(original) (raw)
%!PS-Adobe-2.0 %%Creator: dvipsk 5.58c Copyright 1986, 1994 Radical Eye Software %%Title: paper.dvi %%Pages: 19 %%PageOrder: Ascend %%BoundingBox: 0 0 612 792 %%EndComments %DVIPSCommandLine: dvips paper.dvi %DVIPSParameters: dpi=300, compressed, comments removed %DVIPSSource: TeX output 1998.11.28:1005 %%BeginProcSet: texc.pro /TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} forall round exch round exch]setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ /nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ /sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ 128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff .1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N /cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add /gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{ dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1 adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2 idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg} {adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{ adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{] }if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin 0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict /eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley X /rulex X V}B /V {}B /RV statusdict begin /product where{pop product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval(NeXT)eq or}{pop false} ifelse}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail {dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ 4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B /eos{SS restore}B end %%EndProcSet %%BeginProcSet: special.pro TeXDict begin /SDict 200 dict N SDict begin /@SpecialDefaults{/hs 612 N /vs 792 N /ho 0 N /vo 0 N /hsc 1 N /vsc 1 N /ang 0 N /CLIP 0 N /rwiSeen false N /rhiSeen false N /letter{}N /note{}N /a4{}N /legal{}N}B /@scaleunit 100 N /@hscale{@scaleunit div /hsc X}B /@vscale{@scaleunit div /vsc X}B /@hsize{/hs X /CLIP 1 N}B /@vsize{/vs X /CLIP 1 N}B /@clip{ /CLIP 2 N}B /@hoffset{/ho X}B /@voffset{/vo X}B /@angle{/ang X}B /@rwi{ 10 div /rwi X /rwiSeen true N}B /@rhi{10 div /rhi X /rhiSeen true N}B /@llx{/llx X}B /@lly{/lly X}B /@urx{/urx X}B /@ury{/ury X}B /magscale true def end /@MacSetUp{userdict /md known{userdict /md get type /dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N /note{}N /legal{} N /od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{itransform lineto} }{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{ itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{ closepath}}pathforall newpath counttomark array astore /gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}if}N /txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N /cp {pop pop showpage pm restore}N end}if}if}N /normalscale{Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale}if 0 setgray} N /psfts{S 65781.76 div N}N /startTexFig{/psf$SavedState save N userdict maxlength dict begin /magscale true def normalscale currentpoint TR /psf$ury psfts /psf$urx psfts /psf$lly psfts /psf$llx psfts /psf$y psfts /psf$x psfts currentpoint /psf$cy X /psf$cx X /psf$sx psf$x psf$urx psf$llx sub div N /psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR /showpage{}N /erasepage{}N /copypage{}N /p 3 def @MacSetUp}N /doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N /endTexFig{end psf$SavedState restore}N /@beginspecial{SDict begin /SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count /ocount X /dcount countdictstack N}N /@setspecial {CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if /showpage{}N /erasepage{}N /copypage{}N newpath }N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{ end}repeat grestore SpecialSave restore end}N /@defspecial{SDict begin} N /@fedspecial{end}B /li{lineto}B /rl{rlineto}B /rc{rcurveto}B /np{ /SaveX currentpoint /SaveY X N 1 setlinecap newpath}N /st{stroke SaveX SaveY moveto}N /fil{fill SaveX SaveY moveto}N /ellipse{/endangle X /startangle X /yrad X /xrad X /savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet TeXDict begin 40258431 52099146 1000 300 300 (paper.dvi) @start /Fa 10 58 df<13FE3807FFC0380F83E0381F01F0383E00F8A248137CA312FC14 7EAD007C137CA36C13F8A2381F01F0380F83E03807FFC03800FE0017207E9F1C>48 D<13181378EA01F812FFA21201B3A7387FFFE0A213207C9F1C>II<13FE3807FFC0380F07E0381E03F0123FEB81F8A3EA1F0314F0120014E0EB07C0 EB1F803801FE007F380007C0EB01F014F8EB00FCA2003C13FE127EB4FCA314FCEA7E0100 7813F8381E07F0380FFFC03801FE0017207E9F1C>I<14E013011303A21307130F131FA2 1337137713E7EA01C71387EA03071207120E120C12181238127012E0B512FEA2380007E0 A7EBFFFEA217207E9F1C>I<00101320381E01E0381FFFC0148014005B13F8EA1BC00018 C7FCA4EA19FCEA1FFF381E0FC0381807E01303000013F0A214F8A21238127C12FEA200FC 13F0A2387007E0003013C0381C1F80380FFF00EA03F815207D9F1C>II<12601278387FFFFEA214FC14F8A214F038E0006014C038C0 0180EB0300A2EA00065B131C131813381378A25BA31201A31203A76C5A17227DA11C>I< 13FE3803FFC0380703E0380E00F05A1478123C123E123F1380EBE0F0381FF9E0EBFFC06C 13806C13C06C13E04813F0381E7FF8383C1FFCEA7807EB01FEEAF000143E141EA2141C7E 007813387E381F01F0380FFFC00001130017207E9F1C>II E /Fb 2 51 df<120C123C12CC120CACEAFF8009107E8F0F>49 D<121FEA6180EA40C0EA806012C01200A213C0EA0180EA030012065AEA10201220EA7FC0 12FF0B107F8F0F>I E /Fc 4 107 df22 D<123E12065AA45AEA19E0EA1E30121812381230 A3EA6060136413C4A2EAC0C813700E147E9313>104 D<1206120712061200A41238124C A2128C12981218A2123012321262A21264123808147F930C>I<1360137013601300A4EA 0380EA04C01360EA08C0A21200A2EA0180A4EA0300A4126612E65A12780C1A81930E>I E /Fd 7 117 df<3801803000031370A3380700E0A4380E01C0A4381C0388A3EA1E0738 3E1990383BE0E00038C7FCA25AA45AA25A151B7F9119>22 D<1310A3EB1F8013F03801CF 00EA038048C7FC120EA6EA06FCEA0384EA06FC0008C7FC12185A12201260A212E0A31270 127CEA3F80EA1FE0EA07F8C67E133E130CA2EA0108EA00F01125809C12>24 D<3801FFF85A000F13F0381E1E00EA180EEA38061270A2EAE00EA3130C131C13185BEA60 606C5A001FC7FC15127E9118>27 D<380FFFE05A4813C03860C0001240485A12001201A3 48C7FCA35AA3120E120613127E9112>I<126012F0A2126004047C830C>58 D<3AFFC1FFC1FF3A1C003C003C021C13101620143C027C1340145C029C1380A29039011C 0100A2010213025D130401085B121ED80E105BA2496C5A1560014013405D1380260F000F C7FCA2000E130EA2000C130C1408281D7D9B27>87 D<13C01201A3EA0380A4EAFFF0EA07 00A3120EA45AA4EA3820A21340A2EA1880EA0F000C1A80990F>116 D E /Fe 28 122 df<49B4FC011F13C090387F81E0EBFC013901F807F01203EA07F0A4EC 01C091C8FCA3EC3FF8B6FCA33807F003B3A33A7FFF3FFF80A3212A7FA925>12 D<121C127FA2EAFF80A3EA7F00A2121C09097B8813>46 D<130E131E137EEA07FE12FFA2 12F81200B3AB387FFFFEA317277BA622>49 DII<140E141E143E147E14FEA213011303EB077E130EA2131C1338137013E0 A2EA01C0EA0380EA0700120EA25A5A5A5AB612F8A3C7EAFE00A890387FFFF8A31D277EA6 22>I65 D77 D<3803FF80000F13F0381F01FC383F80FE147F801580EA1F00C7FCA4EB3FFF3801FC3FEA 0FE0EA1F80EA3F00127E5AA4145F007E13DF393F839FFC381FFE0F3803F8031E1B7E9A21 >97 D99 DII<90387F80F03901FFE3F83907C0FE1C390F807C7C381F003E151048 EB3F00A66C133EA26C6C5A6C6C5A3805FFE0380C7F8048C8FC121CA2121E381FFFF814FF 6C14C06C14E06C14F0120F383E000748EB01F8481300A4007CEB01F0A2003FEB07E0390F C01F806CB5120038007FF01E287E9A22>103 D<1207EA0FC0EA1FE0123FA3121FEA0FC0 EA0700C7FCA7EAFFE0A3120FB3A3EAFFFEA30F2B7EAA12>105 D107 DI<26FFC07FEB1FC0903AC1FFC07FF0903A C307E0C1F8D80FC49038F101FC9039C803F20001D801FE7F01D05BA201E05BB03CFFFE3F FF8FFFE0A3331B7D9A38>I<38FFC07E9038C1FF809038C30FC0D80FC413E0EBC80701D8 13F013D0A213E0B039FFFE3FFFA3201B7D9A25>II<38FFE1FE9038E7FF80 9038FE0FE0390FF803F09038F001F801E013FC140015FEA2157FA8157E15FEA215FC1401 01F013F89038F803F09038FC0FE09038EFFF809038E1FC0001E0C7FCA9EAFFFEA320277E 9A25>I<90383F80703901FFE0F03803F071380FC019381F800F123FEB00075AA2127E12 FEA8127FA27E1380001F130F380FC01F3807F0773801FFE738007F87EB0007A9EC7FFFA3 20277E9A23>I<38FFC3E0EBC7F8EBCC7C380FD8FE13D0A213F0EBE07C1400B0B5FCA317 1B7E9A1B>I<3803FE30380FFFF0EA3E03EA7800127000F01370A27E00FE1300EAFFE06C B4FC14C06C13E06C13F0000713F8C6FCEB07FC130000E0137C143C7E14387E6C137038FF 01E038E7FFC000C11300161B7E9A1B>I<1370A413F0A312011203A21207381FFFE0B5FC A23807F000AD1470A7000313E03801F8C0EA00FFEB3F0014267FA51A>I<39FFE07FF0A3 000F1307B2140FA2000713173903F067FF3801FFC738007F87201B7D9A25>I<39FFFE07 FFA33907F000E0A2EBF801000314C0A23901FC0380A2EBFE07000014006D5AEB7F0EA2EB 3F9CA214FC6D5AA26D5AA36D5AA26D5AA2201B7F9A23>I<3BFFFC7FFC1FFCA33B0FE00F E001C02607F007EB0380A201F8EBF0070003160015F82601FC0F130EA29039FE1FFC1E00 00011C131C15FE9039FF387E3C017F1438EC787F6D486C5AA29138E01FF0011F5CA26D48 6C5AA36D486C5AA22E1B7F9A31>I<39FFFE07FFA33907F000E0A2EBF801000314C0A239 01FC0380A2EBFE07000014006D5AEB7F0EA2EB3F9CA214FC6D5AA26D5AA213075CA26D5A A25CA21307003890C7FC127CEAFE0EA25B5BEA7C70EA3FE0EA0F8020277F9A23>121 D E /Ff 47 123 df<1303A2497EA2497E130BEB13E01311EB21F01320497E1478EB807C 143C3801003E141E0002131F8048148014074814C014034814E0140148EB00F0A2007FB5 12F8B612FCA21E1D7E9C23>1 D<137E3801C180EA0301380703C0120EEB018090C7FCA5 B512C0EA0E01B0387F87F8151D809C17>12 D<13401380EA0100120212065AA25AA25AA2 12701260A312E0AC1260A312701230A27EA27EA27E12027EEA008013400A2A7D9E10>40 D<7E12407E7E12187EA27EA27EA213801201A313C0AC1380A312031300A21206A25AA25A 12105A5A5A0A2A7E9E10>I<126012F0A212701210A41220A212401280040C7C830C>44 DI<126012F0A2126004047C830C>I48 D<12035A123F12C71207B3A4EA0F80EAFFF80D1C7C9B15>II53 D<13F0EA030CEA0604EA0C0EEA181E1230 130CEA7000A21260EAE3E0EAE430EAE818EAF00C130EEAE0061307A51260A2EA7006EA30 0E130CEA1818EA0C30EA03E0101D7E9B15>I56 DI<007FB512C0B612E0C9FCA8B612E0 6C14C01B0C7E8F20>61 D69 DI<90381F8080EBE0613801801938070007000E13035A14015A00 781300A2127000F01400A6ECFFF0EC0F80007013071278A212387EA27E6C130B38018011 3800E06090381F80001C1E7E9C21>I77 D79 D<3807E080EA1C19EA3005EA7003EA 600112E01300A36C13007E127CEA7FC0EA3FF8EA1FFEEA07FFC61380130FEB07C0130313 011280A300C01380A238E00300EAD002EACC0CEA83F8121E7E9C17>83 D<007FB512C038700F010060130000401440A200C014201280A300001400B1497E3803FF FC1B1C7F9B1E>I97 D<12FC121CAA137CEA1D86EA1E03 381C018014C0130014E0A614C013011480381E0300EA1906EA10F8131D7F9C17>II<133F1307AAEA03E7EA0C17EA180F487E1270126012E0A61260127012306C5A EA0C373807C7E0131D7E9C17>II<13F8EA018CEA071E 1206EA0E0C1300A6EAFFE0EA0E00B0EA7FE00F1D809C0D>II<12FC12 1CAA137C1387EA1D03001E1380121CAD38FF9FF0141D7F9C17>I<1218123CA21218C7FC A712FC121CB0EAFF80091D7F9C0C>I<12FC121CAAEB3FC0EB0F00130C13085B5B5B13E0 121DEA1E70EA1C781338133C131C7F130F148038FF9FE0131D7F9C16>107 D<12FC121CB3A9EAFF80091D7F9C0C>I<39FC7E07E0391C838838391D019018001EEBE0 1C001C13C0AD3AFF8FF8FF8021127F9124>IIIIIII<1204A4120CA2121C123CEAFFE0EA1C 00A91310A5120CEA0E20EA03C00C1A7F9910>I<38FC1F80EA1C03AD1307120CEA0E1B38 03E3F014127F9117>I<38FF07E0383C0380381C0100A2EA0E02A26C5AA3EA0388A213D8 EA01D0A2EA00E0A3134013127F9116>I<39FF3FCFE0393C0F0380381C07011500130B00 0E1382A21311000713C4A213203803A0E8A2EBC06800011370A2EB8030000013201B127F 911E>I<387F8FF0380F03801400EA0702EA0384EA01C813D8EA00F01370137813F8139C EA010E1202EA060738040380381E07C038FF0FF81512809116>I<38FF07E0383C038038 1C0100A2EA0E02A26C5AA3EA0388A213D8EA01D0A2EA00E0A31340A25BA212F000F1C7FC 12F31266123C131A7F9116>II E /Fg 3 52 df<120C121C12EC120CAFEAFFC00A137D9211>49 D<121FEA60C01360EAF0 7013301260EA0070A2136013C012011380EA02005AEA08101210EA2020EA7FE012FF0C13 7E9211>II E /Fh 2 107 df<1204120C1200A5127012 581298A21230A212601264A21268123006127E910B>105 D<1320A21300A5EA0380EA04 C01208A21200EA0180A4EA0300A4124612CC12780B1780910D>I E /Fi 5 106 df0 D<390F8007C03919E01C2039207030103940 18400839C00C8004EA80071400EB03801307903804C00C394008600839203038103910E0 1E60390F8007C01E0E7E8D23>49 D<3801FF801207000EC7FC12185A5AA35AA2B51280A2 00C0C7FCA21260A37E7E120E3807FF80120111167D9218>I<120112031206A3120CA312 18A21230A31260A312C0A21260A31230A31218A2120CA31206A31203120108227D980E> 104 D<12C0A21260A31230A31218A2120CA31206A31203A21206A3120CA31218A21230A3 1260A312C0A208227E980E>I E /Fj 7 52 df<120112021204120C1218A21230A21270 1260A312E0AA1260A312701230A21218A2120C12041202120108227D980E>40 D<12801240122012301218A2120CA2120E1206A31207AA1206A3120E120CA21218A21230 12201240128008227E980E>I<1330ABB512FCA238003000AB16187E931B>43 D48 D<12035AB4FC1207B1EA7FF00C157E9412>III E /Fk 22 112 df<1306130C131813301370136013C012011380120313005A1206120E12 0C121CA212181238A312301270A65AB21270A612301238A31218121CA2120C120E120612 077E1380120113C012001360137013301318130C13060F4A788119>16 D<12C012607E7E121C120C7E12077E1380120113C0120013E013601370A213301338A313 18131CA6130EB2131CA613181338A313301370A2136013E013C012011380120313005A12 065A121C12185A5A5A0F4A7F8119>I20 DI<1470EB01F0EB03C0EB 0780EB0E005B5B5BA213F05BB3AC485AA3485A48C7FC1206120E12385A12C012707E120E 120612076C7E6C7EA36C7EB3AC7F1370A27F7F7FEB0780EB03C0EB01F0EB007014637B81 1F>26 D<12E07E127C121E7E7E6C7E6C7EA26C7EB3AD1370A27FA27F7F7FEB03C0EB00F0 147014E0EB03C0EB0700130E5B5BA25BA25BB3AD485AA2485A48C7FC5A121E127C12F05A 14637B811F>I34 DI50 DI<12E0B3B3B3B1EAFFFC A30E4A73811C>I<131CB3B3B3B1EAFFFCA30E4A80811C>I68 D<12C0A27E126012701230A212381218121C120C120E12 06A212077E7F12017F1200A27F136013701330A213381318131C130C130E1306A213077F 14801301A2130314005B1306A2130E130C131C131813381330A21370136013E05BA21201 5B120390C7FC5A1206A2120E120C121C121812381230A21270126012E05AA2114A7D8119 >I80 D88 DII<12FFA212C0B3B3B3B012FFA2084A768114>104 D<12FFA21203B3B3B3B012FFA2084A 7F8114>I<14E01303EB0F80EB1E005B1370A25BB3A5485AA2485A48C7FC120E123C12F0 A2123C120E7E6C7E6C7EA26C7EB3A51370A2133C7FEB0F80EB03E01300134A7C811C> 110 D<12E012F8123E120F6C7EEA01C0A26C7EB3A51370A27F7F7FEB0780EB01E0A2EB07 80EB0E005B5B5BA25BB3A5485AA2EA078048C7FC123E12F812E0134A7C811C>I E /Fl 16 113 df0 D<127012F8A3127005057C8E0E>I<6C1302 6C13060060130C6C13186C13306C13606C13C03803018038018300EA00C6136C1338A213 6C13C6EA018338030180380600C048136048133048131848130C48130648130217187897 27>I<150C153C15F0EC03C0EC0F00143C14F0EB07C0011FC7FC1378EA01E0EA0780001E C8FC127812E01278121EEA0780EA01E0EA0078131FEB07C0EB00F0143C140FEC03C0EC00 F0153C150C1500A8007FB512F8B612FC1E277C9F27>20 D<12C012F0123C120FEA03C0EA 00F0133CEB0F80EB03E0EB0078141EEC0780EC01E0EC0078151C1578EC01E0EC0780EC1E 001478EB03E0EB0F80013CC7FC13F0EA03C0000FC8FC123C127012C0C9FCA8007FB512F8 B612FC1E277C9F27>I25 D<166082A282A28282EE0380B812E017C0C9EA0380EE06005E5EA25EA25E2B127D9432> 33 D47 D49 DI<130F1338137013E0EA01C0B1EA0380EA0700121E12F0121E1207EA0380EA 01C0B1EA00E013701338130F10317CA419>102 D<12F0121E1207EA0380EA01C0B1EA00 E013701338130F1338137013E0EA01C0B1EA0380EA0700121E12F010317CA419>I<1340 13C0A2EA0180A3EA0300A31206A25AA35AA35AA35AA35AA41260A37EA37EA37EA37EA27E A3EA0180A3EA00C0A213400A327BA413>I<12C0A31260A37EA37EA27EA37EA37EA3EA01 80A3EA00C0A4EA0180A3EA0300A31206A35AA35AA25AA35AA35AA30A327DA413>I<12C0 B3B3AD02317AA40E>I<160116031606A2160CA21618A21630A21660A216C0A2ED0180A2 ED0300A21506A25DA25DA25D1206001E5C122F004F5CEA87800007495AEA03C04AC7FCA2 3801E006A26C6C5AA2EB7818A26D5AA26D5AA26D5AA26D5AA26DC8FCA228327D812A> 112 D E /Fm 14 123 df14 D22 D<13401380A213F8EA0378EA0C005AA5EA0FE0A2EA18005A5AA25AA37E127012 3CEA1F80EA03E0EA00701330EA0420EA03C00D1D7F9610>24 D<130813181330A31360A3 13C0A3EA0180A3EA0300A21206A35AA35AA35AA35AA35AA20D217E9812>61 D<3907FE1FF83900E00380A43901C00700A43803800EA2EBFFFEEB800E48485AA4000E5B A4485B38FF83FE1D177F961D>72 D83 D<3AFF83FC1FC03A1C00E007001506150401015B13025D13 04EC702001085BA2D81E105BEA0E200271C7FC13401472EB8074120FEB0078120E147012 0C142022177E9621>87 D<13301348138812011308EA0310120212061320EA0C40A21380 EA0D00121AA2121C1218A212781288EA0810EA0460EA03800D1780960E>96 D<121F1206A45AA4EA18F0EA1B18EA1C081218EA38181230A213301260133113611362EA C022133C10177E9614>104 D<120313801300C7FCA6121C12241246A25A120C5AA31231 A21232A2121C09177F960C>I<1318133813101300A6EA01C0EA0220EA0430A2EA086012 00A313C0A4EA0180A4EA630012E312C612780D1D80960E>I<121F1206A45AA4EA181C13 66138EEA190CEA3200123C123FEA3180EA60C013C4A213C812C013700F177E9612>I<12 3E120CA41218A41230A41260A412C012C8A312D0127007177E960B>I122 D E /Fn 33 123 df14 D22 D<13045BA3EB0FE0EB3C20EB73E0EBE000485A1203485AA390C7FCA37F EA03BFEA01C1EA037E0006C7FC5A5A1210123012201260A312E0A212601270127C123FEA 1FE0EA07F8EA01FEEA003F130F7F7FEA0206EA0184EA0078132D7FA215>24 D<0007B5FC121F5A383041001240128013C3EA0082A21201A21306120313071207120612 0EA2381C0380A20018130018157E941C>I<90387FFF8048B5FC5A390783C000EA0E0148 6C7E5AA25AA348485AA3495A91C7FCEA6007130EEA3018EA1870EA07C019157E941C>27 D<3807FFF8121F5A383020001240128013601200A25BA412015BA21203A348C7FC7E1515 7E9415>I<127012F8A3127005057C840E>58 D<127012F812FCA212741204A41208A212 10A212201240060F7C840E>I<15181578EC01E0EC0780EC1E001478EB03E0EB0F80013C C7FC13F0EA03C0000FC8FC123C12F0A2123C120FEA03C0EA00F0133CEB0F80EB03E0EB00 78141EEC0780EC01E0EC007815181D1C7C9926>I<14801301A2EB0300A31306A35BA35B A35BA35BA35BA3485AA448C7FCA31206A35AA35AA35AA35AA35AA311317DA418>I64 D<017FB512C0903807800315 00A249C7FCA21680A2131EA2158016004948C7FCA25C5CEB7FFEEB7806A3EBF004A25DEC 0002485AA25D150C4848130815185D15700007EB03F0B65A22227EA124>69 D<90397FFC1FFF9039078001E0A390390F0003C0A4011EEB0780A449EB0F00A490387FFF FE903878001EA3495BA448485BA448485BA40007130139FFFC3FFF28227EA128>72 D<90397FFC01FF903907800078166016C090390F000180ED02005D5D011E5B15405D4AC7 FCEB3C025C141E143EEB785F148FEB7A0F90387C078013F801F07F1403A248486C7EA36E 7E485A811578A2000714FC3AFFFC07FF8028227EA129>75 DI<90397FC003FF0107EB00781660D905E0132001091440A2EB08F0A2 496C13801478A2800120EB0100143E141EA29038400F02A3EC07820180138415C41403A2 39010001E8A215F8140000025C1570A21206000F1420EAFFE028227EA127>78 D<90387FFFF0903807801C150F8190390F000380A4011E1307A3ED0F005B151E5D157049 485AD97FFFC7FC0178C8FCA25BA4485AA4485AA41207EAFFFC21227EA11F>80 D<147F90380381C090380E0060013813385B49131C4848131E4848130E48C7FC48140F12 0E121E5AA25AA348141EA3151C153C5A1578A215F015E06C130190381E03C0D870211380 39784087000038138E001C13B8000E13F03907C1C0203800FE8013000101134015C0ECC0 8014C3ECFF007F5C1478202D7DA227>I<903803F01090380E0C20903818026090382001 E0EB400001C013C05B1201A200031480A21500A27FEA01F013FE3800FFE06D7EEB1FF8EB 01FCEB003C141C80A30020130CA3140800601318141000705B5C00C85BD8C603C7FCEA81 FC1C247DA21E>83 D86 D<3BFFF03FFC03FF3B1F8007E000786C486C481360 A217401780A20207EB0100A2020B1302A202135B02235BA202435B018013E0000701815B A2D981015B018314C001825C018401E1C7FCA2018813E2A2019013E4A201A013E801C013 F0A201805B120390C75AA200025C30237DA12E>I<133FEBE080380380C0EA0701EA0E03 121C003CC7FCA25AA35AA400701340A23830018038380200EA1C1CEA07E012157E9415> 99 D<141EEB01FCEB001CA31438A41470A414E01378EA01C4EA0302380601C0120E121C 123C383803801278A338F00700A31408EB0E101270131E38302620EA18C6380F01C01723 7EA219>I<137CEA0382EA0701120E121C1238EA7802EA7004EAFFF800F0C7FCA25AA414 80A238700300EA3004EA1838EA0FC011157D9417>I103 D<13F0EA0FE01200A3485A A4485AA448C7FC131FEB2180EBC0C0380F00E0A2120EA2381C01C0A438380380A2EB0700 140400701308130EA2EB061000E01320386003C016237DA21C>I<13E0A21201EA00C013 00A9121E1223EA4380A21283A2EA87001207120EA35AA25A132013401270A2EA3080EA31 00121E0B227EA111>I<14E01301A2EB00C01400A9131E1323EB43801383EA0103A33800 0700A4130EA45BA45BA45BA3EA70E0EAF0C0EAF1800063C7FC123E132C81A114>I<13F0 EA0FE01200A3485AA4485AA448C7FC14F0EB0308EB0438380E08781310EB2030EB400048 5A001FC7FC13C0EA1C70487EA27F141038703820A3EB184038E00C803860070015237DA2 19>I<136013E0A4EA01C0A4EA0380EAFFFCEA0380A2EA0700A4120EA45AA31308EA3810 A21320121813C0EA07000E1F7F9E12>116 D<3801E0F03806310C38081A1C0010133CEA 201C14181400C65AA45BA314083860E01012F0142038E1704038423080383C1F0016157E 941C>120 D<001E133000231370EA438014E01283A2EA8700380701C0120EA3381C0380 A4EB0700A35BEA0C3EEA03CEEA000EA25B1260EAF0381330485AEA80C0EA4180003EC7FC 141F7E9418>II E /Fo 49 123 df12 D<120E121EA41202A21204A21208A21210122012401280070F7D840F>44 DI<13011303A21306131E132EEA03CEEA001CA41338A413 70A413E0A4EA01C0A4EA0380A41207EAFFFC10217AA019>49 D51 D54 D<1207EA0F80A21300120EC7FCAB1270 12F8A25A5A09157A940F>58 D<1403A25CA25CA25C142FA2144F15801487A2EB01071302 A21304A21308A2131013301320EB7FFF90384007C013801403EA01005A12025AA2120C00 3C1307B4EB3FFC1E237DA224>65 D<90B512E090380F0038151C151E011E130E150FA349 130E151EA2153C49137815F0EC01E0EC078090B5FC9038F001E0EC00F01578485A153815 3CA248481378A315F0485AEC01E0EC03C0EC0700000F131EB512F020227DA122>I<027F 138090390380810090380E00630138132749131F49130E485A485A48C7FC481404120E12 1E5A5D4891C7FCA35AA55A1520A25DA26C5C12704AC7FC6C130200185B001C5B00061330 380381C0D800FEC8FC212479A223>I<90B6128090380F00071501A2131EA21600A25BA2 140192C7FCEB7802A21406140EEBFFFCEBF00CA33801E008A21504EC0008485AA25DA248 485B15605D1401000F1307B65A21227DA121>69 D<90B6FC90380F000F1503A2131EA215 02A25BA214011500EB7802A21406140EEBFFFCEBF00CA33801E008A391C7FC485AA4485A A4120FEAFFFC20227DA120>I<027F138090390380810090380E00630138132749131F49 130E485A485A48C7FC481404120E121E5A5D4891C7FCA35AA4EC3FFC48EB01E0A34A5AA2 7E12704A5A7E0018130F001C131300060123C7FC380381C1D800FEC8FC212479A226>I< EBFFF8EB0F00A3131EA45BA45BA45BA4485AA4485AA4485AA4120FEAFFF815227DA113> 73 D<903807FFC09038003C00A35CA45CA4495AA4495AA4495AA449C7FCA212381278EA F81EA2485AEA40385BEA21E0EA1F801A237CA11A>I76 DI<01FFEB0FFC90390F8001E01680ECC0000113EB0100A2EB11E0A201211302EB20F0 A39038407804A3143C01805B143E141EA23901001F10140FA2EC0790000214A0A2EC03E0 A2485C1401A2120C001E6D5AEAFFC026227DA124>I<90B512E090380F0038151E150E01 1E1307A449130FA3151E5B153C157815E09038F003C09038FFFE0001F0C7FCA2485AA448 5AA4485AA4120FEAFFF820227DA121>80 D<90B512C090380F0070153C151C011E130EA2 150FA249131EA3153C4913381570EC01E0EC07809038FFFC00EBF00E80EC0380D801E013 C0A43903C00780A43907800F001501A2EC0702120F39FFF8038CC812F020237DA124>82 D<903801F02090380E0C4090381802C0EB3001136001E0138013C01201A200031400A291 C7FCA27FEA01F813FF6C13E06D7EEB1FF8EB03FCEB007C143C80A30020131CA314180060 1338143000705B5C38C80180D8C607C7FCEA81FC1B247DA21B>I<001FB512F8391E03C0 3800181418123038200780A200401410A2EB0F001280A200001400131EA45BA45BA45BA4 485AA41203B5FC1D2277A123>I<393FFE03FF3903C000781560152048481340A448C712 80A4001EEB0100A4481302A4485BA400705B12F05C12705C5C123038380180D81802C7FC EA0E0CEA03F0202377A124>I<3BFFF03FF80FF83B1F0007C003C0001E91388001801700 1602140F5E001F13175E6C13275E144702C75B1487D901075B16C001025C0381C7FC1304 15C21308EC03C4131015C8132015D0134001C013E0138001005B5D120E92C8FC120C1402 2D2376A131>87 D97 DI<137EEA01C13803 0180EA0703EA0E07121C003CC7FC12381278A35AA45B12701302EA300CEA1830EA0FC011 157B9416>I<143CEB03F8EB0038A31470A414E0A4EB01C013F9EA0185EA0705380E0380 A2121C123C383807001278A3EAF00EA31410EB1C201270133C38305C40138C380F078016 237BA219>I<13F8EA0384EA0E02121C123C1238EA7804EAF018EAFFE0EAF000A25AA413 02A2EA6004EA7018EA3060EA0F800F157A9416>I<143E144714CFEB018F1486EB0380A3 EB0700A5130EEBFFF0EB0E00A35BA55BA55BA55BA45B1201A2EA718012F100F3C7FC1262 123C182D82A20F>II<13F0EA0FE01200A3485AA4485AA448C7FC131FEB2180EBC0C0380F00 E0A2120EA2381C01C0A438380380A3EB070400701308130E1410130600E01320386003C0 16237DA219>I<13C0EA01E013C0A2C7FCA8121C12231243A25AA3120EA25AA35AA21340 EA7080A3EA71001232121C0B217BA00F>I<13F0EA0FE01200A3485AA4485AA448C7FCEB 01E0EB0210EB0C70380E10F0A2EB2060EB4000EA1D80001EC7FCEA1FC0EA1C70487EA27F 142038703840A3EB188012E038600F0014237DA216>107 DI<391C0F80F8 392610C10C39476066063987807807A2EB0070A2000EEBE00EA44848485AA3ED38202638 038013401570168015303A7007003100D83003131E23157B9428>II<137EEA01C338038180380701C0120E001C13E0123C123812 78A338F003C0A21480130700701300130E130CEA3018EA1870EA07C013157B9419>I<38 01C1F0380262183804741C3808780CEB700EA2141EEA00E0A43801C03CA3147838038070 A2EBC0E0EBC1C038072380EB1E0090C7FCA2120EA45AA3EAFFC0171F7F9419>III<13FCEA018338020080EA0401EA 0C03140090C7FC120F13F0EA07FC6C7EEA003E130F7F1270EAF006A2EAE004EA4008EA20 30EA1FC011157D9414>I<13C01201A4EA0380A4EA0700EAFFF8EA0700A2120EA45AA45A A31310EA7020A213401380EA3100121E0D1F7C9E10>I<001E1360002313E0EA4380EB81 C01283EA8701A238070380120EA3381C0700A31408EB0E101218121CEB1E20EA0C263807 C3C015157B941A>I<381E0380382307C0EA43871383EA8381EA8700A200071380120EA3 381C0100A31302A25B5BA2EA0C30EA03C012157B9416>I<001EEB60E00023EBE1F0EA43 80EB81C000831470D887011330A23907038020120EA3391C070040A31580A2EC0100130F 000C13023806138C3803E0F01C157B9420>I<3803C1E0380462103808347038103CF0EA 203814601400C65AA45BA314203861C04012F1148038E2C100EA4462EA383C14157D9416 >I<001E133000231370EA438014E01283EA8700A2380701C0120EA3381C0380A4EB0700 A35BEA0C3EEA03CEEA000EA25B1260EAF0381330485AEA80C0EA4380003EC7FC141F7B94 18>I<3801E0203803F0603807F8C038041F80380801001302C65A5B5B5B5B5B48C7FC12 0248138038080100485AEA3F06EA61FCEA40F8EA807013157D9414>I E /Fp 86 127 df<1460A214F0A2497E1478EB027C143CEB043E141EEB081F8001107F14 0701207F140301407F140101807F140048C77E15780002147C153C48143E151E48141F81 48158015074815C01503007FB612E0A2B712F024237EA229>1 D<90381F83E09038706E 309038C07C78380180F8000313F03907007000A9B612C03907007000B21478397FE3FF80 1D2380A21C>11 DII<90380FC07F90397031C0809039 E00B00402601801E13E00003EB3E013807003C91381C00C01600A7B712E03907001C0115 00B23A7FF1FFCFFE272380A229>I34 D37 D<133C136213C2EA0181A21203A41382A213841388EA01C813D09039E003FF809039 C0007C006C6C1338000114306D1320D802705B1204486C5BEA183C26301C01C7FC38701E 02130E38F0070414881303903801D001EB00E00078EB70030038EBB802393C031C04390E 0C0E0C3903F003F021257EA326>I<127012F812FCA212741204A41208A21210A2122012 40060F7CA20E>I<132013401380EA01005A12061204120CA25AA25AA312701260A312E0 AE1260A312701230A37EA27EA2120412067E7EEA0080134013200B327CA413>I<7E1240 7E7E12187E12041206A27EA2EA0180A313C01200A313E0AE13C0A312011380A3EA0300A2 1206A21204120C5A12105A5A5A0B327DA413>I<497EB0B612FEA23900018000B01F227D 9C26>43 D<127012F812FCA212741204A41208A21210A212201240060F7C840E>II<127012F8A3127005057C840E>I48 D<13801203120F12F31203B3A9EA07C0EAFFFE0F217CA018>III<13021306130EA2131EA2 132E134EA2138EA2EA010E1202A21204A212081210A21220A212401280B512F838000E00 A7131F3801FFF015217FA018>I<00101380381E0700EA1FFF5B13F8EA13E00010C7FCA6 13F8EA130EEA1407381803801210380001C0A214E0A4127012F0A200E013C01280EA4003 148038200700EA1006EA0C1CEA03F013227EA018>I<137EEA01C138030080380601C0EA 0E03121C381801800038C7FCA212781270A2EAF0F8EAF30CEAF4067F00F81380EB01C012 F014E0A51270A3003813C0A238180380001C1300EA0C06EA070CEA01F013227EA018>I< 12401260387FFFE014C0A23840008038C0010012801302A2485A5BA25B133013201360A3 13E05BA21201A41203A86C5A13237DA118>III<127012F8A312701200AB127012F8A3127005157C940E>I<1270 12F8A312701200AB127012F8A312781208A41210A312201240A2051F7C940E>I61 D63 D<497EA3497EA3EB05E0A2EB0DF01308A2497E1478A2497EA3497EA3497EA2 90B5FC3901000780A24814C000021303A24814E01401A2000CEB00F0A2003EEB01F839FF 800FFF20237EA225>65 DI<903807E0109038381830EBE0063901C0 017039038000F048C7FC000E1470121E001C1430123CA2007C14101278A200F81400A812 781510127C123CA2001C1420121E000E14407E6C6C13803901C001003800E002EB381CEB 07E01C247DA223>IIII<903807F00890383C0C18EBE0023901C001B839 038000F848C71278481438121E15185AA2007C14081278A200F81400A7EC1FFF0078EB00 F81578127C123CA27EA27E7E6C6C13B86C7E3900E0031890383C0C08903807F00020247D A226>I<39FFFC3FFF390FC003F039078001E0AE90B5FCEB8001AF390FC003F039FFFC3F FF20227EA125>II<3803FFF038 001F007FB3A6127012F8A2130EEAF01EEA401C6C5AEA1870EA07C014237EA119>I<39FF FC03FF390FC000F86C48136015405D4AC7FC14025C5C5C5C5C5C1381EB83C0EB87E01389 EB88F01390EBA078EBC03C13808080A26E7E8114036E7EA26E7E81486C7F3AFFFC07FF80 21227EA126>III<39FF8007FF3907C000F81570D805E01320EA04 F0A21378137C133C7F131F7FEB0780A2EB03C0EB01E0A2EB00F014F81478143C143E141E 140FA2EC07A0EC03E0A21401A21400000E1460121FD8FFE0132020227EA125>III82 D<3803F020380C0C60EA1802383001E0EA70000060136012E0A2 1420A36C1300A21278127FEA3FF0EA1FFE6C7E0003138038003FC0EB07E01301EB00F0A2 14707EA46C1360A26C13C07E38C8018038C60700EA81FC14247DA21B>I<007FB512F839 780780780060141800401408A300C0140C00801404A400001400B3A3497E0003B5FC1E22 7EA123>I<39FFFC07FF390FC000F86C4813701520B3A5000314407FA2000114806C7E90 38600100EB3006EB1C08EB03F020237EA125>II<3BFFF03F FC03FE3B1F8007E000F86C486C4813701720A26C6C6C6C1340A32703C002F01380A33B01 E004780100A33A00F0083C02A39039F8183E06903978101E04A2137C90393C200F08A390 391E400790A390390F8003E0A36D486C5AA36D5C010213002F237FA132>I89 D<387FFFFE387E003E0078133C007013781260004013F012C0EB01E0388003C0 A2EB07801200EB0F005B131E5BA25BA25B1201EBE001EA03C0A2EA07801403EA0F00001E 1302A2481306140E48131E00F8137EB512FE18227DA11E>I<12FEA212C0B3B3A912FEA2 07317BA40E>II<12FEA21206B3B3A912FEA207317FA40E>I<127012F8A3127005057C A10E>95 D97 D<120E12FE121E120EAB13 1FEB61C0EB8060380F0030000E1338143C141C141EA7141C143C1438000F1370380C8060 EB41C038083F0017237FA21B>II<14E0130F13 011300ABEA01F8EA0704EA0C02EA1C01EA38001278127012F0A7127012781238EA1801EA 0C0238070CF03801F0FE17237EA21B>II<133C13C6EA018F1203130FEA0700A9EAFFF8EA0700B21380EA7FF8102380A2 0F>I<14703801F19838071E18EA0E0E381C0700A2003C1380A4001C1300A2EA0E0EEA0F 1CEA19F00010C7FCA21218A2EA1FFE380FFFC014E0383800F0006013300040131812C0A3 00601330A2003813E0380E03803803FE0015217F9518>I<120E12FE121E120EABEB1F80 EB60C0EB80E0380F0070A2120EAF38FFE7FF18237FA21B>I<121C121E123E121E121CC7 FCA8120E12FE121E120EB1EAFFC00A227FA10E>II<120E12FE121E12 0EABEB03FCEB01F014C01480EB02005B5B5B133813F8EA0F1CEA0E1E130E7F1480EB03C0 130114E0EB00F014F838FFE3FE17237FA21A>I<120E12FE121E120EB3ADEAFFE00B237F A20E>I<390E1FC07F3AFE60E183803A1E807201C03A0F003C00E0A2000E1338AF3AFFE3 FF8FFE27157F942A>I<380E1F8038FE60C0381E80E0380F0070A2120EAF38FFE7FF1815 7F941B>III<3801F82038070460EA0E02EA1C01003813E0EA 7800A25AA712701278EA3801121CEA0C02EA070CEA01F0C7FCA9EB0FFE171F7E941A>I< EA0E3CEAFE46EA1E8FEA0F0F13061300120EAD120FEAFFF010157F9413>II<1202A41206A3120E121E123EEAFFF8EA0E 00AB1304A6EA07081203EA01F00E1F7F9E13>I<000E137038FE07F0EA1E00000E1370AD 14F0A238060170380382783800FC7F18157F941B>I<38FFC1FE381E0078000E13301420 A26C1340A238038080A33801C100A2EA00E2A31374A21338A3131017157F941A>I<39FF 8FF8FF391E01E03C001CEBC018120EECE010A239070260201470A239038430401438A239 01C81880141CA23900F00D00140FA2EB6006A320157F9423>I<38FF83FE381F01F0380E 00C06C1380380381001383EA01C2EA00E41378A21338133C134E138EEA0187EB03803802 01C0000413E0EA0C00383E01F038FF03FE17157F941A>I<38FFC1FE381E0078000E1330 1420A26C1340A238038080A33801C100A2EA00E2A31374A21338A31310A25BA35B12F05B 12F10043C7FC123C171F7F941A>I<383FFFC038380380EA300700201300EA600EEA401C 133C1338C65A5B12015B38038040EA07005A000E13C04813805AEA7801EA7007B5FC1215 7F9416>III126 D E /Fq 33 122 df12 D49 DII<157015F0140114031407 140FA2141F143F147714F714E7EB01C7EB0387EB0707130F130E131C1338137013F013E0 EA01C0EA0380EA07005A120E5A5A5A5AB712E0A3C7380FF000A9010FB512E0A3232E7EAD 28>I<000C1430390FC003F090B512E015C0158015005C14F85C1480000EC8FCA8EB1FF0 EB7FFE390FE03F809038800FC0390E0007E0000C14F0C713F8EC03FCA315FEA21218123E 127F5AA215FCA25A0078EB07F815F06CEB0FE06CEB1FC0390FC07F806CB51200000113FC 38003FE01F2E7CAD28>I<1578A215FCA34A7EA24A7EA24A7FA34A7FEC0E7F021E7FEC1C 3FA202387F151F02787FEC700FA202E07F1507010180ECC003A2D903807F8101078191C7 FCA249B67EA24981011CC7123F013C810138141FA24981160F01F081491407A248488148 6C1403B56C48B512FCA336317DB03D>65 D68 DI71 D73 D77 D80 D82 D97 DIIIII104 DI108 D<2703F007F8EB1FE000FFD93FFEEBFFF8913A783F01 E0FC02C090388300FE280FF1801FC6137F2607F30013CC01F602F8148001FC5CA3495CB3 B500C3B5380FFFFCA33E207D9F43>I<3903F007F800FFEB3FFEEC783F02C013803A0FF1 801FC03807F30001F614E013FCA35BB3B500C3B5FCA328207D9F2D>II<3901F83FE000FFEBFFFC9038FBE07F9039FF00 3F80D807FEEB1FC049EB0FE04914F0ED07F8A216FC1503A216FEA816FC1507A216F8A2ED 0FF06D14E06DEB1FC06DEB3F809039FBC0FE009038F8FFF8EC3FC091C8FCABB512C0A327 2E7E9F2D>I<3803F03F00FFEB7FC09038F1C3E01487390FF30FF0EA07F6A29038FC07E0 EC03C091C7FCA25BB2B512E0A31C207E9F21>114 D<3801FF86000713FEEA1F00003C13 3E48131E140E12F8A36C90C7FCB47E13FC387FFFC014F06C7F6C7F00077F00017FEA003F 01001380143F0060131F00E0130FA27E15007E6C131E6C131C38FF807838F3FFF038C07F 8019207D9F20>I<131CA5133CA3137CA213FC120112031207381FFFFEB5FCA2D803FCC7 FCB0EC0380A71201EC0700EA00FEEB7F0EEB3FFCEB07F0192E7FAD1F>II<3A7FFF807FFCA33A03FE000F000001141E6C6C5B6E5A EB7FC06D6C5A90381FE1E090380FF3C0ECFF806D90C7FC6D5A13016D7E81815B903803DF E09038078FF08190380F07FCEB1E03496C7E496C7E49148049EB7FC00001143F26FFFC01 B5FCA328207F9F2B>120 DI E /Fr 38 123 df<133FEBE0C0EA01C0 380381E0EA0701A290C7FCA6B512E0EA0700B2387FC3FE1720809F19>12 D<127012F812FCA212741204A31208A21210A212201240060E7C840D>44 DI<127012F8A3127005057C840D>I<5B497EA3497EA3EB09E0A3 EB10F0A3EB2078A3497EA3497EA2EBFFFE3801000FA30002EB0780A348EB03C0120E001F EB07E039FFC03FFE1F207F9F22>65 D<90380FC04090387030C03801C009380380053807 0003000E1301001E1300121C123C007C1440A2127800F81400A91278007C1440A2123C12 1C001E1480120E6CEB0100380380026C6C5A38007038EB0FC01A217D9F21>67 D70 D<90380FE02090387818609038E004E0380380023807000148 1300001E1460A25A1520127C127800F81400A7EC7FFCEC03E000781301127C123CA27EA2 7E7E380380023900E00460903878182090380FE0001E217D9F24>I<39FFF8FFF8390F80 0F8000071400AC90B5FCEB800FAE000F148039FFF8FFF81D1F7E9E22>I76 DI79 D<3BFFF07FF81FF03B1F80 0FC007C03B0F0007800380EE010015C0D807801402A33A03C009E004A39039E010F00C00 011508A29038F0207800005DA2EC403C01785CA2ECC03E90393C801E40A390391F000F80 A3011E1307010E91C7FCA2010C7F010413022C207F9E2F>87 D97 D<120E12FE120EAA133EEBC380380F01C0EB00E0120E1470A21478A614 70A214E0120F380D01C0380CC300EA083E15207F9F19>IIII<137C13C6EA018F1203EA0706 1300A7EAFFF0EA0700B2EA7FF01020809F0E>I<14E03803E330EA0E3CEA1C1C38380E00 EA780FA5EA380E6C5AEA1E38EA33E00020C7FCA21230A2EA3FFE381FFF806C13C0383001 E038600070481330A4006013606C13C0381C03803803FC00141F7F9417>I<120E12FE12 0EAA133E1343EB8180380F01C0A2120EAE38FFE7FC16207F9F19>I<121C121E123E121E 121CC7FCA6120E127E120EB1EAFFC00A1F809E0C>I<120E12FE120EAAEB0FF0EB03C014 0013025B5B5B1330137013F8EA0F38EA0E1C131E130E7F1480130314C014E038FFCFF815 207F9F18>107 D<120E12FE120EB3ABEAFFE00B20809F0C>I<390E1F01F039FE61861839 0E81C81C390F00F00EA2000E13E0AE3AFFE7FE7FE023147F9326>IIII<3803E080EA0619EA1C05EA3C07EA3803 1278127012F0A61270127812381307EA1C0BEA0E13EA03E3EA0003A8EB3FF8151D7E9318 >III<1202A31206A2120EA2123EEAFFF8EA0E00AB1308A5EA06101203 EA01E00D1C7F9B12>I<380E01C0EAFE1FEA0E01AE13031206EA030D3801F1FC16147F93 19>I<38FF83F8381E01E0381C00C06C1380A338070100A2EA0382A3EA01C4A213ECEA00 E8A21370A3132015147F9318>I<39FF9FE1FC393C078070391C030060EC8020000E1440 A214C0D807071380130414E039038861001471EBC8733801D032143A3800F03CEBE01CA2 EB6018EB40081E147F9321>I<387FC3FC380F01E0000713C0148038038100EA01C2EA00 E413EC13781338133C137C134E1387EA010738030380380201C0000613E0121E38FF07FE 1714809318>I<38FF83F8381E01E0381C00C06C1380A338070100A2EA0382A3EA01C4A2 13ECEA00E8A21370A31320A25BA3EAF080A200F1C7FC1262123C151D7F9318>II E /Fs 7 117 df<14E0A2497EA3497EA2EB06FC A2EB0EFEEB0C7EA2497EA201307F141F01707FEB600FA2496C7E90B5FC4880EB8003A248 486C7EA20006801400000E803AFFE00FFFE0A2231F7E9E28>65 D97 DII114 DII E /Ft 19 122 df<1238127C12FEA3127C1238070774861F>46 D64 D97 DIII<137F 3801FFC0000713E0380FC1F0381F0078123E003C133C5A141E127012F0B512FEA300F0C7 FCA21278A36C131E7E001F133E380FC07C3803FFF86C13F038003F80171A7D991F>I104 D106 DII<38FE3C0F9038FE3F80B5EA7FC0381FCFF3903887E1E0EB07C1A2001E1381B039FF C7F1FCEBCFF3EBC7F11E1A80991F>I<387F87E038FF9FF0387FBFF83807F83CEBF01CEB E01E13C0A21380AF397FF87FE039FFFCFFF0397FF87FE01C1A7F991F>I<13FCEA03FF48 1380381F87E0EA1E01383C00F0007C13F800781378A248133CA76C137C00781378A2007C 13F8003C13F0381E01E0EA1F873807FF806C1300EA00FC161A7C991F>I<387FE07E39FF E1FF80D87FE713C03801EF87EBFE079038FC038049C7FCA25BA25BAD387FFFE0B57E6C5B 1A1A7E991F>114 D<3803FC70380FFFF0123FEA7C03EA7001EAE000A37E007C1300EA3F E06CB4FC000713C0C613F0EB03F8EB00780070133C00F0131CA27EA26C1338B413F013FF 00E713C038E1FE00161A7C991F>I<137013F0A6387FFFFEB5FCA2D800F0C7FCADEC0780 A5EC0F00EB7C1FEB3FFE6D5AEB07F019217FA01F>I<387F81FEEAFF83EA7F813807801E B1143E147E3803C0FE90B512E06CEBDFF039007F1FE01C1A7F991F>I<397FF0FFE0486C 13F06C4813E0390F800F000007131EA2EA03C05CA2EA01E0147C1478EA00F0A25C1378A2 5C1339133DEB1DC0A2131F130F5CA391C7FCA25B131EA2EA383EEA7C3C137C5BEA7FF06C 5AEA0F801C277F991F>121 D E /Fu 50 124 df38 D<127812FCA212FEA2127A 