto .36722 .84799 lineto fill grestore gsave 0.001 setlinewidth .4054 .88617 moveto .36264 .89933 lineto stroke grestore gsave .295 setgray .36722 .84799 moveto .36264 .8494 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36722 .84799 moveto .36264 .8494 lineto stroke grestore gsave .132 setgray .5 .91209 moveto .46817 .88026 lineto .5 .87814 lineto fill grestore gsave .214 setgray .46817 .88026 moveto .5 .87814 lineto .5 .84341 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .46817 .88026 moveto .5 .87814 lineto stroke grestore gsave .132 setgray .46817 .88026 moveto .43132 .88272 lineto .43132 .91209 lineto .5 .91209 lineto fill grestore gsave .214 setgray .46817 .88026 moveto .43132 .88272 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .46817 .88026 moveto .43132 .88272 lineto stroke grestore gsave .132 setgray .56868 .91209 moveto .56868 .88272 lineto .53721 .88062 lineto fill grestore gsave .214 setgray .56868 .88272 moveto .53721 .88062 lineto .5 .84341 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .56868 .88272 moveto .53721 .88062 lineto stroke grestore gsave .132 setgray .5 .87814 moveto .53721 .88062 lineto .56868 .91209 lineto .5 .91209 lineto fill grestore gsave .214 setgray .5 .87814 moveto .53721 .88062 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .5 .87814 moveto .53721 .88062 lineto stroke grestore gsave .132 setgray .63736 .91209 moveto .63736 .90024 lineto .62228 .89701 lineto fill grestore gsave .214 setgray .63736 .90024 moveto .62228 .89701 lineto .56868 .84341 lineto .58848 .84341 lineto .63736 .85388 lineto fill grestore gsave 0.001 setlinewidth .63736 .90024 moveto .62228 .89701 lineto stroke grestore gsave .295 setgray .63736 .85388 moveto .58848 .84341 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .63736 .85388 moveto .58848 .84341 lineto stroke grestore gsave .132 setgray .56868 .88272 moveto .62228 .89701 lineto .63736 .91209 lineto .56868 .91209 lineto fill grestore gsave .214 setgray .56868 .88272 moveto .62228 .89701 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .56868 .88272 moveto .62228 .89701 lineto stroke grestore gsave .214 setgray .70604 .91209 moveto .70604 .87582 lineto .65366 .8597 lineto fill grestore gsave .295 setgray .70604 .87582 moveto .65366 .8597 lineto .63736 .84341 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .70604 .87582 moveto .65366 .8597 lineto stroke grestore gsave .132 setgray .63736 .91209 moveto .63736 .90024 lineto .67054 .91209 lineto fill grestore gsave .214 setgray .63736 .90024 moveto .67054 .91209 lineto .70604 .91209 lineto .65366 .8597 lineto .63736 .85388 lineto fill grestore gsave 0.001 setlinewidth .63736 .90024 moveto .67054 .91209 lineto stroke grestore gsave .295 setgray .63736 .85388 moveto .65366 .8597 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .63736 .85388 moveto .65366 .8597 lineto stroke grestore gsave .295 setgray .77473 .8645 moveto .73857 .84341 lineto .70604 .84341 lineto .77473 .91209 lineto fill grestore gsave .377 setgray .77473 .8645 moveto .73857 .84341 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .77473 .8645 moveto .73857 .84341 lineto stroke grestore gsave .214 setgray .70604 .91209 moveto .70604 .87582 lineto .76498 .91209 lineto fill grestore gsave .295 setgray .70604 .87582 moveto .76498 .91209 lineto .77473 .91209 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .70604 .87582 moveto .76498 .91209 lineto stroke grestore gsave .295 setgray .84341 .91209 moveto .84341 .89619 lineto .81691 .88559 lineto fill grestore gsave .377 setgray .84341 .89619 moveto .81691 .88559 lineto .77473 .84341 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .84341 .89619 moveto .81691 .88559 lineto stroke grestore gsave .295 setgray .77473 .8645 moveto .81691 .88559 lineto .84341 .91209 lineto .77473 .91209 lineto fill grestore gsave .377 setgray .77473 .8645 moveto .81691 .88559 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .77473 .8645 moveto .81691 .88559 lineto stroke grestore gsave .377 setgray .91209 .85876 moveto .87371 .84341 lineto .84341 .84341 lineto .91209 .91209 lineto fill grestore gsave .459 setgray .91209 .85876 moveto .87371 .84341 lineto .91209 .84341 lineto fill grestore gsave 0.001 setlinewidth .91209 .85876 moveto .87371 .84341 lineto stroke grestore gsave .295 setgray .84341 .91209 moveto .84341 .89619 lineto .88316 .91209 lineto fill grestore gsave .377 setgray .84341 .89619 moveto .88316 .91209 lineto .91209 .91209 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .84341 .89619 moveto .88316 .91209 lineto stroke grestore gsave .377 setgray .98077 .91209 moveto .98077 .88336 lineto .93767 .86899 lineto fill grestore gsave .459 setgray .98077 .88336 moveto .93767 .86899 lineto .91209 .84341 lineto .98077 .84341 lineto fill grestore gsave 0.001 setlinewidth .98077 .88336 moveto .93767 .86899 lineto stroke grestore gsave .377 setgray .91209 .85876 moveto .93767 .86899 lineto .98077 .91209 lineto .91209 .91209 lineto fill grestore gsave .459 setgray .91209 .85876 moveto .93767 .86899 lineto .91209 .84341 lineto fill grestore gsave 0.001 setlinewidth .91209 .85876 moveto .93767 .86899 lineto stroke grestore gsave .295 setgray 0.03576 .92862 moveto 0.05781 .91209 lineto 0.08791 .91209 lineto 0.08791 .98077 lineto fill grestore gsave .377 setgray 0.03576 .92862 moveto 0.05781 .91209 lineto 0.01923 .91209 lineto fill grestore gsave 0.001 setlinewidth 0.03576 .92862 moveto 0.05781 .91209 lineto stroke grestore gsave .295 setgray 0.03576 .92862 moveto 0.01923 .94102 lineto 0.01923 .98077 lineto 0.08791 .98077 lineto fill grestore gsave .377 setgray 0.03576 .92862 moveto 0.01923 .94102 lineto 0.01923 .91209 lineto fill grestore gsave 0.001 setlinewidth 0.03576 .92862 moveto 0.01923 .94102 lineto stroke grestore gsave .214 setgray .15659 .98077 moveto .14999 .97417 lineto .15659 .96889 lineto fill grestore gsave .295 setgray .14999 .97417 moveto .15659 .96889 lineto .15659 .91209 lineto 0.08791 .91209 lineto fill grestore gsave 0.001 setlinewidth .14999 .97417 moveto .15659 .96889 lineto stroke grestore gsave .214 setgray .15659 .98077 moveto .14999 .97417 lineto .14471 .98077 lineto fill grestore gsave .295 setgray .14999 .97417 moveto .14471 .98077 lineto 0.08791 .98077 lineto 0.08791 .91209 lineto fill grestore gsave 0.001 setlinewidth .14999 .97417 moveto .14471 .98077 lineto stroke grestore gsave .214 setgray .18499 .94049 moveto .21339 .91209 lineto .22527 .91209 lineto .22527 .98077 lineto fill grestore gsave .295 setgray .18499 .94049 moveto .21339 .91209 lineto .15659 .91209 lineto fill grestore gsave 0.001 setlinewidth .18499 .94049 moveto .21339 .91209 lineto stroke grestore gsave .214 setgray .18499 .94049 moveto .15659 .96889 lineto .15659 .98077 lineto .22527 .98077 lineto fill grestore gsave .295 setgray .18499 .94049 moveto .15659 .96889 lineto .15659 .91209 lineto fill grestore gsave 0.001 setlinewidth .18499 .94049 moveto .15659 .96889 lineto stroke grestore gsave .132 setgray .29396 .98077 moveto .26739 .9542 lineto .29396 .92764 lineto fill grestore gsave .214 setgray .26739 .9542 moveto .29396 .92764 lineto .29396 .91209 lineto .22527 .91209 lineto fill grestore gsave 0.001 setlinewidth .26739 .9542 moveto .29396 .92764 lineto stroke grestore gsave .132 setgray .29396 .98077 moveto .26739 .9542 lineto .25263 .98077 lineto fill grestore gsave .214 setgray .26739 .9542 moveto .25263 .98077 lineto .22527 .98077 lineto .22527 .91209 lineto fill grestore gsave 0.001 setlinewidth .26739 .9542 moveto .25263 .98077 lineto stroke grestore gsave 0.05 setgray .36264 .98077 moveto .35711 .97525 lineto .36264 .97248 lineto fill grestore gsave .132 setgray .35711 .97525 moveto .36264 .97248 lineto .36264 .91209 lineto .32117 .91209 lineto .30303 .92116 lineto fill grestore gsave 0.001 setlinewidth .35711 .97525 moveto .36264 .97248 lineto stroke grestore gsave .214 setgray .30303 .92116 moveto .32117 .91209 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .30303 .92116 moveto .32117 .91209 lineto stroke grestore gsave 0.05 setgray .36264 .98077 moveto .35711 .97525 lineto .34938 .98077 lineto fill grestore gsave .132 setgray .35711 .97525 moveto .34938 .98077 lineto .29396 .98077 lineto .29396 .92764 lineto .30303 .92116 lineto fill grestore gsave 0.001 setlinewidth .35711 .97525 moveto .34938 .98077 lineto stroke grestore gsave .214 setgray .30303 .92116 moveto .29396 .92764 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .30303 .92116 moveto .29396 .92764 lineto stroke grestore gsave 0.05 setgray .43132 .98077 moveto .4029 .95235 lineto .43132 .93814 lineto fill grestore gsave .132 setgray .4029 .95235 moveto .43132 .93814 lineto .43132 .91209 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .4029 .95235 moveto .43132 .93814 lineto stroke grestore gsave 0.05 setgray .4029 .95235 moveto .36264 .97248 lineto .36264 .98077 lineto .43132 .98077 lineto fill grestore gsave .132 setgray .4029 .95235 moveto .36264 .97248 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .4029 .95235 moveto .36264 .97248 lineto stroke grestore gsave 0.05 setgray .5 .98077 moveto .45216 .93293 lineto .5 .92762 lineto fill grestore gsave .132 setgray .45216 .93293 moveto .5 .92762 lineto .5 .91209 lineto .43132 .91209 lineto fill grestore gsave 0.001 setlinewidth .45216 .93293 moveto .5 .92762 lineto stroke grestore gsave 0.05 setgray .45216 .93293 moveto .43132 .93814 lineto .43132 .98077 lineto .5 .98077 lineto fill grestore gsave .132 setgray .45216 .93293 moveto .43132 .93814 lineto .43132 .91209 lineto fill grestore gsave 0.001 setlinewidth .45216 .93293 moveto .43132 .93814 lineto stroke grestore gsave 0.05 setgray .56868 .98077 moveto .56868 .93525 lineto .51747 .92956 lineto fill grestore gsave .132 setgray .56868 .93525 moveto .51747 .92956 lineto .5 .91209 lineto .56868 .91209 lineto fill grestore gsave 0.001 setlinewidth .56868 .93525 moveto .51747 .92956 lineto stroke grestore gsave 0.05 setgray .5 .92762 moveto .51747 .92956 lineto .56868 .98077 lineto .5 .98077 lineto fill grestore gsave .132 setgray .5 .92762 moveto .51747 .92956 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .5 .92762 moveto .51747 .92956 lineto stroke grestore gsave 0.05 setgray .63736 .98077 moveto .63736 .96577 lineto .61037 .95378 lineto fill grestore gsave .132 setgray .63736 .96577 moveto .61037 .95378 lineto .56868 .91209 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .63736 .96577 moveto .61037 .95378 lineto stroke grestore gsave 0.05 setgray .56868 .93525 moveto .61037 .95378 lineto .63736 .98077 lineto .56868 .98077 lineto fill grestore gsave .132 setgray .56868 .93525 moveto .61037 .95378 lineto .56868 .91209 lineto fill grestore gsave 0.001 setlinewidth .56868 .93525 moveto .61037 .95378 lineto stroke grestore gsave .132 setgray .70604 .93428 moveto .67054 .91209 lineto .63736 .91209 lineto .70604 .98077 lineto fill grestore gsave .214 setgray .70604 .93428 moveto .67054 .91209 lineto .70604 .91209 lineto fill grestore gsave 0.001 setlinewidth .70604 .93428 moveto .67054 .91209 lineto stroke grestore gsave 0.05 setgray .63736 .98077 moveto .63736 .96577 lineto .65986 .98077 lineto fill grestore gsave .132 setgray .63736 .96577 moveto .65986 .98077 lineto .70604 .98077 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .63736 .96577 moveto .65986 .98077 lineto stroke grestore gsave .214 setgray .76498 .91209 moveto .77473 .92322 lineto .77473 .98077 lineto .70604 .91209 lineto fill grestore gsave .295 setgray .76498 .91209 moveto .77473 .92322 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .76498 .91209 moveto .77473 .92322 lineto stroke grestore gsave .132 setgray .70604 .98077 moveto .74737 .98077 lineto .70604 .93428 lineto fill grestore gsave .214 setgray .74737 .98077 moveto .70604 .93428 lineto .70604 .91209 lineto .77473 .98077 lineto fill grestore gsave 0.001 setlinewidth .74737 .98077 moveto .70604 .93428 lineto stroke grestore gsave .295 setgray .84341 .98077 moveto .77473 .91209 lineto .84341 .91209 lineto fill grestore gsave .214 setgray .77473 .98077 moveto .77473 .92322 lineto .84186 .98077 lineto fill grestore gsave .295 setgray .77473 .92322 moveto .84186 .98077 lineto .84341 .98077 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .77473 .92322 moveto .84186 .98077 lineto stroke grestore gsave .295 setgray .91209 .93138 moveto .88316 .91209 lineto .84341 .91209 lineto .91209 .98077 lineto fill grestore gsave .377 setgray .91209 .93138 moveto .88316 .91209 lineto .91209 .91209 lineto fill grestore gsave 0.001 setlinewidth .91209 .93138 moveto .88316 .91209 lineto stroke grestore gsave .295 setgray .84341 .98077 moveto .91209 .98077 lineto .84341 .91209 lineto fill grestore gsave .295 setgray .98077 .98077 moveto .98077 .97716 lineto .96995 .96995 lineto fill grestore gsave .377 setgray .98077 .97716 moveto .96995 .96995 lineto .91209 .91209 lineto .98077 .91209 lineto fill grestore gsave 0.001 setlinewidth .98077 .97716 moveto .96995 .96995 lineto stroke grestore gsave .295 setgray .91209 .93138 moveto .96995 .96995 lineto .98077 .98077 lineto .91209 .98077 lineto fill grestore gsave .377 setgray .91209 .93138 moveto .96995 .96995 lineto .91209 .91209 lineto fill grestore gsave 0.001 setlinewidth .91209 .93138 moveto .96995 .96995 lineto stroke grestore grestore % End of Graphics MathPictureEnd end showpage %%EndDocument endTexFig -158 1625 a 11840716 12551158 2697052 9341009 36245749 44928942 startTexFig 0 rotate -158 1625 a %%BeginDocument: y2a.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 1968 1369 13149 1369 1968 1369 1968 1215 3366 1369 3366 1215 4763 1369 4763 1215 6161 1369 6161 1215 7558 1369 7558 1215 8956 1369 8956 1215 10354 1369 10354 1215 11751 1369 11751 1215 13149 1369 13149 1215 10 dopairs 1400 1842 1400 13057 1400 1842 1246 1842 1400 3244 1246 3244 1400 4645 1246 4645 1400 6047 1246 6047 1400 7449 1246 7449 1400 8851 1246 8851 1400 10253 1246 10253 1400 11655 1246 11655 1400 13057 1246 13057 10 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 130 def /symbsiz 130 def /symbw 260 def /symbh 720 def /ori 69.81 def /showmark {plotsymb} def /symbary [0 0 130 312 -87 0 0 408 -86 0 0 -408 -87 0 130 -312] def % Arrow /fillcolor {0.0 0.0 0.0} def 3117 2567 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 168 def /symbsiz 168 def /symbw 336 def /symbh 928 def /ori 71.58 def /showmark {plotsymb} def /symbary [0 0 168 403 -112 0 0 525 -112 0 0 -525 -112 0 168 -403] def % Arrow /fillcolor {0.0 0.0 0.0} def 3072 6568 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 101 def /symbsiz 101 def /symbw 202 def /symbh 560 def /ori 347.09 def /showmark {plotsymb} def /symbary [0 0 101 242 -68 0 0 318 -66 0 0 -318 -68 0 101 -242] def % Arrow /fillcolor {0.0 0.0 0.0} def 2821 11780 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 125 def /symbsiz 125 def /symbw 250 def /symbh 690 def /ori 68.31 def /showmark {plotsymb} def /symbary [0 0 125 299 -84 0 0 391 -82 0 0 -391 -84 0 125 -299] def % Arrow /fillcolor {0.0 0.0 0.0} def 7303 2602 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 82 def /symbsiz 82 def /symbw 164 def /symbh 452 def /ori 328.49 def /showmark {plotsymb} def /symbary [0 0 82 196 -55 0 0 256 -54 0 0 -256 -55 0 82 -196] def % Arrow /fillcolor {0.0 0.0 0.0} def 7172 7686 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 117 def /symbsiz 117 def /symbw 234 def /symbh 644 def /ori 311.05 def /showmark {plotsymb} def /symbary [0 0 117 280 -78 0 0 364 -78 0 0 -364 -78 0 117 -280] def % Arrow /fillcolor {0.0 0.0 0.0} def 7135 12141 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 33 def /symbsiz 33 def /symbw 66 def /symbh 184 def /ori 310.98 def /showmark {plotsymb} def /symbary [0 0 33 79 -22 0 0 105 -22 0 0 -105 -22 0 33 -79] def % Arrow /fillcolor {0.0 0.0 0.0} def 11630 3383 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 247 def /symbsiz 247 def /symbw 494 def /symbh 1368 def /ori 261.97 def /showmark {plotsymb} def /symbary [0 0 247 592 -165 0 0 776 -164 0 0 -776 -165 0 247 -592] def % Arrow /fillcolor {0.0 0.0 0.0} def 11942 8805 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 141 def /symbsiz 141 def /symbw 282 def /symbh 778 def /ori 264.33 def /showmark {plotsymb} def /symbary [0 0 141 338 -94 0 0 440 -94 0 0 -440 -94 0 141 -338] def % Arrow /fillcolor {0.0 0.0 0.0} def 11828 12430 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 237 def /symbsiz 237 def /symbw 474 def /symbh 1312 def /ori 92.48 def /showmark {plotsymb} def /symbary [0 0 237 568 -158 0 0 744 -158 0 0 -744 -158 0 237 -568] def % Arrow /fillcolor {0.0 0.0 0.0} def 5519 6138 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 313 def /symbsiz 313 def /symbw 626 def /symbh 1734 def /ori 266.82 def /showmark {plotsymb} def /symbary [0 0 313 751 -209 0 0 983 -208 0 0 -983 -209 0 313 -751] def % Arrow /fillcolor {0.0 0.0 0.0} def 9751 9181 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /symbfil {nofill} def /patternw 286 def /symbsiz 286 def /symbw 572 def /symbh 730 def /ori 76.64 def /ratio 1.276224 def /showmark {doellipse} def 9751 9181 1 {showmark} repeat /patternw 222 def /symbsiz 222 def /symbw 444 def /symbh 600 def /ori 99.10 def /ratio 1.351351 def /showmark {doellipse} def 3117 2567 1 {showmark} repeat /patternw 294 def /symbsiz 294 def /symbw 588 def /symbh 840 def /ori 119.58 def /ratio 1.428571 def /showmark {doellipse} def 3072 6568 1 {showmark} repeat /patternw 182 def /symbsiz 182 def /symbw 364 def /symbh 454 def /ori 134.32 def /ratio 1.247253 def /showmark {doellipse} def 2821 11780 1 {showmark} repeat /patternw 147 def /symbsiz 147 def /symbw 294 def /symbh 558 def /ori 90.41 def /ratio 1.897959 def /showmark {doellipse} def 7303 2602 1 {showmark} repeat /patternw 217 def /symbsiz 217 def /symbw 434 def /symbh 568 def /ori 119.61 def /ratio 1.308756 def /showmark {doellipse} def 7172 7686 1 {showmark} repeat /patternw 176 def /symbsiz 176 def /symbw 352 def /symbh 414 def /ori 120.90 def /ratio 1.176136 def /showmark {doellipse} def 7135 12141 1 {showmark} repeat /patternw 190 def /symbsiz 190 def /symbw 380 def /symbh 512 def /ori 87.78 def /ratio 1.347368 def /showmark {doellipse} def 11630 3383 1 {showmark} repeat /patternw 288 def /symbsiz 288 def /symbw 576 def /symbh 792 def /ori 64.58 def /ratio 1.375000 def /showmark {doellipse} def 11942 8805 1 {showmark} repeat /patternw 211 def /symbsiz 211 def /symbw 422 def /symbh 606 def /ori 8.29 def /ratio 1.436019 def /showmark {doellipse} def 11828 12430 1 {showmark} repeat /patternw 281 def /symbsiz 281 def /symbw 562 def /symbh 848 def /ori 113.88 def /ratio 1.508897 def /showmark {doellipse} def 5519 6138 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def 11 7638 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7760 -317 (X \(cm\)) sprnt /fontsiz 855 def /spacesiz 57 def /fontsiz 855 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -475 14578 (c\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 1968 1076 (-15) sprnt 3366 1076 (-10) sprnt 4763 1076 (-5) sprnt 6161 1076 (0) sprnt 7558 1076 (5) sprnt 8956 1076 (10) sprnt 10354 1076 (15) sprnt 11751 1076 (20) sprnt 13149 1076 (25) sprnt /txtpos [1.00 0.35] def 1106 1842 (15) sprnt 1106 3244 (20) sprnt 1106 4645 (25) sprnt 1106 6047 (30) sprnt 1106 7449 (35) sprnt 1106 8851 (40) sprnt 1106 10253 (45) sprnt 1106 11655 (50) sprnt 1106 13057 (55) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 608 1625 a 11840716 12551158 2499706 9341009 36245749 45192069 startTexFig 0 rotate 608 1625 a %%BeginDocument: y2b.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 1450 4255 translate 13 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 1968 1369 13149 1369 1968 1369 1968 1215 3366 1369 3366 1215 4763 1369 4763 1215 6161 1369 6161 1215 7558 1369 7558 1215 8956 1369 8956 1215 10354 1369 10354 1215 11751 1369 11751 1215 13149 1369 13149 1215 10 dopairs 1400 1842 1400 13057 1400 1842 1246 1842 1400 3244 1246 3244 1400 4645 1246 4645 1400 6047 1246 6047 1400 7449 1246 7449 1400 8851 1246 8851 1400 10253 1246 10253 1400 11655 1246 11655 1400 13057 1246 13057 10 dopairs % Data Set 1: % No data in this line % No data in this line 8 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 130 def /symbsiz 130 def /symbw 260 def /symbh 720 def /ori 69.79 def /showmark {plotsymb} def /symbary [0 0 130 311 -87 0 0 409 -86 0 0 -409 -87 0 130 -311] def % Arrow /fillcolor {0.0 0.0 0.0} def 3117 2567 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 132 def /symbsiz 132 def /symbw 264 def /symbh 732 def /ori 70.16 def /showmark {plotsymb} def /symbary [0 0 132 316 -88 0 0 416 -88 0 0 -416 -88 0 132 -316] def % Arrow /fillcolor {0.0 0.0 0.0} def 3117 3955 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 171 def /symbsiz 171 def /symbw 342 def /symbh 946 def /ori 74.05 def /showmark {plotsymb} def /symbary [0 0 171 410 -114 0 0 536 -114 0 0 -536 -114 0 171 -410] def % Arrow /fillcolor {0.0 0.0 0.0} def 3106 5136 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 173 def /symbsiz 173 def /symbw 346 def /symbh 956 def /ori 74.05 def /showmark {plotsymb} def /symbary [0 0 173 415 -116 0 0 541 -114 0 0 -541 -116 0 173 -415] def % Arrow /fillcolor {0.0 0.0 0.0} def 3103 6529 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 166 def /symbsiz 166 def /symbw 332 def /symbh 918 def /ori 72.65 def /showmark {plotsymb} def /symbary [0 0 166 398 -111 0 0 520 -110 0 0 -520 -111 0 166 -398] def % Arrow /fillcolor {0.0 0.0 0.0} def 3092 7973 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 97 def /symbsiz 97 def /symbw 194 def /symbh 536 def /ori 352.23 def /showmark {plotsymb} def /symbary [0 0 97 232 -65 0 0 304 -64 0 0 -304 -65 0 97 -232] def % Arrow /fillcolor {0.0 0.0 0.0} def 2835 10326 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 101 def /symbsiz 101 def /symbw 202 def /symbh 558 def /ori 347.27 def /showmark {plotsymb} def /symbary [0 0 101 242 -68 0 0 316 -66 0 0 -316 -68 0 101 -242] def % Arrow /fillcolor {0.0 0.0 0.0} def 2821 11778 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 130 def /symbsiz 130 def /symbw 260 def /symbh 720 def /ori 69.79 def /showmark {plotsymb} def /symbary [0 0 130 312 -87 0 0 408 -86 0 0 -408 -87 0 130 -312] def % Arrow /fillcolor {0.0 0.0 0.0} def 4514 2567 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 139 def /symbsiz 139 def /symbw 278 def /symbh 768 def /ori 72.88 def /showmark {plotsymb} def /symbary [0 0 139 333 -93 0 0 435 -92 0 0 -435 -93 0 139 -333] def % Arrow /fillcolor {0.0 0.0 0.0} def 4537 3911 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 208 def /symbsiz 208 def /symbw 416 def /symbh 1148 def /ori 86.95 def /showmark {plotsymb} def /symbary [0 0 208 499 -139 0 0 649 -138 0 0 -649 -139 0 208 -499] def % Arrow /fillcolor {0.0 0.0 0.0} def 4702 4900 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 209 def /symbsiz 209 def /symbw 418 def /symbh 1152 def /ori 87.09 def /showmark {plotsymb} def /symbary [0 0 209 501 -140 0 0 651 -138 0 0 -651 -140 0 209 -501] def % Arrow /fillcolor {0.0 0.0 0.0} def 4705 6297 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 205 def /symbsiz 205 def /symbw 410 def /symbh 1138 def /ori 86.61 def /showmark {plotsymb} def /symbary [0 0 205 491 -137 0 0 647 -136 0 0 -647 -137 0 205 -491] def % Arrow /fillcolor {0.0 0.0 0.0} def 4696 7716 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 87 def /symbsiz 87 def /symbw 174 def /symbh 480 def /ori 2.71 def /showmark {plotsymb} def /symbary [0 0 87 208 -58 0 0 272 -58 0 0 -272 -58 0 87 -208] def % Arrow /fillcolor {0.0 0.0 0.0} def 4283 10230 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 101 def /symbsiz 101 def /symbw 202 def /symbh 558 def /ori 345.48 def /showmark {plotsymb} def /symbary [0 0 101 242 -68 0 0 316 -66 0 0 -316 -68 0 101 -242] def % Arrow /fillcolor {0.0 0.0 0.0} def 4224 11795 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 125 def /symbsiz 125 def /symbw 250 def /symbh 690 def /ori 68.40 def /showmark {plotsymb} def /symbary [0 0 125 299 -84 0 0 391 -82 0 0 -391 -84 0 125 -299] def % Arrow /fillcolor {0.0 0.0 0.0} def 5907 2602 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 127 def /symbsiz 127 def /symbw 254 def /symbh 704 def /ori 70.53 def /showmark {plotsymb} def /symbary [0 0 127 304 -85 0 0 400 -84 0 0 -400 -85 0 127 -304] def % Arrow /fillcolor {0.0 0.0 0.0} def 5926 3981 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 148 def /symbsiz 148 def /symbw 296 def /symbh 818 def /ori 83.75 def /showmark {plotsymb} def /symbary [0 0 148 355 -99 0 0 463 -98 0 0 -463 -99 0 148 -355] def % Arrow /fillcolor {0.0 0.0 0.0} def 6072 5234 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 148 def /symbsiz 148 def /symbw 296 def /symbh 820 def /ori 83.95 def /showmark {plotsymb} def /symbary [0 0 148 355 -99 0 0 465 -98 0 0 -465 -99 0 148 -355] def % Arrow /fillcolor {0.0 0.0 0.0} def 6074 6633 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 145 def /symbsiz 145 def /symbw 290 def /symbh 802 def /ori 83.37 def /showmark {plotsymb} def /symbary [0 0 145 348 -97 0 0 454 -96 0 0 -454 -97 0 145 -348] def % Arrow /fillcolor {0.0 0.0 0.0} def 6068 8055 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 90 def /symbsiz 90 def /symbw 180 def /symbh 494 def /ori 321.39 def /showmark {plotsymb} def /symbary [0 0 90 216 -60 0 0 278 -60 0 0 -278 -60 0 90 -216] def % Arrow /fillcolor {0.0 0.0 0.0} def 5775 10561 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 115 def /symbsiz 115 def /symbw 230 def /symbh 636 def /ori 312.27 def /showmark {plotsymb} def /symbary [0 0 115 276 -77 0 0 360 -76 0 0 -360 -77 0 115 -276] def % Arrow /fillcolor {0.0 0.0 0.0} def 5733 12126 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 125 def /symbsiz 125 def /symbw 250 def /symbh 688 def /ori 68.32 def /showmark {plotsymb} def /symbary [0 0 125 300 -84 0 0 388 -82 0 0 -388 -84 0 125 -300] def % Arrow /fillcolor {0.0 0.0 0.0} def 7304 2604 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 117 def /symbsiz 117 def /symbw 234 def /symbh 648 def /ori 66.65 def /showmark {plotsymb} def /symbary [0 0 117 280 -78 0 0 368 -78 0 0 -368 -78 0 117 -280] def % Arrow /fillcolor {0.0 0.0 0.0} def 7302 4051 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 66 def /symbsiz 66 def /symbw 132 def /symbh 366 def /ori 327.07 def /showmark {plotsymb} def /symbary [0 0 66 158 -44 0 0 208 -44 0 0 -208 -44 0 66 -158] def % Arrow /fillcolor {0.0 0.0 0.0} def 7251 6246 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 70 def /symbsiz 70 def /symbw 140 def /symbh 386 def /ori 322.92 def /showmark {plotsymb} def /symbary [0 0 70 168 -47 0 0 218 -46 0 0 -218 -47 0 70 -168] def % Arrow /fillcolor {0.0 0.0 0.0} def 7251 7682 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 72 def /symbsiz 72 def /symbw 144 def /symbh 394 def /ori 322.37 def /showmark {plotsymb} def /symbary [0 0 72 172 -48 0 0 222 -48 0 0 -222 -48 0 72 -172] def % Arrow /fillcolor {0.0 0.0 0.0} def 7246 9092 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 114 def /symbsiz 114 def /symbw 228 def /symbh 630 def /ori 311.35 def /showmark {plotsymb} def /symbary [0 0 114 273 -76 0 0 357 -76 0 0 -357 -76 0 114 -273] def % Arrow /fillcolor {0.0 0.0 0.0} def 7142 10726 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 117 def /symbsiz 117 def /symbw 234 def /symbh 646 def /ori 311.00 def /showmark {plotsymb} def /symbary [0 0 117 280 -78 0 0 366 -78 0 0 -366 -78 0 117 -280] def % Arrow /fillcolor {0.0 0.0 0.0} def 7134 12143 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 118 def /symbsiz 118 def /symbw 236 def /symbh 654 def /ori 67.64 def /showmark {plotsymb} def /symbary [0 0 118 283 -79 0 0 371 -78 0 0 -371 -79 0 118 -283] def % Arrow /fillcolor {0.0 0.0 0.0} def 8707 2638 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 79 def /symbsiz 79 def /symbw 158 def /symbh 434 def /ori 59.06 def /showmark {plotsymb} def /symbary [0 0 79 189 -53 0 0 245 -52 0 0 -245 -53 0 79 -189] def % Arrow /fillcolor {0.0 0.0 0.0} def 8732 4272 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 222 def /symbsiz 222 def /symbw 444 def /symbh 1228 def /ori 272.61 def /showmark {plotsymb} def /symbary [0 0 222 532 -148 0 0 696 -148 0 0 -696 -148 0 222 -532] def % Arrow /fillcolor {0.0 0.0 0.0} def 8900 7275 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 227 def /symbsiz 227 def /symbw 454 def /symbh 1254 def /ori 272.43 def /showmark {plotsymb} def /symbary [0 0 227 544 -152 0 0 710 -150 0 0 -710 -152 0 227 -544] def % Arrow /fillcolor {0.0 0.0 0.0} def 8903 8703 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 225 def /symbsiz 225 def /symbw 450 def /symbh 1242 def /ori 272.70 def /showmark {plotsymb} def /symbary [0 0 225 539 -150 0 0 703 -150 0 0 -703 -150 0 225 -539] def % Arrow /fillcolor {0.0 0.0 0.0} def 8897 10093 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 125 def /symbsiz 125 def /symbw 250 def /symbh 694 def /ori 301.05 def /showmark {plotsymb} def /symbary [0 0 125 299 -84 0 0 395 -82 0 0 -395 -84 0 125 -299] def % Arrow /fillcolor {0.0 0.0 0.0} def 8598 10848 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 116 def /symbsiz 116 def /symbw 232 def /symbh 640 def /ori 308.92 def /showmark {plotsymb} def /symbary [0 0 116 278 -78 0 0 362 -76 0 0 -362 -78 0 116 -278] def % Arrow /fillcolor {0.0 0.0 0.0} def 8553 12154 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 30 def /symbsiz 30 def /symbw 60 def /symbh 166 def /ori 321.01 def /showmark {plotsymb} def /symbary [0 0 30 72 -20 0 0 94 -20 0 0 -94 -20 0 30 -72] def % Arrow /fillcolor {0.0 0.0 0.0} def 10225 3347 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 55 def /symbsiz 55 def /symbw 110 def /symbh 308 def /ori 288.54 def /showmark {plotsymb} def /symbary [0 0 55 132 -37 0 0 176 -36 0 0 -176 -37 0 55 -132] def % Arrow /fillcolor {0.0 0.0 0.0} def 10256 4937 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 284 def /symbsiz 284 def /symbw 568 def /symbh 1574 def /ori 265.83 def /showmark {plotsymb} def /symbary [0 0 284 681 -190 0 0 893 -188 0 0 -893 -190 0 284 -681] def % Arrow /fillcolor {0.0 0.0 0.0} def 10468 7618 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 289 def /symbsiz 289 def /symbw 578 def /symbh 1596 def /ori 265.67 def /showmark {plotsymb} def /symbary [0 0 289 693 -193 0 0 903 -192 0 0 -903 -193 0 289 -693] def % Arrow /fillcolor {0.0 0.0 0.0} def 10474 9042 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 286 def /symbsiz 286 def /symbw 572 def /symbh 1582 def /ori 265.76 def /showmark {plotsymb} def /symbary [0 0 286 686 -191 0 0 896 -190 0 0 -896 -191 0 286 -686] def % Arrow /fillcolor {0.0 0.0 0.0} def 10471 10430 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 157 def /symbsiz 157 def /symbw 314 def /symbh 868 def /ori 265.96 def /showmark {plotsymb} def /symbary [0 0 157 376 -105 0 0 492 -104 0 0 -492 -105 0 157 -376] def % Arrow /fillcolor {0.0 0.0 0.0} def 10415 11120 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 138 def /symbsiz 138 def /symbw 276 def /symbh 764 def /ori 266.00 def /showmark {plotsymb} def /symbary [0 0 138 331 -92 0 0 433 -92 0 0 -433 -92 0 138 -331] def % Arrow /fillcolor {0.0 0.0 0.0} def 10407 12418 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 34 def /symbsiz 34 def /symbw 68 def /symbh 186 def /ori 311.21 def /showmark {plotsymb} def /symbary [0 0 34 81 -23 0 0 105 -22 0 0 -105 -23 0 34 -81] def % Arrow /fillcolor {0.0 0.0 0.0} def 11628 3384 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 228 def /ori 297.84 def /showmark {plotsymb} def /symbary [0 0 41 98 -28 0 0 130 -26 0 0 -130 -28 0 41 -98] def % Arrow /fillcolor {0.0 0.0 0.0} def 11644 4847 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 244 def /symbsiz 244 def /symbw 488 def /symbh 1350 def /ori 262.76 def /showmark {plotsymb} def /symbary [0 0 244 585 -163 0 0 765 -162 0 0 -765 -163 0 244 -585] def % Arrow /fillcolor {0.0 0.0 0.0} def 11921 7387 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 253 def /symbsiz 253 def /symbw 506 def /symbh 1402 def /ori 262.56 def /showmark {plotsymb} def /symbary [0 0 253 607 -169 0 0 795 -168 0 0 -795 -169 0 253 -607] def % Arrow /fillcolor {0.0 0.0 0.0} def 11933 8840 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 249 def /symbsiz 249 def /symbw 498 def /symbh 1376 def /ori 262.53 def /showmark {plotsymb} def /symbary [0 0 249 597 -166 0 0 779 -166 0 0 -779 -166 0 249 -597] def % Arrow /fillcolor {0.0 0.0 0.0} def 11930 10216 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 146 def /symbsiz 146 def /symbw 292 def /symbh 808 def /ori 264.23 def /showmark {plotsymb} def /symbary [0 0 146 350 -98 0 0 458 -96 0 0 -458 -98 0 146 -350] def % Arrow /fillcolor {0.0 0.0 0.0} def 11832 11058 1 {showmark} repeat /fillcolor {0.0 0.0 0.0} def /patternw 141 def /symbsiz 141 def /symbw 282 def /symbh 778 def /ori 264.46 def /showmark {plotsymb} def /symbary [0 0 141 338 -94 0 0 440 -94 0 0 -440 -94 0 141 -338] def % Arrow /fillcolor {0.0 0.0 0.0} def 11826 12429 1 {showmark} repeat /fontsiz 670 def /spacesiz 44 def /fontsiz 670 def /spacesiz 44 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 55 def /txtpos [0.50 0.00] def 11 7638 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 7796 -317 (X \(cm\)) sprnt /fontsiz 855 def /spacesiz 57 def /fontsiz 855 def /spacesiz 57 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 71 def /txtpos [0.50 1.00] def -545 14684 (f\)) sprnt /txtpos [0.00 0.00] def /fontsiz 571 def /spacesiz 38 def /fontsiz 571 def /spacesiz 38 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 47 def /txtpos [0.50 1.00] def 1968 1076 (-15) sprnt 3366 1076 (-10) sprnt 4763 1076 (-5) sprnt 6161 1076 (0) sprnt 7558 1076 (5) sprnt 8956 1076 (10) sprnt 10354 1076 (15) sprnt 11751 1076 (20) sprnt 13149 1076 (25) sprnt /txtpos [1.00 0.35] def 1106 1842 (15) sprnt 1106 3244 (20) sprnt 1106 4645 (25) sprnt 1106 6047 (30) sprnt 1106 7449 (35) sprnt 1106 8851 (40) sprnt 1106 10253 (45) sprnt 1106 11655 (50) sprnt 1106 13057 (55) sprnt -1450 -4255 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 1374 1655 a 11840716 12077530 4736286 9867264 35522150 41442508 startTexFig 0 rotate 1374 1655 a %%BeginDocument: y2c.ps /Mathdict 100 dict def Mathdict begin /Mlmarg 1.0 72 mul def /Mrmarg 1.0 72 mul def /Mbmarg 1.0 72 mul def /Mtmarg 1.0 72 mul def /Mwidth 8.5 72 mul def /Mheight 11 72 mul def /Mtransform { } bind def /Mnodistort true def /Mfixwid false def /Mfixdash false def /Mrot 0 def /Mpstart { MathPictureStart } bind def /Mpend { MathPictureEnd } bind def /Mscale { 0 1 0 1 5 -1 roll MathScale } bind def /ISOLatin1Encoding dup where { pop pop } { [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def } ifelse /MFontDict 50 dict def /MStrCat { exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval } def /MCreateEncoding { 1 index 255 string cvs (-) MStrCat 1 index MStrCat cvn exch (Encoding) MStrCat cvn dup where { exch get } { pop StandardEncoding } ifelse 3 1 roll dup MFontDict exch known not { 1 index findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put } if exch pop exch pop } def /ISOLatin1 { (ISOLatin1) MCreateEncoding } def /ISO8859 { (ISOLatin1) MCreateEncoding } def /Mcopyfont { dup maxlength dict exch { 1 index /FID eq { pop pop } { 2 index 3 1 roll put } ifelse } forall } def /Plain /Helvetica findfont Mcopyfont definefont pop /Bold /Helvetica-Bold findfont Mcopyfont definefont pop /Italic /Helvetica-Oblique findfont Mcopyfont definefont pop /MathPictureStart { gsave Mtransform Mlmarg Mbmarg translate /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def } bind def /MathPictureEnd { grestore } bind def /MathSubStart { Momatrix Mgmatrix Mtmatrix Mlmarg Mrmarg Mbmarg Mtmarg Mwidth Mheight 11 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 13 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def } bind def /MathSubEnd { /Mheight exch def /Mwidth exch def /Mtmarg exch def /Mbmarg exch def /Mrmarg exch def /Mlmarg exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def } bind def /Mdot { moveto 0 0 rlineto stroke } bind def /Mtetra { moveto lineto lineto lineto fill } bind def /Metetra { moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke } bind def /Mistroke { flattenpath 0 0 0 { 4 2 roll pop pop } { 4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll } { stop } { stop } pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash } bind def /Mfstroke { stroke currentdash pop 0 setdash } bind def /Mrotsboxa { gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def } bind def /Msboxa { newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot [ 7 -2 roll 2 copy [ 3 1 roll 10 -1 roll 9 -1 roll ] 6 1 roll 5 -2 roll ] } bind def /Msboxa1 { sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul } bind def /Mvboxa { Mfixwid { Mvboxa1 } { dup Mwidthcal 0 exch { add } forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll } ifelse } bind def /Mvboxa1 { gsave newpath [ true 3 -1 roll { Mbbox 5 -1 roll { 0 5 1 roll } { 7 -1 roll exch sub (m) stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll } ifelse false } forall { stop } if counttomark 1 add 4 roll ] grestore } bind def /Mbbox { 1 dict begin 0 0 moveto /temp (T) def { gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto} forall pathbbox newpath end } bind def /Mmin { 2 copy gt { exch } if pop } bind def /Mmax { 2 copy lt { exch } if pop } bind def /Mrotshowa { dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def } bind def /Mshowa { 4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid { Mshowax } { Mshoway } ifelse pop pop pop pop Mgmatrix setmatrix } bind def /Mshowax { 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash { Mfixdashp } if show } for } bind def /Mfixdashp { dup length 1 gt 1 index true exch { 45 eq and } forall and { gsave (--) stringwidth pop (-) stringwidth pop sub 2 div 0 rmoveto dup length 1 sub { (-) show } repeat grestore } if } bind def /Mshoway { 3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get [ 6 index aload length 2 add -1 roll { pop Strform stringwidth pop neg exch add 0 rmoveto } exch kshow cleartomark } for pop } bind def /Mwidthcal { [ exch { Mwidthcal1 } forall ] [ exch dup Maxlen -1 add 0 1 3 -1 roll { [ exch 2 index { 1 index Mget exch } forall pop Maxget exch } for pop ] Mreva } bind def /Mreva { [ exch aload length -1 1 {1 roll} for ] } bind def /Mget { 1 index length -1 add 1 index ge { get } { pop pop 0 } ifelse } bind def /Maxlen { [ exch { length } forall Maxget } bind def /Maxget { counttomark -1 add 1 1 3 -1 roll { pop Mmax } for exch pop } bind def /Mwidthcal1 { [ exch { Strform stringwidth pop } forall ] } bind def /Strform { /tem (x) def tem 0 3 -1 roll put tem } bind def /Mshowa1 { 2 copy add 4 1 roll sub mul sub -2 div } bind def /MathScale { Mwidth Mlmarg Mrmarg add sub Mheight Mbmarg Mtmarg add sub 0 0 moveto 1 index 0 lineto 2 copy lineto 0 1 index lineto clip newpath Mlp translate dup /Mathabs exch def scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def } bind def /Mlp { 3 copy Mlpfirst { Mnodistort { Mmin dup } if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and { exit } if 3 -1 roll pop pop } loop exch 3 1 roll 7 -3 roll pop pop pop } bind def /Mlpfirst { 3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div } bind def /Mlprun { 2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll { 3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll } forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll } bind def /Mlprun1 { aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add } bind def /Mlprun2 { 2 copy add 2 div 3 1 roll exch sub } bind def /Mlpminmax { cvx 2 index 6 index 2 index exec { 7 -3 roll 4 -1 roll } if 1 index 5 index 3 -1 roll exec { 4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop [ 8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll ] 4 1 roll pop } { pop pop pop } ifelse } bind def /Mlp1 { 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not { 1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll } if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch } bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner { outflag 1 eq { /outflag 0 def /intop 0 def /inrht 0 def } if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt { /intop exch def } { pop } ifelse dup inrht gt { /inrht exch def } { pop } ifelse pop /inflag 1 def } bind def /Mouter { /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq { dup 0 lt { dup intop mul neg /yadtop exch def } if dup 0 gt { dup intop mul /yadbot exch def } if pop dup 0 lt { dup inrht mul neg /xadrht exch def } if dup 0 gt { dup inrht mul /xadlft exch def } if pop /outflag 1 def } { pop pop} ifelse /inflag 0 def /inrht 0 def /intop 0 def } bind def /Mboxout { outflag 1 eq { 4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def } if } bind def /leadjust { (m) stringwidth pop .5 mul } bind def /Mrotcheck { dup 90 eq { yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def } if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop } bind def /Checkaux { 4 index exch 4 index mul 3 1 roll mul add 4 1 roll } bind def /Mboxrot { Mrot 90 eq { brotaux 4 2 roll } if Mrot 180 eq { 4 2 roll brotaux 4 2 roll brotaux } if Mrot 270 eq { 4 2 roll brotaux } if } bind def /brotaux { neg exch neg } bind def /Mabswid { Mathabs div setlinewidth } bind def /Mabsdash { exch Mathabs [ 3 1 roll exch { exch dup 3 -1 roll exch div exch } forall pop ] exch setdash } bind def /MBeginOrig { Momatrix concat} bind def /MEndOrig { Mgmatrix setmatrix} bind def /colorimage where { pop } { /colorimage { 3 1 roll pop pop 5 -1 roll mul 4 1 roll { currentfile 1 index readhexstring pop } image } bind def } ifelse /sampledsound where { pop} { /sampledsound { exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def { Mtempproc pop} repeat } bind def } ifelse /setcmykcolor where { pop} { /setcmykcolor { 4 1 roll [ 4 1 roll ] { 1 index sub 1 sub neg dup 0 lt { pop 0 } if dup 1 gt { pop 1 } if exch } forall pop setrgbcolor } bind def } ifelse MathPictureStart /Helvetica findfont 25 scalefont setfont % Scaling calculations 0.00320513 0.0160256 0.00320513 0.0160256 [ [(-10)] 0.03526 0 0 2 0 Minner Mrotsboxa [(0)] .32372 0 0 2 0 Minner Mrotsboxa [(10)] .64423 0 0 2 0 Minner Mrotsboxa [(20)] .96474 0 0 2 0 Minner Mrotsboxa [(X \(cm\))] .5 0.07 0 2 0 0 -1 Mouter Mrotsboxa [(20)] -0.0125 0.03526 1 0 0 Minner Mrotsboxa [(30)] -0.0125 .32372 1 0 0 Minner Mrotsboxa [(40)] -0.0125 .64423 1 0 0 Minner Mrotsboxa [(50)] -0.0125 .96474 1 0 0 Minner Mrotsboxa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotsboxa [(i\) )] .12 0.93 0 -4 Msboxa [ -0.001 -0.001 0 0 ] [ 1.001 1.001 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 setgray gsave gsave gsave 0.002 setlinewidth 0.03526 0 moveto 0.03526 0.00625 lineto stroke grestore [(-10)] 0.03526 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .32372 0 moveto .32372 0.00625 lineto stroke grestore [(0)] .32372 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .64423 0 moveto .64423 0.00625 lineto stroke grestore [(10)] .64423 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .96474 0 moveto .96474 0.00625 lineto stroke grestore [(20)] .96474 0 0 2 0 Minner Mrotshowa [(X \(cm\))] .5 0.07 0 2 0 0 -1 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 1 0 lineto stroke grestore gsave 0.002 setlinewidth 0 0.03526 moveto 0.00625 0.03526 lineto stroke grestore [(20)] -0.0125 0.03526 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .32372 moveto 0.00625 .32372 lineto stroke grestore [(30)] -0.0125 .32372 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .64423 moveto 0.00625 .64423 lineto stroke grestore [(40)] -0.0125 .64423 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .96474 moveto 0.00625 .96474 lineto stroke grestore [(50)] -0.0125 .96474 1 0 0 Minner Mrotshowa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 0 1 lineto stroke grestore grestore gsave gsave 0.002 setlinewidth 0.03526 .99375 moveto 0.03526 1 lineto stroke grestore gsave 0.002 setlinewidth .32372 .99375 moveto .32372 1 lineto stroke grestore gsave 0.002 setlinewidth .64423 .99375 moveto .64423 1 lineto stroke grestore gsave 0.002 setlinewidth .96474 .99375 moveto .96474 1 lineto stroke grestore [(i\) )] .12 0.93 0 -4 Mshowa gsave 0.002 setlinewidth 0 1 moveto 1 1 lineto stroke grestore gsave 0.002 setlinewidth .99375 0.03526 moveto 1 0.03526 lineto stroke grestore gsave 0.002 setlinewidth .99375 .32372 moveto 1 .32372 lineto stroke grestore gsave 0.002 setlinewidth .99375 .64423 moveto 1 .64423 lineto stroke grestore gsave 0.002 setlinewidth .99375 .96474 moveto 1 .96474 lineto stroke grestore gsave 0.002 setlinewidth 1 0 moveto 1 1 lineto stroke grestore grestore gsave grestore grestore 0 0 moveto 1 0 lineto 1 1 lineto 0 1 lineto closepath clip newpath gsave gsave .214 setgray 0.08791 0.08791 moveto 0.01923 0.01923 lineto 0.08791 0.01923 lineto fill grestore gsave .214 setgray 0.08791 0.08791 moveto 0.01923 0.08791 lineto 0.01923 0.01923 lineto fill grestore gsave .214 setgray .15659 0.08791 moveto 0.08791 0.01923 lineto .15659 0.01923 lineto fill grestore gsave .214 setgray .15659 0.08791 moveto 0.08791 0.08791 lineto 0.08791 0.01923 lineto fill grestore gsave .214 setgray .15659 0.01923 moveto .22527 0.08791 lineto .22527 0.01923 lineto fill grestore gsave .214 setgray .15659 0.08791 moveto .22527 0.08791 lineto .15659 0.01923 lineto fill grestore gsave .214 setgray .22527 0.01923 moveto .29396 0.01923 lineto .29396 0.08791 lineto fill grestore gsave .214 setgray .22527 0.08791 moveto .22527 0.01923 lineto .29396 0.08791 lineto fill grestore gsave .214 setgray .29396 0.01923 moveto .36264 0.01923 lineto .36264 0.08791 lineto fill grestore gsave .214 setgray .29396 0.08791 moveto .29396 0.01923 lineto .36264 0.08791 lineto fill grestore gsave .214 setgray .36264 0.01923 moveto .43132 0.01923 lineto .43132 0.08791 lineto fill grestore gsave .214 setgray .36264 0.08791 moveto .36264 0.01923 lineto .43132 0.08791 lineto fill grestore gsave .214 setgray .43132 0.01923 moveto .5 0.01923 lineto .5 0.08791 lineto fill grestore gsave .214 setgray .43132 0.01923 moveto .5 0.08791 lineto .43132 0.08791 lineto fill grestore gsave .214 setgray .5 0.01923 moveto .56868 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .214 setgray .5 0.08791 moveto .5 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .214 setgray .56868 0.01923 moveto .63736 0.01923 lineto .63736 0.08791 lineto fill grestore gsave .214 setgray .56868 0.01923 moveto .56868 0.08791 lineto .63736 0.08791 lineto fill grestore gsave .214 setgray .63736 0.01923 moveto .70604 0.01923 lineto .70604 0.08791 lineto fill grestore gsave .214 setgray .63736 0.01923 moveto .63736 0.08791 lineto .70604 0.08791 lineto fill grestore gsave .214 setgray .70604 0.01923 moveto .71741 0.0306 lineto .7176 0.01923 lineto fill grestore gsave .295 setgray .71741 0.0306 moveto .7176 0.01923 lineto .75442 0.01923 lineto .75361 0.0668 lineto fill grestore gsave 0.001 setlinewidth .71741 0.0306 moveto .7176 0.01923 lineto stroke grestore gsave .377 setgray .75361 0.0668 moveto .75442 0.01923 lineto .77473 0.01923 lineto .77473 0.08791 lineto fill grestore gsave 0.001 setlinewidth .75361 0.0668 moveto .75442 0.01923 lineto stroke grestore gsave .214 setgray .71741 0.0306 moveto .71644 0.08791 lineto .70604 0.08791 lineto .70604 0.01923 lineto fill grestore gsave .295 setgray .71741 0.0306 moveto .71644 0.08791 lineto .75325 0.08791 lineto .75361 0.0668 lineto fill grestore gsave 0.001 setlinewidth .71741 0.0306 moveto .71644 0.08791 lineto stroke grestore gsave .377 setgray .75361 0.0668 moveto .75325 0.08791 lineto .77473 0.08791 lineto fill grestore gsave 0.001 setlinewidth .75361 0.0668 moveto .75325 0.08791 lineto stroke grestore gsave .377 setgray .77473 0.01923 moveto .82599 0.0705 lineto .82691 0.01923 lineto fill grestore gsave .459 setgray .82599 0.0705 moveto .82691 0.01923 lineto .84341 0.01923 lineto .84341 0.08791 lineto fill grestore gsave 0.001 setlinewidth .82599 0.0705 moveto .82691 0.01923 lineto stroke grestore gsave .377 setgray .82599 0.0705 moveto .82503 0.08791 lineto .77473 0.08791 lineto .77473 0.01923 lineto fill grestore gsave .459 setgray .82599 0.0705 moveto .82503 0.08791 lineto .84341 0.08791 lineto fill grestore gsave 0.001 setlinewidth .82599 0.0705 moveto .82503 0.08791 lineto stroke grestore gsave .459 setgray .84341 0.01923 moveto .91209 0.01923 lineto .91209 0.08791 lineto fill grestore gsave .459 setgray .84341 0.01923 moveto .84341 0.08791 lineto .91209 0.08791 lineto fill grestore gsave .459 setgray .91209 0.01923 moveto .98077 0.01923 lineto .98077 0.08791 lineto fill grestore gsave .459 setgray .91209 0.01923 moveto .98077 0.08791 lineto .91209 0.08791 lineto fill grestore gsave .214 setgray 0.08791 .15659 moveto 0.08791 0.08791 lineto 0.01923 0.08791 lineto fill grestore gsave .214 setgray 0.08791 .15659 moveto 0.01923 .15659 lineto 0.01923 0.08791 lineto fill grestore gsave .214 setgray .15659 .15659 moveto 0.08791 0.08791 lineto .15659 0.08791 lineto fill grestore gsave .214 setgray .15659 .15659 moveto 0.08791 .15659 lineto 0.08791 0.08791 lineto fill grestore gsave .214 setgray .22527 .15659 moveto .15659 0.08791 lineto .22527 0.08791 lineto fill grestore gsave .214 setgray .22527 .15659 moveto .15659 .15659 lineto .15659 0.08791 lineto fill grestore gsave .214 setgray .22527 0.08791 moveto .29396 .15659 lineto .29396 0.08791 lineto fill grestore gsave .214 setgray .22527 .15659 moveto .29396 .15659 lineto .22527 0.08791 lineto fill grestore gsave .214 setgray .29396 0.08791 moveto .36264 .15659 lineto .36264 0.08791 lineto fill grestore gsave .214 setgray .29396 .15659 moveto .29396 0.08791 lineto .36264 .15659 lineto fill grestore gsave .214 setgray .36264 0.08791 moveto .43132 0.08791 lineto .43132 .15659 lineto fill grestore gsave .214 setgray .36264 .15659 moveto .36264 0.08791 lineto .43132 .15659 lineto fill grestore gsave .214 setgray .43132 0.08791 moveto .5 0.08791 lineto .5 .15659 lineto fill grestore gsave .214 setgray .43132 0.08791 moveto .43132 .15659 lineto .5 .15659 lineto fill grestore gsave .214 setgray .5 0.08791 moveto .56868 0.08791 lineto .56868 .15659 lineto fill grestore gsave .214 setgray .5 0.08791 moveto .5 .15659 lineto .56868 .15659 lineto fill grestore gsave .214 setgray .56868 0.08791 moveto .63736 0.08791 lineto .63736 .15659 lineto fill grestore gsave .214 setgray .56868 0.08791 moveto .56868 .15659 lineto .63736 .15659 lineto fill grestore gsave .214 setgray .69643 .14698 moveto .70604 .13763 lineto .70604 0.08791 lineto .63736 0.08791 lineto fill grestore gsave .295 setgray .69643 .14698 moveto .70604 .13763 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .69643 .14698 moveto .70604 .13763 lineto stroke grestore gsave .214 setgray .69643 .14698 moveto .69395 .15659 lineto .63736 .15659 lineto .63736 0.08791 lineto fill grestore gsave .295 setgray .69643 .14698 moveto .69395 .15659 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .69643 .14698 moveto .69395 .15659 lineto stroke grestore gsave .214 setgray .70604 0.08791 moveto .71472 0.09659 lineto .71644 0.08791 lineto fill grestore gsave .295 setgray .71472 0.09659 moveto .71644 0.08791 lineto .75325 0.08791 lineto .74546 .12733 lineto fill grestore gsave 0.001 setlinewidth .71472 0.09659 moveto .71644 0.08791 lineto stroke grestore gsave .377 setgray .74546 .12733 moveto .75325 0.08791 lineto .77473 0.08791 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .74546 .12733 moveto .75325 0.08791 lineto stroke grestore gsave .214 setgray .70604 0.08791 moveto .71472 0.09659 lineto .70604 .13763 lineto fill grestore gsave .295 setgray .71472 0.09659 moveto .70604 .13763 lineto .70604 .15659 lineto .73927 .15659 lineto .74546 .12733 lineto fill grestore gsave 0.001 setlinewidth .71472 0.09659 moveto .70604 .13763 lineto stroke grestore gsave .377 setgray .74546 .12733 moveto .73927 .15659 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .74546 .12733 moveto .73927 .15659 lineto stroke grestore gsave .377 setgray .77473 0.08791 moveto .81353 .12672 lineto .82503 0.08791 lineto fill grestore gsave .459 setgray .81353 .12672 moveto .82503 0.08791 lineto .84341 0.08791 lineto .84341 .15659 lineto fill grestore gsave 0.001 setlinewidth .81353 .12672 moveto .82503 0.08791 lineto stroke grestore gsave .377 setgray .81353 .12672 moveto .78365 .15659 lineto .77473 .15659 lineto .77473 0.08791 lineto fill grestore gsave .459 setgray .81353 .12672 moveto .78365 .15659 lineto .84341 .15659 lineto fill grestore gsave 0.001 setlinewidth .81353 .12672 moveto .78365 .15659 lineto stroke grestore gsave .459 setgray .84341 0.08791 moveto .91209 0.08791 lineto .91209 .15659 lineto fill grestore gsave .459 setgray .84341 0.08791 moveto .91209 .15659 lineto .84341 .15659 lineto fill grestore gsave .459 setgray .91209 0.08791 moveto .98077 0.08791 lineto .98077 .15659 lineto fill grestore gsave .459 setgray .91209 0.08791 moveto .98077 .15659 lineto .91209 .15659 lineto fill grestore gsave .132 setgray 0.08791 .22527 moveto 0.08791 .20275 lineto 0.06539 .20275 lineto fill grestore gsave .214 setgray 0.08791 .20275 moveto 0.06539 .20275 lineto 0.01923 .15659 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .20275 moveto 0.06539 .20275 lineto stroke grestore gsave .132 setgray 0.08791 .22527 moveto 0.06539 .20275 lineto 0.02999 .22527 lineto fill grestore gsave .214 setgray 0.06539 .20275 moveto 0.02999 .22527 lineto 0.01923 .22527 lineto 0.01923 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.06539 .20275 moveto 0.02999 .22527 lineto stroke grestore gsave .132 setgray .15659 .22527 moveto .11037 .17905 lineto .15659 .17497 lineto fill grestore gsave .214 setgray .11037 .17905 moveto .15659 .17497 lineto .15659 .15659 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth .11037 .17905 moveto .15659 .17497 lineto stroke grestore gsave .132 setgray .11037 .17905 moveto 0.08791 .20275 lineto 0.08791 .22527 lineto .15659 .22527 lineto fill grestore gsave .214 setgray .11037 .17905 moveto 0.08791 .20275 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth .11037 .17905 moveto 0.08791 .20275 lineto stroke grestore gsave .132 setgray .22527 .22527 moveto .16578 .16578 lineto .22527 .16206 lineto fill grestore gsave .214 setgray .16578 .16578 moveto .22527 .16206 lineto .22527 .15659 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth .16578 .16578 moveto .22527 .16206 lineto stroke grestore gsave .132 setgray .16578 .16578 moveto .15659 .17497 lineto .15659 .22527 lineto .22527 .22527 lineto fill grestore gsave .214 setgray .16578 .16578 moveto .15659 .17497 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth .16578 .16578 moveto .15659 .17497 lineto stroke grestore gsave .132 setgray .29396 .22527 moveto .29396 .17358 lineto .23257 .16389 lineto fill grestore gsave .214 setgray .29396 .17358 moveto .23257 .16389 lineto .22527 .15659 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .29396 .17358 moveto .23257 .16389 lineto stroke grestore gsave .132 setgray .22527 .16206 moveto .23257 .16389 lineto .29396 .22527 lineto .22527 .22527 lineto fill grestore gsave .214 setgray .22527 .16206 moveto .23257 .16389 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .22527 .16206 moveto .23257 .16389 lineto stroke grestore gsave .214 setgray .29396 .15659 moveto .36264 .22527 lineto .36264 .15659 lineto fill grestore gsave .132 setgray .29396 .22527 moveto .34148 .22527 lineto .29396 .17358 lineto fill grestore gsave .214 setgray .34148 .22527 moveto .29396 .17358 lineto .29396 .15659 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .34148 .22527 moveto .29396 .17358 lineto stroke grestore gsave .214 setgray .36264 .15659 moveto .43132 .15659 lineto .43132 .22527 lineto fill grestore gsave .214 setgray .36264 .22527 moveto .36264 .15659 lineto .43132 .22527 lineto fill grestore gsave .214 setgray .43132 .15659 moveto .5 .15659 lineto .5 .22527 lineto fill grestore gsave .214 setgray .43132 .15659 moveto .43132 .22527 lineto .5 .22527 lineto fill grestore gsave .214 setgray .5592 .21579 moveto .56868 .21525 lineto .56868 .15659 lineto .5 .15659 lineto fill grestore gsave .295 setgray .5592 .21579 moveto .56868 .21525 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .5592 .21579 moveto .56868 .21525 lineto stroke grestore gsave .214 setgray .5592 .21579 moveto .54742 .22527 lineto .5 .22527 lineto .5 .15659 lineto fill grestore gsave .295 setgray .5592 .21579 moveto .54742 .22527 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .5592 .21579 moveto .54742 .22527 lineto stroke grestore gsave .214 setgray .59661 .18453 moveto .63736 .1809 lineto .63736 .15659 lineto .56868 .15659 lineto fill grestore gsave .295 setgray .59661 .18453 moveto .63736 .1809 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .59661 .18453 moveto .63736 .1809 lineto stroke grestore gsave .214 setgray .56868 .15659 moveto .59661 .18453 lineto .56868 .21525 lineto fill grestore gsave .295 setgray .59661 .18453 moveto .56868 .21525 lineto .56868 .22527 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .59661 .18453 moveto .56868 .21525 lineto stroke grestore gsave .214 setgray .63736 .15659 moveto .64805 .16728 lineto .69395 .15659 lineto fill grestore gsave .295 setgray .64805 .16728 moveto .69395 .15659 lineto .70604 .15659 lineto .70604 .17995 lineto .66928 .18851 lineto fill grestore gsave 0.001 setlinewidth .64805 .16728 moveto .69395 .15659 lineto stroke grestore gsave .377 setgray .66928 .18851 moveto .70604 .17995 lineto .70604 .20612 lineto .69051 .20974 lineto fill grestore gsave 0.001 setlinewidth .66928 .18851 moveto .70604 .17995 lineto stroke grestore gsave .459 setgray .69051 .20974 moveto .70604 .20612 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .69051 .20974 moveto .70604 .20612 lineto stroke grestore gsave .214 setgray .63736 .15659 moveto .64805 .16728 lineto .63736 .1809 lineto fill grestore gsave .295 setgray .64805 .16728 moveto .63736 .1809 lineto .63736 .22527 lineto .64042 .22527 lineto .66928 .18851 lineto fill grestore gsave 0.001 setlinewidth .64805 .16728 moveto .63736 .1809 lineto stroke grestore gsave .377 setgray .66928 .18851 moveto .64042 .22527 lineto .67831 .22527 lineto .69051 .20974 lineto fill grestore gsave 0.001 setlinewidth .66928 .18851 moveto .64042 .22527 lineto stroke grestore gsave .459 setgray .69051 .20974 moveto .67831 .22527 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .69051 .20974 moveto .67831 .22527 lineto stroke grestore gsave .295 setgray .70604 .15659 moveto .72051 .17106 lineto .73927 .15659 lineto fill grestore gsave .377 setgray .72051 .17106 moveto .73927 .15659 lineto .77473 .15659 lineto .77473 .15797 lineto .73672 .18727 lineto fill grestore gsave 0.001 setlinewidth .72051 .17106 moveto .73927 .15659 lineto stroke grestore gsave .459 setgray .73672 .18727 moveto .77473 .15797 lineto .77473 .18668 lineto .75293 .20348 lineto fill grestore gsave 0.001 setlinewidth .73672 .18727 moveto .77473 .15797 lineto stroke grestore gsave .541 setgray .75293 .20348 moveto .77473 .18668 lineto .77473 .21538 lineto .76914 .21969 lineto fill grestore gsave 0.001 setlinewidth .75293 .20348 moveto .77473 .18668 lineto stroke grestore gsave .623 setgray .76914 .21969 moveto .77473 .21538 lineto .77473 .22527 lineto fill grestore gsave 0.001 setlinewidth .76914 .21969 moveto .77473 .21538 lineto stroke grestore gsave .295 setgray .70604 .15659 moveto .72051 .17106 lineto .70604 .17995 lineto fill grestore gsave .377 setgray .72051 .17106 moveto .70604 .17995 lineto .70604 .20612 lineto .73672 .18727 lineto fill grestore gsave 0.001 setlinewidth .72051 .17106 moveto .70604 .17995 lineto stroke grestore gsave .459 setgray .73672 .18727 moveto .70604 .20612 lineto .70604 .22527 lineto .71746 .22527 lineto .75293 .20348 lineto fill grestore gsave 0.001 setlinewidth .73672 .18727 moveto .70604 .20612 lineto stroke grestore gsave .541 setgray .75293 .20348 moveto .71746 .22527 lineto .76005 .22527 lineto .76914 .21969 lineto fill grestore gsave 0.001 setlinewidth .75293 .20348 moveto .71746 .22527 lineto stroke grestore gsave .623 setgray .76914 .21969 moveto .76005 .22527 lineto .77473 .22527 lineto fill grestore gsave 0.001 setlinewidth .76914 .21969 moveto .76005 .22527 lineto stroke grestore gsave .377 setgray .77473 .15659 moveto .7766 .15846 lineto .78365 .15659 lineto fill grestore gsave .459 setgray .7766 .15846 moveto .78365 .15659 lineto .84341 .15659 lineto .84341 .19012 lineto .81562 .19749 lineto fill grestore gsave 0.001 setlinewidth .7766 .15846 moveto .78365 .15659 lineto stroke grestore gsave .541 setgray .81562 .19749 moveto .84341 .19012 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .81562 .19749 moveto .84341 .19012 lineto stroke grestore gsave .377 setgray .77473 .15659 moveto .77473 .15797 lineto .7766 .15846 lineto fill grestore gsave .459 setgray .77473 .15797 moveto .7766 .15846 lineto .81562 .19749 lineto .77473 .18668 lineto fill grestore gsave 0.001 setlinewidth .77473 .15797 moveto .7766 .15846 lineto stroke grestore gsave .541 setgray .77473 .18668 moveto .81562 .19749 lineto .84341 .22527 lineto .81214 .22527 lineto .77473 .21538 lineto fill grestore gsave 0.001 setlinewidth .77473 .18668 moveto .81562 .19749 lineto stroke grestore gsave .623 setgray .77473 .21538 moveto .81214 .22527 lineto .77473 .22527 lineto fill grestore gsave 0.001 setlinewidth .77473 .21538 moveto .81214 .22527 lineto stroke grestore gsave .459 setgray .91209 .21277 moveto .89942 .21261 lineto .84341 .15659 lineto .91209 .15659 lineto fill grestore gsave .541 setgray .91209 .21277 moveto .89942 .21261 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .21277 moveto .89942 .21261 lineto stroke grestore gsave .459 setgray .84341 .15659 moveto .84341 .19012 lineto .89942 .21261 lineto fill grestore gsave .541 setgray .84341 .19012 moveto .89942 .21261 lineto .91209 .22527 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .84341 .19012 moveto .89942 .21261 lineto stroke grestore gsave .459 setgray .98077 .15659 moveto .91209 .15659 lineto .98077 .22527 lineto fill grestore gsave .459 setgray .91209 .21277 moveto .96212 .22527 lineto .98077 .22527 lineto .91209 .15659 lineto fill grestore gsave .541 setgray .91209 .21277 moveto .96212 .22527 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .21277 moveto .96212 .22527 lineto stroke grestore gsave .132 setgray 0.02018 .22623 moveto 0.02999 .22527 lineto 0.08791 .22527 lineto 0.08791 .29396 lineto fill grestore gsave .214 setgray 0.02018 .22623 moveto 0.02999 .22527 lineto 0.01923 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.02018 .22623 moveto 0.02999 .22527 lineto stroke grestore gsave .132 setgray 0.02018 .22623 moveto 0.01923 .22662 lineto 0.01923 .29396 lineto 0.08791 .29396 lineto fill grestore gsave .214 setgray 0.02018 .22623 moveto 0.01923 .22662 lineto 0.01923 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.02018 .22623 moveto 0.01923 .22662 lineto stroke grestore gsave 0.05 setgray .15659 .29396 moveto .14152 .27888 lineto .15659 .27587 lineto fill grestore gsave .132 setgray .14152 .27888 moveto .15659 .27587 lineto .15659 .22527 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth .14152 .27888 moveto .15659 .27587 lineto stroke grestore gsave 0.05 setgray .15659 .29396 moveto .14152 .27888 lineto .11568 .29396 lineto fill grestore gsave .132 setgray .14152 .27888 moveto .11568 .29396 lineto 0.08791 .29396 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth .14152 .27888 moveto .11568 .29396 lineto stroke grestore gsave 0.05 setgray .22527 .29396 moveto .19385 .26253 lineto .22527 .25129 lineto fill grestore gsave .132 setgray .19385 .26253 moveto .22527 .25129 lineto .22527 .22527 lineto .15659 .22527 lineto fill grestore gsave 0.001 setlinewidth .19385 .26253 moveto .22527 .25129 lineto stroke grestore gsave 0.05 setgray .19385 .26253 moveto .15659 .27587 lineto .15659 .29396 lineto .22527 .29396 lineto fill grestore gsave .132 setgray .19385 .26253 moveto .15659 .27587 lineto .15659 .22527 lineto fill grestore gsave 0.001 setlinewidth .19385 .26253 moveto .15659 .27587 lineto stroke grestore gsave 0.05 setgray .29396 .29396 moveto .29396 .27486 lineto .2694 .2694 lineto fill grestore gsave .132 setgray .29396 .27486 moveto .2694 .2694 lineto .22527 .22527 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .29396 .27486 moveto .2694 .2694 lineto stroke grestore gsave 0.05 setgray .22527 .25129 moveto .2694 .2694 lineto .29396 .29396 lineto .22527 .29396 lineto fill grestore gsave .132 setgray .22527 .25129 moveto .2694 .2694 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .22527 .25129 moveto .2694 .2694 lineto stroke grestore gsave .132 setgray .29396 .22527 moveto .34148 .22527 lineto .35535 .28666 lineto fill grestore gsave .214 setgray .34148 .22527 moveto .35535 .28666 lineto .36264 .29396 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .34148 .22527 moveto .35535 .28666 lineto stroke grestore gsave 0.05 setgray .29396 .29396 moveto .30542 .29396 lineto .29396 .27486 lineto fill grestore gsave .132 setgray .30542 .29396 moveto .29396 .27486 lineto .29396 .22527 lineto .35535 .28666 lineto .35972 .29396 lineto fill grestore gsave 0.001 setlinewidth .30542 .29396 moveto .29396 .27486 lineto stroke grestore gsave .214 setgray .35972 .29396 moveto .35535 .28666 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .35972 .29396 moveto .35535 .28666 lineto stroke grestore gsave .214 setgray .40237 .26501 moveto .43132 .25404 lineto .43132 .22527 lineto .36264 .22527 lineto fill grestore gsave .295 setgray .40237 .26501 moveto .43132 .25404 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .40237 .26501 moveto .43132 .25404 lineto stroke grestore gsave .214 setgray .40517 .29396 moveto .40237 .26501 lineto .36264 .22527 lineto .36264 .29396 lineto fill grestore gsave .295 setgray .40517 .29396 moveto .40237 .26501 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .40517 .29396 moveto .40237 .26501 lineto stroke grestore gsave .214 setgray .44505 .23901 moveto .5 .23387 lineto .5 .22527 lineto .43132 .22527 lineto fill grestore gsave .295 setgray .44505 .23901 moveto .5 .23387 lineto .5 .26968 lineto .4778 .27175 lineto fill grestore gsave 0.001 setlinewidth .44505 .23901 moveto .5 .23387 lineto stroke grestore gsave .377 setgray .4778 .27175 moveto .5 .26968 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .4778 .27175 moveto .5 .26968 lineto stroke grestore gsave .214 setgray .43132 .22527 moveto .44505 .23901 lineto .43132 .25404 lineto fill grestore gsave .295 setgray .44505 .23901 moveto .43132 .25404 lineto .43132 .29396 lineto .45751 .29396 lineto .4778 .27175 lineto fill grestore gsave 0.001 setlinewidth .44505 .23901 moveto .43132 .25404 lineto stroke grestore gsave .377 setgray .4778 .27175 moveto .45751 .29396 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .4778 .27175 moveto .45751 .29396 lineto stroke grestore gsave .214 setgray .5 .22527 moveto .50502 .23029 lineto .54742 .22527 lineto fill grestore gsave .295 setgray .50502 .23029 moveto .54742 .22527 lineto .56868 .22527 lineto .56868 .24612 lineto .5259 .25118 lineto fill grestore gsave 0.001 setlinewidth .50502 .23029 moveto .54742 .22527 lineto stroke grestore gsave .377 setgray .5259 .25118 moveto .56868 .24612 lineto .56868 .26947 lineto .54679 .27206 lineto fill grestore gsave 0.001 setlinewidth .5259 .25118 moveto .56868 .24612 lineto stroke grestore gsave .459 setgray .54679 .27206 moveto .56868 .26947 lineto .56868 .29283 lineto .56768 .29295 lineto fill grestore gsave 0.001 setlinewidth .54679 .27206 moveto .56868 .26947 lineto stroke grestore gsave .541 setgray .56768 .29295 moveto .56868 .29283 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56768 .29295 moveto .56868 .29283 lineto stroke grestore gsave .214 setgray .5 .22527 moveto .50502 .23029 lineto .5 .23387 lineto fill grestore gsave .295 setgray .50502 .23029 moveto .5 .23387 lineto .5 .26968 lineto .5259 .25118 lineto fill grestore gsave 0.001 setlinewidth .50502 .23029 moveto .5 .23387 lineto stroke grestore gsave .377 setgray .5259 .25118 moveto .5 .26968 lineto .5 .29396 lineto .51614 .29396 lineto .54679 .27206 lineto fill grestore gsave 0.001 setlinewidth .5259 .25118 moveto .5 .26968 lineto stroke grestore gsave .459 setgray .54679 .27206 moveto .51614 .29396 lineto .56627 .29396 lineto .56768 .29295 lineto fill grestore gsave 0.001 setlinewidth .54679 .27206 moveto .51614 .29396 lineto stroke grestore gsave .541 setgray .56768 .29295 moveto .56627 .29396 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56768 .29295 moveto .56627 .29396 lineto stroke grestore gsave .295 setgray .58166 .23825 moveto .63736 .22669 lineto .63736 .22527 lineto .56868 .22527 lineto fill grestore gsave .377 setgray .58166 .23825 moveto .63736 .22669 lineto .63736 .24426 lineto .59621 .2528 lineto fill grestore gsave 0.001 setlinewidth .58166 .23825 moveto .63736 .22669 lineto stroke grestore gsave .459 setgray .59621 .2528 moveto .63736 .24426 lineto .63736 .26182 lineto .61075 .26735 lineto fill grestore gsave 0.001 setlinewidth .59621 .2528 moveto .63736 .24426 lineto stroke grestore gsave .541 setgray .61075 .26735 moveto .63736 .26182 lineto .63736 .27939 lineto .6253 .28189 lineto fill grestore gsave 0.001 setlinewidth .61075 .26735 moveto .63736 .26182 lineto stroke grestore gsave .623 setgray .6253 .28189 moveto .63736 .27939 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .6253 .28189 moveto .63736 .27939 lineto stroke grestore gsave .295 setgray .56868 .22527 moveto .58166 .23825 lineto .56868 .24612 lineto fill grestore gsave .377 setgray .58166 .23825 moveto .56868 .24612 lineto .56868 .26947 lineto .59621 .2528 lineto fill grestore gsave 0.001 setlinewidth .58166 .23825 moveto .56868 .24612 lineto stroke grestore gsave .459 setgray .59621 .2528 moveto .56868 .26947 lineto .56868 .29283 lineto .61075 .26735 lineto fill grestore gsave 0.001 setlinewidth .59621 .2528 moveto .56868 .26947 lineto stroke grestore gsave .541 setgray .61075 .26735 moveto .56868 .29283 lineto .56868 .29396 lineto .60538 .29396 lineto .6253 .28189 lineto fill grestore gsave 0.001 setlinewidth .61075 .26735 moveto .56868 .29283 lineto stroke grestore gsave .623 setgray .6253 .28189 moveto .60538 .29396 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .6253 .28189 moveto .60538 .29396 lineto stroke grestore gsave .295 setgray .63736 .22527 moveto .63834 .22625 lineto .64042 .22527 lineto fill grestore gsave .377 setgray .63834 .22625 moveto .64042 .22527 lineto .67831 .22527 lineto .65045 .23837 lineto fill grestore gsave 0.001 setlinewidth .63834 .22625 moveto .64042 .22527 lineto stroke grestore gsave .459 setgray .65045 .23837 moveto .67831 .22527 lineto .70604 .22527 lineto .70604 .23005 lineto .66257 .25048 lineto fill grestore gsave 0.001 setlinewidth .65045 .23837 moveto .67831 .22527 lineto stroke grestore gsave .541 setgray .66257 .25048 moveto .70604 .23005 lineto .70604 .24785 lineto .67468 .26259 lineto fill grestore gsave 0.001 setlinewidth .66257 .25048 moveto .70604 .23005 lineto stroke grestore gsave .623 setgray .67468 .26259 moveto .70604 .24785 lineto .70604 .26566 lineto .68679 .2747 lineto fill grestore gsave 0.001 setlinewidth .67468 .26259 moveto .70604 .24785 lineto stroke grestore gsave .705 setgray .68679 .2747 moveto .70604 .26566 lineto .70604 .28346 lineto .6989 .28682 lineto fill grestore gsave 0.001 setlinewidth .68679 .2747 moveto .70604 .26566 lineto stroke grestore gsave .786 setgray .6989 .28682 moveto .70604 .28346 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .6989 .28682 moveto .70604 .28346 lineto stroke grestore gsave .295 setgray .63736 .22527 moveto .63834 .22625 lineto .63736 .22669 lineto fill grestore gsave .377 setgray .63834 .22625 moveto .63736 .22669 lineto .63736 .24426 lineto .65045 .23837 lineto fill grestore gsave 0.001 setlinewidth .63834 .22625 moveto .63736 .22669 lineto stroke grestore gsave .459 setgray .65045 .23837 moveto .63736 .24426 lineto .63736 .26182 lineto .66257 .25048 lineto fill grestore gsave 0.001 setlinewidth .65045 .23837 moveto .63736 .24426 lineto stroke grestore gsave .541 setgray .66257 .25048 moveto .63736 .26182 lineto .63736 .27939 lineto .67468 .26259 lineto fill grestore gsave 0.001 setlinewidth .66257 .25048 moveto .63736 .26182 lineto stroke grestore gsave .623 setgray .67468 .26259 moveto .63736 .27939 lineto .63736 .29396 lineto .64402 .29396 lineto .68679 .2747 lineto fill grestore gsave 0.001 setlinewidth .67468 .26259 moveto .63736 .27939 lineto stroke grestore gsave .705 setgray .68679 .2747 moveto .64402 .29396 lineto .68304 .29396 lineto .6989 .28682 lineto fill grestore gsave 0.001 setlinewidth .68679 .2747 moveto .64402 .29396 lineto stroke grestore gsave .786 setgray .6989 .28682 moveto .68304 .29396 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .6989 .28682 moveto .68304 .29396 lineto