1202A41204A312081210A21220124007127B8510>44 DI<1278 12FCA4127806067B8510>I<137E3801C380380700E0000E1370001E1378001C1338003C 133CA20038131C0078131EA400F8131FAF0078131EA4007C133E003C133CA2001C133800 1E1378000E13706C13E03801C38038007E0018297EA71D>48 D<1310137013F0120F12FF 12F01200B3AD487E387FFFE0A213287CA71D>II<137E3803FFC0380703E0380C01F0381000F8121C003E13FC147CA2 121E000C13FCC712F8A214F0130114E0EB0380EB070013FEEB03C0EB00E014F8147CA214 3EA2143FA21230127812FCA2143E5A0040137E147C003013F86C13F0380F03E03803FFC0 3800FE0018297EA71D>I<144014C01301A213031307A2130BA213131323A2134313C313 83EA0103A212021204A21208121812101220A212401280B6FCA2380003C0A8EB07E090B5 FCA218287EA71D>I<12201238003FB5FCA214FE5A3860000400401308A21410481320A2 C712401480A2EB01001302A213061304130CA2131CA35BA31378A513F8A81370182A7DA8 1D>55 D<137E3801FF80380381E0380600F0481378001C13380018131C1238A4123C003E 13387EEBC070380FE0E03807F9803803FF007E6C13804813E038031FF0380E07F8381C03 FC383800FE0030137E0070131E0060130F12E01407A46C13060070130E0078130C003813 18001E1330380F81E03803FFC03800FE0018297EA71D>I<137E3801FF80380781C0380F 00E0001E1370481338A248133CA200F8131EA4141FA41278143FA27E001C135F7E6C139F 3803831FEA00FCEB001EA3143E143CA21438001C1378003E137014E0383C01C038180380 381C0F00EA0FFEEA03F818297EA71D>I<14101438A3147CA314BEA3EB011FA39038020F 80A3496C7EA2010C7FEB0803A201107F1401A2496C7EA390387FFFFCA2903840007C497F A348C77EA24815800002140FA2000615C0EA1F80D8FFE0EBFFFEA2272A7EA92C>65 DI<02FF13200107EBC06090381F807090397E0018E001F813054848 130348481301485A48481300A248C812605A123E007E1520A2127C160012FCA9127CA200 7E1520A2123E123F6C15406C7EA26C6C14806C6CEB01006C6C5B6C6C1306017E131C9038 1F8070903807FFE0010090C7FC232B7DA92A>I69 DI72 DI<3803FFFCA238000FC01307B3AA1230127812FCA214 80EAF80F00401300A2EA201EEA1838EA07E0162A7DA81E>IIIII80 D82 DI<007FB612F0A2397C00F8 010070EC00700060153000401510A200C01518A2481508A5C71400B3A6497E90B512F8A2 25297EA82A>II97 DI<137F3801C0E038070010000E1378001E13F85A1470007C13200078130012 F8A81278127C003C1308A26C1310000E13206C13603801C18038007E00151A7E991A>I< 140F49B4FCA2EB001F80AC133F3801C0CF3803802F380F001F121E001C7F123C127C1278 A212F8A71278A27EA26C5B000E132F6CEB4F803901C18FF838007E0F1D2A7EA921>I<13 FE38038780380701C0000E13E0EA1C00003C13F0A2481378A212F8A2B512F800F8C7FCA5 1278A26C1308A26C1310000E13206C13403801C18038007E00151A7E991A>I<131FEB70 C0EBE1E0EA01C31203EB81C0380780801400A9EAFFFEA2EA0780B3A37FEAFFFEA2132A7F A912>I104 D<1207EA0F80121FA2120FEA0700C7FCA9EA0780127FA2 120F1207B3A2EAFFF8A20D297FA811>I107 DI<3A0783F803F83AFF8C1C0C1C9039900E100E3A0FA0072007000702 A0138001C013C0A201801380B13BFFFCFFFCFFFCA22E1A7F9931>I<380783F838FF8C1C EB900E380FA0070007148013C0A21380B139FFFCFFFCA21E1A7F9921>I<137E3803C3C0 380700E0000E1370481338003C133CA248131EA200F8131FA80078131EA26C133CA2001C 13386C13706C13E03803C3C038007E00181A7E991D>I<380787C038FF88E0EB91F0EA0F A1EA07C1EBC0E014005BB07FEAFFFEA2141A7F9917>114 D<3807F080EA1C0DEA3003EA 6001A2EAE000A27E6C1300127EEA7FE0EA3FFC6C7EEA07FF38003F801307388003C0A213 0112C0A200E01380130300F01300EACC0EEA83F8121A7E9917>I<7FA41201A31203A212 07120F381FFF80B5FC38078000AD1440A73803C08012013800E100133E12257FA417>I< 390780078000FF13FFA2000F130F00071307B0140FA2000313173901C027C03900E047FC EB3F871E1A7F9921>I<39FFF01FF0A2390F8007800007EB0300140213C000035BA26C6C 5AA213F000005BA2EB7820A36D5AA26D5AA36DC7FCA31306A21C1A7F991F>I<3AFFF3FF 83FEA23A0F807C00F8D9003C1360D807801440141C141E2603C02E1380142FA23A01E047 01001581A23900F0838215C2A290387901C415E4137D90383E00E815F8A2011C1370A301 081320271A7F992A>I<39FFF01FF0A2390F8007800007EB0300140213C000035BA26C6C 5AA213F000005BA2EB7820A36D5AA26D5AA36DC7FCA31306A21304A2130C1308A2EA7010 12F85BA2485AEA6080001FC8FC1C267F991F>121 D123 D E /Fv 18 122 df65 D97 D<903801FFF0010F13FE013FEBFF809039FF801FC03901FE003F4848EB7FE048 5A485A121F4848EB3FC0ED1F80007FEC0F004990C7FCA312FFA8127FA27FA2123F6D14F0 121F6C6CEB01E012076C6CEB03C06CB4EB0F806C9038C03F0090383FFFFE010F13F80101 13C024267DA52B>99 DI<49B47E010F13F0013F13FC9038FF81FE3A03FE007F80D807F8133F000F EC1FC049EB0FE0485A003F15F01507485A16F8A212FFA290B6FCA301C0C8FCA4127FA36C 7E1678121F7F000F15F06C6C13016C6CEB03E06C6CEB0FC03A00FFC07F8090393FFFFE00 010F13F8010013C025267DA52C>II105 D<13FE12FFA412071203B092381FFF F0A4923803FC0016F04B5AED1F804BC7FC157E5DEC03F8EC07E04A5A4A5A4A7EECFFE090 B57EA281ECCFFCEC07FE496C7E13FC6E7F6E7F6F7E153F826F7E6F7E1507826F7EB5D8F0 1F13FCA42E3C7DBB33>107 D<13FE12FFA412071203B3B3AEB512F8A4153C7DBB1A>III<903801FFC0010F13F8017F13FFD9FF807F3A03FE003FE0D807F8EB0F F048486D7EA248486D7E003F81A248486D7EA400FF1680A9007F1600A36C6C495AA2001F 5D6D1307000F5D6C6C495AD803FEEB3FE03A00FF80FF806DB5C7FC010F13F8010113C029 267DA530>I<3901FC03F000FFEB0FFC4AB4FC91383C3F80EC707F00079038E0FFC00003 5BEBFD80A201FFEB7F809138003F00151E92C7FC5BB3A3B512FCA422267DA528>114 D<90383FF0703903FFFEF04813FF381FC01F383F0003003E13015A140012FCA27E6C1400 13C013FC387FFFF06C13FEECFF806C14C06C14E0000314F0C614F8011F13FCEB007FEC07 FE0070130100F01300157E7EA27E157C6C14FC6C14F890388001F09038F00FE000F9B512 C0D8F07F130038C01FF81F267DA526>I<130FA55BA45BA25BA25B5A5A5A001FEBFFF0B6 FCA3000190C7FCB3153CA86C14781480017F13F090383FC1E090381FFFC06D1380903801 FE001E377EB626>I<01FEEC3F8000FFEC3FFFA400071401000380B3A45DA25D12011506 6C6C4913C090267F807813FE6DB45A6D5B010313802F267CA536>I119 D121 D E end %%EndProlog %%BeginSetup %%Feature: *Resolution 300dpi TeXDict begin %%EndSetup %%Page: 1 1 1 0 bop 240 251 a Fv(A)m(ttractor)31 b(dynamics)h(in)h(feedforw)m(ard) 637 355 y(neural)g(net)m(w)m(orks)386 510 y Fu(La)n(wrence)19 b(K.)h(Saul)274 b(Mic)n(hael)18 b(I.)h(Jordan)309 584 y(A)-5 b(T&T)20 b(Labs)f({)g(Researc)n(h)124 b(Univ)n(ersit)n(y)18 b(of)h(California)355 659 y(180)h(P)n(ark)g(Av)n(e)f(E-171)291 b(739)21 b(So)r(da)d(Hall)295 734 y(Florham)h(P)n(ark,)h(NJ)f(07932)160 b(Berk)n(eley)-5 b(,)20 b(CA)g(94720)273 809 y Ft(lsaul@research.at)o (t.co)o(m)47 b(jordan@cs.berke)o(ley.)o(edu)875 994 y Fs(Abstract)122 1078 y Fr(W)l(e)12 b(study)h(the)f(probabilistic)j (generativ)o(e)d(mo)q(dels)h(parameterized)g(b)o(y)f(feedforw)o(ard)g (neural)h(net-)122 1135 y(w)o(orks.)k(An)12 b(attractor)c(dynamics)k (for)e(probabilistic)j(inference)g(in)f(these)f(mo)q(dels)g(is)h(deriv) o(ed)g(from)122 1191 y(a)j(mean)h(\014eld)h(appro)o(ximation)f(for)f (large,)g(la)o(y)o(ered)h(sigmoidal)h(net)o(w)o(orks.)j(Fixed)d(p)q (oin)o(ts)f(of)f(the)122 1247 y(dynamics)h(corresp)q(ond)g(to)f (solutions)i(of)e(the)h(mean)g(\014eld)g(equations,)g(whic)o(h)h (relate)f(the)f(statis-)122 1304 y(tics)f(of)e(eac)o(h)i(unit)g(to)e (those)h(of)g(its)h(Mark)o(o)o(v)d(blank)o(et.)20 b(W)l(e)13 b(establish)i(global)f(con)o(v)o(ergence)f(of)g(the)122 1360 y(dynamics)i(b)o(y)f(pro)o(viding)i(a)e(Ly)o(apuno)o(v)g(function) h(and)g(sho)o(w)f(that)f(the)i(dynamics)g(generate)f(the)122 1417 y(signals)k(required)f(for)g(unsup)q(ervised)i(learning.)26 b(Our)17 b(results)g(for)f(feedforw)o(ard)g(net)o(w)o(orks)g(pro-)122 1473 y(vide)g(a)e(coun)o(terpart)g(to)g(those)g(of)h(Cohen-Grossb)q (erg)f(and)h(Hop\014eld)h(for)e(symmetric)h(net)o(w)o(orks.)0 1640 y Fq(1)81 b(In)n(tro)r(duction)0 1749 y Fp(A)o(ttractor)17 b(neural)g(net)o(w)o(orks)g(lend)g(a)g(computational)g(purp)q(ose)h(to) g(con)o(tin)o(uous)f(dynamical)f(systems.)0 1809 y(Celebrated)f(uses)g (of)h(these)f(net)o(w)o(orks)g(include)f(the)i(storage)g(of)g(asso)q (ciativ)o(e)f(memorie)o(s)e(\(Amit,)g(1989\),)0 1870 y(the)18 b(reconstruction)f(of)i(noisy)f(images)f(\(Ko)q(c)o(h)h(et)f (al,)h(1986\),)i(and)e(the)g(searc)o(h)g(for)g(shortest)h(paths)f(in)0 1930 y(the)13 b(tra)o(v)o(eling)e(salesman)h(problem)g(\(Hop\014eld)g (&)h(T)l(ank,)g(1986\).)22 b(In)12 b(all)h(these)f(examples,)f(a)j (distributed)0 1990 y(computation)e(is)g(p)q(erformed)g(b)o(y)g(an)h (attractor)h(dynamics)d(and)i(its)g(\015o)o(w)g(to)g(stable)f(\014xed)h (p)q(oin)o(ts.)20 b(These)0 2050 y(examples)12 b(can)j(also)g(b)q(e)f (form)o(ulated)f(as)i(problems)e(in)h(probabilistic)g(reasoning,)h(and) g(indeed)e(it)h(is)g(w)o(ell)0 2110 y(kno)o(wn)i(that)h(symmetr)o(ic)c (neural)i(net)o(w)o(orks)h(can)g(b)q(e)g(analyzed)g(as)h(statistical)e (mec)o(hanical)e(ensem)o(bles)0 2171 y(or)k(Mark)o(o)o(v)e(random)h (\014elds)g(\(MRFs\).)73 2231 y(A)o(ttractor)k(neural)h(net)o(w)o(orks) g(and)g(Mark)o(o)o(v)f(random)g(\014elds)h(are)g(connected)f(b)o(y)g (the)h(idea)f(of)i(an)0 2291 y(energy)g(surface.)41 b(This)22 b(connection)h(has)g(led)f(to)h(new)g(algorithms)f(for)h(probabilistic) e(inference)g(in)0 2351 y(symmetri)o(c)16 b(net)o(w)o(orks,)i(a)g (problem)f(traditionally)h(addressed)h(via)f(sto)q(c)o(hastic)g (sampling)g(pro)q(cedures)0 2411 y(\(Metrop)q(olis)f(et)g(al,)f(1953;)j (Geman)d(&)h(Geman,)f(1984\).)25 b(F)l(or)17 b(example,)e(in)h(one)i (of)f(the)g(\014rst)g(unsup)q(er-)0 2471 y(vised)h(learning)h (algorithms)f(for)h(neural)f(net)o(w)o(orks,)h(Ac)o(kley)d(et)j(al)f (\(1985\))j(applied)d(Gibbs)h(sampling)0 2532 y(to)f(estimate)e(the)h (statistics)g(of)h(binary)g(MRFs.)25 b(Kno)o(wn)18 b(as)g(Boltzmann)e (mac)o(hines,)f(these)i(net)o(w)o(orks)0 2592 y(relied)d(on)j (time-consuming)c(Mon)o(te)j(Carlo)g(sim)o(ulation)e(and)j(sim)o (ulated)d(annealing)i(as)g(an)h(inner)e(lo)q(op)0 2652 y(of)f(their)e(learning)i(pro)q(cedure.)20 b(Subsequen)o(tly)l(,)12 b(P)o(eterson)h(and)h(Anderson)g(\(1987\))h(in)o(tro)q(duced)e(a)h (faster)963 2795 y(1)p eop %%Page: 2 2 2 1 bop 0 50 a Fp(deterministic)11 b(metho)q(d)j(for)g(probabilistic)g (inference.)19 b(Their)13 b(metho)q(d,)h(based)h(on)g(the)f(so-called)g Fo(me)n(an)0 110 y(\014eld)21 b(appr)n(oximation)d Fp(from)g (statistical)h(mec)o(hanics,)e(transformed)h(the)h(binary-v)m(alued)g (MRF)f(in)o(to)h(a)0 170 y(net)o(w)o(ork)i(with)h(con)o(tin)o(uous-v)m (alued)g(units.)38 b(The)22 b(con)o(tin)o(uous)f(net)o(w)o(ork,)h(endo) o(w)o(ed)g(with)g(dynamics)0 230 y(giv)o(en)17 b(b)o(y)h(the)f(mean)g (\014eld)h(equations,)g(is)g(itself)f(an)h(attractor)h(net)o(w)o(ork;)f (in)f(particular,)h(it)g(p)q(ossesses)0 291 y(a)j(Ly)o(apuno)o(v)g (function)g(\(Cohen)g(&)g(Grossb)q(erg,)i(1983;)h(Hop\014eld,)d (1984\).)36 b(Th)o(us)21 b(one)g(can)g(p)q(erform)0 351 y(appro)o(ximate)13 b(probabilistic)g(inference)f(in)i(a)g(binary)g (MRF)g(b)o(y)f(relaxing)h(a)g(deterministic,)d(con)o(tin)o(uous)0 411 y(net)o(w)o(ork.)73 471 y(In)j(this)g(pap)q(er,)h(w)o(e)e(sho)o(w)i (that)g(this)f(link)m(age)g(of)g(attractor)h(dynamics)e(and)h (probabilistic)g(inference)0 531 y(is)j(not)h(limited)c(to)j(symmetric) d(net)o(w)o(orks)i(or)i(\(equiv)m(alen)o(tly\))d(to)i(mo)q(dels)f (represen)o(ted)g(as)i(undirected)0 592 y(graphs.)25 b(W)l(e)17 b(in)o(v)o(estigate)f(an)h(attractor)h(dynamics)d(for)j (feedforw)o(ard)f(net)o(w)o(orks,)f(or)i(directed)e(acyclic)0 652 y(graphs)k(\(D)o(A)o(Gs\);)f(these)g(are)f(net)o(w)o(orks)h(with)f (directed)g(edges,)h(but)g(no)g(directed)f(lo)q(ops.)29 b(The)19 b(prob-)0 712 y(abilistic)e(mo)q(dels)h(represen)o(ted)g(b)o (y)g(D)o(A)o(Gs)h(are)g(kno)o(wn)g(as)g(Ba)o(y)o(esian)f(net)o(w)o (orks,)h(and)g(together)g(with)0 772 y(MRFs,)k(comprise)e(the)h(class)h (of)g(probabilistic)e(mo)q(dels)h(kno)o(wn)g(as)h Fo(gr)n(aphic)n(al)g (mo)n(dels)k Fp(\(Lauritzen,)0 832 y(1996\).)22 b(Lik)o(e)14 b(their)g(undirected)g(coun)o(terparts,)h(Ba)o(y)o(esian)e(net)o(w)o (orks)i(ha)o(v)o(e)f(b)q(een)h(prop)q(osed)h(as)f(mo)q(dels)0 892 y(of)i(b)q(oth)g(arti\014cial)e(and)i(biological)f(in)o(telligence) d(\(P)o(earl,)i(1988\).)73 953 y(The)22 b(units)g(in)f(Ba)o(y)o(esian)g (net)o(w)o(orks)g(represen)o(t)g(random)h(v)m(ariables,)g(while)f(the)h (links)f(represen)o(t)0 1013 y(assertions)i(of)g(conditional)f(indep)q (endence.)38 b(These)22 b(indep)q(endence)g(relations)g(endo)o(w)g(D)o (A)o(Gs)g(with)0 1073 y(a)e(precise)e(probabilistic)h(seman)o(tics.)29 b(An)o(y)19 b(join)o(t)g(distribution)g(o)o(v)o(er)g(a)h(\014xed,)f (\014nite)g(set)h(of)f(random)0 1133 y(v)m(ariables)j(can)f(b)q(e)h (represen)o(ted)f(b)o(y)g(a)h(Ba)o(y)o(esian)e(net)o(w)o(ork,)i(just)g (as)g(it)f(can)h(b)q(e)g(represen)o(ted)e(b)o(y)i(an)0 1193 y(MRF.)f(What)i(is)f(compactly)e(represen)o(ted)h(b)o(y)h(one)g(t) o(yp)q(e)g(of)g(graphical)g(mo)q(del,)g(ho)o(w)o(ev)o(er,)g(ma)o(y)f(b) q(e)0 1254 y(quite)i(clumsily)e(represen)o(ted)h(b)o(y)h(the)h(other.) 44 b(MRFs)23 b(arise)h(naturally)f(in)h(statistical)f(mec)o(hanics,)0 1314 y(where)c(they)g(describ)q(e)g(the)g(Gibbs)g(distributions)h(for)f (systems)f(in)h(thermal)f(equilibrium.)27 b(Ba)o(y)o(esian)0 1374 y(net)o(w)o(orks,)18 b(on)g(the)g(other)g(hand,)h(are)f(designed)g (to)h(mo)q(del)d(causal)j(or)f(generativ)o(e)f(pro)q(cesses;)i(hidden)0 1434 y(Mark)o(o)o(v)c(mo)q(dels,)g(Kalman)g(\014lters,)g(soft-split)h (decision)f(trees|these)g(are)h(all)g(examples)e(of)i(Ba)o(y)o(esian)0 1494 y(net)o(w)o(orks.)73 1555 y(The)i(connection)g(b)q(et)o(w)o(een)g (Ba)o(y)o(esian)f(net)o(w)o(orks)g(and)i(neural)f(net)o(w)o(ork)g(mo)q (dels)f(of)i(learning)f(w)o(as)0 1615 y(p)q(oin)o(ted)i(out)h(b)o(y)f (Neal)g(\(1992\).)35 b(Neal)19 b(sho)o(w)o(ed)i(that)f(feedforw)o(ard)h (neural)f(net)o(w)o(orks)g(with)g(sigmoid)0 1675 y(squashing)13 b(functions)e(ha)o(v)o(e)h(a)g(natural)g(expression)f(as)i(Ba)o(y)o (esian)e(net)o(w)o(orks)g(with)h(binary-v)m(alued)g(units.)0 1735 y(He)21 b(also)i(sho)o(w)o(ed)f(that)g(these)f(probabilistic)g (net)o(w)o(orks)h(ha)o(v)o(e)f(gradien)o(t-based)i(learning)e(rules)h (that)0 1795 y(dep)q(end)g(only)f(on)h(lo)q(cally)f(a)o(v)m(ailable)g (information)g(\(Bun)o(tine,)g(1994;)26 b(Binder)20 b(et)i(al,)g (1997\).)39 b(These)0 1856 y(observ)m(ations)25 b(led)e(Hin)o(ton)g(et) g(al)h(\(1995\))h(to)f(prop)q(ose)h(the)f(Helmholtz)c(mac)o(hine|a)i(m) o(ultila)o(y)o(e)o(red)0 1916 y(probabilistic)12 b(net)o(w)o(ork)f (that)i(learns)g(hierarc)o(hical)e(generativ)o(e)g(mo)q(dels)g(of)i (sensory)g(inputs.)20 b(Helmholtz)0 1976 y(mac)o(hines)f(w)o(ere)i (conceiv)o(ed)f(not)i(only)f(as)h(to)q(ols)g(for)g(statistical)f (pattern)h(recognition,)g(but)f(also)h(as)0 2036 y(abstract)17 b(mo)q(dels)e(of)i(top-do)o(wn)g(and)g(b)q(ottom-up)f(pro)q(cessing)h (in)f(the)g(brain.)73 2096 y(F)l(ollo)o(wing)e(Hin)o(ton)f(et)h(al)g (\(1995\),)i(a)e(n)o(um)o(b)q(er)f(of)h(researc)o(hers)g(b)q(egan)h(to) f(in)o(v)o(estigate)f(unsup)q(ervised)0 2156 y(learning)i(in)g(large)h (la)o(y)o(ered)d(Ba)o(y)o(esian)i(net)o(w)o(orks)g(\(Da)o(y)o(an)g(et)g (al,)g(1996;)i(Lewic)o(ki)d(&)h(Sejno)o(wski,)g(1996\).)0 2217 y(As)20 b(in)h(undirected)e(MRFs,)i(probabilistic)f(inference)f (in)h(these)g(net)o(w)o(orks)g(is)h(generally)e(in)o(tractable,)0 2277 y(and)c(appro)o(ximations)f(are)h(required.)k(Saul)c(et)g(al)f (\(1996\))i(prop)q(osed)g(a)f(mean)f(\014eld)g(appro)o(ximation)g(for)0 2337 y(these)f(net)o(w)o(orks,)h(analogous)h(to)f(the)g(existing)f(one) h(for)f(Boltzmann)g(mac)o(hines.)18 b(Their)13 b(appro)o(ximation)0 2397 y(transformed)21 b(the)g(binary-v)m(alued)h(net)o(w)o(ork)f(in)o (to)g(a)h(con)o(tin)o(uous-v)m(alued)f(net)o(w)o(ork)g(whose)h (statistics)0 2457 y(w)o(ere)d(describ)q(ed)h(b)o(y)f(a)h(set)g(of)g (mean)f(\014eld)h(equations.)32 b(These)20 b(equations)g(related)f(the) h(statistics)g(of)0 2518 y(eac)o(h)d(unit)g(to)h(a)g(w)o(eigh)o(ted)e (sum)h(of)g(statistics)h(from)e(its)h(Mark)o(o)o(v)g(blank)o(et)g(\(P)o (earl,)f(1988\)|a)k(natural)0 2578 y(generalization)h(of)h(the)f (notion)h(of)g(neigh)o(b)q(orho)q(o)q(d)h(in)e(undirected)f(MRFs.)37 b(This)22 b(earlier)e(w)o(ork)h(did)0 2638 y(not,)16 b(ho)o(w)o(ev)o(er,)f(exhibit)f(the)i(solutions)h(of)f(these)g (equations)g(as)h(\014xed)f(p)q(oin)o(ts)g(of)h(a)f(simple)e(con)o(tin) o(uous)963 2795 y(2)p eop %%Page: 3 3 3 2 bop 0 50 a Fp(dynamical)17 b(system.)29 b(In)19 b(particular,)h (Saul)f(et)g(al)h(\(1996\))g(did)f(not)h(pro)o(vide)f(an)h(attractor)g (dynamics)0 110 y(nor)d(a)f(Ly)o(apuno)o(v)h(function)f(for)g(their)g (mean)f(\014eld)h(equations.)73 170 y(In)c(this)g(pap)q(er,)h(w)o(e)f (bring)h(this)f(sequence)f(of)h(ideas)h(full)e(circle)f(b)o(y)i (forging)h(a)g(link)e(b)q(et)o(w)o(een)g(attractor)0 230 y(dynamics)17 b(and)i(probabilistic)f(inference)f(for)i(directed)f (net)o(w)o(orks.)28 b(The)19 b(link)e(is)i(ac)o(hiev)o(ed)e(via)h(mean) 0 291 y(\014eld)d(theory)l(,)g(just)g(as)h(in)f(the)g(undirected)f (case.)21 b(In)15 b(particular,)g(w)o(e)g(describ)q(e)g(an)h(attractor) g(dynamics)0 351 y(whose)24 b(stable)g(\014xed)f(p)q(oin)o(ts)h (corresp)q(ond)h(to)f(solutions)g(of)g(the)f(mean)g(\014eld)g (equations.)43 b(W)l(e)23 b(also)0 411 y(establish)g(global)h(con)o(v)o (ergence)e(of)i(these)f(dynamics)f(b)o(y)h(pro)o(viding)g(a)h(Ly)o (apuno)o(v)g(function.)43 b(Our)0 471 y(results)15 b(th)o(us)h(pro)o (vide)f(an)h(understanding)h(of)f(feedforw)o(ard)f(\(Ba)o(y)o(esian\))g (net)o(w)o(orks)g(that)h(parallels)f(the)0 531 y(usual)22 b(understanding)h(of)f(symmetric)c(\(MRF\))k(net)o(w)o(orks.)37 b(In)22 b(b)q(oth)h(cases,)g(w)o(e)e(ha)o(v)o(e)h(a)g(satisfying)0 592 y(seman)o(tics)12 b(for)i(the)g(set)f(of)h(allo)o(w)o(ed)f (probabilit)o(y)g(distributions;)h(in)g(b)q(oth)g(cases,)g(w)o(e)g(ha)o (v)o(e)f(a)h(mean)f(\014eld)0 652 y(theory)19 b(that)h(sidesteps)g(the) f(in)o(tractabilit)o(y)e(of)j(exact)f(probabilistic)g(inference;)g(and) h(in)f(b)q(oth)h(cases,)0 712 y(w)o(e)c(ha)o(v)o(e)g(an)g(attractor)i (dynamics)c(that)j(transforms)f(a)h(discrete-v)m(alued)f(net)o(w)o(ork) f(in)o(to)h(a)h(con)o(tin)o(uous)0 772 y(dynamical)d(system.)73 832 y(While)k(this)g(pap)q(er)h(builds)f(on)h(previous)f(w)o(ork,)g(w)o (e)g(ha)o(v)o(e)g(tried)f(to)i(k)o(eep)e(it)h(self-con)o(tained.)27 b(The)0 892 y(organization)19 b(of)f(the)g(pap)q(er)h(is)e(as)i(follo)o (ws.)26 b(In)18 b(section)g(2,)g(w)o(e)g(in)o(tro)q(duce)f(the)h (probabilistic)f(mo)q(dels)0 953 y(represen)o(ted)h(b)o(y)g(D)o(A)o(Gs) h(and)g(review)f(the)g(problems)g(of)h(inference)e(and)j(learning.)29 b(In)18 b(section)h(3,)g(w)o(e)0 1013 y(presen)o(t)h(the)g(mean)g (\014eld)g(theory)g(for)h(these)f(net)o(w)o(orks,)h(including)f(the)g (mean)g(\014eld)g(equations,)h(the)0 1073 y(attractor)c(dynamics,)e (and)i(the)g(learning)f(rule.)22 b(In)16 b(section)h(4,)f(w)o(e)h (describ)q(e)f(some)f(exp)q(erimen)o(ts)f(on)k(a)0 1133 y(database)i(of)e(handwritten)h(digits)f(and)h(compare)e(our)i(results) f(to)h(kno)o(wn)g(b)q(enc)o(hmarks.)26 b(Finally)l(,)17 b(in)0 1193 y(section)f(5,)g(w)o(e)g(presen)o(t)f(our)i(conclusions,)f (as)h(w)o(ell)e(as)i(directions)e(for)i(future)f(researc)o(h.)0 1360 y Fq(2)81 b(Probabilistic)25 b(D)n(A)n(Gs)0 1469 y Fp(Consider)20 b(a)g(feedforw)o(ard)g(net)o(w)o(ork|or)f(equiv)m (alen)o(tly)l(,)f(a)j(directed)d(acyclic)g(graph|in)i(whic)o(h)g(eac)o (h)0 1530 y(unit)13 b(represen)o(ts)f(a)h(binary)g(random)f(v)m (ariable)h Fn(S)898 1537 y Fm(i)926 1530 y Fl(2)h(f)p Fp(0)p Fn(;)8 b Fp(1)p Fl(g)13 b Fp(and)h(eac)o(h)e(link)g(corresp)q (onds)i(to)g(a)f(non-zero,)0 1590 y(real-v)m(alued)19 b(w)o(eigh)o(t,)g Fn(W)469 1597 y Fm(ij)500 1590 y Fp(.)31 b(Th)o(us)19 b Fn(W)717 1597 y Fm(ij)767 1590 y Fp(is)h(a)f Fo(lower-diagonal)j Fp(w)o(eigh)o(t)d(matrix)e(whose)k(zeros)e (indicate)0 1650 y(missing)c(links)g(in)h(the)g(underlying)g(D)o(A)o (G.)73 1710 y(W)l(e)j(can)f(view)g(this)h(net)o(w)o(ork)f(as)h (de\014ning)g(a)g(probabilistic)f(mo)q(del)f(in)h(whic)o(h)g(missing)g (links)g(cor-)0 1770 y(resp)q(ond)g(to)g(statemen)o(ts)e(of)h (conditional)g(indep)q(endence.)23 b(In)17 b(particular,)g(supp)q(ose)i (that)e(the)g(instan-)0 1830 y(tiations)h(of)g(the)f(random)g(v)m (ariables)h Fn(S)734 1837 y Fm(i)766 1830 y Fp(are)f(generated)h(b)o(y) f(a)h(causal)g(pro)q(cess)g(in)g(whic)o(h)f(eac)o(h)g(unit)g(is)0 1891 y(activ)m(ated)g(or)g(inhibited)f(\(i.e.,)f(set)i(to)h(one)f(or)g (zero\))g(dep)q(ending)g(on)h(the)f(v)m(alues)g(of)g(its)g(paren)o(ts.) 24 b(This)0 1951 y(generativ)o(e)15 b(pro)q(cess)i(is)f(mo)q(deled)f(b) o(y)g(the)h(join)o(t)g(distribution:)428 2061 y Fn(P)7 b Fp(\()p Fn(S)s Fp(\))30 b(=)635 2019 y Fk(Y)656 2111 y Fm(i)697 2061 y Fn(P)7 b Fp(\()p Fn(S)784 2068 y Fm(i)798 2061 y Fl(j)p Fn(S)842 2068 y Fj(1)861 2061 y Fn(;)h(S)913 2068 y Fj(2)933 2061 y Fn(;)g(:)g(:)g(:)f(;)h(S)1072 2068 y Fm(i)p Fi(\000)p Fj(1)1131 2061 y Fp(\))31 b(=)1249 2019 y Fk(Y)1269 2111 y Fm(i)1310 2061 y Fn(P)7 b Fp(\()p Fn(S)1397 2068 y Fm(i)1411 2061 y Fl(j)p Fn(\031)1453 2068 y Fm(S)1474 2073 y Fh(i)1489 2061 y Fp(\))p Fn(;)366 b Fp(\(1\))0 2206 y(where)20 b Fn(\031)173 2213 y Fm(S)194 2218 y Fh(i)230 2206 y Fp(denotes)h(the)f(paren)o(ts)g(of)h(the)f Fn(i)p Fp(th)g(unit.)34 b(Eq.)20 b(\(1\))h(states)f(that)h(giv)o(en)f (the)g(v)m(alues)h(of)f(its)0 2266 y(paren)o(ts,)c(the)f Fn(i)p Fp(th)h(unit)g(is)f(conditionally)g(indep)q(enden)o(t)g(of)i (its)e(other)h(ancestors)h(in)e(the)h(graph.)22 b(These)0 2326 y(qualitativ)o(e)11 b(statemen)o(ts)h(of)h(conditional)g(indep)q (endence)e(are)i(enco)q(ded)g(b)o(y)g(the)g(structure)f(of)h(the)g (graph)0 2387 y(and)k(hold)f(for)h(arbitrary)f(v)m(alues)g(of)h(the)f (w)o(eigh)o(ts)g Fn(W)990 2394 y Fm(ij)1036 2387 y Fp(attac)o(hed)g(to) h(non-missing)f(links.)73 2447 y(The)c(quan)o(titativ)o(e)d (predictions)i(of)h(the)f(mo)q(del)f(are)i(determined)c(b)o(y)j(the)g (conditional)h(distributions,)0 2507 y Fn(P)7 b Fp(\()p Fn(S)87 2514 y Fm(i)101 2507 y Fl(j)p Fn(\031)143 2514 y Fm(S)164 2519 y Fh(i)179 2507 y Fp(\),)16 b(in)g(eq.)f(\(1\).)22 b(In)16 b(this)g(pap)q(er,)g(w)o(e)g(consider)g Fo(sigmoid)g Fp(net)o(w)o(orks)g(for)h(whic)o(h)634 2623 y Fn(P)7 b Fp(\()p Fn(S)721 2630 y Fm(i)749 2623 y Fp(=)14 b(1)p Fl(j)p Fn(\031)867 2630 y Fm(S)888 2635 y Fh(i)903 2623 y Fp(\))30 b(=)g Fn(\033)1058 2575 y Fk(\020)1083 2590 y(P)1127 2634 y Fm(j)1145 2623 y Fn(W)1191 2630 y Fm(ij)1221 2623 y Fn(S)1251 2630 y Fm(j)1270 2575 y Fk(\021)1303 2623 y Fn(;)571 b Fp(\(2\))963 2795 y(3)p eop %%Page: 4 4 4 3 bop 467 0 a 16056010 14208860 6907084 27562557 33285570 50717736 startTexFig 467 0 a %%BeginDocument: figs/network.eps 1 setlinejoin /M { moveto } bind def /S { show } bind def /R { rmoveto } bind def /L { lineto } bind def /B { newpath 0 0 M 0 1 L 1 1 L 1 0 L closepath } bind def /CS { closepath stroke } bind def /S { /fixwidth exch def dup length /nchars exch def dup stringwidth pop fixwidth exch sub nchars div exch 0 exch ashow } def /bwproc { rgbproc dup length 3 idiv string 0 3 0 5 -1 roll { add 2 1 roll 1 sub dup 0 eq { pop 3 idiv 3 -1 roll dup 4 -1 roll dup 3 1 roll 5 -1 roll put 1 add 3 0 } { 2 1 roll } ifelse } forall pop pop pop } def systemdict /colorimage known not { /colorimage { pop pop /rgbproc exch def { bwproc } image } def } if 1 1 scale 0 setlinewidth /drawtri { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def 0 setgray newpath x1 y1 moveto x2 y2 lineto x3 y3 lineto closepath stroke } bind def /filltri { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def newpath x1 y1 moveto x2 y2 lineto x3 y3 lineto closepath fill } bind def /cliptri { /y3 exch def /x3 exch def /y2 exch def /x2 exch def /y1 exch def /x1 exch def 0 setgray newpath x1 y1 moveto x2 y2 lineto x3 y3 lineto closepath clip } bind def /imgscanrgb { gsave translate /scandy exch def /scandx exch def /istr scandx 3 mul string def scandx scandy scale scandx scandy 8 [scandx 0 0 scandy neg 0 scandy] {currentfile istr readhexstring pop} false 3 colorimage grestore } bind def /imgscanbw { gsave translate /scandy exch def /scandx exch def /istr scandx string def scandx scandy scale scandx scandy 8 [scandx 0 0 scandy neg 0 scandy] {currentfile istr readhexstring pop} image grestore } bind def /showcaseisoencoding [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /guilsinglright /fraction /florin /quotesingle /quotedblleft /guilsinglleft /fi /fl /endash /dagger /daggerdbl /bullet /quotesinglbase /quotedblbase /quotedblright /ellipsis /trademark /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /perthousand /ring /cedilla /Ydieresis /hungarumlaut /ogonek /caron /emdash /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def /showcasedingbatencoding [ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /a1 /a2 /a202 /a3 /a4 /a5 /a119 /a118 /a117 /a11 /a12 /a13 /a14 /a15 /a16 /a105 /a17 /a18 /a19 /a20 /a21 /a22 /a23 /a24 /a25 /a26 /a27 /a28 /a6 /a7 /a8 /a9 /a10 /a29 /a30 /a31 /a32 /a33 /a34 /a35 /a36 /a37 /a38 /a39 /a40 /a41 /a42 /a43 /a44 /a45 /a46 /a47 /a48 /a49 /a50 /a51 /a52 /a53 /a54 /a55 /a56 /a57 /a58 /a59 /a60 /a61 /a62 /a63 /a64 /a65 /a66 /a67 /a68 /a69 /a70 /a71 /a72 /a73 /a74 /a203 /a75 /a204 /a76 /a77 /a78 /a79 /a81 /a82 /a83 /a84 /a97 /a98 /a99 /a100 /.notdef /a205 /a85 /a206 /a86 /a87 /a88 /a89 /a90 /a91 /a92 /a93 /a94 /a95 /a96 /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /a101 /a102 /a103 /a104 /a106 /a107 /a108 /a112 /a111 /a110 /a109 /a120 /a121 /a122 /a123 /a124 /a125 /a126 /a127 /a128 /a129 /a130 /a131 /a132 /a133 /a134 /a135 /a136 /a137 /a138 /a139 /a140 /a141 /a142 /a143 /a144 /a145 /a146 /a147 /a148 /a149 /a150 /a151 /a152 /a153 /a154 /a155 /a156 /a157 /a158 /a159 /a160 /a161 /a163 /a164 /a196 /a165 /a192 /a166 /a167 /a168 /a169 /a170 /a171 /a172 /a173 /a162 /a174 /a175 /a176 /a177 /a178 /a179 /a193 /a180 /a199 /a181 /a200 /a182 /.notdef /a201 /a183 /a184 /a197 /a185 /a194 /a198 /a186 /a195 /a187 /a188 /a189 /a190 /a191 /.notdef ] def /newfont 10 dict def newfont begin /FontType 3 def /FontMatrix [1 0 0 1 0 0] def /FontBBox [0 0 1 1] def /Encoding 256 array def 0 1 255 {Encoding exch /.notdef put} for /CharProcs 1 dict def CharProcs begin /.notdef {} def end /BuildChar { 1 0 0 0 1 1 setcachedevice exch begin Encoding exch get CharProcs exch get end exec } def end /PatternFont newfont definefont pop gsave /saveit save def gsave gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 134.428 738.452] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 191.168 738.452] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 250.023 738.452] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 361.455 738.452] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 414.425 738.452] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 475.242 738.452] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave gsave matrix currentmatrix [0.784736 0 0 0.803653 279.211 728.005] concat newpath 0 0 M 0 36 L 66.8 36 L 66.8 0 L closepath setmatrix 0 0 0 setrgbcolor grestore newpath 277.249 725.995 M 277.249 758.945 L 333.594 758.945 L 333.594 725.995 L closepath clip newpath 0 0 0 setrgbcolor matrix currentmatrix [0.784736 0 0 0.803653 279.211 728.005] concat /Courier-Bold-SHOWISO findfont 36 scalefont setfont 0 0 0 setrgbcolor 0 9.23077 M (...) 64.8 S setmatrix grestore gsave matrix currentmatrix [401 0 0 -67.5069 105 771] concat B setmatrix 0 0 0 setrgbcolor 2.000000 setlinewidth [4] 0 setdash gsave stroke grestore grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 134.428 597.009] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 191.168 597.009] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 250.023 597.009] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 361.455 597.009] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 414.425 597.009] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 475.242 597.009] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave gsave matrix currentmatrix [0.784736 0 0 0.803653 279.211 586.562] concat newpath 0 0 M 0 36 L 66.8 36 L 66.8 0 L closepath setmatrix 0 0 0 setrgbcolor grestore newpath 277.249 584.552 M 277.249 617.502 L 333.594 617.502 L 333.594 584.552 L closepath clip newpath 0 0 0 setrgbcolor matrix currentmatrix [0.784736 0 0 0.803653 279.211 586.562] concat /Courier-Bold-SHOWISO findfont 36 scalefont setfont 0 0 0 setrgbcolor 0 9.23077 M (...) 64.8 S setmatrix grestore gsave matrix currentmatrix [401 0 0 -67.5069 105 629.557] concat B setmatrix 0 0 0 setrgbcolor 2.000000 setlinewidth [4] 0 setdash gsave stroke grestore grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 134.428 453.959] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 191.168 453.959] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 250.023 453.959] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 361.455 453.959] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 414.425 453.959] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave 2.000000 setlinewidth matrix currentmatrix [13.9718 0 0 14.3086 475.242 453.959] concat newpath 0 0 1 0 360 arc 0 0 0 setrgbcolor closepath setmatrix stroke grestore gsave gsave matrix currentmatrix [0.784736 0 0 0.803653 279.211 443.511] concat newpath 0 0 M 0 36 L 66.8 36 L 66.8 0 L closepath setmatrix 0 0 0 setrgbcolor grestore newpath 277.249 441.502 M 277.249 474.452 L 333.594 474.452 L 333.594 441.502 L closepath clip newpath 0 0 0 setrgbcolor matrix currentmatrix [0.784736 0 0 0.803653 279.211 443.511] concat /Courier-Bold-SHOWISO findfont 36 scalefont setfont 0 0 0 setrgbcolor 0 9.23077 M (...) 64.8 S setmatrix grestore gsave matrix currentmatrix [401 0 0 -67.5069 105 486.507] concat B setmatrix 0 0 0 setrgbcolor 2.000000 setlinewidth [4] 0 setdash gsave stroke grestore grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 474.611 610.073 translate -90 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 474.611 619.073 M 474.611 723.585 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 417.697 610.966 translate -114.387 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 421.413 619.163 M 469.117 724.388 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 365.665 610.315 translate -130.708 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 371.535 617.137 M 465.194 725.995 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 256.377 608.155 translate -149.545 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 264.135 612.717 M 463.624 730.014 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 199.836 608.23 translate -154.379 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 207.951 612.121 M 460.485 733.228 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 149.595 606.661 translate -156.819 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 157.869 610.204 M 462.055 740.461 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 474.611 467.826 translate -90 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 474.611 476.826 M 474.611 581.338 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 417.697 468.719 translate -114.387 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 421.413 476.916 M 469.117 582.142 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 365.665 468.068 translate -130.708 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 371.535 474.891 M 465.194 583.749 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 256.377 465.909 translate -149.545 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 264.135 470.47 M 463.624 587.767 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 199.836 465.983 translate -154.379 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 207.951 469.875 M 460.485 590.982 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 149.595 464.415 translate -156.819 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 157.869 467.957 M 462.055 598.215 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 136.389 611.68 translate -90 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 136.389 722.781 M 136.389 620.68 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 187.004 610.957 translate -66.9523 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 138.744 724.388 M 183.481 619.238 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 243.769 610.318 translate -49.068 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 143.452 725.995 M 237.872 617.117 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 353.842 608.162 translate -30.0279 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 145.806 728.406 M 346.05 612.665 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 408.027 607.43 translate -25.399 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 148.16 730.817 M 399.897 611.29 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 462.98 605.871 translate -22.3264 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 148.945 734.836 M 454.655 609.29 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 134.82 470.237 translate -90 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 134.82 581.338 M 134.82 479.237 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 187.004 469.514 translate -66.9523 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 138.744 582.945 M 183.481 477.795 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 243.769 468.875 translate -49.0679 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 143.452 584.552 M 237.872 475.674 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 353.842 466.719 translate -30.0279 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 145.806 586.964 M 346.05 471.223 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 408.027 465.987 translate -25.399 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 148.16 589.374 M 399.897 469.847 L stroke grestore gsave 0 0 0 setrgbcolor gsave 0 setlinejoin 462.98 464.428 translate -22.3264 rotate 1.2 1.2 scale newpath 0 0 M -10 -3 L -10 3 L closepath fill grestore 2.000000 setlinewidth newpath 148.945 593.393 M 454.655 467.847 L stroke grestore grestore showpage saveit restore grestore %%EndDocument endTexFig 0 1002 a Fp(Figure)15 b(1:)22 b(A)15 b(la)o(y)o(ered)g(Ba)o(y)o(esian) f(net)o(w)o(ork)i(parameterizes)d(a)k(hierarc)o(hical)d(generativ)o(e)h (mo)q(del)f(for)i(the)0 1062 y(data)h(enco)q(ded)f(b)o(y)g(the)g(units) g(in)g(its)g(b)q(ottom)g(la)o(y)o(er.)0 1204 y(where)k Fn(\033)r Fp(\()p Fn(z)r Fp(\))h(=)h([1)14 b(+)g Fn(e)446 1186 y Fi(\000)p Fm(z)493 1204 y Fp(])507 1186 y Fi(\000)p Fj(1)553 1204 y Fp(;)23 b(th)o(us)e(the)f(sign)h(of)g Fn(W)1001 1211 y Fm(ij)1032 1204 y Fp(,)g(p)q(ositiv)o(e)f(or)h (negativ)o(e,)g(determines)d(whether)0 1265 y(unit)d Fn(j)j Fp(excites)c(or)h(inhibits)g(unit)g Fn(i)f Fp(in)h(the)g (generativ)o(e)f(pro)q(cess.)22 b(Though)16 b(w)o(e)f(ha)o(v)o(e)f(not) i(done)f(so)h(here,)0 1325 y(it)i(is)g(straigh)o(tforw)o(ard)h(to)g (include)e(a)h(bias)h(term)d(in)i(the)g(argumen)o(t)g(of)g(the)g (sigmoid)f(function.)27 b(Note)0 1385 y(that)19 b(the)g(sigmoid)f (nonlinearit)o(y)f(induces)i(higher-order)g(correlations)f(b)q(et)o(w)o (een)g(the)h(di\013eren)o(t)f(units)0 1445 y(in)d(the)f(net)o(w)o(ork.) 20 b(In)15 b(what)g(follo)o(ws,)g(w)o(e)f(denote)h(b)o(y)f Fn(\033)1015 1452 y Fm(i)1043 1445 y Fp(=)g Fn(\033)r Fp(\()1144 1412 y Fk(P)1187 1456 y Fm(j)1214 1445 y Fn(W)1260 1452 y Fm(ij)1290 1445 y Fn(S)1320 1452 y Fm(j)1338 1445 y Fp(\))h(the)g(squashed)g(w)o(eigh)o(ted)f(sum)0 1505 y(on)g(the)g(righ)o(t)f(hand)i(side)e(of)h(eq.)f(\(2\);)h(this)g Fo(top-down)h Fp(signal,)f(receiv)o(ed)d(b)o(y)i(eac)o(h)h(unit)f(from) g(its)g(paren)o(ts,)0 1566 y(can)j(also)h(b)q(e)g(regarded)f(as)h(a)g (random)f(v)m(ariable)f(in)h(its)g(o)o(wn)h(righ)o(t.)73 1626 y(La)o(y)o(ered)i(net)o(w)o(orks)f(of)i(this)f(form)f(\(see)h (\014gure)g(1\))h(w)o(ere)e(in)o(tro)q(duced)h(as)h(hierarc)o(hical)d (generativ)o(e)0 1686 y(mo)q(dels)c(b)o(y)h(Hin)o(ton)g(et)g(al)h (\(1995\).)22 b(In)14 b(t)o(ypical)f(applications,)i(one)f(imagines)f (the)h(units)h(in)f(the)g(b)q(ottom)0 1746 y(la)o(y)o(er)i(to)h(enco)q (de)h(sensory)f(data)h(and)g(the)f(units)g(in)g(the)g(top)h(la)o(y)o (ers)e(to)i(enco)q(de)f(di\013eren)o(t)f(dimensions)0 1806 y(of)f(v)m(ariabilit)o(y)l(.)20 b(Th)o(us,)15 b(for)g(example,)e (in)i(net)o(w)o(orks)g(for)g(image)f(recognition,)h(the)g(b)q(ottom)g (units)g(migh)o(t)0 1867 y(enco)q(de)f(pixel)f(v)m(alues,)h(while)g (the)g(top)g(units)h(enco)q(de)f(higher-order)g(features)h(suc)o(h)f (as)g(orien)o(tation)g(and)0 1927 y(o)q(cclusion.)29 b(The)19 b(promise)e(of)i(these)g(net)o(w)o(orks)f(lies)g(in)g(their)g (abilit)o(y)g(to)h(parameterize)d(hierarc)o(hical,)0 1987 y(non-linear)g(mo)q(dels)g(of)g(m)o(ultiple)d(in)o(teracting)i (causes.)73 2047 y(E\013ectiv)o(e)h(use)h(of)g(these)g(net)o(w)o(orks)f (requires)g(the)h(abilit)o(y)f(to)h(mak)o(e)e(probabilistic)h (inferences.)22 b(Es-)0 2107 y(sen)o(tially)l(,)16 b(these)i(are)g (queries)g(to)g(ascertain)g(lik)o(ely)e(v)m(alues)i(for)g(certain)g (units)g(in)g(the)f(net)o(w)o(ork,)h(giv)o(en)0 2167 y(v)m(alues|or)j Fo(evidenc)n(e)p Fp(|for)h(other)e(units.)34 b(Let)21 b Fn(V)31 b Fp(denote)21 b(the)f(visible)f(units)h(for)h(whic) o(h)f(v)m(alues)g(are)0 2228 y(kno)o(wn,)e(and)h Fn(H)k Fp(the)18 b(hidden)g(units)g(for)g(whic)o(h)g(v)m(alues)g(m)o(ust)f(b)q (e)h(inferred.)26 b(In)18 b(principle,)e(inferences)0 2288 y(can)g(b)q(e)h(made)e(from)g(the)h(p)q(osterior)h(distribution:) 750 2423 y Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\))h(=)994 2389 y Fn(P)7 b Fp(\()p Fn(H)q(;)h(V)k Fp(\))p 994 2411 179 2 v 1026 2457 a Fn(P)7 b Fp(\()p Fn(V)k Fp(\))1178 2423 y Fn(;)696 b Fp(\(3\))0 2561 y(where)19 b Fn(P)7 b Fp(\()p Fn(H)q(;)h(V)k Fp(\))19 b(is)g(the)h(join)o(t)f(distribution) f(o)o(v)o(er)h(hidden)g(and)h(visible)e(units,)h(as)h(giv)o(en)f(b)o(y) g(eq.)f(\(1\),)0 2621 y(and)i Fn(P)7 b Fp(\()p Fn(V)12 b Fp(\))20 b(=)292 2587 y Fk(P)336 2631 y Fm(H)378 2621 y Fn(P)7 b Fp(\()p Fn(H)q(;)h(V)k Fp(\))19 b(is)h(the)g(marginal)f (distribution)g(obtained)h(b)o(y)g(summing)d(o)o(v)o(er)i(all)h(con-) 963 2795 y(4)p eop %%Page: 5 5 5 4 bop 0 50 a Fp(\014gurations)20 b(of)f(hidden)f(units.)28 b(Exact)18 b(probabilistic)g(inference,)f(ho)o(w)o(ev)o(er,)g(is)h (generally)g(in)o(tractable)0 110 y(in)h(large)g(Ba)o(y)o(esian)g(net)o (w)o(orks)f(\(Co)q(op)q(er,)k(1990\).)31 b(In)20 b(particular,)f(if)g (there)f(are)i(man)o(y)e(hidden)h(units,)0 170 y(then)d(the)g(sum)f(to) h(compute)f Fn(P)7 b Fp(\()p Fn(V)k Fp(\))16 b(in)o(v)o(olv)o(es)e(an)j (exp)q(onen)o(tially)e(large)h(n)o(um)o(b)q(er)e(of)i(terms.)k(The)c (same)0 230 y(di\016cult)o(y)e(mak)o(es)h(it)h(imp)q(ossible)e(to)j (compute)e(statistics)h(of)g(the)g(p)q(osterior)h(distribution,)e Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\).)73 291 y(Besides)18 b(the)g(problem)f(of)i(inference,)e(one)h(can)h(also)g (consider)f(the)g(problem)f(of)i(learning,)f(or)h(pa-)0 351 y(rameter)h(estimation,)h(in)g(these)g(net)o(w)o(orks.)37 b(Unsup)q(ervised)21 b(learning)g(algorithms)g(in)g(probabilistic)0 411 y(net)o(w)o(orks)d(are)h(designed)g(to)g(maximi)o(ze)d(the)i (log-lik)o(eliho)q(o)q(d)1146 393 y Fj(1)1184 411 y Fp(of)h(observ)o (ed)g(data.)29 b(The)19 b(lik)o(eliho)q(o)q(d)f(of)0 471 y(eac)o(h)d(data)h(v)o(ector)e(is)h(giv)o(en)f(b)o(y)g(the)h (marginal)f(distribution,)h Fn(P)7 b Fp(\()p Fn(V)k Fp(\))j(=)1349 438 y Fk(P)1393 482 y Fm(H)1435 471 y Fn(P)7 b Fp(\()p Fn(H)q(;)h(V)k Fp(\).)20 b(Lo)q(cal)c(learning)0 531 y(rules)g(are)h(deriv)o(ed)f(b)o(y)g(computing)g(the)h(gradien)o(ts)f (of)i(the)e(log-lik)o(eliho)q(o)q(d,)g(ln)8 b Fn(P)f Fp(\()p Fn(V)12 b Fp(\),)k(with)h(resp)q(ect)g(to)0 592 y(the)f(w)o(eigh)o(ts)f(of)h(the)f(net)o(w)o(ork)g(\(Neal,)g(1992;)i (Binder)e(et)g(al,)g(1997\).)23 b(F)l(or)16 b(eac)o(h)f(data)i(v)o (ector,)d(this)i(giv)o(es)0 652 y(the)g(online)g(up)q(date:)722 712 y(\001)p Fn(W)809 719 y Fm(ij)852 712 y Fl(/)e Fp(E)8 b([\()p Fn(S)1009 719 y Fm(i)1034 712 y Fl(\000)j Fn(\033)1112 719 y Fm(i)1126 712 y Fp(\))p Fn(S)1175 719 y Fm(j)1193 712 y Fp(])d Fn(;)659 b Fp(\(4\))0 799 y(where)18 b(E[)p Fl(\001)8 b(\001)g(\001)p Fp(])18 b(denotes)h(an)g(exp)q(ectation)g (with)f(resp)q(ect)h(to)g(the)f(conditional)h(distribution,)f Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\),)0 859 y(and)20 b Fn(\033)126 866 y Fm(i)159 859 y Fp(=)g Fn(\033)r Fp(\()266 826 y Fk(P)309 870 y Fm(j)335 859 y Fn(W)381 866 y Fm(ij)412 859 y Fn(S)442 866 y Fm(j)460 859 y Fp(\))f(is)h(the)f(top-do)o(wn)i (signal)e(from)g(the)g(paren)o(ts)h(of)f(the)h Fn(i)p Fp(th)f(unit.)30 b(Note)20 b(that)0 919 y(the)g(up)q(date)i(tak)o(es)e (the)g(form)g(of)h(a)g(delta)f(rule,)g(with)h(the)f(top-do)o(wn)i (signal)f Fn(\033)1536 926 y Fm(i)1570 919 y Fp(b)q(eing)g(matc)o(hed)e (to)0 980 y(the)j(target)h(v)m(alue)g(pro)o(vided)f(b)o(y)g Fn(S)684 987 y Fm(i)698 980 y Fp(.)40 b(In)o(tuitiv)o(ely)l(,)21 b(the)h(learning)h(rule)f(adjusts)h(the)g(w)o(eigh)o(ts)f(bring)0 1040 y(eac)o(h)16 b(unit's)g(exp)q(ected)f(v)m(alue)h(in)g(line)f(with) h(an)h(appropriate)g(target)g(v)m(alue.)k(These)16 b(target)h(v)m (alues)f(are)0 1100 y(sp)q(eci\014ed)g(explicitly)f(b)o(y)h(the)h (evidence)e(for)i(the)g(visible)e(units)i(in)g(the)f(net)o(w)o(ork.)23 b(F)l(or)17 b(the)g(other)g(units)0 1160 y(in)e(the)h(net)o(w)o (ork|the)f(hidden)g(units|appropriate)h(target)h(v)m(alues)e(m)o(ust)g (b)q(e)h(computed)e(b)o(y)i(running)0 1220 y(an)h(inference)d (algorithm.)73 1281 y(Generally)g(sp)q(eaking,)i(in)e(large)h(la)o(y)o (ered)f(net)o(w)o(orks,)g(w)o(e)h(can)g(neither)f(compute)g(the)g (log-lik)o(eliho)q(o)q(d)0 1341 y(ln)8 b Fn(P)f Fp(\()p Fn(V)k Fp(\))19 b(nor)h(the)e(statistics)h(of)g Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\))18 b(that)i(app)q(ear)g(in)e (the)h(learning)f(rule,)h(eq.)e(\(4\).)30 b(A)18 b(learning)0 1401 y(pro)q(cedure)c(can)g(\014nesse)f(these)h(problems)e(in)i(t)o(w)o (o)f(w)o(a)o(ys:)20 b(\(i\))13 b(b)o(y)g(optimizing)f(the)i(w)o(eigh)o (ts)f(with)g(resp)q(ect)0 1461 y(to)h(a)g(more)e(tractable)h(cost)h (function,)g(or)g(\(ii\))e(b)o(y)h(substituting)h(appro)o(ximate)e(v)m (alues)i(for)g(the)f(statistics)0 1521 y(of)k(the)g(hidden)g(units.)24 b(As)17 b(w)o(e)g(shall)g(see,)f(b)q(oth)i(strategies)f(are)h(emplo)o (y)o(ed)c(in)j(the)g(mean)f(\014eld)g(theory)0 1582 y(for)h(these)e (net)o(w)o(orks.)0 1748 y Fq(3)81 b(Mean)26 b(\014eld)g(theory)0 1857 y Fp(Mean)14 b(\014eld)f(theory)g(is)h(a)g(general)f(metho)q(d)g (from)g(statistical)g(mec)o(hanics)f(for)i(estimating)e(the)h (statistics)0 1918 y(of)g(correlated)e(random)h(v)m(ariables)h(\(P)o (arisi,)f(1988\).)21 b(The)13 b(name)e(arises)i(from)e(ph)o(ysical)g (mo)q(dels)h(in)g(whic)o(h)0 1978 y(w)o(eigh)o(ted)f(sums)f(of)i (random)g(v)m(ariables,)g(suc)o(h)f(as)914 1945 y Fk(P)958 1988 y Fm(j)985 1978 y Fn(W)1031 1985 y Fm(ij)1061 1978 y Fn(S)1091 1985 y Fm(j)1109 1978 y Fp(,)h(are)g(in)o(terpreted)e(as)i (lo)q(cal)g(magnetic)e(\014elds.)0 2038 y(Roughly)k(sp)q(eaking,)h (under)f(certain)g(conditions,)g(a)h(cen)o(tral)e(limit)e(theorem)i(ma) o(y)g(b)q(e)h(applied)g(to)g(these)0 2098 y(sums,)d(and)i(a)f(useful)f (appro)o(ximation)g(is)g(to)i(ignore)e(the)h(\015uctuations)g(in)g (these)f(\014elds)g(and)i(replace)e(them)0 2158 y(b)o(y)17 b(their)g(mean)f(v)m(alue|hence)g(the)i(name,)e(\\mean)h(\014eld")g (theory)l(.)25 b(More)17 b(sophisticated)h(v)o(ersions)f(of)0 2219 y(the)h(appro)o(ximation)f(also)i(exist,)f(in)g(whic)o(h)f(one)i (incorp)q(orates)g(the)f(leading)g(terms)f(in)h(an)h(expansion)0 2279 y(ab)q(out)f(the)e(mean.)73 2339 y(The)c(mean)f(\014eld)h(appro)o (ximation)f(w)o(as)h(originally)g(dev)o(elop)q(ed)f(for)h(Gibbs)g (distributions,)h(as)f(arise)g(in)0 2399 y(MRFs.)19 b(In)11 b(this)g(pap)q(er,)i(w)o(e)d(dev)o(elop)h(a)g(mean)f(\014eld)h(appro)o (ximation)f(for)i(large)f(la)o(y)o(ered)f(net)o(w)o(orks)g(whose)0 2459 y(probabilistic)k(seman)o(tics)e(are)j(giv)o(en)f(b)o(y)g(eqs.)f (\(1{2\).)22 b(As)15 b(in)f(MRFs,)g(our)h(appro)o(ximation)e(exploits)h (the)p 0 2544 780 2 v 56 2575 a Fg(1)75 2590 y Ff(F)m(or)19 b(simplicit)o(y)f(of)i(exp)q(osition,)h(w)o(e)f(do)g(not)g(consider)h (forms)e(of)g(regularization)h(\(e.g.,)g(p)q(enalized)h(lik)o(eliho)q (o)q(ds,)0 2640 y(cross-v)n(alidation\))13 b(that)h(ma)o(y)e(b)q(e)i (necessary)i(to)e(prev)o(en)o(t)h(o)o(v)o(er\014tting.)963 2795 y Fp(5)p eop %%Page: 6 6 6 5 bop 0 50 a Fp(a)o(v)o(eraging)23 b(phenomena)e(that)j(o)q(ccur)e (at)i(units)e(whose)i(conditional)e(distributions,)i Fn(P)7 b Fp(\()p Fn(S)1736 57 y Fm(i)1750 50 y Fl(j)p Fn(\031)1792 57 y Fm(S)1813 62 y Fh(i)1828 50 y Fp(\),)24 b(are)0 110 y(parameterized)16 b(in)h(terms)g(of)h(w)o(eigh)o(ted)f (sums,)g(suc)o(h)g(as)1088 77 y Fk(P)1132 120 y Fm(j)1158 110 y Fn(W)1204 117 y Fm(ij)1235 110 y Fn(S)1265 117 y Fm(j)1283 110 y Fp(.)26 b(Addressing)18 b(the)f(t)o(win)h(issues)g (of)0 170 y(inference)f(and)j(learning,)e(the)h(appro)o(ximation)f (enables)g(one)h(to)g(compute)f(e\013ectiv)o(e)f(substitutes)i(for)0 230 y(the)d(log-lik)o(eliho)q(o)q(d,)f(ln)8 b Fn(P)f Fp(\()p Fn(V)12 b Fp(\),)k(and)g(the)g(statistics)g(of)h(the)f(p)q (osterior)h(distribution,)e Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\).)73 291 y(The)k(organization)g(of)g(this)g(section)f (is)h(as)g(follo)o(ws.)21 b(Section)15 b(3.1)h(describ)q(es)f(the)h (general)f(approac)o(h)0 351 y(b)q(ehind)k(the)g(mean)f(\014eld)h (appro)o(ximation.)29 b(Among)18 b(its)h(man)o(y)f(in)o(terpretations,) h(mean)f(\014eld)g(theory)0 411 y(can)h(b)q(e)h(view)o(ed)d(as)j(a)g (principled)d(w)o(a)o(y)i(of)h(appro)o(ximating)e(an)h(in)o(tractable)f (probabilistic)h(mo)q(del)f(b)o(y)0 471 y(a)g(tractable)e(one.)24 b(This)18 b(is)f(done)g(via)g(a)g(v)m(ariational)h(principle)d(that)j (c)o(ho)q(oses)g(the)f(parameters)f(of)h(the)0 531 y(tractable)g(mo)q (del)e(to)i(minimi)o(ze)d(an)j(en)o(tropic)f(measure)g(of)h(error.)23 b(The)17 b(parameters)f(of)h(the)f(tractable)0 592 y(mo)q(del)g(are)h (kno)o(wn)h(as)g(the)f(mean)f(\014eld)g(parameters,)g(and)i(they)f (serv)o(e)f(as)i(placeholders)f(for)g(the)g(true)0 652 y(statistics)f(of)h(the)f(p)q(osterior)g(distribution,)g Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\).)73 712 y(Our)k(most)f(imp) q(ortan)o(t)g(result)g(for)h(feedforw)o(ard)f(neural)h(net)o(w)o(orks)f (is)h(a)g(compact)e(set)i(of)g(equations)0 772 y(for)j(determining)d (the)i(mean)g(\014eld)g(parameters.)24 b(These)17 b Fo(me)n(an)i (\014eld)h(e)n(quations)e Fp(relate)f(the)g(statistics)0 832 y(of)j(eac)o(h)e(unit)h(to)h(those)g(of)f(its)g(Mark)o(o)o(v)g (blank)o(et.)29 b(Section)19 b(3.2)h(giv)o(es)e(a)i(succinct)e (statemen)o(t)g(of)h(the)0 892 y(mean)d(\014eld)h(equations,)h(along)g (with)f(a)h(n)o(um)o(b)q(er)e(of)i(useful)f(in)o(tuitions.)24 b(A)17 b(more)f(detailed)g(deriv)m(ation)0 953 y(is)g(giv)o(en)f(in)h (the)g(app)q(endix.)73 1013 y(The)d(mean)e(\014eld)h(equations)h(are)f (a)h(coupled)f(set)h(of)g(nonlinear)f(equations,)h(whose)g(solutions)g (cannot)0 1073 y(b)q(e)20 b(expressed)f(in)h(closed)f(form.)31 b(Naturally)l(,)20 b(this)f(raises)h(the)g(follo)o(wing)f(concern:)28 b(ha)o(v)o(e)19 b(w)o(e)h(merely)0 1133 y(replaced)e(one)h(in)o (tractable)e(problem|that)g(of)i(calculating)f(a)o(v)o(erages)h(o)o(v)o (er)f(the)g(p)q(osterior)h(distribu-)0 1193 y(tion,)d Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\)|b)o(y)k(an)h(equally)e (in)o(tractable)h(one|that)h(of)g(solving)g(the)f(mean)g(\014eld)g (equations?)23 b(In)0 1254 y(section)e(3.3,)h(w)o(e)f(sho)o(w)g(ho)o(w) h(to)f(solv)o(e)g(the)f(mean)g(\014eld)h(equations)g(using)h(an)f (attractor)h(dynamics.)0 1314 y(This)15 b(mak)o(es)f(it)g(quite)g (straigh)o(tforw)o(ard)i(to)g(solv)o(e)e(the)h(mean)f(\014eld)g (equations,)h(t)o(ypically)e(at)i(m)o(uc)o(h)e(less)0 1374 y(computational)i(cost)i(than)g(\(sa)o(y\))f(sampling)f(the)h (statistics)g(of)h Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\).)73 1434 y(Finally)l(,)20 b(in)h(section)f(3.4,)i(w)o(e)e(presen) o(t)g(a)h(mean)f(\014eld)g(learning)h(algorithm)e(for)i(these)g(net)o (w)o(orks.)0 1494 y(W)l(eigh)o(ts)14 b(are)h(adapted)h(b)o(y)e(a)h (regularized)f(delta)h(rule)f(that)h(dep)q(ends)g(only)g(on)g(lo)q (cally)f(a)o(v)m(ailable)g(infor-)0 1555 y(mation.)20 b(In)o(terestingly)l(,)13 b(the)j(attractor)g(dynamics)e(for)h(solving) h(the)f(mean)f(\014eld)h(equations)h(generates)0 1615 y(precisely)e(those)j(signals)g(required)e(for)h(unsup)q(ervised)h (learning.)0 1759 y Fe(3.1)66 b(A)22 b(v)l(ariational)j(principl)q(e)0 1852 y Fp(W)l(e)12 b(no)o(w)g(return)g(to)g(the)g(problem)e(of)i (probabilistic)f(inference)g(in)g(la)o(y)o(ered)g(feedforw)o(ard)h(net) o(w)o(orks.)19 b(Our)0 1912 y(goal)d(is)g(to)f(obtain)h(the)g (statistics)f(of)h(the)f(p)q(osterior)h(distribution,)f Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\),)k(for)h(some)f(full)f(or)i (partial)0 1972 y(instan)o(tiation)d Fn(V)25 b Fp(of)13 b(the)g(units)h(in)e(the)h(net)o(w)o(ork.)20 b(Since)12 b(it)h(is)g(generally)g(in)o(tractable)f(to)i(compute)d(these)0 2032 y(statistics)18 b(exactly)l(,)e(w)o(e)h(adopt)i(the)e(follo)o (wing)h(t)o(w)o(o-step)g(approac)o(h:)25 b(\(i\))17 b(in)o(tro)q(duce)g (a)h(parameterized)0 2092 y(family)9 b(of)j(simpler)e(distributions)h (whose)h(statistics)g(are)f(easily)g(computed;)h(\(ii\))e(appro)o (ximate)g Fn(P)d Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\))0 2153 y(b)o(y)j(the)g(mem)n(b)q(er)d(of)k(this)f(family)e(whic)o(h)h(is) h(\\closest",)h(as)f(determined)e(b)o(y)i(some)f(en)o(tropic)g(measure) g(of)0 2213 y(distance.)73 2273 y(The)j(starting)g(p)q(oin)o(t)f(of)h (the)f(mean)g(\014eld)g(appro)o(ximation)f(is)h(to)h(consider)f(the)h (family)d(of)j Fo(factorial)0 2333 y Fp(distributions:)654 2393 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)10 b Fp(\))k(=)900 2352 y Fk(Y)893 2444 y Fm(i)p Fi(2)p Fm(H)968 2393 y Fn(\026)997 2371 y Fm(S)1018 2376 y Fh(i)997 2405 y Fm(i)1034 2393 y Fp(\(1)e Fl(\000)f Fn(\026)1168 2400 y Fm(i)1182 2393 y Fp(\))1201 2373 y Fj(1)p Fi(\000)p Fm(S)1267 2378 y Fh(i)1283 2393 y Fn(:)591 b Fp(\(5\))0 2516 y(The)20 b(parameters)g Fn(\026)390 2523 y Fm(i)424 2516 y Fp(represen)o(t)g (the)g(mean)f(v)m(alues)h(of)h(the)f(hidden)g(units)g(under)h(the)f (factorial)g(dis-)0 2576 y(tribution,)g Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\).)35 b(Note)20 b(that)h(b)o(y)f(design,)i (most)e(statistics)g(of)h Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\))21 b(are)g(easy)f(to)h(compute)0 2636 y(b)q(ecause)16 b(the)g(distribution)g(is)g(factorial.)963 2795 y(6)p eop %%Page: 7 7 7 6 bop 73 50 a Fp(W)l(e)18 b(can)h(measure)f(the)g(distance)g(b)q(et)o (w)o(een)g(the)g(distribution)g Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\))19 b(in)f(eq.)g(\(5\))h(and)g(the)f(true)0 110 y(p)q(osterior)f(distribution)f Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\))16 b(b)o(y)g(the)g(Kullbac)o(k-Leibler)e (\(KL\))j(div)o(ergence:)555 251 y Fn(K)t(L)p Fp(\()p Fn(Q)p Fl(jj)p Fn(P)7 b Fp(\))14 b(=)841 210 y Fk(X)856 302 y Fm(H)910 251 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)d Fp(\))d(ln)1141 178 y Fk(")1170 217 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)j Fp(\))p 1170 240 174 2 v 1170 285 a Fn(P)c Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\))1349 178 y Fk(#)1381 251 y Fn(:)493 b Fp(\(6\))0 397 y(The)17 b(KL)g(div)o(ergence)e(is)h(strictly)f(non-negativ)o(e,)i(v)m(anishing) g(only)f(if)h Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\))j(=)h Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\).)23 b(The)16 b(idea)0 457 y(b)q(ehind)e(the)f(mean)g(\014eld)g(appro)o (ximation)f(is)i(to)g(\014nd)g(the)f(parameters)g Fl(f)p Fn(\026)1377 464 y Fm(i)1391 457 y Fl(g)h Fp(that)g(minimi)o(ze)c(KL)q (\()p Fn(Q)p Fl(jj)p Fn(P)d Fp(\))0 517 y(and)18 b(then)g(to)g(use)g (the)f(statistics)h(of)g Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\))18 b(as)g(a)g(substitute)g(for)g(the)f(statistics)h(of) g Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\).)26 b(The)0 578 y(\014rst)20 b(step)g(of)g(this)g(calculation)f(is)g(to)i(rewrite)d (the)i(p)q(osterior)g(distribution)g Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\))20 b(using)g(eq.)f(\(3\),)0 638 y(th)o(us)d(breaking)g(the)g(righ)o(t)g(hand)h(side)f(of)h(eq.)e (\(5\))h(in)o(to)g(three)g(terms:)207 748 y Fn(K)t(L)p Fp(\()p Fn(Q)p Fl(jj)p Fn(P)7 b Fp(\))13 b(=)493 706 y Fk(X)507 798 y Fm(H)561 748 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)e Fp(\))d(ln)g Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)j Fp(\))g Fl(\000)1027 706 y Fk(X)1041 798 y Fm(H)1095 748 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)g Fp(\))d(ln)h Fn(P)e Fp(\()p Fn(H)q(;)h(V)j Fp(\))h(+)f(ln)c Fn(P)g Fp(\()p Fn(V)12 b Fp(\))p Fn(:)144 b Fp(\(7\))0 891 y(The)22 b(\014rst)g(t)o(w)o(o)g(terms)f(on)h(the)g(righ)o(t)g(hand)g(side)g(of) g(this)g(equation)g(dep)q(end)g(on)h(prop)q(erties)f(of)g(the)0 951 y(appro)o(ximate)h(distribution,)i Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\):)36 b(the)24 b(\014rst)h(measures)e(the)g (\(negativ)o(e\))g(en)o(trop)o(y)l(,)i(while)e(the)0 1011 y(second)18 b(term)e(measures)g(the)i(exp)q(ected)f(v)m(alue)g(of) h(ln)8 b Fn(P)f Fp(\()p Fn(H)q(;)h(V)k Fp(\).)25 b(The)18 b(last)g(term)e(in)h(eq.)g(\(7\))h(is)f(simply)0 1071 y(the)d(log-lik)o(eliho)q(o)q(d)g(of)h(the)f(evidence,)f(whic)o(h|imp)q (ortan)o(tly|do)q(es)f(not)j(dep)q(end)f(on)h(the)f(statistics)h(of)0 1132 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)c Fp(\).)26 b(Th)o(us)19 b(this)f(last)g(term)e(can)i(b)q(e)g(ignored)g(when)g(w)o (e)g(minim)o(ize)c(KL)q(\()p Fn(Q)p Fl(jj)p Fn(P)7 b Fp(\))17 b(with)h(resp)q(ect)g(to)0 1192 y(the)f(parameters)g Fl(f)p Fn(\026)393 1199 y Fm(i)407 1192 y Fl(g)p Fp(.)26 b(It)17 b(nev)o(ertheless)f(has)j(imp)q(ortan)o(t)d(consequences)h(for) h(learning,)g(a)g(sub)s(ject)f(to)0 1252 y(whic)o(h)f(w)o(e)f(return)h (in)g(section)g(3.4.)0 1396 y Fe(3.2)66 b(Mean)22 b(\014eld)i (equations)0 1489 y Fp(The)11 b(\014rst-order)h(statistics)g(of)f Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)g Fp(\))h(that)g(minim)o(iz)o(e)c(KL) q(\()p Fn(Q)p Fl(jj)p Fn(P)f Fp(\))k(naturally)g(dep)q(end)g(on)h(the)g (w)o(eigh)o(ts)0 1549 y(of)19 b(the)g(net)o(w)o(ork,)f Fn(W)393 1556 y Fm(ij)423 1549 y Fp(,)h(and)h(the)e(evidence,)g Fn(V)11 b Fp(.)29 b(This)19 b(dep)q(endence)f(is)g(captured)h(b)o(y)f (the)h(mean)f(\014eld)0 1609 y(equations,)i(whic)o(h)f(are)h(deriv)o (ed)e(b)o(y)h(ev)m(aluating)g(and)i(minim)o(iz)o(ing)c(the)i(righ)o(t)g (hand)i(side)e(of)h(eq.)e(\(7\).)0 1669 y(The)h(details)g(of)g(this)g (calculation,)f(though)j(in)o(teresting)c(in)i(sev)o(eral)f(resp)q (ects,)h(are)g(presen)o(ted)g(in)f(the)0 1730 y(app)q(endix.)30 b(In)18 b(what)i(follo)o(ws,)f(w)o(e)g(presen)o(t)f(the)h(mean)f (\014eld)g(equations)h(as)h(a)f Fo(fait)h(ac)n(c)n(ompli)f Fp(so)h(that)0 1790 y(w)o(e)j(ma)o(y)g(emphasize)e(the)j(main)e(in)o (tuitions)h(that)i(emerge)c(from)i(the)h(appro)o(ximation)e(of)i Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\))0 1850 y(b)o(y)k Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\).)73 1910 y(F)l(or)k(sigmoid)f(D)o(A)o(Gs,)g(the)h(mean)e(\014eld)h(appro)o (ximation)g(w)o(orks)h(b)o(y)f(k)o(eeping)g(trac)o(k)g(of)h Fo(two)h Fp(parame-)0 1970 y(ters,)g Fl(f)p Fn(\026)163 1977 y Fm(i)177 1970 y Fn(;)8 b(\030)220 1977 y Fm(i)234 1970 y Fl(g)p Fp(,)16 b(for)g(eac)o(h)g(unit)g(in)g(the)g(net)o(w)o (ork.)k(Though)e(only)e(the)g(\014rst)g(of)h(these)e(app)q(ears)j (explicitly)0 2030 y(in)g(eq.)f(\(5\),)i(it)f(turns)h(out)g(that)f(b)q (oth)i(are)e(needed)g(to)g(ev)m(aluate)h(and)g(minim)o(iz)o(e)c(the)j (righ)o(t)g(hand)h(side)0 2091 y(of)f(eq.)f(\(7\).)27 b(Roughly)18 b(sp)q(eaking,)h(these)f(parameters)f(are)h(stored)g(as)h (appro)o(ximations)e(to)i(the)e(statis-)0 2151 y(tics)g(of)h(the)f (true)g(p)q(osterior)h(distribution:)23 b(in)17 b(particular,)g Fn(\026)1157 2158 y Fm(i)1188 2151 y Fl(\031)e Fp(E[)p Fn(S)1319 2158 y Fm(i)1333 2151 y Fl(j)p Fn(V)c Fp(])17 b(appro)o(ximates)g(eac)o(h)g(unit's)0 2211 y(p)q(osterior)j(mean,)f (while)g Fn(\030)508 2218 y Fm(i)542 2211 y Fl(\031)g Fp(E[)p Fn(\033)675 2218 y Fm(i)688 2211 y Fl(j)p Fn(V)11 b Fp(])20 b(appro)o(ximates)e(the)h(exp)q(ected)g(top-do)o(wn)i(signal) e(in)h(eq.)e(\(2\).)0 2271 y(In)f(some)g(trivial)f(cases,)i(these)f (statistics)h(can)g(b)q(e)f(computed)g(exactly:)23 b(for)17 b(visible)g(units,)g(E[)p Fn(S)1819 2278 y Fm(i)1833 2271 y Fl(j)p Fn(V)11 b Fp(])17 b(is)0 2331 y(iden)o(tically)11 b(zero)i(or)h(one,)g(as)g(determined)d(b)o(y)i(the)g(evidence,)f(and)i (for)g(units)g(with)f(no)h(paren)o(ts,)g(E[)p Fn(\033)1870 2338 y Fm(i)1883 2331 y Fl(j)p Fn(V)d Fp(])0 2392 y(is)16 b(constan)o(t,)g(indep)q(enden)o(t)f(of)i(the)f(evidence.)j(More)d (generally)l(,)f(though,)h(these)g(statistics)g(cannot)h(b)q(e)0 2452 y(exactly)e(computed,)f(and)j(the)f(parameters)g Fl(f)p Fn(\026)892 2459 y Fm(i)906 2452 y Fn(;)8 b(\030)949 2459 y Fm(i)963 2452 y Fl(g)16 b Fp(represen)o(t)g(appro)o(ximate)e(v)m (alues.)73 2512 y(The)k(v)m(alues)f(of)h(the)g(mean)e(\014eld)h (parameters)g Fl(f)p Fn(\026)1010 2519 y Fm(i)1024 2512 y Fn(;)8 b(\030)1067 2519 y Fm(i)1082 2512 y Fl(g)17 b Fp(are)h(computed)e(b)o(y)h(solving)h(a)g(coupled)f(set)963 2795 y(7)p eop %%Page: 8 8 8 7 bop 0 50 a Fp(of)17 b(nonlinear)f(equations.)21 b(F)l(or)16 b(large,)g(la)o(y)o(ered)f(net)o(w)o(orks,)g(these)h(mean)f(\014eld)h (equations)g(are:)230 201 y Fn(\026)259 208 y Fm(i)315 201 y Fp(=)41 b Fn(\033)432 115 y Fk(2)432 190 y(4)460 159 y(X)482 250 y Fm(j)528 201 y Fn(W)574 208 y Fm(ij)604 201 y Fn(\026)633 208 y Fm(j)663 201 y Fp(+)712 159 y Fk(X)734 250 y Fm(j)780 201 y Fn(W)826 208 y Fm(j)r(i)857 201 y Fp(\()p Fn(\026)905 208 y Fm(j)934 201 y Fl(\000)11 b Fn(\030)1005 208 y Fm(j)1024 201 y Fp(\))g Fl(\000)1108 167 y Fp(1)p 1108 189 25 2 v 1108 235 a(2)1138 201 y(\(1)g Fl(\000)g Fp(2)p Fn(\026)1295 208 y Fm(i)1310 201 y Fp(\))1337 159 y Fk(X)1359 250 y Fm(j)1405 201 y Fn(W)1458 180 y Fj(2)1451 213 y Fm(j)r(i)1482 201 y Fn(\030)1503 208 y Fm(j)1521 201 y Fp(\(1)h Fl(\000)f Fn(\030)1647 208 y Fm(j)1665 201 y Fp(\))1684 115 y Fk(3)1684 190 y(5)1888 201 y Fp(\(8\))238 367 y Fn(\030)259 374 y Fm(i)315 367 y Fp(=)41 b Fn(\033)432 281 y Fk(2)432 356 y(4)460 325 y(X)482 416 y Fm(j)528 367 y Fn(W)574 374 y Fm(ij)604 367 y Fn(\026)633 374 y Fm(j)663 367 y Fp(+)717 333 y(1)p 717 355 V 717 401 a(2)746 367 y(\(1)12 b Fl(\000)f Fp(2)p Fn(\030)896 374 y Fm(i)910 367 y Fp(\))937 325 y Fk(X)960 416 y Fm(j)1006 367 y Fn(W)1059 346 y Fj(2)1052 379 y Fm(ij)1082 367 y Fn(\026)1111 374 y Fm(j)1130 367 y Fp(\(1)g Fl(\000)g Fn(\026)1263 374 y Fm(j)1282 367 y Fp(\))1301 281 y Fk(3)1301 356 y(5)1888 367 y Fp(\(9\))0 518 y(In)19 b(certain)f(cases,)i(these)e(equations)i(ma)o(y)d(ha)o(v)o(e)h(m)o (ultiple)e(solutions.)31 b(Roughly)19 b(sp)q(eaking,)h(in)e(these)0 578 y(cases,)13 b(eac)o(h)f(solution)g(corresp)q(onds)i(to)f(the)f (statistics)g(of)h(a)f(di\013eren)o(t)g(mo)q(de)f(\(or)i(p)q(eak\))g (of)f(the)g(p)q(osterior)0 638 y(distribution.)73 698 y(The)17 b(mean)e(\014eld)h(equations)h(couple)f(the)g(parameters)g(of) g(eac)o(h)h(unit)f(to)h(those)g(of)f(its)h(paren)o(ts)f(and)0 758 y(c)o(hildren.)25 b(In)18 b(la)o(y)o(ered)e(net)o(w)o(orks,)i(this) g(amoun)o(ts)f(to)i(a)f(direct)f(coupling)h(b)q(et)o(w)o(een)f(units)h (in)g(adjacen)o(t)0 818 y(la)o(y)o(ers.)25 b(The)18 b(terms)e(inside)h (the)h(brac)o(k)o(ets)f(of)h(eqs.)f(\(8{9\))i(can)f(b)q(e)g(view)o(ed)e (as)j(e\013ectiv)o(e)c(in\015uences)j(on)0 879 y(eac)o(h)d(unit)g(in)g (the)g(net)o(w)o(ork.)20 b(Let)15 b(us)h(examine)d(these)i (in\015uences,)f(concen)o(trating)h(for)g(the)g(momen)o(t)e(on)0 939 y(the)k(leading-order)g(terms)e(linear)h(in)h(the)g(w)o(eigh)o(ts,) f Fn(W)1030 946 y Fm(ij)1060 939 y Fp(.)23 b(In)17 b(eq.)f(\(8\),)h(w)o (e)f(see)h(that)g(the)g(parameter)f Fn(\026)1936 946 y Fm(i)0 999 y Fp(dep)q(ends)j(on)h(the)f(statistics)g(of)g(its)g(Mark) o(o)o(v)f(blank)o(et)h(\(P)o(earl,)f(1988\)|i.e.,)h(on)h(its)f(paren)o (ts)g(through)0 1059 y(the)c(w)o(eigh)o(ted)f(sum)387 1026 y Fk(P)431 1070 y Fm(j)458 1059 y Fn(W)504 1066 y Fm(ij)534 1059 y Fn(\026)563 1066 y Fm(j)581 1059 y Fp(,)h(on)h(its)f(c)o(hildren)e(through)k(the)d(w)o(eigh)o(ted)h(sum) 1499 1026 y Fk(P)1542 1070 y Fm(j)1569 1059 y Fn(W)1615 1066 y Fm(j)r(i)1645 1059 y Fn(\026)1674 1066 y Fm(j)1693 1059 y Fp(,)g(and)h(on)f(the)0 1119 y(paren)o(ts)c(of)h(its)e(c)o (hildren)g(through)i(the)f(w)o(eigh)o(ted)f(sum)1015 1086 y Fk(P)1059 1130 y Fm(j)1085 1119 y Fn(W)1131 1126 y Fm(j)r(i)1162 1119 y Fn(\030)1183 1126 y Fm(j)1201 1119 y Fp(.)20 b(Note)11 b(that)g(this)g(last)g(term,)1750 1086 y Fk(P)1794 1130 y Fm(j)1821 1119 y Fn(W)1867 1126 y Fm(j)r(i)1897 1119 y Fn(\030)1918 1126 y Fm(j)1936 1119 y Fp(,)0 1180 y(captures)19 b(the)g(e\013ect)f(of)i Fo(explaining)i(away)d Fp(in)g(whic)o(h)f(units)h(in)g(one)g(la)o(y)o (er)f(are)h(coupled)f(b)o(y)h(evidence)0 1240 y(in)e(the)g(la)o(y)o (ers)g(b)q(elo)o(w.)25 b(In)17 b(eq.)f(\(9\),)i(w)o(e)f(see)g(that)h (the)g(parameter)e Fn(\030)1278 1247 y Fm(i)1310 1240 y Fp(dep)q(ends)i(only)f(on)h(the)f(statistics)0 1300 y(of)22 b(its)f(paren)o(ts,)i(with)e(the)h(leading)f(dep)q(endence)g (coming)f(through)j(the)e(w)o(eigh)o(ted)g(sum)1742 1267 y Fk(P)1786 1310 y Fm(j)1813 1300 y Fn(W)1859 1307 y Fm(ij)1889 1300 y Fn(\026)1918 1307 y Fm(j)1936 1300 y Fp(.)0 1360 y(Th)o(us)14 b(w)o(e)g(can)g(in)o(terpret)f Fn(\030)499 1367 y Fm(i)527 1360 y Fp(as)i(an)f(appro)o(ximation)f(to)h (the)g(exp)q(ected)f(top-do)o(wn)i(signal,)f(E[)p Fn(\033)1751 1367 y Fm(i)1765 1360 y Fl(j)p Fn(V)d Fp(].)20 b(The)0 1420 y(quadratic)e(terms)g(in)g(eqs.)g(\(8{9\),)h(prop)q(ortional)h(to) f Fn(W)1058 1402 y Fj(2)1051 1433 y Fm(ij)1081 1420 y Fp(,)g(capture)f(higher-order)h(corrections)f(to)h(the)0 1481 y(dep)q(endencies)d(already)h(noted.)23 b(F)l(or)18 b(example,)c(in)j(eq.)f(\(9\),)h(these)f(terms)g(cause)h(an)o(y)g(v)m (ariance)g(in)f(the)0 1541 y(paren)o(ts)g(of)h(unit)f Fn(i)g Fp(to)g(push)h Fn(\030)561 1548 y Fm(i)589 1541 y Fl(\031)d Fp(E[)p Fn(\033)717 1548 y Fm(i)731 1541 y Fl(j)p Fn(V)d Fp(])k(a)o(w)o(a)o(y)h(from)g(the)g(extreme)d(v)m (alues)j(of)h(zero)f(or)h(one.)73 1601 y(The)e(reader)f(will)g(note)h (that)g(these)f(directed)g(probabilistic)g(net)o(w)o(orks)g(ha)o(v)o(e) g(t)o(wice)g(as)h(man)o(y)e(mean)0 1661 y(\014eld)k(parameters)h(as)g (their)g(undirected)f(coun)o(terparts.)26 b(F)l(or)19 b(this)e(w)o(e)h(can)g(o\013er)h(the)f(follo)o(wing)f(in)o(tu-)0 1721 y(ition.)31 b(Whereas)19 b(the)h(parameters)e Fn(\026)717 1703 y Fm(`)717 1734 y(i)754 1721 y Fp(are)h(determined)e(b)o(y)j (top-do)o(wn)g(and)g(b)q(ottom-up)g(in\015uences,)0 1782 y(the)15 b(parameters)f Fn(\030)357 1763 y Fm(`)355 1794 y(i)389 1782 y Fp(are)h(determined)e(only)h(b)o(y)h(top-do)o(wn)h (in\015uences.)k(The)15 b(distinction|essen)o(tially)l(,)0 1842 y(one)h(b)q(et)o(w)o(een)g(paren)o(ts)g(and)h(c)o(hildren|is)d (only)i(meaningful)f(for)h(directed)f(graphical)i(mo)q(dels.)0 1983 y Fe(3.3)66 b(A)n(ttractor)23 b(dynamics)0 2076 y Fp(The)16 b(mean)g(\014eld)g(equations)g(pro)o(vide)g(a)h (self-consisten)o(t)e(description)h(of)h(the)f(statistics)g Fn(\026)1705 2083 y Fm(i)1734 2076 y Fl(\031)e Fn(E)s Fp([)p Fn(S)1870 2083 y Fm(i)1883 2076 y Fl(j)p Fn(V)d Fp(])0 2136 y(and)17 b Fn(\030)116 2143 y Fm(i)145 2136 y Fl(\031)d Fn(E)s Fp([)p Fn(\033)279 2143 y Fm(i)292 2136 y Fl(j)p Fn(V)e Fp(])k(in)g(terms)f(of)i(the)f(corresp)q(onding)i (statistics)e(for)h(the)f Fn(i)p Fp(th)g(unit's)h(Mark)o(o)o(v)e(blank) o(et.)0 2196 y(Except)20 b(in)g(sp)q(ecial)g(cases,)h(ho)o(w)o(ev)o (er,)f(the)g(solutions)h(to)g(these)f(equations)h(cannot)g(b)q(e)f (expressed)g(in)0 2256 y(closed)j(form.)41 b(Th)o(us,)24 b(in)f(general,)h(the)f(v)m(alues)h(for)f(the)g(parameters)f Fl(f)p Fn(\026)1434 2263 y Fm(i)1448 2256 y Fn(;)8 b(\030)1491 2263 y Fm(i)1506 2256 y Fl(g)23 b Fp(m)o(ust)e(b)q(e)j(found)g(b)o(y)0 2316 y Fo(numeric)n(al)r(ly)g Fp(solving)f(eqs.)f(\(8{9\).)42 b(This)23 b(is)g(greatly)f(facilitated)g(b)o(y)g(expressing)h(the)f (solutions)i(to)0 2377 y(these)17 b(equations)h(as)h(\014xed)e(p)q(oin) o(ts)h(of)g(an)g(attractor)g(dynamics:)23 b(w)o(e)17 b(can)h(then)g(solv)o(e)f(the)g(mean)g(\014eld)0 2437 y(equations)g(b)o(y)f(in)o(tegrating)h(a)g(set)f(of)h(di\013eren)o (tial)f(equations.)23 b(T)l(o)17 b(this)g(end,)f(w)o(e)g(asso)q(ciate)i (with)f(eac)o(h)0 2497 y(unit)f(the)g(conjugate)h(parameters:)275 2626 y Fn(g)298 2633 y Fm(i)354 2626 y Fp(=)433 2585 y Fk(X)455 2676 y Fm(j)502 2626 y Fn(W)548 2633 y Fm(ij)578 2626 y Fn(\026)607 2633 y Fm(j)637 2626 y Fp(+)686 2585 y Fk(X)708 2676 y Fm(j)754 2626 y Fn(W)800 2633 y Fm(j)r(i)830 2626 y Fp(\()p Fn(\026)878 2633 y Fm(j)908 2626 y Fl(\000)11 b Fn(\030)979 2633 y Fm(j)997 2626 y Fp(\))g Fl(\000)1082 2593 y Fp(1)p 1082 2615 V 1082 2661 a(2)1112 2626 y(\(1)g Fl(\000)g Fp(2)p Fn(\026)1269 2633 y Fm(i)1284 2626 y Fp(\))1311 2585 y Fk(X)1333 2676 y Fm(j)1379 2626 y Fn(W)1432 2606 y Fj(2)1425 2639 y Fm(j)r(i)1455 2626 y Fn(\030)1476 2633 y Fm(j)1495 2626 y Fp(\(1)g Fl(\000)g Fn(\030)1620 2633 y Fm(j)1639 2626 y Fp(\))p Fn(;)191 b Fp(\(10\))963 2795 y(8)p eop %%Page: 9 9 9 8 bop 270 66 a Fn(h)298 73 y Fm(i)354 66 y Fp(=)433 24 y Fk(X)455 115 y Fm(j)502 66 y Fn(W)548 73 y Fm(ij)578 66 y Fn(\026)607 73 y Fm(j)637 66 y Fp(+)691 32 y(1)p 691 54 25 2 v 691 100 a(2)720 66 y(\(1)12 b Fl(\000)e Fp(2)p Fn(\030)869 73 y Fm(i)884 66 y Fp(\))911 24 y Fk(X)933 115 y Fm(j)980 66 y Fn(W)1033 45 y Fj(2)1026 78 y Fm(ij)1056 66 y Fn(\026)1085 73 y Fm(j)1104 66 y Fp(\(1)h Fl(\000)g Fn(\026)1237 73 y Fm(j)1255 66 y Fp(\))p Fn(;)575 b Fp(\(11\))0 215 y(whose)19 b(v)m(alues)e(are)h(simply)e (equal)h(to)i(the)e(argumen)o(ts)g(of)h(the)g(sigmoid)f(functions)h(in) f(the)h(mean)f(\014eld)0 275 y(equations.)j(The)13 b(v)m(ariables)f Fn(g)554 282 y Fm(i)581 275 y Fp(and)h Fn(h)700 282 y Fm(i)727 275 y Fp(summarize)c(the)j(in\015uences)g(of)h(the)f Fn(i)p Fp(th)h(unit's)f(Mark)o(o)o(v)f(blank)o(et.)0 335 y(W)l(e)16 b(consider)g(the)g(dynamics:)714 445 y Fn(\034)735 452 y Fm(\026)768 445 y Fp(_)-24 b Fn(\026)787 452 y Fm(i)843 445 y Fp(=)42 b Fl(\000)8 b Fp([)o Fn(\026)1012 452 y Fm(i)1038 445 y Fl(\000)j Fn(\033)r Fp(\()p Fn(g)1160 452 y Fm(i)1174 445 y Fp(\)])c Fn(;)635 b Fp(\(12\))716 518 y Fn(\034)737 525 y Fm(h)765 504 y Fp(_)760 518 y Fn(h)788 525 y Fm(i)843 518 y Fp(=)42 b(+)8 b([)o Fn(\030)1003 525 y Fm(i)1029 518 y Fl(\000)j Fn(\033)r Fp(\()p Fn(h)1156 525 y Fm(i)1169 518 y Fp(\)])d Fn(;)639 b Fp(\(13\))0 628 y(where)18 b Fn(\034)164 635 y Fm(\026)206 628 y Fp(and)i Fn(\034)325 635 y Fm(h)366 628 y Fp(are)f(\(p)q(ositiv)o(e\))e (time)g(constan)o(ts)i(and)29 b(_)-23 b Fn(\026)1129 635 y Fm(i)1162 628 y Fp(and)1265 614 y(_)1259 628 y Fn(h)1287 635 y Fm(i)1320 628 y Fp(are)18 b(the)h(time)d(deriv)m(ativ)o (es)i(of)h Fn(\026)1936 635 y Fm(i)0 688 y Fp(and)i Fn(h)127 695 y Fm(i)141 688 y Fp(.)33 b(Note)19 b(that)i(eq.)e(\(13\))i(sp)q (eci\014es)e(the)h(time)e(deriv)m(ativ)o(e)g(of)j Fn(h)1317 695 y Fm(i)1331 688 y Fp(,)g(not)f Fn(\030)1477 695 y Fm(i)1492 688 y Fp(.)32 b(As)20 b(w)o(e)g(sho)o(w)h(b)q(elo)o(w,)0 748 y(ho)o(w)o(ev)o(er,)15 b(this)h(do)q(es)h(not)f(presen)o(t)g(an)o (y)g(di\016cult)o(y)e(in)i(in)o(tegrating)g(the)g(dynamics.)73 808 y(By)i(construction,)g(the)g(\014xed)g(p)q(oin)o(ts)h(of)g(this)f (dynamics)f(corresp)q(ond)i(to)g(solutions)f(of)h(the)f(mean)0 868 y(\014eld)k(equations.)38 b(T)l(o)23 b(pro)o(v)o(e)e(the)h (stabilit)o(y)f(of)i(these)e(\014xed)h(p)q(oin)o(ts,)i(w)o(e)d(in)o (tro)q(duce)h(the)g(Ly)o(apuno)o(v)0 929 y(function:)125 1057 y Fn(L)14 b Fp(=)224 1016 y Fk(X)240 1107 y Fm(ij)292 997 y Fk(\024)314 1057 y Fl(\000)p Fn(W)399 1064 y Fm(ij)429 1057 y Fn(\026)458 1064 y Fm(i)472 1057 y Fn(\026)501 1064 y Fm(j)531 1057 y Fp(+)585 1024 y(1)p 585 1046 V 585 1091 a(2)614 1057 y Fn(W)667 1037 y Fj(2)660 1070 y Fm(ij)691 1057 y Fn(\030)714 1037 y Fj(2)712 1070 y Fm(i)734 1057 y Fn(\026)763 1064 y Fm(j)782 1057 y Fp(\(1)d Fl(\000)g Fn(\026)915 1064 y Fm(j)934 1057 y Fp(\))953 997 y Fk(\025)986 1057 y Fp(+)1035 1016 y Fk(X)1059 1107 y Fm(i)1103 984 y Fk(")1127 999 y(Z)1169 1012 y Fm(\026)1190 1017 y Fh(i)1150 1093 y Fj(0)1197 1057 y Fn(\033)1227 1037 y Fi(\000)p Fj(1)1273 1057 y Fp(\()p Fn(\026)p Fp(\))p Fn(d\026)h Fp(+)1455 999 y Fk(Z)1497 1012 y Fm(h)1517 1017 y Fh(i)1479 1093 y Fi(\0001)1535 1057 y Fn(\033)r Fp(\()p Fn(h)p Fp(\))p Fn(dh)1684 984 y Fk(#)1716 1057 y Fn(;)133 b Fp(\(14\))0 1211 y(where)16 b Fn(\033)171 1193 y Fi(\000)p Fj(1)218 1211 y Fp(\()p Fn(\026)p Fp(\))g(is)h(the)f (in)o(v)o(erse)e(sigmoid)i(function;)f(i.e.,)g Fn(\033)1103 1193 y Fi(\000)p Fj(1)1149 1211 y Fp(\()p Fn(\033)r Fp(\()p Fn(h)p Fp(\)\))f(=)g Fn(h)p Fp(.)21 b(The)c(\014rst)f(and)h(third)g (terms)0 1271 y(in)i(this)h(Ly)o(apuno)o(v)g(function)g(are)g(iden)o (tical)d(to)k(what)f(Hop\014eld)f(\(1984\))j(considered)d(for)h (symmetri)o(c)0 1331 y(net)o(w)o(orks;)j(the)d(others)i(are)f(p)q (eculiar)g(to)g(sigmoid)f(D)o(A)o(Gs.)35 b(Consider)22 b(the)e(time)f(deriv)m(ativ)o(e)h(of)h(this)0 1392 y(Ly)o(apuno)o(v)e (function)f(under)h(the)f(dynamics)f(of)h(eqs.)g(\(12{13\).)30 b(Note)18 b(that)h(this)f(dynamics)f(do)q(es)j(not)0 1452 y(corresp)q(ond)h(to)g(a)g(strict)f(gradien)o(t)g(descen)o(t)f(in) i Fn(L)p Fp(,)g(whic)o(h)e(w)o(ould)i(trivially)d(giv)o(e)i(rise)g(to)g (a)h(pro)q(of)h(of)0 1512 y(con)o(v)o(ergence.)e(With)c(some)f(straigh) o(tforw)o(ard)i(algebra,)f(ho)o(w)o(ev)o(er,)f(one)h(can)g(sho)o(w)h (that:)384 1609 y(_)373 1622 y Fn(L)30 b Fp(=)g Fl(\000)551 1580 y Fk(X)575 1672 y Fm(i)619 1574 y Fk(n)o(h)665 1622 y Fn(\033)695 1601 y Fi(\000)p Fj(1)742 1622 y Fp(\()p Fn(\026)790 1629 y Fm(i)815 1622 y Fp(+)11 b Fn(\034)885 1629 y Fm(\026)918 1622 y Fp(_)-23 b Fn(\026)938 1629 y Fm(i)952 1622 y Fp(\))11 b Fl(\000)g Fn(\033)1062 1601 y Fi(\000)p Fj(1)1109 1622 y Fp(\()p Fn(\026)1157 1629 y Fm(i)1171 1622 y Fp(\))1190 1574 y Fk(i)1227 1622 y Fp(_)-23 b Fn(\026)1247 1629 y Fm(i)1272 1622 y Fp(+)11 b Fn(\034)1342 1629 y Fm(h)1371 1609 y Fp(_)1365 1622 y Fn(h)1393 1601 y Fj(2)1393 1634 y Fm(i)1413 1574 y Fk(o)1471 1622 y Fl(\024)29 b Fp(0)p Fn(;)286 b Fp(\(15\))0 1764 y(where)14 b(the)f(inequalit)o(y)f(follo)o(ws)i(from)f(the)h (observ)m(ation)g(that)h(the)e(sigmoid)g(function)h(is)g(monotonically) 0 1824 y(increasing.)39 b(Th)o(us)23 b(the)f(function)g Fn(L)g Fp(alw)o(a)o(ys)g(decreases)g(under)h(the)f(attractor)h (dynamics.)37 b(As)22 b(w)o(e)0 1885 y(discuss)16 b(in)g(the)h(app)q (endix,)f(the)g(\015o)o(w)g(to)h(stable)f(\014xed)g(p)q(oin)o(ts)h(can) g(b)q(e)f(view)o(ed)f(as)i(computing)e(the)h(ap-)0 1945 y(pro)o(ximate)c(distribution,)h Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)e Fp(\),)k(that)f(b)q(est)h(matc)o(hes)d(the)i(true)g(p)q (osterior)h(distribution,)e Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\).)73 2005 y(In)k(practice,)f(one)h(solv)o(es)f(the)h(mean)e (\014eld)i(equations)g(b)o(y)f Fo(discr)n(etizing)i Fp(the)e(attractor) i(dynamics)d(in)0 2065 y(eqs.)h(\(12{13\).)23 b(W)l(e)15 b(exp)q(erimen)o(ted)d(with)j(t)o(w)o(o)g(simple)e(sc)o(hemes)f(to)k (compute)e(up)q(dated)h(v)m(alues)h Fl(f)t Fp(~)-28 b Fn(\026)1854 2072 y Fm(i)1868 2065 y Fn(;)1895 2052 y Fp(~)1890 2065 y Fn(\030)1911 2072 y Fm(i)1925 2065 y Fl(g)0 2125 y Fp(at)15 b(time)d Fn(t)7 b Fp(+)g(\001)p Fn(t)13 b Fp(based)h(on)h(curren)o(t)e(v)m(alues)h Fl(f)p Fn(\026)872 2132 y Fm(i)887 2125 y Fn(;)8 b(\030)930 2132 y Fm(i)944 2125 y Fl(g)14 b Fp(at)h(time)d Fn(t)p Fp(.)20 b(One)14 b(of)g(these)g(w)o(as)h(a)g(\014rst-order)g(Euler)0 2186 y(metho)q(d:)363 2296 y(~)-28 b Fn(\026)388 2303 y Fm(i)444 2296 y Fp(=)41 b Fn(\026)552 2303 y Fm(i)578 2296 y Fp(+)20 b(_)-23 b Fn(\026)656 2303 y Fm(i)670 2296 y Fp(\001)p Fn(t;)1120 b Fp(\(16\))372 2377 y(~)367 2390 y Fn(\030)388 2397 y Fm(i)444 2390 y Fp(=)528 2357 y(1)p 528 2379 V 528 2425 a(2)569 2390 y Fl(\000)619 2342 y Fk(h)638 2357 y(P)682 2401 y Fm(j)700 2390 y Fn(W)753 2370 y Fj(2)746 2403 y Fm(ij)780 2390 y Fp(~)-27 b Fn(\026)806 2397 y Fm(j)824 2390 y Fp(\(1)12 b Fl(\000)i Fp(~)-28 b Fn(\026)957 2397 y Fm(j)976 2390 y Fp(\))995 2342 y Fk(i)1015 2354 y Fi(\000)p Fj(1)1070 2342 y Fk(\020)1095 2390 y Fn(h)1123 2397 y Fm(i)1148 2390 y Fp(+)1203 2377 y(_)1197 2390 y Fn(h)1225 2397 y Fm(i)1239 2390 y Fp(\001)p Fn(t)11 b Fl(\000)1358 2357 y Fk(P)1402 2401 y Fm(j)1420 2390 y Fn(W)1466 2397 y Fm(ij)1501 2390 y Fp(~)-28 b Fn(\026)1526 2397 y Fm(j)1544 2342 y Fk(\021)1577 2390 y Fn(;)272 b Fp(\(17\))0 2516 y(follo)o(w)o(ed)21 b(\(when)h (necessary\))f(b)o(y)g(clipping)g(op)q(erations)i(that)f(pro)s(jected)f Fl(f)p Fn(\026)1478 2523 y Fm(i)1492 2516 y Fn(;)8 b(\030)1535 2523 y Fm(i)1550 2516 y Fl(g)21 b Fp(in)o(to)h(the)f(in)o(terv)m(al)0 2576 y([0)p Fn(;)8 b Fp(1].)20 b(The)14 b(other)g(sc)o(heme)e(w)o(e)h (tried)g(w)o(as)i(a)f(sligh)o(t)f(v)m(arian)o(t)h(that)h(sidestepp)q (ed)e(the)h(division)f(op)q(eration)0 2636 y(in)21 b(eq.)g(\(17\).)38 b(This)22 b(w)o(as)g(done)g(b)o(y)f(making)g(additional)h(use)f(of)h (the)g(sigmoid)e(squashing)j(function,)963 2795 y(9)p eop %%Page: 10 10 10 9 bop 606 0 a 11651262 9472573 3157524 12169625 36377313 39008583 startTexFig 606 0 a %%BeginDocument: figs/trace.ps % MathWorks dictionary /MathWorks 160 dict begin % definition operators /bdef {bind def} bind def /ldef {load def} bind def /xdef {exch def} bdef /xstore {exch store} bdef % operator abbreviations /c /clip ldef /cc /concat ldef /cp /closepath ldef /gr /grestore ldef /gs /gsave ldef /mt /moveto ldef /np /newpath ldef /cm /currentmatrix ldef /sm /setmatrix ldef /rc {rectclip} bdef /rf {rectfill} bdef /rm /rmoveto ldef /rl /rlineto ldef /s /show ldef /sc {setcmykcolor} bdef /sr /setrgbcolor ldef /sg /setgray ldef /w /setlinewidth ldef /j /setlinejoin ldef /cap /setlinecap ldef % page state control /pgsv () def /bpage {/pgsv save def} bdef /epage {pgsv restore} bdef /bplot /gsave ldef /eplot {stroke grestore} bdef % orientation switch /portraitMode 0 def /landscapeMode 1 def % coordinate system mappings /dpi2point 0 def % font control /FontSize 0 def /FMS { /FontSize xstore %save size off stack findfont [FontSize 0 0 FontSize neg 0 0] makefont setfont }bdef /reencode { exch dup where {pop load} {pop StandardEncoding} ifelse exch dup 3 1 roll findfont dup length dict begin { 1 index /FID ne {def}{pop pop} ifelse } forall /Encoding exch def currentdict end definefont pop } bdef /isroman { findfont /CharStrings get /Agrave known } bdef /FMSR { 3 1 roll 1 index dup isroman {reencode} {pop pop} ifelse exch FMS } bdef /csm { 1 dpi2point div -1 dpi2point div scale neg translate landscapeMode eq {90 rotate} if } bdef % line types: solid, dotted, dashed, dotdash /SO { [] 0 setdash } bdef /DO { [.5 dpi2point mul 4 dpi2point mul] 0 setdash } bdef /DA { [6 dpi2point mul] 0 setdash } bdef /DD { [.5 dpi2point mul 4 dpi2point mul 6 dpi2point mul 4 dpi2point mul] 0 setdash } bdef % macros for lines and objects /L { lineto stroke } bdef /MP { 3 1 roll moveto 1 sub {rlineto} repeat } bdef /AP { {rlineto} repeat } bdef /PP { closepath eofill } bdef /DP { closepath stroke } bdef /MR { 4 -2 roll moveto dup 0 exch rlineto exch 0 rlineto neg 0 exch rlineto closepath } bdef /FR { MR stroke } bdef /PR { MR fill } bdef /L1i { { currentfile picstr readhexstring pop } image } bdef /tMatrix matrix def /MakeOval { newpath tMatrix currentmatrix pop translate scale 0 0 1 0 360 arc tMatrix setmatrix } bdef /FO { MakeOval stroke } bdef /PO { MakeOval fill } bdef /PD { currentlinecap 1 setlinecap 3 1 roll 2 copy moveto lineto stroke setlinecap } bdef /FA { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arc tMatrix setmatrix stroke } bdef /PA { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arc closepath tMatrix setmatrix fill } bdef /FAn { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arcn tMatrix setmatrix stroke } bdef /PAn { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arcn closepath tMatrix setmatrix fill } bdef /MRR { /vradius xdef /hradius xdef /lry xdef /lrx xdef /uly xdef /ulx xdef newpath tMatrix currentmatrix pop ulx hradius add uly vradius add translate hradius vradius scale 0 0 1 180 270 arc tMatrix setmatrix lrx hradius sub uly vradius add translate hradius vradius scale 0 0 1 270 360 arc tMatrix setmatrix lrx hradius sub lry vradius sub translate hradius vradius scale 0 0 1 0 90 arc tMatrix setmatrix ulx hradius add lry vradius sub translate hradius vradius scale 0 0 1 90 180 arc tMatrix setmatrix closepath } bdef /FRR { MRR stroke } bdef /PRR { MRR fill } bdef /MlrRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lry uly sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 90 270 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 270 90 arc tMatrix setmatrix closepath } bdef /FlrRR { MlrRR stroke } bdef /PlrRR { MlrRR fill } bdef /MtbRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lrx ulx sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 180 360 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 0 180 arc tMatrix setmatrix closepath } bdef /FtbRR { MtbRR stroke } bdef /PtbRR { MtbRR fill } bdef currentdict end def MathWorks begin 0 cap end MathWorks begin bpage bplot /dpi2point 12 def portraitMode 0216 7344 csm 362 217 6061 4896 MR c np 88 dict begin %Colortable dictionary /c0 { 0 0 0 sr} bdef /c1 { 1 1 1 sr} bdef /c2 { 1 0 0 sr} bdef /c3 { 0 1 0 sr} bdef /c4 { 0 0 1 sr} bdef /c5 { 1 1 0 sr} bdef /c6 { 1 0 1 sr} bdef /c7 { 0 1 1 sr} bdef 1 j 1 sg 0 0 6913 5186 PR 6 w 0 4225 5356 0 0 -4225 898 4613 4 MP PP -5356 0 0 4225 5356 0 0 -4225 898 4613 5 MP stroke 4 w DO SO 6 w 0 sg 898 4613 mt 6254 4613 L 898 388 mt 6254 388 L 6254 4613 mt 6254 388 L 898 4613 mt 898 388 L 898 4613 mt 6254 4613 L 898 4613 mt 898 388 L 898 4613 mt 898 4559 L 898 388 mt 898 442 L /Helvetica /ISOLatin1Encoding 216 FMSR 838 4849 mt (0) s 1969 4613 mt 1969 4559 L 1969 388 mt 1969 442 L 1909 4849 mt (2) s 3040 4613 mt 3040 4559 L 3040 388 mt 3040 442 L 2980 4849 mt (4) s 4112 4613 mt 4112 4559 L 4112 388 mt 4112 442 L 4052 4849 mt (6) s 5183 4613 mt 5183 4559 L 5183 388 mt 5183 442 L 5123 4849 mt (8) s 6254 4613 mt 6254 4559 L 6254 388 mt 6254 442 L 6134 4849 mt (10) s 898 4613 mt 952 4613 L 6254 4613 mt 6200 4613 L 623 4693 mt (15) s 898 3909 mt 952 3909 L 6254 3909 mt 6200 3909 L 623 3989 mt (20) s 898 3205 mt 952 3205 L 6254 3205 mt 6200 3205 L 623 3285 mt (25) s 898 2501 mt 952 2501 L 6254 2501 mt 6200 2501 L 623 2581 mt (30) s 898 1796 mt 952 1796 L 6254 1796 mt 6200 1796 L 623 1876 mt (35) s 898 1092 mt 952 1092 L 6254 1092 mt 6200 1092 L 623 1172 mt (40) s 898 388 mt 952 388 L 6254 388 mt 6200 388 L 623 468 mt (45) s 898 388 mt 6254 388 L 898 4613 mt 6254 4613 L 898 4613 mt 898 388 L 6254 4613 mt 6254 388 L gs 898 388 5357 4226 MR c np 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 6201 4440 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6148 4440 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6095 4440 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6042 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5989 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5936 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5883 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5830 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5777 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5724 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5671 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5618 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5565 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5512 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5459 4439 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5406 4439 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5353 4439 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5300 4439 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5247 4439 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5194 4439 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 5140 4439 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 5087 4439 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 5034 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4981 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4928 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4875 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4822 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4769 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4716 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4663 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4610 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4557 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4504 4437 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4451 4437 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4398 4437 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4345 4437 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4292 4437 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4239 4437 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4186 4436 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4133 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4080 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4027 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3974 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3921 4435 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3868 4435 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3815 4435 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3762 4434 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3709 4434 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3656 4434 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3603 4433 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3550 4433 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3497 4432 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3444 4432 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3391 4431 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3338 4430 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3285 4430 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3232 4429 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3179 4428 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3126 4427 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 3073 4425 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3020 4424 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 2966 4423 100 MP stroke 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 2913 4421 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 2860 4419 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 2807 4416 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 2754 4414 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 2701 4411 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 2648 4407 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 2595 4403 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 2542 4399 100 MP stroke 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 2489 4393 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 2436 4387 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 2383 4380 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 2330 4372 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 2277 4363 100 MP stroke 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 2224 4352 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 2171 4340 100 MP stroke 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 2118 4325 100 MP stroke 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 2065 4309 100 MP stroke 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 2012 4289 100 MP stroke 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1959 4267 100 MP stroke 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1906 4241 100 MP stroke 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1853 4211 100 MP stroke 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 1 1800 4175 100 MP stroke 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1747 4134 100 MP stroke 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1694 4087 100 MP stroke 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1641 4031 100 MP stroke 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 1 0 0 1 1 0 1 1588 3966 100 MP stroke 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 0 1 1 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 1 0 1 1535 3890 100 MP stroke 1 0 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 2 1482 3799 100 MP stroke 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 2 0 1 1 1 0 1 1 1 0 1 1 2 0 1 1 1 0 1 1 2 0 0 1 2 1 1 0 1 1 1 0 2 1 1 0 1 1 1 0 2 1 0 0 2 1 1 0 2 1 0 0 2 1 1 1 2 0 0 1 3 0 0 1 2 0 1 1 2 0 0 1 3 0 0 1 2 0 0 1 3 1 0 0 3 1 0 0 2 1 0 0 3 1 0 0 3 1 -1 0 3 1 0 0 3 1 0 0 3 1 -1 1 4 0 -1 1 4 0 -1 1 3 0 0 1 3 0 -1 1 4 0 -1 1 4 0 -1 1 4 1 -2 0 4 1 -1 0 4 1 -1 0 4 1 -1 0 4 1 -1 0 4 1 -2 0 5 1 -2 0 5 1 -2 1 5 0 -2 1 5 0 -2 1 5 0 -3 1429 3673 100 MP stroke 1 6 0 -3 1 5 0 -2 1 5 0 -2 1 5 1 -2 0 5 1 -2 0 5 1 -2 0 5 1 -3 0 6 1 -3 0 6 1 -3 0 6 1 -3 0 6 1 -3 1 6 0 -3 1 7 0 -4 1 7 0 -4 1 7 0 -4 1 7 0 -4 1 7 0 -4 1 7 1 -4 0 7 1 -4 0 7 1 -4 0 7 1 -4 0 7 1 -4 0 7 1 -4 0 8 1 -5 0 8 1 -5 1 8 0 -5 1 8 0 -5 1 8 0 -5 1 8 0 -5 1 9 0 -6 1 9 0 -6 1 9 0 -6 1 9 1 -6 0 9 1 -6 0 10 1 -7 0 10 1 -6 0 9 1 -6 0 9 1 -6 0 9 1 -6 1 10 0 -7 1 10 0 -7 1 10 0 -7 1 11 0 -7 1 10 0 -7 1 10 0 -7 1 10 0 -7 1 11 1 -8 0 11 1 -7 0 10 1 -7 0 11 1376 3513 100 MP stroke 1 -8 0 11 1 -8 0 11 1 -7 0 11 1 -8 1 11 0 -8 1 11 0 -8 1 12 0 -8 1 11 0 -8 1 12 0 -9 1 12 0 -8 1 11 0 -8 1 12 1 -9 0 12 1 -8 0 12 1 -9 0 12 1 -9 0 13 1 -9 0 12 1 -9 0 13 1 -10 1 13 0 -9 1 13 0 -10 1 13 0 -9 1 13 0 -10 1 13 0 -9 1 13 0 -10 1 13 0 -9 1 13 1 -10 0 14 1 -10 0 13 1 -10 0 14 1 -10 0 14 1 -10 0 13 1 -10 0 14 1 -10 1 14 0 -10 1 13 0 -10 1 14 0 -10 1 14 0 -10 1 14 0 -11 1 15 0 -11 1 15 0 -11 1 14 1 -10 0 14 1 -10 0 14 1 -10 0 14 1 -11 0 15 1 -11 0 15 1 -11 0 15 1 -11 1 15 0 -11 1 15 0 -11 1 15 0 -11 1 15 0 -11 1323 3346 100 MP stroke 1 15 0 -11 1 15 0 -11 1 16 0 -12 1 16 1 -12 0 16 1 -12 0 16 1 -11 0 15 1 -11 0 15 1 -11 0 16 1 -12 0 16 1 -12 1 16 0 -12 1 16 0 -12 1 16 0 -11 1 16 0 -12 1 16 0 -12 1 16 0 -12 1 17 0 -12 1 16 1 -12 0 16 1 -12 0 17 1 -13 0 17 1 -12 0 16 1 -12 0 17 1 -13 0 17 1 -12 1 16 0 -12 1 17 0 -13 1 17 0 -12 1 17 0 -13 1 17 0 -12 1 16 0 -12 1 17 0 -13 1 17 1 -12 0 17 1 -13 0 17 1 -12 0 17 1 -13 0 17 1 -12 0 17 1 -13 0 17 1 -12 1 17 0 -13 1 18 0 -13 1 17 0 -12 1 17 0 -13 1 18 0 -13 1 17 0 -12 1 17 0 -13 1 18 1 -13 0 18 1 -13 0 17 1 -12 0 17 1 -12 0 17 1270 3114 100 MP stroke 1 -12 0 17 1 -12 0 17 1 -12 1 17 0 -13 1 18 0 -12 1 17 0 -12 1 17 0 -12 1 17 0 -12 1 18 0 -13 1 18 0 -13 1 18 1 -13 0 18 1 -13 0 18 1 -12 0 18 1 -13 0 18 1 -13 0 18 1 -13 0 19 1 -13 1 18 0 -13 1 18 0 -13 1 19 0 -13 1 18 0 -13 1 19 0 -13 1 18 0 -13 1 19 0 -14 1 19 1 -13 0 19 1 -14 0 19 1 -13 0 19 1 -14 0 19 1 -13 0 19 1 -14 0 20 1 -14 1 19 0 -14 1 20 0 -14 1 19 0 -14 1 20 0 -14 1 20 0 -14 1 19 0 -14 1 20 0 -14 1 20 1 -14 0 19 1 -14 0 20 1 -14 0 20 1 -15 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -15 1 20 0 -14 1 20 0 -14 1 20 0 -15 1 21 0 -15 1217 2861 100 MP stroke 1 21 0 -15 1 20 0 -14 1 20 1 -14 0 20 1 -15 0 21 1 -15 0 21 1 -15 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -15 1 21 0 -15 1 21 0 -15 1 21 0 -15 1 21 0 -15 1 20 0 -14 1 20 0 -14 1 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 1 -14 0 20 1 -14 0 20 1 -13 0 19 1 -13 0 19 1 -13 0 19 1 -13 0 19 1 -13 0 19 1 -13 1 19 0 -12 1 18 0 -12 1 18 0 -12 1 18 0 -12 1 18 0 -11 1 17 0 -11 1 17 1 -11 0 17 1 -11 0 17 1 -10 0 16 1 -10 0 17 1 -11 0 17 1164 2548 100 MP stroke 1 -10 0 16 1 -10 0 16 1 -10 1 16 0 -9 1 15 0 -9 1 16 0 -9 1 15 0 -9 1 15 0 -9 1 15 0 -8 1 14 1 -8 0 15 1 -8 0 14 1 -7 0 13 1 -7 0 14 1 -7 0 13 1 -7 0 13 1 -6 0 13 1 -6 1 12 0 -5 1 12 0 -6 1 12 0 -5 1 12 0 -5 1 11 0 -4 1 11 0 -4 1 11 1 -4 0 10 1 -3 0 10 1 -3 0 10 1 -3 0 9 1 -2 0 9 1 -2 0 9 1 -2 0 9 1 -2 1 9 0 -2 1 8 0 -1 1 8 0 -1 1 8 0 0 1 7 0 0 1 7 0 0 1 7 1 0 0 7 1 1 0 6 1 1 0 6 1 1 0 6 1 1 0 6 1 2 0 5 1 2 0 5 1 2 1 5 0 3 1 4 0 3 1 4 0 4 1 3 0 4 1 3 0 4 1111 2219 100 MP stroke 1 3 0 5 1 2 1 5 0 2 1 6 0 1 1 6 0 1 1 7 0 0 1 7 0 1 1 7 0 0 1 7 0 0 1 8 1 -1 0 8 1 -1 0 9 1 -2 0 9 1 -2 0 10 1 -2 0 9 1 -2 0 10 1 -3 1 11 0 -4 1 11 0 -4 1 12 0 -4 1 11 0 -4 1 12 0 -5 1 13 0 -6 1 13 0 -6 1 14 1 -6 0 14 1 -7 0 14 1 -7 0 15 1 -8 0 16 1 -9 0 16 1 -8 0 16 1 -9 1 17 0 -10 1 18 0 -11 1 18 0 -10 1 18 0 -11 1 19 0 -12 1 20 0 -13 1 20 0 -12 1 20 1 -13 0 21 1 -14 0 22 1 -15 0 23 1 -15 0 22 1 -15 0 23 1 -16 0 24 1 -16 0 24 1 -17 1 25 0 -18 1 25 0 -17 1 25 0 -18 1 26 0 -19 1 27 0 -20 1058 1863 100 MP stroke 1 28 0 -20 1 28 1 -21 0 29 1 -22 0 30 1 -22 0 29 1 -22 0 30 1 -23 0 31 1 -23 0 31 1 -24 0 32 1 -25 1 33 0 -25 1 33 0 -26 1 34 0 -27 1 35 0 -27 1 35 0 -28 1 36 0 -29 1 37 1 -29 0 37 1 -30 0 37 1 -30 0 38 1 -30 0 38 1 -31 0 39 1 -31 0 39 1 -32 0 40 1 -33 1 41 0 -33 1 41 0 -34 1 42 0 -35 1 43 0 -35 1 43 0 -36 1 44 0 -36 1 44 1 -37 0 45 1 -38 0 46 1 -38 0 46 1 -39 0 47 1 -39 0 47 1 -40 0 48 1 -41 0 49 1 -41 1 49 0 -42 1 50 0 -42 1 50 0 -43 1 51 0 -43 1 51 0 -44 1 52 0 -45 1 53 1 -45 0 53 1 -46 0 55 1 -47 0 55 1 -48 0 56 1 -48 0 56 1 -49 0 57 1005 1444 100 MP stroke 1 -49 0 57 1 -50 1 58 0 -50 1 58 0 -51 1 59 0 -51 1 59 0 -52 1 60 0 -52 1 60 0 -53 1 61 1 -53 0 61 1 -54 0 62 1 -54 0 62 1 -55 0 63 1 -55 0 63 1 -56 0 64 1 -56 0 64 1 -57 1 65 0 -57 1 65 0 -58 1 65 0 -57 1 65 0 -58 1 66 0 -58 1 66 0 -59 1 67 1 -59 0 67 1 -59 0 67 1 -60 0 68 1 -60 0 68 1 -61 0 69 1 -61 0 69 1 -61 0 69 1 -62 1 70 0 -62 1 69 0 -62 1 70 0 -62 1 70 0 -62 1 70 0 -63 1 71 0 -63 1 71 1 -63 0 70 1 -63 0 71 1 -63 0 71 1 -63 0 71 1 -64 0 72 1 -64 0 71 1 -63 0 71 1 -64 1 72 0 -64 1 72 0 -64 1 71 0 -64 1 72 0 -64 1 72 0 -64 1 71 0 -64 952 1122 100 MP stroke 1 72 1 -64 0 72 1 -64 0 71 1 -63 0 71 1 -64 0 71 1 -63 0 71 1 -63 0 71 1 -63 0 70 1 -63 1 71 0 -63 1 70 0 -62 1 70 0 -62 1 69 0 -62 1 69 0 -61 1 69 0 -61 1 68 1 -61 0 69 1 -61 0 68 1 -60 0 67 1 -59 0 66 1 -59 0 67 1 -59 0 66 1 -58 0 65 1 -57 1 64 0 -57 1 64 0 -56 1 63 0 -55 1 62 0 -55 1 62 0 -54 1 61 0 -53 1 61 1 -53 0 60 1 -52 0 59 1 -51 0 58 1 -50 0 57 1 -49 0 57 1 -49 0 56 1 -48 0 56 1 -48 1 55 0 -47 1 54 0 -46 1 53 0 -45 1 52 0 -45 1 51 0 -44 1 49 0 -43 1 46 1 -42 0 44 1 -41 0 40 1 -38 0 36 1 -36 0 33 1 -32 0 27 1 -25 0 24 1 -14 0 41 899 734 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 6201 4440 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6148 4440 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6095 4440 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6042 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5989 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5936 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5883 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5830 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5777 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5724 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5671 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5618 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5565 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5512 4439 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5459 4439 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5406 4439 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5353 4439 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5300 4439 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5247 4439 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5194 4439 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 5140 4439 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 5087 4439 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 5034 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4981 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4928 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4875 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4822 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4769 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4716 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4663 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4610 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4557 4438 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4504 4437 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4451 4437 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4398 4437 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4345 4437 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4292 4437 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4239 4437 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4186 4436 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4133 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4080 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4027 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3974 4436 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3921 4435 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3868 4435 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3815 4435 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3762 4434 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3709 4434 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3656 4434 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3603 4433 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3550 4433 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3497 4432 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3444 4432 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3391 4431 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3338 4430 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3285 4430 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3232 4429 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3179 4428 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3126 4427 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 3073 4425 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3020 4424 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 2966 4423 100 MP stroke 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 2913 4421 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 2860 4419 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 2807 4416 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 2754 4414 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 2701 4411 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 2648 4407 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 2595 4403 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 2542 4399 100 MP stroke 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 2489 4393 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 2436 4387 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 2383 4380 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 2330 4372 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 2277 4363 100 MP stroke 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 2224 4352 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 2171 4340 100 MP stroke 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 2118 4325 100 MP stroke 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 2065 4309 100 MP stroke 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 2012 4289 100 MP stroke 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1959 4267 100 MP stroke 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1906 4241 100 MP stroke 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1853 4211 100 MP stroke 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 1 1800 4175 100 MP stroke 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1747 4134 100 MP stroke 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1694 4087 100 MP stroke 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1641 4031 100 MP stroke 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 1 0 0 1 1 0 1 1588 3966 100 MP stroke 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 0 1 1 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 1 0 1 1535 3890 100 MP stroke 1 0 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 2 1482 3799 100 MP stroke 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 2 0 1 1 1 0 1 1 1 0 1 1 2 0 1 1 1 0 1 1 2 0 0 1 2 1 1 0 1 1 1 0 2 1 1 0 1 1 1 0 2 1 0 0 2 1 1 0 2 1 0 0 2 1 1 1 2 0 0 1 3 0 0 1 2 0 1 1 2 0 0 1 3 0 0 1 2 0 0 1 3 1 0 0 3 1 0 0 2 1 0 0 3 1 0 0 3 1 -1 0 3 1 0 0 3 1 0 0 3 1 -1 1 4 0 -1 1 4 0 -1 1 3 0 0 1 3 0 -1 1 4 0 -1 1 4 0 -1 1 4 1 -2 0 4 1 -1 0 4 1 -1 0 4 1 -1 0 4 1 -1 0 4 1 -2 0 5 1 -2 0 5 1 -2 1 5 0 -2 1 5 0 -2 1 5 0 -3 1429 3673 100 MP stroke 1 6 0 -3 1 5 0 -2 1 5 0 -2 1 5 1 -2 0 5 1 -2 0 5 1 -2 0 5 1 -3 0 6 1 -3 0 6 1 -3 0 6 1 -3 0 6 1 -3 1 6 0 -3 1 7 0 -4 1 7 0 -4 1 7 0 -4 1 7 0 -4 1 7 0 -4 1 7 1 -4 0 7 1 -4 0 7 1 -4 0 7 1 -4 0 7 1 -4 0 7 1 -4 0 8 1 -5 0 8 1 -5 1 8 0 -5 1 8 0 -5 1 8 0 -5 1 8 0 -5 1 9 0 -6 1 9 0 -6 1 9 0 -6 1 9 1 -6 0 9 1 -6 0 10 1 -7 0 10 1 -6 0 9 1 -6 0 9 1 -6 0 9 1 -6 1 10 0 -7 1 10 0 -7 1 10 0 -7 1 11 0 -7 1 10 0 -7 1 10 0 -7 1 10 0 -7 1 11 1 -8 0 11 1 -7 0 10 1 -7 0 11 1376 3513 100 MP stroke 1 -8 0 11 1 -8 0 11 1 -7 0 11 1 -8 1 11 0 -8 1 11 0 -8 1 12 0 -8 1 11 0 -8 1 12 0 -9 1 12 0 -8 1 11 0 -8 1 12 1 -9 0 12 1 -8 0 12 1 -9 0 12 1 -9 0 13 1 -9 0 12 1 -9 0 13 1 -10 1 13 0 -9 1 13 0 -10 1 13 0 -9 1 13 0 -10 1 13 0 -9 1 13 0 -10 1 13 0 -9 1 13 1 -10 0 14 1 -10 0 13 1 -10 0 14 1 -10 0 14 1 -10 0 13 1 -10 0 14 1 -10 1 14 0 -10 1 13 0 -10 1 14 0 -10 1 14 0 -10 1 14 0 -11 1 15 0 -11 1 15 0 -11 1 14 1 -10 0 14 1 -10 0 14 1 -10 0 14 1 -11 0 15 1 -11 0 15 1 -11 0 15 1 -11 1 15 0 -11 1 15 0 -11 1 15 0 -11 1 15 0 -11 1323 3346 100 MP stroke 1 15 0 -11 1 15 0 -11 1 16 0 -12 1 16 1 -12 0 16 1 -12 0 16 1 -11 0 15 1 -11 0 15 1 -11 0 16 1 -12 0 16 1 -12 1 16 0 -12 1 16 0 -12 1 16 0 -11 1 16 0 -12 1 16 0 -12 1 16 0 -12 1 17 0 -12 1 16 1 -12 0 16 1 -12 0 17 1 -13 0 17 1 -12 0 16 1 -12 0 17 1 -13 0 17 1 -12 1 16 0 -12 1 17 0 -13 1 17 0 -12 1 17 0 -13 1 17 0 -12 1 16 0 -12 1 17 0 -13 1 17 1 -12 0 17 1 -13 0 17 1 -12 0 17 1 -13 0 17 1 -12 0 17 1 -13 0 17 1 -12 1 17 0 -13 1 18 0 -13 1 17 0 -12 1 17 0 -13 1 18 0 -13 1 17 0 -12 1 17 0 -13 1 18 1 -13 0 18 1 -13 0 17 1 -12 0 17 1 -12 0 17 1270 3114 100 MP stroke 1 -12 0 17 1 -12 0 17 1 -12 1 17 0 -13 1 18 0 -12 1 17 0 -12 1 17 0 -12 1 17 0 -12 1 18 0 -13 1 18 0 -13 1 18 1 -13 0 18 1 -13 0 18 1 -12 0 18 1 -13 0 18 1 -13 0 18 1 -13 0 19 1 -13 1 18 0 -13 1 18 0 -13 1 19 0 -13 1 18 0 -13 1 19 0 -13 1 18 0 -13 1 19 0 -14 1 19 1 -13 0 19 1 -14 0 19 1 -13 0 19 1 -14 0 19 1 -13 0 19 1 -14 0 20 1 -14 1 19 0 -14 1 20 0 -14 1 19 0 -14 1 20 0 -14 1 20 0 -14 1 19 0 -14 1 20 0 -14 1 20 1 -14 0 19 1 -14 0 20 1 -14 0 20 1 -15 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -15 1 20 0 -14 1 20 0 -14 1 20 0 -15 1 21 0 -15 1217 2861 100 MP stroke 1 21 0 -15 1 20 0 -14 1 20 1 -14 0 20 1 -15 0 21 1 -15 0 21 1 -15 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -15 1 21 0 -15 1 21 0 -15 1 21 0 -15 1 21 0 -15 1 20 0 -14 1 20 0 -14 1 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 0 20 1 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 0 -14 1 20 1 -14 0 20 1 -14 0 20 1 -13 0 19 1 -13 0 19 1 -13 0 19 1 -13 0 19 1 -13 0 19 1 -13 1 19 0 -12 1 18 0 -12 1 18 0 -12 1 18 0 -12 1 18 0 -11 1 17 0 -11 1 17 1 -11 0 17 1 -11 0 17 1 -10 0 16 1 -10 0 17 1 -11 0 17 1164 2548 100 MP stroke 1 -10 0 16 1 -10 0 16 1 -10 1 16 0 -9 1 15 0 -9 1 16 0 -9 1 15 0 -9 1 15 0 -9 1 15 0 -8 1 14 1 -8 0 15 1 -8 0 14 1 -7 0 13 1 -7 0 14 1 -7 0 13 1 -7 0 13 1 -6 0 13 1 -6 1 12 0 -5 1 12 0 -6 1 12 0 -5 1 12 0 -5 1 11 0 -4 1 11 0 -4 1 11 1 -4 0 10 1 -3 0 10 1 -3 0 10 1 -3 0 9 1 -2 0 9 1 -2 0 9 1 -2 0 9 1 -2 1 9 0 -2 1 8 0 -1 1 8 0 -1 1 8 0 0 1 7 0 0 1 7 0 0 1 7 1 0 0 7 1 1 0 6 1 1 0 6 1 1 0 6 1 1 0 6 1 2 0 5 1 2 0 5 1 2 1 5 0 3 1 4 0 3 1 4 0 4 1 3 0 4 1 3 0 4 1111 2219 100 MP stroke 1 3 0 5 1 2 1 5 0 2 1 6 0 1 1 6 0 1 1 7 0 0 1 7 0 1 1 7 0 0 1 7 0 0 1 8 1 -1 0 8 1 -1 0 9 1 -2 0 9 1 -2 0 10 1 -2 0 9 1 -2 0 10 1 -3 1 11 0 -4 1 11 0 -4 1 12 0 -4 1 11 0 -4 1 12 0 -5 1 13 0 -6 1 13 0 -6 1 14 1 -6 0 14 1 -7 0 14 1 -7 0 15 1 -8 0 16 1 -9 0 16 1 -8 0 16 1 -9 1 17 0 -10 1 18 0 -11 1 18 0 -10 1 18 0 -11 1 19 0 -12 1 20 0 -13 1 20 0 -12 1 20 1 -13 0 21 1 -14 0 22 1 -15 0 23 1 -15 0 22 1 -15 0 23 1 -16 0 24 1 -16 0 24 1 -17 1 25 0 -18 1 25 0 -17 1 25 0 -18 1 26 0 -19 1 27 0 -20 1058 1863 100 MP stroke 1 28 0 -20 1 28 1 -21 0 29 1 -22 0 30 1 -22 0 29 1 -22 0 30 1 -23 0 31 1 -23 0 31 1 -24 0 32 1 -25 1 33 0 -25 1 33 0 -26 1 34 0 -27 1 35 0 -27 1 35 0 -28 1 36 0 -29 1 37 1 -29 0 37 1 -30 0 37 1 -30 0 38 1 -30 0 38 1 -31 0 39 1 -31 0 39 1 -32 0 40 1 -33 1 41 0 -33 1 41 0 -34 1 42 0 -35 1 43 0 -35 1 43 0 -36 1 44 0 -36 1 44 1 -37 0 45 1 -38 0 46 1 -38 0 46 1 -39 0 47 1 -39 0 47 1 -40 0 48 1 -41 0 49 1 -41 1 49 0 -42 1 50 0 -42 1 50 0 -43 1 51 0 -43 1 51 0 -44 1 52 0 -45 1 53 1 -45 0 53 1 -46 0 55 1 -47 0 55 1 -48 0 56 1 -48 0 56 1 -49 0 57 1005 1444 100 MP stroke 1 -49 0 57 1 -50 1 58 0 -50 1 58 0 -51 1 59 0 -51 1 59 0 -52 1 60 0 -52 1 60 0 -53 1 61 1 -53 0 61 1 -54 0 62 1 -54 0 62 1 -55 0 63 1 -55 0 63 1 -56 0 64 1 -56 0 64 1 -57 1 65 0 -57 1 65 0 -58 1 65 0 -57 1 65 0 -58 1 66 0 -58 1 66 0 -59 1 67 1 -59 0 67 1 -59 0 67 1 -60 0 68 1 -60 0 68 1 -61 0 69 1 -61 0 69 1 -61 0 69 1 -62 1 70 0 -62 1 69 0 -62 1 70 0 -62 1 70 0 -62 1 70 0 -63 1 71 0 -63 1 71 1 -63 0 70 1 -63 0 71 1 -63 0 71 1 -63 0 71 1 -64 0 72 1 -64 0 71 1 -63 0 71 1 -64 1 72 0 -64 1 72 0 -64 1 71 0 -64 1 72 0 -64 1 72 0 -64 1 71 0 -64 952 1122 100 MP stroke 1 72 1 -64 0 72 1 -64 0 71 1 -63 0 71 1 -64 0 71 1 -63 0 71 1 -63 0 71 1 -63 0 70 1 -63 1 71 0 -63 1 70 0 -62 1 70 0 -62 1 69 0 -62 1 69 0 -61 1 69 0 -61 1 68 1 -61 0 69 1 -61 0 68 1 -60 0 67 1 -59 0 66 1 -59 0 67 1 -59 0 66 1 -58 0 65 1 -57 1 64 0 -57 1 64 0 -56 1 63 0 -55 1 62 0 -55 1 62 0 -54 1 61 0 -53 1 61 1 -53 0 60 1 -52 0 59 1 -51 0 58 1 -50 0 57 1 -49 0 57 1 -49 0 56 1 -48 0 56 1 -48 1 55 0 -47 1 54 0 -46 1 53 0 -45 1 52 0 -45 1 51 0 -44 1 49 0 -43 1 46 1 -42 0 44 1 -41 0 40 1 -38 0 36 1 -36 0 33 1 -32 0 27 1 -25 0 24 1 -14 0 41 899 734 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 6201 4391 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6148 4391 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6095 4390 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 6042 4389 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5989 4388 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5936 4387 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 5883 4386 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5830 4385 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5777 4384 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 5724 4383 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5671 4382 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5618 4381 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5565 4380 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5512 4379 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5459 4378 100 MP stroke 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5406 4376 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5353 4375 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5300 4374 100 MP stroke 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5247 4372 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 5194 4371 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 5140 4369 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 5087 4367 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 5034 4366 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4981 4364 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4928 4362 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 4875 4360 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4822 4358 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4769 4356 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 4716 4354 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4663 4352 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 4610 4349 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4557 4347 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 4504 4344 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4451 4342 100 MP stroke 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4398 4339 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4345 4336 100 MP stroke 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4292 4333 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 4239 4329 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4186 4326 100 MP stroke 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 4133 4322 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4080 4319 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 4027 4315 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3974 4311 100 MP stroke 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 3921 4306 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 3868 4302 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3815 4297 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3762 4292 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 3709 4287 100 MP stroke 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3656 4281 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 3603 4275 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 3550 4269 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 3497 4262 100 MP stroke 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 3444 4255 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 3391 4248 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 3338 4240 100 MP stroke 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 3285 4232 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 3232 4223 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 3179 4214 100 MP stroke 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3126 4205 100 MP stroke 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 3073 4194 100 MP stroke 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 3020 4184 100 MP stroke 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 2966 4172 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 2913 4160 100 MP stroke 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 1 0 2860 4147 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 2807 4134 100 MP stroke 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 0 0 1 1 0 2754 4119 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 2701 4104 100 MP stroke 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 2648 4088 100 MP stroke 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 2595 4070 100 MP stroke 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 2542 4052 100 MP stroke 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 2489 4032 100 MP stroke 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 2436 4012 100 MP stroke 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 2383 3989 100 MP stroke 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 2330 3966 100 MP stroke 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 2277 3940 100 MP stroke 0 0 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 2224 3913 100 MP stroke 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 2171 3885 100 MP stroke 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 2118 3854 100 MP stroke 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 2065 3821 100 MP stroke 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 0 2012 3786 100 MP stroke 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 0 1 1 0 0 1 1 1 0 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 1959 3748 100 MP stroke 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 1 0 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1906 3707 100 MP stroke 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1853 3663 100 MP stroke 