stroke grestore gsave .459 setgray .70604 .22527 moveto .70999 .22922 lineto .71746 .22527 lineto fill grestore gsave .541 setgray .70999 .22922 moveto .71746 .22527 lineto .76005 .22527 lineto .7247 .24393 lineto fill grestore gsave 0.001 setlinewidth .70999 .22922 moveto .71746 .22527 lineto stroke grestore gsave .623 setgray .7247 .24393 moveto .76005 .22527 lineto .77473 .22527 lineto .77473 .24 lineto .73941 .25864 lineto fill grestore gsave 0.001 setlinewidth .7247 .24393 moveto .76005 .22527 lineto stroke grestore gsave .705 setgray .73941 .25864 moveto .77473 .24 lineto .77473 .26248 lineto .75412 .27335 lineto fill grestore gsave 0.001 setlinewidth .73941 .25864 moveto .77473 .24 lineto stroke grestore gsave .786 setgray .75412 .27335 moveto .77473 .26248 lineto .77473 .28495 lineto .76883 .28806 lineto fill grestore gsave 0.001 setlinewidth .75412 .27335 moveto .77473 .26248 lineto stroke grestore gsave .868 setgray .76883 .28806 moveto .77473 .28495 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .76883 .28806 moveto .77473 .28495 lineto stroke grestore gsave .459 setgray .70604 .22527 moveto .70999 .22922 lineto .70604 .23005 lineto fill grestore gsave .541 setgray .70999 .22922 moveto .70604 .23005 lineto .70604 .24785 lineto .7247 .24393 lineto fill grestore gsave 0.001 setlinewidth .70999 .22922 moveto .70604 .23005 lineto stroke grestore gsave .623 setgray .7247 .24393 moveto .70604 .24785 lineto .70604 .26566 lineto .73941 .25864 lineto fill grestore gsave 0.001 setlinewidth .7247 .24393 moveto .70604 .24785 lineto stroke grestore gsave .705 setgray .73941 .25864 moveto .70604 .26566 lineto .70604 .28346 lineto .75412 .27335 lineto fill grestore gsave 0.001 setlinewidth .73941 .25864 moveto .70604 .26566 lineto stroke grestore gsave .786 setgray .75412 .27335 moveto .70604 .28346 lineto .70604 .29396 lineto .74079 .29396 lineto .76883 .28806 lineto fill grestore gsave 0.001 setlinewidth .75412 .27335 moveto .70604 .28346 lineto stroke grestore gsave .868 setgray .76883 .28806 moveto .74079 .29396 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .76883 .28806 moveto .74079 .29396 lineto stroke grestore gsave .541 setgray .84341 .22527 moveto .84341 .23123 lineto .81214 .22527 lineto fill grestore gsave .623 setgray .84341 .23123 moveto .81214 .22527 lineto .77473 .22527 lineto .79148 .24203 lineto .84341 .25192 lineto fill grestore gsave 0.001 setlinewidth .84341 .23123 moveto .81214 .22527 lineto stroke grestore gsave .705 setgray .84341 .25192 moveto .79148 .24203 lineto .81703 .26758 lineto .84341 .27261 lineto fill grestore gsave 0.001 setlinewidth .84341 .25192 moveto .79148 .24203 lineto stroke grestore gsave .786 setgray .84341 .27261 moveto .81703 .26758 lineto .84259 .29314 lineto .84341 .29329 lineto fill grestore gsave 0.001 setlinewidth .84341 .27261 moveto .81703 .26758 lineto stroke grestore gsave .868 setgray .84341 .29329 moveto .84259 .29314 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .29329 moveto .84259 .29314 lineto stroke grestore gsave .623 setgray .77473 .22527 moveto .77473 .24 lineto .79148 .24203 lineto fill grestore gsave .705 setgray .77473 .24 moveto .79148 .24203 lineto .81703 .26758 lineto .77473 .26248 lineto fill grestore gsave 0.001 setlinewidth .77473 .24 moveto .79148 .24203 lineto stroke grestore gsave .786 setgray .77473 .26248 moveto .81703 .26758 lineto .84259 .29314 lineto .77473 .28495 lineto fill grestore gsave 0.001 setlinewidth .77473 .26248 moveto .81703 .26758 lineto stroke grestore gsave .868 setgray .77473 .28495 moveto .84259 .29314 lineto .84341 .29396 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .77473 .28495 moveto .84259 .29314 lineto stroke grestore gsave .541 setgray .91209 .24324 moveto .85079 .23266 lineto .84341 .22527 lineto .91209 .22527 lineto fill grestore gsave .623 setgray .91209 .24324 moveto .85079 .23266 lineto .87645 .25832 lineto .91209 .26447 lineto fill grestore gsave 0.001 setlinewidth .91209 .24324 moveto .85079 .23266 lineto stroke grestore gsave .705 setgray .91209 .26447 moveto .87645 .25832 lineto .9021 .28397 lineto .91209 .2857 lineto fill grestore gsave 0.001 setlinewidth .91209 .26447 moveto .87645 .25832 lineto stroke grestore gsave .786 setgray .91209 .2857 moveto .9021 .28397 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .2857 moveto .9021 .28397 lineto stroke grestore gsave .541 setgray .84341 .22527 moveto .84341 .23123 lineto .85079 .23266 lineto fill grestore gsave .623 setgray .84341 .23123 moveto .85079 .23266 lineto .87645 .25832 lineto .84341 .25192 lineto fill grestore gsave 0.001 setlinewidth .84341 .23123 moveto .85079 .23266 lineto stroke grestore gsave .705 setgray .84341 .25192 moveto .87645 .25832 lineto .9021 .28397 lineto .84341 .27261 lineto fill grestore gsave 0.001 setlinewidth .84341 .25192 moveto .87645 .25832 lineto stroke grestore gsave .786 setgray .84341 .27261 moveto .9021 .28397 lineto .91209 .29396 lineto .84683 .29396 lineto .84341 .29329 lineto fill grestore gsave 0.001 setlinewidth .84341 .27261 moveto .9021 .28397 lineto stroke grestore gsave .868 setgray .84341 .29329 moveto .84683 .29396 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .29329 moveto .84683 .29396 lineto stroke grestore gsave .459 setgray .98077 .22527 moveto .98077 .22657 lineto .96212 .22527 lineto fill grestore gsave .541 setgray .98077 .22657 moveto .96212 .22527 lineto .91209 .22527 lineto .93267 .24586 lineto .98077 .2492 lineto fill grestore gsave 0.001 setlinewidth .98077 .22657 moveto .96212 .22527 lineto stroke grestore gsave .623 setgray .98077 .2492 moveto .93267 .24586 lineto .95699 .27017 lineto .98077 .27182 lineto fill grestore gsave 0.001 setlinewidth .98077 .2492 moveto .93267 .24586 lineto stroke grestore gsave .705 setgray .98077 .27182 moveto .95699 .27017 lineto .98077 .29396 lineto fill grestore gsave 0.001 setlinewidth .98077 .27182 moveto .95699 .27017 lineto stroke grestore gsave .541 setgray .91209 .22527 moveto .91209 .24324 lineto .93267 .24586 lineto fill grestore gsave .623 setgray .91209 .24324 moveto .93267 .24586 lineto .95699 .27017 lineto .91209 .26447 lineto fill grestore gsave 0.001 setlinewidth .91209 .24324 moveto .93267 .24586 lineto stroke grestore gsave .705 setgray .91209 .26447 moveto .95699 .27017 lineto .98077 .29396 lineto .97711 .29396 lineto .91209 .2857 lineto fill grestore gsave 0.001 setlinewidth .91209 .26447 moveto .95699 .27017 lineto stroke grestore gsave .786 setgray .91209 .2857 moveto .97711 .29396 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .2857 moveto .97711 .29396 lineto stroke grestore gsave 0.05 setgray 0.08791 .36264 moveto 0.0862 .36093 lineto 0.08791 .35874 lineto fill grestore gsave .132 setgray 0.0862 .36093 moveto 0.08791 .35874 lineto 0.08791 .29396 lineto 0.01923 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.0862 .36093 moveto 0.08791 .35874 lineto stroke grestore gsave 0.05 setgray 0.08791 .36264 moveto 0.0862 .36093 lineto 0.0851 .36264 lineto fill grestore gsave .132 setgray 0.0862 .36093 moveto 0.0851 .36264 lineto 0.01923 .36264 lineto 0.01923 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.0862 .36093 moveto 0.0851 .36264 lineto stroke grestore gsave 0.05 setgray .10768 .31372 moveto .11568 .29396 lineto .15659 .29396 lineto .15659 .36264 lineto fill grestore gsave .132 setgray .10768 .31372 moveto .11568 .29396 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth .10768 .31372 moveto .11568 .29396 lineto stroke grestore gsave 0.05 setgray .10768 .31372 moveto 0.08791 .35874 lineto 0.08791 .36264 lineto .15659 .36264 lineto fill grestore gsave .132 setgray .10768 .31372 moveto 0.08791 .35874 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth .10768 .31372 moveto 0.08791 .35874 lineto stroke grestore gsave 0.05 setgray .22527 .36264 moveto .22527 .29396 lineto .15659 .29396 lineto fill grestore gsave 0.05 setgray .22527 .36264 moveto .15659 .36264 lineto .15659 .29396 lineto fill grestore gsave 0.05 setgray .22527 .29396 moveto .29396 .36264 lineto .29396 .29396 lineto fill grestore gsave 0.05 setgray .22527 .36264 moveto .22527 .29396 lineto .29396 .36264 lineto fill grestore gsave 0.05 setgray .29396 .29396 moveto .30542 .29396 lineto .30561 .30561 lineto fill grestore gsave .132 setgray .30542 .29396 moveto .30561 .30561 lineto .36084 .36084 lineto .35972 .29396 lineto fill grestore gsave 0.001 setlinewidth .30542 .29396 moveto .30561 .30561 lineto stroke grestore gsave .214 setgray .35972 .29396 moveto .36084 .36084 lineto .36264 .36264 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .35972 .29396 moveto .36084 .36084 lineto stroke grestore gsave 0.05 setgray .3088 .36264 moveto .30561 .30561 lineto .29396 .29396 lineto .29396 .36264 lineto fill grestore gsave .132 setgray .3088 .36264 moveto .30561 .30561 lineto .36084 .36084 lineto .36094 .36264 lineto fill grestore gsave 0.001 setlinewidth .3088 .36264 moveto .30561 .30561 lineto stroke grestore gsave .214 setgray .36094 .36264 moveto .36084 .36084 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .36094 .36264 moveto .36084 .36084 lineto stroke grestore gsave .214 setgray .36264 .29396 moveto .39956 .33088 lineto .40517 .29396 lineto fill grestore gsave .295 setgray .39956 .33088 moveto .40517 .29396 lineto .43132 .29396 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .39956 .33088 moveto .40517 .29396 lineto stroke grestore gsave .214 setgray .39994 .36264 moveto .39956 .33088 lineto .36264 .29396 lineto .36264 .36264 lineto fill grestore gsave .295 setgray .39994 .36264 moveto .39956 .33088 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .39994 .36264 moveto .39956 .33088 lineto stroke grestore gsave .295 setgray .43132 .29396 moveto .44901 .31165 lineto .45751 .29396 lineto fill grestore gsave .377 setgray .44901 .31165 moveto .45751 .29396 lineto .5 .29396 lineto .5 .33592 lineto .49133 .35396 lineto fill grestore gsave 0.001 setlinewidth .44901 .31165 moveto .45751 .29396 lineto stroke grestore gsave .459 setgray .49133 .35396 moveto .5 .33592 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .49133 .35396 moveto .5 .33592 lineto stroke grestore gsave .295 setgray .44901 .31165 moveto .44051 .36264 lineto .43132 .36264 lineto .43132 .29396 lineto fill grestore gsave .377 setgray .44901 .31165 moveto .44051 .36264 lineto .48988 .36264 lineto .49133 .35396 lineto fill grestore gsave 0.001 setlinewidth .44901 .31165 moveto .44051 .36264 lineto stroke grestore gsave .459 setgray .49133 .35396 moveto .48988 .36264 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .49133 .35396 moveto .48988 .36264 lineto stroke grestore gsave .377 setgray .5 .29396 moveto .51054 .3045 lineto .51614 .29396 lineto fill grestore gsave .459 setgray .51054 .3045 moveto .51614 .29396 lineto .56627 .29396 lineto .54329 .33725 lineto fill grestore gsave 0.001 setlinewidth .51054 .3045 moveto .51614 .29396 lineto stroke grestore gsave .541 setgray .54329 .33725 moveto .56627 .29396 lineto .56868 .29396 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .54329 .33725 moveto .56627 .29396 lineto stroke grestore gsave .377 setgray .5 .29396 moveto .51054 .3045 lineto .5 .33592 lineto fill grestore gsave .459 setgray .51054 .3045 moveto .5 .33592 lineto .5 .36264 lineto .53477 .36264 lineto .54329 .33725 lineto fill grestore gsave 0.001 setlinewidth .51054 .3045 moveto .5 .33592 lineto stroke grestore gsave .541 setgray .54329 .33725 moveto .53477 .36264 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .54329 .33725 moveto .53477 .36264 lineto stroke grestore gsave .541 setgray .56868 .29396 moveto .5953 .32058 lineto .60538 .29396 lineto fill grestore gsave .623 setgray .5953 .32058 moveto .60538 .29396 lineto .63736 .29396 lineto .63736 .31134 lineto .62327 .34855 lineto fill grestore gsave 0.001 setlinewidth .5953 .32058 moveto .60538 .29396 lineto stroke grestore gsave .705 setgray .62327 .34855 moveto .63736 .31134 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .62327 .34855 moveto .63736 .31134 lineto stroke grestore gsave .541 setgray .5953 .32058 moveto .57761 .36264 lineto .56868 .36264 lineto .56868 .29396 lineto fill grestore gsave .623 setgray .5953 .32058 moveto .57761 .36264 lineto .61734 .36264 lineto .62327 .34855 lineto fill grestore gsave 0.001 setlinewidth .5953 .32058 moveto .57761 .36264 lineto stroke grestore gsave .705 setgray .62327 .34855 moveto .61734 .36264 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .62327 .34855 moveto .61734 .36264 lineto stroke grestore gsave .623 setgray .63736 .29396 moveto .64274 .29933 lineto .64402 .29396 lineto fill grestore gsave .705 setgray .64274 .29933 moveto .64402 .29396 lineto .68304 .29396 lineto .67422 .33081 lineto fill grestore gsave 0.001 setlinewidth .64274 .29933 moveto .64402 .29396 lineto stroke grestore gsave .786 setgray .67422 .33081 moveto .68304 .29396 lineto .70604 .29396 lineto .70604 .36085 lineto .7057 .36229 lineto fill grestore gsave 0.001 setlinewidth .67422 .33081 moveto .68304 .29396 lineto stroke grestore gsave .868 setgray .7057 .36229 moveto .70604 .36085 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .7057 .36229 moveto .70604 .36085 lineto stroke grestore gsave .623 setgray .63736 .29396 moveto .64274 .29933 lineto .63736 .31134 lineto fill grestore gsave .705 setgray .64274 .29933 moveto .63736 .31134 lineto .63736 .36264 lineto .65997 .36264 lineto .67422 .33081 lineto fill grestore gsave 0.001 setlinewidth .64274 .29933 moveto .63736 .31134 lineto stroke grestore gsave .786 setgray .67422 .33081 moveto .65997 .36264 lineto .70554 .36264 lineto .7057 .36229 lineto fill grestore gsave 0.001 setlinewidth .67422 .33081 moveto .65997 .36264 lineto stroke grestore gsave .868 setgray .7057 .36229 moveto .70554 .36264 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .7057 .36229 moveto .70554 .36264 lineto stroke grestore gsave .786 setgray .70604 .29396 moveto .73129 .3192 lineto .74079 .29396 lineto fill grestore gsave .868 setgray .73129 .3192 moveto .74079 .29396 lineto .77473 .29396 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .73129 .3192 moveto .74079 .29396 lineto stroke grestore gsave .786 setgray .70604 .29396 moveto .73129 .3192 lineto .70604 .36085 lineto fill grestore gsave .868 setgray .73129 .3192 moveto .70604 .36085 lineto .70604 .36264 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .73129 .3192 moveto .70604 .36085 lineto stroke grestore gsave .868 setgray .84341 .29396 moveto .77473 .29396 lineto .84341 .36264 lineto fill grestore gsave .868 setgray .77473 .29396 moveto .84341 .36264 lineto .77473 .36264 lineto fill grestore gsave .786 setgray .91209 .29396 moveto .91209 .35002 lineto .84683 .29396 lineto fill grestore gsave .868 setgray .91209 .35002 moveto .84683 .29396 lineto .84341 .29396 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .35002 moveto .84683 .29396 lineto stroke grestore gsave .868 setgray .84341 .29396 moveto .91209 .36264 lineto .84341 .36264 lineto fill grestore gsave .705 setgray .98077 .29396 moveto .98077 .29567 lineto .97711 .29396 lineto fill grestore gsave .786 setgray .98077 .29567 moveto .97711 .29396 lineto .91209 .29396 lineto .98077 .36264 lineto fill grestore gsave 0.001 setlinewidth .98077 .29567 moveto .97711 .29396 lineto stroke grestore gsave .786 setgray .91209 .35002 moveto .94526 .36264 lineto .98077 .36264 lineto .91209 .29396 lineto fill grestore gsave .868 setgray .91209 .35002 moveto .94526 .36264 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .35002 moveto .94526 .36264 lineto stroke grestore gsave 0.05 setgray 0.08023 .42363 moveto 0.0851 .36264 lineto 0.08791 .36264 lineto 0.08791 .43132 lineto fill grestore gsave .132 setgray 0.08023 .42363 moveto 0.0851 .36264 lineto 0.01923 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.08023 .42363 moveto 0.0851 .36264 lineto stroke grestore gsave 0.05 setgray 0.08791 .43132 moveto 0.08023 .42363 lineto 0.07961 .43132 lineto fill grestore gsave .132 setgray 0.08023 .42363 moveto 0.07961 .43132 lineto 0.01923 .43132 lineto 0.01923 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.08023 .42363 moveto 0.07961 .43132 lineto stroke grestore gsave 0.05 setgray .15659 .43132 moveto .15659 .36264 lineto 0.08791 .36264 lineto fill grestore gsave 0.05 setgray .15659 .43132 moveto 0.08791 .43132 lineto 0.08791 .36264 lineto fill grestore gsave 0.05 setgray .22527 .43132 moveto .22527 .36264 lineto .15659 .36264 lineto fill grestore gsave 0.05 setgray .22527 .43132 moveto .15659 .43132 lineto .15659 .36264 lineto fill grestore gsave 0.05 setgray .22527 .36264 moveto .29396 .43132 lineto .29396 .36264 lineto fill grestore gsave 0.05 setgray .22527 .43132 moveto .22527 .36264 lineto .29396 .43132 lineto fill grestore gsave 0.05 setgray .29396 .36264 moveto .3088 .37748 lineto .3088 .36264 lineto fill grestore gsave .132 setgray .3088 .37748 moveto .3088 .36264 lineto .36094 .36264 lineto .36094 .42962 lineto fill grestore gsave 0.001 setlinewidth .3088 .37748 moveto .3088 .36264 lineto stroke grestore gsave .214 setgray .36094 .42962 moveto .36094 .36264 lineto .36264 .36264 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .36094 .42962 moveto .36094 .36264 lineto stroke grestore gsave 0.05 setgray .30923 .43132 moveto .3088 .37748 lineto .29396 .36264 lineto .29396 .43132 lineto fill grestore gsave .132 setgray .30923 .43132 moveto .3088 .37748 lineto .36094 .42962 lineto .36095 .43132 lineto fill grestore gsave 0.001 setlinewidth .30923 .43132 moveto .3088 .37748 lineto stroke grestore gsave .214 setgray .36095 .43132 moveto .36094 .42962 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .36095 .43132 moveto .36094 .42962 lineto stroke grestore gsave .214 setgray .36264 .36264 moveto .3995 .3995 lineto .39994 .36264 lineto fill grestore gsave .295 setgray .3995 .3995 moveto .39994 .36264 lineto .43132 .36264 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .3995 .3995 moveto .39994 .36264 lineto stroke grestore gsave .214 setgray .3995 .43132 moveto .3995 .3995 lineto .36264 .36264 lineto .36264 .43132 lineto fill grestore gsave .295 setgray .3995 .43132 moveto .3995 .3995 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .3995 .43132 moveto .3995 .3995 lineto stroke grestore gsave .295 setgray .43132 .36264 moveto .44018 .37149 lineto .44051 .36264 lineto fill grestore gsave .377 setgray .44018 .37149 moveto .44051 .36264 lineto .48988 .36264 lineto .48774 .41906 lineto fill grestore gsave 0.001 setlinewidth .44018 .37149 moveto .44051 .36264 lineto stroke grestore gsave .459 setgray .48774 .41906 moveto .48988 .36264 lineto .5 .36264 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .48774 .41906 moveto .48988 .36264 lineto stroke grestore gsave .295 setgray .44018 .37149 moveto .43929 .43132 lineto .43132 .43132 lineto .43132 .36264 lineto fill grestore gsave .377 setgray .44018 .37149 moveto .43929 .43132 lineto .48756 .43132 lineto .48774 .41906 lineto fill grestore gsave 0.001 setlinewidth .44018 .37149 moveto .43929 .43132 lineto stroke grestore gsave .459 setgray .48774 .41906 moveto .48756 .43132 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .48774 .41906 moveto .48756 .43132 lineto stroke grestore gsave .459 setgray .5 .36264 moveto .53321 .39585 lineto .53477 .36264 lineto fill grestore gsave .541 setgray .53321 .39585 moveto .53477 .36264 lineto .56868 .36264 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .53321 .39585 moveto .53477 .36264 lineto stroke grestore gsave .459 setgray .53321 .39585 moveto .53204 .43132 lineto .5 .43132 lineto .5 .36264 lineto fill grestore gsave .541 setgray .53321 .39585 moveto .53204 .43132 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .53321 .39585 moveto .53204 .43132 lineto stroke grestore gsave .541 setgray .56868 .36264 moveto .57729 .37125 lineto .57761 .36264 lineto fill grestore gsave .623 setgray .57729 .37125 moveto .57761 .36264 lineto .61734 .36264 lineto .61562 .40958 lineto fill grestore gsave 0.001 setlinewidth .57729 .37125 moveto .57761 .36264 lineto stroke grestore gsave .705 setgray .61562 .40958 moveto .61734 .36264 lineto .63736 .36264 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .61562 .40958 moveto .61734 .36264 lineto stroke grestore gsave .541 setgray .57729 .37125 moveto .57471 .43132 lineto .56868 .43132 lineto .56868 .36264 lineto fill grestore gsave .623 setgray .57729 .37125 moveto .57471 .43132 lineto .61469 .43132 lineto .61562 .40958 lineto fill grestore gsave 0.001 setlinewidth .57729 .37125 moveto .57471 .43132 lineto stroke grestore gsave .705 setgray .61562 .40958 moveto .61469 .43132 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .61562 .40958 moveto .61469 .43132 lineto stroke grestore gsave .705 setgray .63736 .36264 moveto .65936 .38463 lineto .65997 .36264 lineto fill grestore gsave .786 setgray .65936 .38463 moveto .65997 .36264 lineto .70554 .36264 lineto .70369 .42896 lineto fill grestore gsave 0.001 setlinewidth .65936 .38463 moveto .65997 .36264 lineto stroke grestore gsave .868 setgray .70369 .42896 moveto .70554 .36264 lineto .70604 .36264 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .70369 .42896 moveto .70554 .36264 lineto stroke grestore gsave .705 setgray .65936 .38463 moveto .65737 .43132 lineto .63736 .43132 lineto .63736 .36264 lineto fill grestore gsave .786 setgray .65936 .38463 moveto .65737 .43132 lineto .70359 .43132 lineto .70369 .42896 lineto fill grestore gsave 0.001 setlinewidth .65936 .38463 moveto .65737 .43132 lineto stroke grestore gsave .868 setgray .70369 .42896 moveto .70359 .43132 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .70369 .42896 moveto .70359 .43132 lineto stroke grestore gsave .868 setgray .70604 .36264 moveto .77473 .36264 lineto .77473 .43132 lineto fill grestore gsave .868 setgray .70604 .36264 moveto .70604 .43132 lineto .77473 .43132 lineto fill grestore gsave .868 setgray .84341 .36264 moveto .84341 .43132 lineto .77473 .36264 lineto fill grestore gsave .868 setgray .84341 .43132 moveto .77473 .36264 lineto .77473 .43132 lineto fill grestore gsave .868 setgray .91209 .36264 moveto .91209 .43132 lineto .84341 .36264 lineto fill grestore gsave .868 setgray .91209 .43132 moveto .84341 .36264 lineto .84341 .43132 lineto fill grestore gsave .786 setgray .94526 .36264 moveto .96185 .4124 lineto .98077 .43132 lineto .98077 .36264 lineto fill grestore gsave .868 setgray .94526 .36264 moveto .96185 .4124 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .94526 .36264 moveto .96185 .4124 lineto stroke grestore gsave .786 setgray .98077 .43132 moveto .96767 .43132 lineto .96185 .4124 lineto fill grestore gsave .868 setgray .96767 .43132 moveto .96185 .4124 lineto .91209 .36264 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .96767 .43132 moveto .96185 .4124 lineto stroke grestore gsave 0.05 setgray 0.07961 .43132 moveto 0.07961 .4917 lineto 0.08791 .5 lineto 0.08791 .43132 lineto fill grestore gsave .132 setgray 0.07961 .43132 moveto 0.07961 .4917 lineto 0.01923 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.07961 .43132 moveto 0.07961 .4917 lineto stroke grestore gsave 0.05 setgray 0.08791 .5 moveto 0.07961 .4917 lineto 0.07961 .5 lineto fill grestore gsave .132 setgray 0.07961 .4917 moveto 0.07961 .5 lineto 0.01923 .5 lineto 0.01923 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.07961 .4917 moveto 0.07961 .5 lineto stroke grestore gsave 0.05 setgray .15659 .43132 moveto .15659 .5 lineto 0.08791 .43132 lineto fill grestore gsave 0.05 setgray .15659 .5 moveto 0.08791 .5 lineto 0.08791 .43132 lineto fill grestore gsave 0.05 setgray .22527 .43132 moveto .22527 .5 lineto .15659 .43132 lineto fill grestore gsave 0.05 setgray .22527 .5 moveto .15659 .5 lineto .15659 .43132 lineto fill grestore gsave 0.05 setgray .22527 .43132 moveto .29396 .43132 lineto .29396 .5 lineto fill grestore gsave 0.05 setgray .22527 .5 moveto .22527 .43132 lineto .29396 .5 lineto fill grestore gsave 0.05 setgray .29396 .43132 moveto .30923 .44659 lineto .30923 .43132 lineto fill grestore gsave .132 setgray .30923 .44659 moveto .30923 .43132 lineto .36095 .43132 lineto .36095 .49831 lineto fill grestore gsave 0.001 setlinewidth .30923 .44659 moveto .30923 .43132 lineto stroke grestore gsave .214 setgray .36095 .49831 moveto .36095 .43132 lineto .36264 .43132 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .36095 .49831 moveto .36095 .43132 lineto stroke grestore gsave 0.05 setgray .30923 .5 moveto .30923 .44659 lineto .29396 .43132 lineto .29396 .5 lineto fill grestore gsave .132 setgray .30923 .5 moveto .30923 .44659 lineto .36095 .49831 lineto .36095 .5 lineto fill grestore gsave 0.001 setlinewidth .30923 .5 moveto .30923 .44659 lineto stroke grestore gsave .214 setgray .36095 .5 moveto .36095 .49831 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .36095 .5 moveto .36095 .49831 lineto stroke grestore gsave .214 setgray .36264 .43132 moveto .3995 .46818 lineto .3995 .43132 lineto fill grestore gsave .295 setgray .3995 .46818 moveto .3995 .43132 lineto .43132 .43132 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .3995 .46818 moveto .3995 .43132 lineto stroke grestore gsave .214 setgray .3995 .5 moveto .3995 .46818 lineto .36264 .43132 lineto .36264 .5 lineto fill grestore gsave .295 setgray .3995 .5 moveto .3995 .46818 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .3995 .5 moveto .3995 .46818 lineto stroke grestore gsave .295 setgray .43132 .43132 moveto .43923 .43923 lineto .43929 .43132 lineto fill grestore gsave .377 setgray .43923 .43923 moveto .43929 .43132 lineto .48756 .43132 lineto .48715 .48715 lineto fill grestore gsave 0.001 setlinewidth .43923 .43923 moveto .43929 .43132 lineto stroke grestore gsave .459 setgray .48715 .48715 moveto .48756 .43132 lineto .5 .43132 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .48715 .48715 moveto .48756 .43132 lineto stroke grestore gsave .295 setgray .43923 .5 moveto .43923 .43923 lineto .43132 .43132 lineto .43132 .5 lineto fill grestore gsave .377 setgray .43923 .5 moveto .43923 .43923 lineto .48715 .48715 lineto .48715 .5 lineto fill grestore gsave 0.001 setlinewidth .43923 .5 moveto .43923 .43923 lineto stroke grestore gsave .459 setgray .48715 .5 moveto .48715 .48715 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .48715 .5 moveto .48715 .48715 lineto stroke grestore gsave .459 setgray .5 .43132 moveto .53182 .46314 lineto .53204 .43132 lineto fill grestore gsave .541 setgray .53182 .46314 moveto .53204 .43132 lineto .56868 .43132 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .53182 .46314 moveto .53204 .43132 lineto stroke grestore gsave .459 setgray .53182 .46314 moveto .53158 .5 lineto .5 .5 lineto .5 .43132 lineto fill grestore gsave .541 setgray .53182 .46314 moveto .53158 .5 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .53182 .46314 moveto .53158 .5 lineto stroke grestore gsave .541 setgray .56868 .43132 moveto .57468 .43731 lineto .57471 .43132 lineto fill grestore gsave .623 setgray .57468 .43731 moveto .57471 .43132 lineto .61469 .43132 lineto .61441 .47705 lineto fill grestore gsave 0.001 setlinewidth .57468 .43731 moveto .57471 .43132 lineto stroke grestore gsave .705 setgray .61441 .47705 moveto .61469 .43132 lineto .63736 .43132 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .61441 .47705 moveto .61469 .43132 lineto stroke grestore gsave .541 setgray .57468 .43731 moveto .57429 .5 lineto .56868 .5 lineto .56868 .43132 lineto fill grestore gsave .623 setgray .57468 .43731 moveto .57429 .5 lineto .61427 .5 lineto .61441 .47705 lineto fill grestore gsave 0.001 setlinewidth .57468 .43731 moveto .57429 .5 lineto stroke grestore gsave .705 setgray .61441 .47705 moveto .61427 .5 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .61441 .47705 moveto .61427 .5 lineto stroke grestore gsave .705 setgray .63736 .43132 moveto .65737 .45133 lineto .65737 .43132 lineto fill grestore gsave .786 setgray .65737 .45133 moveto .65737 .43132 lineto .70359 .43132 lineto .70359 .49754 lineto fill grestore gsave 0.001 setlinewidth .65737 .45133 moveto .65737 .43132 lineto stroke grestore gsave .868 setgray .70359 .49754 moveto .70359 .43132 lineto .70604 .43132 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .70359 .49754 moveto .70359 .43132 lineto stroke grestore gsave .705 setgray .65737 .45133 moveto .65702 .5 lineto .63736 .5 lineto .63736 .43132 lineto fill grestore gsave .786 setgray .65737 .45133 moveto .65702 .5 lineto .70357 .5 lineto .70359 .49754 lineto fill grestore gsave 0.001 setlinewidth .65737 .45133 moveto .65702 .5 lineto stroke grestore gsave .868 setgray .70359 .49754 moveto .70357 .5 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .70359 .49754 moveto .70357 .5 lineto stroke grestore gsave .868 setgray .70604 .43132 moveto .77473 .43132 lineto .77473 .5 lineto fill grestore gsave .868 setgray .70604 .5 moveto .70604 .43132 lineto .77473 .5 lineto fill grestore gsave .868 setgray .84341 .43132 moveto .84341 .5 lineto .77473 .43132 lineto fill grestore gsave .868 setgray .84341 .5 moveto .77473 .5 lineto .77473 .43132 lineto fill grestore gsave .868 setgray .91209 .43132 moveto .91209 .5 lineto .84341 .43132 lineto fill grestore gsave .868 setgray .91209 .5 moveto .84341 .5 lineto .84341 .43132 lineto fill grestore gsave .786 setgray .96767 .43132 moveto .96767 .4869 lineto .98077 .5 lineto .98077 .43132 lineto fill grestore gsave .868 setgray .96767 .43132 moveto .96767 .4869 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .96767 .43132 moveto .96767 .4869 lineto stroke grestore gsave .786 setgray .98077 .5 moveto .96767 .4869 lineto .96767 .5 lineto fill grestore gsave .868 setgray .96767 .4869 moveto .96767 .5 lineto .91209 .5 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .96767 .4869 moveto .96767 .5 lineto stroke grestore gsave 0.05 setgray 0.07961 .5 moveto 0.07961 .56038 lineto 0.08791 .56868 lineto 0.08791 .5 lineto fill grestore gsave .132 setgray 0.07961 .5 moveto 0.07961 .56038 lineto 0.01923 .5 lineto fill grestore gsave 0.001 setlinewidth 0.07961 .5 moveto 0.07961 .56038 lineto stroke grestore gsave 0.05 setgray 0.08791 .56868 moveto 0.07961 .56038 lineto 0.07961 .56868 lineto fill grestore gsave .132 setgray 0.07961 .56038 moveto 0.07961 .56868 lineto 0.01923 .56868 lineto 0.01923 .5 lineto fill grestore gsave 0.001 setlinewidth 0.07961 .56038 moveto 0.07961 .56868 lineto stroke grestore gsave 0.05 setgray .15659 .5 moveto .15659 .56868 lineto 0.08791 .5 lineto fill grestore gsave 0.05 setgray .15659 .56868 moveto 0.08791 .56868 lineto 0.08791 .5 lineto fill grestore gsave 0.05 setgray .22527 .5 moveto .22527 .56868 lineto .15659 .5 lineto fill grestore gsave 0.05 setgray .22527 .56868 moveto .15659 .5 lineto .15659 .56868 lineto fill grestore gsave 0.05 setgray .22527 .5 moveto .29396 .5 lineto .29396 .56868 lineto fill grestore gsave 0.05 setgray .22527 .56868 moveto .22527 .5 lineto .29396 .56868 lineto fill grestore gsave 0.05 setgray .29396 .5 moveto .30923 .51527 lineto .30923 .5 lineto fill grestore gsave .132 setgray .30923 .51527 moveto .30923 .5 lineto .36095 .5 lineto .36095 .56699 lineto fill grestore gsave 0.001 setlinewidth .30923 .51527 moveto .30923 .5 lineto stroke grestore gsave .214 setgray .36095 .56699 moveto .36095 .5 lineto .36264 .5 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .36095 .56699 moveto .36095 .5 lineto stroke grestore gsave 0.05 setgray .30923 .56868 moveto .30923 .51527 lineto .29396 .5 lineto .29396 .56868 lineto fill grestore gsave .132 setgray .30923 .56868 moveto .30923 .51527 lineto .36095 .56699 lineto .36095 .56868 lineto fill grestore gsave 0.001 setlinewidth .30923 .56868 moveto .30923 .51527 lineto stroke grestore gsave .214 setgray .36095 .56868 moveto .36095 .56699 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .36095 .56868 moveto .36095 .56699 lineto stroke grestore gsave .214 setgray .36264 .5 moveto .3995 .53687 lineto .3995 .5 lineto fill grestore gsave .295 setgray .3995 .53687 moveto .3995 .5 lineto .43132 .5 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .3995 .53687 moveto .3995 .5 lineto stroke grestore gsave .214 setgray .3995 .56868 moveto .3995 .53687 lineto .36264 .5 lineto .36264 .56868 lineto fill grestore gsave .295 setgray .3995 .56868 moveto .3995 .53687 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .3995 .56868 moveto .3995 .53687 lineto stroke grestore gsave .295 setgray .43132 .5 moveto .43923 .50791 lineto .43923 .5 lineto fill grestore gsave .377 setgray .43923 .50791 moveto .43923 .5 lineto .48715 .5 lineto .48715 .55583 lineto fill grestore gsave 0.001 setlinewidth .43923 .50791 moveto .43923 .5 lineto stroke grestore gsave .459 setgray .48715 .55583 moveto .48715 .5 lineto .5 .5 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .48715 .55583 moveto .48715 .5 lineto stroke grestore gsave .295 setgray .43923 .56868 moveto .43923 .50791 lineto .43132 .5 lineto .43132 .56868 lineto fill grestore gsave .377 setgray .43923 .56868 moveto .43923 .50791 lineto .48715 .55583 lineto .48715 .56868 lineto fill grestore gsave 0.001 setlinewidth .43923 .56868 moveto .43923 .50791 lineto stroke grestore gsave .459 setgray .48715 .56868 moveto .48715 .55583 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .48715 .56868 moveto .48715 .55583 lineto stroke grestore gsave .459 setgray .5 .5 moveto .53158 .53158 lineto .53158 .5 lineto fill grestore gsave .541 setgray .53158 .53158 moveto .53158 .5 lineto .56868 .5 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .53158 .53158 moveto .53158 .5 lineto stroke grestore gsave .459 setgray .53158 .56868 moveto .53158 .53158 lineto .5 .5 lineto .5 .56868 lineto fill grestore gsave .541 setgray .53158 .56868 moveto .53158 .53158 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .53158 .56868 moveto .53158 .53158 lineto stroke grestore gsave .541 setgray .56868 .5 moveto .57429 .50561 lineto .57429 .5 lineto fill grestore gsave .623 setgray .57429 .50561 moveto .57429 .5 lineto .61427 .5 lineto .61427 .54559 lineto fill grestore gsave 0.001 setlinewidth .57429 .50561 moveto .57429 .5 lineto stroke grestore gsave .705 setgray .61427 .54559 moveto .61427 .5 lineto .63736 .5 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .61427 .54559 moveto .61427 .5 lineto stroke grestore gsave .541 setgray .57429 .56868 moveto .57429 .50561 lineto .56868 .5 lineto .56868 .56868 lineto fill grestore gsave .623 setgray .57429 .56868 moveto .57429 .50561 lineto .61427 .54559 lineto .61427 .56868 lineto fill grestore gsave 0.001 setlinewidth .57429 .56868 moveto .57429 .50561 lineto stroke grestore gsave .705 setgray .61427 .56868 moveto .61427 .54559 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .61427 .56868 moveto .61427 .54559 lineto stroke grestore gsave .705 setgray .63736 .5 moveto .65702 .51966 lineto .65702 .5 lineto fill grestore gsave .786 setgray .65702 .51966 moveto .65702 .5 lineto .70357 .5 lineto .70357 .56621 lineto fill grestore gsave 0.001 setlinewidth .65702 .51966 moveto .65702 .5 lineto stroke grestore gsave .868 setgray .70357 .56621 moveto .70357 .5 lineto .70604 .5 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70357 .56621 moveto .70357 .5 lineto stroke grestore gsave .705 setgray .65702 .56868 moveto .65702 .51966 lineto .63736 .5 lineto .63736 .56868 lineto fill grestore gsave .786 setgray .65702 .56868 moveto .65702 .51966 lineto .70357 .56621 lineto .70357 .56868 lineto fill grestore gsave 0.001 setlinewidth .65702 .56868 moveto .65702 .51966 lineto stroke grestore gsave .868 setgray .70357 .56868 moveto .70357 .56621 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70357 .56868 moveto .70357 .56621 lineto stroke grestore gsave .868 setgray .70604 .5 moveto .77473 .5 lineto .77473 .56868 lineto fill grestore gsave .868 setgray .70604 .56868 moveto .70604 .5 lineto .77473 .56868 lineto fill grestore gsave .868 setgray .84341 .5 moveto .84341 .56868 lineto .77473 .5 lineto fill grestore gsave .868 setgray .84341 .56868 moveto .77473 .56868 lineto .77473 .5 lineto fill grestore gsave .868 setgray .91209 .5 moveto .91209 .56868 lineto .84341 .5 lineto fill grestore gsave .868 setgray .91209 .56868 moveto .84341 .56868 lineto .84341 .5 lineto fill grestore gsave .786 setgray .96767 .5 moveto .96767 .55558 lineto .98077 .56868 lineto .98077 .5 lineto fill grestore gsave .868 setgray .96767 .5 moveto .96767 .55558 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .96767 .5 moveto .96767 .55558 lineto stroke grestore gsave .786 setgray .98077 .56868 moveto .96767 .55558 lineto .96767 .56868 lineto fill grestore gsave .868 setgray .96767 .55558 moveto .96767 .56868 lineto .91209 .56868 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .96767 .55558 moveto .96767 .56868 lineto stroke grestore gsave 0.05 setgray 0.08791 .56868 moveto 0.07961 .56868 lineto 0.08791 .62057 lineto fill grestore gsave .132 setgray 0.07961 .56868 moveto 0.08791 .62057 lineto 0.08791 .63736 lineto 0.01923 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.07961 .56868 moveto 0.08791 .62057 lineto stroke grestore gsave .132 setgray 0.08791 .63736 moveto 0.01923 .56868 lineto 0.01923 .63736 lineto fill grestore gsave 0.05 setgray .15659 .56868 moveto .15659 .63736 lineto 0.08791 .56868 lineto fill grestore gsave 0.05 setgray 0.08951 .63736 moveto 0.08791 .62057 lineto 0.08791 .56868 lineto .15659 .63736 lineto fill grestore gsave .132 setgray 0.08951 .63736 moveto 0.08791 .62057 lineto 0.08791 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.08951 .63736 moveto 0.08791 .62057 lineto stroke grestore gsave 0.05 setgray .22527 .56868 moveto .22527 .63736 lineto .15659 .56868 lineto fill grestore gsave 0.05 setgray .22527 .63736 moveto .15659 .56868 lineto .15659 .63736 lineto fill grestore gsave 0.05 setgray .22527 .56868 moveto .29396 .56868 lineto .29396 .63736 lineto fill grestore gsave 0.05 setgray .22527 .56868 moveto .22527 .63736 lineto .29396 .63736 lineto fill grestore gsave 0.05 setgray .29396 .56868 moveto .30899 .58372 lineto .30923 .56868 lineto fill grestore gsave .132 setgray .30899 .58372 moveto .30923 .56868 lineto .36095 .56868 lineto .3599 .63463 lineto fill grestore gsave 0.001 setlinewidth .30899 .58372 moveto .30923 .56868 lineto stroke grestore gsave .214 setgray .3599 .63463 moveto .36095 .56868 lineto .36264 .56868 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .3599 .63463 moveto .36095 .56868 lineto stroke grestore gsave 0.05 setgray .30899 .58372 moveto .30857 .63736 lineto .29396 .63736 lineto .29396 .56868 lineto fill grestore gsave .132 setgray .30899 .58372 moveto .30857 .63736 lineto .35988 .63736 lineto .3599 .63463 lineto fill grestore gsave 0.001 setlinewidth .30899 .58372 moveto .30857 .63736 lineto stroke grestore gsave .214 setgray .3599 .63463 moveto .35988 .63736 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .3599 .63463 moveto .35988 .63736 lineto stroke grestore gsave .214 setgray .36264 .56868 moveto .39887 .60491 lineto .3995 .56868 lineto fill grestore gsave .295 setgray .39887 .60491 moveto .3995 .56868 lineto .43132 .56868 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .39887 .60491 moveto .3995 .56868 lineto stroke grestore gsave .214 setgray .39887 .60491 moveto .39849 .63736 lineto .36264 .63736 lineto .36264 .56868 lineto fill grestore gsave .295 setgray .39887 .60491 moveto .39849 .63736 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .39887 .60491 moveto .39849 .63736 lineto stroke grestore gsave .295 setgray .43132 .56868 moveto .43917 .57654 lineto .43923 .56868 lineto fill grestore gsave .377 setgray .43917 .57654 moveto .43923 .56868 lineto .48715 .56868 lineto .48674 .6241 lineto fill grestore gsave 0.001 setlinewidth .43917 .57654 moveto .43923 .56868 lineto stroke grestore gsave .459 setgray .48674 .6241 moveto .48715 .56868 lineto .5 .56868 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .48674 .6241 moveto .48715 .56868 lineto stroke grestore gsave .295 setgray .43917 .57654 moveto .43781 .63736 lineto .43132 .63736 lineto .43132 .56868 lineto fill grestore gsave .377 setgray .43917 .57654 moveto .43781 .63736 lineto .48644 .63736 lineto .48674 .6241 lineto fill grestore gsave 0.001 setlinewidth .43917 .57654 moveto .43781 .63736 lineto stroke grestore gsave .459 setgray .48674 .6241 moveto .48644 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .48674 .6241 moveto .48644 .63736 lineto stroke grestore gsave .459 setgray .5 .56868 moveto .53158 .60026 lineto .53158 .56868 lineto fill grestore gsave .541 setgray .53158 .60026 moveto .53158 .56868 lineto .56868 .56868 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .53158 .60026 moveto .53158 .56868 lineto stroke grestore gsave .459 setgray .53158 .60026 moveto .53133 .63736 lineto .5 .63736 lineto .5 .56868 lineto fill grestore gsave .541 setgray .53158 .60026 moveto .53133 .63736 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .53158 .60026 moveto .53133 .63736 lineto stroke grestore gsave .541 setgray .56868 .56868 moveto .57429 .56868 lineto .57433 .57433 lineto fill grestore gsave .623 setgray .57429 .56868 moveto .57433 .57433 lineto .61455 .61455 lineto .61427 .56868 lineto fill grestore gsave 0.001 setlinewidth .57429 .56868 moveto .57433 .57433 lineto stroke grestore gsave .705 setgray .61427 .56868 moveto .61455 .61455 lineto .63736 .63736 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .61427 .56868 moveto .61455 .61455 lineto stroke grestore gsave .541 setgray .57433 .63736 moveto .57433 .57433 lineto .56868 .56868 lineto .56868 .63736 lineto fill grestore gsave .623 setgray .57433 .63736 moveto .57433 .57433 lineto .61455 .61455 lineto .61455 .63736 lineto fill grestore gsave 0.001 setlinewidth .57433 .63736 moveto .57433 .57433 lineto stroke grestore gsave .705 setgray .61455 .63736 moveto .61455 .61455 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .61455 .63736 moveto .61455 .61455 lineto stroke grestore gsave .705 setgray .63736 .56868 moveto .65702 .56868 lineto .65716 .58848 lineto fill grestore gsave .786 setgray .65702 .56868 moveto .65716 .58848 lineto .70405 .63537 lineto .70357 .56868 lineto fill grestore gsave 0.001 setlinewidth .65702 .56868 moveto .65716 .58848 lineto stroke grestore gsave .868 setgray .70357 .56868 moveto .70405 .63537 lineto .70604 .63736 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70357 .56868 moveto .70405 .63537 lineto stroke grestore gsave .705 setgray .65751 .63736 moveto .65716 .58848 lineto .63736 .56868 lineto .63736 .63736 lineto fill grestore gsave .786 setgray .65751 .63736 moveto .65716 .58848 lineto .70405 .63537 lineto .70406 .63736 lineto fill grestore gsave 0.001 setlinewidth .65751 .63736 moveto .65716 .58848 lineto stroke grestore gsave .868 setgray .70406 .63736 moveto .70405 .63537 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .70406 .63736 moveto .70405 .63537 lineto stroke grestore gsave .868 setgray .70604 .56868 moveto .77473 .63736 lineto .77473 .56868 lineto fill grestore gsave .868 setgray .70604 .63736 moveto .70604 .56868 lineto .77473 .63736 lineto fill grestore gsave .868 setgray .84341 .63736 moveto .84341 .56868 lineto .77473 .56868 lineto fill grestore gsave .868 setgray .84341 .63736 moveto .77473 .63736 lineto .77473 .56868 lineto fill grestore gsave .868 setgray .91209 .63736 moveto .91209 .56868 lineto .84341 .56868 lineto fill grestore gsave .868 setgray .91209 .63736 moveto .84341 .63736 lineto .84341 .56868 lineto fill grestore gsave .786 setgray .9637 .62029 moveto .96767 .56868 lineto .98077 .56868 lineto .98077 .63736 lineto fill grestore gsave .868 setgray .9637 .62029 moveto .96767 .56868 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .9637 .62029 moveto .96767 .56868 lineto stroke grestore gsave .786 setgray .98077 .63736 moveto .9637 .62029 lineto .96239 .63736 lineto fill grestore gsave .868 setgray .9637 .62029 moveto .96239 .63736 lineto .91209 .63736 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .9637 .62029 moveto .96239 .63736 lineto stroke grestore gsave .132 setgray 0.08791 .63736 moveto 0.01923 .63736 lineto 0.08791 .70604 lineto fill grestore gsave .132 setgray 0.01923 .63736 moveto 0.08791 .70604 lineto 0.01923 .70604 lineto fill grestore gsave 0.05 setgray 0.08951 .63736 moveto 0.09271 .64216 lineto .15659 .70604 lineto .15659 .63736 lineto fill grestore gsave .132 setgray 0.08951 .63736 moveto 0.09271 .64216 lineto 0.08791 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.08951 .63736 moveto 0.09271 .64216 lineto stroke grestore gsave 0.05 setgray .15659 .70604 moveto .13939 .70604 lineto 0.09271 .64216 lineto fill grestore gsave .132 setgray .13939 .70604 moveto 0.09271 .64216 lineto 0.08791 .63736 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth .13939 .70604 moveto 0.09271 .64216 lineto stroke grestore gsave 0.05 setgray .22527 .63736 moveto .22527 .70604 lineto .15659 .63736 lineto fill grestore gsave 0.05 setgray .22527 .70604 moveto .15659 .63736 lineto .15659 .70604 lineto fill grestore gsave 0.05 setgray .22527 .63736 moveto .29396 .63736 lineto .29396 .70604 lineto fill grestore gsave 0.05 setgray .22527 .63736 moveto .22527 .70604 lineto .29396 .70604 lineto fill grestore gsave 0.05 setgray .29396 .63736 moveto .30633 .64974 lineto .30857 .63736 lineto fill grestore gsave .132 setgray .30633 .64974 moveto .30857 .63736 lineto .35988 .63736 lineto .34977 .69318 lineto fill grestore gsave 0.001 setlinewidth .30633 .64974 moveto .30857 .63736 lineto stroke grestore gsave .214 setgray .34977 .69318 moveto .35988 .63736 lineto .36264 .63736 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .34977 .69318 moveto .35988 .63736 lineto stroke grestore gsave 0.05 setgray .30633 .64974 moveto .30007 .70604 lineto .29396 .70604 lineto .29396 .63736 lineto fill grestore gsave .132 setgray .30633 .64974 moveto .30007 .70604 lineto .34834 .70604 lineto .34977 .69318 lineto fill grestore gsave 0.001 setlinewidth .30633 .64974 moveto .30007 .70604 lineto stroke grestore gsave .214 setgray .34977 .69318 moveto .34834 .70604 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .34977 .69318 moveto .34834 .70604 lineto stroke grestore gsave .214 setgray .36264 .63736 moveto .39442 .66915 lineto .39849 .63736 lineto fill grestore gsave .295 setgray .39442 .66915 moveto .39849 .63736 lineto .43132 .63736 lineto .43132 .67691 lineto .42801 .70274 lineto fill grestore gsave 0.001 setlinewidth .39442 .66915 moveto .39849 .63736 lineto stroke grestore gsave .377 setgray .42801 .70274 moveto .43132 .67691 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .42801 .70274 moveto .43132 .67691 lineto stroke grestore gsave .214 setgray .39442 .66915 moveto .38946 .70604 lineto .36264 .70604 lineto .36264 .63736 lineto fill grestore gsave .295 setgray .39442 .66915 moveto .38946 .70604 lineto .42757 .70604 lineto .42801 .70274 lineto fill grestore gsave 0.001 setlinewidth .39442 .66915 moveto .38946 .70604 lineto stroke grestore gsave .377 setgray .42801 .70274 moveto .42757 .70604 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .42801 .70274 moveto .42757 .70604 lineto stroke grestore gsave .295 setgray .43132 .63736 moveto .43724 .64328 lineto .43781 .63736 lineto fill grestore gsave .377 setgray .43724 .64328 moveto .43781 .63736 lineto .48644 .63736 lineto .48157 .68761 lineto fill grestore gsave 0.001 setlinewidth .43724 .64328 moveto .43781 .63736 lineto stroke grestore gsave .459 setgray .48157 .68761 moveto .48644 .63736 lineto .5 .63736 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .48157 .68761 moveto .48644 .63736 lineto stroke grestore gsave .295 setgray .43132 .63736 moveto .43724 .64328 lineto .43132 .67691 lineto fill grestore gsave .377 setgray .43724 .64328 moveto .43132 .67691 lineto .43132 .70604 lineto .47832 .70604 lineto .48157 .68761 lineto fill grestore gsave 0.001 setlinewidth .43724 .64328 moveto .43132 .67691 lineto stroke grestore gsave .459 setgray .48157 .68761 moveto .47832 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .48157 .68761 moveto .47832 .70604 lineto stroke grestore gsave .459 setgray .5 .63736 moveto .53133 .63736 lineto .53197 .66933 lineto fill grestore gsave .541 setgray .53133 .63736 moveto .53197 .66933 lineto .56868 .70604 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .53133 .63736 moveto .53197 .66933 lineto stroke grestore gsave .459 setgray .53197 .66933 moveto .52841 .70604 lineto .5 .70604 lineto .5 .63736 lineto fill grestore gsave .541 setgray .53197 .66933 moveto .52841 .70604 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .53197 .66933 moveto .52841 .70604 lineto stroke grestore gsave .541 setgray .56868 .63736 moveto .57433 .63736 lineto .57482 .6435 lineto fill grestore gsave .623 setgray .57433 .63736 moveto .57482 .6435 lineto .61855 .68723 lineto .61455 .63736 lineto fill grestore gsave 0.001 setlinewidth .57433 .63736 moveto .57482 .6435 lineto stroke grestore gsave .705 setgray .61455 .63736 moveto .61855 .68723 lineto .63736 .70604 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .61455 .63736 moveto .61855 .68723 lineto stroke grestore gsave .541 setgray .57605 .70604 moveto .57482 .6435 lineto .56868 .63736 lineto .56868 .70604 lineto fill grestore gsave .623 setgray .57605 .70604 moveto .57482 .6435 lineto .61855 .68723 lineto .61892 .70604 lineto fill grestore gsave 0.001 setlinewidth .57605 .70604 moveto .57482 .6435 lineto stroke grestore gsave .705 setgray .61892 .70604 moveto .61855 .68723 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .61892 .70604 moveto .61855 .68723 lineto stroke grestore gsave .705 setgray .63736 .63736 moveto .65751 .63736 lineto .65906 .65906 lineto fill grestore gsave .786 setgray .65751 .63736 moveto .65906 .65906 lineto .70604 .70604 lineto .70604 .66512 lineto .70406 .63736 lineto fill grestore gsave 0.001 setlinewidth .65751 .63736 moveto .65906 .65906 lineto stroke grestore gsave .868 setgray .70406 .63736 moveto .70604 .66512 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .70406 .63736 moveto .70604 .66512 lineto stroke grestore gsave .705 setgray .66333 .70604 moveto .65906 .65906 lineto .63736 .63736 lineto .63736 .70604 lineto fill grestore gsave .786 setgray .66333 .70604 moveto .65906 .65906 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .66333 .70604 moveto .65906 .65906 lineto stroke grestore gsave .868 setgray .70604 .63736 moveto .77473 .70604 lineto .77473 .63736 lineto fill grestore gsave .786 setgray .70604 .70604 moveto .71224 .70604 lineto .70604 .66512 lineto fill grestore gsave .868 setgray .71224 .70604 moveto .70604 .66512 lineto .70604 .63736 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .71224 .70604 moveto .70604 .66512 lineto stroke grestore gsave .868 setgray .84341 .70604 moveto .84341 .63736 lineto .77473 .63736 lineto fill grestore gsave .868 setgray .84341 .70604 moveto .77473 .70604 lineto .77473 .63736 lineto fill grestore gsave .786 setgray .91209 .70604 moveto .90858 .70254 lineto .91209 .69681 lineto fill grestore gsave .868 setgray .90858 .70254 moveto .91209 .69681 lineto .91209 .63736 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .90858 .70254 moveto .91209 .69681 lineto stroke grestore gsave .786 setgray .91209 .70604 moveto .90858 .70254 lineto .90736 .70604 lineto fill grestore gsave .868 setgray .90858 .70254 moveto .90736 .70604 lineto .84341 .70604 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .90858 .70254 moveto .90736 .70604 lineto stroke grestore gsave .786 setgray .93773 .66301 moveto .96239 .63736 lineto .98077 .63736 lineto .98077 .70604 lineto fill grestore gsave .868 setgray .93773 .66301 moveto .96239 .63736 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .93773 .66301 moveto .96239 .63736 lineto stroke grestore gsave .786 setgray .93773 .66301 moveto .91209 .69681 lineto .91209 .70604 lineto .98077 .70604 lineto fill grestore gsave .868 setgray .93773 .66301 moveto .91209 .69681 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .93773 .66301 moveto .91209 .69681 lineto stroke grestore gsave .132 setgray 0.08791 .72184 moveto 0.02758 .7144 lineto 0.01923 .70604 lineto 0.08791 .70604 lineto fill grestore gsave .214 setgray 0.08791 .72184 moveto 0.02758 .7144 lineto 0.05818 .74499 lineto 0.08791 .74866 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .72184 moveto 0.02758 .7144 lineto stroke grestore gsave .295 setgray 0.08791 .74866 moveto 0.05818 .74499 lineto 0.08791 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .74866 moveto 0.05818 .74499 lineto stroke grestore gsave .132 setgray 0.01923 .70604 moveto 0.01923 .71365 lineto 0.02758 .7144 lineto fill grestore gsave .214 setgray 0.01923 .71365 moveto 0.02758 .7144 lineto 0.05818 .74499 lineto 0.01923 .7415 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .71365 moveto 0.02758 .7144 lineto stroke grestore gsave .295 setgray 0.01923 .7415 moveto 0.05818 .74499 lineto 0.08791 .77473 lineto 0.07919 .77473 lineto 0.01923 .76934 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .7415 moveto 0.05818 .74499 lineto stroke grestore gsave .377 setgray 0.01923 .76934 moveto 0.07919 .77473 lineto 0.01923 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .76934 moveto 0.07919 .77473 lineto stroke grestore gsave 0.05 setgray .15659 .70604 moveto .15659 .70979 lineto .13939 .70604 lineto fill grestore gsave .132 setgray .15659 .70979 moveto .13939 .70604 lineto 0.08791 .70604 lineto .10844 .72658 lineto .15659 .73705 lineto fill grestore gsave 0.001 setlinewidth .15659 .70979 moveto .13939 .70604 lineto stroke grestore gsave .214 setgray .15659 .73705 moveto .10844 .72658 lineto .14329 .76142 lineto .15659 .76432 lineto fill grestore gsave 0.001 setlinewidth .15659 .73705 moveto .10844 .72658 lineto stroke grestore gsave .295 setgray .15659 .76432 moveto .14329 .76142 lineto .15659 .77473 lineto fill grestore gsave 0.001 setlinewidth .15659 .76432 moveto .14329 .76142 lineto stroke grestore gsave .132 setgray 0.08791 .70604 moveto 0.08791 .72184 lineto .10844 .72658 lineto fill grestore gsave .214 setgray 0.08791 .72184 moveto .10844 .72658 lineto .14329 .76142 lineto 0.08791 .74866 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .72184 moveto .10844 .72658 lineto stroke grestore gsave .295 setgray 0.08791 .74866 moveto .14329 .76142 lineto .15659 .77473 lineto 0.08791 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .74866 moveto .14329 .76142 lineto stroke grestore gsave 0.05 setgray .22527 .72527 moveto .16248 .71193 lineto .15659 .70604 lineto .22527 .70604 lineto fill grestore gsave .132 setgray .22527 .72527 moveto .16248 .71193 lineto .20535 .7548 lineto .22527 .75903 lineto fill grestore gsave 0.001 setlinewidth .22527 .72527 moveto .16248 .71193 lineto stroke grestore gsave .214 setgray .22527 .75903 moveto .20535 .7548 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .22527 .75903 moveto .20535 .7548 lineto stroke grestore gsave 0.05 setgray .15659 .70604 moveto .15659 .70979 lineto .16248 .71193 lineto fill grestore gsave .132 setgray .15659 .70979 moveto .16248 .71193 lineto .20535 .7548 lineto .15659 .73705 lineto fill grestore gsave 0.001 setlinewidth .15659 .70979 moveto .16248 .71193 lineto stroke grestore gsave .214 setgray .15659 .73705 moveto .20535 .7548 lineto .22527 .77473 lineto .18518 .77473 lineto .15659 .76432 lineto fill grestore gsave 0.001 setlinewidth .15659 .73705 moveto .20535 .7548 lineto stroke grestore gsave .295 setgray .15659 .76432 moveto .18518 .77473 lineto .15659 .77473 lineto fill grestore gsave 0.001 setlinewidth .15659 .76432 moveto .18518 .77473 lineto stroke grestore gsave 0.05 setgray .24113 .7219 moveto .29396 .71034 lineto .29396 .70604 lineto .22527 .70604 lineto fill grestore gsave .132 setgray .24113 .7219 moveto .29396 .71034 lineto .29396 .74429 lineto .26898 .74975 lineto fill grestore gsave 0.001 setlinewidth .24113 .7219 moveto .29396 .71034 lineto stroke grestore gsave .214 setgray .26898 .74975 moveto .29396 .74429 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .26898 .74975 moveto .29396 .74429 lineto stroke grestore gsave 0.05 setgray .22527 .70604 moveto .24113 .7219 lineto .22527 .72527 lineto fill grestore gsave .132 setgray .24113 .7219 moveto .22527 .72527 lineto .22527 .75903 lineto .26898 .74975 lineto fill grestore gsave 0.001 setlinewidth .24113 .7219 moveto .22527 .72527 lineto stroke grestore gsave .214 setgray .26898 .74975 moveto .22527 .75903 lineto .22527 .77473 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .26898 .74975 moveto .22527 .75903 lineto stroke grestore gsave 0.05 setgray .29396 .70604 moveto .29631 .7084 lineto .30007 .70604 lineto fill grestore gsave .132 setgray .29631 .7084 moveto .30007 .70604 lineto .34834 .70604 lineto .31487 .72696 lineto fill grestore gsave 0.001 setlinewidth .29631 .7084 moveto .30007 .70604 lineto stroke grestore gsave .214 setgray .31487 .72696 moveto .34834 .70604 lineto .36264 .70604 lineto .36264 .72728 lineto .33344 .74553 lineto fill grestore gsave 0.001 setlinewidth .31487 .72696 moveto .34834 .70604 lineto stroke grestore gsave .295 setgray .33344 .74553 moveto .36264 .72728 lineto .36264 .75745 lineto .35201 .76409 lineto fill grestore gsave 0.001 setlinewidth .33344 .74553 moveto .36264 .72728 lineto stroke grestore gsave .377 setgray .35201 .76409 moveto .36264 .75745 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .35201 .76409 moveto .36264 .75745 lineto stroke grestore gsave 0.05 setgray .29396 .70604 moveto .29631 .7084 lineto .29396 .71034 lineto fill grestore gsave .132 setgray .29631 .7084 moveto .29396 .71034 lineto .29396 .74429 lineto .31487 .72696 lineto fill grestore gsave 0.001 setlinewidth .29631 .7084 moveto .29396 .71034 lineto stroke grestore gsave .214 setgray .31487 .72696 moveto .29396 .74429 lineto .29396 .77473 lineto .29818 .77473 lineto .33344 .74553 lineto fill grestore gsave 0.001 setlinewidth .31487 .72696 moveto .29396 .74429 lineto stroke grestore gsave .295 setgray .33344 .74553 moveto .29818 .77473 lineto .33917 .77473 lineto .35201 .76409 lineto fill grestore gsave 0.001 setlinewidth .33344 .74553 moveto .29818 .77473 lineto stroke grestore gsave .377 setgray .35201 .76409 moveto .33917 .77473 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .35201 .76409 moveto .33917 .77473 lineto stroke grestore gsave .214 setgray .36264 .70604 moveto .37684 .72024 lineto .38946 .70604 lineto fill grestore gsave .295 setgray .37684 .72024 moveto .38946 .70604 lineto .42757 .70604 lineto .39701 .74042 lineto fill grestore gsave 0.001 setlinewidth .37684 .72024 moveto .38946 .70604 lineto stroke grestore gsave .377 setgray .39701 .74042 moveto .42757 .70604 lineto .43132 .70604 lineto .43132 .7447 lineto .41719 .7606 lineto fill grestore gsave 0.001 setlinewidth .39701 .74042 moveto .42757 .70604 lineto stroke grestore gsave .459 setgray .41719 .7606 moveto .43132 .7447 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .41719 .7606 moveto .43132 .7447 lineto stroke grestore gsave .214 setgray .36264 .70604 moveto .37684 .72024 lineto .36264 .72728 lineto fill grestore gsave .295 setgray .37684 .72024 moveto .36264 .72728 lineto .36264 .75745 lineto .39701 .74042 lineto fill grestore gsave 0.001 setlinewidth .37684 .72024 moveto .36264 .72728 lineto stroke grestore gsave .377 setgray .39701 .74042 moveto .36264 .75745 lineto .36264 .77473 lineto .38867 .77473 lineto .41719 .7606 lineto fill grestore gsave 0.001 setlinewidth .39701 .74042 moveto .36264 .75745 lineto stroke grestore gsave .459 setgray .41719 .7606 moveto .38867 .77473 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .41719 .7606 moveto .38867 .77473 lineto stroke grestore gsave .377 setgray .43132 .70604 moveto .46099 .73572 lineto .47832 .70604 lineto fill grestore gsave .459 setgray .46099 .73572 moveto .47832 .70604 lineto .5 .70604 lineto .5 .7582 lineto .49391 .76863 lineto fill grestore gsave 0.001 setlinewidth .46099 .73572 moveto .47832 .70604 lineto stroke grestore gsave .541 setgray .49391 .76863 moveto .5 .7582 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .49391 .76863 moveto .5 .7582 lineto stroke grestore gsave .377 setgray .43132 .70604 moveto .46099 .73572 lineto .43132 .7447 lineto fill grestore gsave .459 setgray .46099 .73572 moveto .43132 .7447 lineto .43132 .77473 lineto .47377 .77473 lineto .49391 .76863 lineto fill grestore gsave 0.001 setlinewidth .46099 .73572 moveto .43132 .7447 lineto stroke grestore gsave .541 setgray .49391 .76863 moveto .47377 .77473 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .49391 .76863 moveto .47377 .77473 lineto stroke grestore gsave .459 setgray .5 .70604 moveto .52841 .70604 lineto .5334 .73944 lineto fill grestore gsave .541 setgray .52841 .70604 moveto .5334 .73944 lineto .56868 .77473 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .52841 .70604 moveto .5334 .73944 lineto stroke grestore gsave .459 setgray .5 .70604 moveto .5334 .73944 lineto .5 .7582 lineto fill grestore gsave .541 setgray .5334 .73944 moveto .5 .7582 lineto .5 .77473 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .5334 .73944 moveto .5 .7582 lineto stroke grestore gsave .541 setgray .56868 .70604 moveto .57605 .70604 lineto .59252 .72988 lineto fill grestore gsave .623 setgray .57605 .70604 moveto .59252 .72988 lineto .63736 .77473 lineto .63736 .73274 lineto .61892 .70604 lineto fill grestore gsave 0.001 setlinewidth .57605 .70604 moveto .59252 .72988 lineto stroke grestore gsave .705 setgray .61892 .70604 moveto .63736 .73274 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .61892 .70604 moveto .63736 .73274 lineto stroke grestore gsave .541 setgray .60591 .77473 moveto .59252 .72988 lineto .56868 .70604 lineto .56868 .77473 lineto fill grestore gsave .623 setgray .60591 .77473 moveto .59252 .72988 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .60591 .77473 moveto .59252 .72988 lineto stroke grestore gsave .705 setgray .66333 .70604 moveto .70604 .75339 lineto .70604 .77473 lineto .63736 .70604 lineto fill grestore gsave .786 setgray .66333 .70604 moveto .70604 .75339 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .66333 .70604 moveto .70604 .75339 lineto stroke grestore gsave .623 setgray .63736 .77473 moveto .67441 .77473 lineto .63736 .73274 lineto fill grestore gsave .705 setgray .67441 .77473 moveto .63736 .73274 lineto .63736 .70604 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .67441 .77473 moveto .63736 .73274 lineto stroke grestore gsave .786 setgray .77473 .74129 moveto .71224 .70604 lineto .70604 .70604 lineto .77473 .77473 lineto fill grestore gsave .868 setgray .77473 .74129 moveto .71224 .70604 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .77473 .74129 moveto .71224 .70604 lineto stroke grestore gsave .705 setgray .70604 .77473 moveto .70604 .75339 lineto .74133 .77473 lineto fill grestore gsave .786 setgray .70604 .75339 moveto .74133 .77473 lineto .77473 .77473 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .70604 .75339 moveto .74133 .77473 lineto stroke grestore gsave .705 setgray .84341 .77473 moveto .83844 .76976 lineto .84341 .76908 lineto fill grestore gsave .786 setgray .83844 .76976 moveto .84341 .76908 lineto .84341 .72475 lineto .79942 .73074 lineto fill grestore gsave 0.001 setlinewidth .83844 .76976 moveto .84341 .76908 lineto stroke grestore gsave .868 setgray .79942 .73074 moveto .84341 .72475 lineto .84341 .70604 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .79942 .73074 moveto .84341 .72475 lineto stroke grestore gsave .705 setgray .84341 .77473 moveto .83844 .76976 lineto .82682 .77473 lineto fill grestore gsave .786 setgray .83844 .76976 moveto .82682 .77473 lineto .77473 .77473 lineto .77473 .74129 lineto .79942 .73074 lineto fill grestore gsave 0.001 setlinewidth .83844 .76976 moveto .82682 .77473 lineto stroke grestore gsave .868 setgray .79942 .73074 moveto .77473 .74129 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .79942 .73074 moveto .77473 .74129 lineto stroke grestore gsave .705 setgray .91209 .77473 moveto .89142 .75406 lineto .91209 .74813 lineto fill grestore gsave .786 setgray .89142 .75406 moveto .91209 .74813 lineto .91209 .70604 lineto .90736 .70604 lineto .85766 .72029 lineto fill grestore gsave 0.001 setlinewidth .89142 .75406 moveto .91209 .74813 lineto stroke grestore gsave .868 setgray .85766 .72029 moveto .90736 .70604 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .85766 .72029 moveto .90736 .70604 lineto stroke grestore gsave .705 setgray .89142 .75406 moveto .84341 .76908 lineto .84341 .77473 lineto .91209 .77473 lineto fill grestore gsave .786 setgray .89142 .75406 moveto .84341 .76908 lineto .84341 .72475 lineto .85766 .72029 lineto fill grestore gsave 0.001 setlinewidth .89142 .75406 moveto .84341 .76908 lineto stroke grestore gsave .868 setgray .85766 .72029 moveto .84341 .72475 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .85766 .72029 moveto .84341 .72475 lineto stroke grestore gsave .705 setgray .98077 .77473 moveto .94945 .7434 lineto .98077 .73691 lineto fill grestore gsave .786 setgray .94945 .7434 moveto .98077 .73691 lineto .98077 .70604 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .94945 .7434 moveto .98077 .73691 lineto stroke grestore gsave .705 setgray .94945 .7434 moveto .91209 .74813 lineto .91209 .77473 lineto .98077 .77473 lineto fill grestore gsave .786 setgray .94945 .7434 moveto .91209 .74813 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .94945 .7434 moveto .91209 .74813 lineto stroke grestore gsave .295 setgray 0.08791 .77473 moveto 0.08791 .77658 lineto 0.07919 .77473 lineto fill grestore gsave .377 setgray 0.08791 .77658 moveto 0.07919 .77473 lineto 0.01923 .77473 lineto 0.08663 .84213 lineto 0.08791 .8424 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .77658 moveto 0.07919 .77473 lineto stroke grestore gsave .459 setgray 0.08791 .8424 moveto 0.08663 .84213 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .8424 moveto 0.08663 .84213 lineto stroke grestore gsave .377 setgray 0.01923 .77473 moveto 0.01923 .83963 lineto 0.08663 .84213 lineto fill grestore gsave .459 setgray 0.01923 .83963 moveto 0.08663 .84213 lineto 0.08791 .84341 lineto 0.01923 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .83963 moveto 0.08663 .84213 lineto stroke grestore gsave .295 setgray .15659 .80214 moveto 0.08993 .77674 lineto 0.08791 .77473 lineto .15659 .77473 lineto fill grestore gsave .377 setgray .15659 .80214 moveto 0.08993 .77674 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .15659 .80214 moveto 0.08993 .77674 lineto stroke grestore gsave .295 setgray 0.08791 .77473 moveto 0.08791 .77658 lineto 0.08993 .77674 lineto fill grestore gsave .377 setgray 0.08791 .77658 moveto 0.08993 .77674 lineto .15659 .84341 lineto .10037 .84341 lineto 0.08791 .8424 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .77658 moveto 0.08993 .77674 lineto stroke grestore gsave .459 setgray 0.08791 .8424 moveto .10037 .84341 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .8424 moveto .10037 .84341 lineto stroke grestore gsave .214 setgray .22527 .77473 moveto .22527 .7903 lineto .18518 .77473 lineto fill grestore gsave .295 setgray .22527 .7903 moveto .18518 .77473 lineto .15659 .77473 lineto .186 .80414 lineto .22527 .81939 lineto fill grestore gsave 0.001 setlinewidth .22527 .7903 moveto .18518 .77473 lineto stroke grestore gsave .377 setgray .22527 .81939 moveto .186 .80414 lineto .22527 .84341 lineto fill grestore gsave 0.001 setlinewidth .22527 .81939 moveto .186 .80414 lineto stroke grestore gsave .295 setgray .15659 .77473 moveto .15659 .80214 lineto .186 .80414 lineto fill grestore gsave .377 setgray .15659 .80214 moveto .186 .80414 lineto .22527 .84341 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .15659 .80214 moveto .186 .80414 lineto stroke grestore gsave .214 setgray .2371 .78655 moveto .29396 .77737 lineto .29396 .77473 lineto .22527 .77473 lineto fill grestore gsave .295 setgray .2371 .78655 moveto .29396 .77737 lineto .29396 .80303 lineto .25919 .80864 lineto fill grestore gsave 0.001 setlinewidth .2371 .78655 moveto .29396 .77737 lineto stroke grestore gsave .377 setgray .25919 .80864 moveto .29396 .80303 lineto .29396 .82868 lineto .28128 .83073 lineto fill grestore gsave 0.001 setlinewidth .25919 .80864 moveto .29396 .80303 lineto stroke grestore gsave .459 setgray .28128 .83073 moveto .29396 .82868 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .28128 .83073 moveto .29396 .82868 lineto stroke grestore gsave .214 setgray .22527 .77473 moveto .2371 .78655 lineto .22527 .7903 lineto fill grestore gsave .295 setgray .2371 .78655 moveto .22527 .7903 lineto .22527 .81939 lineto .25919 .80864 lineto fill grestore gsave 0.001 setlinewidth .2371 .78655 moveto .22527 .7903 lineto stroke grestore gsave .377 setgray .25919 .80864 moveto .22527 .81939 lineto .22527 .84341 lineto .24128 .84341 lineto .28128 .83073 lineto fill grestore gsave 0.001 setlinewidth .25919 .80864 moveto .22527 .81939 lineto stroke grestore gsave .459 setgray .28128 .83073 moveto .24128 .84341 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .28128 .83073 moveto .24128 .84341 lineto stroke grestore gsave .214 setgray .29396 .77473 moveto .29609 .77686 lineto .29818 .77473 lineto fill grestore gsave .295 setgray .29609 .77686 moveto .29818 .77473 lineto .33917 .77473 lineto .31678 .79755 lineto fill grestore gsave 0.001 setlinewidth .29609 .77686 moveto .29818 .77473 lineto stroke grestore gsave .377 setgray .31678 .79755 moveto .33917 .77473 lineto .36264 .77473 lineto .36264 .79258 lineto .33746 .81823 lineto fill grestore gsave 0.001 setlinewidth .31678 .79755 moveto .33917 .77473 lineto stroke grestore gsave .459 setgray .33746 .81823 moveto .36264 .79258 lineto .36264 .83435 lineto .35815 .83892 lineto fill grestore gsave 0.001 setlinewidth .33746 .81823 moveto .36264 .79258 lineto stroke grestore gsave .541 setgray .35815 .83892 moveto .36264 .83435 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .35815 .83892 moveto .36264 .83435 lineto stroke grestore gsave .214 setgray .29396 .77473 moveto .29609 .77686 lineto .29396 .77737 lineto fill grestore gsave .295 setgray .29609 .77686 moveto .29396 .77737 lineto .29396 .80303 lineto .31678 .79755 lineto fill grestore gsave 0.001 setlinewidth .29609 .77686 moveto .29396 .77737 lineto stroke grestore gsave .377 setgray .31678 .79755 moveto .29396 .80303 lineto .29396 .82868 lineto .33746 .81823 lineto fill grestore gsave 0.001 setlinewidth .31678 .79755 moveto .29396 .80303 lineto stroke grestore gsave .459 setgray .33746 .81823 moveto .29396 .82868 lineto .29396 .84341 lineto .33948 .84341 lineto .35815 .83892 lineto fill grestore gsave 0.001 setlinewidth .33746 .81823 moveto .29396 .82868 lineto stroke grestore gsave .541 setgray .35815 .83892 moveto .33948 .84341 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .35815 .83892 moveto .33948 .84341 lineto stroke grestore gsave .377 setgray .36264 .77473 moveto .37855 .79064 lineto .38867 .77473 lineto fill grestore gsave .459 setgray .37855 .79064 moveto .38867 .77473 lineto .43132 .77473 lineto .43132 .80344 lineto .41579 .82788 lineto fill grestore gsave 0.001 setlinewidth .37855 .79064 moveto .38867 .77473 lineto stroke grestore gsave .541 setgray .41579 .82788 moveto .43132 .80344 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .41579 .82788 moveto .43132 .80344 lineto stroke grestore gsave .377 setgray .36264 .77473 moveto .37855 .79064 lineto .36264 .79258 lineto fill grestore gsave .459 setgray .37855 .79064 moveto .36264 .79258 lineto .36264 .83435 lineto .41579 .82788 lineto fill grestore gsave 0.001 setlinewidth .37855 .79064 moveto .36264 .79258 lineto stroke grestore gsave .541 setgray .41579 .82788 moveto .36264 .83435 lineto .36264 .84341 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .41579 .82788 moveto .36264 .83435 lineto stroke grestore gsave .459 setgray .43132 .77473 moveto .45771 .80111 lineto .47377 .77473 lineto fill grestore gsave .541 setgray .45771 .80111 moveto .47377 .77473 lineto .5 .77473 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .45771 .80111 moveto .47377 .77473 lineto stroke grestore gsave .459 setgray .43132 .77473 moveto .45771 .80111 lineto .43132 .80344 lineto fill grestore gsave .541 setgray .45771 .80111 moveto .43132 .80344 lineto .43132 .84341 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .45771 .80111 moveto .43132 .80344 lineto stroke grestore gsave .541 setgray .5 .77473 moveto .56868 .84341 lineto .56868 .77473 lineto fill grestore gsave .541 setgray .5 .77473 moveto .5 .84341 lineto .56868 .84341 lineto fill grestore gsave .541 setgray .60591 .77473 moveto .63736 .80715 lineto .63736 .84341 lineto .56868 .77473 lineto fill grestore gsave .623 setgray .60591 .77473 moveto .63736 .80715 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .60591 .77473 moveto .63736 .80715 lineto stroke grestore gsave .541 setgray .56868 .84341 moveto .56868 .77473 lineto .63736 .84341 lineto fill grestore gsave .623 setgray .70604 .79999 moveto .67441 .77473 lineto .63736 .77473 lineto .70604 .84341 lineto fill grestore gsave .705 setgray .70604 .79999 moveto .67441 .77473 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .70604 .79999 moveto .67441 .77473 lineto stroke grestore gsave .541 setgray .63736 .84341 moveto .63736 .80715 lineto .7047 .84341 lineto fill grestore gsave .623 setgray .63736 .80715 moveto .7047 .84341 lineto .70604 .84341 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .63736 .80715 moveto .7047 .84341 lineto stroke grestore gsave .623 setgray .77473 .84341 moveto .77473 .83282 lineto .75369 .82237 lineto fill grestore gsave .705 setgray .77473 .83282 moveto .75369 .82237 lineto .70604 .77473 lineto .74133 .77473 lineto .77473 .79132 lineto fill grestore gsave 0.001 setlinewidth .77473 .83282 moveto .75369 .82237 lineto stroke grestore gsave .786 setgray .77473 .79132 moveto .74133 .77473 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .77473 .79132 moveto .74133 .77473 lineto stroke grestore gsave .623 setgray .70604 .79999 moveto .75369 .82237 lineto .77473 .84341 lineto .70604 .84341 lineto fill grestore gsave .705 setgray .70604 .79999 moveto .75369 .82237 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .70604 .79999 moveto .75369 .82237 lineto stroke grestore gsave .623 setgray .84341 .84341 moveto .83319 .83319 lineto .84341 .82838 lineto fill grestore gsave .705 setgray .83319 .83319 moveto .84341 .82838 lineto .84341 .77473 lineto .82682 .77473 lineto .79142 .79142 lineto fill grestore gsave 0.001 setlinewidth .83319 .83319 moveto .84341 .82838 lineto stroke grestore gsave .786 setgray .79142 .79142 moveto .82682 .77473 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .79142 .79142 moveto .82682 .77473 lineto stroke grestore gsave .623 setgray .77473 .83282 moveto .83319 .83319 lineto .84341 .84341 lineto .77473 .84341 lineto fill grestore gsave .705 setgray .77473 .83282 moveto .83319 .83319 lineto .79142 .79142 lineto .77473 .79132 lineto fill grestore gsave 0.001 setlinewidth .77473 .83282 moveto .83319 .83319 lineto stroke grestore gsave .786 setgray .77473 .79132 moveto .79142 .79142 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .77473 .79132 moveto .79142 .79142 lineto stroke grestore gsave .623 setgray .91209 .84341 moveto .89419 .8255 lineto .91209 .81303 lineto fill grestore gsave .705 setgray .89419 .8255 moveto .91209 .81303 lineto .91209 .77473 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .89419 .8255 moveto .91209 .81303 lineto stroke grestore gsave .623 setgray .89419 .8255 moveto .84341 .82838 lineto .84341 .84341 lineto .91209 .84341 lineto fill grestore gsave .705 setgray .89419 .8255 moveto .84341 .82838 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .89419 .8255 moveto .84341 .82838 lineto stroke grestore gsave .623 setgray .98077 .84341 moveto .94926 .8119 lineto .98077 .79968 lineto fill grestore gsave .705 setgray .94926 .8119 moveto .98077 .79968 lineto .98077 .77473 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .94926 .8119 moveto .98077 .79968 lineto stroke grestore gsave .623 setgray .94926 .8119 moveto .91209 .81303 lineto .91209 .84341 lineto .98077 .84341 lineto fill grestore gsave .705 setgray .94926 .8119 moveto .91209 .81303 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .94926 .8119 moveto .91209 .81303 lineto stroke grestore gsave .459 setgray 0.08791 .84341 moveto 0.01923 .84341 lineto 0.08791 .91209 lineto fill grestore gsave .459 setgray 0.01923 .84341 moveto 0.08791 .91209 lineto 0.01923 .91209 lineto fill grestore gsave .377 setgray .15659 .84341 moveto .15659 .86483 lineto .10037 .84341 lineto fill grestore gsave .459 setgray .15659 .86483 moveto .10037 .84341 lineto 0.08791 .84341 lineto .15659 .91209 lineto fill grestore gsave 0.001 setlinewidth .15659 .86483 moveto .10037 .84341 lineto stroke grestore gsave .459 setgray 0.08791 .84341 moveto 0.08791 .91209 lineto .15659 .91209 lineto fill grestore gsave .377 setgray .22527 .86866 moveto .16944 .85626 lineto .15659 .84341 lineto .22527 .84341 lineto fill grestore gsave .459 setgray .22527 .86866 moveto .16944 .85626 lineto .22527 .91209 lineto fill grestore gsave 0.001 setlinewidth .22527 .86866 moveto .16944 .85626 lineto stroke grestore gsave .377 setgray .15659 .84341 moveto .16944 .85626 lineto .15659 .86483 lineto fill grestore gsave .459 setgray .16944 .85626 moveto .15659 .86483 lineto .15659 .91209 lineto .22527 .91209 lineto fill grestore gsave 0.001 setlinewidth .16944 .85626 moveto .15659 .86483 lineto stroke grestore gsave .377 setgray .22527 .84341 moveto .23437 .8525 lineto .24128 .84341 lineto fill grestore gsave .459 setgray .23437 .8525 moveto .24128 .84341 lineto .29396 .84341 lineto .29396 .89483 lineto .2865 .90463 lineto fill grestore gsave 0.001 setlinewidth .23437 .8525 moveto .24128 .84341 lineto stroke grestore gsave .541 setgray .2865 .90463 moveto .29396 .89483 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .2865 .90463 moveto .29396 .89483 lineto stroke grestore gsave .377 setgray .22527 .84341 moveto .23437 .8525 lineto .22527 .86866 lineto fill grestore gsave .459 setgray .23437 .8525 moveto .22527 .86866 lineto .22527 .91209 lineto .28231 .91209 lineto .2865 .90463 lineto fill grestore gsave 0.001 setlinewidth .23437 .8525 moveto .22527 .86866 lineto stroke grestore gsave .541 setgray .2865 .90463 moveto .28231 .91209 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .2865 .90463 moveto .28231 .91209 lineto stroke grestore gsave .459 setgray .29396 .84341 moveto .32701 .87646 lineto .33948 .84341 lineto fill grestore gsave .541 setgray .32701 .87646 moveto .33948 .84341 lineto .36264 .84341 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .32701 .87646 moveto .33948 .84341 lineto stroke grestore gsave .459 setgray .29396 .84341 moveto .32701 .87646 lineto .29396 .89483 lineto fill grestore gsave .541 setgray .32701 .87646 moveto .29396 .89483 lineto .29396 .91209 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .32701 .87646 moveto .29396 .89483 lineto stroke grestore gsave .541 setgray .36264 .84341 moveto .43132 .84341 lineto .43132 .91209 lineto fill grestore gsave .541 setgray .36264 .84341 moveto .36264 .91209 lineto .43132 .91209 lineto fill grestore gsave .541 setgray .43132 .84341 moveto .5 .84341 lineto .5 .91209 lineto fill grestore gsave .541 setgray .43132 .84341 moveto .5 .91209 lineto .43132 .91209 lineto fill grestore gsave .541 setgray .5 .84341 moveto .56868 .91209 lineto .56868 .84341 lineto fill grestore gsave .541 setgray .5 .84341 moveto .5 .91209 lineto .56868 .91209 lineto fill grestore gsave .541 setgray .56868 .84341 moveto .63736 .91209 lineto .63736 .84341 lineto fill grestore gsave .541 setgray .56868 .91209 moveto .56868 .84341 lineto .63736 .91209 lineto fill grestore gsave .541 setgray .7047 .84341 moveto .70604 .84503 lineto .70604 .91209 lineto .63736 .84341 lineto fill grestore gsave .623 setgray .7047 .84341 moveto .70604 .84503 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .7047 .84341 moveto .70604 .84503 lineto stroke grestore gsave .541 setgray .63736 .91209 moveto .63736 .84341 lineto .70604 .91209 lineto fill grestore gsave .623 setgray .70604 .84341 moveto .77473 .91209 lineto .77473 .84341 lineto fill grestore gsave .541 setgray .70604 .91209 moveto .73551 .91209 lineto .70604 .84503 lineto fill grestore gsave .623 setgray .73551 .91209 moveto .70604 .84503 lineto .70604 .84341 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .73551 .91209 moveto .70604 .84503 lineto stroke grestore gsave .623 setgray .84341 .91209 moveto .77473 .84341 lineto .84341 .84341 lineto fill grestore gsave .623 setgray .77473 .91209 moveto .84341 .91209 lineto .77473 .84341 lineto fill grestore gsave .623 setgray .91209 .91209 moveto .91209 .84341 lineto .84341 .84341 lineto fill grestore gsave .623 setgray .84341 .91209 moveto .91209 .91209 lineto .84341 .84341 lineto fill grestore gsave .623 setgray .98077 .91209 moveto .98077 .84341 lineto .91209 .84341 lineto fill grestore gsave .623 setgray .98077 .91209 moveto .91209 .91209 lineto .91209 .84341 lineto fill grestore gsave .459 setgray 0.08791 .91209 moveto 0.01923 .91209 lineto 0.08791 .98077 lineto fill grestore gsave .459 setgray 0.08791 .98077 moveto 0.01923 .98077 lineto 0.01923 .91209 lineto fill grestore gsave .459 setgray 0.08791 .91209 moveto .15659 .91209 lineto .15659 .98077 lineto fill grestore gsave .459 setgray 0.08791 .91209 moveto 0.08791 .98077 lineto .15659 .98077 lineto fill grestore gsave .459 setgray .15659 .91209 moveto .22527 .91209 lineto .22527 .98077 lineto fill grestore gsave .459 setgray .15659 .91209 moveto .15659 .98077 lineto .22527 .98077 lineto fill grestore gsave .459 setgray .22527 .91209 moveto .27833 .96514 lineto .28231 .91209 lineto fill grestore gsave .541 setgray .27833 .96514 moveto .28231 .91209 lineto .29396 .91209 lineto .29396 .98077 lineto fill grestore gsave 0.001 setlinewidth .27833 .96514 moveto .28231 .91209 lineto stroke grestore gsave .459 setgray .27833 .96514 moveto .27757 .98077 lineto .22527 .98077 lineto .22527 .91209 lineto fill grestore gsave .541 setgray .27833 .96514 moveto .27757 .98077 lineto .29396 .98077 lineto fill grestore gsave 0.001 setlinewidth .27833 .96514 moveto .27757 .98077 lineto stroke grestore gsave .541 setgray .29396 .91209 moveto .36264 .91209 lineto .36264 .98077 lineto fill grestore gsave .541 setgray .29396 .91209 moveto .29396 .98077 lineto .36264 .98077 lineto fill grestore gsave .541 setgray .36264 .91209 moveto .43132 .91209 lineto .43132 .98077 lineto fill grestore gsave .541 setgray .36264 .91209 moveto .36264 .98077 lineto .43132 .98077 lineto fill grestore gsave .541 setgray .43132 .91209 moveto .5 .91209 lineto .5 .98077 lineto fill grestore gsave .541 setgray .43132 .98077 moveto .43132 .91209 lineto .5 .98077 lineto fill grestore gsave .541 setgray .5 .91209 moveto .56868 .91209 lineto .56868 .98077 lineto fill grestore gsave .541 setgray .5 .91209 moveto .56868 .98077 lineto .5 .98077 lineto fill grestore gsave .541 setgray .56868 .91209 moveto .63736 .98077 lineto .63736 .91209 lineto fill grestore gsave .541 setgray .56868 .98077 moveto .56868 .91209 lineto .63736 .98077 lineto fill grestore gsave .541 setgray .63736 .91209 moveto .70604 .98077 lineto .70604 .91209 lineto fill grestore gsave .541 setgray .63736 .98077 moveto .63736 .91209 lineto .70604 .98077 lineto fill grestore gsave .541 setgray .70604 .91209 moveto .73551 .91209 lineto .73741 .94345 lineto fill grestore gsave .623 setgray .73551 .91209 moveto .73741 .94345 lineto .77473 .98077 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .73551 .91209 moveto .73741 .94345 lineto stroke grestore gsave .541 setgray .73913 .98077 moveto .73741 .94345 lineto .70604 .91209 lineto .70604 .98077 lineto fill grestore gsave .623 setgray .73913 .98077 moveto .73741 .94345 lineto .77473 .98077 lineto fill grestore gsave 0.001 setlinewidth .73913 .98077 moveto .73741 .94345 lineto stroke grestore gsave .623 setgray .77473 .91209 moveto .84341 .98077 lineto .84341 .91209 lineto fill grestore gsave .623 setgray .77473 .98077 moveto .77473 .91209 lineto .84341 .98077 lineto fill grestore gsave .623 setgray .84341 .91209 moveto .91209 .98077 lineto .91209 .91209 lineto fill grestore gsave .623 setgray .84341 .98077 moveto .84341 .91209 lineto .91209 .98077 lineto fill grestore gsave .623 setgray .98077 .98077 moveto .91209 .91209 lineto .98077 .91209 lineto fill grestore gsave .623 setgray .98077 .98077 moveto .91209 .98077 lineto .91209 .91209 lineto fill grestore grestore % End of Graphics MathPictureEnd end showpage %%EndDocument endTexFig eop %%Page: 33 33 33 32 bop 868 119 a Fo(Figure)16 b(8:)225 276 y 11840716 10656639 1710325 2302361 40455782 37298257 startTexFig 225 276 a %%BeginDocument: R5x.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 0 0 translate 16 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2400 2080 15200 2080 2400 2080 2400 1904 4533 2080 4533 1904 6666 2080 6666 1904 8800 2080 8800 1904 10933 2080 10933 1904 13066 2080 13066 1904 15200 2080 15200 1904 8 dopairs 2080 2400 2080 15200 2080 2400 1904 2400 2080 4533 1904 4533 2080 6666 1904 6666 2080 8800 1904 8800 2080 10933 1904 10933 2080 13066 1904 13066 2080 15200 1904 15200 8 dopairs % Data Set 1: 20 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 13 def /symbsiz 13 def /symbw 26 def /symbh 90 def /ori 199.44 def /showmark {plotsymb} def /symbary [0 0 13 34 -9 0 0 56 -8 0 0 -56 -9 0 13 -34] def % Arrow /fillcolor {0.0 0.0 0.0} def 2485 2430 1 {showmark} repeat /patternw 27 def /symbsiz 27 def /symbw 54 def /symbh 190 def /ori 209.52 def /showmark {plotsymb} def /symbary [0 0 27 72 -18 0 0 118 -18 0 0 -118 -18 0 27 -72] def % Arrow 2566 4627 1 {showmark} repeat /patternw 53 def /symbsiz 53 def /symbw 106 def /symbh 364 def /ori 218.32 def /showmark {plotsymb} def /symbary [0 0 53 141 -36 0 0 223 -34 0 0 -223 -36 0 53 -141] def % Arrow 2686 6893 1 {showmark} repeat /patternw 72 def /symbsiz 72 def /symbw 144 def /symbh 498 def /ori 216.99 def /showmark {plotsymb} def /symbary [0 0 72 192 -48 0 0 306 -48 0 0 -306 -48 0 72 -192] def % Arrow 2797 9099 1 {showmark} repeat /patternw 62 def /symbsiz 62 def /symbw 124 def /symbh 424 def /ori 209.39 def /showmark {plotsymb} def /symbary [0 0 62 165 -42 0 0 259 -40 0 0 -259 -42 0 62 -165] def % Arrow 2771 11142 1 {showmark} repeat /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 244 def /ori 209.19 def /showmark {plotsymb} def /symbary [0 0 36 96 -24 0 0 148 -24 0 0 -148 -24 0 36 -96] def % Arrow 2613 13186 1 {showmark} repeat /patternw 17 def /symbsiz 17 def /symbw 34 def /symbh 116 def /ori 215.88 def /showmark {plotsymb} def /symbary [0 0 17 45 -12 0 0 71 -10 0 0 -71 -12 0 17 -45] def % Arrow 2494 15268 1 {showmark} repeat /patternw 26 def /symbsiz 26 def /symbw 52 def /symbh 180 def /ori 202.16 def /showmark {plotsymb} def /symbary [0 0 26 69 -18 0 0 111 -16 0 0 -111 -18 0 26 -69] def % Arrow 4700 2468 1 {showmark} repeat /patternw 55 def /symbsiz 55 def /symbw 110 def /symbh 380 def /ori 211.22 def /showmark {plotsymb} def /symbary [0 0 55 146 -37 0 0 234 -36 0 0 -234 -37 0 55 -146] def % Arrow 4858 4730 1 {showmark} repeat /patternw 106 def /symbsiz 106 def /symbw 212 def /symbh 730 def /ori 215.69 def /showmark {plotsymb} def /symbary [0 0 106 282 -71 0 0 448 -70 0 0 -448 -71 0 106 -282] def % Arrow 5126 7093 1 {showmark} repeat /patternw 148 def /symbsiz 148 def /symbw 296 def /symbh 1020 def /ori 209.03 def /showmark {plotsymb} def /symbary [0 0 148 394 -99 0 0 626 -98 0 0 -626 -99 0 148 -394] def % Arrow 5425 9295 1 {showmark} repeat /patternw 130 def /symbsiz 130 def /symbw 260 def /symbh 898 def /ori 199.73 def /showmark {plotsymb} def /symbary [0 0 130 346 -87 0 0 552 -86 0 0 -552 -87 0 130 -346] def % Arrow 5378 11236 1 {showmark} repeat /patternw 75 def /symbsiz 75 def /symbw 150 def /symbh 518 def /ori 199.77 def /showmark {plotsymb} def /symbary [0 0 75 200 -50 0 0 318 -50 0 0 -318 -50 0 75 -200] def % Arrow 5020 13242 1 {showmark} repeat /patternw 36 def /symbsiz 36 def /symbw 72 def /symbh 250 def /ori 205.34 def /showmark {plotsymb} def /symbary [0 0 36 95 -24 0 0 155 -24 0 0 -155 -24 0 36 -95] def % Arrow 4759 15307 1 {showmark} repeat /patternw 46 def /symbsiz 46 def /symbw 92 def /symbh 318 def /ori 204.47 def /showmark {plotsymb} def /symbary [0 0 46 122 -31 0 0 196 -30 0 0 -196 -31 0 46 -122] def % Arrow 6957 2532 1 {showmark} repeat /patternw 98 def /symbsiz 98 def /symbw 196 def /symbh 678 def /ori 208.19 def /showmark {plotsymb} def /symbary [0 0 98 261 -66 0 0 417 -64 0 0 -417 -66 0 98 -261] def % Arrow 7264 4853 1 {showmark} repeat /patternw 192 def /symbsiz 192 def /symbw 384 def /symbh 1324 def /ori 206.57 def /showmark {plotsymb} def /symbary [0 0 192 512 -128 0 0 812 -128 0 0 -812 -128 0 192 -512] def % Arrow 7853 7260 1 {showmark} repeat /patternw 268 def /symbsiz 268 def /symbw 536 def /symbh 1850 def /ori 198.57 def /showmark {plotsymb} def /symbary [0 0 268 714 -179 0 0 1136 -178 0 0 -1136 -179 0 268 -714] def % Arrow 8420 9389 1 {showmark} repeat /patternw 236 def /symbsiz 236 def /symbw 472 def /symbh 1630 def /ori 192.54 def /showmark {plotsymb} def /symbary [0 0 236 629 -158 0 0 1001 -156 0 0 -1001 -158 0 236 -629] def % Arrow 8258 11287 1 {showmark} repeat /patternw 138 def /symbsiz 138 def /symbw 276 def /symbh 950 def /ori 193.19 def /showmark {plotsymb} def /symbary [0 0 138 368 -92 0 0 582 -92 0 0 -582 -92 0 138 -368] def % Arrow 7593 13284 1 {showmark} repeat /patternw 68 def /symbsiz 68 def /symbw 136 def /symbh 468 def /ori 196.42 def /showmark {plotsymb} def /symbary [0 0 68 181 -46 0 0 287 -44 0 0 -287 -46 0 68 -181] def % Arrow 7115 15332 1 {showmark} repeat /patternw 58 def /symbsiz 58 def /symbw 116 def /symbh 404 def /ori 193.45 def /showmark {plotsymb} def /symbary [0 0 58 154 -39 0 0 250 -38 0 0 -250 -39 0 58 -154] def % Arrow 9193 2494 1 {showmark} repeat /patternw 126 def /symbsiz 126 def /symbw 252 def /symbh 870 def /ori 194.21 def /showmark {plotsymb} def /symbary [0 0 126 335 -84 0 0 535 -84 0 0 -535 -84 0 126 -335] def % Arrow 9645 4747 1 {showmark} repeat /patternw 249 def /symbsiz 249 def /symbw 498 def /symbh 1722 def /ori 189.40 def /showmark {plotsymb} def /symbary [0 0 249 664 -166 0 0 1058 -166 0 0 -1058 -166 0 249 -664] def % Arrow 10498 6948 1 {showmark} repeat /patternw 342 def /symbsiz 342 def /symbw 684 def /symbh 2360 def /ori 187.06 def /showmark {plotsymb} def /symbary [0 0 342 911 -228 0 0 1449 -228 0 0 -1449 -228 0 342 -911] def % Arrow 11142 9090 1 {showmark} repeat /patternw 294 def /symbsiz 294 def /symbw 588 def /symbh 2034 def /ori 189.68 def /showmark {plotsymb} def /symbary [0 0 294 784 -196 0 0 1250 -196 0 0 -1250 -196 0 294 -784] def % Arrow 10805 11275 1 {showmark} repeat /patternw 173 def /symbsiz 173 def /symbw 346 def /symbh 1190 def /ori 189.68 def /showmark {plotsymb} def /symbary [0 0 173 461 -116 0 0 729 -114 0 0 -729 -116 0 173 -461] def % Arrow 9973 13267 1 {showmark} repeat /patternw 86 def /symbsiz 86 def /symbw 172 def /symbh 592 def /ori 189.13 def /showmark {plotsymb} def /symbary [0 0 86 229 -58 0 0 363 -56 0 0 -363 -58 0 86 -229] def % Arrow 9385 15294 1 {showmark} repeat /patternw 48 def /symbsiz 48 def /symbw 96 def /symbh 330 def /ori 175.48 def /showmark {plotsymb} def /symbary [0 0 48 127 -32 0 0 203 -32 0 0 -203 -32 0 48 -127] def % Arrow 11262 2374 1 {showmark} repeat /patternw 102 def /symbsiz 102 def /symbw 204 def /symbh 704 def /ori 179.02 def /showmark {plotsymb} def /symbary [0 0 102 271 -68 0 0 433 -68 0 0 -433 -68 0 102 -271] def % Arrow 11637 4521 1 {showmark} repeat /patternw 203 def /symbsiz 203 def /symbw 406 def /symbh 1402 def /ori 177.02 def /showmark {plotsymb} def /symbary [0 0 203 541 -136 0 0 861 -134 0 0 -861 -136 0 203 -541] def % Arrow 12333 6594 1 {showmark} repeat /patternw 277 def /symbsiz 277 def /symbw 554 def /symbh 1916 def /ori 179.88 def /showmark {plotsymb} def /symbary [0 0 277 738 -185 0 0 1178 -184 0 0 -1178 -185 0 277 -738] def % Arrow 12849 8796 1 {showmark} repeat /patternw 236 def /symbsiz 236 def /symbw 472 def /symbh 1628 def /ori 185.11 def /showmark {plotsymb} def /symbary [0 0 236 629 -158 0 0 999 -156 0 0 -999 -158 0 236 -629] def % Arrow 12555 11078 1 {showmark} repeat /patternw 138 def /symbsiz 138 def /symbw 276 def /symbh 954 def /ori 183.07 def /showmark {plotsymb} def /symbary [0 0 138 368 -92 0 0 586 -92 0 0 -586 -92 0 138 -368] def % Arrow 11885 13118 1 {showmark} repeat /patternw 70 def /symbsiz 70 def /symbw 140 def /symbh 482 def /ori 180.48 def /showmark {plotsymb} def /symbary [0 0 70 186 -47 0 0 296 -46 0 0 -296 -47 0 70 -186] def % Arrow 11415 15204 1 {showmark} repeat /patternw 27 def /symbsiz 27 def /symbw 54 def /symbh 184 def /ori 166.49 def /showmark {plotsymb} def /symbary [0 0 27 71 -18 0 0 113 -18 0 0 -113 -18 0 27 -71] def % Arrow 13246 2357 1 {showmark} repeat /patternw 57 def /symbsiz 57 def /symbw 114 def /symbh 392 def /ori 170.63 def /showmark {plotsymb} def /symbary [0 0 57 152 -38 0 0 240 -38 0 0 -240 -38 0 57 -152] def % Arrow 13455 4469 1 {showmark} repeat /patternw 114 def /symbsiz 114 def /symbw 228 def /symbh 786 def /ori 170.63 def /showmark {plotsymb} def /symbary [0 0 114 303 -76 0 0 483 -76 0 0 -483 -76 0 114 -303] def % Arrow 13843 6539 1 {showmark} repeat /patternw 156 def /symbsiz 156 def /symbw 312 def /symbh 1080 def /ori 174.58 def /showmark {plotsymb} def /symbary [0 0 156 415 -104 0 0 665 -104 0 0 -665 -104 0 156 -415] def % Arrow 14142 8698 1 {showmark} repeat /patternw 132 def /symbsiz 132 def /symbw 264 def /symbh 910 def /ori 177.04 def /showmark {plotsymb} def /symbary [0 0 132 351 -88 0 0 559 -88 0 0 -559 -88 0 132 -351] def % Arrow 13975 10886 1 {showmark} repeat /patternw 77 def /symbsiz 77 def /symbw 154 def /symbh 532 def /ori 174.92 def /showmark {plotsymb} def /symbary [0 0 77 205 -52 0 0 327 -50 0 0 -327 -52 0 77 -205] def % Arrow 13596 13020 1 {showmark} repeat /patternw 39 def /symbsiz 39 def /symbw 78 def /symbh 268 def /ori 175.52 def /showmark {plotsymb} def /symbary [0 0 39 103 -26 0 0 165 -26 0 0 -165 -26 0 39 -103] def % Arrow 13335 15179 1 {showmark} repeat /patternw 13 def /symbsiz 13 def /symbw 26 def /symbh 84 def /ori 171.30 def /showmark {plotsymb} def /symbary [0 0 13 34 -9 0 0 50 -8 0 0 -50 -9 0 13 -34] def % Arrow 15285 2387 1 {showmark} repeat /patternw 28 def /symbsiz 28 def /symbw 56 def /symbh 190 def /ori 170.93 def /showmark {plotsymb} def /symbary [0 0 28 74 -19 0 0 116 -18 0 0 -116 -19 0 28 -74] def % Arrow 15388 4503 1 {showmark} repeat /patternw 56 def /symbsiz 56 def /symbw 112 def /symbh 386 def /ori 169.13 def /showmark {plotsymb} def /symbary [0 0 56 149 -38 0 0 237 -36 0 0 -237 -38 0 56 -149] def % Arrow 15580 6594 1 {showmark} repeat /patternw 77 def /symbsiz 77 def /symbw 154 def /symbh 530 def /ori 171.66 def /showmark {plotsymb} def /symbary [0 0 77 205 -52 0 0 325 -50 0 0 -325 -52 0 77 -205] def % Arrow 15725 8723 1 {showmark} repeat /patternw 64 def /symbsiz 64 def /symbw 128 def /symbh 440 def /ori 171.63 def /showmark {plotsymb} def /symbary [0 0 64 170 -43 0 0 270 -42 0 0 -270 -43 0 64 -170] def % Arrow 15635 10869 1 {showmark} repeat /patternw 37 def /symbsiz 37 def /symbw 74 def /symbh 256 def /ori 171.20 def /showmark {plotsymb} def /symbary [0 0 37 98 -25 0 0 158 -24 0 0 -158 -25 0 37 -98] def % Arrow 15452 13028 1 {showmark} repeat /patternw 19 def /symbsiz 19 def /symbw 38 def /symbh 128 def /ori 175.98 def /showmark {plotsymb} def /symbary [0 0 19 50 -13 0 0 78 -12 0 0 -78 -13 0 19 -50] def % Arrow 15328 15191 1 {showmark} repeat /fontsiz 768 def /spacesiz 51 def /fontsiz 768 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 63 def /txtpos [0.50 0.00] def 683 8912 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8160 800 (X \(cm\)) sprnt /txtpos [0.00 0.00] def /fontsiz 512 def /spacesiz 34 def /fontsiz 512 def /spacesiz 34 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 42 def /txtpos [0.50 1.00] def 2400 1744 (-10) sprnt 4533 1744 (-5) sprnt 6666 1744 (0) sprnt 8800 1744 (5) sprnt 10933 1744 (10) sprnt 13066 1744 (15) sprnt 15200 1744 (20) sprnt /txtpos [1.00 0.35] def 1744 2400 (20) sprnt 1744 4533 (25) sprnt 1744 6666 (30) sprnt 1744 8800 (35) sprnt 1744 10933 (40) sprnt 1744 13066 (45) sprnt 1779 15200 (50) sprnt /fontsiz 768 def /spacesiz 51 def /fontsiz 768 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 63 def /txtpos [0.50 1.00] def 617 17091 (a\)) sprnt 0 0 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 991 148 a 11840716 12669565 4736286 9472573 35522150 42626580 startTexFig 991 148 a %%BeginDocument: R5xc.ps /Mathdict 100 dict def Mathdict begin /Mlmarg 1.0 72 mul def /Mrmarg 1.0 72 mul def /Mbmarg 1.0 72 mul def /Mtmarg 1.0 72 mul def /Mwidth 8.5 72 mul def /Mheight 11 72 mul def /Mtransform { } bind def /Mnodistort true def /Mfixwid false def /Mfixdash false def /Mrot 0 def /Mpstart { MathPictureStart } bind def /Mpend { MathPictureEnd } bind def /Mscale { 0 1 0 1 5 -1 roll MathScale } bind def /ISOLatin1Encoding dup where { pop pop } { [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def } ifelse /MFontDict 50 dict def /MStrCat { exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval } def /MCreateEncoding { 1 index 255 string cvs (-) MStrCat 1 index MStrCat cvn exch (Encoding) MStrCat cvn dup where { exch get } { pop StandardEncoding } ifelse 3 1 roll dup MFontDict exch known not { 1 index findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put } if exch pop exch pop } def /ISOLatin1 { (ISOLatin1) MCreateEncoding } def /ISO8859 { (ISOLatin1) MCreateEncoding } def /Mcopyfont { dup maxlength dict exch { 1 index /FID eq { pop pop } { 2 index 3 1 roll put } ifelse } forall } def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier-Bold findfont Mcopyfont definefont pop /Italic /Courier-Oblique findfont Mcopyfont definefont pop /MathPictureStart { gsave Mtransform Mlmarg Mbmarg translate /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def } bind def /MathPictureEnd { grestore } bind def /MathSubStart { Momatrix Mgmatrix Mtmatrix Mlmarg Mrmarg Mbmarg Mtmarg Mwidth Mheight 11 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 13 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def } bind def /MathSubEnd { /Mheight exch def /Mwidth exch def /Mtmarg exch def /Mbmarg exch def /Mrmarg exch def /Mlmarg exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def } bind def /Mdot { moveto 0 0 rlineto stroke } bind def /Mtetra { moveto lineto lineto lineto fill } bind def /Metetra { moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke } bind def /Mistroke { flattenpath 0 0 0 { 4 2 roll pop pop } { 4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll } { stop } { stop } pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash } bind def /Mfstroke { stroke currentdash pop 0 setdash } bind def /Mrotsboxa { gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def } bind def /Msboxa { newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot [ 7 -2 roll 2 copy [ 3 1 roll 10 -1 roll 9 -1 roll ] 6 1 roll 5 -2 roll ] } bind def /Msboxa1 { sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul } bind def /Mvboxa { Mfixwid { Mvboxa1 } { dup Mwidthcal 0 exch { add } forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll } ifelse } bind def /Mvboxa1 { gsave newpath [ true 3 -1 roll { Mbbox 5 -1 roll { 0 5 1 roll } { 7 -1 roll exch sub (m) stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll } ifelse false } forall { stop } if counttomark 1 add 4 roll ] grestore } bind def /Mbbox { 1 dict begin 0 0 moveto /temp (T) def { gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto} forall pathbbox newpath end } bind def /Mmin { 2 copy gt { exch } if pop } bind def /Mmax { 2 copy lt { exch } if pop } bind def /Mrotshowa { dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def } bind def /Mshowa { 4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid { Mshowax } { Mshoway } ifelse pop pop pop pop Mgmatrix setmatrix } bind def /Mshowax { 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash { Mfixdashp } if show } for } bind def /Mfixdashp { dup length 1 gt 1 index true exch { 45 eq and } forall and { gsave (--) stringwidth pop (-) stringwidth pop sub 2 div 0 rmoveto dup length 1 sub { (-) show } repeat grestore } if } bind def /Mshoway { 3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get [ 6 index aload length 2 add -1 roll { pop Strform stringwidth pop neg exch add 0 rmoveto } exch kshow cleartomark } for pop } bind def /Mwidthcal { [ exch { Mwidthcal1 } forall ] [ exch dup Maxlen -1 add 0 1 3 -1 roll { [ exch 2 index { 1 index Mget exch } forall pop Maxget exch } for pop ] Mreva } bind def /Mreva { [ exch aload length -1 1 {1 roll} for ] } bind def /Mget { 1 index length -1 add 1 index ge { get } { pop pop 0 } ifelse } bind def /Maxlen { [ exch { length } forall Maxget } bind def /Maxget { counttomark -1 add 1 1 3 -1 roll { pop Mmax } for exch pop } bind def /Mwidthcal1 { [ exch { Strform stringwidth pop } forall ] } bind def /Strform { /tem (x) def tem 0 3 -1 roll put tem } bind def /Mshowa1 { 2 copy add 4 1 roll sub mul sub -2 div } bind def /MathScale { Mwidth Mlmarg Mrmarg add sub Mheight Mbmarg Mtmarg add sub 0 0 moveto 1 index 0 lineto 2 copy lineto 0 1 index lineto clip newpath Mlp translate dup /Mathabs exch def scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def } bind def /Mlp { 3 copy Mlpfirst { Mnodistort { Mmin dup } if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and { exit } if 3 -1 roll pop pop } loop exch 3 1 roll 7 -3 roll pop pop pop } bind def /Mlpfirst { 3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div } bind def /Mlprun { 2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll { 3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll } forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll } bind def /Mlprun1 { aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add } bind def /Mlprun2 { 2 copy add 2 div 3 1 roll exch sub } bind def /Mlpminmax { cvx 2 index 6 index 2 index exec { 7 -3 roll 4 -1 roll } if 1 index 5 index 3 -1 roll exec { 4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop [ 8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll ] 4 1 roll pop } { pop pop pop } ifelse } bind def /Mlp1 { 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not { 1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll } if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch } bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner { outflag 1 eq { /outflag 0 def /intop 0 def /inrht 0 def } if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt { /intop exch def } { pop } ifelse dup inrht gt { /inrht exch def } { pop } ifelse pop /inflag 1 def } bind def /Mouter { /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq { dup 0 lt { dup intop mul neg /yadtop exch def } if dup 0 gt { dup intop mul /yadbot exch def } if pop dup 0 lt { dup inrht mul neg /xadrht exch def } if dup 0 gt { dup inrht mul /xadlft exch def } if pop /outflag 1 def } { pop pop} ifelse /inflag 0 def /inrht 0 def /intop 0 def } bind def /Mboxout { outflag 1 eq { 4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def } if } bind def /leadjust { (m) stringwidth pop .5 mul } bind def /Mrotcheck { dup 90 eq { yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def } if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop } bind def /Checkaux { 4 index exch 4 index mul 3 1 roll mul add 4 1 roll } bind def /Mboxrot { Mrot 90 eq { brotaux 4 2 roll } if Mrot 180 eq { 4 2 roll brotaux 4 2 roll brotaux } if Mrot 270 eq { 4 2 roll brotaux } if } bind def /brotaux { neg exch neg } bind def /Mabswid { Mathabs div setlinewidth } bind def /Mabsdash { exch Mathabs [ 3 1 roll exch { exch dup 3 -1 roll exch div exch } forall pop ] exch setdash } bind def /MBeginOrig { Momatrix concat} bind def /MEndOrig { Mgmatrix setmatrix} bind def /colorimage where { pop } { /colorimage { 3 1 roll pop pop 5 -1 roll mul 4 1 roll { currentfile 1 index readhexstring pop } image } bind def } ifelse /sampledsound where { pop} { /sampledsound { exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def { Mtempproc pop} repeat } bind def } ifelse /setcmykcolor where { pop} { /setcmykcolor { 4 1 roll [ 4 1 roll ] { 1 index sub 1 sub neg dup 0 lt { pop 0 } if dup 1 gt { pop 1 } if exch } forall pop setrgbcolor } bind def } ifelse MathPictureStart /Helvetica findfont 25 scalefont setfont % Scaling calculations 0.00320513 0.0160256 0.00320513 0.0160256 [ [(-10)] 0.03526 0 0 2 0 Minner Mrotsboxa [(0)] .32372 0 0 2 0 Minner Mrotsboxa [(10)] .64423 0 0 2 0 Minner Mrotsboxa [(20)] .96474 0 0 2 0 Minner Mrotsboxa [(X \(cm\))] .5 0 0 2 0 0 -1 Mouter Mrotsboxa [(20)] -0.0125 0.03526 1 0 0 Minner Mrotsboxa [(30)] -0.0125 .32372 1 0 0 Minner Mrotsboxa [(40)] -0.0125 .64423 1 0 0 Minner Mrotsboxa [(50)] -0.0125 .96474 1 0 0 Minner Mrotsboxa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotsboxa [(d\) )] .5 1 0 -4 Msboxa [ -0.001 -0.001 0 0 ] [ 1.001 1.001 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 setgray gsave gsave gsave 0.002 setlinewidth 0.03526 0 moveto 0.03526 0.00625 lineto stroke grestore [(-10)] 0.03526 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .32372 0 moveto .32372 0.00625 lineto stroke grestore [(0)] .32372 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .64423 0 moveto .64423 0.00625 lineto stroke grestore [(10)] .64423 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .96474 0 moveto .96474 0.00625 lineto stroke grestore [(20)] .96474 0 0 2 0 Minner Mrotshowa [(X \(cm\))] .5 0 0 2 0 0 -1 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 1 0 lineto stroke grestore gsave 0.002 setlinewidth 0 0.03526 moveto 0.00625 0.03526 lineto stroke grestore [(20)] -0.0125 0.03526 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .32372 moveto 0.00625 .32372 lineto stroke grestore [(30)] -0.0125 .32372 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .64423 moveto 0.00625 .64423 lineto stroke grestore [(40)] -0.0125 .64423 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .96474 moveto 0.00625 .96474 lineto stroke grestore [(50)] -0.0125 .96474 1 0 0 Minner Mrotshowa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 0 1 lineto stroke grestore grestore gsave gsave 0.002 setlinewidth 0.03526 .99375 moveto 0.03526 1 lineto stroke grestore gsave 0.002 setlinewidth .32372 .99375 moveto .32372 1 lineto stroke grestore gsave 0.002 setlinewidth .64423 .99375 moveto .64423 1 lineto stroke grestore gsave 0.002 setlinewidth .96474 .99375 moveto .96474 1 lineto stroke grestore [(d\) )] .5 1 0 -4 Mshowa gsave 0.002 setlinewidth 0 1 moveto 1 1 lineto stroke grestore gsave 0.002 setlinewidth .99375 0.03526 moveto 1 0.03526 lineto stroke grestore gsave 0.002 setlinewidth .99375 .32372 moveto 1 .32372 lineto stroke grestore gsave 0.002 setlinewidth .99375 .64423 moveto 1 .64423 lineto stroke grestore gsave 0.002 setlinewidth .99375 .96474 moveto 1 .96474 lineto stroke grestore gsave 0.002 setlinewidth 1 0 moveto 1 1 lineto stroke grestore grestore gsave grestore grestore 0 0 moveto 1 0 lineto 1 1 lineto 0 1 lineto closepath clip newpath gsave gsave 0.05 setgray 0.01923 0.01923 moveto 0.08791 0.01923 lineto 0.08791 0.08791 lineto fill grestore gsave 0.05 setgray 0.01923 0.01923 moveto 0.01923 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave 0.05 setgray 0.08791 0.01923 moveto .15659 0.01923 lineto .15659 0.08791 lineto fill grestore gsave 0.05 setgray 0.08791 0.01923 moveto 0.08791 0.08791 lineto .15659 0.08791 lineto fill grestore gsave 0.05 setgray .18635 0.04899 moveto .22527 0.01942 lineto .22527 0.01923 lineto .15659 0.01923 lineto fill grestore gsave .132 setgray .18635 0.04899 moveto .22527 0.01942 lineto .22527 0.08791 lineto fill grestore gsave 0.001 setlinewidth .18635 0.04899 moveto .22527 0.01942 lineto stroke grestore gsave 0.05 setgray .18635 0.04899 moveto .15925 0.08791 lineto .15659 0.08791 lineto .15659 0.01923 lineto fill grestore gsave .132 setgray .18635 0.04899 moveto .15925 0.08791 lineto .22527 0.08791 lineto fill grestore gsave 0.001 setlinewidth .18635 0.04899 moveto .15925 0.08791 lineto stroke grestore gsave 0.05 setgray .22527 0.01923 moveto .22535 0.0193 lineto .22543 0.01923 lineto fill grestore gsave .132 setgray .22535 0.0193 moveto .22543 0.01923 lineto .29396 0.01923 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .22535 0.0193 moveto .22543 0.01923 lineto stroke grestore gsave 0.05 setgray .22527 0.01923 moveto .22535 0.0193 lineto .22527 0.01942 lineto fill grestore gsave .132 setgray .22535 0.0193 moveto .22527 0.01942 lineto .22527 0.08791 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .22535 0.0193 moveto .22527 0.01942 lineto stroke grestore gsave .132 setgray .35397 0.07924 moveto .36264 0.07424 lineto .36264 0.01923 lineto .29396 0.01923 lineto fill grestore gsave .214 setgray .35397 0.07924 moveto .36264 0.07424 lineto .36264 0.08791 lineto fill grestore gsave 0.001 setlinewidth .35397 0.07924 moveto .36264 0.07424 lineto stroke grestore gsave .132 setgray .35397 0.07924 moveto .34514 0.08791 lineto .29396 0.08791 lineto .29396 0.01923 lineto fill grestore gsave .214 setgray .35397 0.07924 moveto .34514 0.08791 lineto .36264 0.08791 lineto fill grestore gsave 0.001 setlinewidth .35397 0.07924 moveto .34514 0.08791 lineto stroke grestore gsave .132 setgray .39514 0.05173 moveto .43132 0.0357 lineto .43132 0.01923 lineto .36264 0.01923 lineto fill grestore gsave .214 setgray .39514 0.05173 moveto .43132 0.0357 lineto .43132 0.08791 lineto fill grestore gsave 0.001 setlinewidth .39514 0.05173 moveto .43132 0.0357 lineto stroke grestore gsave .132 setgray .36264 0.01923 moveto .39514 0.05173 lineto .36264 0.07424 lineto fill grestore gsave .214 setgray .39514 0.05173 moveto .36264 0.07424 lineto .36264 0.08791 lineto .43132 0.08791 lineto fill grestore gsave 0.001 setlinewidth .39514 0.05173 moveto .36264 0.07424 lineto stroke grestore gsave .132 setgray .43132 0.01923 moveto .44335 0.03127 lineto .48966 0.01923 lineto fill grestore gsave .214 setgray .44335 0.03127 moveto .48966 0.01923 lineto .5 0.01923 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .44335 0.03127 moveto .48966 0.01923 lineto stroke grestore gsave .132 setgray .43132 0.01923 moveto .44335 0.03127 lineto .43132 0.0357 lineto fill grestore gsave .214 setgray .44335 0.03127 moveto .43132 0.0357 lineto .43132 0.08791 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .44335 0.03127 moveto .43132 0.0357 lineto stroke grestore gsave .214 setgray .56868 0.01923 moveto .5 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .214 setgray .5 0.01923 moveto .56868 0.08791 lineto .5 0.08791 lineto fill grestore gsave .132 setgray .63736 0.01923 moveto .63736 0.03824 lineto .57565 0.01923 lineto fill grestore gsave .214 setgray .63736 0.03824 moveto .57565 0.01923 lineto .56868 0.01923 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .63736 0.03824 moveto .57565 0.01923 lineto stroke grestore gsave .214 setgray .56868 0.01923 moveto .63736 0.08791 lineto .56868 0.08791 lineto fill grestore gsave .132 setgray .70604 0.07963 moveto .68761 0.06947 lineto .63736 0.01923 lineto .70604 0.01923 lineto fill grestore gsave .214 setgray .70604 0.07963 moveto .68761 0.06947 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .70604 0.07963 moveto .68761 0.06947 lineto stroke grestore gsave .132 setgray .63736 0.01923 moveto .63736 0.03824 lineto .68761 0.06947 lineto fill grestore gsave .214 setgray .63736 0.03824 moveto .68761 0.06947 lineto .70604 0.08791 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .63736 0.03824 moveto .68761 0.06947 lineto stroke grestore gsave .132 setgray .77473 0.01923 moveto .70604 0.01923 lineto .77473 0.08791 lineto fill grestore gsave .132 setgray .70604 0.07963 moveto .71444 0.08791 lineto .77473 0.08791 lineto .70604 0.01923 lineto fill grestore gsave .214 setgray .70604 0.07963 moveto .71444 0.08791 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .70604 0.07963 moveto .71444 0.08791 lineto stroke grestore gsave 0.05 setgray .84341 0.01923 moveto .84341 0.01963 lineto .84296 0.01923 lineto fill grestore gsave .132 setgray .84341 0.01963 moveto .84296 0.01923 lineto .77473 0.01923 lineto .84341 0.08791 lineto fill grestore gsave 0.001 setlinewidth .84341 0.01963 moveto .84296 0.01923 lineto stroke grestore gsave .132 setgray .77473 0.01923 moveto .84341 0.08791 lineto .77473 0.08791 lineto fill grestore gsave 0.05 setgray .91209 0.08546 moveto .8558 0.03162 lineto .84341 0.01923 lineto .91209 0.01923 lineto fill grestore gsave .132 setgray .91209 0.08546 moveto .8558 0.03162 lineto .91209 0.08791 lineto fill grestore gsave 0.001 setlinewidth .91209 0.08546 moveto .8558 0.03162 lineto stroke grestore gsave 0.05 setgray .84341 0.01923 moveto .84341 0.01963 lineto .8558 0.03162 lineto fill grestore gsave .132 setgray .84341 0.01963 moveto .8558 0.03162 lineto .91209 0.08791 lineto .84341 0.08791 lineto fill grestore gsave 0.001 setlinewidth .84341 0.01963 moveto .8558 0.03162 lineto stroke grestore gsave 0.05 setgray .98077 0.01923 moveto .91209 0.01923 lineto .98077 0.08791 lineto fill grestore gsave 0.05 setgray .91209 0.08546 moveto .91464 0.08791 lineto .98077 0.08791 lineto .91209 0.01923 lineto fill grestore gsave .132 setgray .91209 0.08546 moveto .91464 0.08791 lineto .91209 0.08791 lineto fill grestore gsave 0.001 setlinewidth .91209 0.08546 moveto .91464 0.08791 lineto stroke grestore gsave 0.05 setgray 0.01923 0.08791 moveto 0.08791 0.08791 lineto 0.08791 .15659 lineto fill grestore gsave 0.05 setgray 0.01923 0.08791 moveto 0.01923 .15659 lineto 0.08791 .15659 lineto fill grestore gsave 0.05 setgray .11886 .11886 moveto .15659 0.09058 lineto .15659 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave .132 setgray .11886 .11886 moveto .15659 0.09058 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth .11886 .11886 moveto .15659 0.09058 lineto stroke grestore gsave 0.05 setgray .11886 .11886 moveto 0.09272 .15659 lineto 0.08791 .15659 lineto 0.08791 0.08791 lineto fill grestore gsave .132 setgray .11886 .11886 moveto 0.09272 .15659 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth .11886 .11886 moveto 0.09272 .15659 lineto stroke grestore gsave 0.05 setgray .15659 0.08791 moveto .15771 0.08903 lineto .15925 0.08791 lineto fill grestore gsave .132 setgray .15771 0.08903 moveto .15925 0.08791 lineto .22527 0.08791 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .15771 0.08903 moveto .15925 0.08791 lineto stroke grestore gsave 0.05 setgray .15659 0.08791 moveto .15771 0.08903 lineto .15659 0.09058 lineto fill grestore gsave .132 setgray .15771 0.08903 moveto .15659 0.09058 lineto .15659 .15659 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .15771 0.08903 moveto .15659 0.09058 lineto stroke grestore gsave .132 setgray .27528 .13792 moveto .29396 .12311 lineto .29396 0.08791 lineto .22527 0.08791 lineto fill grestore gsave .214 setgray .27528 .13792 moveto .29396 .12311 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .27528 .13792 moveto .29396 .12311 lineto stroke grestore gsave .132 setgray .27528 .13792 moveto .26337 .15659 lineto .22527 .15659 lineto .22527 0.08791 lineto fill grestore gsave .214 setgray .27528 .13792 moveto .26337 .15659 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .27528 .13792 moveto .26337 .15659 lineto stroke grestore gsave .132 setgray .29396 0.08791 moveto .31211 .10607 lineto .34514 0.08791 lineto fill grestore gsave .214 setgray .31211 .10607 moveto .34514 0.08791 lineto .36264 0.08791 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .31211 .10607 moveto .34514 0.08791 lineto stroke grestore gsave .132 setgray .29396 0.08791 moveto .31211 .10607 lineto .29396 .12311 lineto fill grestore gsave .214 setgray .31211 .10607 moveto .29396 .12311 lineto .29396 .15659 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .31211 .10607 moveto .29396 .12311 lineto stroke grestore gsave .214 setgray .41637 .14165 moveto .43132 .1354 lineto .43132 0.08791 lineto .36264 0.08791 lineto fill grestore gsave .295 setgray .41637 .14165 moveto .43132 .1354 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .41637 .14165 moveto .43132 .1354 lineto stroke grestore gsave .214 setgray .41637 .14165 moveto .39348 .15659 lineto .36264 .15659 lineto .36264 0.08791 lineto fill grestore gsave .295 setgray .41637 .14165 moveto .39348 .15659 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .41637 .14165 moveto .39348 .15659 lineto stroke grestore gsave .214 setgray .46673 .12332 moveto .5 .11528 lineto .5 0.08791 lineto .43132 0.08791 lineto fill grestore gsave .295 setgray .46673 .12332 moveto .5 .11528 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .46673 .12332 moveto .5 .11528 lineto stroke grestore gsave .214 setgray .43132 0.08791 moveto .46673 .12332 lineto .43132 .1354 lineto fill grestore gsave .295 setgray .46673 .12332 moveto .43132 .1354 lineto .43132 .15659 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .46673 .12332 moveto .43132 .1354 lineto stroke grestore gsave .214 setgray .56868 .11667 moveto .52814 .11605 lineto .5 0.08791 lineto .56868 0.08791 lineto fill grestore gsave .295 setgray .56868 .11667 moveto .52814 .11605 lineto .56868 .15659 lineto fill grestore gsave 0.001 setlinewidth .56868 .11667 moveto .52814 .11605 lineto stroke grestore gsave .214 setgray .5 0.08791 moveto .5 .11528 lineto .52814 .11605 lineto fill grestore gsave .295 setgray .5 .11528 moveto .52814 .11605 lineto .56868 .15659 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .5 .11528 moveto .52814 .11605 lineto stroke grestore gsave .214 setgray .63736 .13972 moveto .61349 .13272 lineto .56868 0.08791 lineto .63736 0.08791 lineto fill grestore gsave .295 setgray .63736 .13972 moveto .61349 .13272 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .63736 .13972 moveto .61349 .13272 lineto stroke grestore gsave .214 setgray .56868 0.08791 moveto .56868 .11667 lineto .61349 .13272 lineto fill grestore gsave .295 setgray .56868 .11667 moveto .61349 .13272 lineto .63736 .15659 lineto .56868 .15659 lineto fill grestore gsave 0.001 setlinewidth .56868 .11667 moveto .61349 .13272 lineto stroke grestore gsave .214 setgray .70604 0.08791 moveto .63736 0.08791 lineto .70604 .15659 lineto fill grestore gsave .214 setgray .63736 .13972 moveto .66561 .15659 lineto .70604 .15659 lineto .63736 0.08791 lineto fill grestore gsave .295 setgray .63736 .13972 moveto .66561 .15659 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .63736 .13972 moveto .66561 .15659 lineto stroke grestore gsave .132 setgray .77473 0.08791 moveto .77473 .14426 lineto .71444 0.08791 lineto fill grestore gsave .214 setgray .77473 .14426 moveto .71444 0.08791 lineto .70604 0.08791 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .77473 .14426 moveto .71444 0.08791 lineto stroke grestore gsave .214 setgray .70604 0.08791 moveto .77473 .15659 lineto .70604 .15659 lineto fill grestore gsave .132 setgray .84341 0.08791 moveto .77473 0.08791 lineto .84341 .15659 lineto fill grestore gsave .132 setgray .77473 .14426 moveto .78854 .15659 lineto .84341 .15659 lineto .77473 0.08791 lineto fill grestore gsave .214 setgray .77473 .14426 moveto .78854 .15659 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .77473 .14426 moveto .78854 .15659 lineto stroke grestore gsave .132 setgray .91209 0.08791 moveto .84341 0.08791 lineto .91209 .15659 lineto fill grestore gsave .132 setgray .84341 0.08791 moveto .91209 .15659 lineto .84341 .15659 lineto fill grestore gsave 0.05 setgray .98077 0.08791 moveto .98077 .14792 lineto .91464 0.08791 lineto fill grestore gsave .132 setgray .98077 .14792 moveto .91464 0.08791 lineto .91209 0.08791 lineto .98077 .15659 lineto fill grestore gsave 0.001 setlinewidth .98077 .14792 moveto .91464 0.08791 lineto stroke grestore gsave .132 setgray .91209 0.08791 moveto .98077 .15659 lineto .91209 .15659 lineto fill grestore gsave 0.05 setgray 0.0513 .18866 moveto 0.08791 .16165 lineto 0.08791 .15659 lineto 0.01923 .15659 lineto fill grestore gsave .132 setgray 0.0513 .18866 moveto 0.08791 .16165 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.0513 .18866 moveto 0.08791 .16165 lineto stroke grestore gsave 0.05 setgray 0.0513 .18866 moveto 0.0249 .22527 lineto 0.01923 .22527 lineto 0.01923 .15659 lineto fill grestore gsave .132 setgray 0.0513 .18866 moveto 0.0249 .22527 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.0513 .18866 moveto 0.0249 .22527 lineto stroke grestore gsave 0.05 setgray 0.08791 .15659 moveto 0.08998 .15866 lineto 0.09272 .15659 lineto fill grestore gsave .132 setgray 0.08998 .15866 moveto 0.09272 .15659 lineto .15659 .15659 lineto .15659 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.08998 .15866 moveto 0.09272 .15659 lineto stroke grestore gsave 0.05 setgray 0.08791 .15659 moveto 0.08998 .15866 lineto 0.08791 .16165 lineto fill grestore gsave .132 setgray 0.08998 .15866 moveto 0.08791 .16165 lineto 0.08791 .22527 lineto .15659 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.08998 .15866 moveto 0.08791 .16165 lineto stroke grestore gsave .132 setgray .21093 .21093 moveto .22527 .20038 lineto .22527 .15659 lineto .15659 .15659 lineto fill grestore gsave .214 setgray .21093 .21093 moveto .22527 .20038 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .21093 .21093 moveto .22527 .20038 lineto stroke grestore gsave .132 setgray .21093 .21093 moveto .20068 .22527 lineto .15659 .22527 lineto .15659 .15659 lineto fill grestore gsave .214 setgray .21093 .21093 moveto .20068 .22527 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .21093 .21093 moveto .20068 .22527 lineto stroke grestore gsave .132 setgray .22527 .15659 moveto .24227 .17359 lineto .26337 .15659 lineto fill grestore gsave .214 setgray .24227 .17359 moveto .26337 .15659 lineto .29396 .15659 lineto .29396 .22252 lineto .29243 .22375 lineto fill grestore gsave 0.001 setlinewidth .24227 .17359 moveto .26337 .15659 lineto stroke grestore gsave .295 setgray .29243 .22375 moveto .29396 .22252 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .29243 .22375 moveto .29396 .22252 lineto stroke grestore gsave .132 setgray .22527 .15659 moveto .24227 .17359 lineto .22527 .20038 lineto fill grestore gsave .214 setgray .24227 .17359 moveto .22527 .20038 lineto .22527 .22527 lineto .29146 .22527 lineto .29243 .22375 lineto fill grestore gsave 0.001 setlinewidth .24227 .17359 moveto .22527 .20038 lineto stroke grestore gsave .295 setgray .29243 .22375 moveto .29146 .22527 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .29243 .22375 moveto .29146 .22527 lineto stroke grestore gsave .214 setgray .32804 .19068 moveto .36264 .17148 lineto .36264 .15659 lineto .29396 .15659 lineto fill grestore gsave .295 setgray .32804 .19068 moveto .36264 .17148 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .32804 .19068 moveto .36264 .17148 lineto stroke grestore gsave .214 setgray .29396 .15659 moveto .32804 .19068 lineto .29396 .22252 lineto fill grestore gsave .295 setgray .32804 .19068 moveto .29396 .22252 lineto .29396 .22527 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .32804 .19068 moveto .29396 .22252 lineto stroke grestore gsave .214 setgray .36264 .15659 moveto .37172 .16568 lineto .39348 .15659 lineto fill grestore gsave .295 setgray .37172 .16568 moveto .39348 .15659 lineto .43132 .15659 lineto .43132 .20376 lineto .41614 .21009 lineto fill grestore gsave 0.001 setlinewidth .37172 .16568 moveto .39348 .15659 lineto stroke grestore gsave .377 setgray .41614 .21009 moveto .43132 .20376 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .41614 .21009 moveto .43132 .20376 lineto stroke grestore gsave .214 setgray .36264 .15659 moveto .37172 .16568 lineto .36264 .17148 lineto fill grestore gsave .295 setgray .37172 .16568 moveto .36264 .17148 lineto .36264 .22527 lineto .39237 .22527 lineto .41614 .21009 lineto fill grestore gsave 0.001 setlinewidth .37172 .16568 moveto .36264 .17148 lineto stroke grestore gsave .377 setgray .41614 .21009 moveto .39237 .22527 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .41614 .21009 moveto .39237 .22527 lineto stroke grestore gsave .295 setgray .46688 .19216 moveto .5 .1843 lineto .5 .15659 lineto .43132 .15659 lineto fill grestore gsave .377 setgray .46688 .19216 moveto .5 .1843 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .46688 .19216 moveto .5 .1843 lineto stroke grestore gsave .295 setgray .43132 .15659 moveto .46688 .19216 lineto .43132 .20376 lineto fill grestore gsave .377 setgray .46688 .19216 moveto .43132 .20376 lineto .43132 .22527 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .46688 .19216 moveto .43132 .20376 lineto stroke grestore gsave .295 setgray .56868 .18616 moveto .52874 .18533 lineto .5 .15659 lineto .56868 .15659 lineto fill grestore gsave .377 setgray .56868 .18616 moveto .52874 .18533 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .56868 .18616 moveto .52874 .18533 lineto stroke grestore gsave .295 setgray .5 .15659 moveto .5 .1843 lineto .52874 .18533 lineto fill grestore gsave .377 setgray .5 .1843 moveto .52874 .18533 lineto .56868 .22527 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .5 .1843 moveto .52874 .18533 lineto stroke grestore gsave .295 setgray .63736 .2094 moveto .6148 .20271 lineto .56868 .15659 lineto .63736 .15659 lineto fill grestore gsave .377 setgray .63736 .2094 moveto .6148 .20271 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .63736 .2094 moveto .6148 .20271 lineto stroke grestore gsave .295 setgray .56868 .15659 moveto .56868 .18616 lineto .6148 .20271 lineto fill grestore gsave .377 setgray .56868 .18616 moveto .6148 .20271 lineto .63736 .22527 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .56868 .18616 moveto .6148 .20271 lineto stroke grestore gsave .214 setgray .70604 .15659 moveto .70604 .17794 lineto .66561 .15659 lineto fill grestore gsave .295 setgray .70604 .17794 moveto .66561 .15659 lineto .63736 .15659 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .70604 .17794 moveto .66561 .15659 lineto stroke grestore gsave .295 setgray .63736 .2094 moveto .66388 .22527 lineto .70604 .22527 lineto .63736 .15659 lineto fill grestore gsave .377 setgray .63736 .2094 moveto .66388 .22527 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .63736 .2094 moveto .66388 .22527 lineto stroke grestore gsave .214 setgray .77473 .15659 moveto .70604 .15659 lineto .77473 .22527 lineto fill grestore gsave .214 setgray .70604 .17794 moveto .75541 .22527 lineto .77473 .22527 lineto .70604 .15659 lineto fill grestore gsave .295 setgray .70604 .17794 moveto .75541 .22527 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .70604 .17794 moveto .75541 .22527 lineto stroke grestore gsave .132 setgray .84341 .15659 moveto .84341 .20444 lineto .78854 .15659 lineto fill grestore gsave .214 setgray .84341 .20444 moveto .78854 .15659 lineto .77473 .15659 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .84341 .20444 moveto .78854 .15659 lineto stroke grestore gsave .214 setgray .77473 .15659 moveto .84341 .22527 lineto .77473 .22527 lineto fill grestore gsave .132 setgray .91209 .15659 moveto .84341 .15659 lineto .91209 .22527 lineto fill grestore gsave .132 setgray .84341 .20444 moveto .86541 .22527 lineto .91209 .22527 lineto .84341 .15659 lineto fill grestore gsave .214 setgray .84341 .20444 moveto .86541 .22527 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .84341 .20444 moveto .86541 .22527 lineto stroke grestore gsave .132 setgray .98077 .15659 moveto .91209 .15659 lineto .98077 .22527 lineto fill grestore gsave .132 setgray .91209 .15659 moveto .98077 .22527 lineto .91209 .22527 lineto fill grestore gsave 0.05 setgray 0.01923 .22527 moveto 0.02139 .22744 lineto 0.0249 .22527 lineto fill grestore gsave .132 setgray 0.02139 .22744 moveto 0.0249 .22527 lineto 0.08791 .22527 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.02139 .22744 moveto 0.0249 .22527 lineto stroke grestore gsave 0.05 setgray 0.01923 .22527 moveto 0.02139 .22744 lineto 0.01923 .23001 lineto fill grestore gsave .132 setgray 0.02139 .22744 moveto 0.01923 .23001 lineto 0.01923 .29396 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.02139 .22744 moveto 0.01923 .23001 lineto stroke grestore gsave .132 setgray .13781 .27518 moveto .15659 .26319 lineto .15659 .22527 lineto 0.08791 .22527 lineto fill grestore gsave .214 setgray .13781 .27518 moveto .15659 .26319 lineto .15659 .29396 lineto fill grestore gsave 0.001 setlinewidth .13781 .27518 moveto .15659 .26319 lineto stroke grestore gsave .132 setgray .13781 .27518 moveto .12293 .29396 lineto 0.08791 .29396 lineto 0.08791 .22527 lineto fill grestore gsave .214 setgray .13781 .27518 moveto .12293 .29396 lineto .15659 .29396 lineto fill grestore gsave 0.001 setlinewidth .13781 .27518 moveto .12293 .29396 lineto stroke grestore gsave .132 setgray .15659 .22527 moveto .17356 .24224 lineto .20068 .22527 lineto fill grestore gsave .214 setgray .17356 .24224 moveto .20068 .22527 lineto .22527 .22527 lineto .22527 .28981 lineto .22272 .2914 lineto fill grestore gsave 0.001 setlinewidth .17356 .24224 moveto .20068 .22527 lineto stroke grestore gsave .295 setgray .22272 .2914 moveto .22527 .28981 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .22272 .2914 moveto .22527 .28981 lineto stroke grestore gsave .132 setgray .15659 .22527 moveto .17356 .24224 lineto .15659 .26319 lineto fill grestore gsave .214 setgray .17356 .24224 moveto .15659 .26319 lineto .15659 .29396 lineto .22065 .29396 lineto .22272 .2914 lineto fill grestore gsave 0.001 setlinewidth .17356 .24224 moveto .15659 .26319 lineto stroke grestore gsave .295 setgray .22272 .2914 moveto .22065 .29396 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .22272 .2914 moveto .22065 .29396 lineto stroke grestore gsave .214 setgray .22527 .22527 moveto .25224 .25224 lineto .29146 .22527 lineto fill grestore gsave .295 setgray .25224 .25224 moveto .29146 .22527 lineto .29396 .22527 lineto .29396 .27992 lineto .28564 .28564 lineto fill grestore gsave 0.001 setlinewidth .25224 .25224 moveto .29146 .22527 lineto stroke grestore gsave .377 setgray .28564 .28564 moveto .29396 .27992 lineto .29396 .29396 lineto fill grestore gsave 0.001 setlinewidth .28564 .28564 moveto .29396 .27992 lineto stroke grestore gsave .214 setgray .22527 .22527 moveto .25224 .25224 lineto .22527 .28981 lineto fill grestore gsave .295 setgray .25224 .25224 moveto .22527 .28981 lineto .22527 .29396 lineto .27967 .29396 lineto .28564 .28564 lineto fill grestore gsave 0.001 setlinewidth .25224 .25224 moveto .22527 .28981 lineto stroke grestore gsave .377 setgray .28564 .28564 moveto .27967 .29396 lineto .29396 .29396 lineto fill grestore gsave 0.001 setlinewidth .28564 .28564 moveto .27967 .29396 lineto stroke grestore gsave .295 setgray .32405 .25537 moveto .36264 .23719 lineto .36264 .22527 lineto .29396 .22527 lineto fill grestore gsave .377 setgray .32405 .25537 moveto .36264 .23719 lineto .36264 .28286 lineto .3551 .28641 lineto fill grestore gsave 0.001 setlinewidth .32405 .25537 moveto .36264 .23719 lineto stroke grestore gsave .459 setgray .3551 .28641 moveto .36264 .28286 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .3551 .28641 moveto .36264 .28286 lineto stroke grestore gsave .295 setgray .29396 .22527 moveto .32405 .25537 lineto .29396 .27992 lineto fill grestore gsave .377 setgray .32405 .25537 moveto .29396 .27992 lineto .29396 .29396 lineto .34585 .29396 lineto .3551 .28641 lineto fill grestore gsave 0.001 setlinewidth .32405 .25537 moveto .29396 .27992 lineto stroke grestore gsave .459 setgray .3551 .28641 moveto .34585 .29396 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .3551 .28641 moveto .34585 .29396 lineto stroke grestore gsave .295 setgray .36264 .22527 moveto .37035 .23299 lineto .39237 .22527 lineto fill grestore gsave .377 setgray .37035 .23299 moveto .39237 .22527 lineto .43132 .22527 lineto .43132 .25156 lineto .39992 .26256 lineto fill grestore gsave 0.001 setlinewidth .37035 .23299 moveto .39237 .22527 lineto stroke grestore gsave .459 setgray .39992 .26256 moveto .43132 .25156 lineto .43132 .29148 lineto .42949 .29212 lineto fill grestore gsave 0.001 setlinewidth .39992 .26256 moveto .43132 .25156 lineto stroke grestore gsave .541 setgray .42949 .29212 moveto .43132 .29148 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .42949 .29212 moveto .43132 .29148 lineto stroke grestore gsave .295 setgray .36264 .22527 moveto .37035 .23299 lineto .36264 .23719 lineto fill grestore gsave .377 setgray .37035 .23299 moveto .36264 .23719 lineto .36264 .28286 lineto .39992 .26256 lineto fill grestore gsave 0.001 setlinewidth .37035 .23299 moveto .36264 .23719 lineto stroke grestore gsave .459 setgray .39992 .26256 moveto .36264 .28286 lineto .36264 .29396 lineto .42612 .29396 lineto .42949 .29212 lineto fill grestore gsave 0.001 setlinewidth .39992 .26256 moveto .36264 .28286 lineto stroke grestore gsave .541 setgray .42949 .29212 moveto .42612 .29396 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .42949 .29212 moveto .42612 .29396 lineto stroke grestore gsave .377 setgray .45206 .24601 moveto .5 .23666 lineto .5 .22527 lineto .43132 .22527 lineto fill grestore gsave .459 setgray .45206 .24601 moveto .5 .23666 lineto .5 .27432 lineto .48357 .27752 lineto fill grestore gsave 0.001 setlinewidth .45206 .24601 moveto .5 .23666 lineto stroke grestore gsave .541 setgray .48357 .27752 moveto .5 .27432 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .48357 .27752 moveto .5 .27432 lineto stroke grestore gsave .377 setgray .43132 .22527 moveto .45206 .24601 lineto .43132 .25156 lineto fill grestore gsave .459 setgray .45206 .24601 moveto .43132 .25156 lineto .43132 .29148 lineto .48357 .27752 lineto fill grestore gsave 0.001 setlinewidth .45206 .24601 moveto .43132 .25156 lineto stroke grestore gsave .541 setgray .48357 .27752 moveto .43132 .29148 lineto .43132 .29396 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .48357 .27752 moveto .43132 .29148 lineto stroke grestore gsave .377 setgray .56868 .23853 moveto .51192 .23719 lineto .5 .22527 lineto .56868 .22527 lineto fill grestore gsave .459 setgray .56868 .23853 moveto .51192 .23719 lineto .55134 .27662 lineto .56868 .27702 lineto fill grestore gsave 0.001 setlinewidth .56868 .23853 moveto .51192 .23719 lineto stroke grestore gsave .541 setgray .56868 .27702 moveto .55134 .27662 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56868 .27702 moveto .55134 .27662 lineto stroke grestore gsave .377 setgray .5 .22527 moveto .5 .23666 lineto .51192 .23719 lineto fill grestore gsave .459 setgray .5 .23666 moveto .51192 .23719 lineto .55134 .27662 lineto .5 .27432 lineto fill grestore gsave 0.001 setlinewidth .5 .23666 moveto .51192 .23719 lineto stroke grestore gsave .541 setgray .5 .27432 moveto .55134 .27662 lineto .56868 .29396 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .5 .27432 moveto .55134 .27662 lineto stroke grestore gsave .377 setgray .63736 .25717 moveto .5881 .24469 lineto .56868 .22527 lineto .63736 .22527 lineto fill grestore gsave .459 setgray .63736 .25717 moveto .5881 .24469 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .63736 .25717 moveto .5881 .24469 lineto stroke grestore gsave .377 setgray .56868 .22527 moveto .56868 .23853 lineto .5881 .24469 lineto fill grestore gsave .459 setgray .56868 .23853 moveto .5881 .24469 lineto .63736 .29396 lineto .62203 .29396 lineto .56868 .27702 lineto fill grestore gsave 0.001 setlinewidth .56868 .23853 moveto .5881 .24469 lineto stroke grestore gsave .541 setgray .56868 .27702 moveto .62203 .29396 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56868 .27702 moveto .62203 .29396 lineto stroke grestore gsave .295 setgray .70604 .22527 moveto .70604 .24425 lineto .66388 .22527 lineto fill grestore gsave .377 setgray .70604 .24425 moveto .66388 .22527 lineto .63736 .22527 lineto .70512 .29303 lineto .70604 .29345 lineto fill grestore gsave 0.001 setlinewidth .70604 .24425 moveto .66388 .22527 lineto stroke grestore gsave .459 setgray .70604 .29345 moveto .70512 .29303 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70604 .29345 moveto .70512 .29303 lineto stroke grestore gsave .377 setgray .63736 .22527 moveto .63736 .25717 lineto .70512 .29303 lineto fill grestore gsave .459 setgray .63736 .25717 moveto .70512 .29303 lineto .70604 .29396 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .63736 .25717 moveto .70512 .29303 lineto stroke grestore gsave .214 setgray .77473 .22527 moveto .77473 .24092 lineto .75541 .22527 lineto fill grestore gsave .295 setgray .77473 .24092 moveto .75541 .22527 lineto .70604 .22527 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .77473 .24092 moveto .75541 .22527 lineto stroke grestore gsave .295 setgray .70604 .24425 moveto .76409 .29396 lineto .77473 .29396 lineto .70604 .22527 lineto fill grestore gsave .377 setgray .70604 .24425 moveto .76409 .29396 lineto .70664 .29396 lineto .70604 .29345 lineto fill grestore gsave 0.001 setlinewidth .70604 .24425 moveto .76409 .29396 lineto stroke grestore gsave .459 setgray .70604 .29345 moveto .70664 .29396 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70604 .29345 moveto .70664 .29396 lineto stroke grestore gsave .214 setgray .84341 .22527 moveto .77473 .22527 lineto .84341 .29396 lineto fill grestore gsave .214 setgray .77473 .24092 moveto .84012 .29396 lineto .84341 .29396 lineto .77473 .22527 lineto fill grestore gsave .295 setgray .77473 .24092 moveto .84012 .29396 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .77473 .24092 moveto .84012 .29396 lineto stroke grestore gsave .132 setgray .91209 .22527 moveto .91209 .26282 lineto .86541 .22527 lineto fill grestore gsave .214 setgray .91209 .26282 moveto .86541 .22527 lineto .84341 .22527 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .26282 moveto .86541 .22527 lineto stroke grestore gsave .214 setgray .84341 .22527 moveto .91209 .29396 lineto .84341 .29396 lineto fill grestore gsave .132 setgray .98077 .22527 moveto .91209 .22527 lineto .98077 .29396 lineto fill grestore gsave .132 setgray .91209 .26282 moveto .94858 .29396 lineto .98077 .29396 lineto .91209 .22527 lineto fill grestore gsave .214 setgray .91209 .26282 moveto .94858 .29396 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .26282 moveto .94858 .29396 lineto stroke grestore gsave .132 setgray 0.07728 .352 moveto 0.08791 .34187 lineto 0.08791 .29396 lineto 0.01923 .29396 lineto fill grestore gsave .214 setgray 0.07728 .352 moveto 0.08791 .34187 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.07728 .352 moveto 0.08791 .34187 lineto stroke grestore gsave .132 setgray 0.07728 .352 moveto 0.07065 .36264 lineto 0.01923 .36264 lineto 0.01923 .29396 lineto fill grestore gsave .214 setgray 0.07728 .352 moveto 0.07065 .36264 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.07728 .352 moveto 0.07065 .36264 lineto stroke grestore gsave .132 setgray 0.08791 .29396 moveto .10547 .31151 lineto .12293 .29396 lineto fill grestore gsave .214 setgray .10547 .31151 moveto .12293 .29396 lineto .15659 .29396 lineto .15659 .36264 lineto fill grestore gsave 0.001 setlinewidth .10547 .31151 moveto .12293 .29396 lineto stroke grestore gsave .132 setgray 0.08791 .29396 moveto .10547 .31151 lineto 0.08791 .34187 lineto fill grestore gsave .214 setgray .10547 .31151 moveto 0.08791 .34187 lineto 0.08791 .36264 lineto .15659 .36264 lineto fill grestore gsave 0.001 setlinewidth .10547 .31151 moveto 0.08791 .34187 lineto stroke grestore gsave .214 setgray .15659 .29396 moveto .18858 .32594 lineto .22065 .29396 lineto fill grestore gsave .295 setgray .18858 .32594 moveto .22065 .29396 lineto .22527 .29396 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .18858 .32594 moveto .22065 .29396 lineto stroke grestore gsave .214 setgray .18858 .32594 moveto .16723 .36264 lineto .15659 .36264 lineto .15659 .29396 lineto fill grestore gsave .295 setgray .18858 .32594 moveto .16723 .36264 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .18858 .32594 moveto .16723 .36264 lineto stroke grestore gsave .295 setgray .22527 .29396 moveto .25378 .32246 lineto .27967 .29396 lineto fill grestore gsave .377 setgray .25378 .32246 moveto .27967 .29396 lineto .29396 .29396 lineto .29396 .3414 lineto .28385 .35253 lineto fill grestore gsave 0.001 setlinewidth .25378 .32246 moveto .27967 .29396 lineto stroke grestore gsave .459 setgray .28385 .35253 moveto .29396 .3414 lineto .29396 .36264 lineto fill grestore gsave 0.001 setlinewidth .28385 .35253 moveto .29396 .3414 lineto stroke grestore gsave .295 setgray .25378 .32246 moveto .2332 .36264 lineto .22527 .36264 lineto .22527 .29396 lineto fill grestore gsave .377 setgray .25378 .32246 moveto .2332 .36264 lineto .27867 .36264 lineto .28385 .35253 lineto fill grestore gsave 0.001 setlinewidth .25378 .32246 moveto .2332 .36264 lineto stroke grestore gsave .459 setgray .28385 .35253 moveto .27867 .36264 lineto .29396 .36264 lineto fill grestore gsave 0.001 setlinewidth .28385 .35253 moveto .27867 .36264 lineto stroke grestore gsave .377 setgray .29396 .29396 moveto .31614 .31614 lineto .34585 .29396 lineto fill grestore gsave .459 setgray .31614 .31614 moveto .34585 .29396 lineto .36264 .29396 lineto .36264 .33301 lineto .34567 .34567 lineto fill grestore gsave 0.001 setlinewidth .31614 .31614 moveto .34585 .29396 lineto stroke grestore gsave .541 setgray .34567 .34567 moveto .36264 .33301 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .34567 .34567 moveto .36264 .33301 lineto stroke grestore gsave .377 setgray .29396 .29396 moveto .31614 .31614 lineto .29396 .3414 lineto fill grestore gsave .459 setgray .31614 .31614 moveto .29396 .3414 lineto .29396 .36264 lineto .33078 .36264 lineto .34567 .34567 lineto fill grestore gsave 0.001 setlinewidth .31614 .31614 moveto .29396 .3414 lineto stroke grestore gsave .541 setgray .34567 .34567 moveto .33078 .36264 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .34567 .34567 moveto .33078 .36264 lineto stroke grestore gsave .459 setgray .36264 .29396 moveto .38498 .3163 lineto .42612 .29396 lineto fill grestore gsave .541 setgray .38498 .3163 moveto .42612 .29396 lineto .43132 .29396 lineto .43132 .33668 lineto .4145 .34582 lineto fill grestore gsave 0.001 setlinewidth .38498 .3163 moveto .42612 .29396 lineto stroke grestore gsave .623 setgray .4145 .34582 moveto .43132 .33668 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .4145 .34582 moveto .43132 .33668 lineto stroke grestore gsave .459 setgray .36264 .29396 moveto .38498 .3163 lineto .36264 .33301 lineto fill grestore gsave .541 setgray .38498 .3163 moveto .36264 .33301 lineto .36264 .36264 lineto .392 .36264 lineto .4145 .34582 lineto fill grestore gsave 0.001 setlinewidth .38498 .3163 moveto .36264 .33301 lineto stroke grestore gsave .623 setgray .4145 .34582 moveto .392 .36264 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .4145 .34582 moveto .392 .36264 lineto stroke grestore gsave .541 setgray .46288 .32552 moveto .5 .31473 lineto .5 .29396 lineto .43132 .29396 lineto fill grestore gsave .623 setgray .46288 .32552 moveto .5 .31473 lineto .5 .35816 lineto .49653 .35917 lineto fill grestore gsave 0.001 setlinewidth .46288 .32552 moveto .5 .31473 lineto stroke grestore gsave .705 setgray .49653 .35917 moveto .5 .35816 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .49653 .35917 moveto .5 .35816 lineto stroke grestore gsave .541 setgray .43132 .29396 moveto .46288 .32552 lineto .43132 .33668 lineto fill grestore gsave .623 setgray .46288 .32552 moveto .43132 .33668 lineto .43132 .36264 lineto .48672 .36264 lineto .49653 .35917 lineto fill grestore gsave 0.001 setlinewidth .46288 .32552 moveto .43132 .33668 lineto stroke grestore gsave .705 setgray .49653 .35917 moveto .48672 .36264 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .49653 .35917 moveto .48672 .36264 lineto stroke grestore gsave .541 setgray .56868 .31906 moveto .52265 .31661 lineto .5 .29396 lineto .56868 .29396 lineto fill grestore gsave .623 setgray .56868 .31906 moveto .52265 .31661 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .56868 .31906 moveto .52265 .31661 lineto stroke grestore gsave .541 setgray .5 .29396 moveto .5 .31473 lineto .52265 .31661 lineto fill grestore gsave .623 setgray .5 .31473 moveto .52265 .31661 lineto .56868 .36264 lineto .55416 .36264 lineto .5 .35816 lineto fill grestore gsave 0.001 setlinewidth .5 .31473 moveto .52265 .31661 lineto stroke grestore gsave .705 setgray .5 .35816 moveto .55416 .36264 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .5 .35816 moveto .55416 .36264 lineto stroke grestore gsave .459 setgray .63736 .29396 moveto .63736 .30016 lineto .62203 .29396 lineto fill grestore gsave .541 setgray .63736 .30016 moveto .62203 .29396 lineto .56868 .29396 lineto .61481 .34009 lineto .63736 .34921 lineto fill grestore gsave 0.001 setlinewidth .63736 .30016 moveto .62203 .29396 lineto stroke grestore gsave .623 setgray .63736 .34921 moveto .61481 .34009 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .63736 .34921 moveto .61481 .34009 lineto stroke grestore gsave .541 setgray .56868 .29396 moveto .56868 .31906 lineto .61481 .34009 lineto fill grestore gsave .623 setgray .56868 .31906 moveto .61481 .34009 lineto .63736 .36264 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .56868 .31906 moveto .61481 .34009 lineto stroke grestore gsave .459 setgray .70604 .35047 moveto .66294 .31953 lineto .63736 .29396 lineto .70604 .29396 lineto fill grestore gsave .541 setgray .70604 .35047 moveto .66294 .31953 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .70604 .35047 moveto .66294 .31953 lineto stroke grestore gsave .459 setgray .63736 .29396 moveto .63736 .30016 lineto .66294 .31953 lineto fill grestore gsave .541 setgray .63736 .30016 moveto .66294 .31953 lineto .70604 .36264 lineto .65509 .36264 lineto .63736 .34921 