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1800 3615 100 MP stroke 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1747 3563 100 MP stroke 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1694 3506 100 MP stroke 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 0 0 1 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 1 1 0 1 1 0 0 1 1641 3443 100 MP stroke 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1588 3375 100 MP stroke 1 1 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 1 0 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 1 1 0 1 1 0 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 0 0 1 1 1 0 1 1 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 0 1 1 0 1 1 1 1 1 0 0 1 1 0 1 1535 3302 100 MP stroke 1 1 0 0 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 0 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 1 1 0 0 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 1 1 0 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 1 0 1 1 1 0 0 1 1 0 1 1 1 0 1 1 1 0 1 1 0 1 1 0 1 1 1 0 1 1 1 0 1 1482 3220 100 MP stroke 1 1 0 1 1 0 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 0 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 0 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 0 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 0 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 2 1 1 0 1 1429 3126 100 MP stroke 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 2 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 1 0 2 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 2 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 1 0 2 1 1 0 1 1 1 0 1 1 1 1 1 0 1 1 2 0 1 1 1 0 1 1 1 0 1 1 1 0 1 1 2 0 1 1 1 1 1 0 1 1 1 0 1 1 2 0 1 1 1 0 1 1 1 0 1 1 2 0 1 1 1 0 1 1 1 1 1 0 2 1 1 0 1 1 1 0 1 1376 3018 100 MP stroke 1 1 0 2 1 1 0 1 1 1 0 1 1 2 1 1 0 1 1 1 0 1 1 1 0 2 1 1 0 1 1 1 0 1 1 2 0 1 1 1 0 1 1 2 1 1 0 1 1 1 0 1 1 2 0 1 1 1 0 1 1 2 0 1 1 1 0 1 1 2 1 1 0 1 1 1 0 1 1 2 0 1 1 1 0 2 1 1 0 1 1 1 0 2 1 1 0 1 1 1 1 2 0 1 1 1 0 1 1 2 0 1 1 1 0 2 1 1 0 1 1 1 0 2 1 1 1 1 0 2 1 1 0 1 1 2 0 1 1 1 0 2 1 1 0 1 1 1 0 2 1 1 0 1 1 2 1 1 0 1 1 2 0 1 1 1 0 2 1 1 0 1 1 2 0 1 1 2 0 1 1 1 1 2 0 1 1 1 0 2 1 1 0 1 1 2 0 1 1323 2892 100 MP stroke 1 2 0 1 1 1 0 2 1 1 0 1 1 2 1 1 0 2 1 1 0 1 1 2 0 1 1 2 0 1 1 1 0 2 1 1 0 2 1 1 1 2 0 1 1 1 0 2 1 1 0 2 1 1 0 1 1 2 0 1 1 1 0 2 1 1 0 1 1 2 1 1 0 1 1 2 0 1 1 1 0 2 1 1 0 1 1 2 0 1 1 1 0 2 1 1 1 1 0 2 1 1 0 1 1 2 0 1 1 1 0 2 1 1 0 2 1 1 0 1 1 2 0 1 1 1 1 2 0 1 1 2 0 1 1 1 0 2 1 1 0 2 1 1 0 1 1 2 0 1 1 2 1 1 0 1 1 2 0 1 1 2 0 1 1 2 0 1 1 2 0 1 1 1 0 2 1 1 0 2 1 1 1 2 0 1 1 2 0 1 1 2 0 1 1 2 0 1 1270 2754 100 MP stroke 1 1 0 2 1 1 0 2 1 1 1 2 0 1 1 2 0 1 1 2 0 1 1 2 0 1 1 2 0 2 1 1 0 2 1 1 0 2 1 1 1 2 0 1 1 2 0 1 1 2 0 1 1 2 0 2 1 1 0 2 1 1 0 2 1 1 1 2 0 2 1 1 0 2 1 1 0 2 1 1 0 2 1 2 0 1 1 2 0 1 1 2 0 2 1 1 1 2 0 2 1 1 0 2 1 1 0 2 1 2 0 1 1 2 0 2 1 1 0 2 1 2 1 1 0 2 1 2 0 1 1 2 0 2 1 1 0 2 1 2 0 1 1 2 0 2 1 1 0 2 1 2 1 1 0 2 1 2 0 2 1 1 0 2 1 2 0 1 1 2 0 2 1 2 0 1 1 2 0 2 1 2 1 1 0 2 1 2 0 2 1 1 0 2 1 2 0 2 1217 2593 100 MP stroke 1 2 0 1 1 2 0 2 1 2 1 2 0 1 1 2 0 2 1 2 0 2 1 1 0 2 1 2 0 2 1 2 0 2 1 1 0 2 1 2 1 2 0 2 1 2 0 1 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 1 1 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 1 1 2 0 2 1 2 0 2 1 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 1 2 0 2 1 3 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 1 3 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 3 0 2 1164 2399 100 MP stroke 1 2 0 2 1 2 0 2 1 3 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 3 0 2 1 2 0 2 1 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 2 0 2 1 3 0 2 1 2 0 2 1 2 1 2 0 2 1 2 0 2 1 3 0 2 1 2 0 2 1 2 0 2 1 3 0 2 1 2 1 2 0 2 1 2 0 3 1 2 0 2 1 2 0 2 1 3 0 2 1 2 0 2 1 3 0 2 1 2 1 2 0 3 1 2 0 2 1 2 0 3 1 2 0 2 1 3 0 2 1 2 0 2 1 3 1 2 0 2 1 3 0 2 1 2 0 3 1 2 0 2 1 3 0 2 1 2 0 3 1 2 0 2 1 3 1 2 0 2 1 3 0 2 1 2 0 3 1 2 0 2 1 3 0 2 1111 2181 100 MP stroke 1 2 0 3 1 2 1 3 0 2 1 2 0 3 1 2 0 3 1 2 0 2 1 3 0 2 1 3 0 2 1 3 0 2 1 3 1 2 0 3 1 2 0 3 1 2 0 3 1 2 0 3 1 2 0 3 1 2 0 3 1 2 1 3 0 2 1 3 0 3 1 2 0 3 1 2 0 3 1 3 0 2 1 3 0 2 1 3 0 3 1 2 1 3 0 3 1 2 0 3 1 3 0 2 1 3 0 3 1 2 0 3 1 3 0 2 1 3 1 3 0 2 1 3 0 3 1 3 0 2 1 3 0 3 1 3 0 2 1 3 0 3 1 3 0 2 1 3 1 3 0 3 1 3 0 2 1 3 0 3 1 3 0 3 1 3 0 3 1 2 0 3 1 3 0 3 1 3 1 3 0 3 1 3 0 3 1 2 0 3 1 3 0 3 1 3 0 3 1058 1918 100 MP stroke 1 3 0 3 1 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 1 3 0 3 1 3 0 3 1 4 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 1 3 0 4 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 1 3 0 3 1 3 0 4 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 3 1 3 0 3 1 3 0 4 1 3 0 3 1 3 0 3 1 3 0 3 1 3 0 3 1 4 0 3 1 3 1 3 0 3 1 4 0 3 1 3 0 3 1 4 0 3 1 3 0 3 1 4 0 3 1 3 1 4 0 3 1 3 0 4 1 3 0 4 1 3 0 3 1 4 0 3 1 4 0 3 1005 1608 100 MP stroke 1 4 0 3 1 4 1 3 0 4 1 3 0 4 1 3 0 4 1 3 0 4 1 4 0 3 1 4 0 3 1 4 1 4 0 3 1 4 0 4 1 3 0 4 1 4 0 4 1 3 0 4 1 4 0 4 1 3 0 4 1 4 1 3 0 4 1 4 0 3 1 4 0 4 1 4 0 3 1 4 0 4 1 4 0 3 1 4 1 4 0 4 1 4 0 4 1 3 0 4 1 4 0 4 1 4 0 4 1 4 0 4 1 4 0 4 1 4 1 4 0 4 1 4 0 4 1 4 0 4 1 4 0 5 1 4 0 4 1 4 0 4 1 4 1 4 0 5 1 4 0 4 1 4 0 4 1 5 0 4 1 4 0 4 1 5 0 4 1 4 0 5 1 4 1 4 0 5 1 4 0 4 1 5 0 4 1 4 0 5 1 4 0 5 1 4 0 5 952 1218 100 MP stroke 1 4 1 5 0 4 1 5 0 4 1 5 0 4 1 5 0 5 1 4 0 5 1 5 0 4 1 5 0 5 1 4 1 5 0 5 1 5 0 4 1 5 0 5 1 5 0 5 1 5 0 5 1 5 0 4 1 5 1 5 0 5 1 5 0 5 1 6 0 5 1 5 0 5 1 5 0 5 1 5 0 6 1 5 0 5 1 5 1 6 0 5 1 5 0 6 1 5 0 5 1 6 0 5 1 5 0 6 1 5 0 6 1 5 1 6 0 5 1 6 0 5 1 6 0 5 1 6 0 6 1 5 0 6 1 6 0 5 1 6 0 6 1 5 1 6 0 6 1 6 0 6 1 5 0 6 1 6 0 6 1 6 0 6 1 6 0 6 1 6 1 6 0 6 1 7 0 6 1 6 0 6 1 6 0 7 1 6 0 6 1 7 0 6 1 6 0 7 899 686 100 MP stroke gr 568 2562 mt -90 rotate (L) s 90 rotate 3372 5063 mt (time) s end eplot epage end showpage %%EndDocument endTexFig 0 702 a Fp(Figure)16 b(2:)22 b(T)o(ypical)16 b(con)o(v)o(ergence)f(of) i(the)f(Ly)o(apuno)o(v)h(function,)f Fn(L)p Fp(,)h(under)f(the)h (discretized)d(attractor)0 762 y(dynamics.)20 b(The)c(top)h(curv)o(e)e (sho)o(ws)i(the)f(trace)g(using)g(eq.)g(\(17\);)g(the)g(b)q(ottom)g (curv)o(e,)f(using)h(eq.)g(\(18\).)0 907 y(replacing)g(eq.)f(\(17\))i (b)o(y:)788 954 y(~)783 967 y Fn(\030)804 974 y Fm(i)832 967 y Fp(=)d Fn(\033)r Fp(\()p Fn(h)961 974 y Fm(i)985 967 y Fp(+)1040 954 y(_)1034 967 y Fn(h)1062 974 y Fm(i)1077 967 y Fp(\001)p Fn(t)p Fp(\))p Fn(:)694 b Fp(\(18\))0 1055 y(This)20 b(second)h(metho)q(d)e(do)q(es)i(not)g(strictly)e (reduce)g(to)i(the)f(con)o(tin)o(uous)g(attractor)h(dynamics)d(in)i (the)0 1115 y(limit)c(\001)p Fn(t)i Fl(!)h Fp(0;)i(ho)o(w)o(ev)o(er,)d (empiricall)o(y)e(it)j(tended)g(to)g(con)o(v)o(erge)f(more)g(rapidly)h (to)g(solutions)h(of)f(the)0 1175 y(mean)e(\014eld)i(equations.)28 b(F)l(or)19 b(this)f(reason,)i(and)f(also)g(b)q(ecause)g(of)g(its)f (naturalness,)i(w)o(e)e(fa)o(v)o(ored)g(this)0 1235 y(metho)q(d)f(in)g (practice.)24 b(Figure)17 b(2)h(sho)o(ws)g(t)o(ypical)f(traces)g(of)h Fn(L)g Fp(v)o(ersus)f(time)e(for)j(b)q(oth)g(metho)q(ds.)25 b(The)0 1295 y(traces)16 b(w)o(ere)g(computed)f(from)g(one)h(of)h(the)f (net)o(w)o(orks)g(learned)f(in)h(section)g(4.)0 1440 y Fe(3.4)66 b(Mean)22 b(\014eld)i(learning)0 1532 y Fp(The)f(Ly)o (apuno)o(v)h(function)f(in)f(eq.)h(\(14\))g(has)h(another)g(in)o (terpretation)e(that)i(is)f(imp)q(ortan)o(t)f(for)i(un-)0 1592 y(sup)q(ervised)d(learning.)36 b(Noting)21 b(that)h(the)f(KL)h (div)o(ergence)e(b)q(et)o(w)o(een)g(t)o(w)o(o)h(distributions)g(is)g (strictly)0 1652 y(non-negativ)o(e,)16 b(it)g(follo)o(ws)g(from)f(eq.)g (\(7\))i(that:)553 1794 y(ln)8 b Fn(P)f Fp(\()p Fn(V)k Fp(\))j Fl(\025)30 b(\000)847 1752 y Fk(X)861 1844 y Fm(H)915 1794 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\))d(ln)1146 1721 y Fk(")1178 1760 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)j Fp(\))p 1176 1782 179 2 v 1176 1828 a Fn(P)c Fp(\()p Fn(H)q(;)h(V)j Fp(\))1359 1721 y Fk(#)1392 1794 y Fn(:)457 b Fp(\(19\))0 1939 y(Eq.)22 b(\(19\))h(giv)o(es)e(a)i (lo)o(w)o(er)e(b)q(ound)i(on)g(the)f(log-lik)o(eliho)q(o)q(d)g(of)g (the)g(evidence,)g(ln)7 b Fn(P)g Fp(\()p Fn(V)12 b Fp(\),)23 b(in)f(terms)f(of)0 2000 y(an)c(a)o(v)o(erage)f(o)o(v)o(er)g(the)g (tractable)h(distribution,)f Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\).)22 b(In)16 b(the)h(app)q(endix,)f(w)o(e)h(ev)m(aluate) f(the)g(righ)o(t)0 2060 y(hand)c(side)g(of)g(eq.)e(\(19\))j(and)f(sho)o (w)g(that)g(under)g(certain)f(tec)o(hnical)f(conditions,)i(the)f(Ly)o (apuno)o(v)h(function)0 2120 y(in)17 b(eq.)g(\(14\))i(also)f(pro)o (vides)f(a)h(lo)o(w)o(er)f(b)q(ound)i(on)g(the)e(log-lik)o(eliho)q(o)q (d;)h(in)f(particular,)h(ln)7 b Fn(P)g Fp(\()p Fn(V)12 b Fp(\))k Fl(\025)h(\000)p Fn(L)p Fp(.)0 2180 y(Th)o(us,)d(in)e (addition)h(to)h(computing)e(appro)o(ximate)f(statistics)i(of)h(the)e (p)q(osterior)i(distribution,)f Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\),)0 2240 y(the)16 b(attractor)h(dynamics)e(in)h (eqs.)g(\(12{13\))i(also)f(computes)e(an)i(estimate)d(\(actually)l(,)i (a)g(lo)o(w)o(er)g(b)q(ound\))0 2301 y(of)h(the)f(log-lik)o(eliho)q(o)q (d,)f(ln)8 b Fn(P)f Fp(\()p Fn(V)k Fp(\).)73 2361 y(The)j(lo)o(w)o(er)f (b)q(ound)i(on)g(ln)8 b Fn(P)f Fp(\()p Fn(V)k Fp(\))j(can)g(b)q(e)g (used)g(as)h(an)f(ob)s(jectiv)o(e)e(function)i(for)g(unsup)q(ervised)g (learn-)0 2421 y(ing)k(in)f(directed)f(probabilistic)h(net)o(w)o(orks)g (\(Hin)o(ton)g(et)g(al,)g(1995\).)27 b(Whereas)17 b(in)h(tractable)f (net)o(w)o(orks,)0 2481 y(one)h(adapts)g(the)f(w)o(eigh)o(ts)g(to)h (maximi)o(ze)c(the)j(log-lik)o(eliho)q(o)q(d)g(ln)8 b Fn(P)f Fp(\()p Fn(V)12 b Fp(\),)17 b(as)h(in)f(eq.)f(\(4\),)i(in)f(in)o (tractable)0 2541 y(net)o(w)o(orks,)j(one)g(adapts)h(the)f(w)o(eigh)o (ts)f(to)i(maximi)o(ze)c(its)i(lo)o(w)o(er)g(b)q(ound,)j(ln)8 b Fn(P)f Fp(\()p Fn(V)k Fp(\))21 b Fl(\025)e(\000)p Fn(L)p Fp(.)33 b(Note)19 b(the)0 2602 y(dual)f(role)f(of)h(the)f(Ly)o(apuno)o (v)h(function)f(in)h(the)f(mean)f(\014eld)h(appro)o(ximation:)23 b(the)18 b(attractor)g(dynam-)0 2662 y(ics)g(minim)o(ize)o(s)e Fn(L)j Fp(with)f(resp)q(ect)g(to)h(the)g(mean)e(\014eld)h(parameters)f Fl(f)p Fn(\026)1334 2669 y Fm(i)1349 2662 y Fn(;)8 b(\030)1392 2669 y Fm(i)1406 2662 y Fl(g)p Fp(,)19 b(while)e(the)h(learning)h(rule) 951 2795 y(10)p eop %%Page: 11 11 11 10 bop 0 50 a Fp(minim)o(ize)o(s)14 b Fn(L)j Fp(with)f(resp)q(ect)g (to)h(the)f(w)o(eigh)o(ts)g Fn(W)920 57 y Fm(ij)950 50 y Fp(.)22 b(A)16 b(useful)g(picture)f(is)i(to)f(imagine)f(these)h(t)o (w)o(o)g(min-)0 110 y(imizations)f(o)q(ccurring)i(on)g(v)m(astly)g (di\013eren)o(t)e(time)g(scales,)h(with)h(the)f(mean)g(\014eld)g (parameters)g Fl(f)p Fn(\026)1854 117 y Fm(i)1868 110 y Fn(;)8 b(\030)1911 117 y Fm(i)1925 110 y Fl(g)0 170 y Fp(trac)o(king)20 b(c)o(hanges)h(in)g(the)f(evidence)f(m)o(uc)o(h)g (more)g(rapidly)h(than)i(the)e(w)o(eigh)o(ts,)h Fn(W)1608 177 y Fm(ij)1639 170 y Fp(.)34 b(Put)21 b(another)0 230 y(w)o(a)o(y)l(,)15 b(short-term)g(memories)e(are)j(stored)h(b)o(y)e (the)h(mean)f(\014eld)g(parameters;)g(long-term)g(memories,)e(b)o(y)0 291 y(the)j(w)o(eigh)o(ts.)73 351 y(W)l(e)h(deriv)o(e)f(a)h(mean)f (\014eld)h(learning)g(rule)f(b)o(y)h(computing)f(the)h(gradien)o(ts)g (of)h(the)e(Ly)o(apuno)o(v)i(func-)0 411 y(tion)e Fn(L)h Fp(with)f(resp)q(ect)g(to)g(the)g(w)o(eigh)o(ts,)g Fn(W)805 418 y Fm(ij)835 411 y Fp(.)21 b(Applying)15 b(the)h(c)o(hain)g(rule)g (giv)o(es:)521 513 y Fn(dL)p 499 536 102 2 v 499 581 a(dW)570 588 y Fm(ij)620 547 y Fp(=)698 513 y Fn(@)s(L)p 676 536 105 2 v 676 581 a(@)s(W)751 588 y Fm(ij)797 547 y Fp(+)846 506 y Fk(X)866 598 y Fm(k)928 513 y Fn(@)s(L)p 919 536 80 2 v 919 581 a(@)s(\026)977 588 y Fm(k)1021 513 y Fn(@)s(\026)1079 520 y Fm(k)p 1008 536 105 2 v 1008 581 a Fn(@)s(W)1083 588 y Fm(ij)1129 547 y Fp(+)1178 506 y Fk(X)1199 598 y Fm(k)1256 513 y Fn(@)s(L)p 1252 536 72 2 v 1252 581 a(@)s(\030)1302 588 y Fm(k)1349 513 y Fn(@)s(\030)1399 520 y Fm(k)p 1333 536 105 2 v 1333 581 a Fn(@)s(W)1408 588 y Fm(ij)1442 547 y Fn(;)407 b Fp(\(20\))0 691 y(where)18 b(the)g(last)g(t)o(w)o(o)g(terms)f(accoun)o (t)h(for)g(the)g(fact)g(the)g(mean)f(\014eld)h(parameters)f(dep)q(end)h (implicitl)o(y)0 751 y(on)f(the)g(w)o(eigh)o(ts)f(through)h(eqs.)f (\(8{9\).)24 b(\(Here)16 b(w)o(e)g(ha)o(v)o(e)g(assumed)g(that)h(the)f (attractor)i(dynamics)d(are)0 811 y(allo)o(w)o(ed)e(to)h(con)o(v)o (erge)f(fully)g(b)q(efore)h(adapting)h(the)e(w)o(eigh)o(ts)h(to)g(new)g (evidence.\))k(W)l(e)c(can)g(simplify)d(this)0 871 y(expression)k(b)o (y)f(noting)h(that)h(the)e(mean)g(\014eld)g(equations)i(describ)q(e)e (\014xed)g(p)q(oin)o(ts)i(at)f(whic)o(h)f Fn(@)s(L=@)s(\026)1877 878 y Fm(k)1912 871 y Fp(=)0 931 y Fn(@)s(L=@)s(\030)136 938 y Fm(k)171 931 y Fp(=)g(0;)h(th)o(us)h(the)f(last)g(t)o(w)o(o)h (terms)e(in)h(eq.)f(\(20\))i(v)m(anish.)21 b(Ev)m(aluating)16 b(the)g(\014rst)f(term)f(in)h(eq.)f(\(20\))0 992 y(giv)o(es)h(rise)h (to)h(the)f(online)f(learning)h(rule:)458 1102 y(\001)p Fn(W)545 1109 y Fm(ij)589 1102 y Fl(/)641 1053 y Fk(h)668 1102 y Fp(\()p Fn(\026)716 1109 y Fm(i)741 1102 y Fl(\000)11 b Fn(\030)812 1109 y Fm(i)826 1102 y Fp(\))e Fn(\026)883 1109 y Fm(j)912 1102 y Fl(\000)i Fn(W)1008 1109 y Fm(ij)1038 1102 y Fn(\030)1059 1109 y Fm(i)1074 1102 y Fp(\(1)g Fl(\000)g Fn(\030)1199 1109 y Fm(i)1213 1102 y Fp(\))p Fn(\026)1261 1109 y Fm(j)1280 1102 y Fp(\(1)g Fl(\000)g Fn(\026)1413 1109 y Fm(j)1432 1102 y Fp(\))1451 1053 y Fk(i)1479 1102 y Fn(:)370 b Fp(\(21\))0 1218 y(Comparing)21 b(this)f(learning)h(rule)f(to)h(eq.)f(\(4\),)i(w)o(e)f(see)f(that)i (the)e(mean)g(\014eld)g(parameters)g(\014ll)g(in)h(for)0 1278 y(the)c(statistics)g(of)g Fn(S)376 1285 y Fm(i)408 1278 y Fp(and)h Fn(\033)532 1285 y Fm(i)545 1278 y Fp(.)25 b(This)17 b(is,)g(of)g(course,)g(what)h(mak)o(es)e(the)h(learning)g (algorithm)f(tractable.)0 1338 y(Whereas)21 b(the)f(statistics)g(of)g Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)12 b Fp(\))20 b(cannot)h(b)q(e)g (e\016cien)o(tly)c(computed,)j(the)g(parameters)g Fl(f)p Fn(\026)1854 1345 y Fm(i)1868 1338 y Fn(;)8 b(\030)1911 1345 y Fm(i)1925 1338 y Fl(g)0 1398 y Fp(are)16 b(found)h(b)o(y)f (solving)g(the)g(mean)f(\014eld)h(equations.)73 1459 y(The)g(reader)f(ma)o(y)f(notice)g(that)i(the)f(righ)o(tmost)g(term)e (of)j(eq.)e(\(21\))i(has)g(no)g(coun)o(terpart)g(in)f(eq.)f(\(4\).)0 1519 y(This)h(term,)e(a)j(regularizer)e(induced)g(b)o(y)h(the)g(mean)f (\014eld)g(appro)o(ximation,)g(causes)h Fn(W)1614 1526 y Fm(ij)1660 1519 y Fp(to)g(b)q(e)g(deca)o(y)o(ed)0 1579 y(according)k(to)g(the)f(mean)g(\014eld)g(statistics)g(of)h Fn(\033)903 1586 y Fm(i)935 1579 y Fp(and)h Fn(S)1063 1586 y Fm(j)1081 1579 y Fp(.)28 b(In)18 b(particular,)h(the)f(w)o(eigh) o(t)g(deca)o(y)g(is)g(sup-)0 1639 y(pressed)k(if)e(either)h Fn(\030)391 1646 y Fm(i)427 1639 y Fp(or)h Fn(\026)521 1646 y Fm(j)561 1639 y Fp(is)f(saturated)h(near)g(zero)f(or)h(one;)i (in)d(e\013ect,)h(w)o(eigh)o(ts)f(b)q(et)o(w)o(een)g(highly)0 1699 y(correlated)16 b(units)g(are)g Fo(burne)n(d)i(in)e Fp(to)h(their)f(curren)o(t)f(v)m(alues.)0 1866 y Fq(4)81 b(Exp)r(erimen)n(tal)25 b(results)0 1975 y Fp(W)l(e)13 b(used)h(a)g(database)h(of)f(handwritten)f(digits)h(to)g(ev)m(aluate)f (the)g(computational)g(abilities)f(of)i(unsup)q(er-)0 2035 y(vised)k(neural)g(net)o(w)o(orks)h(represen)o(ted)e(as)i(D)o(A)o (Gs.)28 b(The)19 b(database)h(consisted)f(of)f(11000)j(examples)c(of)0 2096 y(handwritten)e(digits)g(compiled)e(b)o(y)i(the)f(U.S.)g(P)o (ostal)i(Service)d(O\016ce)h(of)i(Adv)m(anced)e(T)l(ec)o(hnology)l(.)21 b(The)0 2156 y(examples)13 b(w)o(ere)i(prepro)q(cessed)g(to)h(pro)q (duce)f(8x8)h(binary)f(images,)f(as)i(in)f(\014gure)g(3.)22 b(F)l(or)15 b(eac)o(h)g(digit,)f(w)o(e)0 2216 y(divided)k(the)i(data)g (in)o(to)f(a)h(training)g(set)f(of)h(700)h(examples)c(and)j(a)g(test)g (set)f(of)h(400)h(examples.)29 b(The)0 2276 y(partition)14 b(of)g(data)h(in)o(to)e(training)h(and)g(test)g(sets)g(w)o(as)g(the)g (same)f(as)h(used)g(in)f(previous)h(studies)g(\(Hin)o(ton)0 2336 y(et)i(al,)g(1995;)h(Saul)f(et)g(al,)g(1996\).)73 2397 y(W)l(e)i(used)g(the)f(mean)g(\014eld)g(algorithm)g(from)g(the)h (previous)f(section)h(to)g(learn)f(generativ)o(e)g(mo)q(dels)0 2457 y(of)g(eac)o(h)e(digit)h(class.)22 b(The)16 b(generativ)o(e)f(mo)q (dels)g(w)o(ere)h(parameterized)e(b)o(y)i(three)f(la)o(y)o(er)g(net)o (w)o(orks)h(with)0 2517 y(8)s Fl(\002)s Fp(24)s Fl(\002)s Fp(64)e(arc)o(hitectures.)19 b(In)12 b(one)g(h)o(undred)g(indep)q (enden)o(t)g(exp)q(erimen)o(ts)1392 2499 y Fj(2)1409 2517 y Fp(,)h(w)o(e)f(trained)g(ten)g(net)o(w)o(orks,)p 0 2599 780 2 v 56 2629 a Fg(2)75 2645 y Ff(The)i(exp)q(erimen)o(tal)f (details)g(w)o(ere)i(as)e(follo)o(ws.)k(Eac)o(h)d(net)o(w)o(ork)f(w)o (as)h(trained)g(b)o(y)f(\014v)o(e)h(passes)h(through)f(the)g(training) 951 2795 y Fp(11)p eop %%Page: 12 12 12 11 bop 67 0 a 8525330 6820264 5788794 14603550 35719495 38745456 startTexFig 67 0 a %%BeginDocument: figs/actual.ps % MathWorks dictionary /MathWorks 160 dict begin % definition operators /bdef {bind def} bind def /ldef {load def} bind def /xdef {exch def} bdef /xstore {exch store} bdef % operator abbreviations /c /clip ldef /cc /concat ldef /cp /closepath ldef /gr /grestore ldef /gs /gsave ldef /mt /moveto ldef /np /newpath ldef /cm /currentmatrix ldef /sm /setmatrix ldef /rc {rectclip} bdef /rf {rectfill} bdef /rm /rmoveto ldef /rl /rlineto ldef /s /show ldef /sc {setcmykcolor} bdef /sr /setrgbcolor ldef /sg /setgray ldef /w /setlinewidth ldef /j /setlinejoin ldef /cap /setlinecap ldef % page state control /pgsv () def /bpage {/pgsv save def} bdef /epage {pgsv restore} bdef /bplot /gsave ldef /eplot {stroke grestore} bdef % orientation switch /portraitMode 0 def /landscapeMode 1 def % coordinate system mappings /dpi2point 0 def % font control /FontSize 0 def /FMS { /FontSize xstore %save size off stack findfont [FontSize 0 0 FontSize neg 0 0] makefont setfont }bdef /reencode { exch dup where {pop load} {pop StandardEncoding} ifelse exch dup 3 1 roll findfont dup length dict begin { 1 index /FID ne {def}{pop pop} ifelse } forall /Encoding exch def currentdict end definefont pop } bdef /isroman { findfont /CharStrings get /Agrave known } bdef /FMSR { 3 1 roll 1 index dup isroman {reencode} {pop pop} ifelse exch FMS } bdef /csm { 1 dpi2point div -1 dpi2point div scale neg translate landscapeMode eq {90 rotate} if } bdef % line types: solid, dotted, dashed, dotdash /SO { [] 0 setdash } bdef /DO { [.5 dpi2point mul 4 dpi2point mul] 0 setdash } bdef /DA { [6 dpi2point mul] 0 setdash } bdef /DD { [.5 dpi2point mul 4 dpi2point mul 6 dpi2point mul 4 dpi2point mul] 0 setdash } bdef % macros for lines and objects /L { lineto stroke } bdef /MP { 3 1 roll moveto 1 sub {rlineto} repeat } bdef /AP { {rlineto} repeat } bdef /PP { closepath eofill } bdef /DP { closepath stroke } bdef /MR { 4 -2 roll moveto dup 0 exch rlineto exch 0 rlineto neg 0 exch rlineto closepath } bdef /FR { MR stroke } bdef /PR { MR fill } bdef /L1i { { currentfile picstr readhexstring pop } image } bdef /tMatrix matrix def /MakeOval { newpath tMatrix currentmatrix pop translate scale 0 0 1 0 360 arc tMatrix setmatrix } bdef /FO { MakeOval stroke } bdef /PO { MakeOval fill } bdef /PD { currentlinecap 1 setlinecap 3 1 roll 2 copy moveto lineto stroke setlinecap } bdef /FA { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arc tMatrix setmatrix stroke } bdef /PA { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arc closepath tMatrix setmatrix fill } bdef /FAn { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arcn tMatrix setmatrix stroke } bdef /PAn { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arcn closepath tMatrix setmatrix fill } bdef /MRR { /vradius xdef /hradius xdef /lry xdef /lrx xdef /uly xdef /ulx xdef newpath tMatrix currentmatrix pop ulx hradius add uly vradius add translate hradius vradius scale 0 0 1 180 270 arc tMatrix setmatrix lrx hradius sub uly vradius add translate hradius vradius scale 0 0 1 270 360 arc tMatrix setmatrix lrx hradius sub lry vradius sub translate hradius vradius scale 0 0 1 0 90 arc tMatrix setmatrix ulx hradius add lry vradius sub translate hradius vradius scale 0 0 1 90 180 arc tMatrix setmatrix closepath } bdef /FRR { MRR stroke } bdef /PRR { MRR fill } bdef /MlrRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lry uly sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 90 270 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 270 90 arc tMatrix setmatrix closepath } bdef /FlrRR { MlrRR stroke } bdef /PlrRR { MlrRR fill } bdef /MtbRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lrx ulx sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 180 360 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 0 180 arc tMatrix setmatrix closepath } bdef /FtbRR { MtbRR stroke } bdef /PtbRR { MtbRR fill } bdef currentdict end def MathWorks begin 0 cap end MathWorks begin bpage bplot /dpi2point 12 def portraitMode 0216 7344 csm 841 272 5463 4397 MR c np 26 dict begin %Colortable dictionary /c0 { 0 0 0 sr} bdef /c1 { 1 1 1 sr} bdef /c2 { 1 0 0 sr} bdef /c3 { 0 1 0 sr} bdef /c4 { 0 0 1 sr} bdef /c5 { 1 1 0 sr} bdef /c6 { 1 0 1 sr} bdef /c7 { 0 1 1 sr} bdef 1 j 1 sg 0 0 6913 5186 PR 6 w 0 -327 522 0 0 327 898 388 4 MP PP -522 0 0 -327 522 0 0 327 898 388 5 MP stroke gs 898 388 523 328 MR c np gs np 898 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F7B71E1C3C3CE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 388 mt 1420 388 L 898 715 mt 1420 715 L 1420 388 mt 1420 715 L 898 388 mt 898 715 L 898 715 mt 1420 715 L 898 388 mt 898 715 L 898 715 mt 1420 715 L 898 388 mt 1420 388 L 898 388 mt 898 715 L 1420 388 mt 1420 715 L 1 sg 0 -327 521 0 0 327 1589 388 4 MP PP -521 0 0 -327 521 0 0 327 1589 388 5 MP stroke gs 1589 388 522 328 MR c np gs np 1589 388 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 07070F1B73E3CEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 388 mt 2110 388 L 1589 715 mt 2110 715 L 2110 388 mt 2110 715 L 1589 388 mt 1589 715 L 1589 715 mt 2110 715 L 1589 388 mt 1589 715 L 1589 715 mt 2110 715 L 1589 388 mt 2110 388 L 1589 388 mt 1589 715 L 2110 388 mt 2110 715 L 1 sg 0 -327 522 0 0 327 2279 388 4 MP PP -522 0 0 -327 522 0 0 327 2279 388 5 MP stroke gs 2279 388 523 328 MR c np gs np 2279 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E3F7363C3C3FFFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 388 mt 2801 388 L 2279 715 mt 2801 715 L 2801 388 mt 2801 715 L 2279 388 mt 2279 715 L 2279 715 mt 2801 715 L 2279 388 mt 2279 715 L 2279 715 mt 2801 715 L 2279 388 mt 2801 388 L 2279 388 mt 2279 715 L 2801 388 mt 2801 715 L 1 sg 0 -327 522 0 0 327 2970 388 4 MP PP -522 0 0 -327 522 0 0 327 2970 388 5 MP stroke gs 2970 388 523 328 MR c np gs np 2970 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070F1F3366CEFCF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 388 mt 3492 388 L 2970 715 mt 3492 715 L 3492 388 mt 3492 715 L 2970 388 mt 2970 715 L 2970 715 mt 3492 715 L 2970 388 mt 2970 715 L 2970 715 mt 3492 715 L 2970 388 mt 3492 388 L 2970 388 mt 2970 715 L 3492 388 mt 3492 715 L 1 sg 0 -327 522 0 0 327 3660 388 4 MP PP -522 0 0 -327 522 0 0 327 3660 388 5 MP stroke gs 3660 388 523 328 MR c np gs np 3660 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 06071D3961C38EFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 388 mt 4182 388 L 3660 715 mt 4182 715 L 4182 388 mt 4182 715 L 3660 388 mt 3660 715 L 3660 715 mt 4182 715 L 3660 388 mt 3660 715 L 3660 715 mt 4182 715 L 3660 388 mt 4182 388 L 3660 388 mt 3660 715 L 4182 388 mt 4182 715 L 1 sg 0 -327 522 0 0 327 4351 388 4 MP PP -522 0 0 -327 522 0 0 327 4351 388 5 MP stroke gs 4351 388 523 328 MR c np gs np 4351 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FCE6C38181C3E67C {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 388 mt 4873 388 L 4351 715 mt 4873 715 L 4873 388 mt 4873 715 L 4351 388 mt 4351 715 L 4351 715 mt 4873 715 L 4351 388 mt 4351 715 L 4351 715 mt 4873 715 L 4351 388 mt 4873 388 L 4351 388 mt 4351 715 L 4873 388 mt 4873 715 L 1 sg 0 -327 521 0 0 327 5042 388 4 MP PP -521 0 0 -327 521 0 0 327 5042 388 5 MP stroke gs 5042 388 522 328 MR c np gs np 5042 388 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E3F73E3C3C7FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 388 mt 5563 388 L 5042 715 mt 5563 715 L 5563 388 mt 5563 715 L 5042 388 mt 5042 715 L 5042 715 mt 5563 715 L 5042 388 mt 5042 715 L 5042 715 mt 5563 715 L 5042 388 mt 5563 388 L 5042 388 mt 5042 715 L 5563 388 mt 5563 715 L 1 sg 0 -327 522 0 0 327 5732 388 4 MP PP -522 0 0 -327 522 0 0 327 5732 388 5 MP stroke gs 5732 388 523 328 MR c np gs np 5732 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 387E67C3C183CE78 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 388 mt 6254 388 L 5732 715 mt 6254 715 L 6254 388 mt 6254 715 L 5732 388 mt 5732 715 L 5732 715 mt 6254 715 L 5732 388 mt 5732 715 L 5732 715 mt 6254 715 L 5732 388 mt 6254 388 L 5732 388 mt 5732 715 L 6254 388 mt 6254 715 L 1 sg 0 -327 522 0 0 327 898 821 4 MP PP -522 0 0 -327 522 0 0 327 898 821 5 MP stroke gs 898 821 523 328 MR c np gs np 898 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070E1C3870E0C0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 821 mt 1420 821 L 898 1148 mt 1420 1148 L 1420 821 mt 1420 1148 L 898 821 mt 898 1148 L 898 1148 mt 1420 1148 L 898 821 mt 898 1148 L 898 1148 mt 1420 1148 L 898 821 mt 1420 821 L 898 821 mt 898 1148 L 1420 821 mt 1420 1148 L 1 sg 0 -327 521 0 0 327 1589 821 4 MP PP -521 0 0 -327 521 0 0 327 1589 821 5 MP stroke gs 1589 821 522 328 MR c np gs np 1589 821 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 07070E1C3878E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 821 mt 2110 821 L 1589 1148 mt 2110 1148 L 2110 821 mt 2110 1148 L 1589 821 mt 1589 1148 L 1589 1148 mt 2110 1148 L 1589 821 mt 1589 1148 L 1589 1148 mt 2110 1148 L 1589 821 mt 2110 821 L 1589 821 mt 1589 1148 L 2110 821 mt 2110 1148 L 1 sg 0 -327 522 0 0 327 2279 821 4 MP PP -522 0 0 -327 522 0 0 327 2279 821 5 MP stroke gs 2279 821 523 328 MR c np gs np 2279 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070E1C387870E0E0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 821 mt 2801 821 L 2279 1148 mt 2801 1148 L 2801 821 mt 2801 1148 L 2279 821 mt 2279 1148 L 2279 1148 mt 2801 1148 L 2279 821 mt 2279 1148 L 2279 1148 mt 2801 1148 L 2279 821 mt 2801 821 L 2279 821 mt 2279 1148 L 2801 821 mt 2801 1148 L 1 sg 0 -327 522 0 0 327 2970 821 4 MP PP -522 0 0 -327 522 0 0 327 2970 821 5 MP stroke gs 2970 821 523 328 MR c np gs np 2970 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03060C1C3070E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 821 mt 3492 821 L 2970 1148 mt 3492 1148 L 3492 821 mt 3492 1148 L 2970 821 mt 2970 1148 L 2970 1148 mt 3492 1148 L 2970 821 mt 2970 1148 L 2970 1148 mt 3492 1148 L 2970 821 mt 3492 821 L 2970 821 mt 2970 1148 L 3492 821 mt 3492 1148 L 1 sg 0 -327 522 0 0 327 3660 821 4 MP PP -522 0 0 -327 522 0 0 327 3660 821 5 MP stroke gs 3660 821 523 328 MR c np gs np 3660 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03070F1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 821 mt 4182 821 L 3660 1148 mt 4182 1148 L 4182 821 mt 4182 1148 L 3660 821 mt 3660 1148 L 3660 1148 mt 4182 1148 L 3660 821 mt 3660 1148 L 3660 1148 mt 4182 1148 L 3660 821 mt 4182 821 L 3660 821 mt 3660 1148 L 4182 821 mt 4182 1148 L 1 sg 0 -327 522 0 0 327 4351 821 4 MP PP -522 0 0 -327 522 0 0 327 4351 821 5 MP stroke gs 4351 821 523 328 MR c np gs np 4351 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03060C183060C0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 821 mt 4873 821 L 4351 1148 mt 4873 1148 L 4873 821 mt 4873 1148 L 4351 821 mt 4351 1148 L 4351 1148 mt 4873 1148 L 4351 821 mt 4351 1148 L 4351 1148 mt 4873 1148 L 4351 821 mt 4873 821 L 4351 821 mt 4351 1148 L 4873 821 mt 4873 1148 L 1 sg 0 -327 521 0 0 327 5042 821 4 MP PP -521 0 0 -327 521 0 0 327 5042 821 5 MP stroke gs 5042 821 522 328 MR c np gs np 5042 821 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03070E1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 821 mt 5563 821 L 5042 1148 mt 5563 1148 L 5563 821 mt 5563 1148 L 5042 821 mt 5042 1148 L 5042 1148 mt 5563 1148 L 5042 821 mt 5042 1148 L 5042 1148 mt 5563 1148 L 5042 821 mt 5563 821 L 5042 821 mt 5042 1148 L 5563 821 mt 5563 1148 L 1 sg 0 -327 522 0 0 327 5732 821 4 MP PP -522 0 0 -327 522 0 0 327 5732 821 5 MP stroke gs 5732 821 523 328 MR c np gs np 5732 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F7E7EFE7E7E7E7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 821 mt 6254 821 L 5732 1148 mt 6254 1148 L 6254 821 mt 6254 1148 L 5732 821 mt 5732 1148 L 5732 1148 mt 6254 1148 L 5732 821 mt 5732 1148 L 5732 1148 mt 6254 1148 L 5732 821 mt 6254 821 L 5732 821 mt 5732 1148 L 6254 821 mt 6254 1148 L 1 sg 0 -326 522 0 0 326 898 1255 4 MP PP -522 0 0 -326 522 0 0 326 898 1255 5 MP stroke gs 898 1255 523 327 MR c np gs np 898 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 898 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7CFCCC0C18307FF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 1255 mt 1420 1255 L 898 1581 mt 1420 1581 L 1420 1255 mt 1420 1581 L 898 1255 mt 898 1581 L 898 1581 mt 1420 1581 L 898 1255 mt 898 1581 L 898 1581 mt 1420 1581 L 898 1255 mt 1420 1255 L 898 1255 mt 898 1581 L 1420 1255 mt 1420 1581 L 1 sg 0 -326 521 0 0 326 1589 1255 4 MP PP -521 0 0 -326 521 0 0 326 1589 1255 5 MP stroke gs 1589 1255 522 327 MR c np gs np 1589 1255 mt 0 327 rl 522 0 rl 0 -327 rl cp c np [522 0 0 327 1589 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7C7C383061C7DCF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 1255 mt 2110 1255 L 1589 1581 mt 2110 1581 L 2110 1255 mt 2110 1581 L 1589 1255 mt 1589 1581 L 1589 1581 mt 2110 1581 L 1589 1255 mt 1589 1581 L 1589 1581 mt 2110 1581 L 1589 1255 mt 2110 1255 L 1589 1255 mt 1589 1581 L 2110 1255 mt 2110 1581 L 1 sg 0 -326 522 0 0 326 2279 1255 4 MP PP -522 0 0 -326 522 0 0 326 2279 1255 5 MP stroke gs 2279 1255 523 327 MR c np gs np 2279 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 2279 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E7E0E0C1C7CFFCF {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 1255 mt 2801 1255 L 2279 1581 mt 2801 1581 L 2801 1255 mt 2801 1581 L 2279 1255 mt 2279 1581 L 2279 1581 mt 2801 1581 L 2279 1255 mt 2279 1581 L 2279 1581 mt 2801 1581 L 2279 1255 mt 2801 1255 L 2279 1255 mt 2279 1581 L 2801 1255 mt 2801 1581 L 1 sg 0 -326 522 0 0 326 2970 1255 4 MP PP -522 0 0 -326 522 0 0 326 2970 1255 5 MP stroke gs 2970 1255 523 327 MR c np gs np 2970 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 2970 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 707858183067FEF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 1255 mt 3492 1255 L 2970 1581 mt 3492 1581 L 3492 1255 mt 3492 1581 L 2970 1255 mt 2970 1581 L 2970 1581 mt 3492 1581 L 2970 1255 mt 2970 1581 L 2970 1581 mt 3492 1581 L 2970 1255 mt 3492 1255 L 2970 1255 mt 2970 1581 L 3492 1255 mt 3492 1581 L 1 sg 0 -326 522 0 0 326 3660 1255 4 MP PP -522 0 0 -326 522 0 0 326 3660 1255 5 MP stroke gs 3660 1255 523 327 MR c np gs np 3660 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 3660 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i F0980808083C7F31 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 1255 mt 4182 1255 L 3660 1581 mt 4182 1581 L 4182 1255 mt 4182 1581 L 3660 1255 mt 3660 1581 L 3660 1581 mt 4182 1581 L 3660 1255 mt 3660 1581 L 3660 1581 mt 4182 1581 L 3660 1255 mt 4182 1255 L 3660 1255 mt 3660 1581 L 4182 1255 mt 4182 1581 L 1 sg 0 -326 522 0 0 326 4351 1255 4 MP PP -522 0 0 -326 522 0 0 326 4351 1255 5 MP stroke gs 4351 1255 523 327 MR c np gs np 4351 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 4351 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 78F8D818307F7E70 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 1255 mt 4873 1255 L 4351 1581 mt 4873 1581 L 4873 1255 mt 4873 1581 L 4351 1255 mt 4351 1581 L 4351 1581 mt 4873 1581 L 4351 1255 mt 4351 1581 L 4351 1581 mt 4873 1581 L 4351 1255 mt 4873 1255 L 4351 1255 mt 4351 1581 L 4873 1255 mt 4873 1581 L 1 sg 0 -326 521 0 0 326 5042 1255 4 MP PP -521 0 0 -326 521 0 0 326 5042 1255 5 MP stroke gs 5042 1255 522 327 MR c np gs np 5042 1255 mt 0 327 rl 522 0 rl 0 -327 rl cp c np [522 0 0 327 5042 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F0307067EFCFF03 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 1255 mt 5563 1255 L 5042 1581 mt 5563 1581 L 5563 1255 mt 5563 1581 L 5042 1255 mt 5042 1581 L 5042 1581 mt 5563 1581 L 5042 1255 mt 5042 1581 L 5042 1581 mt 5563 1581 L 5042 1255 mt 5563 1255 L 5042 1255 mt 5042 1581 L 5563 1255 mt 5563 1581 L 1 sg 0 -326 522 0 0 326 5732 1255 4 MP PP -522 0 0 -326 522 0 0 326 5732 1255 5 MP stroke gs 5732 1255 523 327 MR c np gs np 5732 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 5732 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7C0C183060C0C1FF {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 1255 mt 6254 1255 L 5732 1581 mt 6254 1581 L 6254 1255 mt 6254 1581 L 5732 1255 mt 5732 1581 L 5732 1581 mt 6254 1581 L 5732 1255 mt 5732 1581 L 5732 1581 mt 6254 1581 L 5732 1255 mt 6254 1255 L 5732 1255 mt 5732 1581 L 6254 1255 mt 6254 1581 L 1 sg 0 -327 522 0 0 327 898 1688 4 MP PP -522 0 0 -327 522 0 0 327 898 1688 5 MP stroke gs 898 1688 523 328 MR c np gs np 898 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E7EFC5C0F77FEF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 1688 mt 1420 1688 L 898 2015 mt 1420 2015 L 1420 1688 mt 1420 2015 L 898 1688 mt 898 2015 L 898 2015 mt 1420 2015 L 898 1688 mt 898 2015 L 898 2015 mt 1420 2015 L 898 1688 mt 1420 1688 L 898 1688 mt 898 2015 L 1420 1688 mt 1420 2015 L 1 sg 0 -327 521 0 0 327 1589 1688 4 MP PP -521 0 0 -327 521 0 0 327 1589 1688 5 MP stroke gs 1589 1688 522 328 MR c np gs np 1589 1688 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F3B031E1C8CCE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 1688 mt 2110 1688 L 1589 2015 mt 2110 2015 L 2110 1688 mt 2110 2015 L 1589 1688 mt 1589 2015 L 1589 2015 mt 2110 2015 L 1589 1688 mt 1589 2015 L 1589 2015 mt 2110 2015 L 1589 1688 mt 2110 1688 L 1589 1688 mt 1589 2015 L 2110 1688 mt 2110 2015 L 1 sg 0 -327 522 0 0 327 2279 1688 4 MP PP -522 0 0 -327 522 0 0 327 2279 1688 5 MP stroke gs 2279 1688 523 328 MR c np gs np 2279 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i C6FE1C787E07F7FF {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 1688 mt 2801 1688 L 2279 2015 mt 2801 2015 L 2801 1688 mt 2801 2015 L 2279 1688 mt 2279 2015 L 2279 2015 mt 2801 2015 L 2279 1688 mt 2279 2015 L 2279 2015 mt 2801 2015 L 2279 1688 mt 2801 1688 L 2279 1688 mt 2279 2015 L 2801 1688 mt 2801 2015 L 1 sg 0 -327 522 0 0 327 2970 1688 4 MP PP -522 0 0 -327 522 0 0 327 2970 1688 5 MP stroke gs 2970 1688 523 328 MR c np gs np 2970 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FC9E1E3E0703E3FE {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 1688 mt 3492 1688 L 2970 2015 mt 3492 2015 L 3492 1688 mt 3492 2015 L 2970 1688 mt 2970 2015 L 2970 2015 mt 3492 2015 L 2970 1688 mt 2970 2015 L 2970 2015 mt 3492 2015 L 2970 1688 mt 3492 1688 L 2970 1688 mt 2970 2015 L 3492 1688 mt 3492 2015 L 1 sg 0 -327 522 0 0 327 3660 1688 4 MP PP -522 0 0 -327 522 0 0 327 3660 1688 5 MP stroke gs 3660 1688 523 328 MR c np gs np 3660 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FE7E1E1F030E3CF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 1688 mt 4182 1688 L 3660 2015 mt 4182 2015 L 4182 1688 mt 4182 2015 L 3660 1688 mt 3660 2015 L 3660 2015 mt 4182 2015 L 3660 1688 mt 3660 2015 L 3660 2015 mt 4182 2015 L 3660 1688 mt 4182 1688 L 3660 1688 mt 3660 2015 L 4182 1688 mt 