lineto fill grestore gsave 0.001 setlinewidth .63736 .30016 moveto .66294 .31953 lineto stroke grestore gsave .623 setgray .63736 .34921 moveto .65509 .36264 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .63736 .34921 moveto .65509 .36264 lineto stroke grestore gsave .295 setgray .77473 .29396 moveto .76409 .29396 lineto .77473 .3079 lineto fill grestore gsave .377 setgray .76409 .29396 moveto .77473 .3079 lineto .77473 .36264 lineto .70854 .29646 lineto .70664 .29396 lineto fill grestore gsave 0.001 setlinewidth .76409 .29396 moveto .77473 .3079 lineto stroke grestore gsave .459 setgray .70664 .29396 moveto .70854 .29646 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70664 .29396 moveto .70854 .29646 lineto stroke grestore gsave .377 setgray .77473 .36264 moveto .7621 .36264 lineto .70854 .29646 lineto fill grestore gsave .459 setgray .7621 .36264 moveto .70854 .29646 lineto .70604 .29396 lineto .70604 .35047 lineto .71589 .36264 lineto fill grestore gsave 0.001 setlinewidth .7621 .36264 moveto .70854 .29646 lineto stroke grestore gsave .541 setgray .71589 .36264 moveto .70604 .35047 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .71589 .36264 moveto .70604 .35047 lineto stroke grestore gsave .214 setgray .84341 .29396 moveto .84012 .29396 lineto .84341 .29801 lineto fill grestore gsave .295 setgray .84012 .29396 moveto .84341 .29801 lineto .84341 .36264 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .84012 .29396 moveto .84341 .29801 lineto stroke grestore gsave .295 setgray .82118 .36264 moveto .77473 .3079 lineto .77473 .29396 lineto .84341 .36264 lineto fill grestore gsave .377 setgray .82118 .36264 moveto .77473 .3079 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .82118 .36264 moveto .77473 .3079 lineto stroke grestore gsave .214 setgray .91209 .29396 moveto .91209 .36264 lineto .84341 .29396 lineto fill grestore gsave .214 setgray .89525 .36264 moveto .84341 .29801 lineto .84341 .29396 lineto .91209 .36264 lineto fill grestore gsave .295 setgray .89525 .36264 moveto .84341 .29801 lineto .84341 .36264 lineto fill grestore gsave 0.001 setlinewidth .89525 .36264 moveto .84341 .29801 lineto stroke grestore gsave .132 setgray .98077 .29396 moveto .94858 .29396 lineto .98077 .33701 lineto fill grestore gsave .214 setgray .94858 .29396 moveto .98077 .33701 lineto .98077 .36264 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .94858 .29396 moveto .98077 .33701 lineto stroke grestore gsave .214 setgray .98077 .36264 moveto .91209 .29396 lineto .91209 .36264 lineto fill grestore gsave .132 setgray 0.01923 .36264 moveto 0.04788 .39129 lineto 0.07065 .36264 lineto fill grestore gsave .214 setgray 0.04788 .39129 moveto 0.07065 .36264 lineto 0.08791 .36264 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.04788 .39129 moveto 0.07065 .36264 lineto stroke grestore gsave .132 setgray 0.04788 .39129 moveto 0.02747 .43132 lineto 0.01923 .43132 lineto 0.01923 .36264 lineto fill grestore gsave .214 setgray 0.04788 .39129 moveto 0.02747 .43132 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.04788 .39129 moveto 0.02747 .43132 lineto stroke grestore gsave .214 setgray .13564 .41036 moveto .15659 .38206 lineto .15659 .36264 lineto 0.08791 .36264 lineto fill grestore gsave .295 setgray .13564 .41036 moveto .15659 .38206 lineto .15659 .43132 lineto fill grestore gsave 0.001 setlinewidth .13564 .41036 moveto .15659 .38206 lineto stroke grestore gsave .214 setgray .13564 .41036 moveto .12589 .43132 lineto 0.08791 .43132 lineto 0.08791 .36264 lineto fill grestore gsave .295 setgray .13564 .41036 moveto .12589 .43132 lineto .15659 .43132 lineto fill grestore gsave 0.001 setlinewidth .13564 .41036 moveto .12589 .43132 lineto stroke grestore gsave .214 setgray .15659 .36264 moveto .16272 .36876 lineto .16723 .36264 lineto fill grestore gsave .295 setgray .16272 .36876 moveto .16723 .36264 lineto .22527 .36264 lineto .22527 .37928 lineto .20321 .40926 lineto fill grestore gsave 0.001 setlinewidth .16272 .36876 moveto .16723 .36264 lineto stroke grestore gsave .377 setgray .20321 .40926 moveto .22527 .37928 lineto .22527 .43132 lineto fill grestore gsave 0.001 setlinewidth .20321 .40926 moveto .22527 .37928 lineto stroke grestore gsave .214 setgray .15659 .36264 moveto .16272 .36876 lineto .15659 .38206 lineto fill grestore gsave .295 setgray .16272 .36876 moveto .15659 .38206 lineto .15659 .43132 lineto .19305 .43132 lineto .20321 .40926 lineto fill grestore gsave 0.001 setlinewidth .16272 .36876 moveto .15659 .38206 lineto stroke grestore gsave .377 setgray .20321 .40926 moveto .19305 .43132 lineto .22527 .43132 lineto fill grestore gsave 0.001 setlinewidth .20321 .40926 moveto .19305 .43132 lineto stroke grestore gsave .295 setgray .22527 .36264 moveto .23004 .3674 lineto .2332 .36264 lineto fill grestore gsave .377 setgray .23004 .3674 moveto .2332 .36264 lineto .27867 .36264 lineto .2574 .39477 lineto fill grestore gsave 0.001 setlinewidth .23004 .3674 moveto .2332 .36264 lineto stroke grestore gsave .459 setgray .2574 .39477 moveto .27867 .36264 lineto .29396 .36264 lineto .29396 .40824 lineto .28476 .42213 lineto fill grestore gsave 0.001 setlinewidth .2574 .39477 moveto .27867 .36264 lineto stroke grestore gsave .541 setgray .28476 .42213 moveto .29396 .40824 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .28476 .42213 moveto .29396 .40824 lineto stroke grestore gsave .295 setgray .22527 .36264 moveto .23004 .3674 lineto .22527 .37928 lineto fill grestore gsave .377 setgray .23004 .3674 moveto .22527 .37928 lineto .22527 .43132 lineto .24273 .43132 lineto .2574 .39477 lineto fill grestore gsave 0.001 setlinewidth .23004 .3674 moveto .22527 .37928 lineto stroke grestore gsave .459 setgray .2574 .39477 moveto .24273 .43132 lineto .28107 .43132 lineto .28476 .42213 lineto fill grestore gsave 0.001 setlinewidth .2574 .39477 moveto .24273 .43132 lineto stroke grestore gsave .541 setgray .28476 .42213 moveto .28107 .43132 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .28476 .42213 moveto .28107 .43132 lineto stroke grestore gsave .459 setgray .29396 .36264 moveto .31253 .38121 lineto .33078 .36264 lineto fill grestore gsave .541 setgray .31253 .38121 moveto .33078 .36264 lineto .36264 .36264 lineto .36264 .38666 lineto .34051 .40919 lineto fill grestore gsave 0.001 setlinewidth .31253 .38121 moveto .33078 .36264 lineto stroke grestore gsave .623 setgray .34051 .40919 moveto .36264 .38666 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .34051 .40919 moveto .36264 .38666 lineto stroke grestore gsave .459 setgray .29396 .36264 moveto .31253 .38121 lineto .29396 .40824 lineto fill grestore gsave .541 setgray .31253 .38121 moveto .29396 .40824 lineto .29396 .43132 lineto .3253 .43132 lineto .34051 .40919 lineto fill grestore gsave 0.001 setlinewidth .31253 .38121 moveto .29396 .40824 lineto stroke grestore gsave .623 setgray .34051 .40919 moveto .3253 .43132 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .34051 .40919 moveto .3253 .43132 lineto stroke grestore gsave .541 setgray .36264 .36264 moveto .37499 .37499 lineto .392 .36264 lineto fill grestore gsave .623 setgray .37499 .37499 moveto .392 .36264 lineto .43132 .36264 lineto .43132 .38419 lineto .40402 .40402 lineto fill grestore gsave 0.001 setlinewidth .37499 .37499 moveto .392 .36264 lineto stroke grestore gsave .705 setgray .40402 .40402 moveto .43132 .38419 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .40402 .40402 moveto .43132 .38419 lineto stroke grestore gsave .541 setgray .36264 .36264 moveto .37499 .37499 lineto .36264 .38666 lineto fill grestore gsave .623 setgray .37499 .37499 moveto .36264 .38666 lineto .36264 .43132 lineto .37512 .43132 lineto .40402 .40402 lineto fill grestore gsave 0.001 setlinewidth .37499 .37499 moveto .36264 .38666 lineto stroke grestore gsave .705 setgray .40402 .40402 moveto .37512 .43132 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .40402 .40402 moveto .37512 .43132 lineto stroke grestore gsave .623 setgray .43132 .36264 moveto .44637 .37769 lineto .48672 .36264 lineto fill grestore gsave .705 setgray .44637 .37769 moveto .48672 .36264 lineto .5 .36264 lineto .5 .40572 lineto .48136 .41268 lineto fill grestore gsave 0.001 setlinewidth .44637 .37769 moveto .48672 .36264 lineto stroke grestore gsave .786 setgray .48136 .41268 moveto .5 .40572 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .48136 .41268 moveto .5 .40572 lineto stroke grestore gsave .623 setgray .43132 .36264 moveto .44637 .37769 lineto .43132 .38419 lineto fill grestore gsave .705 setgray .44637 .37769 moveto .43132 .38419 lineto .43132 .43132 lineto .4382 .43132 lineto .48136 .41268 lineto fill grestore gsave 0.001 setlinewidth .44637 .37769 moveto .43132 .38419 lineto stroke grestore gsave .786 setgray .48136 .41268 moveto .4382 .43132 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .48136 .41268 moveto .4382 .43132 lineto stroke grestore gsave .623 setgray .56868 .36264 moveto .56868 .36402 lineto .55416 .36264 lineto fill grestore gsave .705 setgray .56868 .36402 moveto .55416 .36264 lineto .5 .36264 lineto .5496 .41224 lineto .56868 .41406 lineto fill grestore gsave 0.001 setlinewidth .56868 .36402 moveto .55416 .36264 lineto stroke grestore gsave .786 setgray .56868 .41406 moveto .5496 .41224 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .56868 .41406 moveto .5496 .41224 lineto stroke grestore gsave .705 setgray .5 .36264 moveto .5 .40572 lineto .5496 .41224 lineto fill grestore gsave .786 setgray .5 .40572 moveto .5496 .41224 lineto .56868 .43132 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .5 .40572 moveto .5496 .41224 lineto stroke grestore gsave .623 setgray .63736 .40269 moveto .57216 .36611 lineto .56868 .36264 lineto .63736 .36264 lineto fill grestore gsave .705 setgray .63736 .40269 moveto .57216 .36611 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .63736 .40269 moveto .57216 .36611 lineto stroke grestore gsave .623 setgray .56868 .36264 moveto .56868 .36402 lineto .57216 .36611 lineto fill grestore gsave .705 setgray .56868 .36402 moveto .57216 .36611 lineto .63736 .43132 lineto .59737 .43132 lineto .56868 .41406 lineto fill grestore gsave 0.001 setlinewidth .56868 .36402 moveto .57216 .36611 lineto stroke grestore gsave .786 setgray .56868 .41406 moveto .59737 .43132 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .56868 .41406 moveto .59737 .43132 lineto stroke grestore gsave .541 setgray .70604 .36264 moveto .70604 .41343 lineto .65509 .36264 lineto fill grestore gsave .623 setgray .70604 .41343 moveto .65509 .36264 lineto .63736 .36264 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .70604 .41343 moveto .65509 .36264 lineto stroke grestore gsave .623 setgray .63736 .40269 moveto .66607 .43132 lineto .70604 .43132 lineto .63736 .36264 lineto fill grestore gsave .705 setgray .63736 .40269 moveto .66607 .43132 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .63736 .40269 moveto .66607 .43132 lineto stroke grestore gsave .377 setgray .77473 .36264 moveto .7621 .36264 lineto .77473 .38606 lineto fill grestore gsave .459 setgray .7621 .36264 moveto .77473 .38606 lineto .77473 .43132 lineto .72741 .384 lineto .71589 .36264 lineto fill grestore gsave 0.001 setlinewidth .7621 .36264 moveto .77473 .38606 lineto stroke grestore gsave .541 setgray .71589 .36264 moveto .72741 .384 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .71589 .36264 moveto .72741 .384 lineto stroke grestore gsave .459 setgray .77473 .43132 moveto .7562 .43132 lineto .72741 .384 lineto fill grestore gsave .541 setgray .7562 .43132 moveto .72741 .384 lineto .70604 .36264 lineto .70604 .41343 lineto .71693 .43132 lineto fill grestore gsave 0.001 setlinewidth .7562 .43132 moveto .72741 .384 lineto stroke grestore gsave .623 setgray .71693 .43132 moveto .70604 .41343 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .71693 .43132 moveto .70604 .41343 lineto stroke grestore gsave .295 setgray .84341 .36264 moveto .82118 .36264 lineto .84341 .40208 lineto fill grestore gsave .377 setgray .82118 .36264 moveto .84341 .40208 lineto .84341 .43132 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .82118 .36264 moveto .84341 .40208 lineto stroke grestore gsave .377 setgray .80328 .43132 moveto .77473 .38606 lineto .77473 .36264 lineto .84341 .43132 lineto fill grestore gsave .459 setgray .80328 .43132 moveto .77473 .38606 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .80328 .43132 moveto .77473 .38606 lineto stroke grestore gsave .214 setgray .91209 .36264 moveto .89525 .36264 lineto .91209 .39518 lineto fill grestore gsave .295 setgray .89525 .36264 moveto .91209 .39518 lineto .91209 .43132 lineto .84341 .36264 lineto fill grestore gsave 0.001 setlinewidth .89525 .36264 moveto .91209 .39518 lineto stroke grestore gsave .295 setgray .86072 .43132 moveto .84341 .40208 lineto .84341 .36264 lineto .91209 .43132 lineto fill grestore gsave .377 setgray .86072 .43132 moveto .84341 .40208 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .86072 .43132 moveto .84341 .40208 lineto stroke grestore gsave .214 setgray .98077 .36264 moveto .98077 .43132 lineto .91209 .36264 lineto fill grestore gsave .214 setgray .93331 .43132 moveto .91209 .39518 lineto .91209 .36264 lineto .98077 .43132 lineto fill grestore gsave .295 setgray .93331 .43132 moveto .91209 .39518 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .93331 .43132 moveto .91209 .39518 lineto stroke grestore gsave .132 setgray 0.01923 .43132 moveto 0.02476 .43685 lineto 0.02747 .43132 lineto fill grestore gsave .214 setgray 0.02476 .43685 moveto 0.02747 .43132 lineto 0.08791 .43132 lineto 0.08791 .5 lineto fill grestore gsave 0.001 setlinewidth 0.02476 .43685 moveto 0.02747 .43132 lineto stroke grestore gsave .132 setgray 0.01923 .43132 moveto 0.02476 .43685 lineto 0.01923 .45305 lineto fill grestore gsave .214 setgray 0.02476 .43685 moveto 0.01923 .45305 lineto 0.01923 .5 lineto 0.08791 .5 lineto fill grestore gsave 0.001 setlinewidth 0.02476 .43685 moveto 0.01923 .45305 lineto stroke grestore gsave .214 setgray 0.08791 .43132 moveto .11414 .45755 lineto .12589 .43132 lineto fill grestore gsave .295 setgray .11414 .45755 moveto .12589 .43132 lineto .15659 .43132 lineto .15659 .5 lineto fill grestore gsave 0.001 setlinewidth .11414 .45755 moveto .12589 .43132 lineto stroke grestore gsave .214 setgray .11414 .45755 moveto .10109 .5 lineto 0.08791 .5 lineto 0.08791 .43132 lineto fill grestore gsave .295 setgray .11414 .45755 moveto .10109 .5 lineto .15659 .5 lineto fill grestore gsave 0.001 setlinewidth .11414 .45755 moveto .10109 .5 lineto stroke grestore gsave .295 setgray .15659 .43132 moveto .18197 .4567 lineto .19305 .43132 lineto fill grestore gsave .377 setgray .18197 .4567 moveto .19305 .43132 lineto .22527 .43132 lineto .22527 .49299 lineto .22315 .49787 lineto fill grestore gsave 0.001 setlinewidth .18197 .4567 moveto .19305 .43132 lineto stroke grestore gsave .459 setgray .22315 .49787 moveto .22527 .49299 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .22315 .49787 moveto .22527 .49299 lineto stroke grestore gsave .295 setgray .18197 .4567 moveto .16901 .5 lineto .15659 .5 lineto .15659 .43132 lineto fill grestore gsave .377 setgray .18197 .4567 moveto .16901 .5 lineto .22251 .5 lineto .22315 .49787 lineto fill grestore gsave 0.001 setlinewidth .18197 .4567 moveto .16901 .5 lineto stroke grestore gsave .459 setgray .22315 .49787 moveto .22251 .5 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .22315 .49787 moveto .22251 .5 lineto stroke grestore gsave .377 setgray .22527 .43132 moveto .23787 .44391 lineto .24273 .43132 lineto fill grestore gsave .459 setgray .23787 .44391 moveto .24273 .43132 lineto .28107 .43132 lineto .26553 .47157 lineto fill grestore gsave 0.001 setlinewidth .23787 .44391 moveto .24273 .43132 lineto stroke grestore gsave .541 setgray .26553 .47157 moveto .28107 .43132 lineto .29396 .43132 lineto .29396 .49724 lineto .29319 .49923 lineto fill grestore gsave 0.001 setlinewidth .26553 .47157 moveto .28107 .43132 lineto stroke grestore gsave .623 setgray .29319 .49923 moveto .29396 .49724 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .29319 .49923 moveto .29396 .49724 lineto stroke grestore gsave .377 setgray .22527 .43132 moveto .23787 .44391 lineto .22527 .49299 lineto fill grestore gsave .459 setgray .23787 .44391 moveto .22527 .49299 lineto .22527 .5 lineto .25823 .5 lineto .26553 .47157 lineto fill grestore gsave 0.001 setlinewidth .23787 .44391 moveto .22527 .49299 lineto stroke grestore gsave .541 setgray .26553 .47157 moveto .25823 .5 lineto .29299 .5 lineto .29319 .49923 lineto fill grestore gsave 0.001 setlinewidth .26553 .47157 moveto .25823 .5 lineto stroke grestore gsave .623 setgray .29319 .49923 moveto .29299 .5 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .29319 .49923 moveto .29299 .5 lineto stroke grestore gsave .541 setgray .29396 .43132 moveto .31387 .45123 lineto .3253 .43132 lineto fill grestore gsave .623 setgray .31387 .45123 moveto .3253 .43132 lineto .36264 .43132 lineto .36264 .4485 lineto .34386 .48122 lineto fill grestore gsave 0.001 setlinewidth .31387 .45123 moveto .3253 .43132 lineto stroke grestore gsave .705 setgray .34386 .48122 moveto .36264 .4485 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .34386 .48122 moveto .36264 .4485 lineto stroke grestore gsave .541 setgray .29396 .43132 moveto .31387 .45123 lineto .29396 .49724 lineto fill grestore gsave .623 setgray .31387 .45123 moveto .29396 .49724 lineto .29396 .5 lineto .33573 .5 lineto .34386 .48122 lineto fill grestore gsave 0.001 setlinewidth .31387 .45123 moveto .29396 .49724 lineto stroke grestore gsave .705 setgray .34386 .48122 moveto .33573 .5 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .34386 .48122 moveto .33573 .5 lineto stroke grestore gsave .623 setgray .36264 .43132 moveto .3695 .43819 lineto .37512 .43132 lineto fill grestore gsave .705 setgray .3695 .43819 moveto .37512 .43132 lineto .43132 .43132 lineto .43132 .43565 lineto .40237 .47105 lineto fill grestore gsave 0.001 setlinewidth .3695 .43819 moveto .37512 .43132 lineto stroke grestore gsave .786 setgray .40237 .47105 moveto .43132 .43565 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .40237 .47105 moveto .43132 .43565 lineto stroke grestore gsave .623 setgray .36264 .43132 moveto .3695 .43819 lineto .36264 .4485 lineto fill grestore gsave .705 setgray .3695 .43819 moveto .36264 .4485 lineto .36264 .5 lineto .3831 .5 lineto .40237 .47105 lineto fill grestore gsave 0.001 setlinewidth .3695 .43819 moveto .36264 .4485 lineto stroke grestore gsave .786 setgray .40237 .47105 moveto .3831 .5 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .40237 .47105 moveto .3831 .5 lineto stroke grestore gsave .705 setgray .43132 .43132 moveto .43391 .43391 lineto .4382 .43132 lineto fill grestore gsave .786 setgray .43391 .43391 moveto .4382 .43132 lineto .5 .43132 lineto .5 .46397 lineto .47752 .47752 lineto fill grestore gsave 0.001 setlinewidth .43391 .43391 moveto .4382 .43132 lineto stroke grestore gsave .868 setgray .47752 .47752 moveto .5 .46397 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .47752 .47752 moveto .5 .46397 lineto stroke grestore gsave .705 setgray .43132 .43132 moveto .43391 .43391 lineto .43132 .43565 lineto fill grestore gsave .786 setgray .43391 .43391 moveto .43132 .43565 lineto .43132 .5 lineto .44422 .5 lineto .47752 .47752 lineto fill grestore gsave 0.001 setlinewidth .43391 .43391 moveto .43132 .43565 lineto stroke grestore gsave .868 setgray .47752 .47752 moveto .44422 .5 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .47752 .47752 moveto .44422 .5 lineto stroke grestore gsave .786 setgray .56868 .47923 moveto .54272 .47404 lineto .5 .43132 lineto .56868 .43132 lineto fill grestore gsave .868 setgray .56868 .47923 moveto .54272 .47404 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .56868 .47923 moveto .54272 .47404 lineto stroke grestore gsave .786 setgray .5 .43132 moveto .5 .46397 lineto .54272 .47404 lineto fill grestore gsave .868 setgray .5 .46397 moveto .54272 .47404 lineto .56868 .5 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .5 .46397 moveto .54272 .47404 lineto stroke grestore gsave .705 setgray .63736 .43132 moveto .63736 .47065 lineto .59737 .43132 lineto fill grestore gsave .786 setgray .63736 .47065 moveto .59737 .43132 lineto .56868 .43132 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .63736 .47065 moveto .59737 .43132 lineto stroke grestore gsave .786 setgray .56868 .47923 moveto .58976 .5 lineto .63736 .5 lineto .56868 .43132 lineto fill grestore gsave .868 setgray .56868 .47923 moveto .58976 .5 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .56868 .47923 moveto .58976 .5 lineto stroke grestore gsave .623 setgray .66607 .43132 moveto .7036 .49755 lineto .70604 .5 lineto .70604 .43132 lineto fill grestore gsave .705 setgray .66607 .43132 moveto .7036 .49755 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .66607 .43132 moveto .7036 .49755 lineto stroke grestore gsave .623 setgray .70604 .5 moveto .70509 .5 lineto .7036 .49755 lineto fill grestore gsave .705 setgray .70509 .5 moveto .7036 .49755 lineto .63736 .43132 lineto .63736 .47065 lineto .65525 .5 lineto fill grestore gsave 0.001 setlinewidth .70509 .5 moveto .7036 .49755 lineto stroke grestore gsave .786 setgray .65525 .5 moveto .63736 .47065 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .65525 .5 moveto .63736 .47065 lineto stroke grestore gsave .459 setgray .77473 .43132 moveto .7562 .43132 lineto .77473 .49394 lineto fill grestore gsave .541 setgray .7562 .43132 moveto .77473 .49394 lineto .77473 .5 lineto .7215 .44678 lineto .71693 .43132 lineto fill grestore gsave 0.001 setlinewidth .7562 .43132 moveto .77473 .49394 lineto stroke grestore gsave .623 setgray .71693 .43132 moveto .7215 .44678 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .71693 .43132 moveto .7215 .44678 lineto stroke grestore gsave .541 setgray .77473 .5 moveto .74085 .5 lineto .7215 .44678 lineto fill grestore gsave .623 setgray .74085 .5 moveto .7215 .44678 lineto .70604 .43132 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .74085 .5 moveto .7215 .44678 lineto stroke grestore gsave .377 setgray .80328 .43132 moveto .81568 .47228 lineto .84341 .5 lineto .84341 .43132 lineto fill grestore gsave .459 setgray .80328 .43132 moveto .81568 .47228 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .80328 .43132 moveto .81568 .47228 lineto stroke grestore gsave .377 setgray .84341 .5 moveto .82591 .5 lineto .81568 .47228 lineto fill grestore gsave .459 setgray .82591 .5 moveto .81568 .47228 lineto .77473 .43132 lineto .77473 .49394 lineto .77696 .5 lineto fill grestore gsave 0.001 setlinewidth .82591 .5 moveto .81568 .47228 lineto stroke grestore gsave .541 setgray .77696 .5 moveto .77473 .49394 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .77696 .5 moveto .77473 .49394 lineto stroke grestore gsave .295 setgray .86072 .43132 moveto .86728 .4552 lineto .91209 .5 lineto .91209 .43132 lineto fill grestore gsave .377 setgray .86072 .43132 moveto .86728 .4552 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .86072 .43132 moveto .86728 .4552 lineto stroke grestore gsave .295 setgray .91209 .5 moveto .88259 .5 lineto .86728 .4552 lineto fill grestore gsave .377 setgray .88259 .5 moveto .86728 .4552 lineto .84341 .43132 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .88259 .5 moveto .86728 .4552 lineto stroke grestore gsave .214 setgray .93331 .43132 moveto .94121 .46044 lineto .98077 .5 lineto .98077 .43132 lineto fill grestore gsave .295 setgray .93331 .43132 moveto .94121 .46044 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .93331 .43132 moveto .94121 .46044 lineto stroke grestore gsave .214 setgray .98077 .5 moveto .95451 .5 lineto .94121 .46044 lineto fill grestore gsave .295 setgray .95451 .5 moveto .94121 .46044 lineto .91209 .43132 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .95451 .5 moveto .94121 .46044 lineto stroke grestore gsave .214 setgray 0.01923 .5 moveto 0.08791 .5 lineto 0.08791 .56868 lineto fill grestore gsave .214 setgray 0.01923 .5 moveto 0.01923 .56868 lineto 0.08791 .56868 lineto fill grestore gsave .214 setgray 0.08791 .5 moveto 0.09962 .51171 lineto .10109 .5 lineto fill grestore gsave .295 setgray 0.09962 .51171 moveto .10109 .5 lineto .15659 .5 lineto .15659 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.09962 .51171 moveto .10109 .5 lineto stroke grestore gsave .214 setgray 0.09962 .51171 moveto 0.09376 .56868 lineto 0.08791 .56868 lineto 0.08791 .5 lineto fill grestore gsave .295 setgray 0.09962 .51171 moveto 0.09376 .56868 lineto .15659 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.09962 .51171 moveto 0.09376 .56868 lineto stroke grestore gsave .295 setgray .15659 .5 moveto .16779 .5112 lineto .16901 .5 lineto fill grestore gsave .377 setgray .16779 .5112 moveto .16901 .5 lineto .22251 .5 lineto .21604 .55944 lineto fill grestore gsave 0.001 setlinewidth .16779 .5112 moveto .16901 .5 lineto stroke grestore gsave .459 setgray .21604 .55944 moveto .22251 .5 lineto .22527 .5 lineto .22527 .56868 lineto fill grestore gsave 0.001 setlinewidth .21604 .55944 moveto .22251 .5 lineto stroke grestore gsave .295 setgray .16779 .5112 moveto .16251 .56868 lineto .15659 .56868 lineto .15659 .5 lineto fill grestore gsave .377 setgray .16779 .5112 moveto .16251 .56868 lineto .21519 .56868 lineto .21604 .55944 lineto fill grestore gsave 0.001 setlinewidth .16779 .5112 moveto .16251 .56868 lineto stroke grestore gsave .459 setgray .21604 .55944 moveto .21519 .56868 lineto .22527 .56868 lineto fill grestore gsave 0.001 setlinewidth .21604 .55944 moveto .21519 .56868 lineto stroke grestore gsave .459 setgray .22527 .5 moveto .25571 .53044 lineto .25823 .5 lineto fill grestore gsave .541 setgray .25571 .53044 moveto .25823 .5 lineto .29299 .5 lineto .28781 .56254 lineto fill grestore gsave 0.001 setlinewidth .25571 .53044 moveto .25823 .5 lineto stroke grestore gsave .623 setgray .28781 .56254 moveto .29299 .5 lineto .29396 .5 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .28781 .56254 moveto .29299 .5 lineto stroke grestore gsave .459 setgray .25571 .53044 moveto .25304 .56868 lineto .22527 .56868 lineto .22527 .5 lineto fill grestore gsave .541 setgray .25571 .53044 moveto .25304 .56868 lineto .28738 .56868 lineto .28781 .56254 lineto fill grestore gsave 0.001 setlinewidth .25571 .53044 moveto .25304 .56868 lineto stroke grestore gsave .623 setgray .28781 .56254 moveto .28738 .56868 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .28781 .56254 moveto .28738 .56868 lineto stroke grestore gsave .623 setgray .29396 .5 moveto .33143 .53747 lineto .33573 .5 lineto fill grestore gsave .705 setgray .33143 .53747 moveto .33573 .5 lineto .36264 .5 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .33143 .53747 moveto .33573 .5 lineto stroke grestore gsave .623 setgray .33143 .53747 moveto .32827 .56868 lineto .29396 .56868 lineto .29396 .5 lineto fill grestore gsave .705 setgray .33143 .53747 moveto .32827 .56868 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .33143 .53747 moveto .32827 .56868 lineto stroke grestore gsave .705 setgray .36264 .5 moveto .38022 .51758 lineto .3831 .5 lineto fill grestore gsave .786 setgray .38022 .51758 moveto .3831 .5 lineto .43132 .5 lineto .43132 .53984 lineto .42726 .56462 lineto fill grestore gsave 0.001 setlinewidth .38022 .51758 moveto .3831 .5 lineto stroke grestore gsave .868 setgray .42726 .56462 moveto .43132 .53984 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .42726 .56462 moveto .43132 .53984 lineto stroke grestore gsave .705 setgray .38022 .51758 moveto .37287 .56868 lineto .36264 .56868 lineto .36264 .5 lineto fill grestore gsave .786 setgray .38022 .51758 moveto .37287 .56868 lineto .42667 .56868 lineto .42726 .56462 lineto fill grestore gsave 0.001 setlinewidth .38022 .51758 moveto .37287 .56868 lineto stroke grestore gsave .868 setgray .42726 .56462 moveto .42667 .56868 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .42726 .56462 moveto .42667 .56868 lineto stroke grestore gsave .786 setgray .43132 .5 moveto .44087 .50955 lineto .44422 .5 lineto fill grestore gsave .868 setgray .44087 .50955 moveto .44422 .5 lineto .5 .5 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .44087 .50955 moveto .44422 .5 lineto stroke grestore gsave .786 setgray .43132 .5 moveto .44087 .50955 lineto .43132 .53984 lineto fill grestore gsave .868 setgray .44087 .50955 moveto .43132 .53984 lineto .43132 .56868 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .44087 .50955 moveto .43132 .53984 lineto stroke grestore gsave .868 setgray .56868 .5 moveto .56868 .56868 lineto .5 .5 lineto fill grestore gsave .868 setgray .56868 .56868 moveto .5 .5 lineto .5 .56868 lineto fill grestore gsave .786 setgray .58976 .5 moveto .59468 .526 lineto .63736 .56868 lineto .63736 .5 lineto fill grestore gsave .868 setgray .58976 .5 moveto .59468 .526 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .58976 .5 moveto .59468 .526 lineto stroke grestore gsave .786 setgray .63736 .56868 moveto .60415 .56868 lineto .59468 .526 lineto fill grestore gsave .868 setgray .60415 .56868 moveto .59468 .526 lineto .56868 .5 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .60415 .56868 moveto .59468 .526 lineto stroke grestore gsave .623 setgray .70604 .5 moveto .70509 .5 lineto .70604 .5106 lineto fill grestore gsave .705 setgray .70509 .5 moveto .70604 .5106 lineto .70604 .56868 lineto .65702 .51966 lineto .65525 .5 lineto fill grestore gsave 0.001 setlinewidth .70509 .5 moveto .70604 .5106 lineto stroke grestore gsave .786 setgray .65525 .5 moveto .65702 .51966 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .65525 .5 moveto .65702 .51966 lineto stroke grestore gsave .705 setgray .70604 .56868 moveto .66303 .56868 lineto .65702 .51966 lineto fill grestore gsave .786 setgray .66303 .56868 moveto .65702 .51966 lineto .63736 .5 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .66303 .56868 moveto .65702 .51966 lineto stroke grestore gsave .541 setgray .74085 .5 moveto .74216 .53612 lineto .77473 .56868 lineto .77473 .5 lineto fill grestore gsave .623 setgray .74085 .5 moveto .74216 .53612 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .74085 .5 moveto .74216 .53612 lineto stroke grestore gsave .541 setgray .77473 .56868 moveto .7442 .56868 lineto .74216 .53612 lineto fill grestore gsave .623 setgray .7442 .56868 moveto .74216 .53612 lineto .70604 .5 lineto .70604 .5106 lineto .70967 .56868 lineto fill grestore gsave 0.001 setlinewidth .7442 .56868 moveto .74216 .53612 lineto stroke grestore gsave .705 setgray .70967 .56868 moveto .70604 .5106 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70967 .56868 moveto .70604 .5106 lineto stroke grestore gsave .377 setgray .82591 .5 moveto .82752 .5528 lineto .84341 .56868 lineto .84341 .5 lineto fill grestore gsave .459 setgray .82591 .5 moveto .82752 .5528 lineto .77703 .5023 lineto .77696 .5 lineto fill grestore gsave 0.001 setlinewidth .82591 .5 moveto .82752 .5528 lineto stroke grestore gsave .541 setgray .77696 .5 moveto .77703 .5023 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .77696 .5 moveto .77703 .5023 lineto stroke grestore gsave .377 setgray .84341 .56868 moveto .8283 .56868 lineto .82752 .5528 lineto fill grestore gsave .459 setgray .8283 .56868 moveto .82752 .5528 lineto .77703 .5023 lineto .78029 .56868 lineto fill grestore gsave 0.001 setlinewidth .8283 .56868 moveto .82752 .5528 lineto stroke grestore gsave .541 setgray .78029 .56868 moveto .77703 .5023 lineto .77473 .5 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .78029 .56868 moveto .77703 .5023 lineto stroke grestore gsave .295 setgray .88259 .5 moveto .88358 .54017 lineto .91209 .56868 lineto .91209 .5 lineto fill grestore gsave .377 setgray .88259 .5 moveto .88358 .54017 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .88259 .5 moveto .88358 .54017 lineto stroke grestore gsave .295 setgray .91209 .56868 moveto .88465 .56868 lineto .88358 .54017 lineto fill grestore gsave .377 setgray .88465 .56868 moveto .88358 .54017 lineto .84341 .5 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .88465 .56868 moveto .88358 .54017 lineto stroke grestore gsave .214 setgray .95451 .5 moveto .95553 .54344 lineto .98077 .56868 lineto .98077 .5 lineto fill grestore gsave .295 setgray .95451 .5 moveto .95553 .54344 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .95451 .5 moveto .95553 .54344 lineto stroke grestore gsave .214 setgray .98077 .56868 moveto .95635 .56868 lineto .95553 .54344 lineto fill grestore gsave .295 setgray .95635 .56868 moveto .95553 .54344 lineto .91209 .5 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .95635 .56868 moveto .95553 .54344 lineto stroke grestore gsave .214 setgray 0.01923 .56868 moveto 0.08791 .63736 lineto 0.08791 .56868 lineto fill grestore gsave .214 setgray 0.01923 .63736 moveto 0.01923 .56868 lineto 0.08791 .63736 lineto fill grestore gsave .214 setgray 0.08791 .56868 moveto 0.09376 .56868 lineto 0.09555 .57632 lineto fill grestore gsave .295 setgray 0.09376 .56868 moveto 0.09555 .57632 lineto .15659 .63736 lineto .15659 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.09376 .56868 moveto 0.09555 .57632 lineto stroke grestore gsave .214 setgray .10634 .63736 moveto 0.09555 .57632 lineto 0.08791 .56868 lineto 0.08791 .63736 lineto fill grestore gsave .295 setgray .10634 .63736 moveto 0.09555 .57632 lineto .15659 .63736 lineto fill grestore gsave 0.001 setlinewidth .10634 .63736 moveto 0.09555 .57632 lineto stroke grestore gsave .295 setgray .15659 .56868 moveto .16251 .56868 lineto .16447 .57656 lineto fill grestore gsave .377 setgray .16251 .56868 moveto .16447 .57656 lineto .22527 .63736 lineto .22527 .60917 lineto .21519 .56868 lineto fill grestore gsave 0.001 setlinewidth .16251 .56868 moveto .16447 .57656 lineto stroke grestore gsave .459 setgray .21519 .56868 moveto .22527 .60917 lineto .22527 .56868 lineto fill grestore gsave 0.001 setlinewidth .21519 .56868 moveto .22527 .60917 lineto stroke grestore gsave .295 setgray .17592 .63736 moveto .16447 .57656 lineto .15659 .56868 lineto .15659 .63736 lineto fill grestore gsave .377 setgray .17592 .63736 moveto .16447 .57656 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .17592 .63736 moveto .16447 .57656 lineto stroke grestore gsave .459 setgray .22527 .56868 moveto .25304 .56868 lineto .26178 .60518 lineto fill grestore gsave .541 setgray .25304 .56868 moveto .26178 .60518 lineto .29396 .63736 lineto .29396 .59615 lineto .28738 .56868 lineto fill grestore gsave 0.001 setlinewidth .25304 .56868 moveto .26178 .60518 lineto stroke grestore gsave .623 setgray .28738 .56868 moveto .29396 .59615 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .28738 .56868 moveto .29396 .59615 lineto stroke grestore gsave .377 setgray .22527 .63736 moveto .23024 .63736 lineto .22527 .60917 lineto fill grestore gsave .459 setgray .23024 .63736 moveto .22527 .60917 lineto .22527 .56868 lineto .26178 .60518 lineto .26744 .63736 lineto fill grestore gsave 0.001 setlinewidth .23024 .63736 moveto .22527 .60917 lineto stroke grestore gsave .541 setgray .26744 .63736 moveto .26178 .60518 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .26744 .63736 moveto .26178 .60518 lineto stroke grestore gsave .623 setgray .29396 .56868 moveto .32827 .56868 lineto .34828 .62301 lineto fill grestore gsave .705 setgray .32827 .56868 moveto .34828 .62301 lineto .36264 .63736 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .32827 .56868 moveto .34828 .62301 lineto stroke grestore gsave .541 setgray .29396 .63736 moveto .3071 .63736 lineto .29396 .59615 lineto fill grestore gsave .623 setgray .3071 .63736 moveto .29396 .59615 lineto .29396 .56868 lineto .34828 .62301 lineto .35286 .63736 lineto fill grestore gsave 0.001 setlinewidth .3071 .63736 moveto .29396 .59615 lineto stroke grestore gsave .705 setgray .35286 .63736 moveto .34828 .62301 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .35286 .63736 moveto .34828 .62301 lineto stroke grestore gsave .705 setgray .36264 .56868 moveto .37287 .56868 lineto .38439 .59044 lineto fill grestore gsave .786 setgray .37287 .56868 moveto .38439 .59044 lineto .43132 .63736 lineto .43132 .57745 lineto .42667 .56868 lineto fill grestore gsave 0.001 setlinewidth .37287 .56868 moveto .38439 .59044 lineto stroke grestore gsave .868 setgray .42667 .56868 moveto .43132 .57745 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .42667 .56868 moveto .43132 .57745 lineto stroke grestore gsave .705 setgray .40778 .63736 moveto .38439 .59044 lineto .36264 .56868 lineto .36264 .63736 lineto fill grestore gsave .786 setgray .40778 .63736 moveto .38439 .59044 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .40778 .63736 moveto .38439 .59044 lineto stroke grestore gsave .868 setgray .5 .63736 moveto .43132 .56868 lineto .5 .56868 lineto fill grestore gsave .786 setgray .43132 .63736 moveto .43132 .57745 lineto .49631 .63736 lineto fill grestore gsave .868 setgray .43132 .57745 moveto .49631 .63736 lineto .5 .63736 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .43132 .57745 moveto .49631 .63736 lineto stroke grestore gsave .786 setgray .56868 .63736 moveto .55515 .62383 lineto .56868 .61903 lineto fill grestore gsave .868 setgray .55515 .62383 moveto .56868 .61903 lineto .56868 .56868 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .55515 .62383 moveto .56868 .61903 lineto stroke grestore gsave .786 setgray .56868 .63736 moveto .55515 .62383 lineto .51073 .63736 lineto fill grestore gsave .868 setgray .55515 .62383 moveto .51073 .63736 lineto .5 .63736 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .55515 .62383 moveto .51073 .63736 lineto stroke grestore gsave .705 setgray .63736 .63736 moveto .63347 .63347 lineto .63736 .62747 lineto fill grestore gsave .786 setgray .63347 .63347 moveto .63736 .62747 lineto .63736 .56868 lineto .60415 .56868 lineto .59021 .59021 lineto fill grestore gsave 0.001 setlinewidth .63347 .63347 moveto .63736 .62747 lineto stroke grestore gsave .868 setgray .59021 .59021 moveto .60415 .56868 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .59021 .59021 moveto .60415 .56868 lineto stroke grestore gsave .705 setgray .63736 .63736 moveto .63347 .63347 lineto .63057 .63736 lineto fill grestore gsave .786 setgray .63347 .63347 moveto .63057 .63736 lineto .56868 .63736 lineto .56868 .61903 lineto .59021 .59021 lineto fill grestore gsave 0.001 setlinewidth .63347 .63347 moveto .63057 .63736 lineto stroke grestore gsave .868 setgray .59021 .59021 moveto .56868 .61903 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .59021 .59021 moveto .56868 .61903 lineto stroke grestore gsave .623 setgray .70604 .63736 moveto .69079 .6221 lineto .70604 .58197 lineto fill grestore gsave .705 setgray .69079 .6221 moveto .70604 .58197 lineto .70604 .56868 lineto .66303 .56868 lineto .65596 .58728 lineto fill grestore gsave 0.001 setlinewidth .69079 .6221 moveto .70604 .58197 lineto stroke grestore gsave .786 setgray .65596 .58728 moveto .66303 .56868 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .65596 .58728 moveto .66303 .56868 lineto stroke grestore gsave .623 setgray .70604 .63736 moveto .69079 .6221 lineto .68373 .63736 lineto fill grestore gsave .705 setgray .69079 .6221 moveto .68373 .63736 lineto .63736 .63736 lineto .63736 .62747 lineto .65596 .58728 lineto fill grestore gsave 0.001 setlinewidth .69079 .6221 moveto .68373 .63736 lineto stroke grestore gsave .786 setgray .65596 .58728 moveto .63736 .62747 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .65596 .58728 moveto .63736 .62747 lineto stroke grestore gsave .459 setgray .77473 .63736 moveto .7661 .62873 lineto .77473 .5877 lineto fill grestore gsave .541 setgray .7661 .62873 moveto .77473 .5877 lineto .77473 .56868 lineto .7442 .56868 lineto .73757 .60021 lineto fill grestore gsave 0.001 setlinewidth .7661 .62873 moveto .77473 .5877 lineto stroke grestore gsave .623 setgray .73757 .60021 moveto .7442 .56868 lineto .70967 .56868 lineto .70904 .57168 lineto fill grestore gsave 0.001 setlinewidth .73757 .60021 moveto .7442 .56868 lineto stroke grestore gsave .705 setgray .70904 .57168 moveto .70967 .56868 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70904 .57168 moveto .70967 .56868 lineto stroke grestore gsave .459 setgray .77473 .63736 moveto .7661 .62873 lineto .76358 .63736 lineto fill grestore gsave .541 setgray .7661 .62873 moveto .76358 .63736 lineto .72674 .63736 lineto .73757 .60021 lineto fill grestore gsave 0.001 setlinewidth .7661 .62873 moveto .76358 .63736 lineto stroke grestore gsave .623 setgray .73757 .60021 moveto .72674 .63736 lineto .70604 .63736 lineto .70604 .58197 lineto .70904 .57168 lineto fill grestore gsave 0.001 setlinewidth .73757 .60021 moveto .72674 .63736 lineto stroke grestore gsave .705 setgray .70904 .57168 moveto .70604 .58197 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70904 .57168 moveto .70604 .58197 lineto stroke grestore gsave .377 setgray .81852 .61248 moveto .8283 .56868 lineto .84341 .56868 lineto .84341 .63736 lineto fill grestore gsave .459 setgray .81852 .61248 moveto .8283 .56868 lineto .78029 .56868 lineto .77927 .57323 lineto fill grestore gsave 0.001 setlinewidth .81852 .61248 moveto .8283 .56868 lineto stroke grestore gsave .541 setgray .77927 .57323 moveto .78029 .56868 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .77927 .57323 moveto .78029 .56868 lineto stroke grestore gsave .377 setgray .84341 .63736 moveto .81852 .61248 lineto .8107 .63736 lineto fill grestore gsave .459 setgray .81852 .61248 moveto .8107 .63736 lineto .77473 .63736 lineto .77473 .5877 lineto .77927 .57323 lineto fill grestore gsave 0.001 setlinewidth .81852 .61248 moveto .8107 .63736 lineto stroke grestore gsave .541 setgray .77927 .57323 moveto .77473 .5877 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .77927 .57323 moveto .77473 .5877 lineto stroke grestore gsave .295 setgray .87756 .60283 moveto .88465 .56868 lineto .91209 .56868 lineto .91209 .63736 lineto fill grestore gsave .377 setgray .87756 .60283 moveto .88465 .56868 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .87756 .60283 moveto .88465 .56868 lineto stroke grestore gsave .295 setgray .91209 .63736 moveto .87756 .60283 lineto .86714 .63736 lineto fill grestore gsave .377 setgray .87756 .60283 moveto .86714 .63736 lineto .84341 .63736 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .87756 .60283 moveto .86714 .63736 lineto stroke grestore gsave .214 setgray .94875 .60534 moveto .95635 .56868 lineto .98077 .56868 lineto .98077 .63736 lineto fill grestore gsave .295 setgray .94875 .60534 moveto .95635 .56868 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .94875 .60534 moveto .95635 .56868 lineto stroke grestore gsave .214 setgray .98077 .63736 moveto .94875 .60534 lineto .93905 .63736 lineto fill grestore gsave .295 setgray .94875 .60534 moveto .93905 .63736 lineto .91209 .63736 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .94875 .60534 moveto .93905 .63736 lineto stroke grestore gsave .214 setgray 0.01923 .63736 moveto 0.08791 .70604 lineto 0.08791 .63736 lineto fill grestore gsave .132 setgray 0.01923 .70604 moveto 0.03403 .70604 lineto 0.01923 .67172 lineto fill grestore gsave .214 setgray 0.03403 .70604 moveto 0.01923 .67172 lineto 0.01923 .63736 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth 0.03403 .70604 moveto 0.01923 .67172 lineto stroke grestore gsave .214 setgray 0.08791 .63736 moveto .10634 .63736 lineto .1244 .67385 lineto fill grestore gsave .295 setgray .10634 .63736 moveto .1244 .67385 lineto .15659 .70604 lineto .15659 .63736 lineto fill grestore gsave 0.001 setlinewidth .10634 .63736 moveto .1244 .67385 lineto stroke grestore gsave .214 setgray .13774 .70604 moveto .1244 .67385 lineto 0.08791 .63736 lineto 0.08791 .70604 lineto fill grestore gsave .295 setgray .13774 .70604 moveto .1244 .67385 lineto .15659 .70604 lineto fill grestore gsave 0.001 setlinewidth .13774 .70604 moveto .1244 .67385 lineto stroke grestore gsave .295 setgray .15659 .63736 moveto .17592 .63736 lineto .19629 .67706 lineto fill grestore gsave .377 setgray .17592 .63736 moveto .19629 .67706 lineto .22527 .70604 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .17592 .63736 moveto .19629 .67706 lineto stroke grestore gsave .295 setgray .20881 .70604 moveto .19629 .67706 lineto .15659 .63736 lineto .15659 .70604 lineto fill grestore gsave .377 setgray .20881 .70604 moveto .19629 .67706 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .20881 .70604 moveto .19629 .67706 lineto stroke grestore gsave .377 setgray .22527 .63736 moveto .23024 .63736 lineto .23478 .64687 lineto fill grestore gsave .459 setgray .23024 .63736 moveto .23478 .64687 lineto .29396 .70604 lineto .29396 .69283 lineto .26744 .63736 lineto fill grestore gsave 0.001 setlinewidth .23024 .63736 moveto .23478 .64687 lineto stroke grestore gsave .541 setgray .26744 .63736 moveto .29396 .69283 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .26744 .63736 moveto .29396 .69283 lineto stroke grestore gsave .377 setgray .25792 .70604 moveto .23478 .64687 lineto .22527 .63736 lineto .22527 .70604 lineto fill grestore gsave .459 setgray .25792 .70604 moveto .23478 .64687 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .25792 .70604 moveto .23478 .64687 lineto stroke grestore gsave .541 setgray .29396 .63736 moveto .3071 .63736 lineto .34153 .68494 lineto fill grestore gsave .623 setgray .3071 .63736 moveto .34153 .68494 lineto .36264 .70604 lineto .36264 .65087 lineto .35286 .63736 lineto fill grestore gsave 0.001 setlinewidth .3071 .63736 moveto .34153 .68494 lineto stroke grestore gsave .705 setgray .35286 .63736 moveto .36264 .65087 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .35286 .63736 moveto .36264 .65087 lineto stroke grestore gsave .459 setgray .29396 .70604 moveto .30295 .70604 lineto .29396 .69283 lineto fill grestore gsave .541 setgray .30295 .70604 moveto .29396 .69283 lineto .29396 .63736 lineto .34153 .68494 lineto .35589 .70604 lineto fill grestore gsave 0.001 setlinewidth .30295 .70604 moveto .29396 .69283 lineto stroke grestore gsave .623 setgray .35589 .70604 moveto .34153 .68494 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .35589 .70604 moveto .34153 .68494 lineto stroke grestore gsave .705 setgray .43132 .66019 moveto .40778 .63736 lineto .36264 .63736 lineto .43132 .70604 lineto fill grestore gsave .786 setgray .43132 .66019 moveto .40778 .63736 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .43132 .66019 moveto .40778 .63736 lineto stroke grestore gsave .623 setgray .36264 .70604 moveto .36264 .65087 lineto .41977 .70604 lineto fill grestore gsave .705 setgray .36264 .65087 moveto .41977 .70604 lineto .43132 .70604 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .36264 .65087 moveto .41977 .70604 lineto stroke grestore gsave .705 setgray .5 .70604 moveto .5 .69204 lineto .47306 .6791 lineto fill grestore gsave .786 setgray .5 .69204 moveto .47306 .6791 lineto .43132 .63736 lineto .49631 .63736 lineto .5 .63914 lineto fill grestore gsave 0.001 setlinewidth .5 .69204 moveto .47306 .6791 lineto stroke grestore gsave .868 setgray .5 .63914 moveto .49631 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .5 .63914 moveto .49631 .63736 lineto stroke grestore gsave .705 setgray .43132 .66019 moveto .47306 .6791 lineto .5 .70604 lineto .43132 .70604 lineto fill grestore gsave .786 setgray .43132 .66019 moveto .47306 .6791 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .43132 .66019 moveto .47306 .6791 lineto stroke grestore gsave .705 setgray .56868 .70604 moveto .54819 .68555 lineto .56868 .68206 lineto fill grestore gsave .786 setgray .54819 .68555 moveto .56868 .68206 lineto .56868 .63736 lineto .51073 .63736 lineto .50156 .63893 lineto fill grestore gsave 0.001 setlinewidth .54819 .68555 moveto .56868 .68206 lineto stroke grestore gsave .868 setgray .50156 .63893 moveto .51073 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .50156 .63893 moveto .51073 .63736 lineto stroke grestore gsave .705 setgray .54819 .68555 moveto .5 .69204 lineto .5 .70604 lineto .56868 .70604 lineto fill grestore gsave .786 setgray .54819 .68555 moveto .5 .69204 lineto .5 .63914 lineto .50156 .63893 lineto fill grestore gsave 0.001 setlinewidth .54819 .68555 moveto .5 .69204 lineto stroke grestore gsave .868 setgray .50156 .63893 moveto .5 .63914 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .50156 .63893 moveto .5 .63914 lineto stroke grestore gsave .623 setgray .63736 .70604 moveto .62957 .69825 lineto .63736 .69205 lineto fill grestore gsave .705 setgray .62957 .69825 moveto .63736 .69205 lineto .63736 .63736 lineto .63057 .63736 lineto .59609 .66477 lineto fill grestore gsave 0.001 setlinewidth .62957 .69825 moveto .63736 .69205 lineto stroke grestore gsave .786 setgray .59609 .66477 moveto .63057 .63736 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .59609 .66477 moveto .63057 .63736 lineto stroke grestore gsave .623 setgray .63736 .70604 moveto .62957 .69825 lineto .6172 .70604 lineto fill grestore gsave .705 setgray .62957 .69825 moveto .6172 .70604 lineto .56868 .70604 lineto .56868 .68206 lineto .59609 .66477 lineto fill grestore gsave 0.001 setlinewidth .62957 .69825 moveto .6172 .70604 lineto stroke grestore gsave .786 setgray .59609 .66477 moveto .56868 .68206 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .59609 .66477 moveto .56868 .68206 lineto stroke grestore gsave .541 setgray .70604 .70604 moveto .69388 .69388 lineto .70604 .67703 lineto fill grestore gsave .623 setgray .69388 .69388 moveto .70604 .67703 lineto .70604 .63736 lineto .68373 .63736 lineto .66429 .66429 lineto fill grestore gsave 0.001 setlinewidth .69388 .69388 moveto .70604 .67703 lineto stroke grestore gsave .705 setgray .66429 .66429 moveto .68373 .63736 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .66429 .66429 moveto .68373 .63736 lineto stroke grestore gsave .541 setgray .70604 .70604 moveto .69388 .69388 lineto .68209 .70604 lineto fill grestore gsave .623 setgray .69388 .69388 moveto .68209 .70604 lineto .63736 .70604 lineto .63736 .69205 lineto .66429 .66429 lineto fill grestore gsave 0.001 setlinewidth .69388 .69388 moveto .68209 .70604 lineto stroke grestore gsave .705 setgray .66429 .66429 moveto .63736 .69205 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .66429 .66429 moveto .63736 .69205 lineto stroke grestore gsave .377 setgray .77473 .70604 moveto .77389 .70521 lineto .77473 .70308 lineto fill grestore gsave .459 setgray .77389 .70521 moveto .77473 .70308 lineto .77473 .63736 lineto .76358 .63736 lineto .74741 .67873 lineto fill grestore gsave 0.001 setlinewidth .77389 .70521 moveto .77473 .70308 lineto stroke grestore gsave .541 setgray .74741 .67873 moveto .76358 .63736 lineto .72674 .63736 lineto .72093 .65224 lineto fill grestore gsave 0.001 setlinewidth .74741 .67873 moveto .76358 .63736 lineto stroke grestore gsave .623 setgray .72093 .65224 moveto .72674 .63736 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .72093 .65224 moveto .72674 .63736 lineto stroke grestore gsave .377 setgray .77473 .70604 moveto .77389 .70521 lineto .77339 .70604 lineto fill grestore gsave .459 setgray .77389 .70521 moveto .77339 .70604 lineto .73101 .70604 lineto .74741 .67873 lineto fill grestore gsave 0.001 setlinewidth .77389 .70521 moveto .77339 .70604 lineto stroke grestore gsave .541 setgray .74741 .67873 moveto .73101 .70604 lineto .70604 .70604 lineto .70604 .67703 lineto .72093 .65224 lineto fill grestore gsave 0.001 setlinewidth .74741 .67873 moveto .73101 .70604 lineto stroke grestore gsave .623 setgray .72093 .65224 moveto .70604 .67703 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .72093 .65224 moveto .70604 .67703 lineto stroke grestore gsave .295 setgray .84341 .70604 moveto .83669 .69933 lineto .84341 .68307 lineto fill grestore gsave .377 setgray .83669 .69933 moveto .84341 .68307 lineto .84341 .63736 lineto .8107 .63736 lineto .80019 .66283 lineto fill grestore gsave 0.001 setlinewidth .83669 .69933 moveto .84341 .68307 lineto stroke grestore gsave .459 setgray .80019 .66283 moveto .8107 .63736 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .80019 .66283 moveto .8107 .63736 lineto stroke grestore gsave .295 setgray .84341 .70604 moveto .83669 .69933 lineto .83244 .70604 lineto fill grestore gsave .377 setgray .83669 .69933 moveto .83244 .70604 lineto .77473 .70604 lineto .77473 .70308 lineto .80019 .66283 lineto fill grestore gsave 0.001 setlinewidth .83669 .69933 moveto .83244 .70604 lineto stroke grestore gsave .459 setgray .80019 .66283 moveto .77473 .70308 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .80019 .66283 moveto .77473 .70308 lineto stroke grestore gsave .214 setgray .91209 .70604 moveto .90744 .7014 lineto .91209 .68929 lineto fill grestore gsave .295 setgray .90744 .7014 moveto .91209 .68929 lineto .91209 .63736 lineto .86714 .63736 lineto .86056 .65452 lineto fill grestore gsave 0.001 setlinewidth .90744 .7014 moveto .91209 .68929 lineto stroke grestore gsave .377 setgray .86056 .65452 moveto .86714 .63736 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .86056 .65452 moveto .86714 .63736 lineto stroke grestore gsave .214 setgray .91209 .70604 moveto .90744 .7014 lineto .90465 .70604 lineto fill grestore gsave .295 setgray .90744 .7014 moveto .90465 .70604 lineto .84341 .70604 lineto .84341 .68307 lineto .86056 .65452 lineto fill grestore gsave 0.001 setlinewidth .90744 .7014 moveto .90465 .70604 lineto stroke grestore gsave .377 setgray .86056 .65452 moveto .84341 .68307 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .86056 .65452 moveto .84341 .68307 lineto stroke grestore gsave .214 setgray .93157 .65685 moveto .93905 .63736 lineto .98077 .63736 lineto .98077 .70604 lineto fill grestore gsave .295 setgray .93157 .65685 moveto .93905 .63736 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .93157 .65685 moveto .93905 .63736 lineto stroke grestore gsave .214 setgray .93157 .65685 moveto .91209 .68929 lineto .91209 .70604 lineto .98077 .70604 lineto fill grestore gsave .295 setgray .93157 .65685 moveto .91209 .68929 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .93157 .65685 moveto .91209 .68929 lineto stroke grestore gsave .132 setgray 0.03403 .70604 moveto 0.08791 .7662 lineto 0.08791 .77473 lineto 0.01923 .70604 lineto fill grestore gsave .214 setgray 0.03403 .70604 moveto 0.08791 .7662 lineto 0.08791 .70604 lineto fill grestore gsave 0.001 setlinewidth 0.03403 .70604 moveto 0.08791 .7662 lineto stroke grestore gsave .132 setgray 0.01923 .77473 moveto 0.01923 .70604 lineto 0.08791 .77473 lineto fill grestore gsave .214 setgray .13774 .70604 moveto .15659 .72756 lineto .15659 .77473 lineto 0.08791 .70604 lineto fill grestore gsave .295 setgray .13774 .70604 moveto .15659 .72756 lineto .15659 .70604 lineto fill grestore gsave 0.001 setlinewidth .13774 .70604 moveto .15659 .72756 lineto stroke grestore gsave .132 setgray 0.08791 .77473 moveto 0.09505 .77473 lineto 0.08791 .7662 lineto fill grestore gsave .214 setgray 0.09505 .77473 moveto 0.08791 .7662 lineto 0.08791 .70604 lineto .15659 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.09505 .77473 moveto 0.08791 .7662 lineto stroke grestore gsave .295 setgray .20881 .70604 moveto .22527 .72426 lineto .22527 .77473 lineto .15659 .70604 lineto fill grestore gsave .377 setgray .20881 .70604 moveto .22527 .72426 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .20881 .70604 moveto .22527 .72426 lineto stroke grestore gsave .214 setgray .15659 .77473 moveto .19775 .77473 lineto .15659 .72756 lineto fill grestore gsave .295 setgray .19775 .77473 moveto .15659 .72756 lineto .15659 .70604 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .19775 .77473 moveto .15659 .72756 lineto stroke grestore gsave .377 setgray .25792 .70604 moveto .29396 .74925 lineto .29396 .77473 lineto .22527 .70604 lineto fill grestore gsave .459 setgray .25792 .70604 moveto .29396 .74925 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .25792 .70604 moveto .29396 .74925 lineto stroke grestore gsave .295 setgray .22527 .77473 moveto .26466 .77473 lineto .22527 .72426 lineto fill grestore gsave .377 setgray .26466 .77473 moveto .22527 .72426 lineto .22527 .70604 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .26466 .77473 moveto .22527 .72426 lineto stroke grestore gsave .459 setgray .36264 .75375 moveto .30295 .70604 lineto .29396 .70604 lineto .36264 .77473 lineto fill grestore gsave .541 setgray .36264 .75375 moveto .30295 .70604 lineto .35589 .70604 lineto .36264 .71144 lineto fill grestore gsave 0.001 setlinewidth .36264 .75375 moveto .30295 .70604 lineto stroke grestore gsave .623 setgray .36264 .71144 moveto .35589 .70604 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .36264 .71144 moveto .35589 .70604 lineto stroke grestore gsave .377 setgray .29396 .77473 moveto .29396 .74925 lineto .32778 .77473 lineto fill grestore gsave .459 setgray .29396 .74925 moveto .32778 .77473 lineto .36264 .77473 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .29396 .74925 moveto .32778 .77473 lineto stroke grestore gsave .541 setgray .43132 .77473 moveto .43132 .74964 lineto .37352 .71693 lineto fill grestore gsave .623 setgray .43132 .74964 moveto .37352 .71693 lineto .36264 .70604 lineto .41977 .70604 lineto .43132 .71258 lineto fill grestore gsave 0.001 setlinewidth .43132 .74964 moveto .37352 .71693 lineto stroke grestore gsave .705 setgray .43132 .71258 moveto .41977 .70604 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .43132 .71258 moveto .41977 .70604 lineto stroke grestore gsave .459 setgray .36264 .77473 moveto .36264 .75375 lineto .40421 .77473 lineto fill grestore gsave .541 setgray .36264 .75375 moveto .40421 .77473 lineto .43132 .77473 lineto .37352 .71693 lineto .36264 .71144 lineto fill grestore gsave 0.001 setlinewidth .36264 .75375 moveto .40421 .77473 lineto stroke grestore gsave .623 setgray .36264 .71144 moveto .37352 .71693 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .36264 .71144 moveto .37352 .71693 lineto stroke grestore gsave .541 setgray .5 .77473 moveto .5 .76672 lineto .48881 .76354 lineto fill grestore gsave .623 setgray .5 .76672 moveto .48881 .76354 lineto .43994 .71466 lineto .5 .73176 lineto fill grestore gsave 0.001 setlinewidth .5 .76672 moveto .48881 .76354 lineto stroke grestore gsave .705 setgray .5 .73176 moveto .43994 .71466 lineto .43132 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .5 .73176 moveto .43994 .71466 lineto stroke grestore gsave .541 setgray .43132 .74964 moveto .48881 .76354 lineto .5 .77473 lineto .43132 .77473 lineto fill grestore gsave .623 setgray .43132 .74964 moveto .48881 .76354 lineto .43994 .71466 lineto .43132 .71258 lineto fill grestore gsave 0.001 setlinewidth .43132 .74964 moveto .48881 .76354 lineto stroke grestore gsave .705 setgray .43132 .71258 moveto .43994 .71466 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .43132 .71258 moveto .43994 .71466 lineto stroke grestore gsave .541 setgray .56868 .77473 moveto .55707 .76312 lineto .56868 .76206 lineto fill grestore gsave .623 setgray .55707 .76312 moveto .56868 .76206 lineto .56868 .72616 lineto .52418 .73023 lineto fill grestore gsave 0.001 setlinewidth .55707 .76312 moveto .56868 .76206 lineto stroke grestore gsave .705 setgray .52418 .73023 moveto .56868 .72616 lineto .56868 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .52418 .73023 moveto .56868 .72616 lineto stroke grestore gsave .541 setgray .55707 .76312 moveto .5 .76672 lineto .5 .77473 lineto .56868 .77473 lineto fill grestore gsave .623 setgray .55707 .76312 moveto .5 .76672 lineto .5 .73176 lineto .52418 .73023 lineto fill grestore gsave 0.001 setlinewidth .55707 .76312 moveto .5 .76672 lineto stroke grestore gsave .705 setgray .52418 .73023 moveto .5 .73176 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .52418 .73023 moveto .5 .73176 lineto stroke grestore gsave .541 setgray .63736 .77473 moveto .61111 .74847 lineto .63736 .73645 lineto fill grestore gsave .623 setgray .61111 .74847 moveto .63736 .73645 lineto .63736 .70604 lineto .6172 .70604 lineto .58392 .72128 lineto fill grestore gsave 0.001 setlinewidth .61111 .74847 moveto .63736 .73645 lineto stroke grestore gsave .705 setgray .58392 .72128 moveto .6172 .70604 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .58392 .72128 moveto .6172 .70604 lineto stroke grestore gsave .541 setgray .61111 .74847 moveto .56868 .76206 lineto .56868 .77473 lineto .63736 .77473 lineto fill grestore gsave .623 setgray .61111 .74847 moveto .56868 .76206 lineto .56868 .72616 lineto .58392 .72128 lineto fill grestore gsave 0.001 setlinewidth .61111 .74847 moveto .56868 .76206 lineto stroke grestore gsave .705 setgray .58392 .72128 moveto .56868 .72616 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .58392 .72128 moveto .56868 .72616 lineto stroke grestore gsave .459 setgray .70604 .77473 moveto .6833 .75198 lineto .70604 .73368 lineto fill grestore gsave .541 setgray .6833 .75198 moveto .70604 .73368 lineto .70604 .70604 lineto .68209 .70604 lineto .65731 .72599 lineto fill grestore gsave 0.001 setlinewidth .6833 .75198 moveto .70604 .73368 lineto stroke grestore gsave .623 setgray .65731 .72599 moveto .68209 .70604 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .65731 .72599 moveto .68209 .70604 lineto stroke grestore gsave .459 setgray .70604 .77473 moveto .6833 .75198 lineto .63996 .77473 lineto fill grestore gsave .541 setgray .6833 .75198 moveto .63996 .77473 lineto .63736 .77473 lineto .63736 .73645 lineto .65731 .72599 lineto fill grestore gsave 0.001 setlinewidth .6833 .75198 moveto .63996 .77473 lineto stroke grestore gsave .623 setgray .65731 .72599 moveto .63736 .73645 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .65731 .72599 moveto .63736 .73645 lineto stroke grestore gsave .295 setgray .77473 .77473 moveto .77168 .77168 lineto .77473 .76714 lineto fill grestore gsave .377 setgray .77168 .77168 moveto .77473 .76714 lineto .77473 .70604 lineto .77339 .70604 lineto .74633 .74633 lineto fill grestore gsave 0.001 setlinewidth .77168 .77168 moveto .77473 .76714 lineto stroke grestore gsave .459 setgray .74633 .74633 moveto .77339 .70604 lineto .73101 .70604 lineto .72098 .72098 lineto fill grestore gsave 0.001 setlinewidth .74633 .74633 moveto .77339 .70604 lineto stroke grestore gsave .541 setgray .72098 .72098 moveto .73101 .70604 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .72098 .72098 moveto .73101 .70604 lineto stroke grestore gsave .295 setgray .77473 .77473 moveto .77168 .77168 lineto .76809 .77473 lineto fill grestore gsave .377 setgray .77168 .77168 moveto .76809 .77473 lineto .71294 .77473 lineto .74633 .74633 lineto fill grestore gsave 0.001 setlinewidth .77168 .77168 moveto .76809 .77473 lineto stroke grestore gsave .459 setgray .74633 .74633 moveto .71294 .77473 lineto .70604 .77473 lineto .70604 .73368 lineto .72098 .72098 lineto fill grestore gsave 0.001 setlinewidth .74633 .74633 moveto .71294 .77473 lineto stroke grestore gsave .541 setgray .72098 .72098 moveto .70604 .73368 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .72098 .72098 moveto .70604 .73368 lineto stroke grestore gsave .214 setgray .84341 .77473 moveto .84327 .77459 lineto .84341 .77439 lineto fill grestore gsave .295 setgray .84327 .77459 moveto .84341 .77439 lineto .84341 .70604 lineto .83244 .70604 lineto .80845 .73977 lineto fill grestore gsave 0.001 setlinewidth .84327 .77459 moveto .84341 .77439 lineto stroke grestore gsave .377 setgray .80845 .73977 moveto .83244 .70604 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .80845 .73977 moveto .83244 .70604 lineto stroke grestore gsave .214 setgray .84341 .77473 moveto .84327 .77459 lineto .84309 .77473 lineto fill grestore gsave .295 setgray .84327 .77459 moveto .84309 .77473 lineto .77473 .77473 lineto .77473 .76714 lineto .80845 .73977 lineto fill grestore gsave 0.001 setlinewidth .84327 .77459 moveto .84309 .77473 lineto stroke grestore gsave .377 setgray .80845 .73977 moveto .77473 .76714 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .80845 .73977 moveto .77473 .76714 lineto stroke grestore gsave .214 setgray .88023 .74287 moveto .90465 .70604 lineto .91209 .70604 lineto .91209 .77473 lineto fill grestore gsave .295 setgray .88023 .74287 moveto .90465 .70604 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .88023 .74287 moveto .90465 .70604 lineto stroke grestore gsave .214 setgray .88023 .74287 moveto .84341 .77439 lineto .84341 .77473 lineto .91209 .77473 lineto fill grestore gsave .295 setgray .88023 .74287 moveto .84341 .77439 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .88023 .74287 moveto .84341 .77439 lineto stroke grestore gsave .132 setgray .98077 .77473 moveto .96704 .761 lineto .98077 .74036 lineto fill grestore gsave .214 setgray .96704 .761 moveto .98077 .74036 lineto .98077 .70604 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .96704 .761 moveto .98077 .74036 lineto stroke grestore gsave .132 setgray .98077 .77473 moveto .96704 .761 lineto .95099 .77473 lineto fill grestore gsave .214 setgray .96704 .761 moveto .95099 .77473 lineto .91209 .77473 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .96704 .761 moveto .95099 .77473 lineto stroke grestore gsave .132 setgray 0.01923 .77473 moveto 0.08791 .84341 lineto 0.08791 .77473 lineto fill grestore gsave .132 setgray 0.01923 .84341 moveto 0.01923 .77473 lineto 0.08791 .84341 lineto fill grestore gsave .132 setgray 0.08791 .77473 moveto 0.09505 .77473 lineto .13957 .82638 lineto fill grestore gsave .214 setgray 0.09505 .77473 moveto .13957 .82638 lineto .15659 .84341 lineto .15659 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.09505 .77473 moveto .13957 .82638 lineto stroke grestore gsave .132 setgray .15353 .84341 moveto .13957 .82638 lineto 0.08791 .77473 lineto 0.08791 .84341 lineto fill grestore gsave .214 setgray .15353 .84341 moveto .13957 .82638 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .15353 .84341 moveto .13957 .82638 lineto stroke grestore gsave .214 setgray .19775 .77473 moveto .22527 .80568 lineto .22527 .84341 lineto .15659 .77473 lineto fill grestore gsave .295 setgray .19775 .77473 moveto .22527 .80568 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .19775 .77473 moveto .22527 .80568 lineto stroke grestore gsave .214 setgray .15659 .84341 moveto .15659 .77473 lineto .22527 .84341 lineto fill grestore gsave .295 setgray .26466 .77473 moveto .29396 .81059 lineto .29396 .84341 lineto .22527 .77473 lineto fill grestore gsave .377 setgray .26466 .77473 moveto .29396 .81059 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .26466 .77473 moveto .29396 .81059 lineto stroke grestore gsave .214 setgray .22527 .84341 moveto .25395 .84341 lineto .22527 .80568 lineto fill grestore gsave .295 setgray .25395 .84341 moveto .22527 .80568 lineto .22527 .77473 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .25395 .84341 moveto .22527 .80568 lineto stroke grestore gsave .377 setgray .36264 .80343 moveto .32778 .77473 lineto .29396 .77473 lineto .36264 .84341 lineto fill grestore gsave .459 setgray .36264 .80343 moveto .32778 .77473 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .36264 .80343 moveto .32778 .77473 lineto stroke grestore gsave .295 setgray .29396 .84341 moveto .29396 .81059 lineto .33592 .84341 lineto fill grestore gsave .377 setgray .29396 .81059 moveto .33592 .84341 lineto .36264 .84341 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .29396 .81059 moveto .33592 .84341 lineto stroke grestore gsave .377 setgray .43132 .84341 moveto .43132 .84017 lineto .42343 .83552 lineto fill grestore gsave .459 setgray .43132 .84017 moveto .42343 .83552 lineto .36264 .77473 lineto .40421 .77473 lineto .43132 .79071 lineto fill grestore gsave 0.001 setlinewidth .43132 .84017 moveto .42343 .83552 lineto stroke grestore gsave .541 setgray .43132 .79071 moveto .40421 .77473 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .43132 .79071 moveto .40421 .77473 lineto stroke grestore gsave .377 setgray .36264 .80343 moveto .42343 .83552 lineto .43132 .84341 lineto .36264 .84341 lineto fill grestore gsave .459 setgray .36264 .80343 moveto .42343 .83552 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .36264 .80343 moveto .42343 .83552 lineto stroke grestore gsave .459 setgray .5 .84341 moveto .5 .81042 lineto .45275 .79615 lineto fill grestore gsave .541 setgray .5 .81042 moveto .45275 .79615 lineto .43132 .77473 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .5 .81042 moveto .45275 .79615 lineto stroke grestore gsave .377 setgray .43132 .84341 moveto .43132 .84017 lineto .44406 .84341 lineto fill grestore gsave .459 setgray .43132 .84017 moveto .44406 .84341 lineto .5 .84341 lineto .45275 .79615 lineto .43132 .79071 lineto fill grestore gsave 0.001 setlinewidth .43132 .84017 moveto .44406 .84341 lineto stroke grestore gsave .541 setgray .43132 .79071 moveto .45275 .79615 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .43132 .79071 moveto .45275 .79615 lineto stroke grestore gsave .459 setgray .56868 .84341 moveto .53358 .80831 lineto .56868 .80531 lineto fill grestore gsave .541 setgray .53358 .80831 moveto .56868 .80531 lineto .56868 .77473 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .53358 .80831 moveto .56868 .80531 lineto stroke grestore gsave .459 setgray .53358 .80831 moveto .5 .81042 lineto .5 .84341 lineto .56868 .84341 lineto fill grestore gsave .541 setgray .53358 .80831 moveto .5 .81042 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .53358 .80831 moveto .5 .81042 lineto stroke grestore gsave .377 setgray .63736 .84341 moveto .62736 .83341 lineto .63736 .82875 lineto fill grestore gsave .459 setgray .62736 .83341 moveto .63736 .82875 lineto .63736 .77652 lineto .59173 .79778 lineto fill grestore gsave 0.001 setlinewidth .62736 .83341 moveto .63736 .82875 lineto stroke grestore gsave .541 setgray .59173 .79778 moveto .63736 .77652 lineto .63736 .77473 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .59173 .79778 moveto .63736 .77652 lineto stroke grestore gsave .377 setgray .63736 .84341 moveto .62736 .83341 lineto .59675 .84341 lineto fill grestore gsave .459 setgray .62736 .83341 moveto .59675 .84341 lineto .56868 .84341 lineto .56868 .80531 lineto .59173 .79778 lineto fill grestore gsave 0.001 setlinewidth .62736 .83341 moveto .59675 .84341 lineto stroke grestore gsave .541 setgray .59173 .79778 moveto .56868 .80531 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .59173 .79778 moveto .56868 .80531 lineto stroke grestore gsave .377 setgray .70604 .84341 moveto .67257 .80994 lineto .70604 .78248 lineto fill grestore gsave .459 setgray .67257 .80994 moveto .70604 .78248 lineto .70604 .77473 lineto .63996 .77473 lineto .63853 .7759 lineto fill grestore gsave 0.001 setlinewidth .67257 .80994 moveto .70604 .78248 lineto stroke grestore gsave .541 setgray .63853 .7759 moveto .63996 .77473 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .63853 .7759 moveto .63996 .77473 lineto stroke grestore gsave .377 setgray .67257 .80994 moveto .63736 .82875 lineto .63736 .84341 lineto .70604 .84341 lineto fill grestore gsave .459 setgray .67257 .80994 moveto .63736 .82875 lineto .63736 .77652 lineto .63853 .7759 lineto fill grestore gsave 0.001 setlinewidth .67257 .80994 moveto .63736 .82875 lineto stroke grestore gsave .541 setgray .63853 .7759 moveto .63736 .77652 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .63853 .7759 moveto .63736 .77652 lineto stroke grestore gsave .295 setgray .7434 .81208 moveto .76809 .77473 lineto .77473 .77473 lineto .77473 .84341 lineto fill grestore gsave .377 setgray .7434 .81208 moveto .76809 .77473 lineto .71294 .77473 lineto .7102 .77888 lineto fill grestore gsave 0.001 setlinewidth .7434 .81208 moveto .76809 .77473 lineto stroke grestore gsave .459 setgray .7102 .77888 moveto .71294 .77473 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .7102 .77888 moveto .71294 .77473 lineto stroke grestore gsave .295 setgray .77473 .84341 moveto .7434 .81208 lineto .70724 .84341 lineto fill grestore gsave .377 setgray .7434 .81208 moveto .70724 .84341 lineto .70604 .84341 lineto .70604 .78248 lineto .7102 .77888 lineto fill grestore gsave 0.001 setlinewidth .7434 .81208 moveto .70724 .84341 lineto stroke grestore gsave .459 setgray .7102 .77888 moveto .70604 .78248 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .7102 .77888 moveto .70604 .78248 lineto stroke grestore gsave .214 setgray .81488 .81488 moveto .84309 .77473 lineto .84341 .77473 lineto .84341 .84341 lineto fill grestore gsave .295 setgray .81488 .81488 moveto .84309 .77473 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .81488 .81488 moveto .84309 .77473 lineto stroke grestore gsave .214 setgray .84341 .84341 moveto .81488 .81488 lineto .78043 .84341 lineto fill grestore gsave .295 setgray .81488 .81488 moveto .78043 .84341 lineto .77473 .84341 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .81488 .81488 moveto .78043 .84341 lineto stroke grestore gsave .132 setgray .91209 .84341 moveto .90223 .83355 lineto .91209 .81855 lineto fill grestore gsave .214 setgray .90223 .83355 moveto .91209 .81855 lineto .91209 .77473 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .90223 .83355 moveto .91209 .81855 lineto stroke grestore gsave .132 setgray .91209 .84341 moveto .90223 .83355 lineto .89094 .84341 lineto fill grestore gsave .214 setgray .90223 .83355 moveto .89094 .84341 lineto .84341 .84341 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .90223 .83355 moveto .89094 .84341 lineto stroke grestore gsave .132 setgray .93552 .79816 moveto .95099 .77473 lineto .98077 .77473 lineto .98077 .84341 lineto fill grestore gsave .214 setgray .93552 .79816 moveto .95099 .77473 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .93552 .79816 moveto .95099 .77473 lineto stroke grestore gsave .132 setgray .93552 .79816 moveto .91209 .81855 lineto .91209 .84341 lineto .98077 .84341 lineto fill grestore gsave .214 setgray .93552 .79816 moveto .91209 .81855 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .93552 .79816 moveto .91209 .81855 lineto stroke grestore gsave .132 setgray 0.01923 .84341 moveto 0.08791 .91209 lineto 0.08791 .84341 lineto fill grestore gsave .132 setgray 0.01923 .91209 moveto 0.01923 .84341 lineto 0.08791 .91209 lineto fill grestore gsave .132 setgray .15353 .84341 moveto .15659 .84674 lineto .15659 .91209 lineto 0.08791 .84341 lineto fill grestore gsave .214 setgray .15353 .84341 moveto .15659 .84674 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .15353 .84341 moveto .15659 .84674 lineto stroke grestore gsave .132 setgray 0.08791 .91209 moveto 0.08791 .84341 lineto .15659 .91209 lineto fill grestore gsave .214 setgray .15659 .84341 moveto .22527 .91209 lineto .22527 .84341 lineto fill grestore gsave .132 setgray .15659 .91209 moveto .21735 .91209 lineto .15659 .84674 lineto fill grestore gsave .214 setgray .21735 .91209 moveto .15659 .84674 lineto .15659 .84341 lineto .22527 .91209 lineto fill grestore gsave 0.001 setlinewidth .21735 .91209 moveto .15659 .84674 lineto stroke grestore gsave .214 setgray .25395 .84341 moveto .29396 .88951 lineto .29396 .91209 lineto .22527 .84341 lineto fill grestore gsave .295 setgray .25395 .84341 moveto .29396 .88951 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .25395 .84341 moveto .29396 .88951 lineto stroke grestore gsave .214 setgray .22527 .91209 moveto .22527 .84341 lineto .29396 .91209 lineto fill grestore gsave .295 setgray .36264 .8642 moveto .33592 .84341 lineto .29396 .84341 lineto .36264 .91209 lineto fill grestore gsave .377 setgray .36264 .8642 moveto .33592 .84341 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36264 .8642 moveto .33592 .84341 lineto stroke grestore gsave .214 setgray .29396 .91209 moveto .29396 .88951 lineto .32508 .91209 lineto fill grestore gsave .295 setgray .29396 .88951 moveto .32508 .91209 lineto .36264 .91209 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .29396 .88951 moveto .32508 .91209 lineto stroke grestore gsave .295 setgray .43132 .91209 moveto .43132 .8998 lineto .40341 .88418 lineto fill grestore gsave .377 setgray .43132 .8998 moveto .40341 .88418 lineto .36264 .84341 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .43132 .8998 moveto .40341 .88418 lineto stroke grestore gsave .295 setgray .36264 .8642 moveto .40341 .88418 lineto .43132 .91209 lineto .36264 .91209 lineto fill grestore gsave .377 setgray .36264 .8642 moveto .40341 .88418 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36264 .8642 moveto .40341 .88418 lineto stroke grestore gsave .377 setgray .5 .85952 moveto .44406 .84341 lineto .43132 .84341 lineto .5 .91209 lineto fill grestore gsave .459 setgray .5 .85952 moveto .44406 .84341 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .5 .85952 moveto .44406 .84341 lineto stroke grestore gsave .295 setgray .43132 .91209 moveto .43132 .8998 lineto .48383 .91209 lineto fill grestore gsave .377 setgray .43132 .8998 moveto .48383 .91209 lineto .5 .91209 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .43132 .8998 moveto .48383 .91209 lineto stroke grestore gsave .295 setgray .56868 .91209 moveto .56809 .9115 lineto .56868 .91145 lineto fill grestore gsave .377 setgray .56809 .9115 moveto .56868 .91145 lineto .56868 .85446 lineto .5152 .8586 lineto fill grestore gsave 0.001 setlinewidth .56809 .9115 moveto .56868 .91145 lineto stroke grestore gsave .459 setgray .5152 .8586 moveto .56868 .85446 lineto .56868 .84341 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .5152 .8586 moveto .56868 .85446 lineto stroke grestore gsave .295 setgray .56868 .91209 moveto .56809 .9115 lineto .55831 .91209 lineto fill grestore gsave .377 setgray .56809 .9115 moveto .55831 .91209 lineto .5 .91209 lineto .5 .85952 lineto .5152 .8586 lineto fill grestore gsave 0.001 setlinewidth .56809 .9115 moveto .55831 .91209 lineto stroke grestore gsave .459 setgray .5152 .8586 moveto .5 .85952 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .5152 .8586 moveto .5 .85952 lineto stroke grestore gsave .295 setgray .63736 .91209 moveto .62104 .89577 lineto .63736 .88867 lineto fill grestore gsave .377 setgray .62104 .89577 moveto .63736 .88867 lineto .63736 .84341 lineto .59675 .84341 lineto .57719 .85191 lineto fill grestore gsave 0.001 setlinewidth .62104 .89577 moveto .63736 .88867 lineto stroke grestore gsave .459 setgray .57719 .85191 moveto .59675 .84341 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .57719 .85191 moveto .59675 .84341 lineto stroke grestore gsave .295 setgray .62104 .89577 moveto .56868 .91145 lineto .56868 .91209 lineto .63736 .91209 lineto fill grestore gsave .377 setgray .62104 .89577 moveto .56868 .91145 lineto .56868 .85446 lineto .57719 .85191 lineto fill grestore gsave 0.001 setlinewidth .62104 .89577 moveto .56868 .91145 lineto stroke grestore gsave .459 setgray .57719 .85191 moveto .56868 .85446 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .57719 .85191 moveto .56868 .85446 lineto stroke grestore gsave .295 setgray .70604 .91209 moveto .66782 .87386 lineto .70604 .84466 lineto fill grestore gsave .377 setgray .66782 .87386 moveto .70604 .84466 lineto .70604 .84341 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .66782 .87386 moveto .70604 .84466 lineto stroke grestore gsave .295 setgray .66782 .87386 moveto .63736 .88867 lineto .63736 .91209 lineto .70604 .91209 lineto fill grestore gsave .377 setgray .66782 .87386 moveto .63736 .88867 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .66782 .87386 moveto .63736 .88867 lineto stroke grestore gsave .214 setgray .77473 .91209 moveto .74854 .8859 lineto .77473 .84909 lineto fill grestore gsave .295 setgray .74854 .8859 moveto .77473 .84909 lineto .77473 .84341 lineto .70724 .84341 lineto .70675 .84411 lineto fill grestore gsave 0.001 setlinewidth .74854 .8859 moveto .77473 .84909 lineto stroke grestore gsave .377 setgray .70675 .84411 moveto .70724 .84341 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .70675 .84411 moveto .70724 .84341 lineto stroke grestore gsave .214 setgray .77473 .91209 moveto .74854 .8859 lineto .71527 .91209 lineto fill grestore gsave .295 setgray .74854 .8859 moveto .71527 .91209 lineto .70604 .91209 lineto .70604 .84466 lineto .70675 .84411 lineto fill grestore gsave 0.001 setlinewidth .74854 .8859 moveto .71527 .91209 lineto stroke grestore gsave .377 setgray .70675 .84411 moveto .70604 .84466 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .70675 .84411 moveto .70604 .84466 lineto stroke grestore gsave .132 setgray .84341 .91209 moveto .83532 .904 lineto .84341 .89332 lineto fill grestore gsave .214 setgray .83532 .904 moveto .84341 .89332 lineto .84341 .84341 lineto .78043 .84341 lineto .77797 .84665 lineto fill grestore gsave 0.001 setlinewidth .83532 .904 moveto .84341 .89332 lineto stroke grestore gsave .295 setgray .77797 .84665 moveto .78043 .84341 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .77797 .84665 moveto .78043 .84341 lineto stroke grestore gsave .132 setgray .84341 .91209 moveto .83532 .904 lineto .82458 .91209 lineto fill grestore gsave .214 setgray .83532 .904 moveto .82458 .91209 lineto .77473 .91209 lineto .77473 .84909 lineto .77797 .84665 lineto fill grestore gsave 0.001 setlinewidth .83532 .904 moveto .82458 .91209 lineto stroke grestore gsave .295 setgray .77797 .84665 moveto .77473 .84909 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .77797 .84665 moveto .77473 .84909 lineto stroke grestore gsave .132 setgray .87123 .87123 moveto .89094 .84341 lineto .91209 .84341 lineto .91209 .91209 lineto fill grestore gsave .214 setgray .87123 .87123 moveto .89094 .84341 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .87123 .87123 moveto .89094 .84341 lineto stroke grestore gsave .132 setgray .87123 .87123 moveto .84341 .89332 lineto .84341 .91209 lineto .91209 .91209 lineto fill grestore gsave .214 setgray .87123 .87123 moveto .84341 .89332 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .87123 .87123 moveto .84341 .89332 lineto stroke grestore gsave .132 setgray .98077 .91209 moveto .98077 .84341 lineto .91209 .84341 lineto fill grestore gsave .132 setgray .98077 .91209 moveto .91209 .91209 lineto .91209 .84341 lineto fill grestore gsave .132 setgray 0.01923 .91209 moveto 0.08791 .98077 lineto 0.08791 .91209 lineto fill grestore gsave 0.05 setgray 0.01923 .98077 moveto 0.07953 .98077 lineto 0.01923 .91473 lineto fill grestore gsave .132 setgray 0.07953 .98077 moveto 0.01923 .91473 lineto 0.01923 .91209 lineto 0.08791 .98077 lineto fill grestore gsave 0.001 setlinewidth 0.07953 .98077 moveto 0.01923 .91473 lineto stroke grestore gsave .132 setgray 0.08791 .91209 moveto .15659 .98077 lineto .15659 .91209 lineto fill grestore gsave .132 setgray 0.08791 .98077 moveto 0.08791 .91209 lineto .15659 .98077 lineto fill grestore gsave .132 setgray .21735 .91209 moveto .22527 .92044 lineto .22527 .98077 lineto .15659 .91209 lineto fill grestore gsave .214 setgray .21735 .91209 moveto .22527 .92044 lineto .22527 .91209 lineto fill grestore gsave 0.001 setlinewidth .21735 .91209 moveto .22527 .92044 lineto stroke grestore gsave .132 setgray .15659 .98077 moveto .15659 .91209 lineto .22527 .98077 lineto fill grestore gsave .214 setgray .22527 .91209 moveto .29396 .98077 lineto .29396 .91209 lineto fill grestore gsave .132 setgray .22527 .98077 moveto .27503 .98077 lineto .22527 .92044 lineto fill grestore gsave .214 setgray .27503 .98077 moveto .22527 .92044 lineto .22527 .91209 lineto .29396 .98077 lineto fill grestore gsave 0.001 setlinewidth .27503 .98077 moveto .22527 .92044 lineto stroke grestore gsave .214 setgray .36264 .94134 moveto .32508 .91209 lineto .29396 .91209 lineto .36264 .98077 lineto fill grestore gsave .295 setgray .36264 .94134 moveto .32508 .91209 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .36264 .94134 moveto .32508 .91209 lineto stroke grestore gsave .214 setgray .29396 .98077 moveto .36264 .98077 lineto .29396 .91209 lineto fill grestore gsave .214 setgray .43132 .98077 moveto .43132 .97568 lineto .41976 .96921 lineto fill grestore gsave .295 setgray .43132 .97568 moveto .41976 .96921 lineto .36264 .91209 lineto .43132 .91209 lineto fill grestore gsave 0.001 setlinewidth .43132 .97568 moveto .41976 .96921 lineto stroke grestore gsave .214 setgray .36264 .94134 moveto .41976 .96921 lineto .43132 .98077 lineto .36264 .98077 lineto fill grestore gsave .295 setgray .36264 .94134 moveto .41976 .96921 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .36264 .94134 moveto .41976 .96921 lineto stroke grestore gsave .295 setgray .5 .91672 moveto .48383 .91209 lineto .43132 .91209 lineto .5 .98077 lineto fill grestore gsave .377 setgray .5 .91672 moveto .48383 .91209 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .5 .91672 moveto .48383 .91209 lineto stroke grestore gsave .214 setgray .43132 .98077 moveto .43132 .97568 lineto .45359 .98077 lineto fill grestore gsave .295 setgray .43132 .97568 moveto .45359 .98077 lineto .5 .98077 lineto .43132 .91209 lineto fill grestore gsave 0.001 setlinewidth .43132 .97568 moveto .45359 .98077 lineto stroke grestore gsave .295 setgray .50434 .91643 moveto .55831 .91209 lineto .56868 .91209 lineto .56868 .98077 lineto fill grestore gsave .377 setgray .50434 .91643 moveto .55831 .91209 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .50434 .91643 moveto .55831 .91209 lineto stroke grestore gsave .295 setgray .50434 .91643 moveto .5 .91672 lineto .5 .98077 lineto .56868 .98077 lineto fill grestore gsave .377 setgray .50434 .91643 moveto .5 .91672 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .50434 .91643 moveto .5 .91672 lineto stroke grestore gsave .214 setgray .63736 .98077 moveto .62558 .96899 lineto .63736 .96389 lineto fill grestore gsave .295 setgray .62558 .96899 moveto .63736 .96389 lineto .63736 .91209 lineto .56868 .91209 lineto fill grestore gsave 0.001 setlinewidth .62558 .96899 moveto .63736 .96389 lineto stroke grestore gsave .214 setgray .63736 .98077 moveto .62558 .96899 lineto .58627 .98077 lineto fill grestore gsave .295 setgray .62558 .96899 moveto .58627 .98077 lineto .56868 .98077 lineto .56868 .91209 lineto fill grestore gsave 0.001 setlinewidth .62558 .96899 moveto .58627 .98077 lineto stroke grestore gsave .214 setgray .70604 .98077 moveto .67235 .94708 lineto .70604 .9216 lineto fill grestore gsave .295 setgray .67235 .94708 moveto .70604 .9216 lineto .70604 .91209 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .67235 .94708 moveto .70604 .9216 lineto stroke grestore gsave .214 setgray .67235 .94708 moveto .63736 .96389 lineto .63736 .98077 lineto .70604 .98077 lineto fill grestore gsave .295 setgray .67235 .94708 moveto .63736 .96389 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .67235 .94708 moveto .63736 .96389 lineto stroke grestore gsave .132 setgray .77473 .98077 moveto .76655 .97259 lineto .77473 .96125 lineto fill grestore gsave .214 setgray .76655 .97259 moveto .77473 .96125 lineto .77473 .91209 lineto .71527 .91209 lineto .7114 .91745 lineto fill grestore gsave 0.001 setlinewidth .76655 .97259 moveto .77473 .96125 lineto stroke grestore gsave .295 setgray .7114 .91745 moveto .71527 .91209 lineto .70604 .91209 lineto fill grestore gsave 0.001 setlinewidth .7114 .91745 moveto .71527 .91209 lineto stroke grestore gsave .132 setgray .77473 .98077 moveto .76655 .97259 lineto .756 .98077 lineto fill grestore gsave .214 setgray .76655 .97259 moveto .756 .98077 lineto .70604 .98077 lineto .70604 .9216 lineto .7114 .91745 lineto fill grestore gsave 0.001 setlinewidth .76655 .97259 moveto .756 .98077 lineto stroke grestore gsave .295 setgray .7114 .91745 moveto .70604 .9216 lineto .70604 .91209 lineto fill grestore gsave 0.001 setlinewidth .7114 .91745 moveto .70604 .9216 lineto stroke grestore gsave .132 setgray .80295 .94031 moveto .82458 .91209 lineto .84341 .91209 lineto .84341 .98077 lineto fill grestore gsave .214 setgray .80295 .94031 moveto .82458 .91209 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .80295 .94031 moveto .82458 .91209 lineto stroke grestore gsave .132 setgray .80295 .94031 moveto .77473 .96125 lineto .77473 .98077 lineto .84341 .98077 lineto fill grestore gsave .214 setgray .80295 .94031 moveto .77473 .96125 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .80295 .94031 moveto .77473 .96125 lineto stroke grestore gsave .132 setgray .91209 .98077 moveto .91209 .91209 lineto .84341 .91209 lineto fill grestore gsave .132 setgray .91209 .98077 moveto .84341 .98077 lineto .84341 .91209 lineto fill grestore gsave 0.05 setgray .98077 .98077 moveto .97123 .97123 lineto .98077 .95801 lineto fill grestore gsave .132 setgray .97123 .97123 moveto .98077 .95801 lineto .98077 .91209 lineto .91209 .91209 lineto fill grestore gsave 0.001 setlinewidth .97123 .97123 moveto .98077 .95801 lineto stroke grestore gsave 0.05 setgray .98077 .98077 moveto .97123 .97123 lineto .95899 .98077 lineto fill grestore gsave .132 setgray .97123 .97123 moveto .95899 .98077 lineto .91209 .98077 lineto .91209 .91209 lineto fill grestore gsave 0.001 setlinewidth .97123 .97123 moveto .95899 .98077 lineto stroke grestore grestore % End of Graphics MathPictureEnd end showpage %%EndDocument endTexFig 225 1015 a 11840716 11722302 1710325 2302361 40455782 40916254 startTexFig 225 1015 a %%BeginDocument: R5y.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 0 0 translate 16 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2400 2080 15200 2080 2400 2080 2400 1904 4533 2080 4533 1904 6666 2080 6666 1904 8800 2080 8800 1904 10933 2080 10933 1904 13066 2080 13066 1904 15200 2080 15200 1904 8 dopairs 2080 2400 2080 15200 2080 2400 1904 2400 2080 4533 1904 4533 2080 6666 1904 6666 2080 8800 1904 8800 2080 10933 1904 10933 2080 13066 1904 13066 2080 15200 1904 15200 8 dopairs % Data Set 1: 20 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 15 def /symbsiz 15 def /symbw 30 def /symbh 104 def /ori 101.63 def /showmark {plotsymb} def /symbary [0 0 15 39 -10 0 0 65 -10 0 0 -65 -10 0 15 -39] def % Arrow /fillcolor {0.0 0.0 0.0} def 2421 2298 1 {showmark} repeat /patternw 32 def /symbsiz 32 def /symbw 64 def /symbh 222 def /ori 112.62 def /showmark {plotsymb} def /symbary [0 0 32 85 -22 0 0 137 -20 0 0 -137 -22 0 32 -85] def % Arrow 2485 4329 1 {showmark} repeat /patternw 61 def /symbsiz 61 def /symbw 122 def /symbh 424 def /ori 121.45 def /showmark {plotsymb} def /symbary [0 0 61 162 -41 0 0 262 -40 0 0 -262 -41 0 61 -162] def % Arrow 2622 6304 1 {showmark} repeat /patternw 82 def /symbsiz 82 def /symbw 164 def /symbh 562 def /ori 130.68 def /showmark {plotsymb} def /symbary [0 0 82 218 -55 0 0 344 -54 0 0 -344 -55 0 82 -218] def % Arrow 2767 8373 1 {showmark} repeat /patternw 70 def /symbsiz 70 def /symbw 140 def /symbh 482 def /ori 141.06 def /showmark {plotsymb} def /symbary [0 0 70 186 -47 0 0 296 -46 0 0 -296 -47 0 70 -186] def % Arrow 2775 10630 1 {showmark} repeat /patternw 41 def /symbsiz 41 def /symbw 82 def /symbh 278 def /ori 145.51 def /showmark {plotsymb} def /symbary [0 0 41 109 -28 0 0 169 -26 0 0 -169 -28 0 41 -109] def % Arrow 2630 12909 1 {showmark} repeat /patternw 20 def /symbsiz 20 def /symbw 40 def /symbh 140 def /ori 142.56 def /showmark {plotsymb} def /symbary [0 0 20 53 -14 0 0 87 -12 0 0 -87 -14 0 20 -53] def % Arrow 2511 15115 1 {showmark} repeat /patternw 31 def /symbsiz 31 def /symbw 62 def /symbh 208 def /ori 93.56 def /showmark {plotsymb} def /symbary [0 0 31 82 -21 0 0 126 -20 0 0 -126 -21 0 31 -82] def % Arrow 4546 2191 1 {showmark} repeat /patternw 66 def /symbsiz 66 def /symbw 132 def /symbh 456 def /ori 103.58 def /showmark {plotsymb} def /symbary [0 0 66 176 -44 0 0 280 -44 0 0 -280 -44 0 66 -176] def % Arrow 4640 4090 1 {showmark} repeat /patternw 128 def /symbsiz 128 def /symbw 256 def /symbh 884 def /ori 111.22 def /showmark {plotsymb} def /symbary [0 0 128 341 -86 0 0 543 -84 0 0 -543 -86 0 128 -341] def % Arrow 4853 5843 1 {showmark} repeat /patternw 171 def /symbsiz 171 def /symbw 342 def /symbh 1182 def /ori 119.64 def /showmark {plotsymb} def /symbary [0 0 171 456 -114 0 0 726 -114 0 0 -726 -114 0 171 -456] def % Arrow 5118 7772 1 {showmark} repeat /patternw 146 def /symbsiz 146 def /symbw 292 def /symbh 1008 def /ori 132.31 def /showmark {plotsymb} def /symbary [0 0 146 389 -98 0 0 619 -96 0 0 -619 -98 0 146 -389] def % Arrow 5212 10187 1 {showmark} repeat /patternw 85 def /symbsiz 85 def /symbw 170 def /symbh 588 def /ori 139.69 def /showmark {plotsymb} def /symbary [0 0 85 226 -57 0 0 362 -56 0 0 -362 -57 0 85 -226] def % Arrow 4981 12687 1 {showmark} repeat /patternw 43 def /symbsiz 43 def /symbw 86 def /symbh 296 def /ori 138.56 def /showmark {plotsymb} def /symbary [0 0 43 114 -29 0 0 182 -28 0 0 -182 -29 0 43 -114] def % Arrow 4755 15004 1 {showmark} repeat /patternw 56 def /symbsiz 56 def /symbw 112 def /symbh 384 def /ori 84.20 def /showmark {plotsymb} def /symbary [0 0 56 149 -38 0 0 235 -36 0 0 -235 -38 0 56 -149] def % Arrow 6628 2016 1 {showmark} repeat /patternw 121 def /symbsiz 121 def /symbw 242 def /symbh 832 def /ori 91.45 def /showmark {plotsymb} def /symbary [0 0 121 322 -81 0 0 510 -80 0 0 -510 -81 0 121 -322] def % Arrow 6688 3701 1 {showmark} repeat /patternw 232 def /symbsiz 232 def /symbw 464 def /symbh 1602 def /ori 99.63 def /showmark {plotsymb} def /symbary [0 0 232 618 -155 0 0 984 -154 0 0 -984 -155 0 232 -618] def % Arrow 6935 5088 1 {showmark} repeat /patternw 311 def /symbsiz 311 def /symbw 622 def /symbh 2144 def /ori 109.86 def /showmark {plotsymb} def /symbary [0 0 311 829 -208 0 0 1315 -206 0 0 -1315 -208 0 311 -829] def % Arrow 7396 6782 1 {showmark} repeat /patternw 267 def /symbsiz 267 def /symbw 534 def /symbh 1844 def /ori 123.11 def /showmark {plotsymb} def /symbary [0 0 267 712 -178 0 0 1132 -178 0 0 -1132 -178 0 267 -712] def % Arrow 7674 9389 1 {showmark} repeat /patternw 157 def /symbsiz 157 def /symbw 314 def /symbh 1084 def /ori 132.91 def /showmark {plotsymb} def /symbary [0 0 157 418 -105 0 0 666 -104 0 0 -666 -105 0 157 -418] def % Arrow 7405 12273 1 {showmark} repeat /patternw 79 def /symbsiz 79 def /symbw 158 def /symbh 544 def /ori 136.56 def /showmark {plotsymb} def /symbary [0 0 79 210 -53 0 0 334 -52 0 0 -334 -53 0 79 -210] def % Arrow 7063 14825 1 {showmark} repeat /patternw 71 def /symbsiz 71 def /symbw 142 def /symbh 492 def /ori 70.79 def /showmark {plotsymb} def /symbary [0 0 71 189 -48 0 0 303 -46 0 0 -303 -48 0 71 -189] def % Arrow 8638 1935 1 {showmark} repeat /patternw 152 def /symbsiz 152 def /symbw 304 def /symbh 1050 def /ori 77.34 def /showmark {plotsymb} def /symbary [0 0 152 405 -102 0 0 645 -100 0 0 -645 -102 0 152 -405] def % Arrow 8570 3509 1 {showmark} repeat /patternw 289 def /symbsiz 289 def /symbw 578 def /symbh 1996 def /ori 89.14 def /showmark {plotsymb} def /symbary [0 0 289 770 -193 0 0 1226 -192 0 0 -1226 -193 0 289 -770] def % Arrow 8770 4670 1 {showmark} repeat /patternw 387 def /symbsiz 387 def /symbw 774 def /symbh 2672 def /ori 102.73 def /showmark {plotsymb} def /symbary [0 0 387 1032 -258 0 0 1640 -258 0 0 -1640 -258 0 387 -1032] def % Arrow 9389 6193 1 {showmark} repeat /patternw 334 def /symbsiz 334 def /symbw 668 def /symbh 2304 def /ori 113.91 def /showmark {plotsymb} def /symbary [0 0 334 890 -223 0 0 1414 -222 0 0 -1414 -223 0 334 -890] def % Arrow 9734 8826 1 {showmark} repeat /patternw 197 def /symbsiz 197 def /symbw 394 def /symbh 1356 def /ori 124.25 def /showmark {plotsymb} def /symbary [0 0 197 525 -132 0 0 831 -130 0 0 -831 -132 0 197 -525] def % Arrow 9564 11945 1 {showmark} repeat /patternw 99 def /symbsiz 99 def /symbw 198 def /symbh 680 def /ori 132.73 def /showmark {plotsymb} def /symbary [0 0 99 264 -66 0 0 416 -66 0 0 -416 -66 0 99 -264] def % Arrow 9261 14701 1 {showmark} repeat /patternw 58 def /symbsiz 58 def /symbw 116 def /symbh 398 def /ori 59.11 def /showmark {plotsymb} def /symbary [0 0 58 154 -39 0 0 244 -38 0 0 -244 -39 0 58 -154] def % Arrow 10729 2059 1 {showmark} repeat /patternw 123 def /symbsiz 123 def /symbw 246 def /symbh 844 def /ori 67.44 def /showmark {plotsymb} def /symbary [0 0 123 327 -82 0 0 517 -82 0 0 -517 -82 0 123 -327] def % Arrow 10609 3753 1 {showmark} repeat /patternw 234 def /symbsiz 234 def /symbw 468 def /symbh 1614 def /ori 82.56 def /showmark {plotsymb} def /symbary [0 0 234 624 -156 0 0 990 -156 0 0 -990 -156 0 234 -624] def % Arrow 10724 5067 1 {showmark} repeat /patternw 313 def /symbsiz 313 def /symbw 626 def /symbh 2160 def /ori 97.26 def /showmark {plotsymb} def /symbary [0 0 313 834 -209 0 0 1326 -208 0 0 -1326 -209 0 313 -834] def % Arrow 11206 6658 1 {showmark} repeat /patternw 268 def /symbsiz 268 def /symbw 536 def /symbh 1854 def /ori 108.10 def /showmark {plotsymb} def /symbary [0 0 268 714 -179 0 0 1140 -178 0 0 -1140 -179 0 268 -714] def % Arrow 11509 9171 1 {showmark} repeat /patternw 158 def /symbsiz 158 def /symbw 316 def /symbh 1092 def /ori 117.95 def /showmark {plotsymb} def /symbary [0 0 158 421 -106 0 0 671 -104 0 0 -671 -106 0 158 -421] def % Arrow 11445 12102 1 {showmark} repeat /patternw 79 def /symbsiz 79 def /symbw 158 def /symbh 544 def /ori 124.85 def /showmark {plotsymb} def /symbary [0 0 79 210 -53 0 0 334 -52 0 0 -334 -53 0 79 -210] def % Arrow 11245 14752 1 {showmark} repeat /patternw 32 def /symbsiz 32 def /symbw 64 def /symbh 224 def /ori 60.48 def /showmark {plotsymb} def /symbary [0 0 32 85 -22 0 0 139 -20 0 0 -139 -22 0 32 -85] def % Arrow 12956 2204 1 {showmark} repeat /patternw 69 def /symbsiz 69 def /symbw 138 def /symbh 476 def /ori 68.44 def /showmark {plotsymb} def /symbary [0 0 69 183 -46 0 0 293 -46 0 0 -293 -46 0 69 -183] def % Arrow 12892 4090 1 {showmark} repeat /patternw 134 def /symbsiz 134 def /symbw 268 def /symbh 924 def /ori 82.80 def /showmark {plotsymb} def /symbary [0 0 134 357 -90 0 0 567 -88 0 0 -567 -90 0 134 -357] def % Arrow 12951 5749 1 {showmark} repeat /patternw 179 def /symbsiz 179 def /symbw 358 def /symbh 1234 def /ori 95.53 def /showmark {plotsymb} def /symbary [0 0 179 477 -120 0 0 757 -118 0 0 -757 -120 0 179 -477] def % Arrow 13186 7571 1 {showmark} repeat /patternw 152 def /symbsiz 152 def /symbw 304 def /symbh 1044 def /ori 107.31 def /showmark {plotsymb} def /symbary [0 0 152 405 -102 0 0 639 -100 0 0 -639 -102 0 152 -405] def % Arrow 13378 9935 1 {showmark} repeat /patternw 88 def /symbsiz 88 def /symbw 176 def /symbh 612 def /ori 116.90 def /showmark {plotsymb} def /symbary [0 0 88 234 -59 0 0 378 -58 0 0 -378 -59 0 88 -234] def % Arrow 13344 12521 1 {showmark} repeat /patternw 44 def /symbsiz 44 def /symbw 88 def /symbh 304 def /ori 120.00 def /showmark {plotsymb} def /symbary [0 0 44 117 -30 0 0 187 -28 0 0 -187 -30 0 44 -117] def % Arrow 13220 14935 1 {showmark} repeat /patternw 16 def /symbsiz 16 def /symbw 32 def /symbh 110 def /ori 67.14 def /showmark {plotsymb} def /symbary [0 0 16 42 -11 0 0 68 -10 0 0 -68 -11 0 16 -42] def % Arrow 15157 2298 1 {showmark} repeat /patternw 34 def /symbsiz 34 def /symbw 68 def /symbh 232 def /ori 72.97 def /showmark {plotsymb} def /symbary [0 0 34 90 -23 0 0 142 -22 0 0 -142 -23 0 34 -90] def % Arrow 15132 4311 1 {showmark} repeat /patternw 66 def /symbsiz 66 def /symbw 132 def /symbh 456 def /ori 84.08 def /showmark {plotsymb} def /symbary [0 0 66 175 -44 0 0 281 -44 0 0 -281 -44 0 66 -175] def % Arrow 15153 6214 1 {showmark} repeat /patternw 88 def /symbsiz 88 def /symbw 176 def /symbh 612 def /ori 94.78 def /showmark {plotsymb} def /symbary [0 0 88 234 -59 0 0 378 -58 0 0 -378 -59 0 88 -234] def % Arrow 15251 8190 1 {showmark} repeat /patternw 74 def /symbsiz 74 def /symbw 148 def /symbh 508 def /ori 107.04 def /showmark {plotsymb} def /symbary [0 0 74 197 -50 0 0 311 -48 0 0 -311 -50 0 74 -197] def % Arrow 15349 10447 1 {showmark} repeat /patternw 43 def /symbsiz 43 def /symbw 86 def /symbh 296 def /ori 116.48 def /showmark {plotsymb} def /symbary [0 0 43 114 -29 0 0 182 -28 0 0 -182 -29 0 43 -114] def % Arrow 15332 12802 1 {showmark} repeat /patternw 21 def /symbsiz 21 def /symbw 42 def /symbh 146 def /ori 119.70 def /showmark {plotsymb} def /symbary [0 0 21 55 -14 0 0 91 -14 0 0 -91 -14 0 21 -55] def % Arrow 15273 15072 1 {showmark} repeat /fontsiz 768 def /spacesiz 51 def /fontsiz 768 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 63 def /txtpos [0.50 0.00] def 683 8912 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8160 800 (X \(cm\)) sprnt /txtpos [0.50 1.00] def 617 17091 (b\)) sprnt /txtpos [0.00 0.00] def /fontsiz 512 def /spacesiz 34 def /fontsiz 512 def /spacesiz 34 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 42 def /txtpos [0.50 1.00] def 2400 1744 (-10) sprnt 4533 1744 (-5) sprnt 6666 1744 (0) sprnt 8800 1744 (5) sprnt 10933 1744 (10) sprnt 13066 1744 (15) sprnt 15200 1744 (20) sprnt /txtpos [1.00 0.35] def 1744 2400 (20) sprnt 1744 4533 (25) sprnt 1744 6666 (30) sprnt 1744 8800 (35) sprnt 1744 10933 (40) sprnt 1744 13066 (45) sprnt 1744 15200 (50) sprnt 0 0 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 991 955 a 11840716 12669565 4736286 9472573 35522150 42626580 startTexFig 991 955 a %%BeginDocument: R5yc.ps /Mathdict 100 dict def Mathdict begin /Mlmarg 1.0 72 mul def /Mrmarg 1.0 72 mul def /Mbmarg 1.0 72 mul def /Mtmarg 1.0 72 mul def /Mwidth 8.5 72 mul def /Mheight 11 72 mul def /Mtransform { } bind def /Mnodistort true def /Mfixwid false def /Mfixdash false def /Mrot 0 def /Mpstart { MathPictureStart } bind def /Mpend { MathPictureEnd } bind def /Mscale { 0 1 0 1 5 -1 roll MathScale } bind def /ISOLatin1Encoding dup where { pop pop } { [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def } ifelse /MFontDict 50 dict def /MStrCat { exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval } def /MCreateEncoding { 1 index 255 string cvs (-) MStrCat 1 index MStrCat cvn exch (Encoding) MStrCat cvn dup where { exch get } { pop StandardEncoding } ifelse 3 1 roll dup MFontDict exch known not { 1 index findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put } if exch pop exch pop } def /ISOLatin1 { (ISOLatin1) MCreateEncoding } def /ISO8859 { (ISOLatin1) MCreateEncoding } def /Mcopyfont { dup maxlength dict exch { 1 index /FID eq { pop pop } { 2 index 3 1 roll put } ifelse } forall } def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier-Bold findfont Mcopyfont definefont pop /Italic /Courier-Oblique findfont Mcopyfont definefont pop /MathPictureStart { gsave Mtransform Mlmarg Mbmarg translate /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def } bind def /MathPictureEnd { grestore } bind def /MathSubStart { Momatrix Mgmatrix Mtmatrix Mlmarg Mrmarg Mbmarg Mtmarg Mwidth Mheight 11 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 13 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def } bind def /MathSubEnd { /Mheight exch def /Mwidth exch def /Mtmarg exch def /Mbmarg exch def /Mrmarg exch def /Mlmarg exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def } bind def /Mdot { moveto 0 0 rlineto stroke } bind def /Mtetra { moveto lineto lineto lineto fill } bind def /Metetra { moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke } bind def /Mistroke { flattenpath 0 0 0 { 4 2 roll pop pop } { 4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll } { stop } { stop } pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash } bind def /Mfstroke { stroke currentdash pop 0 setdash } bind def /Mrotsboxa { gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def } bind def /Msboxa { newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot [ 7 -2 roll 2 copy [ 3 1 roll 10 -1 roll 9 -1 roll ] 6 1 roll 5 -2 roll ] } bind def /Msboxa1 { sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul } bind def /Mvboxa { Mfixwid { Mvboxa1 } { dup Mwidthcal 0 exch { add } forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll } ifelse } bind def /Mvboxa1 { gsave newpath [ true 3 -1 roll { Mbbox 5 -1 roll { 0 5 1 roll } { 7 -1 roll exch sub (m) stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll } ifelse false } forall { stop } if counttomark 1 add 4 roll ] grestore } bind def /Mbbox { 1 dict begin 0 0 moveto /temp (T) def { gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto} forall pathbbox newpath end } bind def /Mmin { 2 copy gt { exch } if pop } bind def /Mmax { 2 copy lt { exch } if pop } bind def /Mrotshowa { dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def } bind def /Mshowa { 4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid { Mshowax } { Mshoway } ifelse pop pop pop pop Mgmatrix setmatrix } bind def /Mshowax { 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash { Mfixdashp } if show } for } bind def /Mfixdashp { dup length 1 gt 1 index true exch { 45 eq and } forall and { gsave (--) stringwidth pop (-) stringwidth pop sub 2 div 0 rmoveto dup length 1 sub { (-) show } repeat grestore } if } bind def /Mshoway { 3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get [ 6 index aload length 2 add -1 roll { pop Strform stringwidth pop neg exch add 0 rmoveto } exch kshow cleartomark } for pop } bind def /Mwidthcal { [ exch { Mwidthcal1 } forall ] [ exch dup Maxlen -1 add 0 1 3 -1 roll { [ exch 2 index { 1 index Mget exch } forall pop Maxget exch } for pop ] Mreva } bind def /Mreva { [ exch aload length -1 1 {1 roll} for ] } bind def /Mget { 1 index length -1 add 1 index ge { get } { pop pop 0 } ifelse } bind def /Maxlen { [ exch { length } forall Maxget } bind def /Maxget { counttomark -1 add 1 1 3 -1 roll { pop Mmax } for exch pop } bind def /Mwidthcal1 { [ exch { Strform stringwidth pop } forall ] } bind def /Strform { /tem (x) def tem 0 3 -1 roll put tem } bind def /Mshowa1 { 2 copy add 4 1 roll sub mul sub -2 div } bind def /MathScale { Mwidth Mlmarg Mrmarg add sub Mheight Mbmarg Mtmarg add sub 0 0 moveto 1 index 0 lineto 2 copy lineto 0 1 index lineto clip newpath Mlp translate dup /Mathabs exch def scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def } bind def /Mlp { 3 copy Mlpfirst { Mnodistort { Mmin dup } if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and { exit } if 3 -1 roll pop pop } loop exch 3 1 roll 7 -3 roll pop pop pop } bind def /Mlpfirst { 3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div } bind def /Mlprun { 2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll { 3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll } forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll } bind def /Mlprun1 { aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add } bind def /Mlprun2 { 2 copy add 2 div 3 1 roll exch sub } bind def /Mlpminmax { cvx 2 index 6 index 2 index exec { 7 -3 roll 4 -1 roll } if 1 index 5 index 3 -1 roll exec { 4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop [ 8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll ] 4 1 roll pop } { pop pop pop } ifelse } bind def /Mlp1 { 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not { 1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll } if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch } bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner { outflag 1 eq { /outflag 0 def /intop 0 def /inrht 0 def } if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt { /intop exch def } { pop } ifelse dup inrht gt { /inrht exch def } { pop } ifelse pop /inflag 1 def } bind def /Mouter { /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq { dup 0 lt { dup intop mul neg /yadtop exch def } if dup 0 gt { dup intop mul /yadbot exch def } if pop dup 0 lt { dup inrht mul neg /xadrht exch def } if dup 0 gt { dup inrht mul /xadlft exch def } if pop /outflag 1 def } { pop pop} ifelse /inflag 0 def /inrht 0 def /intop 0 def } bind def /Mboxout { outflag 1 eq { 4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def } if } bind def /leadjust { (m) stringwidth pop .5 mul } bind def /Mrotcheck { dup 90 eq { yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def } if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop } bind def /Checkaux { 4 index exch 4 index mul 3 1 roll mul add 4 1 roll } bind def /Mboxrot { Mrot 90 eq { brotaux 4 2 roll } if Mrot 180 eq { 4 2 roll brotaux 4 2 roll brotaux } if Mrot 270 eq { 4 2 roll brotaux } if } bind def /brotaux { neg exch neg } bind def /Mabswid { Mathabs div setlinewidth } bind def /Mabsdash { exch Mathabs [ 3 1 roll exch { exch dup 3 -1 roll exch div exch } forall pop ] exch setdash } bind def /MBeginOrig { Momatrix concat} bind def /MEndOrig { Mgmatrix setmatrix} bind def /colorimage where { pop } { /colorimage { 3 1 roll pop pop 5 -1 roll mul 4 1 roll { currentfile 1 index readhexstring pop } image } bind def } ifelse /sampledsound where { pop} { /sampledsound { exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def { Mtempproc pop} repeat } bind def } ifelse /setcmykcolor where { pop} { /setcmykcolor { 4 1 roll [ 4 1 roll ] { 1 index sub 1 sub neg dup 0 lt { pop 0 } if dup 1 gt { pop 1 } if exch } forall pop setrgbcolor } bind def } ifelse MathPictureStart /Helvetica findfont 25 scalefont setfont % Scaling calculations 0.00320513 0.0160256 0.00320513 0.0160256 [ [(-10)] 0.03526 0 0 2 0 Minner Mrotsboxa [(0)] .32372 0 0 2 0 Minner Mrotsboxa [(10)] .64423 0 0 2 0 Minner Mrotsboxa [(20)] .96474 0 0 2 0 Minner Mrotsboxa [(X \(cm\))] .5 0 0 2 0 0 -1 Mouter Mrotsboxa [(20)] -0.0125 0.03526 1 0 0 Minner Mrotsboxa [(30)] -0.0125 .32372 1 0 0 Minner Mrotsboxa [(40)] -0.0125 .64423 1 0 0 Minner Mrotsboxa [(50)] -0.0125 .96474 1 0 0 Minner Mrotsboxa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotsboxa [(e\) )] .5 1 0 -4 Msboxa [ -0.001 -0.001 0 0 ] [ 1.001 1.001 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 setgray gsave gsave gsave 0.002 setlinewidth 0.03526 0 moveto 0.03526 0.00625 lineto stroke grestore [(-10)] 0.03526 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .32372 0 moveto .32372 0.00625 lineto stroke grestore [(0)] .32372 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .64423 0 moveto .64423 0.00625 lineto stroke grestore [(10)] .64423 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .96474 0 moveto .96474 0.00625 lineto stroke grestore [(20)] .96474 0 0 2 0 Minner Mrotshowa [(X \(cm\))] .5 0 0 2 0 0 -1 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 1 0 lineto stroke grestore gsave 0.002 setlinewidth 0 0.03526 moveto 0.00625 0.03526 lineto stroke grestore [(20)] -0.0125 0.03526 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .32372 moveto 0.00625 .32372 lineto stroke grestore [(30)] -0.0125 .32372 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .64423 moveto 0.00625 .64423 lineto stroke grestore [(40)] -0.0125 .64423 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .96474 moveto 0.00625 .96474 lineto stroke grestore [(50)] -0.0125 .96474 1 0 0 Minner Mrotshowa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 0 1 lineto stroke grestore grestore gsave gsave 0.002 setlinewidth 0.03526 .99375 moveto 0.03526 1 lineto stroke grestore gsave 0.002 setlinewidth .32372 .99375 moveto .32372 1 lineto stroke grestore gsave 0.002 setlinewidth .64423 .99375 moveto .64423 1 lineto stroke grestore gsave 0.002 setlinewidth .96474 .99375 moveto .96474 1 lineto stroke grestore [(e\) )] .5 1 0 -4 Mshowa gsave 0.002 setlinewidth 0 1 moveto 1 1 lineto stroke grestore gsave 0.002 setlinewidth .99375 0.03526 moveto 1 0.03526 lineto stroke grestore gsave 0.002 setlinewidth .99375 .32372 moveto 1 .32372 lineto stroke grestore gsave 0.002 setlinewidth .99375 .64423 moveto 1 .64423 lineto stroke grestore gsave 0.002 setlinewidth .99375 .96474 moveto 1 .96474 lineto stroke grestore gsave 0.002 setlinewidth 1 0 moveto 1 1 lineto stroke grestore grestore gsave grestore grestore 0 0 moveto 1 0 lineto 1 1 lineto 0 1 lineto closepath clip newpath gsave gsave 0.05 setgray 0.01923 0.01923 moveto 0.08791 0.01923 lineto 0.08791 0.08791 lineto fill grestore gsave 0.05 setgray 0.01923 0.01923 moveto 0.01923 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave 0.05 setgray 0.08791 0.01923 moveto .11693 0.04824 lineto .15593 0.01923 lineto fill grestore gsave .132 setgray .11693 0.04824 moveto .15593 0.01923 lineto .15659 0.01923 lineto .15659 0.08791 lineto fill grestore gsave 0.001 setlinewidth .11693 0.04824 moveto .15593 0.01923 lineto stroke grestore gsave 0.05 setgray .11693 0.04824 moveto 0.08865 0.08791 lineto 0.08791 0.08791 lineto 0.08791 0.01923 lineto fill grestore gsave .132 setgray .11693 0.04824 moveto 0.08865 0.08791 lineto .15659 0.08791 lineto fill grestore gsave 0.001 setlinewidth .11693 0.04824 moveto 0.08865 0.08791 lineto stroke grestore gsave .132 setgray .15659 0.01923 moveto .22527 0.01923 lineto .22527 0.08791 lineto fill grestore gsave .132 setgray .15659 0.01923 moveto .15659 0.08791 lineto .22527 0.08791 lineto fill grestore gsave .132 setgray .28703 0.08098 moveto .29396 0.0758 lineto .29396 0.01923 lineto .22527 0.01923 lineto fill grestore gsave .214 setgray .28703 0.08098 moveto .29396 0.0758 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .28703 0.08098 moveto .29396 0.0758 lineto stroke grestore gsave .132 setgray .28703 0.08098 moveto .28219 0.08791 lineto .22527 0.08791 lineto .22527 0.01923 lineto fill grestore gsave .214 setgray .28703 0.08098 moveto .28219 0.08791 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .28703 0.08098 moveto .28219 0.08791 lineto stroke grestore gsave .132 setgray .32529 0.05056 moveto .36264 0.03258 lineto .36264 0.01923 lineto .29396 0.01923 lineto fill grestore gsave .214 setgray .32529 0.05056 moveto .36264 0.03258 lineto .36264 0.08791 lineto fill grestore gsave 0.001 setlinewidth .32529 0.05056 moveto .36264 0.03258 lineto stroke grestore gsave .132 setgray .29396 0.01923 moveto .32529 0.05056 lineto .29396 0.0758 lineto fill grestore gsave .214 setgray .32529 0.05056 moveto .29396 0.0758 lineto .29396 0.08791 lineto .36264 0.08791 lineto fill grestore gsave 0.001 setlinewidth .32529 0.05056 moveto .29396 0.0758 lineto stroke grestore gsave .132 setgray .36264 0.01923 moveto .37164 0.02824 lineto .4007 0.01923 lineto fill grestore gsave .214 setgray .37164 0.02824 moveto .4007 0.01923 lineto .43132 0.01923 lineto .43132 0.08791 lineto fill grestore gsave 0.001 setlinewidth .37164 0.02824 moveto .4007 0.01923 lineto stroke grestore gsave .132 setgray .36264 0.01923 moveto .37164 0.02824 lineto .36264 0.03258 lineto fill grestore gsave .214 setgray .37164 0.02824 moveto .36264 0.03258 lineto .36264 0.08791 lineto .43132 0.08791 lineto fill grestore gsave 0.001 setlinewidth .37164 0.02824 moveto .36264 0.03258 lineto stroke grestore gsave .214 setgray .43132 0.01923 moveto .5 0.01923 lineto .5 0.08791 lineto fill grestore gsave .214 setgray .43132 0.01923 moveto .43132 0.08791 lineto .5 0.08791 lineto fill grestore gsave .214 setgray .56868 0.01923 moveto .5 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .214 setgray .5 0.01923 moveto .56868 0.08791 lineto .5 0.08791 lineto fill grestore gsave .132 setgray .63736 0.01923 moveto .63736 0.04581 lineto .57223 0.01923 lineto fill grestore gsave .214 setgray .63736 0.04581 moveto .57223 0.01923 lineto .56868 0.01923 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .63736 0.04581 moveto .57223 0.01923 lineto stroke grestore gsave .214 setgray .56868 0.01923 moveto .63736 0.08791 lineto .56868 0.08791 lineto fill grestore gsave .132 setgray .70604 0.01923 moveto .63736 0.01923 lineto .70604 0.08791 lineto fill grestore gsave .132 setgray .63736 0.04581 moveto .70501 0.08791 lineto .70604 0.08791 lineto .63736 0.01923 lineto fill grestore gsave .214 setgray .63736 0.04581 moveto .70501 0.08791 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .63736 0.04581 moveto .70501 0.08791 lineto stroke grestore gsave .132 setgray .77473 0.01923 moveto .70604 0.01923 lineto .77473 0.08791 lineto fill grestore gsave .132 setgray .70604 0.01923 moveto .77473 0.08791 lineto .70604 0.08791 lineto fill grestore gsave .132 setgray .84341 0.01923 moveto .77473 0.01923 lineto .84341 0.08791 lineto fill grestore gsave .132 setgray .77473 0.01923 moveto .84341 0.08791 lineto .77473 0.08791 lineto fill grestore gsave 0.05 setgray .91209 0.01923 moveto .91209 0.07352 lineto .8456 0.01923 lineto fill grestore gsave .132 setgray .91209 0.07352 moveto .8456 0.01923 lineto .84341 0.01923 lineto .91209 0.08791 lineto fill grestore gsave 0.001 setlinewidth .91209 0.07352 moveto .8456 0.01923 lineto stroke grestore gsave .132 setgray .84341 0.01923 moveto .91209 0.08791 lineto .84341 0.08791 lineto fill grestore gsave 0.05 setgray .98077 0.01923 moveto .91209 0.01923 lineto .98077 0.08791 lineto fill grestore gsave 0.05 setgray .91209 0.07352 moveto .92828 0.08791 lineto .98077 0.08791 lineto .91209 0.01923 lineto fill grestore gsave .132 setgray .91209 0.07352 moveto .92828 0.08791 lineto .91209 0.08791 lineto fill grestore gsave 0.001 setlinewidth .91209 0.07352 moveto .92828 0.08791 lineto stroke grestore gsave 0.05 setgray 0.04923 .11791 moveto 0.08791 0.08867 lineto 0.08791 0.08791 lineto 0.01923 0.08791 lineto fill grestore gsave .132 setgray 0.04923 .11791 moveto 0.08791 0.08867 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.04923 .11791 moveto 0.08791 0.08867 lineto stroke grestore gsave 0.05 setgray 0.04923 .11791 moveto 0.02213 .15659 lineto 0.01923 .15659 lineto 0.01923 0.08791 lineto fill grestore gsave .132 setgray 0.04923 .11791 moveto 0.02213 .15659 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.04923 .11791 moveto 0.02213 .15659 lineto stroke grestore gsave 0.05 setgray 0.08791 0.08791 moveto 0.08823 0.08823 lineto 0.08865 0.08791 lineto fill grestore gsave .132 setgray 0.08823 0.08823 moveto 0.08865 0.08791 lineto .15659 0.08791 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.08823 0.08823 moveto 0.08865 0.08791 lineto stroke grestore gsave 0.05 setgray 0.08791 0.08791 moveto 0.08823 0.08823 lineto 0.08791 0.08867 lineto fill grestore gsave .132 setgray 0.08823 0.08823 moveto 0.08791 0.08867 lineto 0.08791 .15659 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.08823 0.08823 moveto 0.08791 0.08867 lineto stroke grestore gsave .132 setgray .21974 .15106 moveto .22527 .14717 lineto .22527 0.08791 lineto .15659 0.08791 lineto fill grestore gsave .214 setgray .21974 .15106 moveto .22527 .14717 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .21974 .15106 moveto .22527 .14717 lineto stroke grestore gsave .132 setgray .21974 .15106 moveto .2156 .15659 lineto .15659 .15659 lineto .15659 0.08791 lineto fill grestore gsave .214 setgray .21974 .15106 moveto .2156 .15659 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .21974 .15106 moveto .2156 .15659 lineto stroke grestore gsave .132 setgray .22527 0.08791 moveto .24952 .11216 lineto .28219 0.08791 lineto fill grestore gsave .214 setgray .24952 .11216 moveto .28219 0.08791 lineto .29396 0.08791 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .24952 .11216 moveto .28219 0.08791 lineto stroke grestore gsave .132 setgray .22527 0.08791 moveto .24952 .11216 lineto .22527 .14717 lineto fill grestore gsave .214 setgray .24952 .11216 moveto .22527 .14717 lineto .22527 .15659 lineto .29396 .15659 lineto fill grestore gsave 0.001 setlinewidth .24952 .11216 moveto .22527 .14717 lineto stroke grestore gsave .214 setgray .34622 .14018 moveto .36264 .13239 lineto .36264 0.08791 lineto .29396 0.08791 lineto fill grestore gsave .295 setgray .34622 .14018 moveto .36264 .13239 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .34622 .14018 moveto .36264 .13239 lineto stroke grestore gsave .214 setgray .34622 .14018 moveto .32587 .15659 lineto .29396 .15659 lineto .29396 0.08791 lineto fill grestore gsave .295 setgray .34622 .14018 moveto .32587 .15659 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .34622 .14018 moveto .32587 .15659 lineto stroke grestore gsave .214 setgray .39262 .11789 moveto .43132 .1061 lineto .43132 0.08791 lineto .36264 0.08791 lineto fill grestore gsave .295 setgray .39262 .11789 moveto .43132 .1061 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .39262 .11789 moveto .43132 .1061 lineto stroke grestore gsave .214 setgray .36264 0.08791 moveto .39262 .11789 lineto .36264 .13239 lineto fill grestore gsave .295 setgray .39262 .11789 moveto .36264 .13239 lineto .36264 .15659 lineto .43132 .15659 lineto fill grestore gsave 0.001 setlinewidth .39262 .11789 moveto .36264 .13239 lineto stroke grestore gsave .214 setgray .44715 .10374 moveto .5 0.09874 lineto .5 0.08791 lineto .43132 0.08791 lineto fill grestore gsave .295 setgray .44715 .10374 moveto .5 0.09874 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .44715 .10374 moveto .5 0.09874 lineto stroke grestore gsave .214 setgray .43132 0.08791 moveto .44715 .10374 lineto .43132 .1061 lineto fill grestore gsave .295 setgray .44715 .10374 moveto .43132 .1061 lineto .43132 .15659 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .44715 .10374 moveto .43132 .1061 lineto stroke grestore gsave .214 setgray .56868 .11287 moveto .51415 .10206 lineto .5 0.08791 lineto .56868 0.08791 lineto fill grestore gsave .295 setgray .56868 .11287 moveto .51415 .10206 lineto .56868 .15659 lineto fill grestore gsave 0.001 setlinewidth .56868 .11287 moveto .51415 .10206 lineto stroke grestore gsave .214 setgray .5 0.08791 moveto .5 0.09874 lineto .51415 .10206 lineto fill grestore gsave .295 setgray .5 0.09874 moveto .51415 .10206 lineto .56868 .15659 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .5 0.09874 moveto .51415 .10206 lineto stroke grestore gsave .214 setgray .63736 .14157 moveto .61335 .13258 lineto .56868 0.08791 lineto .63736 0.08791 lineto fill grestore gsave .295 setgray .63736 .14157 moveto .61335 .13258 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .63736 .14157 moveto .61335 .13258 lineto stroke grestore gsave .214 setgray .56868 0.08791 moveto .56868 .11287 lineto .61335 .13258 lineto fill grestore gsave .295 setgray .56868 .11287 moveto .61335 .13258 lineto .63736 .15659 lineto .56868 .15659 lineto fill grestore gsave 0.001 setlinewidth .56868 .11287 moveto .61335 .13258 lineto stroke grestore gsave .132 setgray .70604 0.08791 moveto .70604 0.08844 lineto .70501 0.08791 lineto fill grestore gsave .214 setgray .70604 0.08844 moveto .70501 0.08791 lineto .63736 0.08791 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .70604 0.08844 moveto .70501 0.08791 lineto stroke grestore gsave .214 setgray .63736 .14157 moveto .66304 .15659 lineto .70604 .15659 lineto .63736 0.08791 lineto fill grestore gsave .295 setgray .63736 .14157 moveto .66304 .15659 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .63736 .14157 moveto .66304 .15659 lineto stroke grestore gsave .132 setgray .77473 .14315 moveto .70941 0.09127 lineto .70604 0.08791 lineto .77473 0.08791 lineto fill grestore gsave .214 setgray .77473 .14315 moveto .70941 0.09127 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .77473 .14315 moveto .70941 0.09127 lineto stroke grestore gsave .132 setgray .70604 0.08791 moveto .70604 0.08844 lineto .70941 0.09127 lineto fill grestore gsave .214 setgray .70604 0.08844 moveto .70941 0.09127 lineto .77473 .15659 lineto .70604 .15659 lineto fill grestore gsave 0.001 setlinewidth .70604 0.08844 moveto .70941 0.09127 lineto stroke grestore gsave .132 setgray .84341 0.08791 moveto .77473 0.08791 lineto .84341 .15659 lineto fill grestore gsave .132 setgray .77473 .14315 moveto .79199 .15659 lineto .84341 .15659 lineto .77473 0.08791 lineto fill grestore gsave .214 setgray .77473 .14315 moveto .79199 .15659 lineto .77473 .15659 lineto fill grestore gsave 0.001 setlinewidth .77473 .14315 moveto .79199 .15659 lineto stroke grestore gsave .132 setgray .91209 0.08791 moveto .84341 0.08791 lineto .91209 .15659 lineto fill grestore gsave .132 setgray .84341 0.08791 moveto .91209 .15659 lineto .84341 .15659 lineto fill grestore gsave 0.05 setgray .98077 0.08791 moveto .98077 .13046 lineto .92828 0.08791 lineto fill grestore gsave .132 setgray .98077 .13046 moveto .92828 0.08791 lineto .91209 0.08791 lineto .98077 .15659 lineto fill grestore gsave 0.001 setlinewidth .98077 .13046 moveto .92828 0.08791 lineto stroke grestore gsave .132 setgray .91209 0.08791 moveto .98077 .15659 lineto .91209 .15659 lineto fill grestore gsave 0.05 setgray 0.01923 .15659 moveto 0.02053 .15789 lineto 0.02213 .15659 lineto fill grestore gsave .132 setgray 0.02053 .15789 moveto 0.02213 .15659 lineto 0.08791 .15659 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.02053 .15789 moveto 0.02213 .15659 lineto stroke grestore gsave 0.05 setgray 0.01923 .15659 moveto 0.02053 .15789 lineto 0.01923 .15989 lineto fill grestore gsave .132 setgray 0.02053 .15789 moveto 0.01923 .15989 lineto 0.01923 .22527 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.02053 .15789 moveto 0.01923 .15989 lineto stroke grestore gsave .132 setgray .15257 .22125 moveto .15659 .21802 lineto .15659 .15659 lineto 0.08791 .15659 lineto fill grestore gsave .214 setgray .15257 .22125 moveto .15659 .21802 lineto .15659 .22527 lineto fill grestore gsave 0.001 setlinewidth .15257 .22125 moveto .15659 .21802 lineto stroke grestore gsave .132 setgray .15257 .22125 moveto .14993 .22527 lineto 0.08791 .22527 lineto 0.08791 .15659 lineto fill grestore gsave .214 setgray .15257 .22125 moveto .14993 .22527 lineto .15659 .22527 lineto fill grestore gsave 0.001 setlinewidth .15257 .22125 moveto .14993 .22527 lineto stroke grestore gsave .132 setgray .15659 .15659 moveto .18195 .18195 lineto .2156 .15659 lineto fill grestore gsave .214 setgray .18195 .18195 moveto .2156 .15659 lineto .22527 .15659 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .18195 .18195 moveto .2156 .15659 lineto stroke grestore gsave .132 setgray .15659 .15659 moveto .18195 .18195 lineto .15659 .21802 lineto fill grestore gsave .214 setgray .18195 .18195 moveto .15659 .21802 lineto .15659 .22527 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .18195 .18195 moveto .15659 .21802 lineto stroke grestore gsave .214 setgray .26663 .19795 moveto .29396 .17635 lineto .29396 .15659 lineto .22527 .15659 lineto fill grestore gsave .295 setgray .26663 .19795 moveto .29396 .17635 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .26663 .19795 moveto .29396 .17635 lineto stroke grestore gsave .214 setgray .26663 .19795 moveto .24877 .22527 lineto .22527 .22527 lineto .22527 .15659 lineto fill grestore gsave .295 setgray .26663 .19795 moveto .24877 .22527 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .26663 .19795 moveto .24877 .22527 lineto stroke grestore gsave .214 setgray .29396 .15659 moveto .30463 .16727 lineto .32587 .15659 lineto fill grestore gsave .295 setgray .30463 .16727 moveto .32587 .15659 lineto .36264 .15659 lineto .36264 .20243 lineto .34744 .21007 lineto fill grestore gsave 0.001 setlinewidth .30463 .16727 moveto .32587 .15659 lineto stroke grestore gsave .377 setgray .34744 .21007 moveto .36264 .20243 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .34744 .21007 moveto .36264 .20243 lineto stroke grestore gsave .214 setgray .29396 .15659 moveto .30463 .16727 lineto .29396 .17635 lineto fill grestore gsave .295 setgray .30463 .16727 moveto .29396 .17635 lineto .29396 .22527 lineto .32956 .22527 lineto .34744 .21007 lineto fill grestore gsave 0.001 setlinewidth .30463 .16727 moveto .29396 .17635 lineto stroke grestore gsave .377 setgray .34744 .21007 moveto .32956 .22527 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .34744 .21007 moveto .32956 .22527 lineto stroke grestore gsave .295 setgray .39292 .18688 moveto .43132 .17448 lineto .43132 .15659 lineto .36264 .15659 lineto fill grestore gsave .377 setgray .39292 .18688 moveto .43132 .17448 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .39292 .18688 moveto .43132 .17448 lineto stroke grestore gsave .295 setgray .36264 .15659 moveto .39292 .18688 lineto .36264 .20243 lineto fill grestore gsave .377 setgray .39292 .18688 moveto .36264 .20243 lineto .36264 .22527 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .39292 .18688 moveto .36264 .20243 lineto stroke grestore gsave .295 setgray .44656 .17183 moveto .5 .16612 lineto .5 .15659 lineto .43132 .15659 lineto fill grestore gsave .377 setgray .44656 .17183 moveto .5 .16612 lineto .5 .21915 lineto .49447 .21975 lineto fill grestore gsave 0.001 setlinewidth .44656 .17183 moveto .5 .16612 lineto stroke grestore gsave .459 setgray .49447 .21975 moveto .5 .21915 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .49447 .21975 moveto .5 .21915 lineto stroke grestore gsave .295 setgray .43132 .15659 moveto .44656 .17183 lineto .43132 .17448 lineto fill grestore gsave .377 setgray .44656 .17183 moveto .43132 .17448 lineto .43132 .22527 lineto .4626 .22527 lineto .49447 .21975 lineto fill grestore gsave 0.001 setlinewidth .44656 .17183 moveto .43132 .17448 lineto stroke grestore gsave .459 setgray .49447 .21975 moveto .4626 .22527 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .49447 .21975 moveto .4626 .22527 lineto stroke grestore gsave .295 setgray .56868 .1789 moveto .512 .16859 lineto .5 .15659 lineto .56868 .15659 lineto fill grestore gsave .377 setgray .56868 .1789 moveto .512 .16859 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .56868 .1789 moveto .512 .16859 lineto stroke grestore gsave .295 setgray .5 .15659 moveto .5 .16612 lineto .512 .16859 lineto fill grestore gsave .377 setgray .5 .16612 moveto .512 .16859 lineto .56868 .22527 lineto .52971 .22527 lineto .5 .21915 lineto fill grestore gsave 0.001 setlinewidth .5 .16612 moveto .512 .16859 lineto stroke grestore gsave .459 setgray .5 .21915 moveto .52971 .22527 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .5 .21915 moveto .52971 .22527 lineto stroke grestore gsave .295 setgray .63736 .20596 moveto .60718 .19509 lineto .56868 .15659 lineto .63736 .15659 lineto fill grestore gsave .377 setgray .63736 .20596 moveto .60718 .19509 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .63736 .20596 moveto .60718 .19509 lineto stroke grestore gsave .295 setgray .56868 .15659 moveto .56868 .1789 lineto .60718 .19509 lineto fill grestore gsave .377 setgray .56868 .1789 moveto .60718 .19509 lineto .63736 .22527 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .56868 .1789 moveto .60718 .19509 lineto stroke grestore gsave .214 setgray .70604 .15659 moveto .70604 .17811 lineto .66304 .15659 lineto fill grestore gsave .295 setgray .70604 .17811 moveto .66304 .15659 lineto .63736 .15659 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .70604 .17811 moveto .66304 .15659 lineto stroke grestore gsave .295 setgray .63736 .20596 moveto .671 .22527 lineto .70604 .22527 lineto .63736 .15659 lineto fill grestore gsave .377 setgray .63736 .20596 moveto .671 .22527 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .63736 .20596 moveto .671 .22527 lineto stroke grestore gsave .214 setgray .77473 .15659 moveto .70604 .15659 lineto .77473 .22527 lineto fill grestore gsave .214 setgray .70604 .17811 moveto .76158 .22527 lineto .77473 .22527 lineto .70604 .15659 lineto fill grestore gsave .295 setgray .70604 .17811 moveto .76158 .22527 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .70604 .17811 moveto .76158 .22527 lineto stroke grestore gsave .132 setgray .84341 .15659 moveto .84341 .19412 lineto .79199 .15659 lineto fill grestore gsave .214 setgray .84341 .19412 moveto .79199 .15659 lineto .77473 .15659 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .84341 .19412 moveto .79199 .15659 lineto stroke grestore gsave .214 setgray .77473 .15659 moveto .84341 .22527 lineto .77473 .22527 lineto fill grestore gsave .132 setgray .91209 .15659 moveto .84341 .15659 lineto .91209 .22527 lineto fill grestore gsave .132 setgray .84341 .19412 moveto .88002 .22527 lineto .91209 .22527 lineto .84341 .15659 lineto fill grestore gsave .214 setgray .84341 .19412 moveto .88002 .22527 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .84341 .19412 moveto .88002 .22527 lineto stroke grestore gsave .132 setgray .98077 .15659 moveto .91209 .15659 lineto .98077 .22527 lineto fill grestore gsave .132 setgray .91209 .15659 moveto .98077 .22527 lineto .91209 .22527 lineto fill grestore gsave .132 setgray 0.08584 .29188 moveto 0.08791 .29032 lineto 0.08791 .22527 lineto 0.01923 .22527 lineto fill grestore gsave .214 setgray 0.08584 .29188 moveto 0.08791 .29032 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.08584 .29188 moveto 0.08791 .29032 lineto stroke grestore gsave .132 setgray 0.08584 .29188 moveto 0.08445 .29396 lineto 0.01923 .29396 lineto 0.01923 .22527 lineto fill grestore gsave .214 setgray 0.08584 .29188 moveto 0.08445 .29396 lineto 0.08791 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.08584 .29188 moveto 0.08445 .29396 lineto stroke grestore gsave .132 setgray 0.08791 .22527 moveto .11422 .25159 lineto .14993 .22527 lineto fill grestore gsave .214 setgray .11422 .25159 moveto .14993 .22527 lineto .15659 .22527 lineto .15659 .29396 lineto fill grestore gsave 0.001 setlinewidth .11422 .25159 moveto .14993 .22527 lineto stroke grestore gsave .132 setgray 0.08791 .22527 moveto .11422 .25159 lineto 0.08791 .29032 lineto fill grestore gsave .214 setgray .11422 .25159 moveto 0.08791 .29032 lineto 0.08791 .29396 lineto .15659 .29396 lineto fill grestore gsave 0.001 setlinewidth .11422 .25159 moveto 0.08791 .29032 lineto stroke grestore gsave .214 setgray .19891 .26759 moveto .22527 .24938 lineto .22527 .22527 lineto .15659 .22527 lineto fill grestore gsave .295 setgray .19891 .26759 moveto .22527 .24938 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .19891 .26759 moveto .22527 .24938 lineto stroke grestore gsave .214 setgray .19891 .26759 moveto .17943 .29396 lineto .15659 .29396 lineto .15659 .22527 lineto fill grestore gsave .295 setgray .19891 .26759 moveto .17943 .29396 lineto .22527 .29396 lineto fill grestore gsave 0.001 setlinewidth .19891 .26759 moveto .17943 .29396 lineto stroke grestore gsave .214 setgray .22527 .22527 moveto .23513 .23513 lineto .24877 .22527 lineto fill grestore gsave .295 setgray .23513 .23513 moveto .24877 .22527 lineto .29396 .22527 lineto .29396 .24547 lineto .26581 .26581 lineto fill grestore gsave 0.001 setlinewidth .23513 .23513 moveto .24877 .22527 lineto stroke grestore gsave .377 setgray .26581 .26581 moveto .29396 .24547 lineto .29396 .29396 lineto fill grestore gsave 0.001 setlinewidth .26581 .26581 moveto .29396 .24547 lineto stroke grestore gsave .214 setgray .22527 .22527 moveto .23513 .23513 lineto .22527 .24938 lineto fill grestore gsave .295 setgray .23513 .23513 moveto .22527 .24938 lineto .22527 .29396 lineto .24635 .29396 lineto .26581 .26581 lineto fill grestore gsave 0.001 setlinewidth .23513 .23513 moveto .22527 .24938 lineto stroke grestore gsave .377 setgray .26581 .26581 moveto .24635 .29396 lineto .29396 .29396 lineto fill grestore gsave 0.001 setlinewidth .26581 .26581 moveto .24635 .29396 lineto stroke grestore gsave .295 setgray .29396 .22527 moveto .30516 .23648 lineto .32956 .22527 lineto fill grestore gsave .377 setgray .30516 .23648 moveto .32956 .22527 lineto .36264 .22527 lineto .36264 .25285 lineto .33446 .26578 lineto fill grestore gsave 0.001 setlinewidth .30516 .23648 moveto .32956 .22527 lineto stroke grestore gsave .459 setgray .33446 .26578 moveto .36264 .25285 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .33446 .26578 moveto .36264 .25285 lineto stroke grestore gsave .295 setgray .29396 .22527 moveto .30516 .23648 lineto .29396 .24547 lineto fill grestore gsave .377 setgray .30516 .23648 moveto .29396 .24547 lineto .29396 .29396 lineto .29938 .29396 lineto .33446 .26578 lineto fill grestore gsave 0.001 setlinewidth .30516 .23648 moveto .29396 .24547 lineto stroke grestore gsave .459 setgray .33446 .26578 moveto .29938 .29396 lineto .36264 .29396 lineto fill grestore gsave 0.001 setlinewidth .33446 .26578 moveto .29938 .29396 lineto stroke grestore gsave .377 setgray .3811 .24373 moveto .43132 .22886 lineto .43132 .22527 lineto .36264 .22527 lineto fill grestore gsave .459 setgray .3811 .24373 moveto .43132 .22886 lineto .43132 .26596 lineto .40972 .27236 lineto fill grestore gsave 0.001 setlinewidth .3811 .24373 moveto .43132 .22886 lineto stroke grestore gsave .541 setgray .40972 .27236 moveto .43132 .26596 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .40972 .27236 moveto .43132 .26596 lineto stroke grestore gsave .377 setgray .36264 .22527 moveto .3811 .24373 lineto .36264 .25285 lineto fill grestore gsave .459 setgray .3811 .24373 moveto .36264 .25285 lineto .36264 .29396 lineto .36598 .29396 lineto .40972 .27236 lineto fill grestore gsave 0.001 setlinewidth .3811 .24373 moveto .36264 .25285 lineto stroke grestore gsave .541 setgray .40972 .27236 moveto .36598 .29396 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .40972 .27236 moveto .36598 .29396 lineto stroke grestore gsave .377 setgray .43132 .22527 moveto .43434 .22829 lineto .4626 .22527 lineto fill grestore gsave .459 setgray .43434 .22829 moveto .4626 .22527 lineto .5 .22527 lineto .5 .25587 lineto .46558 .25954 lineto fill grestore gsave 0.001 setlinewidth .43434 .22829 moveto .4626 .22527 lineto stroke grestore gsave .541 setgray .46558 .25954 moveto .5 .25587 lineto .5 .29045 lineto .49683 .29079 lineto fill grestore gsave 0.001 setlinewidth .46558 .25954 moveto .5 .25587 lineto stroke grestore gsave .623 setgray .49683 .29079 moveto .5 .29045 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .49683 .29079 moveto .5 .29045 lineto stroke grestore gsave .377 setgray .43132 .22527 moveto .43434 .22829 lineto .43132 .22886 lineto fill grestore gsave .459 setgray .43434 .22829 moveto .43132 .22886 lineto .43132 .26596 lineto .46558 .25954 lineto fill grestore gsave 0.001 setlinewidth .43434 .22829 moveto .43132 .22886 lineto stroke grestore gsave .541 setgray .46558 .25954 moveto .43132 .26596 lineto .43132 .29396 lineto .47991 .29396 lineto .49683 .29079 lineto fill grestore gsave 0.001 setlinewidth .46558 .25954 moveto .43132 .26596 lineto stroke grestore gsave .623 setgray .49683 .29079 moveto .47991 .29396 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .49683 .29079 moveto .47991 .29396 lineto stroke grestore gsave .377 setgray .56868 .22527 moveto .56868 .23057 lineto .52971 .22527 lineto fill grestore gsave .459 setgray .56868 .23057 moveto .52971 .22527 lineto .5 .22527 lineto .53581 .26109 lineto .56868 .26555 lineto fill grestore gsave 0.001 setlinewidth .56868 .23057 moveto .52971 .22527 lineto stroke grestore gsave .541 setgray .56868 .26555 moveto .53581 .26109 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56868 .26555 moveto .53581 .26109 lineto stroke grestore gsave .459 setgray .5 .22527 moveto .5 .25587 lineto .53581 .26109 lineto fill grestore gsave .541 setgray .5 .25587 moveto .53581 .26109 lineto .56868 .29396 lineto .52406 .29396 lineto .5 .29045 lineto fill grestore gsave 0.001 setlinewidth .5 .25587 moveto .53581 .26109 lineto stroke grestore gsave .623 setgray .5 .29045 moveto .52406 .29396 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .5 .29045 moveto .52406 .29396 lineto stroke grestore gsave .377 setgray .63736 .25123 moveto .57686 .23345 lineto .56868 .22527 lineto .63736 .22527 lineto fill grestore gsave .459 setgray .63736 .25123 moveto .57686 .23345 lineto .63091 .2875 lineto .63736 .2894 lineto fill grestore gsave 0.001 setlinewidth .63736 .25123 moveto .57686 .23345 lineto stroke grestore gsave .541 setgray .63736 .2894 moveto .63091 .2875 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .63736 .2894 moveto .63091 .2875 lineto stroke grestore gsave .377 setgray .56868 .22527 moveto .56868 .23057 lineto .57686 .23345 lineto fill grestore gsave .459 setgray .56868 .23057 moveto .57686 .23345 lineto .63091 .2875 lineto .56868 .26555 lineto fill grestore gsave 0.001 setlinewidth .56868 .23057 moveto .57686 .23345 lineto stroke grestore gsave .541 setgray .56868 .26555 moveto .63091 .2875 lineto .63736 .29396 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .56868 .26555 moveto .63091 .2875 lineto stroke grestore gsave .295 setgray .70604 .22527 moveto .70604 .24011 lineto .671 .22527 lineto fill grestore gsave .377 setgray .70604 .24011 moveto .671 .22527 lineto .63736 .22527 lineto .6898 .27772 lineto .70604 .28459 lineto fill grestore gsave 0.001 setlinewidth .70604 .24011 moveto .671 .22527 lineto stroke grestore gsave .459 setgray .70604 .28459 moveto .6898 .27772 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70604 .28459 moveto .6898 .27772 lineto stroke grestore gsave .377 setgray .63736 .22527 moveto .63736 .25123 lineto .6898 .27772 lineto fill grestore gsave .459 setgray .63736 .25123 moveto .6898 .27772 lineto .70604 .29396 lineto .64639 .29396 lineto .63736 .2894 lineto fill grestore gsave 0.001 setlinewidth .63736 .25123 moveto .6898 .27772 lineto stroke grestore gsave .541 setgray .63736 .2894 moveto .64639 .29396 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .63736 .2894 moveto .64639 .29396 lineto stroke grestore gsave .214 setgray .77473 .22527 moveto .77473 .23449 lineto .76158 .22527 lineto fill grestore gsave .295 setgray .77473 .23449 moveto .76158 .22527 lineto .70604 .22527 lineto .77117 .29041 lineto .77473 .29289 lineto fill grestore gsave 0.001 setlinewidth .77473 .23449 moveto .76158 .22527 lineto stroke grestore gsave .377 setgray .77473 .29289 moveto .77117 .29041 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .77473 .29289 moveto .77117 .29041 lineto stroke grestore gsave .295 setgray .70604 .22527 moveto .70604 .24011 lineto .77117 .29041 lineto fill grestore gsave .377 setgray .70604 .24011 moveto .77117 .29041 lineto .77473 .29396 lineto .71817 .29396 lineto .70604 .28459 lineto fill grestore gsave 0.001 setlinewidth .70604 .24011 moveto .77117 .29041 lineto stroke grestore gsave .459 setgray .70604 .28459 moveto .71817 .29396 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70604 .28459 moveto .71817 .29396 lineto stroke grestore gsave .214 setgray .84341 .28187 moveto .80896 .25951 lineto .77473 .22527 lineto .84341 .22527 lineto fill grestore gsave .295 setgray .84341 .28187 moveto .80896 .25951 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .28187 moveto .80896 .25951 lineto stroke grestore gsave .214 setgray .77473 .22527 moveto .77473 .23449 lineto .80896 .25951 lineto fill grestore gsave .295 setgray .77473 .23449 moveto .80896 .25951 lineto .84341 .29396 lineto .77618 .29396 lineto .77473 .29289 lineto fill grestore gsave 0.001 setlinewidth .77473 .23449 moveto .80896 .25951 lineto stroke grestore gsave .377 setgray .77473 .29289 moveto .77618 .29396 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .77473 .29289 moveto .77618 .29396 lineto stroke grestore gsave .132 setgray .91209 .22527 moveto .91209 .24812 lineto .88002 .22527 lineto fill grestore gsave .214 setgray .91209 .24812 moveto .88002 .22527 lineto .84341 .22527 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .24812 moveto .88002 .22527 lineto stroke grestore gsave .214 setgray .84341 .28187 moveto .85882 .29396 lineto .91209 .29396 lineto .84341 .22527 lineto fill grestore gsave .295 setgray .84341 .28187 moveto .85882 .29396 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .28187 moveto .85882 .29396 lineto stroke grestore gsave .132 setgray .98077 .22527 moveto .91209 .22527 lineto .98077 .29396 lineto fill grestore gsave .132 setgray .91209 .24812 moveto .96942 .29396 lineto .98077 .29396 lineto .91209 .22527 lineto fill grestore gsave .214 setgray .91209 .24812 moveto .96942 .29396 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .24812 moveto .96942 .29396 lineto stroke grestore gsave .132 setgray 0.01923 .29396 moveto 0.05661 .33134 lineto 0.08445 .29396 lineto fill grestore gsave .214 setgray 0.05661 .33134 moveto 0.08445 .29396 lineto 0.08791 .29396 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.05661 .33134 moveto 0.08445 .29396 lineto stroke grestore gsave .132 setgray 0.05661 .33134 moveto 0.04375 .36264 lineto 0.01923 .36264 lineto 0.01923 .29396 lineto fill grestore gsave .214 setgray 0.05661 .33134 moveto 0.04375 .36264 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.05661 .33134 moveto 0.04375 .36264 lineto stroke grestore gsave .214 setgray .14358 .34962 moveto .15659 .33274 lineto .15659 .29396 lineto 0.08791 .29396 lineto fill grestore gsave .295 setgray .14358 .34962 moveto .15659 .33274 lineto .15659 .36264 lineto fill grestore gsave 0.001 setlinewidth .14358 .34962 moveto .15659 .33274 lineto stroke grestore gsave .214 setgray .14358 .34962 moveto .13801 .36264 lineto 0.08791 .36264 lineto 0.08791 .29396 lineto fill grestore gsave .295 setgray .14358 .34962 moveto .13801 .36264 lineto .15659 .36264 lineto fill grestore gsave 0.001 setlinewidth .14358 .34962 moveto .13801 .36264 lineto stroke grestore gsave .214 setgray .15659 .29396 moveto .16908 .30645 lineto .17943 .29396 lineto fill grestore gsave .295 setgray .16908 .30645 moveto .17943 .29396 lineto .22527 .29396 lineto .22527 .3318 lineto .2113 .34866 lineto fill grestore gsave 0.001 setlinewidth .16908 .30645 moveto .17943 .29396 lineto stroke grestore gsave .377 setgray .2113 .34866 moveto .22527 .3318 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .2113 .34866 moveto .22527 .3318 lineto stroke grestore gsave .214 setgray .15659 .29396 moveto .16908 .30645 lineto .15659 .33274 lineto fill grestore gsave .295 setgray .16908 .30645 moveto .15659 .33274 lineto .15659 .36264 lineto .20466 .36264 lineto .2113 .34866 lineto fill grestore gsave 0.001 setlinewidth .16908 .30645 moveto .15659 .33274 lineto stroke grestore gsave .377 setgray .2113 .34866 moveto .20466 .36264 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .2113 .34866 moveto .20466 .36264 lineto stroke grestore gsave .295 setgray .22527 .29396 moveto .23702 .3057 lineto .24635 .29396 lineto fill grestore gsave .377 setgray .23702 .3057 moveto .24635 .29396 lineto .29396 .29396 lineto .29396 .29935 