4182 2015 L 1 sg 0 -327 522 0 0 327 4351 1688 4 MP PP -522 0 0 -327 522 0 0 327 4351 1688 5 MP stroke gs 4351 1688 523 328 MR c np gs np 4351 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7E731E1F03C3E77E {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 1688 mt 4873 1688 L 4351 2015 mt 4873 2015 L 4873 1688 mt 4873 2015 L 4351 1688 mt 4351 2015 L 4351 2015 mt 4873 2015 L 4351 1688 mt 4351 2015 L 4351 2015 mt 4873 2015 L 4351 1688 mt 4873 1688 L 4351 1688 mt 4351 2015 L 4873 1688 mt 4873 2015 L 1 sg 0 -327 521 0 0 327 5042 1688 4 MP PP -521 0 0 -327 521 0 0 327 5042 1688 5 MP stroke gs 5042 1688 522 328 MR c np gs np 5042 1688 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FE3E0E7C7F03070E {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 1688 mt 5563 1688 L 5042 2015 mt 5563 2015 L 5563 1688 mt 5563 2015 L 5042 1688 mt 5042 2015 L 5042 2015 mt 5563 2015 L 5042 1688 mt 5042 2015 L 5042 2015 mt 5563 2015 L 5042 1688 mt 5563 1688 L 5042 1688 mt 5042 2015 L 5563 1688 mt 5563 2015 L 1 sg 0 -327 522 0 0 327 5732 1688 4 MP PP -522 0 0 -327 522 0 0 327 5732 1688 5 MP stroke gs 5732 1688 523 328 MR c np gs np 5732 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F7B671F1F030EFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 1688 mt 6254 1688 L 5732 2015 mt 6254 2015 L 6254 1688 mt 6254 2015 L 5732 1688 mt 5732 2015 L 5732 2015 mt 6254 2015 L 5732 1688 mt 5732 2015 L 5732 2015 mt 6254 2015 L 5732 1688 mt 6254 1688 L 5732 1688 mt 5732 2015 L 6254 1688 mt 6254 2015 L 1 sg 0 -327 522 0 0 327 898 2121 4 MP PP -522 0 0 -327 522 0 0 327 898 2121 5 MP stroke gs 898 2121 523 328 MR c np gs np 898 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 013363C6FE0C1818 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2121 mt 1420 2121 L 898 2448 mt 1420 2448 L 1420 2121 mt 1420 2448 L 898 2121 mt 898 2448 L 898 2448 mt 1420 2448 L 898 2121 mt 898 2448 L 898 2448 mt 1420 2448 L 898 2121 mt 1420 2121 L 898 2121 mt 898 2448 L 1420 2121 mt 1420 2448 L 1 sg 0 -327 521 0 0 327 1589 2121 4 MP PP -521 0 0 -327 521 0 0 327 1589 2121 5 MP stroke gs 1589 2121 522 328 MR c np gs np 1589 2121 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 212363C6FE7C1818 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2121 mt 2110 2121 L 1589 2448 mt 2110 2448 L 2110 2121 mt 2110 2448 L 1589 2121 mt 1589 2448 L 1589 2448 mt 2110 2448 L 1589 2121 mt 1589 2448 L 1589 2448 mt 2110 2448 L 1589 2121 mt 2110 2121 L 1589 2121 mt 1589 2448 L 2110 2121 mt 2110 2448 L 1 sg 0 -327 522 0 0 327 2279 2121 4 MP PP -522 0 0 -327 522 0 0 327 2279 2121 5 MP stroke gs 2279 2121 523 328 MR c np gs np 2279 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3464FFFF18307060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2121 mt 2801 2121 L 2279 2448 mt 2801 2448 L 2801 2121 mt 2801 2448 L 2279 2121 mt 2279 2448 L 2279 2448 mt 2801 2448 L 2279 2121 mt 2279 2448 L 2279 2448 mt 2801 2448 L 2279 2121 mt 2801 2121 L 2279 2121 mt 2279 2448 L 2801 2121 mt 2801 2448 L 1 sg 0 -327 522 0 0 327 2970 2121 4 MP PP -522 0 0 -327 522 0 0 327 2970 2121 5 MP stroke gs 2970 2121 523 328 MR c np gs np 2970 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0302043E7E704080 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2121 mt 3492 2121 L 2970 2448 mt 3492 2448 L 3492 2121 mt 3492 2448 L 2970 2121 mt 2970 2448 L 2970 2448 mt 3492 2448 L 2970 2121 mt 2970 2448 L 2970 2448 mt 3492 2448 L 2970 2121 mt 3492 2121 L 2970 2121 mt 2970 2448 L 3492 2121 mt 3492 2448 L 1 sg 0 -327 522 0 0 327 3660 2121 4 MP PP -522 0 0 -327 522 0 0 327 3660 2121 5 MP stroke gs 3660 2121 523 328 MR c np gs np 3660 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 113366CCFC383060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2121 mt 4182 2121 L 3660 2448 mt 4182 2448 L 4182 2121 mt 4182 2448 L 3660 2121 mt 3660 2448 L 3660 2448 mt 4182 2448 L 3660 2121 mt 3660 2448 L 3660 2448 mt 4182 2448 L 3660 2121 mt 4182 2121 L 3660 2121 mt 3660 2448 L 4182 2121 mt 4182 2448 L 1 sg 0 -327 522 0 0 327 4351 2121 4 MP PP -522 0 0 -327 522 0 0 327 4351 2121 5 MP stroke gs 4351 2121 523 328 MR c np gs np 4351 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 61C3F67E18383070 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2121 mt 4873 2121 L 4351 2448 mt 4873 2448 L 4873 2121 mt 4873 2448 L 4351 2121 mt 4351 2448 L 4351 2448 mt 4873 2448 L 4351 2121 mt 4351 2448 L 4351 2448 mt 4873 2448 L 4351 2121 mt 4873 2121 L 4351 2121 mt 4351 2448 L 4873 2121 mt 4873 2448 L 1 sg 0 -327 521 0 0 327 5042 2121 4 MP PP -521 0 0 -327 521 0 0 327 5042 2121 5 MP stroke gs 5042 2121 522 328 MR c np gs np 5042 2121 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1B1B36FCFF306060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2121 mt 5563 2121 L 5042 2448 mt 5563 2448 L 5563 2121 mt 5563 2448 L 5042 2121 mt 5042 2448 L 5042 2448 mt 5563 2448 L 5042 2121 mt 5042 2448 L 5042 2448 mt 5563 2448 L 5042 2121 mt 5563 2121 L 5042 2121 mt 5042 2448 L 5563 2121 mt 5563 2448 L 1 sg 0 -327 522 0 0 327 5732 2121 4 MP PP -522 0 0 -327 522 0 0 327 5732 2121 5 MP stroke gs 5732 2121 523 328 MR c np gs np 5732 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0366E6CDFF7E3830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2121 mt 6254 2121 L 5732 2448 mt 6254 2448 L 6254 2121 mt 6254 2448 L 5732 2121 mt 5732 2448 L 5732 2448 mt 6254 2448 L 5732 2121 mt 5732 2448 L 5732 2448 mt 6254 2448 L 5732 2121 mt 6254 2121 L 5732 2121 mt 5732 2448 L 6254 2121 mt 6254 2448 L 1 sg 0 -327 522 0 0 327 898 2554 4 MP PP -522 0 0 -327 522 0 0 327 898 2554 5 MP stroke gs 898 2554 523 328 MR c np gs np 898 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F3F387C6606FCFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2554 mt 1420 2554 L 898 2881 mt 1420 2881 L 1420 2554 mt 1420 2881 L 898 2554 mt 898 2881 L 898 2881 mt 1420 2881 L 898 2554 mt 898 2881 L 898 2881 mt 1420 2881 L 898 2554 mt 1420 2554 L 898 2554 mt 898 2881 L 1420 2554 mt 1420 2881 L 1 sg 0 -327 521 0 0 327 1589 2554 4 MP PP -521 0 0 -327 521 0 0 327 1589 2554 5 MP stroke gs 1589 2554 522 328 MR c np gs np 1589 2554 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F77607E0206DCF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2554 mt 2110 2554 L 1589 2881 mt 2110 2881 L 2110 2554 mt 2110 2881 L 1589 2554 mt 1589 2881 L 1589 2881 mt 2110 2881 L 1589 2554 mt 1589 2881 L 1589 2881 mt 2110 2881 L 1589 2554 mt 2110 2554 L 1589 2554 mt 1589 2881 L 2110 2554 mt 2110 2881 L 1 sg 0 -327 522 0 0 327 2279 2554 4 MP PP -522 0 0 -327 522 0 0 327 2279 2554 5 MP stroke gs 2279 2554 523 328 MR c np gs np 2279 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 071F3C3030B0F0E0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2554 mt 2801 2554 L 2279 2881 mt 2801 2881 L 2801 2554 mt 2801 2881 L 2279 2554 mt 2279 2881 L 2279 2881 mt 2801 2881 L 2279 2554 mt 2279 2881 L 2279 2881 mt 2801 2881 L 2279 2554 mt 2801 2554 L 2279 2554 mt 2279 2881 L 2801 2554 mt 2801 2881 L 1 sg 0 -327 522 0 0 327 2970 2554 4 MP PP -522 0 0 -327 522 0 0 327 2970 2554 5 MP stroke gs 2970 2554 523 328 MR c np gs np 2970 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 030F1C180C06FEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2554 mt 3492 2554 L 2970 2881 mt 3492 2881 L 3492 2554 mt 3492 2881 L 2970 2554 mt 2970 2881 L 2970 2881 mt 3492 2881 L 2970 2554 mt 2970 2881 L 2970 2881 mt 3492 2881 L 2970 2554 mt 3492 2554 L 2970 2554 mt 2970 2881 L 3492 2554 mt 3492 2881 L 1 sg 0 -327 522 0 0 327 3660 2554 4 MP PP -522 0 0 -327 522 0 0 327 3660 2554 5 MP stroke gs 3660 2554 523 328 MR c np gs np 3660 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i F7FEC06E7F63CEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2554 mt 4182 2554 L 3660 2881 mt 4182 2881 L 4182 2554 mt 4182 2881 L 3660 2554 mt 3660 2881 L 3660 2881 mt 4182 2881 L 3660 2554 mt 3660 2881 L 3660 2881 mt 4182 2881 L 3660 2554 mt 4182 2554 L 3660 2554 mt 3660 2881 L 4182 2554 mt 4182 2881 L 1 sg 0 -327 522 0 0 327 4351 2554 4 MP PP -522 0 0 -327 522 0 0 327 4351 2554 5 MP stroke gs 4351 2554 523 328 MR c np gs np 4351 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F7EE060784CFC7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2554 mt 4873 2554 L 4351 2881 mt 4873 2881 L 4873 2554 mt 4873 2881 L 4351 2554 mt 4351 2881 L 4351 2881 mt 4873 2881 L 4351 2554 mt 4351 2881 L 4351 2881 mt 4873 2881 L 4351 2554 mt 4873 2554 L 4351 2554 mt 4351 2881 L 4873 2554 mt 4873 2881 L 1 sg 0 -327 521 0 0 327 5042 2554 4 MP PP -521 0 0 -327 521 0 0 327 5042 2554 5 MP stroke gs 5042 2554 522 328 MR c np gs np 5042 2554 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F1830383818B8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2554 mt 5563 2554 L 5042 2881 mt 5563 2881 L 5563 2554 mt 5563 2881 L 5042 2554 mt 5042 2881 L 5042 2881 mt 5563 2881 L 5042 2554 mt 5042 2881 L 5042 2881 mt 5563 2881 L 5042 2554 mt 5563 2554 L 5042 2554 mt 5042 2881 L 5563 2554 mt 5563 2881 L 1 sg 0 -327 522 0 0 327 5732 2554 4 MP PP -522 0 0 -327 522 0 0 327 5732 2554 5 MP stroke gs 5732 2554 523 328 MR c np gs np 5732 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F78C0FEC3061EF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2554 mt 6254 2554 L 5732 2881 mt 6254 2881 L 6254 2554 mt 6254 2881 L 5732 2554 mt 5732 2881 L 5732 2881 mt 6254 2881 L 5732 2554 mt 5732 2881 L 5732 2881 mt 6254 2881 L 5732 2554 mt 6254 2554 L 5732 2554 mt 5732 2881 L 6254 2554 mt 6254 2881 L 1 sg 0 -327 522 0 0 327 898 2987 4 MP PP -522 0 0 -327 522 0 0 327 898 2987 5 MP stroke gs 898 2987 523 328 MR c np gs np 898 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070E1C3070FCFCFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2987 mt 1420 2987 L 898 3314 mt 1420 3314 L 1420 2987 mt 1420 3314 L 898 2987 mt 898 3314 L 898 3314 mt 1420 3314 L 898 2987 mt 898 3314 L 898 3314 mt 1420 3314 L 898 2987 mt 1420 2987 L 898 2987 mt 898 3314 L 1420 2987 mt 1420 3314 L 1 sg 0 -327 521 0 0 327 1589 2987 4 MP PP -521 0 0 -327 521 0 0 327 1589 2987 5 MP stroke gs 1589 2987 522 328 MR c np gs np 1589 2987 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3060C0C08FFBFE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2987 mt 2110 2987 L 1589 3314 mt 2110 3314 L 2110 2987 mt 2110 3314 L 1589 2987 mt 1589 3314 L 1589 3314 mt 2110 3314 L 1589 2987 mt 1589 3314 L 1589 3314 mt 2110 3314 L 1589 2987 mt 2110 2987 L 1589 2987 mt 1589 3314 L 2110 2987 mt 2110 3314 L 1 sg 0 -327 522 0 0 327 2279 2987 4 MP PP -522 0 0 -327 522 0 0 327 2279 2987 5 MP stroke gs 2279 2987 523 328 MR c np gs np 2279 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 060C193F3E78C080 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2987 mt 2801 2987 L 2279 3314 mt 2801 3314 L 2801 2987 mt 2801 3314 L 2279 2987 mt 2279 3314 L 2279 3314 mt 2801 3314 L 2279 2987 mt 2279 3314 L 2279 3314 mt 2801 3314 L 2279 2987 mt 2801 2987 L 2279 2987 mt 2279 3314 L 2801 2987 mt 2801 3314 L 1 sg 0 -327 522 0 0 327 2970 2987 4 MP PP -522 0 0 -327 522 0 0 327 2970 2987 5 MP stroke gs 2970 2987 523 328 MR c np gs np 2970 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 80808080C7EF7B3E {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2987 mt 3492 2987 L 2970 3314 mt 3492 3314 L 3492 2987 mt 3492 3314 L 2970 2987 mt 2970 3314 L 2970 3314 mt 3492 3314 L 2970 2987 mt 2970 3314 L 2970 3314 mt 3492 3314 L 2970 2987 mt 3492 2987 L 2970 2987 mt 2970 3314 L 3492 2987 mt 3492 3314 L 1 sg 0 -327 522 0 0 327 3660 2987 4 MP PP -522 0 0 -327 522 0 0 327 3660 2987 5 MP stroke gs 3660 2987 523 328 MR c np gs np 3660 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 6060C0C0C0DFFF7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2987 mt 4182 2987 L 3660 3314 mt 4182 3314 L 4182 2987 mt 4182 3314 L 3660 2987 mt 3660 3314 L 3660 3314 mt 4182 3314 L 3660 2987 mt 3660 3314 L 3660 3314 mt 4182 3314 L 3660 2987 mt 4182 2987 L 3660 2987 mt 3660 3314 L 4182 2987 mt 4182 3314 L 1 sg 0 -327 522 0 0 327 4351 2987 4 MP PP -522 0 0 -327 522 0 0 327 4351 2987 5 MP stroke gs 4351 2987 523 328 MR c np gs np 4351 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3060C0C0869FFF7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2987 mt 4873 2987 L 4351 3314 mt 4873 3314 L 4873 2987 mt 4873 3314 L 4351 2987 mt 4351 3314 L 4351 3314 mt 4873 3314 L 4351 2987 mt 4351 3314 L 4351 3314 mt 4873 3314 L 4351 2987 mt 4873 2987 L 4351 2987 mt 4351 3314 L 4873 2987 mt 4873 3314 L 1 sg 0 -327 521 0 0 327 5042 2987 4 MP PP -521 0 0 -327 521 0 0 327 5042 2987 5 MP stroke gs 5042 2987 522 328 MR c np gs np 5042 2987 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0C1870EFDFFF7C30 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2987 mt 5563 2987 L 5042 3314 mt 5563 3314 L 5563 2987 mt 5563 3314 L 5042 2987 mt 5042 3314 L 5042 3314 mt 5563 3314 L 5042 2987 mt 5042 3314 L 5042 3314 mt 5563 3314 L 5042 2987 mt 5563 2987 L 5042 2987 mt 5042 3314 L 5563 2987 mt 5563 3314 L 1 sg 0 -327 522 0 0 327 5732 2987 4 MP PP -522 0 0 -327 522 0 0 327 5732 2987 5 MP stroke gs 5732 2987 523 328 MR c np gs np 5732 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0E1C3870EFFFFEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2987 mt 6254 2987 L 5732 3314 mt 6254 3314 L 6254 2987 mt 6254 3314 L 5732 2987 mt 5732 3314 L 5732 3314 mt 6254 3314 L 5732 2987 mt 5732 3314 L 5732 3314 mt 6254 3314 L 5732 2987 mt 6254 2987 L 5732 2987 mt 5732 3314 L 6254 2987 mt 6254 3314 L 1 sg 0 -327 522 0 0 327 898 3420 4 MP PP -522 0 0 -327 522 0 0 327 898 3420 5 MP stroke gs 898 3420 523 328 MR c np gs np 898 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FF3F030302060606 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 3420 mt 1420 3420 L 898 3747 mt 1420 3747 L 1420 3420 mt 1420 3747 L 898 3420 mt 898 3747 L 898 3747 mt 1420 3747 L 898 3420 mt 898 3747 L 898 3747 mt 1420 3747 L 898 3420 mt 1420 3420 L 898 3420 mt 898 3747 L 1420 3420 mt 1420 3747 L 1 sg 0 -327 521 0 0 327 1589 3420 4 MP PP -521 0 0 -327 521 0 0 327 1589 3420 5 MP stroke gs 1589 3420 522 328 MR c np gs np 1589 3420 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FC8781C303030203 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 3420 mt 2110 3420 L 1589 3747 mt 2110 3747 L 2110 3420 mt 2110 3747 L 1589 3420 mt 1589 3747 L 1589 3747 mt 2110 3747 L 1589 3420 mt 1589 3747 L 1589 3747 mt 2110 3747 L 1589 3420 mt 2110 3420 L 1589 3420 mt 1589 3747 L 2110 3420 mt 2110 3747 L 1 sg 0 -327 522 0 0 327 2279 3420 4 MP PP -522 0 0 -327 522 0 0 327 2279 3420 5 MP stroke gs 2279 3420 523 328 MR c np gs np 2279 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F7B070E1C3878E0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 3420 mt 2801 3420 L 2279 3747 mt 2801 3747 L 2801 3420 mt 2801 3747 L 2279 3420 mt 2279 3747 L 2279 3747 mt 2801 3747 L 2279 3420 mt 2279 3747 L 2279 3747 mt 2801 3747 L 2279 3420 mt 2801 3420 L 2279 3420 mt 2279 3747 L 2801 3420 mt 2801 3747 L 1 sg 0 -327 522 0 0 327 2970 3420 4 MP PP -522 0 0 -327 522 0 0 327 2970 3420 5 MP stroke gs 2970 3420 523 328 MR c np gs np 2970 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FF7F0E1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 3420 mt 3492 3420 L 2970 3747 mt 3492 3747 L 3492 3420 mt 3492 3747 L 2970 3420 mt 2970 3747 L 2970 3747 mt 3492 3747 L 2970 3420 mt 2970 3747 L 2970 3747 mt 3492 3747 L 2970 3420 mt 3492 3420 L 2970 3420 mt 2970 3747 L 3492 3420 mt 3492 3747 L 1 sg 0 -327 522 0 0 327 3660 3420 4 MP PP -522 0 0 -327 522 0 0 327 3660 3420 5 MP stroke gs 3660 3420 523 328 MR c np gs np 3660 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7FFB07061C387060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 3420 mt 4182 3420 L 3660 3747 mt 4182 3747 L 4182 3420 mt 4182 3747 L 3660 3420 mt 3660 3747 L 3660 3747 mt 4182 3747 L 3660 3420 mt 3660 3747 L 3660 3747 mt 4182 3747 L 3660 3420 mt 4182 3420 L 3660 3420 mt 3660 3747 L 4182 3420 mt 4182 3747 L 1 sg 0 -327 522 0 0 327 4351 3420 4 MP PP -522 0 0 -327 522 0 0 327 4351 3420 5 MP stroke gs 4351 3420 523 328 MR c np gs np 4351 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F3BE3C60C183060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 3420 mt 4873 3420 L 4351 3747 mt 4873 3747 L 4873 3420 mt 4873 3747 L 4351 3420 mt 4351 3747 L 4351 3747 mt 4873 3747 L 4351 3420 mt 4351 3747 L 4351 3747 mt 4873 3747 L 4351 3420 mt 4873 3420 L 4351 3420 mt 4351 3747 L 4873 3420 mt 4873 3747 L 1 sg 0 -327 521 0 0 327 5042 3420 4 MP PP -521 0 0 -327 521 0 0 327 5042 3420 5 MP stroke gs 5042 3420 522 328 MR c np gs np 5042 3420 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F770E183060C080 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 3420 mt 5563 3420 L 5042 3747 mt 5563 3747 L 5563 3420 mt 5563 3747 L 5042 3420 mt 5042 3747 L 5042 3747 mt 5563 3747 L 5042 3420 mt 5042 3747 L 5042 3747 mt 5563 3747 L 5042 3420 mt 5563 3420 L 5042 3420 mt 5042 3747 L 5563 3420 mt 5563 3747 L 1 sg 0 -327 522 0 0 327 5732 3420 4 MP PP -522 0 0 -327 522 0 0 327 5732 3420 5 MP stroke gs 5732 3420 523 328 MR c np gs np 5732 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FFFF030303030303 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 3420 mt 6254 3420 L 5732 3747 mt 6254 3747 L 6254 3420 mt 6254 3747 L 5732 3420 mt 5732 3747 L 5732 3747 mt 6254 3747 L 5732 3420 mt 5732 3747 L 5732 3747 mt 6254 3747 L 5732 3420 mt 6254 3420 L 5732 3420 mt 5732 3747 L 6254 3420 mt 6254 3747 L 1 sg 0 -327 522 0 0 327 898 3853 4 MP PP -522 0 0 -327 522 0 0 327 898 3853 5 MP stroke gs 898 3853 523 328 MR c np gs np 898 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7CCEC3FEFEC3CEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 3853 mt 1420 3853 L 898 4180 mt 1420 4180 L 1420 3853 mt 1420 4180 L 898 3853 mt 898 4180 L 898 4180 mt 1420 4180 L 898 3853 mt 898 4180 L 898 4180 mt 1420 4180 L 898 3853 mt 1420 3853 L 898 3853 mt 898 4180 L 1420 3853 mt 1420 4180 L 1 sg 0 -327 521 0 0 327 1589 3853 4 MP PP -521 0 0 -327 521 0 0 327 1589 3853 5 MP stroke gs 1589 3853 522 328 MR c np gs np 1589 3853 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FEE7F3EE78F8D878 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 3853 mt 2110 3853 L 1589 4180 mt 2110 4180 L 2110 3853 mt 2110 4180 L 1589 3853 mt 1589 4180 L 1589 4180 mt 2110 4180 L 1589 3853 mt 1589 4180 L 1589 4180 mt 2110 4180 L 1589 3853 mt 2110 3853 L 1589 3853 mt 1589 4180 L 2110 3853 mt 2110 4180 L 1 sg 0 -327 522 0 0 327 2279 3853 4 MP PP -522 0 0 -327 522 0 0 327 2279 3853 5 MP stroke gs 2279 3853 523 328 MR c np gs np 2279 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 071F333F1E7CFCF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 3853 mt 2801 3853 L 2279 4180 mt 2801 4180 L 2801 3853 mt 2801 4180 L 2279 3853 mt 2279 4180 L 2279 4180 mt 2801 4180 L 2279 3853 mt 2279 4180 L 2279 4180 mt 2801 4180 L 2279 3853 mt 2801 3853 L 2279 3853 mt 2279 4180 L 2801 3853 mt 2801 4180 L 1 sg 0 -327 522 0 0 327 2970 3853 4 MP PP -522 0 0 -327 522 0 0 327 2970 3853 5 MP stroke gs 2970 3853 523 328 MR c np gs np 2970 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F3F677C78E8F8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 3853 mt 3492 3853 L 2970 4180 mt 3492 4180 L 3492 3853 mt 3492 4180 L 2970 3853 mt 2970 4180 L 2970 4180 mt 3492 4180 L 2970 3853 mt 2970 4180 L 2970 4180 mt 3492 4180 L 2970 3853 mt 3492 3853 L 2970 3853 mt 2970 4180 L 3492 3853 mt 3492 4180 L 1 sg 0 -327 522 0 0 327 3660 3853 4 MP PP -522 0 0 -327 522 0 0 327 3660 3853 5 MP stroke gs 3660 3853 523 328 MR c np gs np 3660 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0E3F3F78F0D0B0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 3853 mt 4182 3853 L 3660 4180 mt 4182 4180 L 4182 3853 mt 4182 4180 L 3660 3853 mt 3660 4180 L 3660 4180 mt 4182 4180 L 3660 3853 mt 3660 4180 L 3660 4180 mt 4182 4180 L 3660 3853 mt 4182 3853 L 3660 3853 mt 3660 4180 L 4182 3853 mt 4182 4180 L 1 sg 0 -327 522 0 0 327 4351 3853 4 MP PP -522 0 0 -327 522 0 0 327 4351 3853 5 MP stroke gs 4351 3853 523 328 MR c np gs np 4351 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E7FEF7C78F0F8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 3853 mt 4873 3853 L 4351 4180 mt 4873 4180 L 4873 3853 mt 4873 4180 L 4351 3853 mt 4351 4180 L 4351 4180 mt 4873 4180 L 4351 3853 mt 4351 4180 L 4351 4180 mt 4873 4180 L 4351 3853 mt 4873 3853 L 4351 3853 mt 4351 4180 L 4873 3853 mt 4873 4180 L 1 sg 0 -327 521 0 0 327 5042 3853 4 MP PP -521 0 0 -327 521 0 0 327 5042 3853 5 MP stroke gs 5042 3853 522 328 MR c np gs np 5042 3853 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F18131E3878D8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 3853 mt 5563 3853 L 5042 4180 mt 5563 4180 L 5563 3853 mt 5563 4180 L 5042 3853 mt 5042 4180 L 5042 4180 mt 5563 4180 L 5042 3853 mt 5042 4180 L 5042 4180 mt 5563 4180 L 5042 3853 mt 5563 3853 L 5042 3853 mt 5042 4180 L 5563 3853 mt 5563 4180 L 1 sg 0 -327 522 0 0 327 5732 3853 4 MP PP -522 0 0 -327 522 0 0 327 5732 3853 5 MP stroke gs 5732 3853 523 328 MR c np gs np 5732 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F33733E38FCDCF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 3853 mt 6254 3853 L 5732 4180 mt 6254 4180 L 6254 3853 mt 6254 4180 L 5732 3853 mt 5732 4180 L 5732 4180 mt 6254 4180 L 5732 3853 mt 5732 4180 L 5732 4180 mt 6254 4180 L 5732 3853 mt 6254 3853 L 5732 3853 mt 5732 4180 L 6254 3853 mt 6254 4180 L 1 sg 0 -327 522 0 0 327 898 4286 4 MP PP -522 0 0 -327 522 0 0 327 898 4286 5 MP stroke gs 898 4286 523 328 MR c np gs np 898 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F7FEEFCF8307060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 4286 mt 1420 4286 L 898 4613 mt 1420 4613 L 1420 4286 mt 1420 4613 L 898 4286 mt 898 4613 L 898 4613 mt 1420 4613 L 898 4286 mt 898 4613 L 898 4613 mt 1420 4613 L 898 4286 mt 1420 4286 L 898 4286 mt 898 4613 L 1420 4286 mt 1420 4613 L 1 sg 0 -327 521 0 0 327 1589 4286 4 MP PP -521 0 0 -327 521 0 0 327 1589 4286 5 MP stroke gs 1589 4286 522 328 MR c np gs np 1589 4286 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F7FFE1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 4286 mt 2110 4286 L 1589 4613 mt 2110 4613 L 2110 4286 mt 2110 4613 L 1589 4286 mt 1589 4613 L 1589 4613 mt 2110 4613 L 1589 4286 mt 1589 4613 L 1589 4613 mt 2110 4613 L 1589 4286 mt 2110 4286 L 1589 4286 mt 1589 4613 L 2110 4286 mt 2110 4613 L 1 sg 0 -327 522 0 0 327 2279 4286 4 MP PP -522 0 0 -327 522 0 0 327 2279 4286 5 MP stroke gs 2279 4286 523 328 MR c np gs np 2279 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E63C7FEFC1C1838 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 4286 mt 2801 4286 L 2279 4613 mt 2801 4613 L 2801 4286 mt 2801 4613 L 2279 4286 mt 2279 4613 L 2279 4613 mt 2801 4613 L 2279 4286 mt 2279 4613 L 2279 4613 mt 2801 4613 L 2279 4286 mt 2801 4286 L 2279 4286 mt 2279 4613 L 2801 4286 mt 2801 4613 L 1 sg 0 -327 522 0 0 327 2970 4286 4 MP PP -522 0 0 -327 522 0 0 327 2970 4286 5 MP stroke gs 2970 4286 523 328 MR c np gs np 2970 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7EFBEF7E1C386060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 4286 mt 3492 4286 L 2970 4613 mt 3492 4613 L 3492 4286 mt 3492 4613 L 2970 4286 mt 2970 4613 L 2970 4613 mt 3492 4613 L 2970 4286 mt 2970 4613 L 2970 4613 mt 3492 4613 L 2970 4286 mt 3492 4286 L 2970 4286 mt 2970 4613 L 3492 4286 mt 3492 4613 L 1 sg 0 -327 522 0 0 327 3660 4286 4 MP PP -522 0 0 -327 522 0 0 327 3660 4286 5 MP stroke gs 3660 4286 523 328 MR c np gs np 3660 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E77DEFC18302060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 4286 mt 4182 4286 L 3660 4613 mt 4182 4613 L 4182 4286 mt 4182 4613 L 3660 4286 mt 3660 4613 L 3660 4613 mt 4182 4613 L 3660 4286 mt 3660 4613 L 3660 4613 mt 4182 4613 L 3660 4286 mt 4182 4286 L 3660 4286 mt 3660 4613 L 4182 4286 mt 4182 4613 L 1 sg 0 -327 522 0 0 327 4351 4286 4 MP PP -522 0 0 -327 522 0 0 327 4351 4286 5 MP stroke gs 4351 4286 523 328 MR c np gs np 4351 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F77FEFC4C1C1830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 4286 mt 4873 4286 L 4351 4613 mt 4873 4613 L 4873 4286 mt 4873 4613 L 4351 4286 mt 4351 4613 L 4351 4613 mt 4873 4613 L 4351 4286 mt 4351 4613 L 4351 4613 mt 4873 4613 L 4351 4286 mt 4873 4286 L 4351 4286 mt 4351 4613 L 4873 4286 mt 4873 4613 L 1 sg 0 -327 521 0 0 327 5042 4286 4 MP PP -521 0 0 -327 521 0 0 327 5042 4286 5 MP stroke gs 5042 4286 522 328 MR c np gs np 5042 4286 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7EC7CFFF03030303 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 4286 mt 5563 4286 L 5042 4613 mt 5563 4613 L 5563 4286 mt 5563 4613 L 5042 4286 mt 5042 4613 L 5042 4613 mt 5563 4613 L 5042 4286 mt 5042 4613 L 5042 4613 mt 5563 4613 L 5042 4286 mt 5563 4286 L 5042 4286 mt 5042 4613 L 5563 4286 mt 5563 4613 L 1 sg 0 -327 522 0 0 327 5732 4286 4 MP PP -522 0 0 -327 522 0 0 327 5732 4286 5 MP stroke gs 5732 4286 523 328 MR c np gs np 5732 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7FFFFEFC3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 4286 mt 6254 4286 L 5732 4613 mt 6254 4613 L 6254 4286 mt 6254 4613 L 5732 4286 mt 5732 4613 L 5732 4613 mt 6254 4613 L 5732 4286 mt 5732 4613 L 5732 4613 mt 6254 4613 L 5732 4286 mt 6254 4286 L 5732 4286 mt 5732 4613 L 6254 4286 mt 6254 4613 L end eplot epage end showpage %%EndDocument endTexFig 683 0 a 8525330 6820264 5788794 14603550 35719495 38745456 startTexFig 683 0 a %%BeginDocument: figs/fantasy.ps % MathWorks dictionary /MathWorks 160 dict begin % definition operators /bdef {bind def} bind def /ldef {load def} bind def /xdef {exch def} bdef /xstore {exch store} bdef % operator abbreviations /c /clip ldef /cc /concat ldef /cp /closepath ldef /gr /grestore ldef /gs /gsave ldef /mt /moveto ldef /np /newpath ldef /cm /currentmatrix ldef /sm /setmatrix ldef /rc {rectclip} bdef /rf {rectfill} bdef /rm /rmoveto ldef /rl /rlineto ldef /s /show ldef /sc {setcmykcolor} bdef /sr /setrgbcolor ldef /sg /setgray ldef /w /setlinewidth ldef /j /setlinejoin ldef /cap /setlinecap ldef % page state control /pgsv () def /bpage {/pgsv save def} bdef /epage {pgsv restore} bdef /bplot /gsave ldef /eplot {stroke grestore} bdef % orientation switch /portraitMode 0 def /landscapeMode 1 def % coordinate system mappings /dpi2point 0 def % font control /FontSize 0 def /FMS { /FontSize xstore %save size off stack findfont [FontSize 0 0 FontSize neg 0 0] makefont setfont }bdef /reencode { exch dup where {pop load} {pop StandardEncoding} ifelse exch dup 3 1 roll findfont dup length dict begin { 1 index /FID ne {def}{pop pop} ifelse } forall /Encoding exch def currentdict end definefont pop } bdef /isroman { findfont /CharStrings get /Agrave known } bdef /FMSR { 3 1 roll 1 index dup isroman {reencode} {pop pop} ifelse exch FMS } bdef /csm { 1 dpi2point div -1 dpi2point div scale neg translate landscapeMode eq {90 rotate} if } bdef % line types: solid, dotted, dashed, dotdash /SO { [] 0 setdash } bdef /DO { [.5 dpi2point mul 4 dpi2point mul] 0 setdash } bdef /DA { [6 dpi2point mul] 0 setdash } bdef /DD { [.5 dpi2point mul 4 dpi2point mul 6 dpi2point mul 4 dpi2point mul] 0 setdash } bdef % macros for lines and objects /L { lineto stroke } bdef /MP { 3 1 roll moveto 1 sub {rlineto} repeat } bdef /AP { {rlineto} repeat } bdef /PP { closepath eofill } bdef /DP { closepath stroke } bdef /MR { 4 -2 roll moveto dup 0 exch rlineto exch 0 rlineto neg 0 exch rlineto closepath } bdef /FR { MR stroke } bdef /PR { MR fill } bdef /L1i { { currentfile picstr readhexstring pop } image } bdef /tMatrix matrix def /MakeOval { newpath tMatrix currentmatrix pop translate scale 0 0 1 0 360 arc tMatrix setmatrix } bdef /FO { MakeOval stroke } bdef /PO { MakeOval fill } bdef /PD { currentlinecap 1 setlinecap 3 1 roll 2 copy moveto lineto stroke setlinecap } bdef /FA { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arc tMatrix setmatrix stroke } bdef /PA { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arc closepath tMatrix setmatrix fill } bdef /FAn { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arcn tMatrix setmatrix stroke } bdef /PAn { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arcn closepath tMatrix setmatrix fill } bdef /MRR { /vradius xdef /hradius xdef /lry xdef /lrx xdef /uly xdef /ulx xdef newpath tMatrix currentmatrix pop ulx hradius add uly vradius add translate hradius vradius scale 0 0 1 180 270 arc tMatrix setmatrix lrx hradius sub uly vradius add translate hradius vradius scale 0 0 1 270 360 arc tMatrix setmatrix lrx hradius sub lry vradius sub translate hradius vradius scale 0 0 1 0 90 arc tMatrix setmatrix ulx hradius add lry vradius sub translate hradius vradius scale 0 0 1 90 180 arc tMatrix setmatrix closepath } bdef /FRR { MRR stroke } bdef /PRR { MRR fill } bdef /MlrRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lry uly sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 90 270 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 270 90 arc tMatrix setmatrix closepath } bdef /FlrRR { MlrRR stroke } bdef /PlrRR { MlrRR fill } bdef /MtbRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lrx ulx sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 180 360 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 0 180 arc tMatrix setmatrix closepath } bdef /FtbRR { MtbRR stroke } bdef /PtbRR { MtbRR fill } bdef currentdict end def MathWorks begin 0 cap end MathWorks begin bpage bplot /dpi2point 12 def portraitMode 0216 7344 csm 841 272 5463 4397 MR c np 26 dict begin %Colortable dictionary /c0 { 0 0 0 sr} bdef /c1 { 1 1 1 sr} bdef /c2 { 1 0 0 sr} bdef /c3 { 0 1 0 sr} bdef /c4 { 0 0 1 sr} bdef /c5 { 1 1 0 sr} bdef /c6 { 1 0 1 sr} bdef /c7 { 0 1 1 sr} bdef 1 j 1 sg 0 0 6913 5186 PR 6 w 0 -327 522 0 0 327 898 388 4 MP PP -522 0 0 -327 522 0 0 327 898 388 5 MP stroke gs 898 388 523 328 MR c np gs np 898 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 076D9FA3C3C3DF7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 388 mt 1420 388 L 898 715 mt 1420 715 L 1420 388 mt 1420 715 L 898 388 mt 898 715 L 898 715 mt 1420 715 L 898 388 mt 898 715 L 898 715 mt 1420 715 L 898 388 mt 1420 388 L 898 388 mt 898 715 L 1420 388 mt 1420 715 L 1 sg 0 -327 521 0 0 327 1589 388 4 MP PP -521 0 0 -327 521 0 0 327 1589 388 5 MP stroke gs 1589 388 522 328 MR c np gs np 1589 388 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 071E3362C6C6FCFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 388 mt 2110 388 L 1589 715 mt 2110 715 L 2110 388 mt 2110 715 L 1589 388 mt 1589 715 L 1589 715 mt 2110 715 L 1589 388 mt 1589 715 L 1589 715 mt 2110 715 L 1589 388 mt 2110 388 L 1589 388 mt 1589 715 L 2110 388 mt 2110 715 L 1 sg 0 -327 522 0 0 327 2279 388 4 MP PP -522 0 0 -327 522 0 0 327 2279 388 5 MP stroke gs 2279 388 523 328 MR c np gs np 2279 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070F316163C6DEF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 388 mt 2801 388 L 2279 715 mt 2801 715 L 2801 388 mt 2801 715 L 2279 388 mt 2279 715 L 2279 715 mt 2801 715 L 2279 388 mt 2279 715 L 2279 715 mt 2801 715 L 2279 388 mt 2801 388 L 2279 388 mt 2279 715 L 2801 388 mt 2801 715 L 1 sg 0 -327 522 0 0 327 2970 388 4 MP PP -522 0 0 -327 522 0 0 327 2970 388 5 MP stroke gs 2970 388 523 328 MR c np gs np 2970 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0E3F7763C3C7DC78 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 388 mt 3492 388 L 2970 715 mt 3492 715 L 3492 388 mt 3492 715 L 2970 388 mt 2970 715 L 2970 715 mt 3492 715 L 2970 388 mt 2970 715 L 2970 715 mt 3492 715 L 2970 388 mt 3492 388 L 2970 388 mt 2970 715 L 3492 388 mt 3492 715 L 1 sg 0 -327 522 0 0 327 3660 388 4 MP PP -522 0 0 -327 522 0 0 327 3660 388 5 MP stroke gs 3660 388 523 328 MR c np gs np 3660 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F1F397161C2DEF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 388 mt 4182 388 L 3660 715 mt 4182 715 L 4182 388 mt 4182 715 L 3660 388 mt 3660 715 L 3660 715 mt 4182 715 L 3660 388 mt 3660 715 L 3660 715 mt 4182 715 L 3660 388 mt 4182 388 L 3660 388 mt 3660 715 L 4182 388 mt 4182 715 L 1 sg 0 -327 522 0 0 327 4351 388 4 MP PP -522 0 0 -327 522 0 0 327 4351 388 5 MP stroke gs 4351 388 523 328 MR c np gs np 4351 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0C3F3F60E5C7FF7A {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 388 mt 4873 388 L 4351 715 mt 4873 715 L 4873 388 mt 4873 715 L 4351 388 mt 4351 715 L 4351 715 mt 4873 715 L 4351 388 mt 4351 715 L 4351 715 mt 4873 715 L 4351 388 mt 4873 388 L 4351 388 mt 4351 715 L 4873 388 mt 4873 715 L 1 sg 0 -327 521 0 0 327 5042 388 4 MP PP -521 0 0 -327 521 0 0 327 5042 388 5 MP stroke gs 5042 388 522 328 MR c np gs np 5042 388 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E3D3F67EFE7FEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 388 mt 5563 388 L 5042 715 mt 5563 715 L 5563 388 mt 5563 715 L 5042 388 mt 5042 715 L 5042 715 mt 5563 715 L 5042 388 mt 5042 715 L 5042 715 mt 5563 715 L 5042 388 mt 5563 388 L 5042 388 mt 5042 715 L 5563 388 mt 5563 715 L 1 sg 0 -327 522 0 0 327 5732 388 4 MP PP -522 0 0 -327 522 0 0 327 5732 388 5 MP stroke gs 5732 388 523 328 MR c np gs np 5732 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1C3F7B73E3CEDC78 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 388 mt 6254 388 L 5732 715 mt 6254 715 L 6254 388 mt 6254 715 L 5732 388 mt 5732 715 L 5732 715 mt 6254 715 L 5732 388 mt 5732 715 L 5732 715 mt 6254 715 L 5732 388 mt 6254 388 L 5732 388 mt 5732 715 L 6254 388 mt 6254 715 L 1 sg 0 -327 522 0 0 327 898 821 4 MP PP -522 0 0 -327 522 0 0 327 898 821 5 MP stroke gs 898 821 523 328 MR c np gs np 898 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03070E1E3C38F0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 821 mt 1420 821 L 898 1148 mt 1420 1148 L 1420 821 mt 1420 1148 L 898 821 mt 898 1148 L 898 1148 mt 1420 1148 L 898 821 mt 898 1148 L 898 1148 mt 1420 1148 L 898 821 mt 1420 821 L 898 821 mt 898 1148 L 1420 821 mt 1420 1148 L 1 sg 0 -327 521 0 0 327 1589 821 4 MP PP -521 0 0 -327 521 0 0 327 1589 821 5 MP stroke gs 1589 821 522 328 MR c np gs np 1589 821 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 00062C1C3C3830E8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 821 mt 2110 821 L 1589 1148 mt 2110 1148 L 2110 821 mt 2110 1148 L 1589 821 mt 1589 1148 L 1589 1148 mt 2110 1148 L 1589 821 mt 1589 1148 L 1589 1148 mt 2110 1148 L 1589 821 mt 2110 821 L 1589 821 mt 1589 1148 L 2110 821 mt 2110 1148 L 1 sg 0 -327 522 0 0 327 2279 821 4 MP PP -522 0 0 -327 522 0 0 327 2279 821 5 MP stroke gs 2279 821 523 328 MR c np gs np 2279 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070F070C2C78F0E0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 821 mt 2801 821 L 2279 1148 mt 2801 1148 L 2801 821 mt 2801 1148 L 2279 821 mt 2279 1148 L 2279 1148 mt 2801 1148 L 2279 821 mt 2279 1148 L 2279 1148 mt 2801 1148 L 2279 821 mt 2801 821 L 2279 821 mt 2279 1148 L 2801 821 mt 2801 1148 L 1 sg 0 -327 522 0 0 327 2970 821 4 MP PP -522 0 0 -327 522 0 0 327 2970 821 5 MP stroke gs 2970 821 523 328 MR c np gs np 2970 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03070E1C3870F0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 821 mt 3492 821 L 2970 1148 mt 3492 1148 L 3492 821 mt 3492 1148 L 2970 821 mt 2970 1148 L 2970 1148 mt 3492 1148 L 2970 821 mt 2970 1148 L 2970 1148 mt 3492 1148 L 2970 821 mt 3492 821 L 2970 821 mt 2970 1148 L 3492 821 mt 3492 1148 L 1 sg 0 -327 522 0 0 327 3660 821 4 MP PP -522 0 0 -327 522 0 0 327 3660 821 5 MP stroke gs 3660 821 523 328 MR c np gs np 3660 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 030F0E1C3C78F0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 821 mt 4182 821 L 3660 1148 mt 4182 1148 L 4182 821 mt 4182 1148 L 3660 821 mt 3660 1148 L 3660 1148 mt 4182 1148 L 3660 821 mt 3660 1148 L 3660 1148 mt 4182 1148 L 3660 821 mt 4182 821 L 3660 821 mt 3660 1148 L 4182 821 mt 4182 1148 L 1 sg 0 -327 522 0 0 327 4351 821 4 MP PP -522 0 0 -327 522 0 0 327 4351 821 5 MP stroke gs 4351 821 523 328 MR c np gs np 4351 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 030E0C187060E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 821 mt 4873 821 L 4351 1148 mt 4873 1148 L 4873 821 mt 4873 1148 L 4351 821 mt 4351 1148 L 4351 1148 mt 4873 1148 L 4351 821 mt 4351 1148 L 4351 1148 mt 4873 1148 L 4351 821 mt 4873 821 L 4351 821 mt 4351 1148 L 4873 821 mt 4873 1148 L 1 sg 0 -327 521 0 0 327 5042 821 4 MP PP -521 0 0 -327 521 0 0 327 5042 821 5 MP stroke gs 5042 821 522 328 MR c np gs np 5042 821 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070F1E3C3870E0E0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 821 mt 5563 821 L 5042 1148 mt 5563 1148 L 5563 821 mt 5563 1148 L 5042 821 mt 5042 1148 L 5042 1148 mt 5563 1148 L 5042 821 mt 5042 1148 L 5042 1148 mt 5563 1148 L 5042 821 mt 5563 821 L 5042 821 mt 5042 1148 L 5563 821 mt 5563 1148 L 1 sg 0 -327 522 0 0 327 5732 821 4 MP PP -522 0 0 -327 522 0 0 327 5732 821 5 MP stroke gs 5732 821 523 328 MR c np gs np 5732 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03060C18303060C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 821 mt 6254 821 L 5732 1148 mt 6254 1148 L 6254 821 mt 6254 1148 L 5732 821 mt 5732 1148 L 5732 1148 mt 6254 1148 L 5732 821 mt 5732 1148 L 5732 1148 mt 6254 1148 L 5732 821 mt 6254 821 L 5732 821 mt 5732 1148 L 6254 821 mt 6254 1148 L 1 sg 0 -326 522 0 0 326 898 1255 4 MP PP -522 0 0 -326 522 0 0 326 898 1255 5 MP stroke gs 898 1255 523 327 MR c np gs np 898 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 898 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7CFC1C187867FEBE {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 1255 mt 1420 1255 L 898 1581 mt 1420 1581 L 1420 1255 mt 1420 1581 L 898 1255 mt 898 1581 L 898 1581 mt 1420 1581 L 898 1255 mt 898 1581 L 898 1581 mt 1420 1581 L 898 1255 mt 1420 1255 L 898 1255 mt 898 1581 L 1420 1255 mt 1420 1581 L 1 sg 0 -326 521 0 0 326 1589 1255 4 MP PP -521 0 0 -326 521 0 0 326 1589 1255 5 MP stroke gs 1589 1255 522 327 MR c np gs np 1589 1255 mt 0 327 rl 522 0 rl 0 -327 rl cp c np [522 0 0 327 1589 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F0F1B031AFEFEF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 1255 mt 2110 1255 L 1589 1581 mt 2110 1581 L 2110 1255 mt 2110 1581 L 1589 1255 mt 1589 1581 L 1589 1581 mt 2110 1581 L 1589 1255 mt 1589 1581 L 1589 1581 mt 2110 1581 L 1589 1255 mt 2110 1255 L 1589 1255 mt 1589 1581 L 2110 1255 mt 2110 1581 L 1 sg 0 -326 522 0 0 326 2279 1255 4 MP PP -522 0 0 -326 522 0 0 326 2279 1255 5 MP stroke gs 2279 1255 523 327 MR c np gs np 2279 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 2279 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3C08041C1CFCFCC2 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 1255 mt 2801 1255 L 2279 1581 mt 2801 1581 L 2801 1255 mt 2801 1581 L 2279 1255 mt 2279 1581 L 2279 1581 mt 2801 1581 L 2279 1255 mt 2279 1581 L 2279 1581 mt 2801 1581 L 2279 1255 mt 2801 1255 L 2279 1255 mt 2279 1581 L 2801 1255 mt 2801 1581 L 1 sg 0 -326 522 0 0 326 2970 1255 4 MP PP -522 0 0 -326 522 0 0 326 2970 1255 5 MP stroke gs 2970 1255 523 327 MR c np gs np 2970 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 2970 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0C18083122FFFFF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 1255 mt 3492 1255 L 2970 1581 mt 3492 1581 L 3492 1255 mt 3492 1581 L 2970 1255 mt 2970 1581 L 2970 1581 mt 3492 1581 L 2970 1255 mt 2970 1581 L 2970 1581 mt 3492 1581 L 2970 1255 mt 3492 1255 L 2970 1255 mt 2970 1581 L 3492 1255 mt 3492 1581 L 1 sg 0 -326 522 0 0 326 3660 1255 4 MP PP -522 0 0 -326 522 0 0 326 3660 1255 5 MP stroke gs 3660 1255 523 327 MR c np gs np 3660 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 3660 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 4078381870FCFF4F {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 1255 mt 4182 1255 L 3660 1581 mt 4182 1581 L 4182 1255 mt 4182 1581 L 3660 1255 mt 3660 1581 L 3660 1581 mt 4182 1581 L 3660 1255 mt 3660 1581 L 3660 1581 mt 4182 1581 L 3660 1255 mt 4182 1255 L 3660 1255 mt 3660 1581 L 4182 1255 mt 4182 1581 L 1 sg 0 -326 522 0 0 326 4351 1255 4 MP PP -522 0 0 -326 522 0 0 326 4351 1255 5 MP stroke gs 4351 1255 523 327 MR c np gs np 4351 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 4351 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 78DE8C0C2C1C7C3E {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 1255 mt 4873 1255 L 4351 1581 mt 4873 1581 L 4873 1255 mt 4873 1581 L 4351 1255 mt 4351 1581 L 4351 1581 mt 4873 1581 L 4351 1255 mt 4351 1581 L 4351 1581 mt 4873 1581 L 4351 1255 mt 4873 1255 L 4351 1255 mt 4351 1581 L 4873 1255 mt 4873 1581 L 1 sg 0 -326 521 0 0 326 5042 1255 4 MP PP -521 0 0 -326 521 0 0 326 5042 1255 5 MP stroke gs 5042 1255 522 327 MR c np gs np 5042 1255 mt 0 327 rl 522 0 rl 0 -327 rl cp c np [522 0 0 327 5042 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E2E069C78787F87 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 1255 mt 5563 1255 L 5042 1581 mt 5563 1581 L 5563 1255 mt 5563 1581 L 5042 1255 mt 5042 1581 L 5042 1581 mt 5563 1581 L 5042 1255 mt 5042 1581 L 5042 1581 mt 5563 1581 L 5042 1255 mt 5563 1255 L 5042 1255 mt 5042 1581 L 5563 1255 mt 5563 1581 L 1 sg 0 -326 522 0 0 326 5732 1255 4 MP PP -522 0 0 -326 522 0 0 326 5732 1255 5 MP stroke gs 5732 1255 523 327 MR c np gs np 5732 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 5732 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F21C003027EF6E0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 1255 mt 6254 1255 L 5732 1581 mt 6254 1581 L 6254 1255 mt 6254 1581 L 5732 1255 mt 5732 1581 L 5732 1581 mt 6254 1581 L 5732 1255 mt 5732 1581 L 5732 1581 mt 6254 1581 L 5732 1255 mt 6254 1255 L 5732 1255 mt 5732 1581 L 6254 1255 mt 6254 1581 L 1 sg 0 -327 522 0 0 327 898 1688 4 MP PP -522 0 0 -327 522 0 0 327 898 1688 5 MP stroke gs 898 1688 523 328 MR c np gs np 898 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7E821C3A020317FC {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 1688 mt 1420 1688 L 898 2015 mt 1420 2015 L 1420 1688 mt 1420 2015 L 898 1688 mt 898 2015 L 898 2015 mt 1420 2015 L 898 1688 mt 898 2015 L 898 2015 mt 1420 2015 L 898 1688 mt 1420 1688 L 898 1688 mt 898 2015 L 1420 1688 mt 1420 2015 L 1 sg 0 -327 521 0 0 327 1589 1688 4 MP PP -521 0 0 -327 521 0 0 327 1589 1688 5 MP stroke gs 1589 1688 522 328 MR c np gs np 1589 1688 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FE2E0E3F03033F7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 1688 mt 2110 1688 L 1589 2015 mt 2110 2015 L 2110 1688 mt 2110 2015 L 1589 1688 mt 1589 2015 L 1589 2015 mt 2110 2015 L 1589 1688 mt 1589 2015 L 1589 2015 mt 2110 2015 L 1589 1688 mt 2110 1688 L 1589 1688 mt 1589 2015 L 2110 1688 mt 2110 2015 L 1 sg 0 -327 522 0 0 327 2279 1688 4 MP PP -522 0 0 -327 522 0 0 327 2279 1688 5 MP stroke gs 2279 1688 523 328 MR c np gs np 2279 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7F431EC703132F7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 1688 mt 2801 1688 L 2279 2015 mt 2801 2015 L 2801 1688 mt 2801 2015 L 2279 1688 mt 2279 2015 L 2279 2015 mt 2801 2015 L 2279 1688 mt 2279 2015 L 2279 2015 mt 2801 2015 L 2279 1688 mt 2801 1688 L 2279 1688 mt 2279 2015 L 2801 1688 mt 2801 2015 L 1 sg 0 -327 522 0 0 327 2970 1688 4 MP PP -522 0 0 -327 522 0 0 327 2970 1688 5 MP stroke gs 2970 1688 523 328 MR c np gs np 2970 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FCEE341F03035FFD {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 1688 mt 3492 1688 L 2970 2015 mt 3492 2015 L 3492 1688 mt 3492 2015 L 2970 1688 mt 2970 2015 L 2970 2015 mt 3492 2015 L 2970 1688 mt 2970 2015 L 2970 2015 mt 3492 2015 L 2970 1688 mt 3492 1688 L 2970 1688 mt 2970 2015 L 3492 1688 mt 3492 2015 L 1 sg 0 -327 522 0 0 327 3660 1688 4 MP PP -522 0 0 -327 522 0 0 327 3660 1688 5 MP stroke gs 3660 1688 523 328 MR c np gs np 3660 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7F331E2E0202C6FC {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 1688 mt 4182 1688 L 3660 2015 mt 4182 2015 L 4182 1688 mt 4182 2015 L 3660 1688 mt 3660 2015 L 3660 2015 mt 4182 2015 L 3660 1688 mt 3660 2015 L 3660 2015 mt 4182 2015 L 3660 1688 mt 4182 1688 L 3660 1688 mt 3660 2015 L 4182 1688 mt 4182 2015 L 1 sg 0 -327 522 0 0 327 4351 1688 4 MP PP -522 0 0 -327 522 0 0 327 4351 1688 5 MP stroke gs 4351 1688 523 328 MR c np gs np 4351 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F1B1F0F0196FCB8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 1688 mt 4873 1688 L 4351 2015 mt 4873 2015 L 4873 1688 mt 4873 2015 L 4351 1688 mt 4351 2015 L 4351 2015 mt 4873 2015 L 4351 1688 mt 4351 2015 L 4351 2015 mt 4873 2015 L 4351 1688 mt 4873 1688 L 4351 1688 mt 4351 2015 L 4873 1688 mt 4873 2015 L 1 sg 0 -327 521 0 0 327 5042 1688 4 MP PP -521 0 0 -327 521 0 0 327 5042 1688 5 MP stroke gs 5042 1688 522 328 MR c np gs np 5042 1688 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 4E1D073E2B079EF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 1688 mt 5563 1688 L 5042 2015 mt 5563 2015 L 5563 1688 mt 5563 2015 L 5042 1688 mt 5042 2015 L 5042 2015 mt 5563 2015 L 5042 1688 mt 5042 2015 L 5042 2015 mt 5563 2015 L 5042 1688 mt 5563 1688 L 5042 1688 mt 5042 2015 L 5563 1688 mt 5563 2015 L 1 sg 0 -327 522 0 0 327 5732 1688 4 MP PP -522 0 0 -327 522 0 0 327 5732 1688 5 MP stroke gs 5732 1688 523 328 MR c np gs np 5732 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E3F0A1C1E8EFE74 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 1688 mt 6254 1688 L 5732 2015 mt 6254 2015 L 6254 1688 mt 6254 2015 L 5732 1688 mt 5732 2015 L 5732 2015 mt 6254 2015 L 5732 1688 mt 5732 2015 L 5732 2015 mt 6254 2015 L 5732 1688 mt 6254 1688 L 5732 1688 mt 5732 2015 L 6254 1688 mt 6254 2015 L 1 sg 0 -327 522 0 0 327 898 2121 4 MP PP -522 0 0 -327 522 0 0 327 898 2121 5 MP stroke gs 898 2121 523 328 MR c np gs np 898 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 6166C6FF9C302440 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2121 mt 1420 2121 L 898 2448 mt 1420 2448 L 1420 2121 mt 1420 2448 L 898 2121 mt 898 2448 L 898 2448 mt 1420 2448 L 898 2121 mt 898 2448 L 898 2448 mt 1420 2448 L 898 2121 mt 1420 2121 L 898 2121 mt 898 2448 L 1420 2121 mt 1420 2448 L 1 sg 0 -327 521 0 0 327 1589 2121 4 MP PP -521 0 0 -327 521 0 0 327 1589 2121 5 MP stroke gs 1589 2121 522 328 MR c np gs np 1589 2121 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 010327FE7C306040 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2121 mt 2110 2121 L 1589 2448 mt 2110 2448 L 2110 2121 mt 2110 2448 L 1589 2121 mt 1589 2448 L 1589 2448 mt 2110 2448 L 1589 2121 mt 1589 2448 L 1589 2448 mt 2110 2448 L 1589 2121 mt 2110 2121 L 1589 2121 mt 1589 2448 L 2110 2121 mt 2110 2448 L 1 sg 0 -327 522 0 0 327 2279 2121 4 MP PP -522 0 0 -327 522 0 0 327 2279 2121 5 MP stroke gs 2279 2121 523 328 MR c np gs np 2279 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 034666FFFD281C10 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2121 mt 2801 2121 L 2279 2448 mt 2801 2448 L 2801 2121 mt 2801 2448 L 2279 2121 mt 2279 2448 L 2279 2448 mt 2801 2448 L 2279 2121 mt 2279 2448 L 2279 2448 mt 2801 2448 L 2279 2121 mt 2801 2121 L 2279 2121 mt 2279 2448 L 2801 2121 mt 2801 2448 L 1 sg 0 -327 522 0 0 327 2970 2121 4 MP PP -522 0 0 -327 522 0 0 327 2970 2121 5 MP stroke gs 2970 2121 523 328 MR c np gs np 2970 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 032366FEFE387030 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2121 mt 3492 2121 L 2970 2448 mt 3492 2448 L 3492 2121 mt 3492 2448 L 2970 2121 mt 2970 2448 L 2970 2448 mt 3492 2448 L 2970 2121 mt 2970 2448 L 2970 2448 mt 3492 2448 L 2970 2121 mt 3492 2121 L 2970 2121 mt 2970 2448 L 3492 2121 mt 3492 2448 L 1 sg 0 -327 522 0 0 327 3660 2121 4 MP PP -522 0 0 -327 522 0 0 327 3660 2121 5 MP stroke gs 3660 2121 523 328 MR c np gs np 3660 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03C267FDFD7A0000 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2121 mt 4182 2121 L 3660 2448 mt 4182 2448 L 4182 2121 mt 4182 2448 L 3660 2121 mt 3660 2448 L 3660 2448 mt 4182 2448 L 3660 2121 mt 3660 2448 L 3660 2448 mt 4182 2448 L 3660 2121 mt 4182 2121 L 3660 2121 mt 3660 2448 L 4182 2121 mt 4182 2448 L 1 sg 0 -327 522 0 0 327 4351 2121 4 MP PP -522 0 0 -327 522 0 0 327 4351 2121 5 MP stroke gs 4351 2121 523 328 MR c np gs np 4351 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0171E7FE0C3C2040 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2121 mt 4873 2121 L 4351 2448 mt 4873 2448 L 4873 2121 mt 4873 2448 L 4351 2121 mt 4351 2448 L 4351 2448 mt 4873 2448 L 4351 2121 mt 4351 2448 L 4351 2448 mt 4873 2448 L 4351 2121 mt 4873 2121 L 4351 2121 mt 4351 2448 L 4873 2121 mt 4873 2448 L 1 sg 0 -327 521 0 0 327 5042 2121 4 MP PP -521 0 0 -327 521 0 0 327 5042 2121 5 MP stroke gs 5042 2121 522 328 MR c np gs np 5042 2121 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 397BE3FEBC3E3010 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2121 mt 5563 2121 L 5042 2448 mt 5563 2448 L 5563 2121 mt 5563 2448 L 5042 2121 mt 5042 2448 L 5042 2448 mt 5563 2448 L 5042 2121 mt 5042 2448 L 5042 2448 mt 5563 2448 L 5042 2121 mt 5563 2121 L 5042 2121 mt 5042 2448 L 5563 2121 mt 5563 2448 L 1 sg 0 -327 522 0 0 327 5732 2121 4 MP PP -522 0 0 -327 522 0 0 327 5732 2121 5 MP stroke gs 5732 2121 523 328 MR c np gs np 5732 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 01036264FFFE1810 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2121 mt 6254 2121 L 5732 2448 mt 6254 2448 L 6254 2121 mt 6254 2448 L 5732 2121 mt 5732 2448 L 5732 2448 mt 6254 2448 L 5732 2121 mt 5732 2448 L 5732 2448 mt 6254 2448 L 5732 2121 mt 6254 2121 L 5732 2121 mt 5732 2448 L 6254 2121 mt 6254 2448 L 1 sg 0 -327 522 0 0 327 898 2554 4 MP PP -522 0 0 -327 522 0 0 327 898 2554 5 MP stroke gs 898 2554 523 328 MR c np gs np 898 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F1D1C36244CFCF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2554 mt 1420 2554 L 898 2881 mt 1420 2881 L 1420 2554 mt 1420 2881 L 898 2554 mt 898 2881 L 898 2881 mt 1420 2881 L 898 2554 mt 898 2881 L 898 2881 mt 1420 2881 L 898 2554 mt 1420 2554 L 898 2554 mt 898 2881 L 1420 2554 mt 1420 2881 L 1 sg 0 -327 521 0 0 327 1589 2554 4 MP PP -521 0 0 -327 521 0 0 327 1589 2554 5 MP stroke gs 1589 2554 522 328 MR c np gs np 1589 2554 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0776C0488606E67C {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2554 mt 2110 2554 L 1589 2881 mt 2110 2881 L 2110 2554 mt 2110 2881 L 1589 2554 mt 1589 2881 L 1589 2881 mt 2110 2881 L 1589 2554 mt 1589 2881 L 1589 2881 mt 2110 2881 L 1589 2554 mt 2110 2554 L 1589 2554 mt 1589 2881 L 2110 2554 mt 2110 2881 L 1 sg 0 -327 522 0 0 327 2279 2554 4 MP PP -522 0 0 -327 522 0 0 327 2279 2554 5 MP stroke gs 2279 2554 523 328 MR c np gs np 2279 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F1C307AB018E0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2554 mt 2801 2554 L 2279 2881 mt 2801 2881 L 2801 2554 mt 2801 2881 L 2279 2554 mt 2279 2881 L 2279 2881 mt 2801 2881 L 2279 2554 mt 2279 2881 L 2279 2881 mt 2801 2881 L 2279 2554 mt 2801 2554 L 2279 2554 mt 2279 2881 L 2801 2554 mt 2801 2881 L 1 sg 0 -327 522 0 0 327 2970 2554 4 MP PP -522 0 0 -327 522 0 0 327 2970 2554 5 MP stroke gs 2970 2554 523 328 MR c np gs np 2970 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F07382008C4FCF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2554 mt 3492 2554 L 2970 2881 mt 3492 2881 L 3492 2554 mt 3492 2881 L 2970 2554 mt 2970 2881 L 2970 2881 mt 3492 2881 L 2970 2554 mt 2970 2881 L 2970 2881 mt 3492 2881 L 2970 2554 mt 3492 2554 L 2970 2554 mt 2970 2881 L 3492 2554 mt 3492 2881 L 1 sg 0 -327 522 0 0 327 3660 2554 4 MP PP -522 0 0 -327 522 0 0 327 3660 2554 5 MP stroke gs 3660 2554 523 328 MR c np gs np 3660 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F3578608CCCCE76 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2554 mt 4182 2554 L 3660 2881 mt 4182 2881 L 4182 2554 mt 4182 2881 L 3660 2554 mt 3660 2881 L 3660 2881 mt 4182 2881 L 3660 2554 mt 3660 2881 L 3660 2881 mt 4182 2881 L 3660 2554 mt 4182 2554 L 3660 2554 mt 3660 2881 L 4182 2554 mt 4182 2881 L 1 sg 0 -327 522 0 0 327 4351 2554 4 MP PP -522 0 0 -327 522 0 0 327 4351 2554 5 MP stroke gs 4351 2554 523 328 MR c np gs np 4351 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F3F34780C06FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2554 mt 4873 2554 L 4351 2881 mt 4873 2881 L 4873 2554 mt 4873 2881 L 4351 2554 mt 4351 2881 L 4351 2881 mt 4873 2881 L 4351 2554 mt 4351 2881 L 4351 2881 mt 4873 2881 L 4351 2554 mt 4873 2554 L 4351 2554 mt 4351 2881 L 4873 2554 mt 4873 2881 L 1 sg 0 -327 521 0 0 327 5042 2554 4 MP PP -521 0 0 -327 521 0 0 327 5042 2554 5 MP stroke gs 5042 2554 522 328 MR c np gs np 5042 2554 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F30FCE4DE86C57C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2554 mt 5563 2554 L 5042 2881 mt 5563 2881 L 5563 2554 mt 5563 2881 L 5042 2554 mt 5042 2881 L 5042 2881 mt 5563 2881 L 5042 2554 mt 5042 2881 L 5042 2881 mt 5563 2881 L 5042 2554 mt 5563 2554 L 5042 2554 mt 5042 2881 L 5563 2554 mt 5563 2881 L 1 sg 0 -327 522 0 0 327 5732 2554 4 MP PP -522 0 0 -327 522 0 0 327 5732 2554 5 MP stroke gs 5732 2554 523 328 MR c np gs np 5732 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3FD6E07CDE03FEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2554 mt 6254 2554 L 5732 2881 mt 6254 2881 L 6254 2554 mt 6254 2881 L 5732 2554 mt 5732 2881 L 5732 2881 mt 6254 2881 L 5732 2554 mt 5732 2881 L 5732 2881 mt 6254 2881 L 5732 2554 mt 6254 2554 L 5732 2554 mt 5732 2881 L 6254 2554 mt 6254 2881 L 1 sg 0 -327 522 0 0 327 898 2987 4 MP PP -522 0 0 -327 522 0 0 327 898 2987 5 MP stroke gs 898 2987 523 328 MR c np gs np 898 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 8C187060C7EBFF1E {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2987 mt 1420 2987 L 898 3314 mt 1420 3314 L 1420 2987 mt 1420 3314 L 898 2987 mt 898 3314 L 898 3314 mt 1420 3314 L 898 2987 mt 898 3314 L 898 3314 mt 1420 3314 L 898 2987 mt 1420 2987 L 898 2987 mt 898 3314 L 1420 2987 mt 1420 3314 L 1 sg 0 -327 521 0 0 327 1589 2987 4 MP PP -521 0 0 -327 521 0 0 327 1589 2987 5 MP stroke gs 1589 2987 522 328 MR c np gs np 1589 2987 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3030E067FBC3FFFE {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2987 mt 2110 2987 L 1589 3314 mt 2110 3314 L 2110 2987 mt 2110 3314 L 1589 2987 mt 1589 3314 L 1589 3314 mt 2110 3314 L 1589 2987 mt 1589 3314 L 1589 3314 mt 2110 3314 L 1589 2987 mt 2110 2987 L 1589 2987 mt 1589 3314 L 2110 2987 mt 2110 3314 L 1 sg 0 -327 522 0 0 327 2279 2987 4 MP PP -522 0 0 -327 522 0 0 327 2279 2987 5 MP stroke gs 2279 2987 523 328 MR c np gs np 2279 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 2070C0C2EFCBD77E {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2987 mt 2801 2987 L 2279 3314 mt 2801 3314 L 2801 2987 mt 2801 3314 L 2279 2987 mt 2279 3314 L 2279 3314 mt 2801 3314 L 2279 2987 mt 2279 3314 L 2279 3314 mt 2801 3314 L 2279 2987 mt 2801 2987 L 2279 2987 mt 2279 3314 L 2801 2987 mt 2801 3314 L 1 sg 0 -327 522 0 0 327 2970 2987 4 MP PP -522 0 0 -327 522 0 0 327 2970 2987 5 MP stroke gs 2970 2987 523 328 MR c np gs np 2970 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E1C3870CFD3F6FC {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2987 mt 3492 2987 L 2970 3314 mt 3492 3314 L 3492 2987 mt 3492 3314 L 2970 2987 mt 2970 3314 L 2970 3314 mt 3492 3314 L 2970 2987 mt 2970 3314 L 2970 3314 mt 3492 3314 L 2970 2987 mt 3492 2987 L 2970 2987 mt 2970 3314 L 3492 2987 mt 3492 3314 L 1 sg 0 -327 522 0 0 327 3660 2987 4 MP PP -522 0 0 -327 522 0 0 327 3660 2987 5 MP stroke gs 3660 2987 523 328 MR c np gs np 3660 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0C3C3870FEB7FEFA {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2987 mt 4182 2987 L 3660 3314 mt 4182 3314 L 4182 2987 mt 4182 3314 L 3660 2987 mt 3660 3314 L 3660 3314 mt 4182 3314 L 3660 2987 mt 3660 3314 L 3660 3314 mt 4182 3314 L 3660 2987 mt 4182 2987 L 3660 2987 mt 3660 3314 L 4182 2987 mt 4182 3314 L 1 sg 0 -327 522 0 0 327 4351 2987 4 MP PP -522 0 0 -327 522 0 0 327 4351 2987 5 MP stroke gs 4351 2987 523 328 MR c np gs np 4351 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 6060C0D0DFDEFF7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2987 mt 4873 2987 L 4351 3314 mt 4873 3314 L 4873 2987 mt 4873 3314 L 4351 2987 mt 4351 3314 L 4351 3314 mt 4873 3314 L 4351 2987 mt 4351 3314 L 4351 3314 mt 4873 3314 L 4351 2987 mt 4873 2987 L 4351 2987 mt 4351 3314 L 4873 2987 mt 4873 3314 L 1 sg 0 -327 521 0 0 327 5042 2987 4 MP PP -521 0 0 -327 521 0 0 327 5042 2987 5 MP stroke gs 5042 2987 522 328 MR c np gs np 5042 2987 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 183870E0CFDFFE7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2987 mt 5563 2987 L 5042 3314 mt 5563 3314 L 5563 2987 mt 5563 3314 L 5042 2987 mt 5042 3314 L 5042 3314 mt 5563 3314 L 5042 2987 mt 5042 3314 L 5042 3314 mt 5563 3314 L 5042 2987 mt 5563 2987 L 5042 2987 mt 5042 3314 L 5563 2987 mt 5563 3314 L 1 sg 0 -327 522 0 0 327 5732 2987 4 MP PP -522 0 0 -327 522 0 0 327 5732 2987 5 MP stroke gs 5732 2987 523 328 MR c np gs np 5732 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0C183876E4FEFB7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2987 mt 6254 2987 L 5732 3314 mt 6254 3314 L 6254 2987 mt 6254 3314 L 5732 2987 mt 5732 3314 L 5732 3314 mt 6254 3314 L 5732 2987 mt 5732 3314 L 5732 3314 mt 6254 3314 L 5732 2987 mt 6254 2987 L 5732 2987 mt 5732 3314 L 6254 2987 mt 6254 3314 L 1 sg 0 -327 522 0 0 327 898 3420 4 MP PP -522 0 0 -327 522 0 0 327 898 3420 5 MP stroke gs 898 3420 523 328 MR c np gs np 898 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 8773060201030101 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 3420 mt 1420 3420 L 898 3747 mt 1420 3747 L 1420 3420 mt 1420 3747 L 898 3420 mt 898 3747 L 898 3747 mt 1420 3747 L 898 3420 mt 898 3747 L 898 3747 mt 1420 3747 L 898 3420 mt 1420 3420 L 898 3420 mt 898 3747 L 1420 3420 mt 1420 3747 L 1 sg 0 -327 521 0 0 327 1589 3420 4 MP PP -521 0 0 -327 521 0 0 327 1589 3420 5 MP stroke gs 1589 3420 522 328 MR c np gs np 1589 3420 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7FF7C7460C187830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 3420 mt 2110 3420 L 1589 3747 mt 2110 3747 L 2110 3420 mt 2110 3747 L 1589 3420 mt 1589 3747 L 1589 3747 mt 2110 3747 L 1589 3420 mt 1589 3747 L 1589 3747 mt 2110 3747 L 1589 3420 mt 2110 3420 L 1589 3420 mt 1589 3747 L 2110 3420 mt 2110 3747 L 1 sg 0 -327 522 0 0 327 2279 3420 4 MP PP -522 0 0 -327 522 0 0 327 2279 3420 5 MP stroke gs 2279 3420 523 328 MR c np gs np 2279 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FFFF060C183060C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 3420 mt 2801 3420 L 2279 3747 mt 2801 3747 L 2801 3420 mt 2801 3747 L 2279 3420 mt 2279 3747 L 2279 3747 mt 2801 3747 L 2279 3420 mt 2279 3747 L 2279 3747 mt 2801 3747 L 2279 3420 mt 2801 3420 L 2279 3420 mt 2279 3747 L 2801 3420 mt 2801 3747 L 1 sg 0 -327 522 0 0 327 2970 3420 4 MP PP -522 0 0 -327 522 0 0 327 2970 3420 5 MP stroke gs 2970 3420 523 328 MR c np gs np 2970 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i BF7B070E1C3C9032 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 3420 mt 3492 3420 L 2970 3747 mt 3492 3747 L 3492 3420 mt 3492 3747 L 2970 3420 mt 2970 3747 L 2970 3747 mt 3492 3747 L 2970 3420 mt 2970 3747 L 2970 3747 mt 3492 3747 L 2970 3420 mt 3492 3420 L 2970 3420 mt 2970 3747 L 3492 3420 mt 3492 3747 L 1 sg 0 -327 522 0 0 327 3660 3420 4 MP PP -522 0 0 -327 522 0 0 327 3660 3420 5 MP stroke gs 3660 3420 523 328 MR c np gs np 3660 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E1F060E1838E060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 3420 mt 4182 3420 L 3660 3747 mt 4182 3747 L 4182 3420 mt 4182 3747 L 3660 3420 mt 3660 3747 L 3660 3747 mt 4182 3747 L 3660 3420 mt 3660 3747 L 3660 3747 mt 4182 3747 L 3660 3420 mt 4182 3420 L 3660 3420 mt 3660 3747 L 4182 3420 mt 4182 3747 L 1 sg 0 -327 522 0 0 327 4351 3420 4 MP PP -522 0 0 -327 522 0 0 327 4351 3420 5 MP stroke gs 4351 3420 523 328 MR c np gs np 4351 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FECFC2870E1C3830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 3420 mt 4873 3420 L 4351 3747 mt 4873 3747 L 4873 3420 mt 4873 3747 L 4351 3420 mt 4351 3747 L 4351 3747 mt 4873 3747 L 4351 3420 mt 4351 3747 L 4351 3747 mt 4873 3747 L 4351 3420 mt 4873 3420 L 4351 3420 mt 4351 3747 L 4873 3420 mt 4873 3747 L 1 sg 0 -327 521 0 0 327 5042 3420 4 MP PP -521 0 0 -327 521 0 0 327 5042 3420 5 MP stroke gs 5042 3420 522 328 MR c np gs np 5042 3420 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7FFF0E0C18383060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 3420 mt 5563 3420 L 5042 3747 mt 5563 3747 L 5563 3420 mt 5563 3747 L 5042 3420 mt 5042 3747 L 5042 3747 mt 5563 3747 L 5042 3420 mt 5042 3747 L 5042 3747 mt 5563 3747 L 5042 3420 mt 5563 3420 L 5042 3420 mt 5042 3747 L 5563 3420 mt 5563 3747 L 1 sg 0 -327 522 0 0 327 5732 3420 4 MP PP -522 0 0 -327 522 0 0 327 5732 3420 5 MP stroke gs 5732 3420 523 328 MR c np gs np 5732 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FB0F060C3C38E060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 3420 mt 6254 3420 L 5732 3747 mt 6254 3747 L 6254 3420 mt 6254 3747 L 5732 3420 mt 5732 3747 L 5732 3747 mt 6254 3747 L 5732 3420 mt 5732 3747 L 5732 3747 mt 6254 3747 L 5732 3420 mt 6254 3420 L 5732 3420 mt 5732 3747 L 6254 3420 mt 6254 3747 L 1 sg 0 -327 522 0 0 327 898 3853 4 MP PP -522 0 0 -327 522 0 0 327 898 3853 5 MP stroke gs 898 3853 523 328 MR c np gs np 898 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F3D363A70F0F0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 3853 mt 1420 3853 L 898 4180 mt 1420 4180 L 1420 3853 mt 1420 4180 L 898 3853 mt 898 4180 L 898 4180 mt 1420 4180 L 898 3853 mt 898 4180 L 898 4180 mt 1420 4180 L 898 3853 mt 1420 3853 L 898 3853 mt 898 4180 L 1420 3853 mt 1420 4180 L 1 sg 0 -327 521 0 0 327 1589 3853 4 MP PP -521 0 0 -327 521 0 0 327 1589 3853 5 MP stroke gs 1589 3853 522 328 MR c np gs np 1589 3853 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 69794BFE70F0D0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 3853 mt 2110 3853 L 1589 4180 mt 2110 4180 L 2110 3853 mt 2110 4180 L 1589 3853 mt 1589 4180 L 1589 4180 mt 2110 4180 L 1589 3853 mt 1589 4180 L 1589 4180 mt 2110 4180 L 1589 3853 mt 2110 3853 L 1589 3853 mt 1589 4180 L 2110 3853 mt 2110 4180 L 1 sg 0 -327 522 0 0 327 2279 3853 4 MP PP -522 0 0 -327 522 0 0 327 2279 3853 5 MP stroke gs 2279 3853 523 328 MR c np gs np 2279 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F1F3F5C7870E0E0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 3853 mt 2801 3853 L 2279 4180 mt 2801 4180 L 2801 3853 mt 2801 4180 L 2279 3853 mt 2279 4180 L 2279 4180 mt 2801 4180 L 2279 3853 mt 2279 4180 L 2279 4180 mt 2801 4180 L 2279 3853 mt 2801 3853 L 2279 3853 mt 2279 4180 L 2801 3853 mt 2801 4180 L 1 sg 0 -327 522 0 0 327 2970 3853 4 MP PP -522 0 0 -327 522 0 0 327 2970 3853 5 MP stroke gs 2970 3853 523 328 MR c np gs np 2970 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F7D514F7EEAF8F4 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 3853 mt 3492 3853 L 2970 4180 mt 3492 4180 L 3492 3853 mt 3492 4180 L 2970 3853 mt 2970 4180 L 2970 4180 mt 3492 4180 L 2970 3853 mt 2970 4180 L 2970 4180 mt 3492 4180 L 2970 3853 mt 3492 3853 L 2970 3853 mt 2970 4180 L 3492 3853 mt 3492 4180 L 1 sg 0 -327 522 0 0 327 3660 3853 4 MP PP -522 0 0 -327 522 0 0 327 3660 3853 5 MP stroke gs 3660 3853 523 328 MR c np gs np 3660 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3B79667C3860F0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 3853 mt 4182 3853 L 3660 4180 mt 4182 4180 L 4182 3853 mt 4182 4180 L 3660 3853 mt 3660 4180 L 3660 4180 mt 4182 4180 L 3660 3853 mt 3660 4180 L 3660 4180 mt 4182 4180 L 3660 3853 mt 4182 3853 L 3660 3853 mt 3660 4180 L 4182 3853 mt 4182 4180 L 1 sg 0 -327 522 0 0 327 4351 3853 4 MP PP -522 0 0 -327 522 0 0 327 4351 3853 5 MP stroke gs 4351 3853 523 328 MR c np gs np 4351 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3A70CF7EE290F6F8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 3853 mt 4873 3853 L 4351 4180 mt 4873 4180 L 4873 3853 mt 4873 4180 L 4351 3853 mt 4351 4180 L 4351 4180 mt 4873 4180 L 4351 3853 mt 4351 4180 L 4351 4180 mt 4873 4180 L 4351 3853 mt 4873 3853 L 4351 3853 mt 4351 4180 L 4873 3853 mt 4873 4180 L 1 sg 0 -327 521 0 0 327 5042 3853 4 MP PP -521 0 0 -327 521 0 0 327 5042 3853 5 MP stroke gs 5042 3853 522 328 MR c np gs np 5042 3853 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FCE7CF7EFED9EE7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 3853 mt 5563 3853 L 5042 4180 mt 5563 4180 L 5563 3853 mt 5563 4180 L 5042 3853 mt 5042 4180 L 5042 4180 mt 5563 4180 L 5042 3853 mt 5042 4180 L 5042 4180 mt 5563 4180 L 5042 3853 mt 5563 3853 L 5042 3853 mt 5042 4180 L 5563 3853 mt 5563 4180 L 1 sg 0 -327 522 0 0 327 5732 3853 4 MP PP -522 0 0 -327 522 0 0 327 5732 3853 5 MP stroke gs 5732 3853 523 328 MR c np gs np 5732 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F31571C5078D0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 3853 mt 6254 3853 L 5732 4180 mt 6254 4180 L 6254 3853 mt 6254 4180 L 5732 3853 mt 5732 4180 L 5732 4180 mt 6254 4180 L 5732 3853 mt 5732 4180 L 5732 4180 mt 6254 4180 L 5732 3853 mt 6254 3853 L 5732 3853 mt 5732 4180 L 6254 3853 mt 6254 4180 L 1 sg 0 -327 522 0 0 327 898 4286 4 MP PP -522 0 0 -327 522 0 0 327 898 4286 5 MP stroke gs 898 4286 523 328 MR c np gs np 898 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3AF6CE7E1C1C1830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 4286 mt 1420 4286 L 898 4613 mt 1420 4613 L 1420 4286 mt 1420 4613 L 898 4286 mt 898 4613 L 898 4613 mt 1420 4613 L 898 4286 mt 898 4613 L 898 4613 mt 1420 4613 L 898 4286 mt 1420 4286 L 898 4286 mt 898 4613 L 1420 4286 mt 1420 4613 L 1 sg 0 -327 521 0 0 327 1589 4286 4 MP PP -521 0 0 -327 521 0 0 327 1589 4286 5 MP stroke gs 1589 4286 522 328 MR c np gs np 1589 4286 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F7BC7DEFC0C1818 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 4286 mt 2110 4286 L 1589 4613 mt 2110 4613 L 2110 4286 mt 2110 4613 L 1589 4286 mt 1589 4613 L 1589 4613 mt 2110 4613 L 1589 4286 mt 1589 4613 L 1589 4613 mt 2110 4613 L 1589 4286 mt 2110 4286 L 1589 4286 mt 1589 4613 L 2110 4286 mt 2110 4613 L 1 sg 0 -327 522 0 0 327 2279 4286 4 MP PP -522 0 0 -327 522 0 0 327 2279 4286 5 MP stroke gs 2279 4286 523 328 MR c np gs np 2279 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 073EEF7E587070C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 4286 mt 2801 4286 L 2279 4613 mt 2801 4613 L 2801 4286 mt 2801 4613 L 2279 4286 mt 2279 4613 L 2279 4613 mt 2801 4613 L 2279 4286 mt 2279 4613 L 2279 4613 mt 2801 4613 L 2279 4286 mt 2801 4286 L 2279 4286 mt 2279 4613 L 2801 4286 mt 2801 4613 L 1 sg 0 -327 522 0 0 327 2970 4286 4 MP PP -522 0 0 -327 522 0 0 327 2970 4286 5 MP stroke gs 2970 4286 523 328 MR c np gs np 2970 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1FA73F1F1C3060C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 4286 mt 3492 4286 L 2970 4613 mt 3492 4613 L 3492 4286 mt 3492 4613 L 2970 4286 mt 2970 4613 L 2970 4613 mt 3492 4613 L 2970 4286 mt 2970 4613 L 2970 4613 mt 3492 4613 L 2970 4286 mt 3492 4286 L 2970 4286 mt 2970 4613 L 3492 4286 mt 3492 4613 L 1 sg 0 -327 522 0 0 327 3660 4286 4 MP PP -522 0 0 -327 522 0 0 327 3660 4286 5 MP stroke gs 3660 4286 523 328 MR c np gs np 3660 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7EFFFF7E0E0C0C18 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 4286 mt 4182 4286 L 3660 4613 mt 4182 4613 L 4182 4286 mt 4182 4613 L 3660 4286 mt 3660 4613 L 3660 4613 mt 4182 4613 L 3660 4286 mt 3660 4613 L 3660 4613 mt 4182 4613 L 3660 4286 mt 4182 4286 L 3660 4286 mt 3660 4613 L 4182 4286 mt 4182 4613 L 1 sg 0 -327 522 0 0 327 4351 4286 4 MP PP -522 0 0 -327 522 0 0 327 4351 4286 5 MP stroke gs 4351 4286 523 328 MR c np gs np 4351 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7EE3C6DC33201707 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 4286 mt 4873 4286 L 4351 4613 mt 4873 4613 L 4873 4286 mt 4873 4613 L 4351 4286 mt 4351 4613 L 4351 4613 mt 4873 4613 L 4351 4286 mt 4351 4613 L 4351 4613 mt 4873 4613 L 4351 4286 mt 4873 4286 L 4351 4286 mt 4351 4613 L 4873 4286 mt 4873 4613 L 1 sg 0 -327 521 0 0 327 5042 4286 4 MP PP -521 0 0 -327 521 0 0 327 5042 4286 5 MP stroke gs 5042 4286 522 328 MR c np gs np 5042 4286 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F7FE37F3E020604 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 4286 mt 5563 4286 L 5042 4613 mt 5563 4613 L 5563 4286 mt 5563 4613 L 5042 4286 mt 5042 4613 L 5042 4613 mt 5563 4613 L 5042 4286 mt 5042 4613 L 5042 4613 mt 5563 4613 L 5042 4286 mt 5563 4286 L 5042 4286 mt 5042 4613 L 5563 4286 mt 5563 4613 L 1 sg 0 -327 522 0 0 327 5732 4286 4 MP PP -522 0 0 -327 522 0 0 327 5732 4286 5 MP stroke gs 5732 4286 523 328 MR c np gs np 5732 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F73CFFE7C1C1810 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 4286 mt 6254 4286 L 5732 4613 mt 6254 4613 L 6254 4286 mt 6254 4613 L 5732 4286 mt 5732 4613 L 5732 4613 mt 6254 4613 L 5732 4286 mt 5732 4613 L 5732 4613 mt 6254 4613 L 5732 4286 mt 6254 4286 L 5732 4286 mt 5732 4613 L 6254 4286 mt 6254 4613 L end eplot epage end showpage %%EndDocument endTexFig 1299 0 a 8525330 6820264 5788794 14603550 35719495 38745456 startTexFig 1299 0 a %%BeginDocument: figs/fillin.ps % MathWorks dictionary /MathWorks 160 dict begin % definition operators /bdef {bind def} bind def /ldef {load def} bind def /xdef {exch def} bdef /xstore {exch store} bdef % operator abbreviations /c /clip ldef /cc /concat ldef /cp /closepath ldef /gr /grestore ldef /gs /gsave ldef /mt /moveto ldef /np /newpath ldef /cm /currentmatrix ldef /sm /setmatrix ldef /rc {rectclip} bdef /rf {rectfill} bdef /rm /rmoveto ldef /rl /rlineto ldef /s /show ldef /sc {setcmykcolor} bdef /sr /setrgbcolor ldef /sg /setgray ldef /w /setlinewidth ldef /j /setlinejoin ldef /cap /setlinecap ldef % page state control /pgsv () def /bpage {/pgsv save def} bdef /epage {pgsv restore} bdef /bplot /gsave ldef /eplot {stroke grestore} bdef % orientation switch /portraitMode 0 def /landscapeMode 1 def % coordinate system mappings /dpi2point 0 def % font control /FontSize 0 def /FMS { /FontSize xstore %save size off stack findfont [FontSize 0 0 FontSize neg 0 0] makefont setfont }bdef /reencode { exch dup where {pop load} {pop StandardEncoding} ifelse exch dup 3 1 roll findfont dup length dict begin { 1 index /FID ne {def}{pop pop} ifelse } forall /Encoding exch def currentdict end definefont pop } bdef /isroman { findfont /CharStrings get /Agrave known } bdef /FMSR { 3 1 roll 1 index dup isroman {reencode} {pop pop} ifelse exch FMS } bdef /csm { 1 dpi2point div -1 dpi2point div scale neg translate landscapeMode eq {90 rotate} if } bdef % line types: solid, dotted, dashed, dotdash /SO { [] 0 setdash } bdef /DO { [.5 dpi2point mul 4 dpi2point mul] 0 setdash } bdef /DA { [6 dpi2point mul] 0 setdash } bdef /DD { [.5 dpi2point mul 4 dpi2point mul 6 dpi2point mul 4 dpi2point mul] 0 setdash } bdef % macros for lines and objects /L { lineto stroke } bdef /MP { 3 1 roll moveto 1 sub {rlineto} repeat } bdef /AP { {rlineto} repeat } bdef /PP { closepath eofill } bdef /DP { closepath stroke } bdef /MR { 4 -2 roll moveto dup 0 exch rlineto exch 0 rlineto neg 0 exch rlineto closepath } bdef /FR { MR stroke } bdef /PR { MR fill } bdef /L1i { { currentfile picstr readhexstring pop } image } bdef /tMatrix matrix def /MakeOval { newpath tMatrix currentmatrix pop translate scale 0 0 1 0 360 arc tMatrix setmatrix } bdef /FO { MakeOval stroke } bdef /PO { MakeOval fill } bdef /PD { currentlinecap 1 setlinecap 3 1 roll 2 copy moveto lineto stroke setlinecap } bdef /FA { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arc tMatrix setmatrix stroke } bdef /PA { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arc closepath tMatrix setmatrix fill } bdef /FAn { newpath tMatrix currentmatrix pop translate scale 0 0 1 5 -2 roll arcn tMatrix setmatrix stroke } bdef /PAn { newpath tMatrix currentmatrix pop translate 0 0 moveto scale 0 0 1 5 -2 roll arcn closepath tMatrix setmatrix fill } bdef /MRR { /vradius xdef /hradius xdef /lry xdef /lrx xdef /uly xdef /ulx xdef newpath tMatrix currentmatrix pop ulx hradius add uly vradius add translate hradius vradius scale 0 0 1 180 270 arc tMatrix setmatrix lrx hradius sub uly vradius add translate hradius vradius scale 0 0 1 270 360 arc tMatrix setmatrix lrx hradius sub lry vradius sub translate hradius vradius scale 0 0 1 0 90 arc tMatrix setmatrix ulx hradius add lry vradius sub translate hradius vradius scale 0 0 1 90 180 arc tMatrix setmatrix closepath } bdef /FRR { MRR stroke } bdef /PRR { MRR fill } bdef /MlrRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lry uly sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 90 270 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 270 90 arc tMatrix setmatrix closepath } bdef /FlrRR { MlrRR stroke } bdef /PlrRR { MlrRR fill } bdef /MtbRR { /lry xdef /lrx xdef /uly xdef /ulx xdef /rad lrx ulx sub 2 div def newpath tMatrix currentmatrix pop ulx rad add uly rad add translate rad rad scale 0 0 1 180 360 arc tMatrix setmatrix lrx rad sub lry rad sub translate rad rad scale 0 0 1 0 180 arc tMatrix setmatrix closepath } bdef /FtbRR { MtbRR stroke } bdef /PtbRR { MtbRR fill } bdef currentdict end def MathWorks begin 0 cap end MathWorks begin bpage bplot /dpi2point 12 def portraitMode 0216 7344 csm 841 272 5463 4397 MR c np 26 dict begin %Colortable dictionary /c0 { 0 0 0 sr} bdef /c1 { 1 1 1 sr} bdef /c2 { 1 0 0 sr} bdef /c3 { 0 1 0 sr} bdef /c4 { 0 0 1 sr} bdef /c5 { 1 1 0 sr} bdef /c6 { 1 0 1 sr} bdef /c7 { 0 1 1 sr} bdef 1 j 1 sg 0 0 6913 5186 PR 6 w 0 -327 522 0 0 327 898 388 4 MP PP -522 0 0 -327 522 0 0 327 898 388 5 MP stroke gs 898 388 523 328 MR c np gs np 898 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F7B71E1C3C6FC78 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 388 mt 1420 388 L 898 715 mt 1420 715 L 1420 388 mt 1420 715 L 898 388 mt 898 715 L 898 715 mt 1420 715 L 898 388 mt 898 715 L 898 715 mt 1420 715 L 898 388 mt 1420 388 L 898 388 mt 898 715 L 1420 388 mt 1420 715 L 1 sg 0 -327 521 0 0 327 1589 388 4 MP PP -521 0 0 -327 521 0 0 327 1589 388 5 MP stroke gs 1589 388 522 328 MR c np gs np 1589 388 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 07070F1B63C6FCF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 388 mt 2110 388 L 1589 715 mt 2110 715 L 2110 388 mt 2110 715 L 1589 388 mt 1589 715 L 1589 715 mt 2110 715 L 1589 388 mt 1589 715 L 1589 715 mt 2110 715 L 1589 388 mt 2110 388 L 1589 388 mt 1589 715 L 2110 388 mt 2110 715 L 1 sg 0 -327 522 0 0 327 2279 388 4 MP PP -522 0 0 -327 522 0 0 327 2279 388 5 MP stroke gs 2279 388 523 328 MR c np gs np 2279 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E3F7363C3C7FE78 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 388 mt 2801 388 L 2279 715 mt 2801 715 L 2801 388 mt 2801 715 L 2279 388 mt 2279 715 L 2279 715 mt 2801 715 L 2279 388 mt 2279 715 L 2279 715 mt 2801 715 L 2279 388 mt 2801 388 L 2279 388 mt 2279 715 L 2801 388 mt 2801 715 L 1 sg 0 -327 522 0 0 327 2970 388 4 MP PP -522 0 0 -327 522 0 0 327 2970 388 5 MP stroke gs 2970 388 523 328 MR c np gs np 2970 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070F1F3363C6FCF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 388 mt 3492 388 L 2970 715 mt 3492 715 L 3492 388 mt 3492 715 L 2970 388 mt 2970 715 L 2970 715 mt 3492 715 L 2970 388 mt 2970 715 L 2970 715 mt 3492 715 L 2970 388 mt 3492 388 L 2970 388 mt 2970 715 L 3492 388 mt 3492 715 L 1 sg 0 -327 522 0 0 327 3660 388 4 MP PP -522 0 0 -327 522 0 0 327 3660 388 5 MP stroke gs 3660 388 523 328 MR c np gs np 3660 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 06071D3963C6FCF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 388 mt 4182 388 L 3660 715 mt 4182 715 L 4182 388 mt 4182 715 L 3660 388 mt 3660 715 L 3660 715 mt 4182 715 L 3660 388 mt 3660 715 L 3660 715 mt 4182 715 L 3660 388 mt 4182 388 L 3660 388 mt 3660 715 L 4182 388 mt 4182 715 L 1 sg 0 -327 522 0 0 327 4351 388 4 MP PP -522 0 0 -327 522 0 0 327 4351 388 5 MP stroke gs 4351 388 523 328 MR c np gs np 4351 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FCE6C381C3C3FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 388 mt 4873 388 L 4351 715 mt 4873 715 L 4873 388 mt 4873 715 L 4351 388 mt 4351 715 L 4351 715 mt 4873 715 L 4351 388 mt 4351 715 L 4351 715 mt 4873 715 L 4351 388 mt 4873 388 L 4351 388 mt 4351 715 L 4873 388 mt 4873 715 L 1 sg 0 -327 521 0 0 327 5042 388 4 MP PP -521 0 0 -327 521 0 0 327 5042 388 5 MP stroke gs 5042 388 522 328 MR c np gs np 5042 388 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E3F73E3C3C7FE78 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 388 mt 5563 388 L 5042 715 mt 5563 715 L 5563 388 mt 5563 715 L 5042 388 mt 5042 715 L 5042 715 mt 5563 715 L 5042 388 mt 5042 715 L 5042 715 mt 5563 715 L 5042 388 mt 5563 388 L 5042 388 mt 5042 715 L 5563 388 mt 5563 715 L 1 sg 0 -327 522 0 0 327 5732 388 4 MP PP -522 0 0 -327 522 0 0 327 5732 388 5 MP stroke gs 5732 388 523 328 MR c np gs np 5732 388 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 388] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 387E67C3C3C7FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 388 mt 6254 388 L 5732 715 mt 6254 715 L 6254 388 mt 6254 715 L 5732 388 mt 5732 715 L 5732 715 mt 6254 715 L 5732 388 mt 5732 715 L 5732 715 mt 6254 715 L 5732 388 mt 6254 388 L 5732 388 mt 5732 715 L 6254 388 mt 6254 715 L 1 sg 0 -327 522 0 0 327 898 821 4 MP PP -522 0 0 -327 522 0 0 327 898 821 5 MP stroke gs 898 821 523 328 MR c np gs np 898 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070E1C387070E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 821 mt 1420 821 L 898 1148 mt 1420 1148 L 1420 821 mt 1420 1148 L 898 821 mt 898 1148 L 898 1148 mt 1420 1148 L 898 821 mt 898 1148 L 898 1148 mt 1420 1148 L 898 821 mt 1420 821 L 898 821 mt 898 1148 L 1420 821 mt 1420 1148 L 1 sg 0 -327 521 0 0 327 1589 821 4 MP PP -521 0 0 -327 521 0 0 327 1589 821 5 MP stroke gs 1589 821 522 328 MR c np gs np 1589 821 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 07070E1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 821 mt 2110 821 L 1589 1148 mt 2110 1148 L 2110 821 mt 2110 1148 L 1589 821 mt 1589 1148 L 1589 1148 mt 2110 1148 L 1589 821 mt 1589 1148 L 1589 1148 mt 2110 1148 L 1589 821 mt 2110 821 L 1589 821 mt 1589 1148 L 2110 821 mt 2110 1148 L 1 sg 0 -327 522 0 0 327 2279 821 4 MP PP -522 0 0 -327 522 0 0 327 2279 821 5 MP stroke gs 2279 821 523 328 MR c np gs np 2279 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070E1C387070E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 821 mt 2801 821 L 2279 1148 mt 2801 1148 L 2801 821 mt 2801 1148 L 2279 821 mt 2279 1148 L 2279 1148 mt 2801 1148 L 2279 821 mt 2279 1148 L 2279 1148 mt 2801 1148 L 2279 821 mt 2801 821 L 2279 821 mt 2279 1148 L 2801 821 mt 2801 1148 L 1 sg 0 -327 522 0 0 327 2970 821 4 MP PP -522 0 0 -327 522 0 0 327 2970 821 5 MP stroke gs 2970 821 523 328 MR c np gs np 2970 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03060C1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 821 mt 3492 821 L 2970 1148 mt 3492 1148 L 3492 821 mt 3492 1148 L 2970 821 mt 2970 1148 L 2970 1148 mt 3492 1148 L 2970 821 mt 2970 1148 L 2970 1148 mt 3492 1148 L 2970 821 mt 3492 821 L 2970 821 mt 2970 1148 L 3492 821 mt 3492 1148 L 1 sg 0 -327 522 0 0 327 3660 821 4 MP PP -522 0 0 -327 522 0 0 327 3660 821 5 MP stroke gs 3660 821 523 328 MR c np gs np 3660 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03070F1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 821 mt 4182 821 L 3660 1148 mt 4182 1148 L 4182 821 mt 4182 1148 L 3660 821 mt 3660 1148 L 3660 1148 mt 4182 1148 L 3660 821 mt 3660 1148 L 3660 1148 mt 4182 1148 L 3660 821 mt 4182 821 L 3660 821 mt 3660 1148 L 4182 821 mt 4182 1148 L 1 sg 0 -327 522 0 0 327 4351 821 4 MP PP -522 0 0 -327 522 0 0 327 4351 821 5 MP stroke gs 4351 821 523 328 MR c np gs np 4351 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03060C183870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 821 mt 4873 821 L 4351 1148 mt 4873 1148 L 4873 821 mt 4873 1148 L 4351 821 mt 4351 1148 L 4351 1148 mt 4873 1148 L 4351 821 mt 4351 1148 L 4351 1148 mt 4873 1148 L 4351 821 mt 4873 821 L 4351 821 mt 4351 1148 L 4873 821 mt 4873 1148 L 1 sg 0 -327 521 0 0 327 5042 821 4 MP PP -521 0 0 -327 521 0 0 327 5042 821 5 MP stroke gs 5042 821 522 328 MR c np gs np 5042 821 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 03070E1C3870E0C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 821 mt 5563 821 L 5042 1148 mt 5563 1148 L 5563 821 mt 5563 1148 L 5042 821 mt 5042 1148 L 5042 1148 mt 5563 1148 L 5042 821 mt 5042 1148 L 5042 1148 mt 5563 1148 L 5042 821 mt 5563 821 L 5042 821 mt 5042 1148 L 5563 821 mt 5563 1148 L 1 sg 0 -327 522 0 0 327 5732 821 4 MP PP -522 0 0 -327 522 0 0 327 5732 821 5 MP stroke gs 5732 821 523 328 MR c np gs np 5732 821 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 821] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F7E7EFE7C7C7C7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 821 mt 6254 821 L 5732 1148 mt 6254 1148 L 6254 821 mt 6254 1148 L 5732 821 mt 5732 1148 L 5732 1148 mt 6254 1148 L 5732 821 mt 5732 1148 L 5732 1148 mt 6254 1148 L 5732 821 mt 6254 821 L 5732 821 mt 5732 1148 L 6254 821 mt 6254 1148 L 1 sg 0 -326 522 0 0 326 898 1255 4 MP PP -522 0 0 -326 522 0 0 326 898 1255 5 MP stroke gs 898 1255 523 327 MR c np gs np 898 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 898 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7CFCCC0C1C7EFFF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 1255 mt 1420 1255 L 898 1581 mt 1420 1581 L 1420 1255 mt 1420 1581 L 898 1255 mt 898 1581 L 898 1581 mt 1420 1581 L 898 1255 mt 898 1581 L 898 1581 mt 1420 1581 L 898 1255 mt 1420 1255 L 898 1255 mt 898 1581 L 1420 1255 mt 1420 1581 L 1 sg 0 -326 521 0 0 326 1589 1255 4 MP PP -521 0 0 -326 521 0 0 326 1589 1255 5 MP stroke gs 1589 1255 522 327 MR c np gs np 1589 1255 mt 0 327 rl 522 0 rl 0 -327 rl cp c np [522 0 0 327 1589 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7C7C383060FFFFF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 1255 mt 2110 1255 L 1589 1581 mt 2110 1581 L 2110 1255 mt 2110 1581 L 1589 1255 mt 1589 1581 L 1589 1581 mt 2110 1581 L 1589 1255 mt 1589 1581 L 1589 1581 mt 2110 1581 L 1589 1255 mt 2110 1255 L 1589 1255 mt 1589 1581 L 2110 1255 mt 2110 1581 L 1 sg 0 -326 522 0 0 326 2279 1255 4 MP PP -522 0 0 -326 522 0 0 326 2279 1255 5 MP stroke gs 2279 1255 523 327 MR c np gs np 2279 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 2279 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E7E0E0C1C7FFFF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 1255 mt 2801 1255 L 2279 1581 mt 2801 1581 L 2801 1255 mt 2801 1581 L 2279 1255 mt 2279 1581 L 2279 1581 mt 2801 1581 L 2279 1255 mt 2279 1581 L 2279 1581 mt 2801 1581 L 2279 1255 mt 2801 1255 L 2279 1255 mt 2279 1581 L 2801 1255 mt 2801 1581 L 1 sg 0 -326 522 0 0 326 2970 1255 4 MP PP -522 0 0 -326 522 0 0 326 2970 1255 5 MP stroke gs 2970 1255 523 327 MR c np gs np 2970 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 2970 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 70785818307FFFF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 1255 mt 3492 1255 L 2970 1581 mt 3492 1581 L 3492 1255 mt 3492 1581 L 2970 1255 mt 2970 1581 L 2970 1581 mt 3492 1581 L 2970 1255 mt 2970 1581 L 2970 1581 mt 3492 1581 L 2970 1255 mt 3492 1255 L 2970 1255 mt 2970 1581 L 3492 1255 mt 3492 1581 L 1 sg 0 -326 522 0 0 326 3660 1255 4 MP PP -522 0 0 -326 522 0 0 326 3660 1255 5 MP stroke gs 3660 1255 523 327 MR c np gs np 3660 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 3660 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i F0980808387EFFF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 1255 mt 4182 1255 L 3660 1581 mt 4182 1581 L 4182 1255 mt 4182 1581 L 3660 1255 mt 3660 1581 L 3660 1581 mt 4182 1581 L 3660 1255 mt 3660 1581 L 3660 1581 mt 4182 1581 L 3660 1255 mt 4182 1255 L 3660 1255 mt 3660 1581 L 4182 1255 mt 4182 1581 L 1 sg 0 -326 522 0 0 326 4351 1255 4 MP PP -522 0 0 -326 522 0 0 326 4351 1255 5 MP stroke gs 4351 1255 523 327 MR c np gs np 4351 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 4351 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 78F8D818387EFEE0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 1255 mt 4873 1255 L 4351 1581 mt 4873 1581 L 4873 1255 mt 4873 1581 L 4351 1255 mt 4351 1581 L 4351 1581 mt 4873 1581 L 4351 1255 mt 4351 1581 L 4351 1581 mt 4873 1581 L 4351 1255 mt 4873 1255 L 4351 1255 mt 4351 1581 L 4873 1255 mt 4873 1581 L 1 sg 0 -326 521 0 0 326 5042 1255 4 MP PP -521 0 0 -326 521 0 0 326 5042 1255 5 MP stroke gs 5042 1255 522 327 MR c np gs np 5042 1255 mt 0 327 rl 522 0 rl 0 -327 rl cp c np [522 0 0 327 5042 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F0307061E7EFEE3 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 1255 mt 5563 1255 L 5042 1581 mt 5563 1581 L 5563 1255 mt 5563 1581 L 5042 1255 mt 5042 1581 L 5042 1581 mt 5563 1581 L 5042 1255 mt 5042 1581 L 5042 1581 mt 5563 1581 L 5042 1255 mt 5563 1255 L 5042 1255 mt 5042 1581 L 5563 1255 mt 5563 1581 L 1 sg 0 -326 522 0 0 326 5732 1255 4 MP PP -522 0 0 -326 522 0 0 326 5732 1255 5 MP stroke gs 5732 1255 523 327 MR c np gs np 5732 1255 mt 0 327 rl 523 0 rl 0 -327 rl cp c np [523 0 0 327 5732 1255] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7C0C183070FFFFF0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 1255 mt 6254 1255 L 5732 1581 mt 6254 1581 L 6254 1255 mt 6254 1581 L 5732 1255 mt 5732 1581 L 5732 1581 mt 6254 1581 L 5732 1255 mt 5732 1581 L 5732 1581 mt 6254 1581 L 5732 1255 mt 6254 1255 L 5732 1255 mt 5732 1581 L 6254 1255 mt 6254 1581 L 1 sg 0 -327 522 0 0 327 898 1688 4 MP PP -522 0 0 -327 522 0 0 327 898 1688 5 MP stroke gs 898 1688 523 328 MR c np gs np 898 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E7EFC5C0303DFFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 1688 mt 1420 1688 L 898 2015 mt 1420 2015 L 1420 1688 mt 1420 2015 L 898 1688 mt 898 2015 L 898 2015 mt 1420 2015 L 898 1688 mt 898 2015 L 898 2015 mt 1420 2015 L 898 1688 mt 1420 1688 L 898 1688 mt 898 2015 L 1420 1688 mt 1420 2015 L 1 sg 0 -327 521 0 0 327 1589 1688 4 MP PP -521 0 0 -327 521 0 0 327 1589 1688 5 MP stroke gs 1589 1688 522 328 MR c np gs np 1589 1688 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F3B031E0E02DEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 1688 mt 2110 1688 L 1589 2015 mt 2110 2015 L 2110 1688 mt 2110 2015 L 1589 1688 mt 1589 2015 L 1589 2015 mt 2110 2015 L 1589 1688 mt 1589 2015 L 1589 2015 mt 2110 2015 L 1589 1688 mt 2110 1688 L 1589 1688 mt 1589 2015 L 2110 1688 mt 2110 2015 L 1 sg 0 -327 522 0 0 327 2279 1688 4 MP PP -522 0 0 -327 522 0 0 327 2279 1688 5 MP stroke gs 2279 1688 523 328 MR c np gs np 2279 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i C6FE1C7803077E7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 1688 mt 2801 1688 L 2279 2015 mt 2801 2015 L 2801 1688 mt 2801 2015 L 2279 1688 mt 2279 2015 L 2279 2015 mt 2801 2015 L 2279 1688 mt 2279 2015 L 2279 2015 mt 2801 2015 L 2279 1688 mt 2801 1688 L 2279 1688 mt 2279 2015 L 2801 1688 mt 2801 2015 L 1 sg 0 -327 522 0 0 327 2970 1688 4 MP PP -522 0 0 -327 522 0 0 327 2970 1688 5 MP stroke gs 2970 1688 523 328 MR c np gs np 2970 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FC9E1E3E03037F7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 1688 mt 3492 1688 L 2970 2015 mt 3492 2015 L 3492 1688 mt 3492 2015 L 2970 1688 mt 2970 2015 L 2970 2015 mt 3492 2015 L 2970 1688 mt 2970 2015 L 2970 2015 mt 3492 2015 L 2970 1688 mt 3492 1688 L 2970 1688 mt 2970 2015 L 3492 1688 mt 3492 2015 L 1 sg 0 -327 522 0 0 327 3660 1688 4 MP PP -522 0 0 -327 522 0 0 327 3660 1688 5 MP stroke gs 3660 1688 523 328 MR c np gs np 3660 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FE7E1E1F03037F7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 1688 mt 4182 1688 L 3660 2015 mt 4182 2015 L 4182 1688 mt 4182 2015 L 3660 1688 mt 3660 2015 L 3660 2015 mt 4182 2015 L 3660 1688 mt 3660 2015 L 3660 2015 mt 4182 2015 L 3660 1688 mt 4182 1688 L 3660 1688 mt 3660 2015 L 4182 1688 mt 4182 2015 L 1 sg 0 -327 522 0 0 327 4351 1688 4 MP PP -522 0 0 -327 522 0 0 327 4351 1688 5 MP stroke gs 4351 1688 523 328 MR c np gs np 4351 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7E731E1F0303FFFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 1688 mt 4873 1688 L 4351 2015 mt 4873 2015 L 4873 1688 mt 4873 2015 L 4351 1688 mt 4351 2015 L 4351 2015 mt 4873 2015 L 4351 1688 mt 4351 2015 L 4351 2015 mt 4873 2015 L 4351 1688 mt 4873 1688 L 4351 1688 mt 4351 2015 L 4873 1688 mt 4873 2015 L 1 sg 0 -327 521 0 0 327 5042 1688 4 MP PP -521 0 0 -327 521 0 0 327 5042 1688 5 MP stroke gs 5042 1688 522 328 MR c np gs np 5042 1688 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FE3E0E7C0703FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 1688 mt 5563 1688 L 5042 2015 mt 5563 2015 L 5563 1688 mt 5563 2015 L 5042 1688 mt 5042 2015 L 5042 2015 mt 5563 2015 L 5042 1688 mt 5042 2015 L 5042 2015 mt 5563 2015 L 5042 1688 mt 5563 1688 L 5042 1688 mt 5042 2015 L 5563 1688 mt 5563 2015 L 1 sg 0 -327 522 0 0 327 5732 1688 4 MP PP -522 0 0 -327 522 0 0 327 5732 1688 5 MP stroke gs 5732 1688 523 328 MR c np gs np 5732 1688 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 1688] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F7B671F0303CFFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 1688 mt 6254 1688 L 5732 2015 mt 6254 2015 L 6254 1688 mt 6254 2015 L 5732 1688 mt 5732 2015 L 5732 2015 mt 6254 2015 L 5732 1688 mt 5732 2015 L 5732 2015 mt 6254 2015 L 5732 1688 mt 6254 1688 L 5732 1688 mt 5732 2015 L 6254 1688 mt 6254 2015 L 1 sg 0 -327 522 0 0 327 898 2121 4 MP PP -522 0 0 -327 522 0 0 327 898 2121 5 MP stroke gs 898 2121 523 328 MR c np gs np 898 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 013363C6FE7C1810 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2121 mt 1420 2121 L 898 2448 mt 1420 2448 L 1420 2121 mt 1420 2448 L 898 2121 mt 898 2448 L 898 2448 mt 1420 2448 L 898 2121 mt 898 2448 L 898 2448 mt 1420 2448 L 898 2121 mt 1420 2121 L 898 2121 mt 898 2448 L 1420 2121 mt 1420 2448 L 1 sg 0 -327 521 0 0 327 1589 2121 4 MP PP -521 0 0 -327 521 0 0 327 1589 2121 5 MP stroke gs 1589 2121 522 328 MR c np gs np 1589 2121 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 212363C6FE1C1810 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2121 mt 2110 2121 L 1589 2448 mt 2110 2448 L 2110 2121 mt 2110 2448 L 1589 2121 mt 1589 2448 L 1589 2448 mt 2110 2448 L 1589 2121 mt 1589 2448 L 1589 2448 mt 2110 2448 L 1589 2121 mt 2110 2121 L 1589 2121 mt 1589 2448 L 2110 2121 mt 2110 2448 L 1 sg 0 -327 522 0 0 327 2279 2121 4 MP PP -522 0 0 -327 522 0 0 327 2279 2121 5 MP stroke gs 2279 2121 523 328 MR c np gs np 2279 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3464FFFFFE0C0C18 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2121 mt 2801 2121 L 2279 2448 mt 2801 2448 L 2801 2121 mt 2801 2448 L 2279 2121 mt 2279 2448 L 2279 2448 mt 2801 2448 L 2279 2121 mt 2279 2448 L 2279 2448 mt 2801 2448 L 2279 2121 mt 2801 2121 L 2279 2121 mt 2279 2448 L 2801 2121 mt 2801 2448 L 1 sg 0 -327 522 0 0 327 2970 2121 4 MP PP -522 0 0 -327 522 0 0 327 2970 2121 5 MP stroke gs 2970 2121 523 328 MR c np gs np 2970 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0302043EFEFC0800 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2121 mt 3492 2121 L 2970 2448 mt 3492 2448 L 3492 2121 mt 3492 2448 L 2970 2121 mt 2970 2448 L 2970 2448 mt 3492 2448 L 2970 2121 mt 2970 2448 L 2970 2448 mt 3492 2448 L 2970 2121 mt 3492 2121 L 2970 2121 mt 2970 2448 L 3492 2121 mt 3492 2448 L 1 sg 0 -327 522 0 0 327 3660 2121 4 MP PP -522 0 0 -327 522 0 0 327 3660 2121 5 MP stroke gs 3660 2121 523 328 MR c np gs np 3660 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 113366CCFC383030 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2121 mt 4182 2121 L 3660 2448 mt 4182 2448 L 4182 2121 mt 4182 2448 L 3660 2121 mt 3660 2448 L 3660 2448 mt 4182 2448 L 3660 2121 mt 3660 2448 L 3660 2448 mt 4182 2448 L 3660 2121 mt 4182 2121 L 3660 2121 mt 3660 2448 L 4182 2121 mt 4182 2448 L 1 sg 0 -327 522 0 0 327 4351 2121 4 MP PP -522 0 0 -327 522 0 0 327 4351 2121 5 MP stroke gs 4351 2121 523 328 MR c np gs np 4351 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 61C3F67E3E1C1810 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2121 mt 4873 2121 L 4351 2448 mt 4873 2448 L 4873 2121 mt 4873 2448 L 4351 2121 mt 4351 2448 L 4351 2448 mt 4873 2448 L 4351 2121 mt 4351 2448 L 4351 2448 mt 4873 2448 L 4351 2121 mt 4873 2121 L 4351 2121 mt 4351 2448 L 4873 2121 mt 4873 2448 L 1 sg 0 -327 521 0 0 327 5042 2121 4 MP PP -521 0 0 -327 521 0 0 327 5042 2121 5 MP stroke gs 5042 2121 522 328 MR c np gs np 5042 2121 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1B1B36FCFC383030 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2121 mt 5563 2121 L 5042 2448 mt 5563 2448 L 5563 2121 mt 5563 2448 L 5042 2121 mt 5042 2448 L 5042 2448 mt 5563 2448 L 5042 2121 mt 5042 2448 L 5042 2448 mt 5563 2448 L 5042 2121 mt 5563 2121 L 5042 2121 mt 5042 2448 L 5563 2121 mt 5563 2448 L 1 sg 0 -327 522 0 0 327 5732 2121 4 MP PP -522 0 0 -327 522 0 0 327 5732 2121 5 MP stroke gs 5732 2121 523 328 MR c np gs np 5732 2121 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2121] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0366E6CDFF1C1810 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2121 mt 6254 2121 L 5732 2448 mt 6254 2448 L 6254 2121 mt 6254 2448 L 5732 2121 mt 5732 2448 L 5732 2448 mt 6254 2448 L 5732 2121 mt 5732 2448 L 5732 2448 mt 6254 2448 L 5732 2121 mt 6254 2121 L 5732 2121 mt 5732 2448 L 6254 2121 mt 6254 2448 L 1 sg 0 -327 522 0 0 327 898 2554 4 MP PP -522 0 0 -327 522 0 0 327 898 2554 5 MP stroke gs 898 2554 523 328 MR c np gs np 898 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F3F387C0E06FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2554 mt 1420 2554 L 898 2881 mt 1420 2881 L 1420 2554 mt 1420 2881 L 898 2554 mt 898 2881 L 898 2881 mt 1420 2881 L 898 2554 mt 898 2881 L 898 2881 mt 1420 2881 L 898 2554 mt 1420 2554 L 898 2554 mt 898 2881 L 1420 2554 mt 1420 2881 L 1 sg 0 -327 521 0 0 327 1589 2554 4 MP PP -521 0 0 -327 521 0 0 327 1589 2554 5 MP stroke gs 1589 2554 522 328 MR c np gs np 1589 2554 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F77607E1E86FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2554 mt 2110 2554 L 1589 2881 mt 2110 2881 L 2110 2554 mt 2110 2881 L 1589 2554 mt 1589 2881 L 1589 2881 mt 2110 2881 L 1589 2554 mt 1589 2881 L 1589 2881 mt 2110 2881 L 1589 2554 mt 2110 2554 L 1589 2554 mt 1589 2881 L 2110 2554 mt 2110 2881 L 1 sg 0 -327 522 0 0 327 2279 2554 4 MP PP -522 0 0 -327 522 0 0 327 2279 2554 5 MP stroke gs 2279 2554 523 328 MR c np gs np 2279 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 071F3C300E86FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2554 mt 2801 2554 L 2279 2881 mt 2801 2881 L 2801 2554 mt 2801 2881 L 2279 2554 mt 2279 2881 L 2279 2881 mt 2801 2881 L 2279 2554 mt 2279 2881 L 2279 2881 mt 2801 2881 L 2279 2554 mt 2801 2554 L 2279 2554 mt 2279 2881 L 2801 2554 mt 2801 2881 L 1 sg 0 -327 522 0 0 327 2970 2554 4 MP PP -522 0 0 -327 522 0 0 327 2970 2554 5 MP stroke gs 2970 2554 523 328 MR c np gs np 2970 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 030F1C180E06FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2554 mt 3492 2554 L 2970 2881 mt 3492 2881 L 3492 2554 mt 3492 2881 L 2970 2554 mt 2970 2881 L 2970 2881 mt 3492 2881 L 2970 2554 mt 2970 2881 L 2970 2881 mt 3492 2881 L 2970 2554 mt 3492 2554 L 2970 2554 mt 2970 2881 L 3492 2554 mt 3492 2881 L 1 sg 0 -327 522 0 0 327 3660 2554 4 MP PP -522 0 0 -327 522 0 0 327 3660 2554 5 MP stroke gs 3660 2554 523 328 MR c np gs np 3660 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i F7FEC06E3606FE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2554 mt 4182 2554 L 3660 2881 mt 4182 2881 L 4182 2554 mt 4182 2881 L 3660 2554 mt 3660 2881 L 3660 2881 mt 4182 2881 L 3660 2554 mt 3660 2881 L 3660 2881 mt 4182 2881 L 3660 2554 mt 4182 2554 L 3660 2554 mt 3660 2881 L 4182 2554 mt 4182 2881 L 1 sg 0 -327 522 0 0 327 4351 2554 4 MP PP -522 0 0 -327 522 0 0 327 4351 2554 5 MP stroke gs 4351 2554 523 328 MR c np gs np 4351 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F7EE0603C0CFC78 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2554 mt 4873 2554 L 4351 2881 mt 4873 2881 L 4873 2554 mt 4873 2881 L 4351 2554 mt 4351 2881 L 4351 2881 mt 4873 2881 L 4351 2554 mt 4351 2881 L 4351 2881 mt 4873 2881 L 4351 2554 mt 4873 2554 L 4351 2554 mt 4351 2881 L 4873 2554 mt 4873 2881 L 1 sg 0 -327 521 0 0 327 5042 2554 4 MP PP -521 0 0 -327 521 0 0 327 5042 2554 5 MP stroke gs 5042 2554 522 328 MR c np gs np 5042 2554 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F1830381C86DE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2554 mt 5563 2554 L 5042 2881 mt 5563 2881 L 5563 2554 mt 5563 2881 L 5042 2554 mt 5042 2881 L 5042 2881 mt 5563 2881 L 5042 2554 mt 5042 2881 L 5042 2881 mt 5563 2881 L 5042 2554 mt 5563 2554 L 5042 2554 mt 5042 2881 L 5563 2554 mt 5563 2881 L 1 sg 0 -327 522 0 0 327 5732 2554 4 MP PP -522 0 0 -327 522 0 0 327 5732 2554 5 MP stroke gs 5732 2554 523 328 MR c np gs np 5732 2554 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2554] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F78C0FE0606DE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2554 mt 6254 2554 L 5732 2881 mt 6254 2881 L 6254 2554 mt 6254 2881 L 5732 2554 mt 5732 2881 L 5732 2881 mt 6254 2881 L 5732 2554 mt 5732 2881 L 5732 2881 mt 6254 2881 L 5732 2554 mt 6254 2554 L 5732 2554 mt 5732 2881 L 6254 2554 mt 6254 2881 L 1 sg 0 -327 522 0 0 327 898 2987 4 MP PP -522 0 0 -327 522 0 0 327 898 2987 5 MP stroke gs 898 2987 523 328 MR c np gs np 898 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 070E1C306FFFFEF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 2987 mt 1420 2987 L 898 3314 mt 1420 3314 L 1420 2987 mt 1420 3314 L 898 2987 mt 898 3314 L 898 3314 mt 1420 3314 L 898 2987 mt 898 3314 L 898 3314 mt 1420 3314 L 898 2987 mt 1420 2987 L 898 2987 mt 898 3314 L 1420 2987 mt 1420 3314 L 1 sg 0 -327 521 0 0 327 1589 2987 4 MP PP -521 0 0 -327 521 0 0 327 1589 2987 5 MP stroke gs 1589 2987 522 328 MR c np gs np 1589 2987 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3060C0C0CFDFFF7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 2987 mt 2110 2987 L 1589 3314 mt 2110 3314 L 2110 2987 mt 2110 3314 L 1589 2987 mt 1589 3314 L 1589 3314 mt 2110 3314 L 1589 2987 mt 1589 3314 L 1589 3314 mt 2110 3314 L 1589 2987 mt 2110 2987 L 1589 2987 mt 1589 3314 L 2110 2987 mt 2110 3314 L 1 sg 0 -327 522 0 0 327 2279 2987 4 MP PP -522 0 0 -327 522 0 0 327 2279 2987 5 MP stroke gs 2279 2987 523 328 MR c np gs np 2279 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 060C193F7FFFFEF8 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 2987 mt 2801 2987 L 2279 3314 mt 2801 3314 L 2801 2987 mt 2801 3314 L 2279 2987 mt 2279 3314 L 2279 3314 mt 2801 3314 L 2279 2987 mt 2279 3314 L 2279 3314 mt 2801 3314 L 2279 2987 mt 2801 2987 L 2279 2987 mt 2279 3314 L 2801 2987 mt 2801 3314 L 1 sg 0 -327 522 0 0 327 2970 2987 4 MP PP -522 0 0 -327 522 0 0 327 2970 2987 5 MP stroke gs 2970 2987 523 328 MR c np gs np 2970 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 80808080C7DF7F7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 2987 mt 3492 2987 L 2970 3314 mt 3492 3314 L 3492 2987 mt 3492 3314 L 2970 2987 mt 2970 3314 L 2970 3314 mt 3492 3314 L 2970 2987 mt 2970 3314 L 2970 3314 mt 3492 3314 L 2970 2987 mt 3492 2987 L 2970 2987 mt 2970 3314 L 3492 2987 mt 3492 3314 L 1 sg 0 -327 522 0 0 327 3660 2987 4 MP PP -522 0 0 -327 522 0 0 327 3660 2987 5 MP stroke gs 3660 2987 523 328 MR c np gs np 3660 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 6060C0C0CFDFFF7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 2987 mt 4182 2987 L 3660 3314 mt 4182 3314 L 4182 2987 mt 4182 3314 L 3660 2987 mt 3660 3314 L 3660 3314 mt 4182 3314 L 3660 2987 mt 3660 3314 L 3660 3314 mt 4182 3314 L 3660 2987 mt 4182 2987 L 3660 2987 mt 3660 3314 L 4182 2987 mt 4182 3314 L 1 sg 0 -327 522 0 0 327 4351 2987 4 MP PP -522 0 0 -327 522 0 0 327 4351 2987 5 MP stroke gs 4351 2987 523 328 MR c np gs np 4351 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3060C0C0CFDFFF7E {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 2987 mt 4873 2987 L 4351 3314 mt 4873 3314 L 4873 2987 mt 4873 3314 L 4351 2987 mt 4351 3314 L 4351 3314 mt 4873 3314 L 4351 2987 mt 4351 3314 L 4351 3314 mt 4873 3314 L 4351 2987 mt 4873 2987 L 4351 2987 mt 4351 3314 L 4873 2987 mt 4873 3314 L 1 sg 0 -327 521 0 0 327 5042 2987 4 MP PP -521 0 0 -327 521 0 0 327 5042 2987 5 MP stroke gs 5042 2987 522 328 MR c np gs np 5042 2987 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0C1870EFFFFBFE7C {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 2987 mt 5563 2987 L 5042 3314 mt 5563 3314 L 5563 2987 mt 5563 3314 L 5042 2987 mt 5042 3314 L 5042 3314 mt 5563 3314 L 5042 2987 mt 5042 3314 L 5042 3314 mt 5563 3314 L 5042 2987 mt 5563 2987 L 5042 2987 mt 5042 3314 L 5563 2987 mt 5563 3314 L 1 sg 0 -327 522 0 0 327 5732 2987 4 MP PP -522 0 0 -327 522 0 0 327 5732 2987 5 MP stroke gs 5732 2987 523 328 MR c np gs np 5732 2987 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 2987] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0E1C3870EFFFFEFC {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 2987 mt 6254 2987 L 5732 3314 mt 6254 3314 L 6254 2987 mt 6254 3314 L 5732 2987 mt 5732 3314 L 5732 3314 mt 6254 3314 L 5732 2987 mt 5732 3314 L 5732 3314 mt 6254 3314 L 5732 2987 mt 6254 2987 L 5732 2987 mt 5732 3314 L 6254 2987 mt 6254 3314 L 1 sg 0 -327 522 0 0 327 898 3420 4 MP PP -522 0 0 -327 522 0 0 327 898 3420 5 MP stroke gs 898 3420 523 328 MR c np gs np 898 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FF3F0303061C3830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 3420 mt 1420 3420 L 898 3747 mt 1420 3747 L 1420 3420 mt 1420 3747 L 898 3420 mt 898 3747 L 898 3747 mt 1420 3747 L 898 3420 mt 898 3747 L 898 3747 mt 1420 3747 L 898 3420 mt 1420 3420 L 898 3420 mt 898 3747 L 1420 3420 mt 1420 3747 L 1 sg 0 -327 521 0 0 327 1589 3420 4 MP PP -521 0 0 -327 521 0 0 327 1589 3420 5 MP stroke gs 1589 3420 522 328 MR c np gs np 1589 3420 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FC8781C3060C1820 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 3420 mt 2110 3420 L 1589 3747 mt 2110 3747 L 2110 3420 mt 2110 3747 L 1589 3420 mt 1589 3747 L 1589 3747 mt 2110 3747 L 1589 3420 mt 1589 3747 L 1589 3747 mt 2110 3747 L 1589 3420 mt 2110 3420 L 1589 3420 mt 1589 3747 L 2110 3420 mt 2110 3747 L 1 sg 0 -327 522 0 0 327 2279 3420 4 MP PP -522 0 0 -327 522 0 0 327 2279 3420 5 MP stroke gs 2279 3420 523 328 MR c np gs np 2279 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F7B070E0C180000 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 3420 mt 2801 3420 L 2279 3747 mt 2801 3747 L 2801 3420 mt 2801 3747 L 2279 3420 mt 2279 3747 L 2279 3747 mt 2801 3747 L 2279 3420 mt 2279 3747 L 2279 3747 mt 2801 3747 L 2279 3420 mt 2801 3420 L 2279 3420 mt 2279 3747 L 2801 3420 mt 2801 3747 L 1 sg 0 -327 522 0 0 327 2970 3420 4 MP PP -522 0 0 -327 522 0 0 327 2970 3420 5 MP stroke gs 2970 3420 523 328 MR c np gs np 2970 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FF7F0E1C387060C0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 3420 mt 3492 3420 L 2970 3747 mt 3492 3747 L 3492 3420 mt 3492 3747 L 2970 3420 mt 2970 3747 L 2970 3747 mt 3492 3747 L 2970 3420 mt 2970 3747 L 2970 3747 mt 3492 3747 L 2970 3420 mt 3492 3420 L 2970 3420 mt 2970 3747 L 3492 3420 mt 3492 3747 L 1 sg 0 -327 522 0 0 327 3660 3420 4 MP PP -522 0 0 -327 522 0 0 327 3660 3420 5 MP stroke gs 3660 3420 523 328 MR c np gs np 3660 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7FFB07060C183020 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 3420 mt 4182 3420 L 3660 3747 mt 4182 3747 L 4182 3420 mt 4182 3747 L 3660 3420 mt 3660 3747 L 3660 3747 mt 4182 3747 L 3660 3420 mt 3660 3747 L 3660 3747 mt 4182 3747 L 3660 3420 mt 4182 3420 L 3660 3420 mt 3660 3747 L 4182 3420 mt 4182 3747 L 1 sg 0 -327 522 0 0 327 4351 3420 4 MP PP -522 0 0 -327 522 0 0 327 4351 3420 5 MP stroke gs 4351 3420 523 328 MR c np gs np 4351 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F3BE3C60C182060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 3420 mt 4873 3420 L 4351 3747 mt 4873 3747 L 4873 3420 mt 4873 3747 L 4351 3420 mt 4351 3747 L 4351 3747 mt 4873 3747 L 4351 3420 mt 4351 3747 L 4351 3747 mt 4873 3747 L 4351 3420 mt 4873 3420 L 4351 3420 mt 4351 3747 L 4873 3420 mt 4873 3747 L 1 sg 0 -327 521 0 0 327 5042 3420 4 MP PP -521 0 0 -327 521 0 0 327 5042 3420 5 MP stroke gs 5042 3420 522 328 MR c np gs np 5042 3420 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F770E183060C080 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 3420 mt 5563 3420 L 5042 3747 mt 5563 3747 L 5563 3420 mt 5563 3747 L 5042 3420 mt 5042 3747 L 5042 3747 mt 5563 3747 L 5042 3420 mt 5042 3747 L 5042 3747 mt 5563 3747 L 5042 3420 mt 5563 3420 L 5042 3420 mt 5042 3747 L 5563 3420 mt 5563 3747 L 1 sg 0 -327 522 0 0 327 5732 3420 4 MP PP -522 0 0 -327 522 0 0 327 5732 3420 5 MP stroke gs 5732 3420 523 328 MR c np gs np 5732 3420 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 3420] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FFFF0303061C0820 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 3420 mt 6254 3420 L 5732 3747 mt 6254 3747 L 6254 3420 mt 6254 3747 L 5732 3420 mt 5732 3747 L 5732 3747 mt 6254 3747 L 5732 3420 mt 5732 3747 L 5732 3747 mt 6254 3747 L 5732 3420 mt 6254 3420 L 5732 3420 mt 5732 3747 L 6254 3420 mt 6254 3747 L 1 sg 0 -327 522 0 0 327 898 3853 4 MP PP -522 0 0 -327 522 0 0 327 898 3853 5 MP stroke gs 898 3853 523 328 