lineto .26595 .33463 lineto fill grestore gsave 0.001 setlinewidth .23702 .3057 moveto .24635 .29396 lineto stroke grestore gsave .459 setgray .26595 .33463 moveto .29396 .29935 lineto .29396 .36264 lineto fill grestore gsave 0.001 setlinewidth .26595 .33463 moveto .29396 .29935 lineto stroke grestore gsave .295 setgray .22527 .29396 moveto .23702 .3057 lineto .22527 .3318 lineto fill grestore gsave .377 setgray .23702 .3057 moveto .22527 .3318 lineto .22527 .36264 lineto .25334 .36264 lineto .26595 .33463 lineto fill grestore gsave 0.001 setlinewidth .23702 .3057 moveto .22527 .3318 lineto stroke grestore gsave .459 setgray .26595 .33463 moveto .25334 .36264 lineto .29396 .36264 lineto fill grestore gsave 0.001 setlinewidth .26595 .33463 moveto .25334 .36264 lineto stroke grestore gsave .377 setgray .29396 .29396 moveto .29637 .29637 lineto .29938 .29396 lineto fill grestore gsave .459 setgray .29637 .29637 moveto .29938 .29396 lineto .36264 .29396 lineto .36264 .296 lineto .32566 .32566 lineto fill grestore gsave 0.001 setlinewidth .29637 .29637 moveto .29938 .29396 lineto stroke grestore gsave .541 setgray .32566 .32566 moveto .36264 .296 lineto .36264 .34878 lineto .35495 .35495 lineto fill grestore gsave 0.001 setlinewidth .32566 .32566 moveto .36264 .296 lineto stroke grestore gsave .623 setgray .35495 .35495 moveto .36264 .34878 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .35495 .35495 moveto .36264 .34878 lineto stroke grestore gsave .377 setgray .29396 .29396 moveto .29637 .29637 lineto .29396 .29935 lineto fill grestore gsave .459 setgray .29637 .29637 moveto .29396 .29935 lineto .29396 .36264 lineto .29563 .36264 lineto .32566 .32566 lineto fill grestore gsave 0.001 setlinewidth .29637 .29637 moveto .29396 .29935 lineto stroke grestore gsave .541 setgray .32566 .32566 moveto .29563 .36264 lineto .3487 .36264 lineto .35495 .35495 lineto fill grestore gsave 0.001 setlinewidth .32566 .32566 moveto .29563 .36264 lineto stroke grestore gsave .623 setgray .35495 .35495 moveto .3487 .36264 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .35495 .35495 moveto .3487 .36264 lineto stroke grestore gsave .459 setgray .36264 .29396 moveto .36379 .29511 lineto .36598 .29396 lineto fill grestore gsave .541 setgray .36379 .29511 moveto .36598 .29396 lineto .43132 .29396 lineto .43132 .30513 lineto .39364 .32496 lineto fill grestore gsave 0.001 setlinewidth .36379 .29511 moveto .36598 .29396 lineto stroke grestore gsave .623 setgray .39364 .32496 moveto .43132 .30513 lineto .43132 .35068 lineto .42348 .3548 lineto fill grestore gsave 0.001 setlinewidth .39364 .32496 moveto .43132 .30513 lineto stroke grestore gsave .705 setgray .42348 .3548 moveto .43132 .35068 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .42348 .3548 moveto .43132 .35068 lineto stroke grestore gsave .459 setgray .36264 .29396 moveto .36379 .29511 lineto .36264 .296 lineto fill grestore gsave .541 setgray .36379 .29511 moveto .36264 .296 lineto .36264 .34878 lineto .39364 .32496 lineto fill grestore gsave 0.001 setlinewidth .36379 .29511 moveto .36264 .296 lineto stroke grestore gsave .623 setgray .39364 .32496 moveto .36264 .34878 lineto .36264 .36264 lineto .41329 .36264 lineto .42348 .3548 lineto fill grestore gsave 0.001 setlinewidth .39364 .32496 moveto .36264 .34878 lineto stroke grestore gsave .705 setgray .42348 .3548 moveto .41329 .36264 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .42348 .3548 moveto .41329 .36264 lineto stroke grestore gsave .541 setgray .43132 .29396 moveto .43983 .30247 lineto .47991 .29396 lineto fill grestore gsave .623 setgray .43983 .30247 moveto .47991 .29396 lineto .5 .29396 lineto .5 .33174 lineto .47452 .33715 lineto fill grestore gsave 0.001 setlinewidth .43983 .30247 moveto .47991 .29396 lineto stroke grestore gsave .705 setgray .47452 .33715 moveto .5 .33174 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .47452 .33715 moveto .5 .33174 lineto stroke grestore gsave .541 setgray .43132 .29396 moveto .43983 .30247 lineto .43132 .30513 lineto fill grestore gsave .623 setgray .43983 .30247 moveto .43132 .30513 lineto .43132 .35068 lineto .47452 .33715 lineto fill grestore gsave 0.001 setlinewidth .43983 .30247 moveto .43132 .30513 lineto stroke grestore gsave .705 setgray .47452 .33715 moveto .43132 .35068 lineto .43132 .36264 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .47452 .33715 moveto .43132 .35068 lineto stroke grestore gsave .541 setgray .56868 .29396 moveto .56868 .30186 lineto .52406 .29396 lineto fill grestore gsave .623 setgray .56868 .30186 moveto .52406 .29396 lineto .5 .29396 lineto .54585 .33981 lineto .56868 .34385 lineto fill grestore gsave 0.001 setlinewidth .56868 .30186 moveto .52406 .29396 lineto stroke grestore gsave .705 setgray .56868 .34385 moveto .54585 .33981 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .56868 .34385 moveto .54585 .33981 lineto stroke grestore gsave .623 setgray .5 .29396 moveto .5 .33174 lineto .54585 .33981 lineto fill grestore gsave .705 setgray .5 .33174 moveto .54585 .33981 lineto .56868 .36264 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .5 .33174 moveto .54585 .33981 lineto stroke grestore gsave .541 setgray .63736 .33403 moveto .5845 .30977 lineto .56868 .29396 lineto .63736 .29396 lineto fill grestore gsave .623 setgray .63736 .33403 moveto .5845 .30977 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .63736 .33403 moveto .5845 .30977 lineto stroke grestore gsave .541 setgray .56868 .29396 moveto .56868 .30186 lineto .5845 .30977 lineto fill grestore gsave .623 setgray .56868 .30186 moveto .5845 .30977 lineto .63736 .36264 lineto .60621 .36264 lineto .56868 .34385 lineto fill grestore gsave 0.001 setlinewidth .56868 .30186 moveto .5845 .30977 lineto stroke grestore gsave .705 setgray .56868 .34385 moveto .60621 .36264 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .56868 .34385 moveto .60621 .36264 lineto stroke grestore gsave .459 setgray .70604 .29396 moveto .70604 .33573 lineto .64639 .29396 lineto fill grestore gsave .541 setgray .70604 .33573 moveto .64639 .29396 lineto .63736 .29396 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .70604 .33573 moveto .64639 .29396 lineto stroke grestore gsave .541 setgray .63736 .33403 moveto .67591 .36264 lineto .70604 .36264 lineto .63736 .29396 lineto fill grestore gsave .623 setgray .63736 .33403 moveto .67591 .36264 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .63736 .33403 moveto .67591 .36264 lineto stroke grestore gsave .377 setgray .77473 .29396 moveto .71817 .29396 lineto .77473 .36217 lineto fill grestore gsave .459 setgray .71817 .29396 moveto .77473 .36217 lineto .77473 .36264 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .71817 .29396 moveto .77473 .36217 lineto stroke grestore gsave .459 setgray .7293 .36264 moveto .70604 .33573 lineto .70604 .29396 lineto .77473 .36264 lineto fill grestore gsave .541 setgray .7293 .36264 moveto .70604 .33573 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .7293 .36264 moveto .70604 .33573 lineto stroke grestore gsave .295 setgray .77618 .29396 moveto .78711 .30634 lineto .84341 .36264 lineto .84341 .29396 lineto fill grestore gsave .377 setgray .77618 .29396 moveto .78711 .30634 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .77618 .29396 moveto .78711 .30634 lineto stroke grestore gsave .295 setgray .84341 .36264 moveto .8382 .36264 lineto .78711 .30634 lineto fill grestore gsave .377 setgray .8382 .36264 moveto .78711 .30634 lineto .77473 .29396 lineto .77473 .36217 lineto .77515 .36264 lineto fill grestore gsave 0.001 setlinewidth .8382 .36264 moveto .78711 .30634 lineto stroke grestore gsave .459 setgray .77515 .36264 moveto .77473 .36217 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .77515 .36264 moveto .77473 .36217 lineto stroke grestore gsave .214 setgray .91209 .29396 moveto .85882 .29396 lineto .91209 .35996 lineto fill grestore gsave .295 setgray .85882 .29396 moveto .91209 .35996 lineto .91209 .36264 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .85882 .29396 moveto .91209 .35996 lineto stroke grestore gsave .295 setgray .91209 .36264 moveto .84341 .29396 lineto .84341 .36264 lineto fill grestore gsave .132 setgray .98077 .29396 moveto .96942 .29396 lineto .98077 .30827 lineto fill grestore gsave .214 setgray .96942 .29396 moveto .98077 .30827 lineto .98077 .36264 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .96942 .29396 moveto .98077 .30827 lineto stroke grestore gsave .214 setgray .91433 .36264 moveto .91209 .35996 lineto .91209 .29396 lineto .98077 .36264 lineto fill grestore gsave .295 setgray .91433 .36264 moveto .91209 .35996 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91433 .36264 moveto .91209 .35996 lineto stroke grestore gsave .132 setgray 0.01923 .36264 moveto 0.0362 .37961 lineto 0.04375 .36264 lineto fill grestore gsave .214 setgray 0.0362 .37961 moveto 0.04375 .36264 lineto 0.08791 .36264 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.0362 .37961 moveto 0.04375 .36264 lineto stroke grestore gsave .132 setgray 0.0362 .37961 moveto 0.02332 .43132 lineto 0.01923 .43132 lineto 0.01923 .36264 lineto fill grestore gsave .214 setgray 0.0362 .37961 moveto 0.02332 .43132 lineto 0.08791 .43132 lineto fill grestore gsave 0.001 setlinewidth 0.0362 .37961 moveto 0.02332 .43132 lineto stroke grestore gsave .214 setgray 0.08791 .36264 moveto .12185 .39657 lineto .13801 .36264 lineto fill grestore gsave .295 setgray .12185 .39657 moveto .13801 .36264 lineto .15659 .36264 lineto .15659 .43132 lineto fill grestore gsave 0.001 setlinewidth .12185 .39657 moveto .13801 .36264 lineto stroke grestore gsave .214 setgray .12185 .39657 moveto .11237 .43132 lineto 0.08791 .43132 lineto 0.08791 .36264 lineto fill grestore gsave .295 setgray .12185 .39657 moveto .11237 .43132 lineto .15659 .43132 lineto fill grestore gsave 0.001 setlinewidth .12185 .39657 moveto .11237 .43132 lineto stroke grestore gsave .295 setgray .15659 .36264 moveto .18816 .3942 lineto .20466 .36264 lineto fill grestore gsave .377 setgray .18816 .3942 moveto .20466 .36264 lineto .22527 .36264 lineto .22527 .43132 lineto fill grestore gsave 0.001 setlinewidth .18816 .3942 moveto .20466 .36264 lineto stroke grestore gsave .295 setgray .18816 .3942 moveto .17651 .43132 lineto .15659 .43132 lineto .15659 .36264 lineto fill grestore gsave .377 setgray .18816 .3942 moveto .17651 .43132 lineto .22527 .43132 lineto fill grestore gsave 0.001 setlinewidth .18816 .3942 moveto .17651 .43132 lineto stroke grestore gsave .377 setgray .22527 .36264 moveto .24388 .38124 lineto .25334 .36264 lineto fill grestore gsave .459 setgray .24388 .38124 moveto .25334 .36264 lineto .29396 .36264 lineto .29396 .36524 lineto .27168 .40904 lineto fill grestore gsave 0.001 setlinewidth .24388 .38124 moveto .25334 .36264 lineto stroke grestore gsave .541 setgray .27168 .40904 moveto .29396 .36524 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .27168 .40904 moveto .29396 .36524 lineto stroke grestore gsave .377 setgray .24388 .38124 moveto .22863 .43132 lineto .22527 .43132 lineto .22527 .36264 lineto fill grestore gsave .459 setgray .24388 .38124 moveto .22863 .43132 lineto .2649 .43132 lineto .27168 .40904 lineto fill grestore gsave 0.001 setlinewidth .24388 .38124 moveto .22863 .43132 lineto stroke grestore gsave .541 setgray .27168 .40904 moveto .2649 .43132 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .27168 .40904 moveto .2649 .43132 lineto stroke grestore gsave .459 setgray .29396 .36264 moveto .29489 .36357 lineto .29563 .36264 lineto fill grestore gsave .541 setgray .29489 .36357 moveto .29563 .36264 lineto .3487 .36264 lineto .32435 .39303 lineto fill grestore gsave 0.001 setlinewidth .29489 .36357 moveto .29563 .36264 lineto stroke grestore gsave .623 setgray .32435 .39303 moveto .3487 .36264 lineto .36264 .36264 lineto .36264 .41148 lineto .35382 .4225 lineto fill grestore gsave 0.001 setlinewidth .32435 .39303 moveto .3487 .36264 lineto stroke grestore gsave .705 setgray .35382 .4225 moveto .36264 .41148 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .35382 .4225 moveto .36264 .41148 lineto stroke grestore gsave .459 setgray .29396 .36264 moveto .29489 .36357 lineto .29396 .36524 lineto fill grestore gsave .541 setgray .29489 .36357 moveto .29396 .36524 lineto .29396 .43132 lineto .30307 .43132 lineto .32435 .39303 lineto fill grestore gsave 0.001 setlinewidth .29489 .36357 moveto .29396 .36524 lineto stroke grestore gsave .623 setgray .32435 .39303 moveto .30307 .43132 lineto .34891 .43132 lineto .35382 .4225 lineto fill grestore gsave 0.001 setlinewidth .32435 .39303 moveto .30307 .43132 lineto stroke grestore gsave .705 setgray .35382 .4225 moveto .34891 .43132 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .35382 .4225 moveto .34891 .43132 lineto stroke grestore gsave .623 setgray .36264 .36264 moveto .38557 .38557 lineto .41329 .36264 lineto fill grestore gsave .705 setgray .38557 .38557 moveto .41329 .36264 lineto .43132 .36264 lineto .43132 .40457 lineto .41668 .41668 lineto fill grestore gsave 0.001 setlinewidth .38557 .38557 moveto .41329 .36264 lineto stroke grestore gsave .786 setgray .41668 .41668 moveto .43132 .40457 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .41668 .41668 moveto .43132 .40457 lineto stroke grestore gsave .623 setgray .36264 .36264 moveto .38557 .38557 lineto .36264 .41148 lineto fill grestore gsave .705 setgray .38557 .38557 moveto .36264 .41148 lineto .36264 .43132 lineto .40372 .43132 lineto .41668 .41668 lineto fill grestore gsave 0.001 setlinewidth .38557 .38557 moveto .36264 .41148 lineto stroke grestore gsave .786 setgray .41668 .41668 moveto .40372 .43132 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .41668 .41668 moveto .40372 .43132 lineto stroke grestore gsave .705 setgray .45962 .39094 moveto .5 .37646 lineto .5 .36264 lineto .43132 .36264 lineto fill grestore gsave .786 setgray .45962 .39094 moveto .5 .37646 lineto .5 .42859 lineto .49799 .42931 lineto fill grestore gsave 0.001 setlinewidth .45962 .39094 moveto .5 .37646 lineto stroke grestore gsave .868 setgray .49799 .42931 moveto .5 .42859 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .49799 .42931 moveto .5 .42859 lineto stroke grestore gsave .705 setgray .43132 .36264 moveto .45962 .39094 lineto .43132 .40457 lineto fill grestore gsave .786 setgray .45962 .39094 moveto .43132 .40457 lineto .43132 .43132 lineto .49382 .43132 lineto .49799 .42931 lineto fill grestore gsave 0.001 setlinewidth .45962 .39094 moveto .43132 .40457 lineto stroke grestore gsave .868 setgray .49799 .42931 moveto .49382 .43132 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .49799 .42931 moveto .49382 .43132 lineto stroke grestore gsave .705 setgray .56868 .39113 moveto .51744 .38008 lineto .5 .36264 lineto .56868 .36264 lineto fill grestore gsave .786 setgray .56868 .39113 moveto .51744 .38008 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .56868 .39113 moveto .51744 .38008 lineto stroke grestore gsave .705 setgray .5 .36264 moveto .5 .37646 lineto .51744 .38008 lineto fill grestore gsave .786 setgray .5 .37646 moveto .51744 .38008 lineto .56868 .43132 lineto .51317 .43132 lineto .5 .42859 lineto fill grestore gsave 0.001 setlinewidth .5 .37646 moveto .51744 .38008 lineto stroke grestore gsave .868 setgray .5 .42859 moveto .51317 .43132 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .5 .42859 moveto .51317 .43132 lineto stroke grestore gsave .623 setgray .63736 .36264 moveto .63736 .38328 lineto .60621 .36264 lineto fill grestore gsave .705 setgray .63736 .38328 moveto .60621 .36264 lineto .56868 .36264 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .63736 .38328 moveto .60621 .36264 lineto stroke grestore gsave .705 setgray .56868 .39113 moveto .62717 .43132 lineto .63736 .43132 lineto .56868 .36264 lineto fill grestore gsave .786 setgray .56868 .39113 moveto .62717 .43132 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .56868 .39113 moveto .62717 .43132 lineto stroke grestore gsave .541 setgray .70604 .36264 moveto .67591 .36264 lineto .70604 .39432 lineto fill grestore gsave .623 setgray .67591 .36264 moveto .70604 .39432 lineto .70604 .43132 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .67591 .36264 moveto .70604 .39432 lineto stroke grestore gsave .623 setgray .68337 .43132 moveto .63736 .38328 lineto .63736 .36264 lineto .70604 .43132 lineto fill grestore gsave .705 setgray .68337 .43132 moveto .63736 .38328 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .68337 .43132 moveto .63736 .38328 lineto stroke grestore gsave .459 setgray .7293 .36264 moveto .75672 .41332 lineto .77473 .43132 lineto .77473 .36264 lineto fill grestore gsave .541 setgray .7293 .36264 moveto .75672 .41332 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .7293 .36264 moveto .75672 .41332 lineto stroke grestore gsave .459 setgray .77473 .43132 moveto .76765 .43132 lineto .75672 .41332 lineto fill grestore gsave .541 setgray .76765 .43132 moveto .75672 .41332 lineto .70604 .36264 lineto .70604 .39432 lineto .72851 .43132 lineto fill grestore gsave 0.001 setlinewidth .76765 .43132 moveto .75672 .41332 lineto stroke grestore gsave .623 setgray .72851 .43132 moveto .70604 .39432 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .72851 .43132 moveto .70604 .39432 lineto stroke grestore gsave .295 setgray .84341 .36264 moveto .8382 .36264 lineto .84341 .37172 lineto fill grestore gsave .377 setgray .8382 .36264 moveto .84341 .37172 lineto .84341 .43132 lineto .77571 .36362 lineto .77515 .36264 lineto fill grestore gsave 0.001 setlinewidth .8382 .36264 moveto .84341 .37172 lineto stroke grestore gsave .459 setgray .77515 .36264 moveto .77571 .36362 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .77515 .36264 moveto .77571 .36362 lineto stroke grestore gsave .377 setgray .84341 .43132 moveto .81878 .43132 lineto .77571 .36362 lineto fill grestore gsave .459 setgray .81878 .43132 moveto .77571 .36362 lineto .77473 .36264 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .81878 .43132 moveto .77571 .36362 lineto stroke grestore gsave .295 setgray .91209 .36264 moveto .91209 .43132 lineto .84341 .36264 lineto fill grestore gsave .295 setgray .8789 .43132 moveto .84341 .37172 lineto .84341 .36264 lineto .91209 .43132 lineto fill grestore gsave .377 setgray .8789 .43132 moveto .84341 .37172 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .8789 .43132 moveto .84341 .37172 lineto stroke grestore gsave .214 setgray .91433 .36264 moveto .91675 .3673 lineto .98077 .43132 lineto .98077 .36264 lineto fill grestore gsave .295 setgray .91433 .36264 moveto .91675 .3673 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91433 .36264 moveto .91675 .3673 lineto stroke grestore gsave .214 setgray .98077 .43132 moveto .95451 .43132 lineto .91675 .3673 lineto fill grestore gsave .295 setgray .95451 .43132 moveto .91675 .3673 lineto .91209 .36264 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .95451 .43132 moveto .91675 .3673 lineto stroke grestore gsave .132 setgray 0.01923 .43132 moveto 0.02285 .43494 lineto 0.02332 .43132 lineto fill grestore gsave .214 setgray 0.02285 .43494 moveto 0.02332 .43132 lineto 0.08791 .43132 lineto 0.08791 .5 lineto fill grestore gsave 0.001 setlinewidth 0.02285 .43494 moveto 0.02332 .43132 lineto stroke grestore gsave .132 setgray 0.01923 .43132 moveto 0.02285 .43494 lineto 0.01923 .49383 lineto fill grestore gsave .214 setgray 0.02285 .43494 moveto 0.01923 .49383 lineto 0.01923 .5 lineto 0.08791 .5 lineto fill grestore gsave 0.001 setlinewidth 0.02285 .43494 moveto 0.01923 .49383 lineto stroke grestore gsave .214 setgray 0.08791 .43132 moveto .10895 .45236 lineto .11237 .43132 lineto fill grestore gsave .295 setgray .10895 .45236 moveto .11237 .43132 lineto .15659 .43132 lineto .15659 .5 lineto fill grestore gsave 0.001 setlinewidth .10895 .45236 moveto .11237 .43132 lineto stroke grestore gsave .214 setgray .10895 .45236 moveto .10483 .5 lineto 0.08791 .5 lineto 0.08791 .43132 lineto fill grestore gsave .295 setgray .10895 .45236 moveto .10483 .5 lineto .15659 .5 lineto fill grestore gsave 0.001 setlinewidth .10895 .45236 moveto .10483 .5 lineto stroke grestore gsave .295 setgray .15659 .43132 moveto .17324 .44797 lineto .17651 .43132 lineto fill grestore gsave .377 setgray .17324 .44797 moveto .17651 .43132 lineto .22527 .43132 lineto .22527 .45661 lineto .21815 .49288 lineto fill grestore gsave 0.001 setlinewidth .17324 .44797 moveto .17651 .43132 lineto stroke grestore gsave .459 setgray .21815 .49288 moveto .22527 .45661 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .21815 .49288 moveto .22527 .45661 lineto stroke grestore gsave .295 setgray .17324 .44797 moveto .16721 .5 lineto .15659 .5 lineto .15659 .43132 lineto fill grestore gsave .377 setgray .17324 .44797 moveto .16721 .5 lineto .21733 .5 lineto .21815 .49288 lineto fill grestore gsave 0.001 setlinewidth .17324 .44797 moveto .16721 .5 lineto stroke grestore gsave .459 setgray .21815 .49288 moveto .21733 .5 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .21815 .49288 moveto .21733 .5 lineto stroke grestore gsave .377 setgray .22527 .43132 moveto .22805 .4341 lineto .22863 .43132 lineto fill grestore gsave .459 setgray .22805 .4341 moveto .22863 .43132 lineto .2649 .43132 lineto .25812 .46417 lineto fill grestore gsave 0.001 setlinewidth .22805 .4341 moveto .22863 .43132 lineto stroke grestore gsave .541 setgray .25812 .46417 moveto .2649 .43132 lineto .29396 .43132 lineto .29396 .46628 lineto .28819 .49423 lineto fill grestore gsave 0.001 setlinewidth .25812 .46417 moveto .2649 .43132 lineto stroke grestore gsave .623 setgray .28819 .49423 moveto .29396 .46628 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .28819 .49423 moveto .29396 .46628 lineto stroke grestore gsave .377 setgray .22527 .43132 moveto .22805 .4341 lineto .22527 .45661 lineto fill grestore gsave .459 setgray .22805 .4341 moveto .22527 .45661 lineto .22527 .5 lineto .2537 .5 lineto .25812 .46417 lineto fill grestore gsave 0.001 setlinewidth .22805 .4341 moveto .22527 .45661 lineto stroke grestore gsave .541 setgray .25812 .46417 moveto .2537 .5 lineto .28748 .5 lineto .28819 .49423 lineto fill grestore gsave 0.001 setlinewidth .25812 .46417 moveto .2537 .5 lineto stroke grestore gsave .623 setgray .28819 .49423 moveto .28748 .5 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .28819 .49423 moveto .28748 .5 lineto stroke grestore gsave .541 setgray .29396 .43132 moveto .30077 .43813 lineto .30307 .43132 lineto fill grestore gsave .623 setgray .30077 .43813 moveto .30307 .43132 lineto .34891 .43132 lineto .33502 .47239 lineto fill grestore gsave 0.001 setlinewidth .30077 .43813 moveto .30307 .43132 lineto stroke grestore gsave .705 setgray .33502 .47239 moveto .34891 .43132 lineto .36264 .43132 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .33502 .47239 moveto .34891 .43132 lineto stroke grestore gsave .541 setgray .29396 .43132 moveto .30077 .43813 lineto .29396 .46628 lineto fill grestore gsave .623 setgray .30077 .43813 moveto .29396 .46628 lineto .29396 .5 lineto .32834 .5 lineto .33502 .47239 lineto fill grestore gsave 0.001 setlinewidth .30077 .43813 moveto .29396 .46628 lineto stroke grestore gsave .705 setgray .33502 .47239 moveto .32834 .5 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .33502 .47239 moveto .32834 .5 lineto stroke grestore gsave .705 setgray .36264 .43132 moveto .38965 .45833 lineto .40372 .43132 lineto fill grestore gsave .786 setgray .38965 .45833 moveto .40372 .43132 lineto .43132 .43132 lineto .43132 .4909 lineto .4282 .49688 lineto fill grestore gsave 0.001 setlinewidth .38965 .45833 moveto .40372 .43132 lineto stroke grestore gsave .868 setgray .4282 .49688 moveto .43132 .4909 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .4282 .49688 moveto .43132 .4909 lineto stroke grestore gsave .705 setgray .38965 .45833 moveto .37308 .5 lineto .36264 .5 lineto .36264 .43132 lineto fill grestore gsave .786 setgray .38965 .45833 moveto .37308 .5 lineto .42696 .5 lineto .4282 .49688 lineto fill grestore gsave 0.001 setlinewidth .38965 .45833 moveto .37308 .5 lineto stroke grestore gsave .868 setgray .4282 .49688 moveto .42696 .5 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .4282 .49688 moveto .42696 .5 lineto stroke grestore gsave .786 setgray .43132 .43132 moveto .46 .46 lineto .49382 .43132 lineto fill grestore gsave .868 setgray .46 .46 moveto .49382 .43132 lineto .5 .43132 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .46 .46 moveto .49382 .43132 lineto stroke grestore gsave .786 setgray .43132 .43132 moveto .46 .46 lineto .43132 .4909 lineto fill grestore gsave .868 setgray .46 .46 moveto .43132 .4909 lineto .43132 .5 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .46 .46 moveto .43132 .4909 lineto stroke grestore gsave .786 setgray .56868 .43132 moveto .56868 .45251 lineto .51317 .43132 lineto fill grestore gsave .868 setgray .56868 .45251 moveto .51317 .43132 lineto .5 .43132 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .56868 .45251 moveto .51317 .43132 lineto stroke grestore gsave .868 setgray .5 .43132 moveto .56868 .5 lineto .5 .5 lineto fill grestore gsave .705 setgray .63736 .43132 moveto .62717 .43132 lineto .63736 .44513 lineto fill grestore gsave .786 setgray .62717 .43132 moveto .63736 .44513 lineto .63736 .5 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .62717 .43132 moveto .63736 .44513 lineto stroke grestore gsave .786 setgray .60426 .5 moveto .56868 .45251 lineto .56868 .43132 lineto .63736 .5 lineto fill grestore gsave .868 setgray .60426 .5 moveto .56868 .45251 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .60426 .5 moveto .56868 .45251 lineto stroke grestore gsave .623 setgray .70604 .43132 moveto .68337 .43132 lineto .70604 .4811 lineto fill grestore gsave .705 setgray .68337 .43132 moveto .70604 .4811 lineto .70604 .5 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .68337 .43132 moveto .70604 .4811 lineto stroke grestore gsave .705 setgray .66426 .5 moveto .63736 .44513 lineto .63736 .43132 lineto .70604 .5 lineto fill grestore gsave .786 setgray .66426 .5 moveto .63736 .44513 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .66426 .5 moveto .63736 .44513 lineto stroke grestore gsave .459 setgray .77473 .43132 moveto .76765 .43132 lineto .77473 .45897 lineto fill grestore gsave .541 setgray .76765 .43132 moveto .77473 .45897 lineto .77473 .5 lineto .73623 .46151 lineto .72851 .43132 lineto fill grestore gsave 0.001 setlinewidth .76765 .43132 moveto .77473 .45897 lineto stroke grestore gsave .623 setgray .72851 .43132 moveto .73623 .46151 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .72851 .43132 moveto .73623 .46151 lineto stroke grestore gsave .541 setgray .77473 .5 moveto .74818 .5 lineto .73623 .46151 lineto fill grestore gsave .623 setgray .74818 .5 moveto .73623 .46151 lineto .70604 .43132 lineto .70604 .4811 lineto .71191 .5 lineto fill grestore gsave 0.001 setlinewidth .74818 .5 moveto .73623 .46151 lineto stroke grestore gsave .705 setgray .71191 .5 moveto .70604 .4811 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .71191 .5 moveto .70604 .4811 lineto stroke grestore gsave .377 setgray .81878 .43132 moveto .83499 .49158 lineto .84341 .5 lineto .84341 .43132 lineto fill grestore gsave .459 setgray .81878 .43132 moveto .83499 .49158 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .81878 .43132 moveto .83499 .49158 lineto stroke grestore gsave .377 setgray .84341 .5 moveto .83772 .5 lineto .83499 .49158 lineto fill grestore gsave .459 setgray .83772 .5 moveto .83499 .49158 lineto .77473 .43132 lineto .77473 .45897 lineto .78804 .5 lineto fill grestore gsave 0.001 setlinewidth .83772 .5 moveto .83499 .49158 lineto stroke grestore gsave .541 setgray .78804 .5 moveto .77473 .45897 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .78804 .5 moveto .77473 .45897 lineto stroke grestore gsave .295 setgray .8789 .43132 moveto .89048 .4784 lineto .91209 .5 lineto .91209 .43132 lineto fill grestore gsave .377 setgray .8789 .43132 moveto .89048 .4784 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .8789 .43132 moveto .89048 .4784 lineto stroke grestore gsave .295 setgray .91209 .5 moveto .89703 .5 lineto .89048 .4784 lineto fill grestore gsave .377 setgray .89703 .5 moveto .89048 .4784 lineto .84341 .43132 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .89703 .5 moveto .89048 .4784 lineto stroke grestore gsave .214 setgray .95451 .43132 moveto .96811 .48734 lineto .98077 .5 lineto .98077 .43132 lineto fill grestore gsave .295 setgray .95451 .43132 moveto .96811 .48734 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .95451 .43132 moveto .96811 .48734 lineto stroke grestore gsave .214 setgray .98077 .5 moveto .9719 .5 lineto .96811 .48734 lineto fill grestore gsave .295 setgray .9719 .5 moveto .96811 .48734 lineto .91209 .43132 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .9719 .5 moveto .96811 .48734 lineto stroke grestore gsave .214 setgray 0.01923 .5 moveto 0.08791 .56868 lineto 0.08791 .5 lineto fill grestore gsave .132 setgray 0.01923 .56868 moveto 0.03336 .56868 lineto 0.01923 .50189 lineto fill grestore gsave .214 setgray 0.03336 .56868 moveto 0.01923 .50189 lineto 0.01923 .5 lineto 0.08791 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.03336 .56868 moveto 0.01923 .50189 lineto stroke grestore gsave .214 setgray 0.08791 .5 moveto .10483 .5 lineto .10973 .52181 lineto fill grestore gsave .295 setgray .10483 .5 moveto .10973 .52181 lineto .15659 .56868 lineto .15659 .5 lineto fill grestore gsave 0.001 setlinewidth .10483 .5 moveto .10973 .52181 lineto stroke grestore gsave .214 setgray .11854 .56868 moveto .10973 .52181 lineto 0.08791 .5 lineto 0.08791 .56868 lineto fill grestore gsave .295 setgray .11854 .56868 moveto .10973 .52181 lineto .15659 .56868 lineto fill grestore gsave 0.001 setlinewidth .11854 .56868 moveto .10973 .52181 lineto stroke grestore gsave .295 setgray .15659 .5 moveto .16721 .5 lineto .16998 .51338 lineto fill grestore gsave .377 setgray .16721 .5 moveto .16998 .51338 lineto .22527 .56868 lineto .22527 .53851 lineto .21733 .5 lineto fill grestore gsave 0.001 setlinewidth .16721 .5 moveto .16998 .51338 lineto stroke grestore gsave .459 setgray .21733 .5 moveto .22527 .53851 lineto .22527 .5 lineto fill grestore gsave 0.001 setlinewidth .21733 .5 moveto .22527 .53851 lineto stroke grestore gsave .295 setgray .17979 .56868 moveto .16998 .51338 lineto .15659 .5 lineto .15659 .56868 lineto fill grestore gsave .377 setgray .17979 .56868 moveto .16998 .51338 lineto .22527 .56868 lineto fill grestore gsave 0.001 setlinewidth .17979 .56868 moveto .16998 .51338 lineto stroke grestore gsave .459 setgray .22527 .5 moveto .2537 .5 lineto .25916 .53388 lineto fill grestore gsave .541 setgray .2537 .5 moveto .25916 .53388 lineto .29396 .56868 lineto .29396 .54023 lineto .28748 .5 lineto fill grestore gsave 0.001 setlinewidth .2537 .5 moveto .25916 .53388 lineto stroke grestore gsave .623 setgray .28748 .5 moveto .29396 .54023 lineto .29396 .5 lineto fill grestore gsave 0.001 setlinewidth .28748 .5 moveto .29396 .54023 lineto stroke grestore gsave .377 setgray .22527 .56868 moveto .22956 .56868 lineto .22527 .53851 lineto fill grestore gsave .459 setgray .22956 .56868 moveto .22527 .53851 lineto .22527 .5 lineto .25916 .53388 lineto .2641 .56868 lineto fill grestore gsave 0.001 setlinewidth .22956 .56868 moveto .22527 .53851 lineto stroke grestore gsave .541 setgray .2641 .56868 moveto .25916 .53388 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .2641 .56868 moveto .25916 .53388 lineto stroke grestore gsave .623 setgray .29396 .5 moveto .32834 .5 lineto .3374 .54344 lineto fill grestore gsave .705 setgray .32834 .5 moveto .3374 .54344 lineto .36264 .56868 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .32834 .5 moveto .3374 .54344 lineto stroke grestore gsave .541 setgray .29396 .56868 moveto .29976 .56868 lineto .29396 .54023 lineto fill grestore gsave .623 setgray .29976 .56868 moveto .29396 .54023 lineto .29396 .5 lineto .3374 .54344 lineto .34255 .56868 lineto fill grestore gsave 0.001 setlinewidth .29976 .56868 moveto .29396 .54023 lineto stroke grestore gsave .705 setgray .34255 .56868 moveto .3374 .54344 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .34255 .56868 moveto .3374 .54344 lineto stroke grestore gsave .705 setgray .36264 .5 moveto .37308 .5 lineto .3765 .51386 lineto fill grestore gsave .786 setgray .37308 .5 moveto .3765 .51386 lineto .43132 .56868 lineto .43132 .5177 lineto .42696 .5 lineto fill grestore gsave 0.001 setlinewidth .37308 .5 moveto .3765 .51386 lineto stroke grestore gsave .868 setgray .42696 .5 moveto .43132 .5177 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .42696 .5 moveto .43132 .5177 lineto stroke grestore gsave .705 setgray .39072 .56868 moveto .3765 .51386 lineto .36264 .5 lineto .36264 .56868 lineto fill grestore gsave .786 setgray .39072 .56868 moveto .3765 .51386 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .39072 .56868 moveto .3765 .51386 lineto stroke grestore gsave .868 setgray .43132 .5 moveto .5 .56868 lineto .5 .5 lineto fill grestore gsave .786 setgray .43132 .56868 moveto .45396 .56868 lineto .43132 .5177 lineto fill grestore gsave .868 setgray .45396 .56868 moveto .43132 .5177 lineto .43132 .5 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .45396 .56868 moveto .43132 .5177 lineto stroke grestore gsave .868 setgray .56868 .56868 moveto .56868 .5 lineto .5 .5 lineto fill grestore gsave .868 setgray .56868 .56868 moveto .5 .56868 lineto .5 .5 lineto fill grestore gsave .786 setgray .59953 .53085 moveto .60426 .5 lineto .63736 .5 lineto .63736 .56868 lineto fill grestore gsave .868 setgray .59953 .53085 moveto .60426 .5 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .59953 .53085 moveto .60426 .5 lineto stroke grestore gsave .786 setgray .63736 .56868 moveto .59953 .53085 lineto .59155 .56868 lineto fill grestore gsave .868 setgray .59953 .53085 moveto .59155 .56868 lineto .56868 .56868 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .59953 .53085 moveto .59155 .56868 lineto stroke grestore gsave .705 setgray .66215 .52478 moveto .66426 .5 lineto .70604 .5 lineto .70604 .56868 lineto fill grestore gsave .786 setgray .66215 .52478 moveto .66426 .5 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .66215 .52478 moveto .66426 .5 lineto stroke grestore gsave .705 setgray .70604 .56868 moveto .66215 .52478 lineto .65739 .56868 lineto fill grestore gsave .786 setgray .66215 .52478 moveto .65739 .56868 lineto .63736 .56868 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .66215 .52478 moveto .65739 .56868 lineto stroke grestore gsave .541 setgray .74613 .54009 moveto .74818 .5 lineto .77473 .5 lineto .77473 .56868 lineto fill grestore gsave .623 setgray .74613 .54009 moveto .74818 .5 lineto .71191 .5 lineto .71163 .50558 lineto fill grestore gsave 0.001 setlinewidth .74613 .54009 moveto .74818 .5 lineto stroke grestore gsave .705 setgray .71163 .50558 moveto .71191 .5 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .71163 .50558 moveto .71191 .5 lineto stroke grestore gsave .541 setgray .77473 .56868 moveto .74613 .54009 lineto .74433 .56868 lineto fill grestore gsave .623 setgray .74613 .54009 moveto .74433 .56868 lineto .70766 .56868 lineto .71163 .50558 lineto fill grestore gsave 0.001 setlinewidth .74613 .54009 moveto .74433 .56868 lineto stroke grestore gsave .705 setgray .71163 .50558 moveto .70766 .56868 lineto .70604 .56868 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .71163 .50558 moveto .70766 .56868 lineto stroke grestore gsave .377 setgray .83416 .55943 moveto .83772 .5 lineto .84341 .5 lineto .84341 .56868 lineto fill grestore gsave .459 setgray .83416 .55943 moveto .83772 .5 lineto .78804 .5 lineto .78729 .51256 lineto fill grestore gsave 0.001 setlinewidth .83416 .55943 moveto .83772 .5 lineto stroke grestore gsave .541 setgray .78729 .51256 moveto .78804 .5 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .78729 .51256 moveto .78804 .5 lineto stroke grestore gsave .377 setgray .84341 .56868 moveto .83416 .55943 lineto .83351 .56868 lineto fill grestore gsave .459 setgray .83416 .55943 moveto .83351 .56868 lineto .78332 .56868 lineto .78729 .51256 lineto fill grestore gsave 0.001 setlinewidth .83416 .55943 moveto .83351 .56868 lineto stroke grestore gsave .541 setgray .78729 .51256 moveto .78332 .56868 lineto .77473 .56868 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .78729 .51256 moveto .78332 .56868 lineto stroke grestore gsave .295 setgray .89397 .55056 moveto .89703 .5 lineto .91209 .5 lineto .91209 .56868 lineto fill grestore gsave .377 setgray .89397 .55056 moveto .89703 .5 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .89397 .55056 moveto .89703 .5 lineto stroke grestore gsave .295 setgray .91209 .56868 moveto .89397 .55056 lineto .89263 .56868 lineto fill grestore gsave .377 setgray .89397 .55056 moveto .89263 .56868 lineto .84341 .56868 lineto .84341 .5 lineto fill grestore gsave 0.001 setlinewidth .89397 .55056 moveto .89263 .56868 lineto stroke grestore gsave .214 setgray .9683 .55622 moveto .9719 .5 lineto .98077 .5 lineto .98077 .56868 lineto fill grestore gsave .295 setgray .9683 .55622 moveto .9719 .5 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .9683 .55622 moveto .9719 .5 lineto stroke grestore gsave .214 setgray .98077 .56868 moveto .9683 .55622 lineto .9673 .56868 lineto fill grestore gsave .295 setgray .9683 .55622 moveto .9673 .56868 lineto .91209 .56868 lineto .91209 .5 lineto fill grestore gsave 0.001 setlinewidth .9683 .55622 moveto .9673 .56868 lineto stroke grestore gsave .132 setgray 0.01923 .56868 moveto 0.03336 .56868 lineto 0.04659 .59604 lineto fill grestore gsave .214 setgray 0.03336 .56868 moveto 0.04659 .59604 lineto 0.08791 .63736 lineto 0.08791 .56868 lineto fill grestore gsave 0.001 setlinewidth 0.03336 .56868 moveto 0.04659 .59604 lineto stroke grestore gsave .132 setgray 0.06301 .63736 moveto 0.04659 .59604 lineto 0.01923 .56868 lineto 0.01923 .63736 lineto fill grestore gsave .214 setgray 0.06301 .63736 moveto 0.04659 .59604 lineto 0.08791 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.06301 .63736 moveto 0.04659 .59604 lineto stroke grestore gsave .214 setgray 0.08791 .56868 moveto .11854 .56868 lineto .14603 .6268 lineto fill grestore gsave .295 setgray .11854 .56868 moveto .14603 .6268 lineto .15659 .63736 lineto .15659 .56868 lineto fill grestore gsave 0.001 setlinewidth .11854 .56868 moveto .14603 .6268 lineto stroke grestore gsave .214 setgray .15016 .63736 moveto .14603 .6268 lineto 0.08791 .56868 lineto 0.08791 .63736 lineto fill grestore gsave .295 setgray .15016 .63736 moveto .14603 .6268 lineto .15659 .63736 lineto fill grestore gsave 0.001 setlinewidth .15016 .63736 moveto .14603 .6268 lineto stroke grestore gsave .295 setgray .15659 .56868 moveto .17979 .56868 lineto .20119 .61328 lineto fill grestore gsave .377 setgray .17979 .56868 moveto .20119 .61328 lineto .22527 .63736 lineto .22527 .56868 lineto fill grestore gsave 0.001 setlinewidth .17979 .56868 moveto .20119 .61328 lineto stroke grestore gsave .295 setgray .21099 .63736 moveto .20119 .61328 lineto .15659 .56868 lineto .15659 .63736 lineto fill grestore gsave .377 setgray .21099 .63736 moveto .20119 .61328 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .21099 .63736 moveto .20119 .61328 lineto stroke grestore gsave .377 setgray .22527 .56868 moveto .22956 .56868 lineto .23271 .57612 lineto fill grestore gsave .459 setgray .22956 .56868 moveto .23271 .57612 lineto .2926 .636 lineto .2641 .56868 lineto fill grestore gsave 0.001 setlinewidth .22956 .56868 moveto .23271 .57612 lineto stroke grestore gsave .541 setgray .2641 .56868 moveto .2926 .636 lineto .29396 .63736 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .2641 .56868 moveto .2926 .636 lineto stroke grestore gsave .377 setgray .25453 .63736 moveto .23271 .57612 lineto .22527 .56868 lineto .22527 .63736 lineto fill grestore gsave .459 setgray .25453 .63736 moveto .23271 .57612 lineto .2926 .636 lineto .29308 .63736 lineto fill grestore gsave 0.001 setlinewidth .25453 .63736 moveto .23271 .57612 lineto stroke grestore gsave .541 setgray .29308 .63736 moveto .2926 .636 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .29308 .63736 moveto .2926 .636 lineto stroke grestore gsave .541 setgray .29396 .56868 moveto .29976 .56868 lineto .30863 .58336 lineto fill grestore gsave .623 setgray .29976 .56868 moveto .30863 .58336 lineto .36264 .63736 lineto .36264 .60192 lineto .34255 .56868 lineto fill grestore gsave 0.001 setlinewidth .29976 .56868 moveto .30863 .58336 lineto stroke grestore gsave .705 setgray .34255 .56868 moveto .36264 .60192 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .34255 .56868 moveto .36264 .60192 lineto stroke grestore gsave .541 setgray .33941 .63736 moveto .30863 .58336 lineto .29396 .56868 lineto .29396 .63736 lineto fill grestore gsave .623 setgray .33941 .63736 moveto .30863 .58336 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .33941 .63736 moveto .30863 .58336 lineto stroke grestore gsave .705 setgray .39072 .56868 moveto .43132 .6195 lineto .43132 .63736 lineto .36264 .56868 lineto fill grestore gsave .786 setgray .39072 .56868 moveto .43132 .6195 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .39072 .56868 moveto .43132 .6195 lineto stroke grestore gsave .623 setgray .36264 .63736 moveto .39057 .63736 lineto .36264 .60192 lineto fill grestore gsave .705 setgray .39057 .63736 moveto .36264 .60192 lineto .36264 .56868 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .39057 .63736 moveto .36264 .60192 lineto stroke grestore gsave .786 setgray .5 .60013 moveto .45396 .56868 lineto .43132 .56868 lineto .5 .63736 lineto fill grestore gsave .868 setgray .5 .60013 moveto .45396 .56868 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .5 .60013 moveto .45396 .56868 lineto stroke grestore gsave .705 setgray .43132 .63736 moveto .43132 .6195 lineto .45744 .63736 lineto fill grestore gsave .786 setgray .43132 .6195 moveto .45744 .63736 lineto .5 .63736 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .43132 .6195 moveto .45744 .63736 lineto stroke grestore gsave .786 setgray .56868 .63736 moveto .52889 .59757 lineto .56868 .59045 lineto fill grestore gsave .868 setgray .52889 .59757 moveto .56868 .59045 lineto .56868 .56868 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .52889 .59757 moveto .56868 .59045 lineto stroke grestore gsave .786 setgray .52889 .59757 moveto .5 .60013 lineto .5 .63736 lineto .56868 .63736 lineto fill grestore gsave .868 setgray .52889 .59757 moveto .5 .60013 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .52889 .59757 moveto .5 .60013 lineto stroke grestore gsave .705 setgray .63736 .63736 moveto .61949 .61949 lineto .63736 .6004 lineto fill grestore gsave .786 setgray .61949 .61949 moveto .63736 .6004 lineto .63736 .56868 lineto .59155 .56868 lineto .58049 .58049 lineto fill grestore gsave 0.001 setlinewidth .61949 .61949 moveto .63736 .6004 lineto stroke grestore gsave .868 setgray .58049 .58049 moveto .59155 .56868 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .58049 .58049 moveto .59155 .56868 lineto stroke grestore gsave .705 setgray .63736 .63736 moveto .61949 .61949 lineto .59829 .63736 lineto fill grestore gsave .786 setgray .61949 .61949 moveto .59829 .63736 lineto .56868 .63736 lineto .56868 .59045 lineto .58049 .58049 lineto fill grestore gsave 0.001 setlinewidth .61949 .61949 moveto .59829 .63736 lineto stroke grestore gsave .868 setgray .58049 .58049 moveto .56868 .59045 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .58049 .58049 moveto .56868 .59045 lineto stroke grestore gsave .623 setgray .70604 .63736 moveto .68341 .61473 lineto .70604 .57284 lineto fill grestore gsave .705 setgray .68341 .61473 moveto .70604 .57284 lineto .70604 .56868 lineto .65739 .56868 lineto .65036 .58168 lineto fill grestore gsave 0.001 setlinewidth .68341 .61473 moveto .70604 .57284 lineto stroke grestore gsave .786 setgray .65036 .58168 moveto .65739 .56868 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .65036 .58168 moveto .65739 .56868 lineto stroke grestore gsave .623 setgray .70604 .63736 moveto .68341 .61473 lineto .66769 .63736 lineto fill grestore gsave .705 setgray .68341 .61473 moveto .66769 .63736 lineto .63736 .63736 lineto .63736 .6004 lineto .65036 .58168 lineto fill grestore gsave 0.001 setlinewidth .68341 .61473 moveto .66769 .63736 lineto stroke grestore gsave .786 setgray .65036 .58168 moveto .63736 .6004 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .65036 .58168 moveto .63736 .6004 lineto stroke grestore gsave .459 setgray .77473 .63736 moveto .76354 .62618 lineto .77473 .58936 lineto fill grestore gsave .541 setgray .76354 .62618 moveto .77473 .58936 lineto .77473 .56868 lineto .74433 .56868 lineto .73541 .59805 lineto fill grestore gsave 0.001 setlinewidth .76354 .62618 moveto .77473 .58936 lineto stroke grestore gsave .623 setgray .73541 .59805 moveto .74433 .56868 lineto .70766 .56868 lineto .70728 .56992 lineto fill grestore gsave 0.001 setlinewidth .73541 .59805 moveto .74433 .56868 lineto stroke grestore gsave .705 setgray .70728 .56992 moveto .70766 .56868 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70728 .56992 moveto .70766 .56868 lineto stroke grestore gsave .459 setgray .77473 .63736 moveto .76354 .62618 lineto .75878 .63736 lineto fill grestore gsave .541 setgray .76354 .62618 moveto .75878 .63736 lineto .71868 .63736 lineto .73541 .59805 lineto fill grestore gsave 0.001 setlinewidth .76354 .62618 moveto .75878 .63736 lineto stroke grestore gsave .623 setgray .73541 .59805 moveto .71868 .63736 lineto .70604 .63736 lineto .70604 .57284 lineto .70728 .56992 lineto fill grestore gsave 0.001 setlinewidth .73541 .59805 moveto .71868 .63736 lineto stroke grestore gsave .705 setgray .70728 .56992 moveto .70604 .57284 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .70728 .56992 moveto .70604 .57284 lineto stroke grestore gsave .377 setgray .81899 .61295 moveto .83351 .56868 lineto .84341 .56868 lineto .84341 .63736 lineto fill grestore gsave .459 setgray .81899 .61295 moveto .83351 .56868 lineto .78332 .56868 lineto .7812 .57515 lineto fill grestore gsave 0.001 setlinewidth .81899 .61295 moveto .83351 .56868 lineto stroke grestore gsave .541 setgray .7812 .57515 moveto .78332 .56868 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .7812 .57515 moveto .78332 .56868 lineto stroke grestore gsave .377 setgray .84341 .63736 moveto .81899 .61295 lineto .80787 .63736 lineto fill grestore gsave .459 setgray .81899 .61295 moveto .80787 .63736 lineto .77473 .63736 lineto .77473 .58936 lineto .7812 .57515 lineto fill grestore gsave 0.001 setlinewidth .81899 .61295 moveto .80787 .63736 lineto stroke grestore gsave .541 setgray .7812 .57515 moveto .77473 .58936 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .7812 .57515 moveto .77473 .58936 lineto stroke grestore gsave .295 setgray .88102 .60629 moveto .89263 .56868 lineto .91209 .56868 lineto .91209 .63736 lineto fill grestore gsave .377 setgray .88102 .60629 moveto .89263 .56868 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .88102 .60629 moveto .89263 .56868 lineto stroke grestore gsave .295 setgray .91209 .63736 moveto .88102 .60629 lineto .86731 .63736 lineto fill grestore gsave .377 setgray .88102 .60629 moveto .86731 .63736 lineto .84341 .63736 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .88102 .60629 moveto .86731 .63736 lineto stroke grestore gsave .214 setgray .9542 .61079 moveto .9673 .56868 lineto .98077 .56868 lineto .98077 .63736 lineto fill grestore gsave .295 setgray .9542 .61079 moveto .9673 .56868 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .9542 .61079 moveto .9673 .56868 lineto stroke grestore gsave .214 setgray .98077 .63736 moveto .9542 .61079 lineto .94223 .63736 lineto fill grestore gsave .295 setgray .9542 .61079 moveto .94223 .63736 lineto .91209 .63736 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .9542 .61079 moveto .94223 .63736 lineto stroke grestore gsave .132 setgray 0.06301 .63736 moveto 0.08791 .67506 lineto 0.08791 .70604 lineto 0.01923 .63736 lineto fill grestore gsave .214 setgray 0.06301 .63736 moveto 0.08791 .67506 lineto 0.08791 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.06301 .63736 moveto 0.08791 .67506 lineto stroke grestore gsave .132 setgray 0.01923 .70604 moveto 0.01923 .63736 lineto 0.08791 .70604 lineto fill grestore gsave .214 setgray .15016 .63736 moveto .15659 .6471 lineto .15659 .70604 lineto 0.08791 .63736 lineto fill grestore gsave .295 setgray .15016 .63736 moveto .15659 .6471 lineto .15659 .63736 lineto fill grestore gsave 0.001 setlinewidth .15016 .63736 moveto .15659 .6471 lineto stroke grestore gsave .132 setgray 0.08791 .70604 moveto .1057 .70604 lineto 0.08791 .67506 lineto fill grestore gsave .214 setgray .1057 .70604 moveto 0.08791 .67506 lineto 0.08791 .63736 lineto .15659 .70604 lineto fill grestore gsave 0.001 setlinewidth .1057 .70604 moveto 0.08791 .67506 lineto stroke grestore gsave .295 setgray .21099 .63736 moveto .22527 .65825 lineto .22527 .70604 lineto .15659 .63736 lineto fill grestore gsave .377 setgray .21099 .63736 moveto .22527 .65825 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .21099 .63736 moveto .22527 .65825 lineto stroke grestore gsave .214 setgray .15659 .70604 moveto .19246 .70604 lineto .15659 .6471 lineto fill grestore gsave .295 setgray .19246 .70604 moveto .15659 .6471 lineto .15659 .63736 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .19246 .70604 moveto .15659 .6471 lineto stroke grestore gsave .377 setgray .25453 .63736 moveto .29396 .70122 lineto .29396 .70604 lineto .22527 .63736 lineto fill grestore gsave .459 setgray .25453 .63736 moveto .29396 .70122 lineto .29396 .63878 lineto .29308 .63736 lineto fill grestore gsave 0.001 setlinewidth .25453 .63736 moveto .29396 .70122 lineto stroke grestore gsave .541 setgray .29308 .63736 moveto .29396 .63878 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .29308 .63736 moveto .29396 .63878 lineto stroke grestore gsave .295 setgray .22527 .70604 moveto .25098 .70604 lineto .22527 .65825 lineto fill grestore gsave .377 setgray .25098 .70604 moveto .22527 .65825 lineto .22527 .63736 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .25098 .70604 moveto .22527 .65825 lineto stroke grestore gsave .541 setgray .33941 .63736 moveto .36264 .66343 lineto .36264 .70604 lineto .29396 .63736 lineto fill grestore gsave .623 setgray .33941 .63736 moveto .36264 .66343 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .33941 .63736 moveto .36264 .66343 lineto stroke grestore gsave .377 setgray .29396 .70604 moveto .29816 .70604 lineto .29396 .70122 lineto fill grestore gsave .459 setgray .29816 .70604 moveto .29396 .70122 lineto .29396 .63878 lineto .35263 .70604 lineto fill grestore gsave 0.001 setlinewidth .29816 .70604 moveto .29396 .70122 lineto stroke grestore gsave .541 setgray .35263 .70604 moveto .29396 .63878 lineto .29396 .63736 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .35263 .70604 moveto .29396 .63878 lineto stroke grestore gsave .623 setgray .43132 .67177 moveto .39057 .63736 lineto .36264 .63736 lineto .43132 .70604 lineto fill grestore gsave .705 setgray .43132 .67177 moveto .39057 .63736 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .43132 .67177 moveto .39057 .63736 lineto stroke grestore gsave .541 setgray .36264 .70604 moveto .36264 .66343 lineto .41414 .70604 lineto fill grestore gsave .623 setgray .36264 .66343 moveto .41414 .70604 lineto .43132 .70604 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .36264 .66343 moveto .41414 .70604 lineto stroke grestore gsave .623 setgray .5 .70604 moveto .5 .70303 lineto .49431 .70035 lineto fill grestore gsave .705 setgray .5 .70303 moveto .49431 .70035 lineto .43132 .63736 lineto .45744 .63736 lineto .5 .6574 lineto fill grestore gsave 0.001 setlinewidth .5 .70303 moveto .49431 .70035 lineto stroke grestore gsave .786 setgray .5 .6574 moveto .45744 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .5 .6574 moveto .45744 .63736 lineto stroke grestore gsave .623 setgray .43132 .67177 moveto .49431 .70035 lineto .5 .70604 lineto .43132 .70604 lineto fill grestore gsave .705 setgray .43132 .67177 moveto .49431 .70035 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .43132 .67177 moveto .49431 .70035 lineto stroke grestore gsave .623 setgray .56868 .70604 moveto .56489 .70225 lineto .56868 .70201 lineto fill grestore gsave .705 setgray .56489 .70225 moveto .56868 .70201 lineto .56868 .65403 lineto .5198 .65716 lineto fill grestore gsave 0.001 setlinewidth .56489 .70225 moveto .56868 .70201 lineto stroke grestore gsave .786 setgray .5198 .65716 moveto .56868 .65403 lineto .56868 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .5198 .65716 moveto .56868 .65403 lineto stroke grestore gsave .623 setgray .56489 .70225 moveto .5 .70303 lineto .5 .70604 lineto .56868 .70604 lineto fill grestore gsave .705 setgray .56489 .70225 moveto .5 .70303 lineto .5 .6574 lineto .5198 .65716 lineto fill grestore gsave 0.001 setlinewidth .56489 .70225 moveto .5 .70303 lineto stroke grestore gsave .786 setgray .5198 .65716 moveto .5 .6574 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .5198 .65716 moveto .5 .6574 lineto stroke grestore gsave .623 setgray .63736 .70604 moveto .61285 .68153 lineto .63736 .66621 lineto fill grestore gsave .705 setgray .61285 .68153 moveto .63736 .66621 lineto .63736 .63736 lineto .59829 .63736 lineto .58007 .64875 lineto fill grestore gsave 0.001 setlinewidth .61285 .68153 moveto .63736 .66621 lineto stroke grestore gsave .786 setgray .58007 .64875 moveto .59829 .63736 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .58007 .64875 moveto .59829 .63736 lineto stroke grestore gsave .623 setgray .61285 .68153 moveto .56868 .70201 lineto .56868 .70604 lineto .63736 .70604 lineto fill grestore gsave .705 setgray .61285 .68153 moveto .56868 .70201 lineto .56868 .65403 lineto .58007 .64875 lineto fill grestore gsave 0.001 setlinewidth .61285 .68153 moveto .56868 .70201 lineto stroke grestore gsave .786 setgray .58007 .64875 moveto .56868 .65403 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .58007 .64875 moveto .56868 .65403 lineto stroke grestore gsave .541 setgray .70604 .70604 moveto .68281 .68281 lineto .70604 .65698 lineto fill grestore gsave .623 setgray .68281 .68281 moveto .70604 .65698 lineto .70604 .63736 lineto .66769 .63736 lineto .65333 .65333 lineto fill grestore gsave 0.001 setlinewidth .68281 .68281 moveto .70604 .65698 lineto stroke grestore gsave .705 setgray .65333 .65333 moveto .66769 .63736 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .65333 .65333 moveto .66769 .63736 lineto stroke grestore gsave .541 setgray .70604 .70604 moveto .68281 .68281 lineto .65402 .70604 lineto fill grestore gsave .623 setgray .68281 .68281 moveto .65402 .70604 lineto .63736 .70604 lineto .63736 .66621 lineto .65333 .65333 lineto fill grestore gsave 0.001 setlinewidth .68281 .68281 moveto .65402 .70604 lineto stroke grestore gsave .705 setgray .65333 .65333 moveto .63736 .66621 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .65333 .65333 moveto .63736 .66621 lineto stroke grestore gsave .377 setgray .77473 .70604 moveto .76807 .69938 lineto .77473 .68598 lineto fill grestore gsave .459 setgray .76807 .69938 moveto .77473 .68598 lineto .77473 .63736 lineto .75878 .63736 lineto .74127 .67259 lineto fill grestore gsave 0.001 setlinewidth .76807 .69938 moveto .77473 .68598 lineto stroke grestore gsave .541 setgray .74127 .67259 moveto .75878 .63736 lineto .71868 .63736 lineto .71448 .6458 lineto fill grestore gsave 0.001 setlinewidth .74127 .67259 moveto .75878 .63736 lineto stroke grestore gsave .623 setgray .71448 .6458 moveto .71868 .63736 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .71448 .6458 moveto .71868 .63736 lineto stroke grestore gsave .377 setgray .77473 .70604 moveto .76807 .69938 lineto .76304 .70604 lineto fill grestore gsave .459 setgray .76807 .69938 moveto .76304 .70604 lineto .71602 .70604 lineto .74127 .67259 lineto fill grestore gsave 0.001 setlinewidth .76807 .69938 moveto .76304 .70604 lineto stroke grestore gsave .541 setgray .74127 .67259 moveto .71602 .70604 lineto .70604 .70604 lineto .70604 .65698 lineto .71448 .6458 lineto fill grestore gsave 0.001 setlinewidth .74127 .67259 moveto .71602 .70604 lineto stroke grestore gsave .623 setgray .71448 .6458 moveto .70604 .65698 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .71448 .6458 moveto .70604 .65698 lineto stroke grestore gsave .295 setgray .84341 .70604 moveto .83229 .69492 lineto .84341 .674 lineto fill grestore gsave .377 setgray .83229 .69492 moveto .84341 .674 lineto .84341 .63736 lineto .80787 .63736 lineto .79636 .659 lineto fill grestore gsave 0.001 setlinewidth .83229 .69492 moveto .84341 .674 lineto stroke grestore gsave .459 setgray .79636 .659 moveto .80787 .63736 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .79636 .659 moveto .80787 .63736 lineto stroke grestore gsave .295 setgray .84341 .70604 moveto .83229 .69492 lineto .82337 .70604 lineto fill grestore gsave .377 setgray .83229 .69492 moveto .82337 .70604 lineto .77473 .70604 lineto .77473 .68598 lineto .79636 .659 lineto fill grestore gsave 0.001 setlinewidth .83229 .69492 moveto .82337 .70604 lineto stroke grestore gsave .459 setgray .79636 .659 moveto .77473 .68598 lineto .77473 .63736 lineto fill grestore gsave 0.001 setlinewidth .79636 .659 moveto .77473 .68598 lineto stroke grestore gsave .214 setgray .91209 .70604 moveto .90447 .69842 lineto .91209 .6831 lineto fill grestore gsave .295 setgray .90447 .69842 moveto .91209 .6831 lineto .91209 .63736 lineto .86731 .63736 lineto .85937 .65333 lineto fill grestore gsave 0.001 setlinewidth .90447 .69842 moveto .91209 .6831 lineto stroke grestore gsave .377 setgray .85937 .65333 moveto .86731 .63736 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .85937 .65333 moveto .86731 .63736 lineto stroke grestore gsave .214 setgray .91209 .70604 moveto .90447 .69842 lineto .89858 .70604 lineto fill grestore gsave .295 setgray .90447 .69842 moveto .89858 .70604 lineto .84341 .70604 lineto .84341 .674 lineto .85937 .65333 lineto fill grestore gsave 0.001 setlinewidth .90447 .69842 moveto .89858 .70604 lineto stroke grestore gsave .377 setgray .85937 .65333 moveto .84341 .674 lineto .84341 .63736 lineto fill grestore gsave 0.001 setlinewidth .85937 .65333 moveto .84341 .674 lineto stroke grestore gsave .214 setgray .93219 .65747 moveto .94223 .63736 lineto .98077 .63736 lineto .98077 .70604 lineto fill grestore gsave .295 setgray .93219 .65747 moveto .94223 .63736 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .93219 .65747 moveto .94223 .63736 lineto stroke grestore gsave .214 setgray .93219 .65747 moveto .91209 .6831 lineto .91209 .70604 lineto .98077 .70604 lineto fill grestore gsave .295 setgray .93219 .65747 moveto .91209 .6831 lineto .91209 .63736 lineto fill grestore gsave 0.001 setlinewidth .93219 .65747 moveto .91209 .6831 lineto stroke grestore gsave .132 setgray 0.01923 .70604 moveto 0.08791 .77473 lineto 0.08791 .70604 lineto fill grestore gsave .132 setgray 0.01923 .77473 moveto 0.01923 .70604 lineto 0.08791 .77473 lineto fill grestore gsave .132 setgray .1057 .70604 moveto .15659 .76038 lineto .15659 .77473 lineto 0.08791 .70604 lineto fill grestore gsave .214 setgray .1057 .70604 moveto .15659 .76038 lineto .15659 .70604 lineto fill grestore gsave 0.001 setlinewidth .1057 .70604 moveto .15659 .76038 lineto stroke grestore gsave .132 setgray 0.08791 .77473 moveto 0.08791 .70604 lineto .15659 .77473 lineto fill grestore gsave .214 setgray .19246 .70604 moveto .22527 .73953 lineto .22527 .77473 lineto .15659 .70604 lineto fill grestore gsave .295 setgray .19246 .70604 moveto .22527 .73953 lineto .22527 .70604 lineto fill grestore gsave 0.001 setlinewidth .19246 .70604 moveto .22527 .73953 lineto stroke grestore gsave .132 setgray .15659 .77473 moveto .17053 .77473 lineto .15659 .76038 lineto fill grestore gsave .214 setgray .17053 .77473 moveto .15659 .76038 lineto .15659 .70604 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .17053 .77473 moveto .15659 .76038 lineto stroke grestore gsave .295 setgray .25098 .70604 moveto .29396 .7536 lineto .29396 .77473 lineto .22527 .70604 lineto fill grestore gsave .377 setgray .25098 .70604 moveto .29396 .7536 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .25098 .70604 moveto .29396 .7536 lineto stroke grestore gsave .214 setgray .22527 .77473 moveto .25576 .77473 lineto .22527 .73953 lineto fill grestore gsave .295 setgray .25576 .77473 moveto .22527 .73953 lineto .22527 .70604 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .25576 .77473 moveto .22527 .73953 lineto stroke grestore gsave .377 setgray .36264 .75492 moveto .29816 .70604 lineto .29396 .70604 lineto .36264 .77473 lineto fill grestore gsave .459 setgray .36264 .75492 moveto .29816 .70604 lineto .35263 .70604 lineto .36264 .71363 lineto fill grestore gsave 0.001 setlinewidth .36264 .75492 moveto .29816 .70604 lineto stroke grestore gsave .541 setgray .36264 .71363 moveto .35263 .70604 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .36264 .71363 moveto .35263 .70604 lineto stroke grestore gsave .295 setgray .29396 .77473 moveto .29396 .7536 lineto .32422 .77473 lineto fill grestore gsave .377 setgray .29396 .7536 moveto .32422 .77473 lineto .36264 .77473 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .29396 .7536 moveto .32422 .77473 lineto stroke grestore gsave .459 setgray .43132 .77473 moveto .43132 .75148 lineto .37775 .72116 lineto fill grestore gsave .541 setgray .43132 .75148 moveto .37775 .72116 lineto .36264 .70604 lineto .41414 .70604 lineto .43132 .71577 lineto fill grestore gsave 0.001 setlinewidth .43132 .75148 moveto .37775 .72116 lineto stroke grestore gsave .623 setgray .43132 .71577 moveto .41414 .70604 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .43132 .71577 moveto .41414 .70604 lineto stroke grestore gsave .377 setgray .36264 .77473 moveto .36264 .75492 lineto .40238 .77473 lineto fill grestore gsave .459 setgray .36264 .75492 moveto .40238 .77473 lineto .43132 .77473 lineto .37775 .72116 lineto .36264 .71363 lineto fill grestore gsave 0.001 setlinewidth .36264 .75492 moveto .40238 .77473 lineto stroke grestore gsave .541 setgray .36264 .71363 moveto .37775 .72116 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .36264 .71363 moveto .37775 .72116 lineto stroke grestore gsave .459 setgray .5 .77473 moveto .5 .77074 lineto .49412 .76885 lineto fill grestore gsave .541 setgray .5 .77074 moveto .49412 .76885 lineto .44476 .71948 lineto .5 .73729 lineto fill grestore gsave 0.001 setlinewidth .5 .77074 moveto .49412 .76885 lineto stroke grestore gsave .623 setgray .5 .73729 moveto .44476 .71948 lineto .43132 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .5 .73729 moveto .44476 .71948 lineto stroke grestore gsave .459 setgray .43132 .75148 moveto .49412 .76885 lineto .5 .77473 lineto .43132 .77473 lineto fill grestore gsave .541 setgray .43132 .75148 moveto .49412 .76885 lineto .44476 .71948 lineto .43132 .71577 lineto fill grestore gsave 0.001 setlinewidth .43132 .75148 moveto .49412 .76885 lineto stroke grestore gsave .623 setgray .43132 .71577 moveto .44476 .71948 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .43132 .71577 moveto .44476 .71948 lineto stroke grestore gsave .459 setgray .56868 .77473 moveto .56591 .77196 lineto .56868 .77193 lineto fill grestore gsave .541 setgray .56591 .77196 moveto .56868 .77193 lineto .56868 .73754 lineto .53183 .73788 lineto fill grestore gsave 0.001 setlinewidth .56591 .77196 moveto .56868 .77193 lineto stroke grestore gsave .623 setgray .53183 .73788 moveto .56868 .73754 lineto .56868 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .53183 .73788 moveto .56868 .73754 lineto stroke grestore gsave .459 setgray .5 .77074 moveto .56591 .77196 lineto .56868 .77473 lineto .5 .77473 lineto fill grestore gsave .541 setgray .5 .77074 moveto .56591 .77196 lineto .53183 .73788 lineto .5 .73729 lineto fill grestore gsave 0.001 setlinewidth .5 .77074 moveto .56591 .77196 lineto stroke grestore gsave .623 setgray .5 .73729 moveto .53183 .73788 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .5 .73729 moveto .53183 .73788 lineto stroke grestore gsave .459 setgray .63736 .77473 moveto .62203 .75939 lineto .63736 .75374 lineto fill grestore gsave .541 setgray .62203 .75939 moveto .63736 .75374 lineto .63736 .71565 lineto .59418 .73155 lineto fill grestore gsave 0.001 setlinewidth .62203 .75939 moveto .63736 .75374 lineto stroke grestore gsave .623 setgray .59418 .73155 moveto .63736 .71565 lineto .63736 .70604 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .59418 .73155 moveto .63736 .71565 lineto stroke grestore gsave .459 setgray .62203 .75939 moveto .56868 .77193 lineto .56868 .77473 lineto .63736 .77473 lineto fill grestore gsave .541 setgray .62203 .75939 moveto .56868 .77193 lineto .56868 .73754 lineto .59418 .73155 lineto fill grestore gsave 0.001 setlinewidth .62203 .75939 moveto .56868 .77193 lineto stroke grestore gsave .623 setgray .59418 .73155 moveto .56868 .73754 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .59418 .73155 moveto .56868 .73754 lineto stroke grestore gsave .377 setgray .70604 .77473 moveto .69753 .76621 lineto .70604 .76043 lineto fill grestore gsave .459 setgray .69753 .76621 moveto .70604 .76043 lineto .70604 .71556 lineto .67082 .7395 lineto fill grestore gsave 0.001 setlinewidth .69753 .76621 moveto .70604 .76043 lineto stroke grestore gsave .541 setgray .67082 .7395 moveto .70604 .71556 lineto .70604 .70604 lineto .65402 .70604 lineto .6441 .71278 lineto fill grestore gsave 0.001 setlinewidth .67082 .7395 moveto .70604 .71556 lineto stroke grestore gsave .623 setgray .6441 .71278 moveto .65402 .70604 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .6441 .71278 moveto .65402 .70604 lineto stroke grestore gsave .377 setgray .70604 .77473 moveto .69753 .76621 lineto .67754 .77473 lineto fill grestore gsave .459 setgray .69753 .76621 moveto .67754 .77473 lineto .63736 .77473 lineto .63736 .75374 lineto .67082 .7395 lineto fill grestore gsave 0.001 setlinewidth .69753 .76621 moveto .67754 .77473 lineto stroke grestore gsave .541 setgray .67082 .7395 moveto .63736 .75374 lineto .63736 .71565 lineto .6441 .71278 lineto fill grestore gsave 0.001 setlinewidth .67082 .7395 moveto .63736 .75374 lineto stroke grestore gsave .623 setgray .6441 .71278 moveto .63736 .71565 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .6441 .71278 moveto .63736 .71565 lineto stroke grestore gsave .295 setgray .77473 .77473 moveto .76398 .76398 lineto .77473 .75047 lineto fill grestore gsave .377 setgray .76398 .76398 moveto .77473 .75047 lineto .77473 .70604 lineto .76304 .70604 lineto .73779 .73779 lineto fill grestore gsave 0.001 setlinewidth .76398 .76398 moveto .77473 .75047 lineto stroke grestore gsave .459 setgray .73779 .73779 moveto .76304 .70604 lineto .71602 .70604 lineto .7116 .7116 lineto fill grestore gsave 0.001 setlinewidth .73779 .73779 moveto .76304 .70604 lineto stroke grestore gsave .541 setgray .7116 .7116 moveto .71602 .70604 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .7116 .7116 moveto .71602 .70604 lineto stroke grestore gsave .295 setgray .77473 .77473 moveto .76398 .76398 lineto .74892 .77473 lineto fill grestore gsave .377 setgray .76398 .76398 moveto .74892 .77473 lineto .70604 .77473 lineto .70604 .76043 lineto .73779 .73779 lineto fill grestore gsave 0.001 setlinewidth .76398 .76398 moveto .74892 .77473 lineto stroke grestore gsave .459 setgray .73779 .73779 moveto .70604 .76043 lineto .70604 .71556 lineto .7116 .7116 lineto fill grestore gsave 0.001 setlinewidth .73779 .73779 moveto .70604 .76043 lineto stroke grestore gsave .541 setgray .7116 .7116 moveto .70604 .71556 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .7116 .7116 moveto .70604 .71556 lineto stroke grestore gsave .214 setgray .84341 .77473 moveto .83626 .76757 lineto .84341 .75909 lineto fill grestore gsave .295 setgray .83626 .76757 moveto .84341 .75909 lineto .84341 .70604 lineto .82337 .70604 lineto .80112 .73244 lineto fill grestore gsave 0.001 setlinewidth .83626 .76757 moveto .84341 .75909 lineto stroke grestore gsave .377 setgray .80112 .73244 moveto .82337 .70604 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .80112 .73244 moveto .82337 .70604 lineto stroke grestore gsave .214 setgray .84341 .77473 moveto .83626 .76757 lineto .82579 .77473 lineto fill grestore gsave .295 setgray .83626 .76757 moveto .82579 .77473 lineto .77473 .77473 lineto .77473 .75047 lineto .80112 .73244 lineto fill grestore gsave 0.001 setlinewidth .83626 .76757 moveto .82579 .77473 lineto stroke grestore gsave .377 setgray .80112 .73244 moveto .77473 .75047 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .80112 .73244 moveto .77473 .75047 lineto stroke grestore gsave .214 setgray .87431 .73695 moveto .89858 .70604 lineto .91209 .70604 lineto .91209 .77473 lineto fill grestore gsave .295 setgray .87431 .73695 moveto .89858 .70604 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .87431 .73695 moveto .89858 .70604 lineto stroke grestore gsave .214 setgray .87431 .73695 moveto .84341 .75909 lineto .84341 .77473 lineto .91209 .77473 lineto fill grestore gsave .295 setgray .87431 .73695 moveto .84341 .75909 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .87431 .73695 moveto .84341 .75909 lineto stroke grestore gsave .132 setgray .98077 .77473 moveto .96158 .75553 lineto .98077 .73116 lineto fill grestore gsave .214 setgray .96158 .75553 moveto .98077 .73116 lineto .98077 .70604 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .96158 .75553 moveto .98077 .73116 lineto stroke grestore gsave .132 setgray .98077 .77473 moveto .96158 .75553 lineto .93451 .77473 lineto fill grestore gsave .214 setgray .96158 .75553 moveto .93451 .77473 lineto .91209 .77473 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .96158 .75553 moveto .93451 .77473 lineto stroke grestore gsave .132 setgray 0.01923 .77473 moveto 0.08791 .84341 lineto 0.08791 .77473 lineto fill grestore gsave 0.05 setgray 0.01923 .84341 moveto 0.05598 .84341 lineto 0.01923 .79342 lineto fill grestore gsave .132 setgray 0.05598 .84341 moveto 0.01923 .79342 lineto 0.01923 .77473 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.05598 .84341 moveto 0.01923 .79342 lineto stroke grestore gsave .132 setgray 0.08791 .77473 moveto .15659 .84341 lineto .15659 .77473 lineto fill grestore gsave .132 setgray 0.08791 .84341 moveto 0.08791 .77473 lineto .15659 .84341 lineto fill grestore gsave .132 setgray .17053 .77473 moveto .22527 .83899 lineto .22527 .84341 lineto .15659 .77473 lineto fill grestore gsave .214 setgray .17053 .77473 moveto .22527 .83899 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .17053 .77473 moveto .22527 .83899 lineto stroke grestore gsave .132 setgray .15659 .84341 moveto .15659 .77473 lineto .22527 .84341 lineto fill grestore gsave .214 setgray .25576 .77473 moveto .29396 .82238 lineto .29396 .84341 lineto .22527 .77473 lineto fill grestore gsave .295 setgray .25576 .77473 moveto .29396 .82238 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .25576 .77473 moveto .29396 .82238 lineto stroke grestore gsave .132 setgray .22527 .84341 moveto .22849 .84341 lineto .22527 .83899 lineto fill grestore gsave .214 setgray .22849 .84341 moveto .22527 .83899 lineto .22527 .77473 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .22849 .84341 moveto .22527 .83899 lineto stroke grestore gsave .295 setgray .36264 .80712 moveto .32422 .77473 lineto .29396 .77473 lineto .36264 .84341 lineto fill grestore gsave .377 setgray .36264 .80712 moveto .32422 .77473 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .36264 .80712 moveto .32422 .77473 lineto stroke grestore gsave .214 setgray .29396 .84341 moveto .29396 .82238 lineto .32035 .84341 lineto fill grestore gsave .295 setgray .29396 .82238 moveto .32035 .84341 lineto .36264 .84341 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .29396 .82238 moveto .32035 .84341 lineto stroke grestore gsave .377 setgray .43132 .79283 moveto .40238 .77473 lineto .36264 .77473 lineto .43132 .84341 lineto fill grestore gsave .459 setgray .43132 .79283 moveto .40238 .77473 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .43132 .79283 moveto .40238 .77473 lineto stroke grestore gsave .295 setgray .36264 .84341 moveto .36264 .80712 lineto .42859 .84341 lineto fill grestore gsave .377 setgray .36264 .80712 moveto .42859 .84341 lineto .43132 .84341 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .36264 .80712 moveto .42859 .84341 lineto stroke grestore gsave .377 setgray .5 .84341 moveto .5 .81626 lineto .45725 .80065 lineto fill grestore gsave .459 setgray .5 .81626 moveto .45725 .80065 lineto .43132 .77473 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .5 .81626 moveto .45725 .80065 lineto stroke grestore gsave .377 setgray .43132 .79283 moveto .45725 .80065 lineto .5 .84341 lineto .43132 .84341 lineto fill grestore gsave .459 setgray .43132 .79283 moveto .45725 .80065 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .43132 .79283 moveto .45725 .80065 lineto stroke grestore gsave .377 setgray .56868 .84341 moveto .56868 .81846 lineto .54307 .81779 lineto fill grestore gsave .459 setgray .56868 .81846 moveto .54307 .81779 lineto .5 .77473 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .56868 .81846 moveto .54307 .81779 lineto stroke grestore gsave .377 setgray .5 .81626 moveto .54307 .81779 lineto .56868 .84341 lineto .5 .84341 lineto fill grestore gsave .459 setgray .5 .81626 moveto .54307 .81779 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .5 .81626 moveto .54307 .81779 lineto stroke grestore gsave .377 setgray .63736 .84341 moveto .60429 .81033 lineto .63736 .79841 lineto fill grestore gsave .459 setgray .60429 .81033 moveto .63736 .79841 lineto .63736 .77473 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .60429 .81033 moveto .63736 .79841 lineto stroke grestore gsave .377 setgray .60429 .81033 moveto .56868 .81846 lineto .56868 .84341 lineto .63736 .84341 lineto fill grestore gsave .459 setgray .60429 .81033 moveto .56868 .81846 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .60429 .81033 moveto .56868 .81846 lineto stroke grestore gsave .295 setgray .70604 .84341 moveto .69077 .82813 lineto .70604 .81743 lineto fill grestore gsave .377 setgray .69077 .82813 moveto .70604 .81743 lineto .70604 .77473 lineto .67754 .77473 lineto .65392 .79128 lineto fill grestore gsave 0.001 setlinewidth .69077 .82813 moveto .70604 .81743 lineto stroke grestore gsave .459 setgray .65392 .79128 moveto .67754 .77473 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .65392 .79128 moveto .67754 .77473 lineto stroke grestore gsave .295 setgray .70604 .84341 moveto .69077 .82813 lineto .65531 .84341 lineto fill grestore gsave .377 setgray .69077 .82813 moveto .65531 .84341 lineto .63736 .84341 lineto .63736 .79841 lineto .65392 .79128 lineto fill grestore gsave 0.001 setlinewidth .69077 .82813 moveto .65531 .84341 lineto stroke grestore gsave .459 setgray .65392 .79128 moveto .63736 .79841 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .65392 .79128 moveto .63736 .79841 lineto stroke grestore gsave .214 setgray .77473 .84341 moveto .76651 .83519 lineto .77473 .82423 lineto fill grestore gsave .295 setgray .76651 .83519 moveto .77473 .82423 lineto .77473 .77473 lineto .74892 .77473 lineto .73055 .79923 lineto fill grestore gsave 0.001 setlinewidth .76651 .83519 moveto .77473 .82423 lineto stroke grestore gsave .377 setgray .73055 .79923 moveto .74892 .77473 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .73055 .79923 moveto .74892 .77473 lineto stroke grestore gsave .214 setgray .77473 .84341 moveto .76651 .83519 lineto .75544 .84341 lineto fill grestore gsave .295 setgray .76651 .83519 moveto .75544 .84341 lineto .70604 .84341 lineto .70604 .81743 lineto .73055 .79923 lineto fill grestore gsave 0.001 setlinewidth .76651 .83519 moveto .75544 .84341 lineto stroke grestore gsave .377 setgray .73055 .79923 moveto .70604 .81743 lineto .70604 .77473 lineto fill grestore gsave 0.001 setlinewidth .73055 .79923 moveto .70604 .81743 lineto stroke grestore gsave .214 setgray .80334 .80334 moveto .82579 .77473 lineto .84341 .77473 lineto .84341 .84341 lineto fill grestore gsave .295 setgray .80334 .80334 moveto .82579 .77473 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .80334 .80334 moveto .82579 .77473 lineto stroke grestore gsave .214 setgray .80334 .80334 moveto .77473 .82423 lineto .77473 .84341 lineto .84341 .84341 lineto fill grestore gsave .295 setgray .80334 .80334 moveto .77473 .82423 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .80334 .80334 moveto .77473 .82423 lineto stroke grestore gsave .132 setgray .91209 .84341 moveto .89285 .82417 lineto .91209 .79774 lineto fill grestore gsave .214 setgray .89285 .82417 moveto .91209 .79774 lineto .91209 .77473 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .89285 .82417 moveto .91209 .79774 lineto stroke grestore gsave .132 setgray .91209 .84341 moveto .89285 .82417 lineto .8681 .84341 lineto fill grestore gsave .214 setgray .89285 .82417 moveto .8681 .84341 lineto .84341 .84341 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .89285 .82417 moveto .8681 .84341 lineto stroke grestore gsave .132 setgray .92504 .78768 moveto .93451 .77473 lineto .98077 .77473 lineto .98077 .84341 lineto fill grestore gsave .214 setgray .92504 .78768 moveto .93451 .77473 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .92504 .78768 moveto .93451 .77473 lineto stroke grestore gsave .132 setgray .92504 .78768 moveto .91209 .79774 lineto .91209 .84341 lineto .98077 .84341 lineto fill grestore gsave .214 setgray .92504 .78768 moveto .91209 .79774 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .92504 .78768 moveto .91209 .79774 lineto stroke grestore gsave 0.05 setgray 0.05598 .84341 moveto 0.08791 .88391 lineto 0.08791 .91209 lineto 0.01923 .84341 lineto fill grestore gsave .132 setgray 0.05598 .84341 moveto 0.08791 .88391 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.05598 .84341 moveto 0.08791 .88391 lineto stroke grestore gsave 0.05 setgray 0.01923 .91209 moveto 0.01923 .84341 lineto 0.08791 .91209 lineto fill grestore gsave .132 setgray 0.08791 .84341 moveto .15659 .91209 lineto .15659 .84341 lineto fill grestore gsave 0.05 setgray 0.08791 .91209 moveto .10838 .91209 lineto 0.08791 .88391 lineto fill grestore gsave .132 setgray .10838 .91209 moveto 0.08791 .88391 lineto 0.08791 .84341 lineto .15659 .91209 lineto fill grestore gsave 0.001 setlinewidth .10838 .91209 moveto 0.08791 .88391 lineto stroke grestore gsave .132 setgray .15659 .84341 moveto .22527 .91209 lineto .22527 .84341 lineto fill grestore gsave .132 setgray .15659 .91209 moveto .15659 .84341 lineto .22527 .91209 lineto fill grestore gsave .132 setgray .22527 .84341 moveto .22849 .84341 lineto .24276 .86089 lineto fill grestore gsave .214 setgray .22849 .84341 moveto .24276 .86089 lineto .29396 .91209 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .22849 .84341 moveto .24276 .86089 lineto stroke grestore gsave .132 setgray .28082 .91209 moveto .24276 .86089 lineto .22527 .84341 lineto .22527 .91209 lineto fill grestore gsave .214 setgray .28082 .91209 moveto .24276 .86089 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .28082 .91209 moveto .24276 .86089 lineto stroke grestore gsave .214 setgray .36264 .87758 moveto .32035 .84341 lineto .29396 .84341 lineto .36264 .91209 lineto fill grestore gsave .295 setgray .36264 .87758 moveto .32035 .84341 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36264 .87758 moveto .32035 .84341 lineto stroke grestore gsave .214 setgray .29396 .91209 moveto .36264 .91209 lineto .29396 .84341 lineto fill grestore gsave .214 setgray .43132 .91209 moveto .43132 .91179 lineto .43059 .91136 lineto fill grestore gsave .295 setgray .43132 .91179 moveto .43059 .91136 lineto .36264 .84341 lineto .42859 .84341 lineto .43132 .84501 lineto fill grestore gsave 0.001 setlinewidth .43132 .91179 moveto .43059 .91136 lineto stroke grestore gsave .377 setgray .43132 .84501 moveto .42859 .84341 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .43132 .84501 moveto .42859 .84341 lineto stroke grestore gsave .214 setgray .36264 .87758 moveto .43059 .91136 lineto .43132 .91209 lineto .36264 .91209 lineto fill grestore gsave .295 setgray .36264 .87758 moveto .43059 .91136 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36264 .87758 moveto .43059 .91136 lineto stroke grestore gsave .295 setgray .5 .91209 moveto .5 .86872 lineto .43352 .84561 lineto fill grestore gsave .377 setgray .5 .86872 moveto .43352 .84561 lineto .43132 .84341 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .5 .86872 moveto .43352 .84561 lineto stroke grestore gsave .214 setgray .43132 .91209 moveto .43132 .91179 lineto .43242 .91209 lineto fill grestore gsave .295 setgray .43132 .91179 moveto .43242 .91209 lineto .5 .91209 lineto .43352 .84561 lineto .43132 .84501 lineto fill grestore gsave 0.001 setlinewidth .43132 .91179 moveto .43242 .91209 lineto stroke grestore gsave .377 setgray .43132 .84501 moveto .43352 .84561 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .43132 .84501 moveto .43352 .84561 lineto stroke grestore gsave .295 setgray .56868 .91209 moveto .56868 .87178 lineto .52646 .86987 lineto fill grestore gsave .377 setgray .56868 .87178 moveto .52646 .86987 lineto .5 .84341 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .56868 .87178 moveto .52646 .86987 lineto stroke grestore gsave .295 setgray .5 .86872 moveto .52646 .86987 lineto .56868 .91209 lineto .5 .91209 lineto fill grestore gsave .377 setgray .5 .86872 moveto .52646 .86987 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .5 .86872 moveto .52646 .86987 lineto stroke grestore gsave .295 setgray .63736 .91209 moveto .59254 .86726 lineto .63736 .85308 lineto fill grestore gsave .377 setgray .59254 .86726 moveto .63736 .85308 lineto .63736 .84341 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .59254 .86726 moveto .63736 .85308 lineto stroke grestore gsave .295 setgray .59254 .86726 moveto .56868 .87178 lineto .56868 .91209 lineto .63736 .91209 lineto fill grestore gsave .377 setgray .59254 .86726 moveto .56868 .87178 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .59254 .86726 moveto .56868 .87178 lineto stroke grestore gsave .214 setgray .70604 .91209 moveto .69232 .89836 lineto .70604 .88953 lineto fill grestore gsave .295 setgray .69232 .89836 moveto .70604 .88953 lineto .70604 .84341 lineto .65531 .84341 lineto .64439 .85043 lineto fill grestore gsave 0.001 setlinewidth .69232 .89836 moveto .70604 .88953 lineto stroke grestore gsave .377 setgray .64439 .85043 moveto .65531 .84341 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .64439 .85043 moveto .65531 .84341 lineto stroke grestore gsave .214 setgray .70604 .91209 moveto .69232 .89836 lineto .65584 .91209 lineto fill grestore gsave .295 setgray .69232 .89836 moveto .65584 .91209 lineto .63736 .91209 lineto .63736 .85308 lineto .64439 .85043 lineto fill grestore gsave 0.001 setlinewidth .69232 .89836 moveto .65584 .91209 lineto stroke grestore gsave .377 setgray .64439 .85043 moveto .63736 .85308 lineto .63736 .84341 lineto fill grestore gsave 0.001 setlinewidth .64439 .85043 moveto .63736 .85308 lineto stroke grestore gsave .214 setgray .7336 .87096 moveto .75544 .84341 lineto .77473 .84341 lineto .77473 .91209 lineto fill grestore gsave .295 setgray .7336 .87096 moveto .75544 .84341 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .7336 .87096 moveto .75544 .84341 lineto stroke grestore gsave .214 setgray .7336 .87096 moveto .70604 .88953 lineto .70604 .91209 lineto .77473 .91209 lineto fill grestore gsave .295 setgray .7336 .87096 moveto .70604 .88953 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .7336 .87096 moveto .70604 .88953 lineto stroke grestore gsave .132 setgray .84341 .91209 moveto .82354 .89222 lineto .84341 .8679 lineto fill grestore gsave .214 setgray .82354 .89222 moveto .84341 .8679 lineto .84341 .84341 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .82354 .89222 moveto .84341 .8679 lineto stroke grestore gsave .132 setgray .84341 .91209 moveto .82354 .89222 lineto .79441 .91209 lineto fill grestore gsave .214 setgray .82354 .89222 moveto .79441 .91209 lineto .77473 .91209 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .82354 .89222 moveto .79441 .91209 lineto stroke grestore gsave .132 setgray .8575 .8575 moveto .8681 .84341 lineto .91209 .84341 lineto .91209 .91209 lineto fill grestore gsave .214 setgray .8575 .8575 moveto .8681 .84341 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .8575 .8575 moveto .8681 .84341 lineto stroke grestore gsave .132 setgray .8575 .8575 moveto .84341 .8679 lineto .84341 .91209 lineto .91209 .91209 lineto fill grestore gsave .214 setgray .8575 .8575 moveto .84341 .8679 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .8575 .8575 moveto .84341 .8679 lineto stroke grestore gsave .132 setgray .98077 .91209 moveto .98077 .84341 lineto .91209 .84341 lineto fill grestore gsave .132 setgray .98077 .91209 moveto .91209 .91209 lineto .91209 .84341 lineto fill grestore gsave 0.05 setgray 0.01923 .91209 moveto 0.08791 .98077 lineto 0.08791 .91209 lineto fill grestore gsave 0.05 setgray 0.01923 .98077 moveto 0.01923 .91209 lineto 0.08791 .98077 lineto fill grestore gsave 0.05 setgray .10838 .91209 moveto .15659 .9753 lineto .15659 .98077 lineto 0.08791 .91209 lineto fill grestore gsave .132 setgray .10838 .91209 moveto .15659 .9753 lineto .15659 .91209 lineto fill grestore gsave 0.001 setlinewidth .10838 .91209 moveto .15659 .9753 lineto stroke grestore gsave 0.05 setgray 0.08791 .98077 moveto 0.08791 .91209 lineto .15659 .98077 lineto fill grestore gsave .132 setgray .15659 .91209 moveto .22527 .98077 lineto .22527 .91209 lineto fill grestore gsave 0.05 setgray .15659 .98077 moveto .16076 .98077 lineto .15659 .9753 lineto fill grestore gsave .132 setgray .16076 .98077 moveto .15659 .9753 lineto .15659 .91209 lineto .22527 .98077 lineto fill grestore gsave 0.001 setlinewidth .16076 .98077 moveto .15659 .9753 lineto stroke grestore gsave .132 setgray .28082 .91209 moveto .29396 .92826 lineto .29396 .98077 lineto .22527 .91209 lineto fill grestore gsave .214 setgray .28082 .91209 moveto .29396 .92826 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .28082 .91209 moveto .29396 .92826 lineto stroke grestore gsave .132 setgray .22527 .98077 moveto .22527 .91209 lineto .29396 .98077 lineto fill grestore gsave .132 setgray .36264 .98077 moveto .36264 .97821 lineto .35069 .96883 lineto fill grestore gsave .214 setgray .36264 .97821 moveto .35069 .96883 lineto .29396 .91209 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .36264 .97821 moveto .35069 .96883 lineto stroke grestore gsave .132 setgray .29396 .92826 moveto .35069 .96883 lineto .36264 .98077 lineto .29396 .98077 lineto fill grestore gsave .214 setgray .29396 .92826 moveto .35069 .96883 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .29396 .92826 moveto .35069 .96883 lineto stroke grestore gsave .214 setgray .43132 .98077 moveto .36264 .91209 lineto .43132 .91209 lineto fill grestore gsave .132 setgray .36264 .98077 moveto .36264 .97821 lineto .36824 .98077 lineto fill grestore gsave .214 setgray .36264 .97821 moveto .36824 .98077 lineto .43132 .98077 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .36264 .97821 moveto .36824 .98077 lineto stroke grestore gsave .214 setgray .5 .93449 moveto .43242 .91209 lineto .43132 .91209 lineto .5 .98077 lineto fill grestore gsave .295 setgray .5 .93449 moveto .43242 .91209 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .5 .93449 moveto .43242 .91209 lineto stroke grestore gsave .214 setgray .43132 .98077 moveto .5 .98077 lineto .43132 .91209 lineto fill grestore gsave .214 setgray .56868 .98077 moveto .56868 .93835 lineto .52359 .93568 lineto fill grestore gsave .295 setgray .56868 .93835 moveto .52359 .93568 lineto .5 .91209 lineto .56868 .91209 lineto fill grestore gsave 0.001 setlinewidth .56868 .93835 moveto .52359 .93568 lineto stroke grestore gsave .214 setgray .5 .93449 moveto .52359 .93568 lineto .56868 .98077 lineto .5 .98077 lineto fill grestore gsave .295 setgray .5 .93449 moveto .52359 .93568 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .5 .93449 moveto .52359 .93568 lineto stroke grestore gsave .214 setgray .63736 .98077 moveto .59125 .93466 lineto .63736 .92154 lineto fill grestore gsave .295 setgray .59125 .93466 moveto .63736 .92154 lineto .63736 .91209 lineto .56868 .91209 lineto fill grestore gsave 0.001 setlinewidth .59125 .93466 moveto .63736 .92154 lineto stroke grestore gsave .214 setgray .59125 .93466 moveto .56868 .93835 lineto .56868 .98077 lineto .63736 .98077 lineto fill grestore gsave .295 setgray .59125 .93466 moveto .56868 .93835 lineto .56868 .91209 lineto fill grestore gsave 0.001 setlinewidth .59125 .93466 moveto .56868 .93835 lineto stroke grestore gsave .214 setgray .64437 .91909 moveto .65584 .91209 lineto .70604 .91209 lineto .70604 .98077 lineto fill grestore gsave .295 setgray .64437 .91909 moveto .65584 .91209 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .64437 .91909 moveto .65584 .91209 lineto stroke grestore gsave .214 setgray .64437 .91909 moveto .63736 .92154 lineto .63736 .98077 lineto .70604 .98077 lineto fill grestore gsave .295 setgray .64437 .91909 moveto .63736 .92154 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .64437 .91909 moveto .63736 .92154 lineto stroke grestore gsave .132 setgray .77473 .98077 moveto .75221 .95825 lineto .77473 .93035 lineto fill grestore gsave .214 setgray .75221 .95825 moveto .77473 .93035 lineto .77473 .91209 lineto .70604 .91209 lineto fill grestore gsave 0.001 setlinewidth .75221 .95825 moveto .77473 .93035 lineto stroke grestore gsave .132 setgray .77473 .98077 moveto .75221 .95825 lineto .71782 .98077 lineto fill grestore gsave .214 setgray .75221 .95825 moveto .71782 .98077 lineto .70604 .98077 lineto .70604 .91209 lineto fill grestore gsave 0.001 setlinewidth .75221 .95825 moveto .71782 .98077 lineto stroke grestore gsave .132 setgray .78558 .92294 moveto .79441 .91209 lineto .84341 .91209 lineto .84341 .98077 lineto fill grestore gsave .214 setgray .78558 .92294 moveto .79441 .91209 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .78558 .92294 moveto .79441 .91209 lineto stroke grestore gsave .132 setgray .78558 .92294 moveto .77473 .93035 lineto .77473 .98077 lineto .84341 .98077 lineto fill grestore gsave .214 setgray .78558 .92294 moveto .77473 .93035 lineto .77473 .91209 lineto fill grestore gsave 0.001 setlinewidth .78558 .92294 moveto .77473 .93035 lineto stroke grestore gsave .132 setgray .91209 .98077 moveto .91209 .91209 lineto .84341 .91209 lineto fill grestore gsave .132 setgray .91209 .98077 moveto .84341 .98077 lineto .84341 .91209 lineto fill grestore gsave 0.05 setgray .98077 .98077 moveto .95973 .95973 lineto .98077 .93123 lineto fill grestore gsave .132 setgray .95973 .95973 moveto .98077 .93123 lineto .98077 .91209 lineto .91209 .91209 lineto fill grestore gsave 0.001 setlinewidth .95973 .95973 moveto .98077 .93123 lineto stroke grestore gsave 0.05 setgray .98077 .98077 moveto .95973 .95973 lineto .93214 .98077 lineto fill grestore gsave .132 setgray .95973 .95973 moveto .93214 .98077 lineto .91209 .98077 lineto .91209 .91209 lineto fill grestore gsave 0.001 setlinewidth .95973 .95973 moveto .93214 .98077 lineto stroke grestore grestore % End of Graphics MathPictureEnd end showpage %%EndDocument endTexFig 225 1822 a 11840716 11722302 1710325 2302361 40455782 40916254 startTexFig 225 1822 a %%BeginDocument: R5two.ps %gr.pro prolog for graph plots from bruce's own graphics /G2PSbegin {newpath 0 0 moveto 12 setlinewidth 0 0 0 setrgbcolor 1 setlinecap 0 setlinejoin 2 setmiterlimit /imtx matrix currentmatrix def /dmtx matrix defaultmatrix def} def /len {dup mul exch dup mul add sqrt} def /dotpat {0 imtx dtransform len 0 idtransform len}def /solid {{}0}def /dotted {[0 dotpat 3 dotpat ] 0}def /fewdotted {[0 dotpat 6 dotpat ] 0} def /longdashed {[10 dotpat 4 dotpat] 0}def /shortdashed {[4 dotpat] 0}def /dashed {[6 dotpat] 0} def /dotdashed {[1 dotpat 6 dotpat 10 dotpat 6 dotpat] 0}def /none {[0 dotpat 10000 dotpat] 0} def /linestyle {solid} def /ratio 1 def /symbsiz 20 def % symbol size/radius /symbw 40 def /symbh 40 def /patternw 20 def /fillcolor {1 1 1} def % setrgbcolor value for symbol insides /linecolor {0 0 0} def % set color value for lines /nofill {} def /colorfill {fillcolor setrgbcolor fill} def /symbfil {colorfill} def % I think first true should be false, but little success /ifpath {pathbbox eq {eq {false} {true} ifelse} {pop pop true} ifelse} def /ifheight {pathbbox exch pop eq {pop false} {pop true} ifelse} def /crossfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw patternw rlineto patternw neg 0 rmoveto patternw patternw neg rlineto patternw neg patternw rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /plusfill { gsave 1.0 1.0 1.0 setrgbcolor fill grestore % wipe the inside clean clip currentpoint 0 patternw symbw {0 patternw symbh {patternw 0 rlineto patternw 2 div neg 0 rmoveto 0 patternw rlineto patternw 2 div neg 0 rmoveto pop} for patternw symbh patternw add patternw idiv patternw mul neg rmoveto pop} for stroke newpath moveto} def /txtpath 0 def % direction for strings in degrees /txtpos [0 0] def % positioning of strings relative to % current position /subpos [0 0] def /txtspace 1 def % space between letters in x direction /fontsiz 15 def % size of font /spacesiz 1 def % size for space character /foostr () def % draws a line between a pair of points /pairup {moveto lineto stroke} def /ifpairup {moveto lineto ifpath {stroke} if} def /dopairs { linecolor setrgbcolor {pairup} repeat} def % draws a line joining n points, where n is the last % number before doline is called /doline { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat stroke} def % fill area closes the path and fills the area /fillarea { linecolor setrgbcolor 3 1 roll moveto 1 sub {lineto} repeat gsave closepath symbfil grestore stroke} def % draws a circle radius symbsiz at current point /docircle { newpath linestyle setdash symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke } def /ori 0 def /doellipse { dup neg /movy exch def exch dup neg /movx exch def exch translate ori rotate 1 ratio scale newpath linestyle setdash 0 0 symbsiz 0 360 arc gsave closepath % define cirlce symbw neg symbh 2 div neg rmoveto symbfil % move to corner before filling grestore linecolor setrgbcolor stroke 1 ratio 1 exch div scale ori neg rotate movx movy translate} def % dobar draws a vertical bar % y x basey => - /dobar {newpath dup 3 1 roll exch symbsiz sub exch moveto symbsiz 2 mul 0 rlineto sub dup /symbh exch def dup 0 exch rlineto symbsiz 2 mul neg 0 rlineto neg 0 exch rlineto ifheight {gsave closepath symbfil grestore} if ifheight {stroke} if} def % an array descibing the relative co-ordinates of a the % points in a non-circular symbol /symbary [10 10 -20 0 0 -20 20 0 0 20] def % draws a symbol desribed by an array on top of the stack /arydraw { /ard exch def currentpoint % save centre posn ard 0 get ard 1 get rmoveto % go to plotting point 2 2 ard length 1 sub % { dup 1 add ard exch get exch ard exch get rlineto } for gsave closepath moveto % return to centre symbw 2 div neg symbh 2 div neg rmoveto % bottom left corner ifpath {symbfil} if grestore ifpath {linecolor setrgbcolor stroke} if } def % plots symbol symbary at x,y on the stack /plotsymb {dupxy /movy exch neg def /movx exch neg def moveto ori rotate symbary arydraw ori neg rotate movx movy moveto} def % prints a string in direction txtpath, /sprnt {3 1 roll dup neg 4 1 roll exch dup neg 5 1 roll exch translate txtpath rotate puts txtpath neg rotate translate} def /puts {linecolor setrgbcolor dup dup stringwidth pop exch length txtspace mul add txtpos 0 get mul neg fontsiz txtpos 1 get mul neg moveto 0 0 8#040 txtspace 0 6 -1 roll awidthshow} def /showmark {docircle} def /dupxy {dup 3 2 roll dup 4 1 roll exch} def /nlin 0 def /offx 0 def /showkeyline {dupxy dupxy dupxy exch symbw nlin mul add exch ifpath {pairup} if pop pop} def /showkeysymb {dupxy exch offx add exch showmark} def /showkey {showkeyline /offx 0 def showkeysymb pop pop} def % stringmark puts a symbol within a string /stringmark {4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub symbsiz add % X pos for mark - sub was add before!! fontsiz txtpos 1 get 0.4 exch sub mul showkey txtpath neg rotate translate} def %set a default font /Times-Roman findfont fontsiz scalefont setfont /mainfont /Times-Roman def % substr places the string foostr inside another string % scaled down by factor subscale /subfont mainfont def /subscale 0.8 def /substr {/cpath txtpath def 4 2 roll dup neg 5 1 roll exch dup neg 6 1 roll exch % make inverse co-ordinates translate txtpath rotate % move to string pos dup stringwidth pop exch length txtspace mul add % lengtt of first string exch dup stringwidth pop exch length txtspace mul add % length of full string txtpos 0 get mul sub subpos 0 get foostr stringwidth pop mul add % X pos for mark fontsiz txtpos 1 get 0.4 exch sub subpos 1 get add mul % Ypos /txtpath 0 def /txtpos [0. 0.4] def subfont findfont fontsiz subscale mul scalefont setfont foostr sprnt /txtpath cpath def txtpath neg rotate translate mainfont findfont fontsiz scalefont setfont} def G2PSbegin 18 36 translate 0.034965 0.034965 scale 0 0 translate % Graph number 1 0 0 translate 16 setlinewidth solid setdash /linestyle {solid} def /linecolor {0.0 0.0 0.0} def 2400 2080 15200 2080 2400 2080 2400 1904 4533 2080 4533 1904 6666 2080 6666 1904 8800 2080 8800 1904 10933 2080 10933 1904 13066 2080 13066 1904 15200 2080 15200 1904 8 dopairs 2080 2400 2080 15200 2080 2400 1904 2400 2080 4533 1904 4533 2080 6666 1904 6666 2080 8800 1904 8800 2080 10933 1904 10933 2080 13066 1904 13066 2080 15200 1904 15200 8 dopairs % Data Set 1: 20 setlinewidth solid setdash /linestyle {solid} def /symbfil {colorfill} def /fillcolor {0.0 0.0 0.0} def /patternw 63 def /symbsiz 63 def /symbw 126 def /symbh 436 def /ori 82.07 def /showmark {plotsymb} def /symbary [0 0 63 167 -42 0 0 269 -42 0 0 -269 -42 0 63 -167] def % Arrow /fillcolor {0.0 0.0 0.0} def 2340 1969 1 {showmark} repeat /patternw 131 def /symbsiz 131 def /symbw 262 def /symbh 904 def /ori 91.33 def /showmark {plotsymb} def /symbary [0 0 131 349 -88 0 0 555 -86 0 0 -555 -88 0 131 -349] def % Arrow 2421 3629 1 {showmark} repeat /patternw 241 def /symbsiz 241 def /symbw 482 def /symbh 1668 def /ori 105.89 def /showmark {plotsymb} def /symbary [0 0 241 642 -161 0 0 1026 -160 0 0 -1026 -161 0 241 -642] def % Arrow 2857 5062 1 {showmark} repeat /patternw 306 def /symbsiz 306 def /symbw 612 def /symbh 2116 def /ori 115.54 def /showmark {plotsymb} def /symbary [0 0 306 815 -204 0 0 1301 -204 0 0 -1301 -204 0 306 -815] def % Arrow 3313 6889 1 {showmark} repeat /patternw 246 def /symbsiz 246 def /symbw 492 def /symbh 1698 def /ori 120.51 def /showmark {plotsymb} def /symbary [0 0 246 656 -164 0 0 1042 -164 0 0 -1042 -164 0 246 -656] def % Arrow 3262 9470 1 {showmark} repeat /patternw 136 def /symbsiz 136 def /symbw 272 def /symbh 938 def /ori 128.55 def /showmark {plotsymb} def /symbary [0 0 136 362 -91 0 0 576 -90 0 0 -576 -91 0 136 -362] def % Arrow 2985 12333 1 {showmark} repeat /patternw 65 def /symbsiz 65 def /symbw 130 def /symbh 450 def /ori 136.98 def /showmark {plotsymb} def /symbary [0 0 65 173 -44 0 0 277 -42 0 0 -277 -44 0 65 -173] def % Arrow 2729 14893 1 {showmark} repeat /patternw 65 def /symbsiz 65 def /symbw 130 def /symbh 450 def /ori 77.42 def /showmark {plotsymb} def /symbary [0 0 65 173 -44 0 0 277 -42 0 0 -277 -44 0 65 -173] def % Arrow 4435 1961 1 {showmark} repeat /patternw 136 def /symbsiz 136 def /symbw 272 def /symbh 940 def /ori 86.10 def /showmark {plotsymb} def /symbary [0 0 136 362 -91 0 0 578 -90 0 0 -578 -91 0 136 -362] def % Arrow 4469 3595 1 {showmark} repeat /patternw 251 def /symbsiz 251 def /symbw 502 def /symbh 1734 def /ori 98.49 def /showmark {plotsymb} def /symbary [0 0 251 669 -168 0 0 1065 -166 0 0 -1065 -168 0 251 -669] def % Arrow 4789 4951 1 {showmark} repeat /patternw 319 def /symbsiz 319 def /symbw 638 def /symbh 2204 def /ori 105.95 def /showmark {plotsymb} def /symbary [0 0 319 850 -213 0 0 1354 -212 0 0 -1354 -213 0 319 -850] def % Arrow 5139 6679 1 {showmark} repeat /patternw 257 def /symbsiz 257 def /symbw 514 def /symbh 1774 def /ori 111.75 def /showmark {plotsymb} def /symbary [0 0 257 685 -172 0 0 1089 -170 0 0 -1089 -172 0 257 -685] def % Arrow 5190 9286 1 {showmark} repeat /patternw 142 def /symbsiz 142 def /symbw 284 def /symbh 980 def /ori 120.93 def /showmark {plotsymb} def /symbary [0 0 142 378 -95 0 0 602 -94 0 0 -602 -95 0 142 -378] def % Arrow 5037 12226 1 {showmark} repeat /patternw 68 def /symbsiz 68 def /symbw 136 def /symbh 470 def /ori 128.79 def /showmark {plotsymb} def /symbary [0 0 68 181 -46 0 0 289 -44 0 0 -289 -46 0 68 -181] def % Arrow 4828 14833 1 {showmark} repeat /patternw 47 def /symbsiz 47 def /symbw 94 def /symbh 324 def /ori 73.18 def /showmark {plotsymb} def /symbary [0 0 47 125 -32 0 0 199 -30 0 0 -199 -32 0 47 -125] def % Arrow 6573 2089 1 {showmark} repeat /patternw 99 def /symbsiz 99 def /symbw 198 def /symbh 684 def /ori 80.65 def /showmark {plotsymb} def /symbary [0 0 99 264 -66 0 0 420 -66 0 0 -420 -66 0 99 -264] def % Arrow 6556 3859 1 {showmark} repeat /patternw 182 def /symbsiz 182 def /symbw 364 def /symbh 1260 def /ori 89.77 def /showmark {plotsymb} def /symbary [0 0 182 485 -122 0 0 775 -120 0 0 -775 -122 0 182 -485] def % Arrow 6662 5408 1 {showmark} repeat /patternw 232 def /symbsiz 232 def /symbw 464 def /symbh 1606 def /ori 96.54 def /showmark {plotsymb} def /symbary [0 0 232 618 -155 0 0 988 -154 0 0 -988 -155 0 232 -618] def % Arrow 6850 7204 1 {showmark} repeat /patternw 187 def /symbsiz 187 def /symbw 374 def /symbh 1294 def /ori 105.69 def /showmark {plotsymb} def /symbary [0 0 187 498 -125 0 0 796 -124 0 0 -796 -125 0 187 -498] def % Arrow 7017 9687 1 {showmark} repeat /patternw 104 def /symbsiz 104 def /symbw 208 def /symbh 716 def /ori 115.74 def /showmark {plotsymb} def /symbary [0 0 104 277 -70 0 0 439 -68 0 0 -439 -70 0 104 -277] def % Arrow 6978 12422 1 {showmark} repeat /patternw 50 def /symbsiz 50 def /symbw 100 def /symbh 342 def /ori 122.25 def /showmark {plotsymb} def /symbary [0 0 50 133 -34 0 0 209 -32 0 0 -209 -34 0 50 -133] def % Arrow 6850 14910 1 {showmark} repeat /patternw 1 def /symbsiz 1 def /symbw 2 def /symbh 4 def /ori 180.00 def /showmark {plotsymb} def /symbary [0 0 1 2 -1 0 0 2 0 0 0 -2 -1 0 1 -2] def % Arrow 8804 2400 1 {showmark} repeat /patternw 2 def /symbsiz 2 def /symbw 4 def /symbh 10 def /ori 156.04 def /showmark {plotsymb} def /symbary [0 0 2 5 -2 0 0 5 0 0 0 -5 -2 0 2 -5] def % Arrow 8809 4529 1 {showmark} repeat /patternw 3 def /symbsiz 3 def /symbw 6 def /symbh 22 def /ori 156.80 def /showmark {plotsymb} def /symbary [0 0 3 8 -2 0 0 14 -2 0 0 -14 -2 0 3 -8] def % Arrow 8821 6658 1 {showmark} repeat /patternw 5 def /symbsiz 5 def /symbw 10 def /symbh 36 def /ori 165.17 def /showmark {plotsymb} def /symbary [0 0 5 13 -4 0 0 23 -2 0 0 -23 -4 0 5 -13] def % Arrow 8834 8791 1 {showmark} repeat /patternw 5 def /symbsiz 5 def /symbw 10 def /symbh 34 def /ori 166.76 def /showmark {plotsymb} def /symbary [0 0 5 13 -4 0 0 21 -2 0 0 -21 -4 0 5 -13] def % Arrow 8834 10925 1 {showmark} repeat /patternw 3 def /symbsiz 3 def /symbw 6 def /symbh 22 def /ori 166.61 def /showmark {plotsymb} def /symbary [0 0 3 8 -2 0 0 14 -2 0 0 -14 -2 0 3 -8] def % Arrow 8821 13062 1 {showmark} repeat /patternw 1 def /symbsiz 1 def /symbw 2 def /symbh 10 def /ori 180.00 def /showmark {plotsymb} def /symbary [0 0 1 2 -1 0 0 8 0 0 0 -8 -1 0 1 -2] def % Arrow 8809 15200 1 {showmark} repeat /patternw 48 def /symbsiz 48 def /symbw 96 def /symbh 330 def /ori 229.66 def /showmark {plotsymb} def /symbary [0 0 48 127 -32 0 0 203 -32 0 0 -203 -32 0 48 -127] def % Arrow 11147 2652 1 {showmark} repeat /patternw 99 def /symbsiz 99 def /symbw 198 def /symbh 684 def /ori 240.03 def /showmark {plotsymb} def /symbary [0 0 99 264 -66 0 0 420 -66 0 0 -420 -66 0 99 -264] def % Arrow 11275 5126 1 {showmark} repeat /patternw 183 def /symbsiz 183 def /symbw 366 def /symbh 1260 def /ori 252.47 def /showmark {plotsymb} def /symbary [0 0 183 487 -122 0 0 773 -122 0 0 -773 -122 0 183 -487] def % Arrow 11313 7870 1 {showmark} repeat /patternw 231 def /symbsiz 231 def /symbw 462 def /symbh 1596 def /ori 267.70 def /showmark {plotsymb} def /symbary [0 0 231 616 -154 0 0 980 -154 0 0 -980 -154 0 231 -616] def % Arrow 10997 10396 1 {showmark} repeat /patternw 184 def /symbsiz 184 def /symbw 368 def /symbh 1270 def /ori 281.04 def /showmark {plotsymb} def /symbary [0 0 184 490 -123 0 0 780 -122 0 0 -780 -123 0 184 -490] def % Arrow 10690 12179 1 {showmark} repeat /patternw 101 def /symbsiz 101 def /symbw 202 def /symbh 694 def /ori 286.74 def /showmark {plotsymb} def /symbary [0 0 101 269 -68 0 0 425 -66 0 0 -425 -68 0 101 -269] def % Arrow 10733 13732 1 {showmark} repeat /patternw 48 def /symbsiz 48 def /symbw 96 def /symbh 334 def /ori 289.35 def /showmark {plotsymb} def /symbary [0 0 48 128 -32 0 0 206 -32 0 0 -206 -32 0 48 -128] def % Arrow 10822 15516 1 {showmark} repeat /patternw 66 def /symbsiz 66 def /symbw 132 def /symbh 456 def /ori 226.25 def /showmark {plotsymb} def /symbary [0 0 66 175 -44 0 0 281 -44 0 0 -281 -44 0 66 -175] def % Arrow 13382 2729 1 {showmark} repeat /patternw 137 def /symbsiz 137 def /symbw 274 def /symbh 944 def /ori 235.69 def /showmark {plotsymb} def /symbary [0 0 137 365 -92 0 0 579 -90 0 0 -579 -92 0 137 -365] def % Arrow 13600 5314 1 {showmark} repeat /patternw 252 def /symbsiz 252 def /symbw 504 def /symbh 1738 def /ori 250.83 def /showmark {plotsymb} def /symbary [0 0 252 671 -168 0 0 1067 -168 0 0 -1067 -168 0 252 -671] def % Arrow 13638 8309 1 {showmark} repeat /patternw 319 def /symbsiz 319 def /symbw 638 def /symbh 2204 def /ori 267.79 def /showmark {plotsymb} def /symbary [0 0 319 850 -213 0 0 1354 -212 0 0 -1354 -213 0 319 -850] def % Arrow 13152 11002 1 {showmark} repeat /patternw 254 def /symbsiz 254 def /symbw 508 def /symbh 1756 def /ori 277.40 def /showmark {plotsymb} def /symbary [0 0 254 677 -170 0 0 1079 -168 0 0 -1079 -170 0 254 -677] def % Arrow 12841 12674 1 {showmark} repeat /patternw 139 def /symbsiz 139 def /symbw 278 def /symbh 964 def /ori 282.03 def /showmark {plotsymb} def /symbary [0 0 139 370 -93 0 0 594 -92 0 0 -594 -93 0 139 -370] def % Arrow 12866 14010 1 {showmark} repeat /patternw 67 def /symbsiz 67 def /symbw 134 def /symbh 464 def /ori 289.33 def /showmark {plotsymb} def /symbary [0 0 67 178 -45 0 0 286 -44 0 0 -286 -45 0 67 -178] def % Arrow 12913 15639 1 {showmark} repeat /patternw 63 def /symbsiz 63 def /symbw 126 def /symbh 436 def /ori 230.58 def /showmark {plotsymb} def /symbary [0 0 63 168 -42 0 0 268 -42 0 0 -268 -42 0 63 -168] def % Arrow 15477 2737 1 {showmark} repeat /patternw 131 def /symbsiz 131 def /symbw 262 def /symbh 904 def /ori 237.54 def /showmark {plotsymb} def /symbary [0 0 131 349 -88 0 0 555 -86 0 0 -555 -88 0 131 -349] def % Arrow 15686 5297 1 {showmark} repeat /patternw 242 def /symbsiz 242 def /symbw 484 def /symbh 1670 def /ori 251.83 def /showmark {plotsymb} def /symbary [0 0 242 645 -162 0 0 1025 -160 0 0 -1025 -162 0 242 -645] def % Arrow 15721 8254 1 {showmark} repeat /patternw 307 def /symbsiz 307 def /symbw 614 def /symbh 2120 def /ori 266.89 def /showmark {plotsymb} def /symbary [0 0 307 818 -205 0 0 1302 -204 0 0 -1302 -205 0 307 -818] def % Arrow 15315 10916 1 {showmark} repeat /patternw 244 def /symbsiz 244 def /symbw 488 def /symbh 1686 def /ori 272.17 def /showmark {plotsymb} def /symbary [0 0 244 650 -163 0 0 1036 -162 0 0 -1036 -163 0 244 -650] def % Arrow 15136 12619 1 {showmark} repeat /patternw 134 def /symbsiz 134 def /symbw 268 def /symbh 920 def /ori 277.98 def /showmark {plotsymb} def /symbary [0 0 134 357 -90 0 0 563 -88 0 0 -563 -90 0 134 -357] def % Arrow 15072 13980 1 {showmark} repeat /patternw 64 def /symbsiz 64 def /symbw 128 def /symbh 446 def /ori 290.71 def /showmark {plotsymb} def /symbary [0 0 64 170 -43 0 0 276 -42 0 0 -276 -43 0 64 -170] def % Arrow 15042 15618 1 {showmark} repeat /fontsiz 768 def /spacesiz 51 def /fontsiz 768 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtpath 90 def /txtspace 63 def /txtpos [0.50 0.00] def 683 8912 (Y \(cm\)) sprnt /txtpath 0 def /txtpos [0.50 0.50] def 8160 800 (X \(cm\)) sprnt /fontsiz 771 def /spacesiz 51 def /fontsiz 771 def /spacesiz 51 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 64 def /txtpos [0.50 1.00] def 617 17091 (c\)) sprnt /txtpos [0.00 0.00] def /fontsiz 512 def /spacesiz 34 def /fontsiz 512 def /spacesiz 34 def /mainfont /Helvetica def mainfont findfont fontsiz scalefont setfont /txtspace 42 def /txtpos [0.50 1.00] def 2400 1744 (-10) sprnt 4533 1744 (-5) sprnt 6666 1744 (0) sprnt 8800 1744 (5) sprnt 10933 1744 (10) sprnt 13066 1744 (15) sprnt 15200 1744 (20) sprnt /txtpos [1.00 0.35] def 1744 2400 (20) sprnt 1744 4533 (25) sprnt 1744 6666 (30) sprnt 1744 8800 (35) sprnt 1744 10933 (40) sprnt 1744 13066 (45) sprnt 1744 15200 (50) sprnt 0 0 translate 0 0 translate 28.600028 28.600028 scale -18 -36 translate showpage %%EndDocument endTexFig 991 1762 a 11840716 12669565 4736286 9472573 35522150 42626580 startTexFig 991 1762 a %%BeginDocument: R5twoc.ps /Mathdict 100 dict def Mathdict begin /Mlmarg 1.0 72 mul def /Mrmarg 1.0 72 mul def /Mbmarg 1.0 72 mul def /Mtmarg 1.0 72 mul def /Mwidth 8.5 72 mul def /Mheight 11 72 mul def /Mtransform { } bind def /Mnodistort true def /Mfixwid false def /Mfixdash false def /Mrot 0 def /Mpstart { MathPictureStart } bind def /Mpend { MathPictureEnd } bind def /Mscale { 0 1 0 1 5 -1 roll MathScale } bind def /ISOLatin1Encoding dup where { pop pop } { [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def } ifelse /MFontDict 50 dict def /MStrCat { exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval } def /MCreateEncoding { 1 index 255 string cvs (-) MStrCat 1 index MStrCat cvn exch (Encoding) MStrCat cvn dup where { exch get } { pop StandardEncoding } ifelse 3 1 roll dup MFontDict exch known not { 1 index findfont dup length dict begin {1 index /FID ne {def} {pop pop} ifelse} forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put } if exch pop exch pop } def /ISOLatin1 { (ISOLatin1) MCreateEncoding } def /ISO8859 { (ISOLatin1) MCreateEncoding } def /Mcopyfont { dup maxlength dict exch { 1 index /FID eq { pop pop } { 2 index 3 1 roll put } ifelse } forall } def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier-Bold findfont Mcopyfont definefont pop /Italic /Courier-Oblique findfont Mcopyfont definefont pop /MathPictureStart { gsave Mtransform Mlmarg Mbmarg translate /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def } bind def /MathPictureEnd { grestore } bind def /MathSubStart { Momatrix Mgmatrix Mtmatrix Mlmarg Mrmarg Mbmarg Mtmarg Mwidth Mheight 11 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 13 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def } bind def /MathSubEnd { /Mheight exch def /Mwidth exch def /Mtmarg exch def /Mbmarg exch def /Mrmarg exch def /Mlmarg exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def } bind def /Mdot { moveto 0 0 rlineto stroke } bind def /Mtetra { moveto lineto lineto lineto fill } bind def /Metetra { moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke } bind def /Mistroke { flattenpath 0 0 0 { 4 2 roll pop pop } { 4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll } { stop } { stop } pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash } bind def /Mfstroke { stroke currentdash pop 0 setdash } bind def /Mrotsboxa { gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def } bind def /Msboxa { newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot [ 7 -2 roll 2 copy [ 3 1 roll 10 -1 roll 9 -1 roll ] 6 1 roll 5 -2 roll ] } bind def /Msboxa1 { sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul } bind def /Mvboxa { Mfixwid { Mvboxa1 } { dup Mwidthcal 0 exch { add } forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll } ifelse } bind def /Mvboxa1 { gsave newpath [ true 3 -1 roll { Mbbox 5 -1 roll { 0 5 1 roll } { 7 -1 roll exch sub (m) stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll } ifelse false } forall { stop } if counttomark 1 add 4 roll ] grestore } bind def /Mbbox { 1 dict begin 0 0 moveto /temp (T) def { gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto} forall pathbbox newpath end } bind def /Mmin { 2 copy gt { exch } if pop } bind def /Mmax { 2 copy lt { exch } if pop } bind def /Mrotshowa { dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def } bind def /Mshowa { 4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid { Mshowax } { Mshoway } ifelse pop pop pop pop Mgmatrix setmatrix } bind def /Mshowax { 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash { Mfixdashp } if show } for } bind def /Mfixdashp { dup length 1 gt 1 index true exch { 45 eq and } forall and { gsave (--) stringwidth pop (-) stringwidth pop sub 2 div 0 rmoveto dup length 1 sub { (-) show } repeat grestore } if } bind def /Mshoway { 3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add { 2 index 4 index 2 index get 3 index add moveto 4 index exch get [ 6 index aload length 2 add -1 roll { pop Strform stringwidth pop neg exch add 0 rmoveto } exch kshow cleartomark } for pop } bind def /Mwidthcal { [ exch { Mwidthcal1 } forall ] [ exch dup Maxlen -1 add 0 1 3 -1 roll { [ exch 2 index { 1 index Mget exch } forall pop Maxget exch } for pop ] Mreva } bind def /Mreva { [ exch aload length -1 1 {1 roll} for ] } bind def /Mget { 1 index length -1 add 1 index ge { get } { pop pop 0 } ifelse } bind def /Maxlen { [ exch { length } forall Maxget } bind def /Maxget { counttomark -1 add 1 1 3 -1 roll { pop Mmax } for exch pop } bind def /Mwidthcal1 { [ exch { Strform stringwidth pop } forall ] } bind def /Strform { /tem (x) def tem 0 3 -1 roll put tem } bind def /Mshowa1 { 2 copy add 4 1 roll sub mul sub -2 div } bind def /MathScale { Mwidth Mlmarg Mrmarg add sub Mheight Mbmarg Mtmarg add sub 0 0 moveto 1 index 0 lineto 2 copy lineto 0 1 index lineto clip newpath Mlp translate dup /Mathabs exch def scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def } bind def /Mlp { 3 copy Mlpfirst { Mnodistort { Mmin dup } if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and { exit } if 3 -1 roll pop pop } loop exch 3 1 roll 7 -3 roll pop pop pop } bind def /Mlpfirst { 3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div } bind def /Mlprun { 2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll { 3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll } forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll } bind def /Mlprun1 { aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add } bind def /Mlprun2 { 2 copy add 2 div 3 1 roll exch sub } bind def /Mlpminmax { cvx 2 index 6 index 2 index exec { 7 -3 roll 4 -1 roll } if 1 index 5 index 3 -1 roll exec { 4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop [ 8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll ] 4 1 roll pop } { pop pop pop } ifelse } bind def /Mlp1 { 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not { 1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll } if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch } bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner { outflag 1 eq { /outflag 0 def /intop 0 def /inrht 0 def } if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt { /intop exch def } { pop } ifelse dup inrht gt { /inrht exch def } { pop } ifelse pop /inflag 1 def } bind def /Mouter { /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq { dup 0 lt { dup intop mul neg /yadtop exch def } if dup 0 gt { dup intop mul /yadbot exch def } if pop dup 0 lt { dup inrht mul neg /xadrht exch def } if dup 0 gt { dup inrht mul /xadlft exch def } if pop /outflag 1 def } { pop pop} ifelse /inflag 0 def /inrht 0 def /intop 0 def } bind def /Mboxout { outflag 1 eq { 4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def } if } bind def /leadjust { (m) stringwidth pop .5 mul } bind def /Mrotcheck { dup 90 eq { yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def } if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop } bind def /Checkaux { 4 index exch 4 index mul 3 1 roll mul add 4 1 roll } bind def /Mboxrot { Mrot 90 eq { brotaux 4 2 roll } if Mrot 180 eq { 4 2 roll brotaux 4 2 roll brotaux } if Mrot 270 eq { 4 2 roll brotaux } if } bind def /brotaux { neg exch neg } bind def /Mabswid { Mathabs div setlinewidth } bind def /Mabsdash { exch Mathabs [ 3 1 roll exch { exch dup 3 -1 roll exch div exch } forall pop ] exch setdash } bind def /MBeginOrig { Momatrix concat} bind def /MEndOrig { Mgmatrix setmatrix} bind def /colorimage where { pop } { /colorimage { 3 1 roll pop pop 5 -1 roll mul 4 1 roll { currentfile 1 index readhexstring pop } image } bind def } ifelse /sampledsound where { pop} { /sampledsound { exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def { Mtempproc pop} repeat } bind def } ifelse /setcmykcolor where { pop} { /setcmykcolor { 4 1 roll [ 4 1 roll ] { 1 index sub 1 sub neg dup 0 lt { pop 0 } if dup 1 gt { pop 1 } if exch } forall pop setrgbcolor } bind def } ifelse MathPictureStart /Helvetica findfont 25 scalefont setfont % Scaling calculations 0.00320513 0.0160256 0.00320513 0.0160256 [ [(-10)] 0.03526 0 0 2 0 Minner Mrotsboxa [(0)] .32372 0 0 2 0 Minner Mrotsboxa [(10)] .64423 0 0 2 0 Minner Mrotsboxa [(20)] .96474 0 0 2 0 Minner Mrotsboxa [(X \(cm\))] .5 0 0 2 0 0 -1 Mouter Mrotsboxa [(20)] -0.0125 0.03526 1 0 0 Minner Mrotsboxa [(30)] -0.0125 .32372 1 0 0 Minner Mrotsboxa [(40)] -0.0125 .64423 1 0 0 Minner Mrotsboxa [(50)] -0.0125 .96474 1 0 0 Minner Mrotsboxa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotsboxa [(f\) )] .5 1 0 -4 Msboxa [ -0.001 -0.001 0 0 ] [ 1.001 1.001 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 setgray gsave gsave gsave 0.002 setlinewidth 0.03526 0 moveto 0.03526 0.00625 lineto stroke grestore [(-10)] 0.03526 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .32372 0 moveto .32372 0.00625 lineto stroke grestore [(0)] .32372 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .64423 0 moveto .64423 0.00625 lineto stroke grestore [(10)] .64423 0 0 2 0 Minner Mrotshowa gsave 0.002 setlinewidth .96474 0 moveto .96474 0.00625 lineto stroke grestore [(20)] .96474 0 0 2 0 Minner Mrotshowa [(X \(cm\))] .5 0 0 2 0 0 -1 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 1 0 lineto stroke grestore gsave 0.002 setlinewidth 0 0.03526 moveto 0.00625 0.03526 lineto stroke grestore [(20)] -0.0125 0.03526 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .32372 moveto 0.00625 .32372 lineto stroke grestore [(30)] -0.0125 .32372 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .64423 moveto 0.00625 .64423 lineto stroke grestore [(40)] -0.0125 .64423 1 0 0 Minner Mrotshowa gsave 0.002 setlinewidth 0 .96474 moveto 0.00625 .96474 lineto stroke grestore [(50)] -0.0125 .96474 1 0 0 Minner Mrotshowa [(Y \(cm\))] -0.0125 .5 1 0 90 -1 0 Mouter Mrotshowa gsave 0.002 setlinewidth 0 0 moveto 0 1 lineto stroke grestore grestore gsave gsave 0.002 setlinewidth 0.03526 .99375 moveto 0.03526 1 lineto stroke grestore gsave 0.002 setlinewidth .32372 .99375 moveto .32372 1 lineto stroke grestore gsave 0.002 setlinewidth .64423 .99375 moveto .64423 1 lineto stroke grestore gsave 0.002 setlinewidth .96474 .99375 moveto .96474 1 lineto stroke grestore [(f\) )] .5 1 0 -4 Mshowa gsave 0.002 setlinewidth 0 1 moveto 1 1 lineto stroke grestore gsave 0.002 setlinewidth .99375 0.03526 moveto 1 0.03526 lineto stroke grestore gsave 0.002 setlinewidth .99375 .32372 moveto 1 .32372 lineto stroke grestore gsave 0.002 setlinewidth .99375 .64423 moveto 1 .64423 lineto stroke grestore gsave 0.002 setlinewidth .99375 .96474 moveto 1 .96474 lineto stroke grestore gsave 0.002 setlinewidth 1 0 moveto 1 1 lineto stroke grestore grestore gsave grestore grestore 0 0 moveto 1 0 lineto 1 1 lineto 0 1 lineto closepath clip newpath gsave gsave .295 setgray 0.08791 0.08791 moveto 0.06724 0.06724 lineto 0.08791 0.06529 lineto fill grestore gsave .377 setgray 0.06724 0.06724 moveto 0.08791 0.06529 lineto 0.08791 0.01923 lineto 0.01923 0.01923 lineto fill grestore gsave 0.001 setlinewidth 0.06724 0.06724 moveto 0.08791 0.06529 lineto stroke grestore gsave .295 setgray 0.06724 0.06724 moveto 0.01923 0.07438 lineto 0.01923 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave .377 setgray 0.06724 0.06724 moveto 0.01923 0.07438 lineto 0.01923 0.01923 lineto fill grestore gsave 0.001 setlinewidth 0.06724 0.06724 moveto 0.01923 0.07438 lineto stroke grestore gsave .295 setgray .15659 0.08791 moveto .13192 0.06323 lineto .15659 0.0628 lineto fill grestore gsave .377 setgray .13192 0.06323 moveto .15659 0.0628 lineto .15659 0.01923 lineto 0.08791 0.01923 lineto fill grestore gsave 0.001 setlinewidth .13192 0.06323 moveto .15659 0.0628 lineto stroke grestore gsave .295 setgray .13192 0.06323 moveto 0.08791 0.06529 lineto 0.08791 0.08791 lineto .15659 0.08791 lineto fill grestore gsave .377 setgray .13192 0.06323 moveto 0.08791 0.06529 lineto 0.08791 0.01923 lineto fill grestore gsave 0.001 setlinewidth .13192 0.06323 moveto 0.08791 0.06529 lineto stroke grestore gsave .295 setgray .22527 0.08791 moveto .22527 0.07145 lineto .20665 0.06929 lineto fill grestore gsave .377 setgray .22527 0.07145 moveto .20665 0.06929 lineto .15659 0.01923 lineto .22527 0.01923 lineto fill grestore gsave 0.001 setlinewidth .22527 0.07145 moveto .20665 0.06929 lineto stroke grestore gsave .295 setgray .15659 0.0628 moveto .20665 0.06929 lineto .22527 0.08791 lineto .15659 0.08791 lineto fill grestore gsave .377 setgray .15659 0.0628 moveto .20665 0.06929 lineto .15659 0.01923 lineto fill grestore gsave 0.001 setlinewidth .15659 0.0628 moveto .20665 0.06929 lineto stroke grestore gsave .377 setgray .29396 0.08791 moveto .22527 0.01923 lineto .29396 0.01923 lineto fill grestore gsave .295 setgray .22527 0.08791 moveto .22527 0.07145 lineto .25596 0.08791 lineto fill grestore gsave .377 setgray .22527 0.07145 moveto .25596 0.08791 lineto .29396 0.08791 lineto .22527 0.01923 lineto fill grestore gsave 0.001 setlinewidth .22527 0.07145 moveto .25596 0.08791 lineto stroke grestore gsave .377 setgray .36264 0.08791 moveto .29396 0.01923 lineto .36264 0.01923 lineto fill grestore gsave .377 setgray .29396 0.08791 moveto .36264 0.08791 lineto .29396 0.01923 lineto fill grestore gsave .377 setgray .36264 0.01923 moveto .43132 0.08791 lineto .43132 0.01923 lineto fill grestore gsave .377 setgray .36264 0.08791 moveto .36264 0.01923 lineto .43132 0.08791 lineto fill grestore gsave .377 setgray .43132 0.01923 moveto .44921 0.01923 lineto .45071 0.03862 lineto fill grestore gsave .459 setgray .44921 0.01923 moveto .45071 0.03862 lineto .5 0.08791 lineto .5 0.01923 lineto fill grestore gsave 0.001 setlinewidth .44921 0.01923 moveto .45071 0.03862 lineto stroke grestore gsave .377 setgray .46707 0.08791 moveto .45071 0.03862 lineto .43132 0.01923 lineto .43132 0.08791 lineto fill grestore gsave .459 setgray .46707 0.08791 moveto .45071 0.03862 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .46707 0.08791 moveto .45071 0.03862 lineto stroke grestore gsave .459 setgray .5 0.01923 moveto .56868 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .459 setgray .5 0.08791 moveto .5 0.01923 lineto .56868 0.08791 lineto fill grestore gsave .459 setgray .62684 0.07739 moveto .63736 0.06565 lineto .63736 0.01923 lineto .56868 0.01923 lineto fill grestore gsave .541 setgray .62684 0.07739 moveto .63736 0.06565 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .62684 0.07739 moveto .63736 0.06565 lineto stroke grestore gsave .459 setgray .62684 0.07739 moveto .62304 0.08791 lineto .56868 0.08791 lineto .56868 0.01923 lineto fill grestore gsave .541 setgray .62684 0.07739 moveto .62304 0.08791 lineto .63736 0.08791 lineto fill grestore gsave 0.001 setlinewidth .62684 0.07739 moveto .62304 0.08791 lineto stroke grestore gsave .459 setgray .63736 0.01923 moveto .65931 0.04118 lineto .69442 0.01923 lineto fill grestore gsave .541 setgray .65931 0.04118 moveto .69442 0.01923 lineto .70604 0.01923 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .65931 0.04118 moveto .69442 0.01923 lineto stroke grestore gsave .459 setgray .63736 0.01923 moveto .65931 0.04118 lineto .63736 0.06565 lineto fill grestore gsave .541 setgray .65931 0.04118 moveto .63736 0.06565 lineto .63736 0.08791 lineto .70604 0.08791 lineto fill grestore gsave 0.001 setlinewidth .65931 0.04118 moveto .63736 0.06565 lineto stroke grestore gsave .541 setgray .70604 0.01923 moveto .77473 0.01923 lineto .77473 0.08791 lineto fill grestore gsave .541 setgray .70604 0.01923 moveto .70604 0.08791 lineto .77473 0.08791 lineto fill grestore gsave .541 setgray .77473 0.01923 moveto .84341 0.01923 lineto .84341 0.08791 lineto fill grestore gsave .541 setgray .77473 0.01923 moveto .77473 0.08791 lineto .84341 0.08791 lineto fill grestore gsave .541 setgray .84341 0.01923 moveto .91209 0.01923 lineto .91209 0.08791 lineto fill grestore gsave .541 setgray .84341 0.01923 moveto .91209 0.08791 lineto .84341 0.08791 lineto fill grestore gsave .541 setgray .98077 0.01923 moveto .91209 0.01923 lineto .98077 0.08791 lineto fill grestore gsave .541 setgray .91209 0.01923 moveto .98077 0.08791 lineto .91209 0.08791 lineto fill grestore gsave .295 setgray 0.08791 .15659 moveto 0.08791 0.08791 lineto 0.01923 0.08791 lineto fill grestore gsave .295 setgray 0.08791 .15659 moveto 0.01923 .15659 lineto 0.01923 0.08791 lineto fill grestore gsave .295 setgray .15659 .15659 moveto .15659 0.08791 lineto 0.08791 0.08791 lineto fill grestore gsave .295 setgray .15659 .15659 moveto 0.08791 .15659 lineto 0.08791 0.08791 lineto fill grestore gsave .295 setgray .22527 .15659 moveto .15659 0.08791 lineto .22527 0.08791 lineto fill grestore gsave .295 setgray .15659 .15659 moveto .22527 .15659 lineto .15659 0.08791 lineto fill grestore gsave .295 setgray .29396 .10476 moveto .25596 0.08791 lineto .22527 0.08791 lineto .29396 .15659 lineto fill grestore gsave .377 setgray .29396 .10476 moveto .25596 0.08791 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .29396 .10476 moveto .25596 0.08791 lineto stroke grestore gsave .295 setgray .22527 .15659 moveto .29396 .15659 lineto .22527 0.08791 lineto fill grestore gsave .377 setgray .36264 .15659 moveto .29396 0.08791 lineto .36264 0.08791 lineto fill grestore gsave .295 setgray .29396 .15659 moveto .29396 .10476 lineto .3539 .15659 lineto fill grestore gsave .377 setgray .29396 .10476 moveto .3539 .15659 lineto .36264 .15659 lineto .29396 0.08791 lineto fill grestore gsave 0.001 setlinewidth .29396 .10476 moveto .3539 .15659 lineto stroke grestore gsave .377 setgray .36264 0.08791 moveto .43132 .15659 lineto .43132 0.08791 lineto fill grestore gsave .377 setgray .36264 .15659 moveto .36264 0.08791 lineto .43132 .15659 lineto fill grestore gsave .377 setgray .43132 0.08791 moveto .46707 0.08791 lineto .4701 .1267 lineto fill grestore gsave .459 setgray .46707 0.08791 moveto .4701 .1267 lineto .5 .15659 lineto .5 0.08791 lineto fill grestore gsave 0.001 setlinewidth .46707 0.08791 moveto .4701 .1267 lineto stroke grestore gsave .377 setgray .48009 .15659 moveto .4701 .1267 lineto .43132 0.08791 lineto .43132 .15659 lineto fill grestore gsave .459 setgray .48009 .15659 moveto .4701 .1267 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .48009 .15659 moveto .4701 .1267 lineto stroke grestore gsave .459 setgray .5 0.08791 moveto .56868 0.08791 lineto .56868 .15659 lineto fill grestore gsave .459 setgray .5 .15659 moveto .5 0.08791 lineto .56868 .15659 lineto fill grestore gsave .459 setgray .56868 0.08791 moveto .59716 .11639 lineto .62304 0.08791 lineto fill grestore gsave .541 setgray .59716 .11639 moveto .62304 0.08791 lineto .63736 0.08791 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .59716 .11639 moveto .62304 0.08791 lineto stroke grestore gsave .459 setgray .59716 .11639 moveto .58255 .15659 lineto .56868 .15659 lineto .56868 0.08791 lineto fill grestore gsave .541 setgray .59716 .11639 moveto .58255 .15659 lineto .63736 .15659 lineto fill grestore gsave 0.001 setlinewidth .59716 .11639 moveto .58255 .15659 lineto stroke grestore gsave .541 setgray .63736 0.08791 moveto .70604 0.08791 lineto .70604 .15659 lineto fill grestore gsave .541 setgray .63736 0.08791 moveto .63736 .15659 lineto .70604 .15659 lineto fill grestore gsave .541 setgray .70604 0.08791 moveto .77473 0.08791 lineto .77473 .15659 lineto fill grestore gsave .541 setgray .70604 0.08791 moveto .70604 .15659 lineto .77473 .15659 lineto fill grestore gsave .541 setgray .77473 0.08791 moveto .84341 0.08791 lineto .84341 .15659 lineto fill grestore gsave .541 setgray .77473 0.08791 moveto .77473 .15659 lineto .84341 .15659 lineto fill grestore gsave .541 setgray .91209 0.08791 moveto .84341 0.08791 lineto .91209 .15659 lineto fill grestore gsave .541 setgray .84341 0.08791 moveto .91209 .15659 lineto .84341 .15659 lineto fill grestore gsave .541 setgray .98077 0.08791 moveto .91209 0.08791 lineto .98077 .15659 lineto fill grestore gsave .541 setgray .91209 0.08791 moveto .98077 .15659 lineto .91209 .15659 lineto fill grestore gsave .214 setgray 0.08791 .22527 moveto 0.06599 .20335 lineto 0.08791 .20062 lineto fill grestore gsave .295 setgray 0.06599 .20335 moveto 0.08791 .20062 lineto 0.08791 .15659 lineto 0.01923 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.06599 .20335 moveto 0.08791 .20062 lineto stroke grestore gsave .214 setgray 0.06599 .20335 moveto 0.01923 .21219 lineto 0.01923 .22527 lineto 0.08791 .22527 lineto fill grestore gsave .295 setgray 0.06599 .20335 moveto 0.01923 .21219 lineto 0.01923 .15659 lineto fill grestore gsave 0.001 setlinewidth 0.06599 .20335 moveto 0.01923 .21219 lineto stroke grestore gsave .214 setgray .15659 .22527 moveto .12816 .19684 lineto .15659 .19535 lineto fill grestore gsave .295 setgray .12816 .19684 moveto .15659 .19535 lineto .15659 .15659 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth .12816 .19684 moveto .15659 .19535 lineto stroke grestore gsave .214 setgray .12816 .19684 moveto 0.08791 .20062 lineto 0.08791 .22527 lineto .15659 .22527 lineto fill grestore gsave .295 setgray .12816 .19684 moveto 0.08791 .20062 lineto 0.08791 .15659 lineto fill grestore gsave 0.001 setlinewidth .12816 .19684 moveto 0.08791 .20062 lineto stroke grestore gsave .214 setgray .22527 .22527 moveto .22527 .20111 lineto .19893 .19893 lineto fill grestore gsave .295 setgray .22527 .20111 moveto .19893 .19893 lineto .15659 .15659 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .22527 .20111 moveto .19893 .19893 lineto stroke grestore gsave .214 setgray .15659 .19535 moveto .19893 .19893 lineto .22527 .22527 lineto .15659 .22527 lineto fill grestore gsave .295 setgray .15659 .19535 moveto .19893 .19893 lineto .15659 .15659 lineto fill grestore gsave 0.001 setlinewidth .15659 .19535 moveto .19893 .19893 lineto stroke grestore gsave .295 setgray .29396 .22527 moveto .22527 .15659 lineto .29396 .15659 lineto fill grestore gsave .214 setgray .22527 .22527 moveto .22527 .20111 lineto .27297 .22527 lineto fill grestore gsave .295 setgray .22527 .20111 moveto .27297 .22527 lineto .29396 .22527 lineto .22527 .15659 lineto fill grestore gsave 0.001 setlinewidth .22527 .20111 moveto .27297 .22527 lineto stroke grestore gsave .295 setgray .36264 .16413 moveto .3539 .15659 lineto .29396 .15659 lineto .36264 .22527 lineto fill grestore gsave .377 setgray .36264 .16413 moveto .3539 .15659 lineto .36264 .15659 lineto fill grestore gsave 0.001 setlinewidth .36264 .16413 moveto .3539 .15659 lineto stroke grestore gsave .295 setgray .29396 .22527 moveto .36264 .22527 lineto .29396 .15659 lineto fill grestore gsave .377 setgray .36264 .15659 moveto .43132 .22527 lineto .43132 .15659 lineto fill grestore gsave .295 setgray .36264 .22527 moveto .40109 .22527 lineto .36264 .16413 lineto fill grestore gsave .377 setgray .40109 .22527 moveto .36264 .16413 lineto .36264 .15659 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .40109 .22527 moveto .36264 .16413 lineto stroke grestore gsave .377 setgray .43132 .15659 moveto .48009 .15659 lineto .48401 .20928 lineto fill grestore gsave .459 setgray .48009 .15659 moveto .48401 .20928 lineto .5 .22527 lineto .5 .15659 lineto fill grestore gsave 0.001 setlinewidth .48009 .15659 moveto .48401 .20928 lineto stroke grestore gsave .377 setgray .48912 .22527 moveto .48401 .20928 lineto .43132 .15659 lineto .43132 .22527 lineto fill grestore gsave .459 setgray .48912 .22527 moveto .48401 .20928 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .48912 .22527 moveto .48401 .20928 lineto stroke grestore gsave .459 setgray .55926 .21586 moveto .56868 .18558 lineto .56868 .15659 lineto .5 .15659 lineto fill grestore gsave .541 setgray .55926 .21586 moveto .56868 .18558 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .55926 .21586 moveto .56868 .18558 lineto stroke grestore gsave .459 setgray .55968 .22527 moveto .55926 .21586 lineto .5 .15659 lineto .5 .22527 lineto fill grestore gsave .541 setgray .55968 .22527 moveto .55926 .21586 lineto .56868 .22527 lineto fill grestore gsave 0.001 setlinewidth .55968 .22527 moveto .55926 .21586 lineto stroke grestore gsave .459 setgray .56868 .15659 moveto .57613 .16405 lineto .58255 .15659 lineto fill grestore gsave .541 setgray .57613 .16405 moveto .58255 .15659 lineto .63736 .15659 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .57613 .16405 moveto .58255 .15659 lineto stroke grestore gsave .459 setgray .56868 .15659 moveto .57613 .16405 lineto .56868 .18558 lineto fill grestore gsave .541 setgray .57613 .16405 moveto .56868 .18558 lineto .56868 .22527 lineto .63736 .22527 lineto fill grestore gsave 0.001 setlinewidth .57613 .16405 moveto .56868 .18558 lineto stroke grestore gsave .541 setgray .68619 .20542 moveto .70604 .19296 lineto .70604 .15659 lineto .63736 .15659 lineto fill grestore gsave .623 setgray .68619 .20542 moveto .70604 .19296 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .68619 .20542 moveto .70604 .19296 lineto stroke grestore gsave .541 setgray .68619 .20542 moveto .66878 .22527 lineto .63736 .22527 lineto .63736 .15659 lineto fill grestore gsave .623 setgray .68619 .20542 moveto .66878 .22527 lineto .70604 .22527 lineto fill grestore gsave 0.001 setlinewidth .68619 .20542 moveto .66878 .22527 lineto stroke grestore gsave .541 setgray .72916 .17971 moveto .77473 .16289 lineto .77473 .15659 lineto .70604 .15659 lineto fill grestore gsave .623 setgray .72916 .17971 moveto .77473 .16289 lineto .77473 .22527 lineto fill grestore gsave 0.001 setlinewidth .72916 .17971 moveto .77473 .16289 lineto stroke grestore gsave .541 setgray .70604 .15659 moveto .72916 .17971 lineto .70604 .19296 lineto fill grestore gsave .623 setgray .72916 .17971 moveto .70604 .19296 lineto .70604 .22527 lineto .77473 .22527 lineto fill grestore gsave 0.001 setlinewidth .72916 .17971 moveto .70604 .19296 lineto stroke grestore gsave .541 setgray .78042 .16229 moveto .84341 .1569 lineto .84341 .15659 lineto .77473 .15659 lineto fill grestore gsave .623 setgray .78042 .16229 moveto .84341 .1569 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .78042 .16229 moveto .84341 .1569 lineto stroke grestore gsave .541 setgray .77473 .15659 moveto .78042 .16229 lineto .77473 .16289 lineto fill grestore gsave .623 setgray .78042 .16229 moveto .77473 .16289 lineto .77473 .22527 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .78042 .16229 moveto .77473 .16289 lineto stroke grestore gsave .541 setgray .91209 .15951 moveto .84373 .15692 lineto .84341 .15659 lineto .91209 .15659 lineto fill grestore gsave .623 setgray .91209 .15951 moveto .84373 .15692 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .15951 moveto .84373 .15692 lineto stroke grestore gsave .541 setgray .84341 .15659 moveto .84341 .1569 lineto .84373 .15692 lineto fill grestore gsave .623 setgray .84341 .1569 moveto .84373 .15692 lineto .91209 .22527 lineto .84341 .22527 lineto fill grestore gsave 0.001 setlinewidth .84341 .1569 moveto .84373 .15692 lineto stroke grestore gsave .541 setgray .98077 .16732 moveto .91554 .16004 lineto .91209 .15659 lineto .98077 .15659 lineto fill grestore gsave .623 setgray .98077 .16732 moveto .91554 .16004 lineto .98077 .22527 lineto fill grestore gsave 0.001 setlinewidth .98077 .16732 moveto .91554 .16004 lineto stroke grestore gsave .541 setgray .91209 .15659 moveto .91209 .15951 lineto .91554 .16004 lineto fill grestore gsave .623 setgray .91209 .15951 moveto .91554 .16004 lineto .98077 .22527 lineto .91209 .22527 lineto fill grestore gsave 0.001 setlinewidth .91209 .15951 moveto .91554 .16004 lineto stroke grestore gsave .132 setgray 0.08791 .29396 moveto 0.08136 .2874 lineto 0.08791 .28658 lineto fill grestore gsave .214 setgray 0.08136 .2874 moveto 0.08791 .28658 lineto 0.08791 .22527 lineto 0.01923 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.08136 .2874 moveto 0.08791 .28658 lineto stroke grestore gsave .132 setgray 0.08791 .29396 moveto 0.08136 .2874 lineto 0.04747 .29396 lineto fill grestore gsave .214 setgray 0.08136 .2874 moveto 0.04747 .29396 lineto 0.01923 .29396 lineto 0.01923 .22527 lineto fill grestore gsave 0.001 setlinewidth 0.08136 .2874 moveto 0.04747 .29396 lineto stroke grestore gsave .132 setgray .15659 .29396 moveto .14319 .28055 lineto .15659 .27971 lineto fill grestore gsave .214 setgray .14319 .28055 moveto .15659 .27971 lineto .15659 .22527 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth .14319 .28055 moveto .15659 .27971 lineto stroke grestore gsave .132 setgray .14319 .28055 moveto 0.08791 .28658 lineto 0.08791 .29396 lineto .15659 .29396 lineto fill grestore gsave .214 setgray .14319 .28055 moveto 0.08791 .28658 lineto 0.08791 .22527 lineto fill grestore gsave 0.001 setlinewidth .14319 .28055 moveto 0.08791 .28658 lineto stroke grestore gsave .132 setgray .22527 .29396 moveto .22527 .28354 lineto .2142 .28289 lineto fill grestore gsave .214 setgray .22527 .28354 moveto .2142 .28289 lineto .15659 .22527 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .22527 .28354 moveto .2142 .28289 lineto stroke grestore gsave .132 setgray .15659 .27971 moveto .2142 .28289 lineto .22527 .29396 lineto .15659 .29396 lineto fill grestore gsave .214 setgray .15659 .27971 moveto .2142 .28289 lineto .15659 .22527 lineto fill grestore gsave 0.001 setlinewidth .15659 .27971 moveto .2142 .28289 lineto stroke grestore gsave .214 setgray .29396 .23344 moveto .27297 .22527 lineto .22527 .22527 lineto .29396 .29396 lineto fill grestore gsave .295 setgray .29396 .23344 moveto .27297 .22527 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .29396 .23344 moveto .27297 .22527 lineto stroke grestore gsave .132 setgray .22527 .29396 moveto .22527 .28354 lineto .24853 .29396 lineto fill grestore gsave .214 setgray .22527 .28354 moveto .24853 .29396 lineto .29396 .29396 lineto .22527 .22527 lineto fill grestore gsave 0.001 setlinewidth .22527 .28354 moveto .24853 .29396 lineto stroke grestore gsave .214 setgray .36264 .29396 moveto .36264 .28883 lineto .33985 .27117 lineto fill grestore gsave .295 setgray .36264 .28883 moveto .33985 .27117 lineto .29396 .22527 lineto .36264 .22527 lineto fill grestore gsave 0.001 setlinewidth .36264 .28883 moveto .33985 .27117 lineto stroke grestore gsave .214 setgray .29396 .23344 moveto .33985 .27117 lineto .36264 .29396 lineto .29396 .29396 lineto fill grestore gsave .295 setgray .29396 .23344 moveto .33985 .27117 lineto .29396 .22527 lineto fill grestore gsave 0.001 setlinewidth .29396 .23344 moveto .33985 .27117 lineto stroke grestore gsave .295 setgray .40109 .22527 moveto .43132 .27988 lineto .43132 .29396 lineto .36264 .22527 lineto fill grestore gsave .377 setgray .40109 .22527 moveto .43132 .27988 lineto .43132 .22527 lineto fill grestore gsave 0.001 setlinewidth .40109 .22527 moveto .43132 .27988 lineto stroke grestore gsave .214 setgray .36264 .29396 moveto .3661 .29396 lineto .36264 .28883 lineto fill grestore gsave .295 setgray .3661 .29396 moveto .36264 .28883 lineto .36264 .22527 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .3661 .29396 moveto .36264 .28883 lineto stroke grestore gsave .377 setgray .43132 .22527 moveto .48912 .22527 lineto .49444 .2884 lineto fill grestore gsave .459 setgray .48912 .22527 moveto .49444 .2884 lineto .5 .29396 lineto .5 .22527 lineto fill grestore gsave 0.001 setlinewidth .48912 .22527 moveto .49444 .2884 lineto stroke grestore gsave .295 setgray .43132 .29396 moveto .43614 .29396 lineto .43132 .27988 lineto fill grestore gsave .377 setgray .43614 .29396 moveto .43132 .27988 lineto .43132 .22527 lineto .49444 .2884 lineto .49635 .29396 lineto fill grestore gsave 0.001 setlinewidth .43614 .29396 moveto .43132 .27988 lineto stroke grestore gsave .459 setgray .49635 .29396 moveto .49444 .2884 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .49635 .29396 moveto .49444 .2884 lineto stroke grestore gsave .459 setgray .5 .22527 moveto .54443 .2697 lineto .55968 .22527 lineto fill grestore gsave .541 setgray .54443 .2697 moveto .55968 .22527 lineto .56868 .22527 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .54443 .2697 moveto .55968 .22527 lineto stroke grestore gsave .459 setgray .54561 .29396 moveto .54443 .2697 lineto .5 .22527 lineto .5 .29396 lineto fill grestore gsave .541 setgray .54561 .29396 moveto .54443 .2697 lineto .56868 .29396 lineto fill grestore gsave 0.001 setlinewidth .54561 .29396 moveto .54443 .2697 lineto stroke grestore gsave .541 setgray .61513 .27172 moveto .63736 .24853 lineto .63736 .22527 lineto .56868 .22527 lineto fill grestore gsave .623 setgray .61513 .27172 moveto .63736 .24853 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .61513 .27172 moveto .63736 .24853 lineto stroke grestore gsave .541 setgray .61513 .27172 moveto .607 .29396 lineto .56868 .29396 lineto .56868 .22527 lineto fill grestore gsave .623 setgray .61513 .27172 moveto .607 .29396 lineto .63736 .29396 lineto fill grestore gsave 0.001 setlinewidth .61513 .27172 moveto .607 .29396 lineto stroke grestore gsave .541 setgray .63736 .22527 moveto .64857 .23648 lineto .66878 .22527 lineto fill grestore gsave .623 setgray .64857 .23648 moveto .66878 .22527 lineto .70604 .22527 lineto .70604 .28643 lineto .70121 .28912 lineto fill grestore gsave 0.001 setlinewidth .64857 .23648 moveto .66878 .22527 lineto stroke grestore gsave .705 setgray .70121 .28912 moveto .70604 .28643 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70121 .28912 moveto .70604 .28643 lineto stroke grestore gsave .541 setgray .63736 .22527 moveto .64857 .23648 lineto .63736 .24853 lineto fill grestore gsave .623 setgray .64857 .23648 moveto .63736 .24853 lineto .63736 .29396 lineto .69671 .29396 lineto .70121 .28912 lineto fill grestore gsave 0.001 setlinewidth .64857 .23648 moveto .63736 .24853 lineto stroke grestore gsave .705 setgray .70121 .28912 moveto .69671 .29396 lineto .70604 .29396 lineto fill grestore gsave 0.001 setlinewidth .70121 .28912 moveto .69671 .29396 lineto stroke grestore gsave .623 setgray .74584 .26507 moveto .77473 .25602 lineto .77473 .22527 lineto .70604 .22527 lineto fill grestore gsave .705 setgray .74584 .26507 moveto .77473 .25602 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .74584 .26507 moveto .77473 .25602 lineto stroke grestore gsave .623 setgray .70604 .22527 moveto .74584 .26507 lineto .70604 .28643 lineto fill grestore gsave .705 setgray .74584 .26507 moveto .70604 .28643 lineto .70604 .29396 lineto .77473 .29396 lineto fill grestore gsave 0.001 setlinewidth .74584 .26507 moveto .70604 .28643 lineto stroke grestore gsave .623 setgray .80265 .2532 moveto .84341 .25057 lineto .84341 .22527 lineto .77473 .22527 lineto fill grestore gsave .705 setgray .80265 .2532 moveto .84341 .25057 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .80265 .2532 moveto .84341 .25057 lineto stroke grestore gsave .623 setgray .77473 .22527 moveto .80265 .2532 lineto .77473 .25602 lineto fill grestore gsave .705 setgray .80265 .2532 moveto .77473 .25602 lineto .77473 .29396 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .80265 .2532 moveto .77473 .25602 lineto stroke grestore gsave .623 setgray .91209 .25361 moveto .87007 .25194 lineto .84341 .22527 lineto .91209 .22527 lineto fill grestore gsave .705 setgray .91209 .25361 moveto .87007 .25194 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .25361 moveto .87007 .25194 lineto stroke grestore gsave .623 setgray .84341 .22527 moveto .84341 .25057 lineto .87007 .25194 lineto fill grestore gsave .705 setgray .84341 .25057 moveto .87007 .25194 lineto .91209 .29396 lineto .84341 .29396 lineto fill grestore gsave 0.001 setlinewidth .84341 .25057 moveto .87007 .25194 lineto stroke grestore gsave .623 setgray .98077 .26135 moveto .94463 .25781 lineto .91209 .22527 lineto .98077 .22527 lineto fill grestore gsave .705 setgray .98077 .26135 moveto .94463 .25781 lineto .98077 .29396 lineto fill grestore gsave 0.001 setlinewidth .98077 .26135 moveto .94463 .25781 lineto stroke grestore gsave .623 setgray .91209 .22527 moveto .91209 .25361 lineto .94463 .25781 lineto fill grestore gsave .705 setgray .91209 .25361 moveto .94463 .25781 lineto .98077 .29396 lineto .91209 .29396 lineto fill grestore gsave 0.001 setlinewidth .91209 .25361 moveto .94463 .25781 lineto stroke grestore gsave .132 setgray 0.02456 .29929 moveto 0.04747 .29396 lineto 0.08791 .29396 lineto 0.08791 .36264 lineto fill grestore gsave .214 setgray 0.02456 .29929 moveto 0.04747 .29396 lineto 0.01923 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.02456 .29929 moveto 0.04747 .29396 lineto stroke grestore gsave .132 setgray 0.02456 .29929 moveto 0.01923 .30091 lineto 0.01923 .36264 lineto 0.08791 .36264 lineto fill grestore gsave .214 setgray 0.02456 .29929 moveto 0.01923 .30091 lineto 0.01923 .29396 lineto fill grestore gsave 0.001 setlinewidth 0.02456 .29929 moveto 0.01923 .30091 lineto stroke grestore gsave .132 setgray .15659 .36264 moveto .15659 .29396 lineto 0.08791 .29396 lineto fill grestore gsave .132 setgray .15659 .36264 moveto 0.08791 .36264 lineto 0.08791 .29396 lineto fill grestore gsave .132 setgray .22527 .36264 moveto .15659 .29396 lineto .22527 .29396 lineto fill grestore gsave .132 setgray .15659 .36264 moveto .22527 .36264 lineto .15659 .29396 lineto fill grestore gsave .132 setgray .29396 .32264 moveto .24853 .29396 lineto .22527 .29396 lineto .29396 .36264 lineto fill grestore gsave .214 setgray .29396 .32264 moveto .24853 .29396 lineto .29396 .29396 lineto fill grestore gsave 0.001 setlinewidth .29396 .32264 moveto .24853 .29396 lineto stroke grestore gsave .132 setgray .22527 .36264 moveto .29396 .36264 lineto .22527 .29396 lineto fill grestore gsave .214 setgray .29396 .29396 moveto .36264 .36264 lineto .36264 .29396 lineto fill grestore gsave .132 setgray .29396 .36264 moveto .32599 .36264 lineto .29396 .32264 lineto fill grestore gsave .214 setgray .32599 .36264 moveto .29396 .32264 lineto .29396 .29396 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .32599 .36264 moveto .29396 .32264 lineto stroke grestore gsave .214 setgray .36264 .29396 moveto .3661 .29396 lineto .36776 .29908 lineto fill grestore gsave .295 setgray .3661 .29396 moveto .36776 .29908 lineto .43132 .36264 lineto .43132 .29396 lineto fill grestore gsave 0.001 setlinewidth .3661 .29396 moveto .36776 .29908 lineto stroke grestore gsave .214 setgray .39587 .36264 moveto .36776 .29908 lineto .36264 .29396 lineto .36264 .36264 lineto fill grestore gsave .295 setgray .39587 .36264 moveto .36776 .29908 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .39587 .36264 moveto .36776 .29908 lineto stroke grestore gsave .295 setgray .43132 .29396 moveto .43614 .29396 lineto .4364 .29904 lineto fill grestore gsave .377 setgray .43614 .29396 moveto .4364 .29904 lineto .49988 .36252 lineto .49635 .29396 lineto fill grestore gsave 0.001 setlinewidth .43614 .29396 moveto .4364 .29904 lineto stroke grestore gsave .459 setgray .49635 .29396 moveto .49988 .36252 lineto .5 .36264 lineto .5 .29396 lineto fill grestore gsave 0.001 setlinewidth .49635 .29396 moveto .49988 .36252 lineto stroke grestore gsave .295 setgray .45073 .36264 moveto .4364 .29904 lineto .43132 .29396 lineto .43132 .36264 lineto fill grestore gsave .377 setgray .45073 .36264 moveto .4364 .29904 lineto .49988 .36252 lineto .49991 .36264 lineto fill grestore gsave 0.001 setlinewidth .45073 .36264 moveto .4364 .29904 lineto stroke grestore gsave .459 setgray .49991 .36264 moveto .49988 .36252 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .49991 .36264 moveto .49988 .36252 lineto stroke grestore gsave .459 setgray .5 .29396 moveto .53801 .33197 lineto .54561 .29396 lineto fill grestore gsave .541 setgray .53801 .33197 moveto .54561 .29396 lineto .56868 .29396 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .53801 .33197 moveto .54561 .29396 lineto stroke grestore gsave .459 setgray .53904 .36264 moveto .53801 .33197 lineto .5 .29396 lineto .5 .36264 lineto fill grestore gsave .541 setgray .53904 .36264 moveto .53801 .33197 lineto .56868 .36264 lineto fill grestore gsave 0.001 setlinewidth .53904 .36264 moveto .53801 .33197 lineto stroke grestore gsave .541 setgray .56868 .29396 moveto .5932 .31847 lineto .607 .29396 lineto fill grestore gsave .623 setgray .5932 .31847 moveto .607 .29396 lineto .63736 .29396 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .5932 .31847 moveto .607 .29396 lineto stroke grestore gsave .541 setgray .5932 .31847 moveto .58268 .36264 lineto .56868 .36264 lineto .56868 .29396 lineto fill grestore gsave .623 setgray .5932 .31847 moveto .58268 .36264 lineto .63736 .36264 lineto fill grestore gsave 0.001 setlinewidth .5932 .31847 moveto .58268 .36264 lineto stroke grestore gsave .623 setgray .63736 .29396 moveto .66609 .32269 lineto .69671 .29396 lineto fill grestore gsave .705 setgray .66609 .32269 moveto .69671 .29396 lineto .70604 .29396 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .66609 .32269 moveto .69671 .29396 lineto stroke grestore gsave .623 setgray .66609 .32269 moveto .64167 .36264 lineto .63736 .36264 lineto .63736 .29396 lineto fill grestore gsave .705 setgray .66609 .32269 moveto .64167 .36264 lineto .70604 .36264 lineto fill grestore gsave 0.001 setlinewidth .66609 .32269 moveto .64167 .36264 lineto stroke grestore gsave .705 setgray .75364 .34155 moveto .77473 .33049 lineto .77473 .29396 lineto .70604 .29396 lineto fill grestore gsave .786 setgray .75364 .34155 moveto .77473 .33049 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .75364 .34155 moveto .77473 .33049 lineto stroke grestore gsave .705 setgray .75364 .34155 moveto .7279 .36264 lineto .70604 .36264 lineto .70604 .29396 lineto fill grestore gsave .786 setgray .75364 .34155 moveto .7279 .36264 lineto .77473 .36264 lineto fill grestore gsave 0.001 setlinewidth .75364 .34155 moveto .7279 .36264 lineto stroke grestore gsave .705 setgray .80611 .32535 moveto .84341 .32125 lineto .84341 .29396 lineto .77473 .29396 lineto fill grestore gsave .786 setgray .80611 .32535 moveto .84341 .32125 lineto .84341 .36264 lineto fill grestore gsave 0.001 setlinewidth .80611 .32535 moveto .84341 .32125 lineto stroke grestore gsave .705 setgray .77473 .29396 moveto .80611 .32535 lineto .77473 .33049 lineto fill grestore gsave .786 setgray .80611 .32535 moveto .77473 .33049 lineto .77473 .36264 lineto .84341 .36264 lineto fill grestore gsave 0.001 setlinewidth .80611 .32535 moveto .77473 .33049 lineto stroke grestore gsave .705 setgray .91209 .32518 moveto .87234 .32289 lineto .84341 .29396 lineto .91209 .29396 lineto fill grestore gsave .786 setgray .91209 .32518 moveto .87234 .32289 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .32518 moveto .87234 .32289 lineto stroke grestore gsave .705 setgray .84341 .29396 moveto .84341 .32125 lineto .87234 .32289 lineto fill grestore gsave .786 setgray .84341 .32125 moveto .87234 .32289 lineto .91209 .36264 lineto .84341 .36264 lineto fill grestore gsave 0.001 setlinewidth .84341 .32125 moveto .87234 .32289 lineto stroke grestore gsave .705 setgray .98077 .33603 moveto .94957 .33144 lineto .91209 .29396 lineto .98077 .29396 lineto fill grestore gsave .786 setgray .98077 .33603 moveto .94957 .33144 lineto .98077 .36264 lineto fill grestore gsave 0.001 setlinewidth .98077 .33603 moveto .94957 .33144 lineto stroke grestore gsave .705 setgray .91209 .29396 moveto .91209 .32518 lineto .94957 .33144 lineto fill grestore gsave .786 setgray .91209 .32518 moveto .94957 .33144 lineto .98077 .36264 lineto .91209 .36264 lineto fill grestore gsave 0.001 setlinewidth .91209 .32518 moveto .94957 .33144 lineto stroke grestore gsave 0.05 setgray 0.08791 .43132 moveto 0.05784 .40125 lineto 0.08791 .39038 lineto fill grestore gsave .132 setgray 0.05784 .40125 moveto 0.08791 .39038 lineto 0.08791 .36264 lineto 0.01923 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.05784 .40125 moveto 0.08791 .39038 lineto stroke grestore gsave 0.05 setgray 0.05784 .40125 moveto 0.01923 .41775 lineto 0.01923 .43132 lineto 0.08791 .43132 lineto fill grestore gsave .132 setgray 0.05784 .40125 moveto 0.01923 .41775 lineto 0.01923 .36264 lineto fill grestore gsave 0.001 setlinewidth 0.05784 .40125 moveto 0.01923 .41775 lineto stroke grestore gsave 0.05 setgray .15659 .43132 moveto .11001 .38473 lineto .15659 .37451 lineto fill grestore gsave .132 setgray .11001 .38473 moveto .15659 .37451 lineto .15659 .36264 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth .11001 .38473 moveto .15659 .37451 lineto stroke grestore gsave 0.05 setgray .11001 .38473 moveto 0.08791 .39038 lineto 0.08791 .43132 lineto .15659 .43132 lineto fill grestore gsave .132 setgray .11001 .38473 moveto 0.08791 .39038 lineto 0.08791 .36264 lineto fill grestore gsave 0.001 setlinewidth .11001 .38473 moveto 0.08791 .39038 lineto stroke grestore gsave 0.05 setgray .22527 .43132 moveto .22527 .38046 lineto .16966 .3757 lineto fill grestore gsave .132 setgray .22527 .38046 moveto .16966 .3757 lineto .15659 .36264 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .22527 .38046 moveto .16966 .3757 lineto stroke grestore gsave 0.05 setgray .15659 .37451 moveto .16966 .3757 lineto .22527 .43132 lineto .15659 .43132 lineto fill grestore gsave .132 setgray .15659 .37451 moveto .16966 .3757 lineto .15659 .36264 lineto fill grestore gsave 0.001 setlinewidth .15659 .37451 moveto .16966 .3757 lineto stroke grestore gsave .132 setgray .29396 .43132 moveto .22527 .36264 lineto .29396 .36264 lineto fill grestore gsave 0.05 setgray .22527 .43132 moveto .22527 .38046 lineto .27896 .43132 lineto fill grestore gsave .132 setgray .22527 .38046 moveto .27896 .43132 lineto .29396 .43132 lineto .22527 .36264 lineto fill grestore gsave 0.001 setlinewidth .22527 .38046 moveto .27896 .43132 lineto stroke grestore gsave .132 setgray .29396 .36264 moveto .32599 .36264 lineto .3582 .42688 lineto fill grestore gsave .214 setgray .32599 .36264 moveto .3582 .42688 lineto .36264 .43132 lineto .36264 .36264 lineto fill grestore gsave 0.001 setlinewidth .32599 .36264 moveto .3582 .42688 lineto stroke grestore gsave .132 setgray .36066 .43132 moveto .3582 .42688 lineto .29396 .36264 lineto .29396 .43132 lineto fill grestore gsave .214 setgray .36066 .43132 moveto .3582 .42688 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .36066 .43132 moveto .3582 .42688 lineto stroke grestore gsave .214 setgray .36264 .36264 moveto .39587 .36264 lineto .40494 .40494 lineto fill grestore gsave .295 setgray .39587 .36264 moveto .40494 .40494 lineto .43132 .43132 lineto .43132 .36264 lineto fill grestore gsave 0.001 setlinewidth .39587 .36264 moveto .40494 .40494 lineto stroke grestore gsave .214 setgray .41302 .43132 moveto .40494 .40494 lineto .36264 .36264 lineto .36264 .43132 lineto fill grestore gsave .295 setgray .41302 .43132 moveto .40494 .40494 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .41302 .43132 moveto .40494 .40494 lineto stroke grestore gsave .295 setgray .43132 .36264 moveto .45073 .36264 lineto .45146 .38278 lineto fill grestore gsave .377 setgray .45073 .36264 moveto .45146 .38278 lineto .5 .43132 lineto .5 .36512 lineto .49991 .36264 lineto fill grestore gsave 0.001 setlinewidth .45073 .36264 moveto .45146 .38278 lineto stroke grestore gsave .459 setgray .49991 .36264 moveto .5 .36512 lineto .5 .36264 lineto fill grestore gsave 0.001 setlinewidth .49991 .36264 moveto .5 .36512 lineto stroke grestore gsave .295 setgray .4591 .43132 moveto .45146 .38278 lineto .43132 .36264 lineto .43132 .43132 lineto fill grestore gsave .377 setgray .4591 .43132 moveto .45146 .38278 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .4591 .43132 moveto .45146 .38278 lineto stroke grestore gsave .459 setgray .5 .36264 moveto .53448 .39712 lineto .53904 .36264 lineto fill grestore gsave .541 setgray .53448 .39712 moveto .53904 .36264 lineto .56868 .36264 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .53448 .39712 moveto .53904 .36264 lineto stroke grestore gsave .377 setgray .5 .43132 moveto .50163 .43132 lineto .5 .36512 lineto fill grestore gsave .459 setgray .50163 .43132 moveto .5 .36512 lineto .5 .36264 lineto .53448 .39712 lineto .53532 .43132 lineto fill grestore gsave 0.001 setlinewidth .50163 .43132 moveto .5 .36512 lineto stroke grestore gsave .541 setgray .53532 .43132 moveto .53448 .39712 lineto .56868 .43132 lineto fill grestore gsave 0.001 setlinewidth .53532 .43132 moveto .53448 .39712 lineto stroke grestore gsave .541 setgray .56868 .36264 moveto .57886 .37282 lineto .58268 .36264 lineto fill grestore gsave .623 setgray .57886 .37282 moveto .58268 .36264 lineto .63736 .36264 lineto .63736 .37102 lineto .62092 .41488 lineto fill grestore gsave 0.001 setlinewidth .57886 .37282 moveto .58268 .36264 lineto stroke grestore gsave .705 setgray .62092 .41488 moveto .63736 .37102 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .62092 .41488 moveto .63736 .37102 lineto stroke grestore gsave .541 setgray .57886 .37282 moveto .56916 .43132 lineto .56868 .43132 lineto .56868 .36264 lineto fill grestore gsave .623 setgray .57886 .37282 moveto .56916 .43132 lineto .6182 .43132 lineto .62092 .41488 lineto fill grestore gsave 0.001 setlinewidth .57886 .37282 moveto .56916 .43132 lineto stroke grestore gsave .705 setgray .62092 .41488 moveto .6182 .43132 lineto .63736 .43132 lineto fill grestore gsave 0.001 setlinewidth .62092 .41488 moveto .6182 .43132 lineto stroke grestore gsave .623 setgray .63736 .36264 moveto .63988 .36516 lineto .64167 .36264 lineto fill grestore gsave .705 setgray .63988 .36516 moveto .64167 .36264 lineto .70604 .36264 lineto .70604 .38368 lineto .6863 .41158 lineto fill grestore gsave 0.001 setlinewidth .63988 .36516 moveto .64167 .36264 lineto stroke grestore gsave .786 setgray .6863 .41158 moveto .70604 .38368 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .6863 .41158 moveto .70604 .38368 lineto stroke grestore gsave .623 setgray .63736 .36264 moveto .63988 .36516 lineto .63736 .37102 lineto fill grestore gsave .705 setgray .63988 .36516 moveto .63736 .37102 lineto .63736 .43132 lineto .67781 .43132 lineto .6863 .41158 lineto fill grestore gsave 0.001 setlinewidth .63988 .36516 moveto .63736 .37102 lineto stroke grestore gsave .786 setgray .6863 .41158 moveto .67781 .43132 lineto .70604 .43132 lineto fill grestore gsave 0.001 setlinewidth .6863 .41158 moveto .67781 .43132 lineto stroke grestore gsave .705 setgray .70604 .36264 moveto .71575 .37235 lineto .7279 .36264 lineto fill grestore gsave .786 setgray .71575 .37235 moveto .7279 .36264 lineto .77473 .36264 lineto .77473 .41823 lineto .76745 .42404 lineto fill grestore gsave 0.001 setlinewidth .71575 .37235 moveto .7279 .36264 lineto stroke grestore gsave .868 setgray .76745 .42404 moveto .77473 .41823 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .76745 .42404 moveto .77473 .41823 lineto stroke grestore gsave .705 setgray .70604 .36264 moveto .71575 .37235 lineto .70604 .38368 lineto fill grestore gsave .786 setgray .71575 .37235 moveto .70604 .38368 lineto .70604 .43132 lineto .76121 .43132 lineto .76745 .42404 lineto fill grestore gsave 0.001 setlinewidth .71575 .37235 moveto .70604 .38368 lineto stroke grestore gsave .868 setgray .76745 .42404 moveto .76121 .43132 lineto .77473 .43132 lineto fill grestore gsave 0.001 setlinewidth .76745 .42404 moveto .76121 .43132 lineto stroke grestore gsave .786 setgray .81937 .40729 moveto .84341 .40293 lineto .84341 .36264 lineto .77473 .36264 lineto fill grestore gsave .868 setgray .81937 .40729 moveto .84341 .40293 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .81937 .40729 moveto .84341 .40293 lineto stroke grestore gsave .786 setgray .77473 .36264 moveto .81937 .40729 lineto .77473 .41823 lineto fill grestore gsave .868 setgray .81937 .40729 moveto .77473 .41823 lineto .77473 .43132 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .81937 .40729 moveto .77473 .41823 lineto stroke grestore gsave .786 setgray .91209 .40721 moveto .8863 .40553 lineto .84341 .36264 lineto .91209 .36264 lineto fill grestore gsave .868 setgray .91209 .40721 moveto .8863 .40553 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .91209 .40721 moveto .8863 .40553 lineto stroke grestore gsave .786 setgray .84341 .36264 moveto .84341 .40293 lineto .8863 .40553 lineto fill grestore gsave .868 setgray .84341 .40293 moveto .8863 .40553 lineto .91209 .43132 lineto .84341 .43132 lineto fill grestore gsave 0.001 setlinewidth .84341 .40293 moveto .8863 .40553 lineto stroke grestore gsave .786 setgray .98077 .42163 moveto .96871 .41926 lineto .91209 .36264 lineto .98077 .36264 lineto fill grestore gsave .868 setgray .98077 .42163 moveto .96871 .41926 lineto .98077 .43132 lineto fill grestore gsave 0.001 setlinewidth .98077 .42163 moveto .96871 .41926 lineto stroke grestore gsave .786 setgray .91209 .36264 moveto .91209 .40721 lineto .96871 .41926 lineto fill grestore gsave .868 setgray .91209 .40721 moveto .96871 .41926 lineto .98077 .43132 lineto .91209 .43132 lineto fill grestore gsave 0.001 setlinewidth .91209 .40721 moveto .96871 .41926 lineto stroke grestore gsave 0.05 setgray 0.08791 .5 moveto 0.08791 .43132 lineto 0.01923 .43132 lineto fill grestore gsave 0.05 setgray 0.08791 .5 moveto 0.01923 .5 lineto 0.01923 .43132 lineto fill grestore gsave 0.05 setgray .15659 .5 moveto .15659 .43132 lineto 0.08791 .43132 lineto fill grestore gsave 0.05 setgray .15659 .5 moveto 0.08791 .5 lineto 0.08791 .43132 lineto fill grestore gsave 0.05 setgray .22527 .5 moveto .15659 .43132 lineto .22527 .43132 lineto fill grestore gsave 0.05 setgray .15659 .5 moveto .22527 .5 lineto .15659 .43132 lineto fill grestore gsave 0.05 setgray .27896 .43132 moveto .29396 .46446 lineto .29396 .5 lineto .22527 .43132 lineto fill grestore gsave .132 setgray .27896 .43132 moveto .29396 .46446 lineto .29396 .43132 lineto fill grestore gsave 0.001 setlinewidth .27896 .43132 moveto .29396 .46446 lineto stroke grestore gsave 0.05 setgray .22527 .5 moveto .22527 .43132 lineto .29396 .5 lineto fill grestore gsave .132 setgray .36066 .43132 moveto .36264 .44046 lineto .36264 .5 lineto .29396 .43132 lineto fill grestore gsave .214 setgray .36066 .43132 moveto .36264 .44046 lineto .36264 .43132 lineto fill grestore gsave 0.001 setlinewidth .36066 .43132 moveto .36264 .44046 lineto stroke grestore gsave 0.05 setgray .29396 .5 moveto .30289 .5 lineto .29396 .46446 lineto fill grestore gsave .132 setgray .30289 .5 moveto .29396 .46446 lineto .29396 .43132 lineto .36264 .5 lineto fill grestore gsave 0.001 setlinewidth .30289 .5 moveto .29396 .46446 lineto stroke grestore gsave .214 setgray .36264 .43132 moveto .41302 .43132 lineto .41834 .48702 lineto fill grestore gsave .295 setgray .41302 .43132 moveto .41834 .48702 lineto .43132 .5 lineto .43132 .43132 lineto fill grestore gsave 0.001 setlinewidth .41302 .43132 moveto .41834 .48702 lineto stroke grestore gsave .132 setgray .36264 .5 moveto .37101 .5 lineto .36264 .44046 lineto fill grestore gsave .214 setgray .37101 .5 moveto .36264 .44046 lineto .36264 .43132 lineto .41834 .48702 lineto .42016 .5 lineto fill grestore gsave 0.001 setlinewidth .37101 .5 moveto .36264 .44046 lineto stroke grestore gsave .295 setgray .42016 .5 moveto .41834 .48702 lineto .43132 .5 lineto fill grestore gsave 0.001 setlinewidth .42016 .5 moveto .41834 .48702 lineto stroke grestore gsave .295 setgray .43132 .43132 moveto .4591 .43132 lineto .45959 .45959 lineto fill grestore gsave .377 setgray .4591 .43132 moveto .45959 .45959 lineto .5 .5 lineto .5 .43132 lineto fill grestore gsave 0.001 setlinewidth .4591 .43132 moveto .45959 .45959 lineto stroke grestore gsave .295 setgray .46261 .5 moveto .45959 .45959 lineto .43132 .43132 lineto .43132 .5 lineto fill grestore gsave .377 setgray .46261 .5 moveto .45959 .45959 lineto .5 .5 lineto fill grestore gsave 0.001 setlinewidth .46261 .5 moveto .45959 .45959 lineto stroke grestore gsave .377 setgray .5 .43132 moveto .50154 .43286 lineto .50163 .43132 lineto fill grestore gsave .459 setgray .50154 .43286 moveto .50163 .43132 lineto .53532 .43132 lineto .53331 .46463 lineto fill grestore gsave 0.001 setlinewidth .50154 .43286 moveto .50163 .43132 lineto stroke grestore gsave .541 setgray .53331 .46463 moveto .53532 .43132 lineto .56868 .43132 lineto .56868 .43678 lineto .56509 .49641 lineto fill grestore gsave 0.001 setlinewidth .53331 .46463 moveto .53532 .43132 lineto stroke grestore gsave .623 setgray .56509 .49641 moveto .56868 .43678 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .56509 .49641 moveto .56868 .43678 lineto stroke grestore gsave .377 setgray .5024 .5 moveto .50154 .43286 lineto .5 .43132 lineto .5 .5 lineto fill grestore gsave .459 setgray .5024 .5 moveto .50154 .43286 lineto .53331 .46463 lineto .53377 .5 lineto fill grestore gsave 0.001 setlinewidth .5024 .5 moveto .50154 .43286 lineto stroke grestore gsave .541 setgray .53377 .5 moveto .53331 .46463 lineto .56509 .49641 lineto .56514 .5 lineto fill grestore gsave 0.001 setlinewidth .53377 .5 moveto .53331 .46463 lineto stroke grestore gsave .623 setgray .56514 .5 moveto .56509 .49641 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .56514 .5 moveto .56509 .49641 lineto stroke grestore gsave .541 setgray .56868 .43132 moveto .56909 .43173 lineto .56916 .43132 lineto fill grestore gsave .623 setgray .56909 .43173 moveto .56916 .43132 lineto .6182 .43132 lineto .61095 .47359 lineto fill grestore gsave 0.001 setlinewidth .56909 .43173 moveto .56916 .43132 lineto stroke grestore gsave .705 setgray .61095 .47359 moveto .6182 .43132 lineto .63736 .43132 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .61095 .47359 moveto .6182 .43132 lineto stroke grestore gsave .541 setgray .56868 .43132 moveto .56909 .43173 lineto .56868 .43678 lineto fill grestore gsave .623 setgray .56909 .43173 moveto .56868 .43678 lineto .56868 .5 lineto .60882 .5 lineto .61095 .47359 lineto fill grestore gsave 0.001 setlinewidth .56909 .43173 moveto .56868 .43678 lineto stroke grestore gsave .705 setgray .61095 .47359 moveto .60882 .5 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .61095 .47359 moveto .60882 .5 lineto stroke grestore gsave .705 setgray .63736 .43132 moveto .66801 .46196 lineto .67781 .43132 lineto fill grestore gsave .786 setgray .66801 .46196 moveto .67781 .43132 lineto .70604 .43132 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .66801 .46196 moveto .67781 .43132 lineto stroke grestore gsave .705 setgray .66801 .46196 moveto .65989 .5 lineto .63736 .5 lineto .63736 .43132 lineto fill grestore gsave .786 setgray .66801 .46196 moveto .65989 .5 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .66801 .46196 moveto .65989 .5 lineto stroke grestore gsave .786 setgray .70604 .43132 moveto .74156 .46684 lineto .76121 .43132 lineto fill grestore gsave .868 setgray .74156 .46684 moveto .76121 .43132 lineto .77473 .43132 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .74156 .46684 moveto .76121 .43132 lineto stroke grestore gsave .786 setgray .74156 .46684 moveto .7275 .5 lineto .70604 .5 lineto .70604 .43132 lineto fill grestore gsave .868 setgray .74156 .46684 moveto .7275 .5 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .74156 .46684 moveto .7275 .5 lineto stroke grestore gsave .868 setgray .77473 .43132 moveto .84341 .43132 lineto .84341 .5 lineto fill grestore gsave .868 setgray .77473 .43132 moveto .77473 .5 lineto .84341 .5 lineto fill grestore gsave .868 setgray .91209 .43132 moveto .84341 .43132 lineto .91209 .5 lineto fill grestore gsave .868 setgray .84341 .43132 moveto .91209 .5 lineto .84341 .5 lineto fill grestore gsave .868 setgray .98077 .43132 moveto .91209 .43132 lineto .98077 .5 lineto fill grestore gsave .868 setgray .91209 .43132 moveto .98077 .5 lineto .91209 .5 lineto fill grestore gsave 0.05 setgray 0.08791 .5 moveto 0.08791 .56868 lineto 0.01923 .5 lineto fill grestore gsave 0.05 setgray 0.08791 .56868 moveto 0.01923 .5 lineto 0.01923 .56868 lineto fill grestore gsave 0.05 setgray .15659 .5 moveto 0.08791 .5 lineto .15659 .56868 lineto fill grestore gsave 0.05 setgray 0.08791 .5 moveto .15659 .56868 lineto 0.08791 .56868 lineto fill grestore gsave 0.05 setgray .15659 .5 moveto .22527 .5 lineto .22527 .56868 lineto fill grestore gsave 0.05 setgray .15659 .5 moveto .15659 .56868 lineto .22527 .56868 lineto fill grestore gsave 0.05 setgray .28916 .56388 moveto .29396 .54864 lineto .29396 .5 lineto .22527 .5 lineto fill grestore gsave .132 setgray .28916 .56388 moveto .29396 .54864 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .28916 .56388 moveto .29396 .54864 lineto stroke grestore gsave 0.05 setgray .28916 .56388 moveto .2873 .56868 lineto .22527 .56868 lineto .22527 .5 lineto fill grestore gsave .132 setgray .28916 .56388 moveto .2873 .56868 lineto .29396 .56868 lineto fill grestore gsave 0.001 setlinewidth .28916 .56388 moveto .2873 .56868 lineto stroke grestore gsave 0.05 setgray .29396 .5 moveto .30183 .50787 lineto .30289 .5 lineto fill grestore gsave .132 setgray .30183 .50787 moveto .30289 .5 lineto .36264 .5 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .30183 .50787 moveto .30289 .5 lineto stroke grestore gsave 0.05 setgray .29396 .5 moveto .30183 .50787 lineto .29396 .54864 lineto fill grestore gsave .132 setgray .30183 .50787 moveto .29396 .54864 lineto .29396 .56868 lineto .36264 .56868 lineto fill grestore gsave 0.001 setlinewidth .30183 .50787 moveto .29396 .54864 lineto stroke grestore gsave .132 setgray .36264 .5 moveto .37062 .50798 lineto .37101 .5 lineto fill grestore gsave .214 setgray .37062 .50798 moveto .37101 .5 lineto .42016 .5 lineto .41744 .5548 lineto fill grestore gsave 0.001 setlinewidth .37062 .50798 moveto .37101 .5 lineto stroke grestore gsave .295 setgray .41744 .5548 moveto .42016 .5 lineto .43132 .5 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .41744 .5548 moveto .42016 .5 lineto stroke grestore gsave .132 setgray .37062 .50798 moveto .36476 .56868 lineto .36264 .56868 lineto .36264 .5 lineto fill grestore gsave .214 setgray .37062 .50798 moveto .36476 .56868 lineto .4161 .56868 lineto .41744 .5548 lineto fill grestore gsave 0.001 setlinewidth .37062 .50798 moveto .36476 .56868 lineto stroke grestore gsave .295 setgray .41744 .5548 moveto .4161 .56868 lineto .43132 .56868 lineto fill grestore gsave 0.001 setlinewidth .41744 .5548 moveto .4161 .56868 lineto stroke grestore gsave .295 setgray .43132 .5 moveto .46244 .53112 lineto .46261 .5 lineto fill grestore gsave .377 setgray .46244 .53112 moveto .46261 .5 lineto .5 .5 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .46244 .53112 moveto .46261 .5 lineto stroke grestore gsave .295 setgray .46244 .53112 moveto .46085 .56868 lineto .43132 .56868 lineto .43132 .5 lineto fill grestore gsave .377 setgray .46244 .53112 moveto .46085 .56868 lineto .5 .56868 lineto fill grestore gsave 0.001 setlinewidth .46244 .53112 moveto .46085 .56868 lineto stroke grestore gsave .377 setgray .5 .5 moveto .5024 .5 lineto .50246 .50246 lineto fill grestore gsave .459 setgray .5024 .5 moveto .50246 .50246 lineto .53464 .53464 lineto .53377 .5 lineto fill grestore gsave 0.001 setlinewidth .5024 .5 moveto .50246 .50246 lineto stroke grestore gsave .541 setgray .53377 .5 moveto .53464 .53464 lineto .56683 .56683 lineto .56514 .5 lineto fill grestore gsave 0.001 setlinewidth .53377 .5 moveto .53464 .53464 lineto stroke grestore gsave .623 setgray .56514 .5 moveto .56683 .56683 lineto .56868 .56868 lineto .56868 .5 lineto fill grestore gsave 0.001 setlinewidth .56514 .5 moveto .56683 .56683 lineto stroke grestore gsave .377 setgray .50246 .50246 moveto .50217 .56868 lineto .5 .56868 lineto .5 .5 lineto fill grestore gsave .459 setgray .50246 .50246 moveto .50217 .56868 lineto .53449 .56868 lineto .53464 .53464 lineto fill grestore gsave 0.001 setlinewidth .50246 .50246 moveto .50217 .56868 lineto stroke grestore gsave .541 setgray .53464 .53464 moveto .53449 .56868 lineto .56682 .56868 lineto .56683 .56683 lineto fill grestore gsave 0.001 setlinewidth .53464 .53464 moveto .53449 .56868 lineto stroke grestore gsave .623 setgray .56683 .56683 moveto .56682 .56868 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .56683 .56683 moveto .56682 .56868 lineto stroke grestore gsave .623 setgray .56868 .5 moveto .60882 .5 lineto .61167 .54299 lineto fill grestore gsave .705 setgray .60882 .5 moveto .61167 .54299 lineto .63736 .56868 lineto .63736 .5 lineto fill grestore gsave 0.001 setlinewidth .60882 .5 moveto .61167 .54299 lineto stroke grestore gsave .623 setgray .61263 .56868 moveto .61167 .54299 lineto .56868 .5 lineto .56868 .56868 lineto fill grestore gsave .705 setgray .61263 .56868 moveto .61167 .54299 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .61263 .56868 moveto .61167 .54299 lineto stroke grestore gsave .705 setgray .63736 .5 moveto .65989 .5 lineto .66308 .52572 lineto fill grestore gsave .786 setgray .65989 .5 moveto .66308 .52572 lineto .70604 .56868 lineto .70604 .5 lineto fill grestore gsave 0.001 setlinewidth .65989 .5 moveto .66308 .52572 lineto stroke grestore gsave .705 setgray .66706 .56868 moveto .66308 .52572 lineto .63736 .5 lineto .63736 .56868 lineto fill grestore gsave .786 setgray .66706 .56868 moveto .66308 .52572 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .66706 .56868 moveto .66308 .52572 lineto stroke grestore gsave .786 setgray .70604 .5 moveto .7275 .5 lineto .73333 .52728 lineto fill grestore gsave .868 setgray .7275 .5 moveto .73333 .52728 lineto .77473 .56868 lineto .77473 .5 lineto fill grestore gsave 0.001 setlinewidth .7275 .5 moveto .73333 .52728 lineto stroke grestore gsave .786 setgray .74099 .56868 moveto .73333 .52728 lineto .70604 .5 lineto .70604 .56868 lineto fill grestore gsave .868 setgray .74099 .56868 moveto .73333 .52728 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .74099 .56868 moveto .73333 .52728 lineto stroke grestore gsave .868 setgray .77473 .5 moveto .84341 .56868 lineto .84341 .5 lineto fill grestore gsave .868 setgray .77473 .56868 moveto .77473 .5 lineto .84341 .56868 lineto fill grestore gsave .868 setgray .91209 .56868 moveto .91209 .5 lineto .84341 .5 lineto fill grestore gsave .868 setgray .91209 .56868 moveto .84341 .56868 lineto .84341 .5 lineto fill grestore gsave .868 setgray .98077 .56868 moveto .98077 .5 lineto .91209 .5 lineto fill grestore gsave .868 setgray .98077 .56868 moveto .91209 .56868 lineto .91209 .5 lineto fill grestore gsave 0.05 setgray 0.08791 .61744 moveto 0.05573 .60518 lineto 0.01923 .56868 lineto 0.08791 .56868 lineto fill grestore gsave .132 setgray 0.08791 .61744 moveto 0.05573 .60518 lineto 0.08791 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .61744 moveto 0.05573 .60518 lineto stroke grestore gsave 0.05 setgray 0.01923 .56868 moveto 0.01923 .59218 lineto 0.05573 .60518 lineto fill grestore gsave .132 setgray 0.01923 .59218 moveto 0.05573 .60518 lineto 0.08791 .63736 lineto 0.01923 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .59218 moveto 0.05573 .60518 lineto stroke grestore gsave 0.05 setgray .15659 .63243 moveto .15019 .63096 lineto 0.08791 .56868 lineto .15659 .56868 lineto fill grestore gsave .132 setgray .15659 .63243 moveto .15019 .63096 lineto .15659 .63736 lineto fill grestore gsave 0.001 setlinewidth .15659 .63243 moveto .15019 .63096 lineto stroke grestore gsave 0.05 setgray 0.08791 .56868 moveto 0.08791 .61744 lineto .15019 .63096 lineto fill grestore gsave .132 setgray 0.08791 .61744 moveto .15019 .63096 lineto .15659 .63736 lineto 0.08791 .63736 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .61744 moveto .15019 .63096 lineto stroke grestore gsave 0.05 setgray .21611 .6282 moveto .22527 .62728 lineto .22527 .56868 lineto .15659 .56868 lineto fill grestore gsave .132 setgray .21611 .6282 moveto .22527 .62728 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .21611 .6282 moveto .22527 .62728 lineto stroke grestore gsave 0.05 setgray .15659 .56868 moveto .21611 .6282 lineto .15659 .63243 lineto fill grestore gsave .132 setgray .21611 .6282 moveto .15659 .63243 lineto .15659 .63736 lineto .22527 .63736 lineto fill grestore gsave 0.001 setlinewidth .21611 .6282 moveto .15659 .63243 lineto stroke grestore gsave 0.05 setgray .22527 .56868 moveto .25756 .60097 lineto .2873 .56868 lineto fill grestore gsave .132 setgray .25756 .60097 moveto .2873 .56868 lineto .29396 .56868 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .25756 .60097 moveto .2873 .56868 lineto stroke grestore gsave 0.05 setgray .22527 .56868 moveto .25756 .60097 lineto .22527 .62728 lineto fill grestore gsave .132 setgray .25756 .60097 moveto .22527 .62728 lineto .22527 .63736 lineto .29396 .63736 lineto fill grestore gsave 0.001 setlinewidth .25756 .60097 moveto .22527 .62728 lineto stroke grestore gsave .132 setgray .34474 .61946 moveto .36264 .57624 lineto .36264 .56868 lineto .29396 .56868 lineto fill grestore gsave .214 setgray .34474 .61946 moveto .36264 .57624 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .34474 .61946 moveto .36264 .57624 lineto stroke grestore gsave .132 setgray .34474 .61946 moveto .33382 .63736 lineto .29396 .63736 lineto .29396 .56868 lineto fill grestore gsave .214 setgray .34474 .61946 moveto .33382 .63736 lineto .36264 .63736 lineto fill grestore gsave 0.001 setlinewidth .34474 .61946 moveto .33382 .63736 lineto stroke grestore gsave .132 setgray .36264 .56868 moveto .36446 .5705 lineto .36476 .56868 lineto fill grestore gsave .214 setgray .36446 .5705 moveto .36476 .56868 lineto .4161 .56868 lineto .40848 .61452 lineto fill grestore gsave 0.001 setlinewidth .36446 .5705 moveto .36476 .56868 lineto stroke grestore gsave .295 setgray .40848 .61452 moveto .4161 .56868 lineto .43132 .56868 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .40848 .61452 moveto .4161 .56868 lineto stroke grestore gsave .132 setgray .36264 .56868 moveto .36446 .5705 lineto .36264 .57624 lineto fill grestore gsave .214 setgray .36446 .5705 moveto .36264 .57624 lineto .36264 .63736 lineto .40123 .63736 lineto .40848 .61452 lineto fill grestore gsave 0.001 setlinewidth .36446 .5705 moveto .36264 .57624 lineto stroke grestore gsave .295 setgray .40848 .61452 moveto .40123 .63736 lineto .43132 .63736 lineto fill grestore gsave 0.001 setlinewidth .40848 .61452 moveto .40123 .63736 lineto stroke grestore gsave .295 setgray .43132 .56868 moveto .46013 .59749 lineto .46085 .56868 lineto fill grestore gsave .377 setgray .46013 .59749 moveto .46085 .56868 lineto .5 .56868 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .46013 .59749 moveto .46085 .56868 lineto stroke grestore gsave .295 setgray .46013 .59749 moveto .45403 .63736 lineto .43132 .63736 lineto .43132 .56868 lineto fill grestore gsave .377 setgray .46013 .59749 moveto .45403 .63736 lineto .5 .63736 lineto fill grestore gsave 0.001 setlinewidth .46013 .59749 moveto .45403 .63736 lineto stroke grestore gsave .377 setgray .5 .56868 moveto .50217 .56868 lineto .50239 .57107 lineto fill grestore gsave .459 setgray .50217 .56868 moveto .50239 .57107 lineto .538 .60668 lineto .53449 .56868 lineto fill grestore gsave 0.001 setlinewidth .50217 .56868 moveto .50239 .57107 lineto stroke grestore gsave .541 setgray .53449 .56868 moveto .538 .60668 lineto .56868 .63736 lineto .56868 .58888 lineto .56682 .56868 lineto fill grestore gsave 0.001 setlinewidth .53449 .56868 moveto .538 .60668 lineto stroke grestore gsave .623 setgray .56682 .56868 moveto .56868 .58888 lineto .56868 .56868 lineto fill grestore gsave 0.001 setlinewidth .56682 .56868 moveto .56868 .58888 lineto stroke grestore gsave .377 setgray .50239 .57107 moveto .50096 .63736 lineto .5 .63736 lineto .5 .56868 lineto fill grestore gsave .459 setgray .50239 .57107 moveto .50096 .63736 lineto .53734 .63736 lineto .538 .60668 lineto fill grestore gsave 0.001 setlinewidth .50239 .57107 moveto .50096 .63736 lineto stroke grestore gsave .541 setgray .538 .60668 moveto .53734 .63736 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .538 .60668 moveto .53734 .63736 lineto stroke grestore gsave .623 setgray .56868 .56868 moveto .61263 .56868 lineto .62716 .62716 lineto fill grestore gsave .705 setgray .61263 .56868 moveto .62716 .62716 lineto .63736 .63736 lineto .63736 .56868 lineto fill grestore gsave 0.001 setlinewidth .61263 .56868 moveto .62716 .62716 lineto stroke grestore gsave .541 setgray .56868 .63736 moveto .57597 .63736 lineto .56868 .58888 lineto fill grestore gsave .623 setgray .57597 .63736 moveto .56868 .58888 lineto .56868 .56868 lineto .62716 .62716 lineto .6287 .63736 lineto fill grestore gsave 0.001 setlinewidth .57597 .63736 moveto .56868 .58888 lineto stroke grestore gsave .705 setgray .6287 .63736 moveto .62716 .62716 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .6287 .63736 moveto .62716 .62716 lineto stroke grestore gsave .705 setgray .63736 .56868 moveto .66706 .56868 lineto .69183 .62314 lineto fill grestore gsave .786 setgray .66706 .56868 moveto .69183 .62314 lineto .70604 .63736 lineto .70604 .56868 lineto fill grestore gsave 0.001 setlinewidth .66706 .56868 moveto .69183 .62314 lineto stroke grestore gsave .705 setgray .69725 .63736 moveto .69183 .62314 lineto .63736 .56868 lineto .63736 .63736 lineto fill grestore gsave .786 setgray .69725 .63736 moveto .69183 .62314 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .69725 .63736 moveto .69183 .62314 lineto stroke grestore gsave .786 setgray .74099 .56868 moveto .77473 .61282 lineto .77473 .63736 lineto .70604 .56868 lineto fill grestore gsave .868 setgray .74099 .56868 moveto .77473 .61282 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .74099 .56868 moveto .77473 .61282 lineto stroke grestore gsave .786 setgray .70604 .63736 moveto .70604 .56868 lineto .77473 .63736 lineto fill grestore gsave .786 setgray .84341 .63736 moveto .84341 .63552 lineto .84061 .63456 lineto fill grestore gsave .868 setgray .84341 .63552 moveto .84061 .63456 lineto .77473 .56868 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .84341 .63552 moveto .84061 .63456 lineto stroke grestore gsave .786 setgray .77473 .61282 moveto .84061 .63456 lineto .84341 .63736 lineto .77473 .63736 lineto fill grestore gsave .868 setgray .77473 .61282 moveto .84061 .63456 lineto .77473 .56868 lineto fill grestore gsave 0.001 setlinewidth .77473 .61282 moveto .84061 .63456 lineto stroke grestore gsave .786 setgray .91209 .63736 moveto .90859 .63386 lineto .91209 .63366 lineto fill grestore gsave .868 setgray .90859 .63386 moveto .91209 .63366 lineto .91209 .56868 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .90859 .63386 moveto .91209 .63366 lineto stroke grestore gsave .786 setgray .90859 .63386 moveto .84341 .63552 lineto .84341 .63736 lineto .91209 .63736 lineto fill grestore gsave .868 setgray .90859 .63386 moveto .84341 .63552 lineto .84341 .56868 lineto fill grestore gsave 0.001 setlinewidth .90859 .63386 moveto .84341 .63552 lineto stroke grestore gsave .786 setgray .98077 .63736 moveto .96506 .62166 lineto .98077 .61709 lineto fill grestore gsave .868 setgray .96506 .62166 moveto .98077 .61709 lineto .98077 .56868 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .96506 .62166 moveto .98077 .61709 lineto stroke grestore gsave .786 setgray .96506 .62166 moveto .91209 .63366 lineto .91209 .63736 lineto .98077 .63736 lineto fill grestore gsave .868 setgray .96506 .62166 moveto .91209 .63366 lineto .91209 .56868 lineto fill grestore gsave 0.001 setlinewidth .96506 .62166 moveto .91209 .63366 lineto stroke grestore gsave .132 setgray 0.08791 .63736 moveto 0.01923 .63736 lineto 0.08791 .70604 lineto fill grestore gsave .132 setgray 0.01923 .69625 moveto 0.06357 .70604 lineto 0.08791 .70604 lineto 0.01923 .63736 lineto fill grestore gsave .214 setgray 0.01923 .69625 moveto 0.06357 .70604 lineto 0.01923 .70604 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .69625 moveto 0.06357 .70604 lineto stroke grestore gsave .132 setgray .15659 .63736 moveto 0.08791 .63736 lineto .15659 .70604 lineto fill grestore gsave .132 setgray 0.08791 .63736 moveto .15659 .70604 lineto 0.08791 .70604 lineto fill grestore gsave .132 setgray .15659 .63736 moveto .22527 .63736 lineto .22527 .70604 lineto fill grestore gsave .132 setgray .15659 .63736 moveto .15659 .70604 lineto .22527 .70604 lineto fill grestore gsave .132 setgray .2813 .69339 moveto .29396 .68479 lineto .29396 .63736 lineto .22527 .63736 lineto fill grestore gsave .214 setgray .2813 .69339 moveto .29396 .68479 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .2813 .69339 moveto .29396 .68479 lineto stroke grestore gsave .132 setgray .2813 .69339 moveto .25413 .70604 lineto .22527 .70604 lineto .22527 .63736 lineto fill grestore gsave .214 setgray .2813 .69339 moveto .25413 .70604 lineto .29396 .70604 lineto fill grestore gsave 0.001 setlinewidth .2813 .69339 moveto .25413 .70604 lineto stroke grestore gsave .132 setgray .29396 .63736 moveto .31807 .66147 lineto .33382 .63736 lineto fill grestore gsave .214 setgray .31807 .66147 moveto .33382 .63736 lineto .36264 .63736 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .31807 .66147 moveto .33382 .63736 lineto stroke grestore gsave .132 setgray .29396 .63736 moveto .31807 .66147 lineto .29396 .68479 lineto fill grestore gsave .214 setgray .31807 .66147 moveto .29396 .68479 lineto .29396 .70604 lineto .36264 .70604 lineto fill grestore gsave 0.001 setlinewidth .31807 .66147 moveto .29396 .68479 lineto stroke grestore gsave .214 setgray .36264 .63736 moveto .39321 .66794 lineto .40123 .63736 lineto fill grestore gsave .295 setgray .39321 .66794 moveto .40123 .63736 lineto .43132 .63736 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .39321 .66794 moveto .40123 .63736 lineto stroke grestore gsave .214 setgray .39321 .66794 moveto .37284 .70604 lineto .36264 .70604 lineto .36264 .63736 lineto fill grestore gsave .295 setgray .39321 .66794 moveto .37284 .70604 lineto .43132 .70604 lineto fill grestore gsave 0.001 setlinewidth .39321 .66794 moveto .37284 .70604 lineto stroke grestore gsave .295 setgray .43132 .63736 moveto .45316 .65921 lineto .45403 .63736 lineto fill grestore gsave .377 setgray .45316 .65921 moveto .45403 .63736 lineto .5 .63736 lineto .5 .6686 lineto .49856 .70461 lineto fill grestore gsave 0.001 setlinewidth .45316 .65921 moveto .45403 .63736 lineto stroke grestore gsave .459 setgray .49856 .70461 moveto .5 .6686 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .49856 .70461 moveto .5 .6686 lineto stroke grestore gsave .295 setgray .45316 .65921 moveto .44105 .70604 lineto .43132 .70604 lineto .43132 .63736 lineto fill grestore gsave .377 setgray .45316 .65921 moveto .44105 .70604 lineto .49819 .70604 lineto .49856 .70461 lineto fill grestore gsave 0.001 setlinewidth .45316 .65921 moveto .44105 .70604 lineto stroke grestore gsave .459 setgray .49856 .70461 moveto .49819 .70604 lineto .5 .70604 lineto fill grestore gsave 0.001 setlinewidth .49856 .70461 moveto .49819 .70604 lineto stroke grestore gsave .377 setgray .5 .63736 moveto .50096 .63736 lineto .50112 .63848 lineto fill grestore gsave .459 setgray .50096 .63736 moveto .50112 .63848 lineto .54359 .68095 lineto .53734 .63736 lineto fill grestore gsave 0.001 setlinewidth .50096 .63736 moveto .50112 .63848 lineto stroke grestore gsave .541 setgray .53734 .63736 moveto .54359 .68095 lineto .56868 .70604 lineto .56868 .63736 lineto fill grestore gsave 0.001 setlinewidth .53734 .63736 moveto .54359 .68095 lineto stroke grestore gsave .377 setgray .5 .63736 moveto .50112 .63848 lineto .5 .6686 lineto fill grestore gsave .459 setgray .50112 .63848 moveto .5 .6686 lineto .5 .70604 lineto .54266 .70604 lineto .54359 .68095 lineto fill grestore gsave 0.001 setlinewidth .50112 .63848 moveto .5 .6686 lineto stroke grestore gsave .541 setgray .54359 .68095 moveto .54266 .70604 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .54359 .68095 moveto .54266 .70604 lineto stroke grestore gsave .541 setgray .56868 .63736 moveto .57597 .63736 lineto .58051 .64919 lineto fill grestore gsave .623 setgray .57597 .63736 moveto .58051 .64919 lineto .63736 .70604 lineto .63736 .65995 lineto .6287 .63736 lineto fill grestore gsave 0.001 setlinewidth .57597 .63736 moveto .58051 .64919 lineto stroke grestore gsave .705 setgray .6287 .63736 moveto .63736 .65995 lineto .63736 .63736 lineto fill grestore gsave 0.001 setlinewidth .6287 .63736 moveto .63736 .65995 lineto stroke grestore gsave .541 setgray .59485 .70604 moveto .58051 .64919 lineto .56868 .63736 lineto .56868 .70604 lineto fill grestore gsave .623 setgray .59485 .70604 moveto .58051 .64919 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .59485 .70604 moveto .58051 .64919 lineto stroke grestore gsave .705 setgray .69725 .63736 moveto .70604 .65003 lineto .70604 .70604 lineto .63736 .63736 lineto fill grestore gsave .786 setgray .69725 .63736 moveto .70604 .65003 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .69725 .63736 moveto .70604 .65003 lineto stroke grestore gsave .623 setgray .63736 .70604 moveto .66641 .70604 lineto .63736 .65995 lineto fill grestore gsave .705 setgray .66641 .70604 moveto .63736 .65995 lineto .63736 .63736 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .66641 .70604 moveto .63736 .65995 lineto stroke grestore gsave .786 setgray .77473 .70604 moveto .70604 .63736 lineto .77473 .63736 lineto fill grestore gsave .705 setgray .70604 .70604 moveto .70604 .65003 lineto .77191 .70604 lineto fill grestore gsave .786 setgray .70604 .65003 moveto .77191 .70604 lineto .77473 .70604 lineto .70604 .63736 lineto fill grestore gsave 0.001 setlinewidth .70604 .65003 moveto .77191 .70604 lineto stroke grestore gsave .786 setgray .84341 .70604 moveto .77473 .63736 lineto .84341 .63736 lineto fill grestore gsave .786 setgray .77473 .70604 moveto .84341 .70604 lineto .77473 .63736 lineto fill grestore gsave .786 setgray .91209 .70604 moveto .91209 .63736 lineto .84341 .63736 lineto fill grestore gsave .786 setgray .91209 .70604 moveto .84341 .70604 lineto .84341 .63736 lineto fill grestore gsave .786 setgray .98077 .70604 moveto .98077 .63736 lineto .91209 .63736 lineto fill grestore gsave .786 setgray .98077 .70604 moveto .91209 .70604 lineto .91209 .63736 lineto fill grestore gsave .132 setgray 0.08791 .70604 moveto 0.08791 .71011 lineto 0.06357 .70604 lineto fill grestore gsave .214 setgray 0.08791 .71011 moveto 0.06357 .70604 lineto 0.01923 .70604 lineto 0.08791 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .71011 moveto 0.06357 .70604 lineto stroke grestore gsave .214 setgray 0.01923 .77049 moveto 0.05138 .77473 lineto 0.08791 .77473 lineto 0.01923 .70604 lineto fill grestore gsave .295 setgray 0.01923 .77049 moveto 0.05138 .77473 lineto 0.01923 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .77049 moveto 0.05138 .77473 lineto stroke grestore gsave .132 setgray .15659 .71757 moveto 0.09238 .71052 lineto 0.08791 .70604 lineto .15659 .70604 lineto fill grestore gsave .214 setgray .15659 .71757 moveto 0.09238 .71052 lineto .15659 .77473 lineto fill grestore gsave 0.001 setlinewidth .15659 .71757 moveto 0.09238 .71052 lineto stroke grestore gsave .132 setgray 0.08791 .70604 moveto 0.08791 .71011 lineto 0.09238 .71052 lineto fill grestore gsave .214 setgray 0.08791 .71011 moveto 0.09238 .71052 lineto .15659 .77473 lineto 0.08791 .77473 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .71011 moveto 0.09238 .71052 lineto stroke grestore gsave .132 setgray .16812 .71757 moveto .22527 .71643 lineto .22527 .70604 lineto .15659 .70604 lineto fill grestore gsave .214 setgray .16812 .71757 moveto .22527 .71643 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .16812 .71757 moveto .22527 .71643 lineto stroke grestore gsave .132 setgray .15659 .70604 moveto .16812 .71757 lineto .15659 .71757 lineto fill grestore gsave .214 setgray .16812 .71757 moveto .15659 .71757 lineto .15659 .77473 lineto .22527 .77473 lineto fill grestore gsave 0.001 setlinewidth .16812 .71757 moveto .15659 .71757 lineto stroke grestore gsave .132 setgray .22527 .70604 moveto .23365 .71442 lineto .25413 .70604 lineto fill grestore gsave .214 setgray .23365 .71442 moveto .25413 .70604 lineto .29396 .70604 lineto .29396 .7683 lineto .2894 .77017 lineto fill grestore gsave 0.001 setlinewidth .23365 .71442 moveto .25413 .70604 lineto stroke grestore gsave .295 setgray .2894 .77017 moveto .29396 .7683 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .2894 .77017 moveto .29396 .7683 lineto stroke grestore gsave .132 setgray .22527 .70604 moveto .23365 .71442 lineto .22527 .71643 lineto fill grestore gsave .214 setgray .23365 .71442 moveto .22527 .71643 lineto .22527 .77473 lineto .27039 .77473 lineto .2894 .77017 lineto fill grestore gsave 0.001 setlinewidth .23365 .71442 moveto .22527 .71643 lineto stroke grestore gsave .295 setgray .2894 .77017 moveto .27039 .77473 lineto .29396 .77473 lineto fill grestore gsave 0.001 setlinewidth .2894 .77017 moveto .27039 .77473 lineto stroke grestore gsave .214 setgray .33488 .74697 moveto .36264 .72061 lineto .36264 .70604 lineto .29396 .70604 lineto fill grestore gsave .295 setgray .33488 .74697 moveto .36264 .72061 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .33488 .74697 moveto .36264 .72061 lineto stroke grestore gsave .214 setgray .29396 .70604 moveto .33488 .74697 lineto .29396 .7683 lineto fill grestore gsave .295 setgray .33488 .74697 moveto .29396 .7683 lineto .29396 .77473 lineto .36264 .77473 lineto fill grestore gsave 0.001 setlinewidth .33488 .74697 moveto .29396 .7683 lineto stroke grestore gsave .214 setgray .36264 .70604 moveto .36983 .71324 lineto .37284 .70604 lineto fill grestore gsave .295 setgray .36983 .71324 moveto .37284 .70604 lineto .43132 .70604 lineto .43132 .73478 lineto .41955 .76295 lineto fill grestore gsave 0.001 setlinewidth .36983 .71324 moveto .37284 .70604 lineto stroke grestore gsave .377 setgray .41955 .76295 moveto .43132 .73478 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .41955 .76295 moveto .43132 .73478 lineto stroke grestore gsave .214 setgray .36264 .70604 moveto .36983 .71324 lineto .36264 .72061 lineto fill grestore gsave .295 setgray .36983 .71324 moveto .36264 .72061 lineto .36264 .77473 lineto .40806 .77473 lineto .41955 .76295 lineto fill grestore gsave 0.001 setlinewidth .36983 .71324 moveto .36264 .72061 lineto stroke grestore gsave .377 setgray .41955 .76295 moveto .40806 .77473 lineto .43132 .77473 lineto fill grestore gsave 0.001 setlinewidth .41955 .76295 moveto .40806 .77473 lineto stroke grestore gsave .295 setgray .43132 .70604 moveto .44048 .7152 lineto .44105 .70604 lineto fill grestore gsave .377 setgray .44048 .7152 moveto .44105 .70604 lineto .49819 .70604 lineto .49423 .76896 lineto fill grestore gsave 0.001 setlinewidth .44048 .7152 moveto .44105 .70604 lineto stroke grestore gsave .459 setgray .49423 .76896 moveto .49819 .70604 lineto .5 .70604 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .49423 .76896 moveto .49819 .70604 lineto stroke grestore gsave .295 setgray .43132 .70604 moveto .44048 .7152 lineto .43132 .73478 lineto fill grestore gsave .377 setgray .44048 .7152 moveto .43132 .73478 lineto .43132 .77473 lineto .49153 .77473 lineto .49423 .76896 lineto fill grestore gsave 0.001 setlinewidth .44048 .7152 moveto .43132 .73478 lineto stroke grestore gsave .459 setgray .49423 .76896 moveto .49153 .77473 lineto .5 .77473 lineto fill grestore gsave 0.001 setlinewidth .49423 .76896 moveto .49153 .77473 lineto stroke grestore gsave .459 setgray .5 .70604 moveto .54266 .70604 lineto .55494 .76098 lineto fill grestore gsave .541 setgray .54266 .70604 moveto .55494 .76098 lineto .56868 .77473 lineto .56868 .70604 lineto fill grestore gsave 0.001 setlinewidth .54266 .70604 moveto .55494 .76098 lineto stroke grestore gsave .459 setgray .55494 .76098 moveto .55402 .77473 lineto .5 .77473 lineto .5 .70604 lineto fill grestore gsave .541 setgray .55494 .76098 moveto .55402 .77473 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .55494 .76098 moveto .55402 .77473 lineto stroke grestore gsave .541 setgray .56868 .70604 moveto .59485 .70604 lineto .63283 .77019 lineto fill grestore gsave .623 setgray .59485 .70604 moveto .63283 .77019 lineto .63736 .77473 lineto .63736 .70604 lineto fill grestore gsave 0.001 setlinewidth .59485 .70604 moveto .63283 .77019 lineto stroke grestore gsave .541 setgray .63484 .77473 moveto .63283 .77019 lineto .56868 .70604 lineto .56868 .77473 lineto fill grestore gsave .623 setgray .63484 .77473 moveto .63283 .77019 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .63484 .77473 moveto .63283 .77019 lineto stroke grestore gsave .623 setgray .70604 .7434 moveto .66641 .70604 lineto .63736 .70604 lineto .70604 .77473 lineto fill grestore gsave .705 setgray .70604 .7434 moveto .66641 .70604 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .70604 .7434 moveto .66641 .70604 lineto stroke grestore gsave .623 setgray .63736 .77473 moveto .70604 .77473 lineto .63736 .70604 lineto fill grestore gsave .705 setgray .77473 .70766 moveto .77191 .70604 lineto .70604 .70604 lineto .77473 .77473 lineto fill grestore gsave .786 setgray .77473 .70766 moveto .77191 .70604 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .77473 .70766 moveto .77191 .70604 lineto stroke grestore gsave .623 setgray .70604 .77473 moveto .70604 .7434 lineto .76797 .77473 lineto fill grestore gsave .705 setgray .70604 .7434 moveto .76797 .77473 lineto .77473 .77473 lineto .70604 .70604 lineto fill grestore gsave 0.001 setlinewidth .70604 .7434 moveto .76797 .77473 lineto stroke grestore gsave .705 setgray .84341 .77473 moveto .84341 .71896 lineto .77659 .70791 lineto fill grestore gsave .786 setgray .84341 .71896 moveto .77659 .70791 lineto .77473 .70604 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .84341 .71896 moveto .77659 .70791 lineto stroke grestore gsave .705 setgray .77473 .70766 moveto .77659 .70791 lineto .84341 .77473 lineto .77473 .77473 lineto fill grestore gsave .786 setgray .77473 .70766 moveto .77659 .70791 lineto .77473 .70604 lineto fill grestore gsave 0.001 setlinewidth .77473 .70766 moveto .77659 .70791 lineto stroke grestore gsave .705 setgray .91209 .77473 moveto .85634 .71898 lineto .91209 .71884 lineto fill grestore gsave .786 setgray .85634 .71898 moveto .91209 .71884 lineto .91209 .70604 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .85634 .71898 moveto .91209 .71884 lineto stroke grestore gsave .705 setgray .84341 .71896 moveto .85634 .71898 lineto .91209 .77473 lineto .84341 .77473 lineto fill grestore gsave .786 setgray .84341 .71896 moveto .85634 .71898 lineto .84341 .70604 lineto fill grestore gsave 0.001 setlinewidth .84341 .71896 moveto .85634 .71898 lineto stroke grestore gsave .705 setgray .98077 .77473 moveto .92404 .71799 lineto .98077 .71223 lineto fill grestore gsave .786 setgray .92404 .71799 moveto .98077 .71223 lineto .98077 .70604 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .92404 .71799 moveto .98077 .71223 lineto stroke grestore gsave .705 setgray .92404 .71799 moveto .91209 .71884 lineto .91209 .77473 lineto .98077 .77473 lineto fill grestore gsave .786 setgray .92404 .71799 moveto .91209 .71884 lineto .91209 .70604 lineto fill grestore gsave 0.001 setlinewidth .92404 .71799 moveto .91209 .71884 lineto stroke grestore gsave .214 setgray 0.08791 .77473 moveto 0.08791 .78173 lineto 0.05138 .77473 lineto fill grestore gsave .295 setgray 0.08791 .78173 moveto 0.05138 .77473 lineto 0.01923 .77473 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .78173 moveto 0.05138 .77473 lineto stroke grestore gsave .295 setgray 0.01923 .77473 moveto 0.08791 .84341 lineto 0.01923 .84341 lineto fill grestore gsave .214 setgray .15659 .79067 moveto 0.09574 .78255 lineto 0.08791 .77473 lineto .15659 .77473 lineto fill grestore gsave .295 setgray .15659 .79067 moveto 0.09574 .78255 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .15659 .79067 moveto 0.09574 .78255 lineto stroke grestore gsave .214 setgray 0.08791 .77473 moveto 0.08791 .78173 lineto 0.09574 .78255 lineto fill grestore gsave .295 setgray 0.08791 .78173 moveto 0.09574 .78255 lineto .15659 .84341 lineto 0.08791 .84341 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .78173 moveto 0.09574 .78255 lineto stroke grestore gsave .214 setgray .17266 .79079 moveto .22527 .79077 lineto .22527 .77473 lineto .15659 .77473 lineto fill grestore gsave .295 setgray .17266 .79079 moveto .22527 .79077 lineto .22527 .84341 lineto fill grestore gsave 0.001 setlinewidth .17266 .79079 moveto .22527 .79077 lineto stroke grestore gsave .214 setgray .15659 .77473 moveto .15659 .79067 lineto .17266 .79079 lineto fill grestore gsave .295 setgray .15659 .79067 moveto .17266 .79079 lineto .22527 .84341 lineto .15659 .84341 lineto fill grestore gsave 0.001 setlinewidth .15659 .79067 moveto .17266 .79079 lineto stroke grestore gsave .214 setgray .22527 .77473 moveto .23815 .7876 lineto .27039 .77473 lineto fill grestore gsave .295 setgray .23815 .7876 moveto .27039 .77473 lineto .29396 .77473 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .23815 .7876 moveto .27039 .77473 lineto stroke grestore gsave .214 setgray .22527 .77473 moveto .23815 .7876 lineto .22527 .79077 lineto fill grestore gsave .295 setgray .23815 .7876 moveto .22527 .79077 lineto .22527 .84341 lineto .29396 .84341 lineto fill grestore gsave 0.001 setlinewidth .23815 .7876 moveto .22527 .79077 lineto stroke grestore gsave .295 setgray .36221 .84297 moveto .36264 .84255 lineto .36264 .77473 lineto .29396 .77473 lineto fill grestore gsave .377 setgray .36221 .84297 moveto .36264 .84255 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36221 .84297 moveto .36264 .84255 lineto stroke grestore gsave .295 setgray .36221 .84297 moveto .36142 .84341 lineto .29396 .84341 lineto .29396 .77473 lineto fill grestore gsave .377 setgray .36221 .84297 moveto .36142 .84341 lineto .36264 .84341 lineto fill grestore gsave 0.001 setlinewidth .36221 .84297 moveto .36142 .84341 lineto stroke grestore gsave .295 setgray .36264 .77473 moveto .39509 .80718 lineto .40806 .77473 lineto fill grestore gsave .377 setgray .39509 .80718 moveto .40806 .77473 lineto .43132 .77473 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .39509 .80718 moveto .40806 .77473 lineto stroke grestore gsave .295 setgray .36264 .77473 moveto .39509 .80718 lineto .36264 .84255 lineto fill grestore gsave .377 setgray .39509 .80718 moveto .36264 .84255 lineto .36264 .84341 lineto .43132 .84341 lineto fill grestore gsave 0.001 setlinewidth .39509 .80718 moveto .36264 .84255 lineto stroke grestore gsave .377 setgray .43132 .77473 moveto .48818 .83158 lineto .49153 .77473 lineto fill grestore gsave .459 setgray .48818 .83158 moveto .49153 .77473 lineto .5 .77473 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .48818 .83158 moveto .49153 .77473 lineto stroke grestore gsave .377 setgray .48818 .83158 moveto .48304 .84341 lineto .43132 .84341 lineto .43132 .77473 lineto fill grestore gsave .459 setgray .48818 .83158 moveto .48304 .84341 lineto .5 .84341 lineto fill grestore gsave 0.001 setlinewidth .48818 .83158 moveto .48304 .84341 lineto stroke grestore gsave .459 setgray .5 .77473 moveto .55402 .77473 lineto .56827 .84299 lineto fill grestore gsave .541 setgray .55402 .77473 moveto .56827 .84299 lineto .56868 .84341 lineto .56868 .77473 lineto fill grestore gsave 0.001 setlinewidth .55402 .77473 moveto .56827 .84299 lineto stroke grestore gsave .459 setgray .56827 .84299 moveto .56824 .84341 lineto .5 .84341 lineto .5 .77473 lineto fill grestore gsave .541 setgray .56827 .84299 moveto .56824 .84341 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .56827 .84299 moveto .56824 .84341 lineto stroke grestore gsave .541 setgray .63484 .77473 moveto .63736 .77934 lineto .63736 .84341 lineto .56868 .77473 lineto fill grestore gsave .623 setgray .63484 .77473 moveto .63736 .77934 lineto .63736 .77473 lineto fill grestore gsave 0.001 setlinewidth .63484 .77473 moveto .63736 .77934 lineto stroke grestore gsave .541 setgray .56868 .84341 moveto .56868 .77473 lineto .63736 .84341 lineto fill grestore gsave .623 setgray .63736 .77473 moveto .70604 .84341 lineto .70604 .77473 lineto fill grestore gsave .541 setgray .63736 .84341 moveto .6991 .84341 lineto .63736 .77934 lineto fill grestore gsave .623 setgray .6991 .84341 moveto .63736 .77934 lineto .63736 .77473 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .6991 .84341 moveto .63736 .77934 lineto stroke grestore gsave .623 setgray .77473 .779 moveto .76797 .77473 lineto .70604 .77473 lineto .77473 .84341 lineto fill grestore gsave .705 setgray .77473 .779 moveto .76797 .77473 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .77473 .779 moveto .76797 .77473 lineto stroke grestore gsave .623 setgray .70604 .84341 moveto .77473 .84341 lineto .70604 .77473 lineto fill grestore gsave .623 setgray .84341 .84341 moveto .84341 .79143 lineto .77972 .77972 lineto fill grestore gsave .705 setgray .84341 .79143 moveto .77972 .77972 lineto .77473 .77473 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .84341 .79143 moveto .77972 .77972 lineto stroke grestore gsave .623 setgray .77473 .779 moveto .77972 .77972 lineto .84341 .84341 lineto .77473 .84341 lineto fill grestore gsave .705 setgray .77473 .779 moveto .77972 .77972 lineto .77473 .77473 lineto fill grestore gsave 0.001 setlinewidth .77473 .779 moveto .77972 .77972 lineto stroke grestore gsave .623 setgray .91209 .84341 moveto .91209 .79146 lineto .86007 .79139 lineto fill grestore gsave .705 setgray .91209 .79146 moveto .86007 .79139 lineto .84341 .77473 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .91209 .79146 moveto .86007 .79139 lineto stroke grestore gsave .623 setgray .86007 .79139 moveto .84341 .79143 lineto .84341 .84341 lineto .91209 .84341 lineto fill grestore gsave .705 setgray .86007 .79139 moveto .84341 .79143 lineto .84341 .77473 lineto fill grestore gsave 0.001 setlinewidth .86007 .79139 moveto .84341 .79143 lineto stroke grestore gsave .623 setgray .98077 .84341 moveto .92759 .79023 lineto .98077 .78467 lineto fill grestore gsave .705 setgray .92759 .79023 moveto .98077 .78467 lineto .98077 .77473 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .92759 .79023 moveto .98077 .78467 lineto stroke grestore gsave .623 setgray .92759 .79023 moveto .91209 .79146 lineto .91209 .84341 lineto .98077 .84341 lineto fill grestore gsave .705 setgray .92759 .79023 moveto .91209 .79146 lineto .91209 .77473 lineto fill grestore gsave 0.001 setlinewidth .92759 .79023 moveto .91209 .79146 lineto stroke grestore gsave .295 setgray 0.08791 .90147 moveto 0.0748 .89897 lineto 0.01923 .84341 lineto 0.08791 .84341 lineto fill grestore gsave .377 setgray 0.08791 .90147 moveto 0.0748 .89897 lineto 0.08791 .91209 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .90147 moveto 0.0748 .89897 lineto stroke grestore gsave .295 setgray 0.01923 .84341 moveto 0.01923 .8911 lineto 0.0748 .89897 lineto fill grestore gsave .377 setgray 0.01923 .8911 moveto 0.0748 .89897 lineto 0.08791 .91209 lineto 0.01923 .91209 lineto fill grestore gsave 0.001 setlinewidth 0.01923 .8911 moveto 0.0748 .89897 lineto stroke grestore gsave .295 setgray .15659 .90839 moveto .15232 .90781 lineto 0.08791 .84341 lineto .15659 .84341 lineto fill grestore gsave .377 setgray .15659 .90839 moveto .15232 .90781 lineto .15659 .91209 lineto fill grestore gsave 0.001 setlinewidth .15659 .90839 moveto .15232 .90781 lineto stroke grestore gsave .295 setgray 0.08791 .84341 moveto 0.08791 .90147 lineto .15232 .90781 lineto fill grestore gsave .377 setgray 0.08791 .90147 moveto .15232 .90781 lineto .15659 .91209 lineto 0.08791 .91209 lineto fill grestore gsave 0.001 setlinewidth 0.08791 .90147 moveto .15232 .90781 lineto stroke grestore gsave .295 setgray .22527 .90893 moveto .22208 .9089 lineto .15659 .84341 lineto .22527 .84341 lineto fill grestore gsave .377 setgray .22527 .90893 moveto .22208 .9089 lineto .22527 .91209 lineto fill grestore gsave 0.001 setlinewidth .22527 .90893 moveto .22208 .9089 lineto stroke grestore gsave .295 setgray .15659 .84341 moveto .15659 .90839 lineto .22208 .9089 lineto fill grestore gsave .377 setgray .15659 .90839 moveto .22208 .9089 lineto .22527 .91209 lineto .15659 .91209 lineto fill grestore gsave 0.001 setlinewidth .15659 .90839 moveto .22208 .9089 lineto stroke grestore gsave .295 setgray .27882 .89695 moveto .29396 .89151 lineto .29396 .84341 lineto .22527 .84341 lineto fill grestore gsave .377 setgray .27882 .89695 moveto .29396 .89151 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .27882 .89695 moveto .29396 .89151 lineto stroke grestore gsave .295 setgray .22527 .84341 moveto .27882 .89695 lineto .22527 .90893 lineto fill grestore gsave .377 setgray .27882 .89695 moveto .22527 .90893 lineto .22527 .91209 lineto .29396 .91209 lineto fill grestore gsave 0.001 setlinewidth .27882 .89695 moveto .22527 .90893 lineto stroke grestore gsave .295 setgray .29396 .84341 moveto .326 .87546 lineto .36142 .84341 lineto fill grestore gsave .377 setgray .326 .87546 moveto .36142 .84341 lineto .36264 .84341 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .326 .87546 moveto .36142 .84341 lineto stroke grestore gsave .295 setgray .29396 .84341 moveto .326 .87546 lineto .29396 .89151 lineto fill grestore gsave .377 setgray .326 .87546 moveto .29396 .89151 lineto .29396 .91209 lineto .36264 .91209 lineto fill grestore gsave 0.001 setlinewidth .326 .87546 moveto .29396 .89151 lineto stroke grestore gsave .377 setgray .36264 .84341 moveto .43132 .84341 lineto .43132 .91209 lineto fill grestore gsave .377 setgray .36264 .84341 moveto .36264 .91209 lineto .43132 .91209 lineto fill grestore gsave .377 setgray .43132 .84341 moveto .48006 .89215 lineto .48304 .84341 lineto fill grestore gsave .459 setgray .48006 .89215 moveto .48304 .84341 lineto .5 .84341 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .48006 .89215 moveto .48304 .84341 lineto stroke grestore gsave .377 setgray .48006 .89215 moveto .47084 .91209 lineto .43132 .91209 lineto .43132 .84341 lineto fill grestore gsave .459 setgray .48006 .89215 moveto .47084 .91209 lineto .5 .91209 lineto fill grestore gsave 0.001 setlinewidth .48006 .89215 moveto .47084 .91209 lineto stroke grestore gsave .459 setgray .56824 .84341 moveto .56868 .84542 lineto .56868 .91209 lineto .5 .84341 lineto fill grestore gsave .541 setgray .56824 .84341 moveto .56868 .84542 lineto .56868 .84341 lineto fill grestore gsave 0.001 setlinewidth .56824 .84341 moveto .56868 .84542 lineto stroke grestore gsave .459 setgray .5 .84341 moveto .5 .91209 lineto .56868 .91209 lineto fill grestore gsave .541 setgray .56868 .84341 moveto .63736 .91209 lineto .63736 .84341 lineto fill grestore gsave .459 setgray .56868 .91209 moveto .59638 .91209 lineto .56868 .84542 lineto fill grestore gsave .541 setgray .59638 .91209 moveto .56868 .84542 lineto .56868 .84341 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .59638 .91209 moveto .56868 .84542 lineto stroke grestore gsave .541 setgray .6991 .84341 moveto .70604 .85035 lineto .70604 .91209 lineto .63736 .84341 lineto fill grestore gsave .623 setgray .6991 .84341 moveto .70604 .85035 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .6991 .84341 moveto .70604 .85035 lineto stroke grestore gsave .541 setgray .63736 .91209 moveto .70604 .91209 lineto .63736 .84341 lineto fill grestore gsave .541 setgray .77473 .91209 moveto .77473 .89131 lineto .72114 .85851 lineto fill grestore gsave .623 setgray .77473 .89131 moveto .72114 .85851 lineto .70604 .84341 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .77473 .89131 moveto .72114 .85851 lineto stroke grestore gsave .541 setgray .70604 .85035 moveto .72114 .85851 lineto .77473 .91209 lineto .70604 .91209 lineto fill grestore gsave .623 setgray .70604 .85035 moveto .72114 .85851 lineto .70604 .84341 lineto fill grestore gsave 0.001 setlinewidth .70604 .85035 moveto .72114 .85851 lineto stroke grestore gsave .541 setgray .84341 .91209 moveto .84341 .90091 lineto .82987 .89855 lineto fill grestore gsave .623 setgray .84341 .90091 moveto .82987 .89855 lineto .77473 .84341 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .84341 .90091 moveto .82987 .89855 lineto stroke grestore gsave .541 setgray .77473 .89131 moveto .82987 .89855 lineto .84341 .91209 lineto .77473 .91209 lineto fill grestore gsave .623 setgray .77473 .89131 moveto .82987 .89855 lineto .77473 .84341 lineto fill grestore gsave 0.001 setlinewidth .77473 .89131 moveto .82987 .89855 lineto stroke grestore gsave .541 setgray .91209 .91209 moveto .90042 .90042 lineto .91209 .90038 lineto fill grestore gsave .623 setgray .90042 .90042 moveto .91209 .90038 lineto .91209 .84341 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .90042 .90042 moveto .91209 .90038 lineto stroke grestore gsave .541 setgray .90042 .90042 moveto .84341 .90091 lineto .84341 .91209 lineto .91209 .91209 lineto fill grestore gsave .623 setgray .90042 .90042 moveto .84341 .90091 lineto .84341 .84341 lineto fill grestore gsave 0.001 setlinewidth .90042 .90042 moveto .84341 .90091 lineto stroke grestore gsave .541 setgray .98077 .91209 moveto .96482 .89614 lineto .98077 .8945 lineto fill grestore gsave .623 setgray .96482 .89614 moveto .98077 .8945 lineto .98077 .84341 lineto .91209 .84341 lineto fill grestore gsave 0.001 setlinewidth .96482 .89614 moveto .98077 .8945 lineto stroke grestore gsave .541 setgray .96482 .89614 moveto .91209 .90038 lineto .91209 .91209 lineto .98077 .91209 lineto fill grestore gsave .623 setgray .96482 .89614 moveto .91209 .90038 lineto .91209 .84341 lineto fill grestore gsave 0.001 setlinewidth .96482 .89614 moveto .91209 .90038 lineto stroke grestore gsave .377 setgray 0.08791 .91209 moveto 0.01923 .91209 lineto 0.08791 .98077 lineto fill grestore gsave .377 setgray 0.01923 .91209 moveto 0.08791 .98077 lineto 0.01923 .98077 lineto fill grestore gsave .377 setgray .15659 .91209 moveto 0.08791 .91209 lineto .15659 .98077 lineto fill grestore gsave .377 setgray 0.08791 .91209 moveto .15659 .98077 lineto 0.08791 .98077 lineto fill grestore gsave .377 setgray .22527 .91209 moveto .15659 .91209 lineto .22527 .98077 lineto fill grestore gsave .377 setgray .15659 .91209 moveto .22527 .98077 lineto .15659 .98077 lineto fill grestore gsave .377 setgray .22527 .91209 moveto .29396 .91209 lineto .29396 .98077 lineto fill grestore gsave .377 setgray .22527 .91209 moveto .22527 .98077 lineto .29396 .98077 lineto fill grestore gsave .377 setgray .29396 .91209 moveto .36264 .91209 lineto .36264 .98077 lineto fill grestore gsave .377 setgray .29396 .91209 moveto .29396 .98077 lineto .36264 .98077 lineto fill grestore gsave .377 setgray .36264 .91209 moveto .43132 .91209 lineto .43132 .98077 lineto fill grestore gsave .377 setgray .36264 .91209 moveto .36264 .98077 lineto .43132 .98077 lineto fill grestore gsave .377 setgray .43132 .91209 moveto .46859 .94936 lineto .47084 .91209 lineto fill grestore gsave .459 setgray .46859 .94936 moveto .47084 .91209 lineto .5 .91209 lineto .5 .98077 lineto fill grestore gsave 0.001 setlinewidth .46859 .94936 moveto .47084 .91209 lineto stroke grestore gsave .377 setgray .46859 .94936 moveto .45424 .98077 lineto .43132 .98077 lineto .43132 .91209 lineto fill grestore gsave .459 setgray .46859 .94936 moveto .45424 .98077 lineto .5 .98077 lineto fill grestore gsave 0.001 setlinewidth .46859 .94936 moveto .45424 .98077 lineto stroke grestore gsave .459 setgray .5 .91209 moveto .56868 .98077 lineto .56868 .91209 lineto fill grestore gsave .459 setgray .5 .91209 moveto .5 .98077 lineto .56868 .98077 lineto fill grestore gsave .459 setgray .56868 .91209 moveto .59638 .91209 lineto .63081 .97422 lineto fill grestore gsave .541 setgray .59638 .91209 moveto .63081 .97422 lineto .63736 .98077 lineto .63736 .91209 lineto fill grestore gsave 0.001 setlinewidth .59638 .91209 moveto .63081 .97422 lineto stroke grestore gsave .459 setgray .63346 .98077 moveto .63081 .97422 lineto .56868 .91209 lineto .56868 .98077 lineto fill grestore gsave .541 setgray .63346 .98077 moveto .63081 .97422 lineto .63736 .98077 lineto fill grestore gsave 0.001 setlinewidth .63346 .98077 moveto .63081 .97422 lineto stroke grestore gsave .541 setgray .63736 .91209 moveto .70604 .98077 lineto .70604 .91209 lineto fill grestore gsave .541 setgray .63736 .98077 moveto .63736 .91209 lineto .70604 .98077 lineto fill grestore gsave .541 setgray .77473 .98077 moveto .70604 .91209 lineto .77473 .91209 lineto fill grestore gsave .541 setgray .70604 .98077 moveto .77473 .98077 lineto .70604 .91209 lineto fill grestore gsave .541 setgray .84341 .98077 moveto .77473 .91209 lineto .84341 .91209 lineto fill grestore gsave .541 setgray .77473 .98077 moveto .84341 .98077 lineto .77473 .91209 lineto fill grestore gsave .541 setgray .91209 .98077 moveto .91209 .91209 lineto .84341 .91209 lineto fill grestore gsave .541 setgray .91209 .98077 moveto .84341 .98077 lineto .84341 .91209 lineto fill grestore gsave .541 setgray .98077 .98077 moveto .98077 .91209 lineto .91209 .91209 lineto fill grestore gsave .541 setgray .98077 .98077 moveto .91209 .98077 lineto .91209 .91209 lineto fill grestore grestore % End of Graphics MathPictureEnd end showpage %%EndDocument endTexFig eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF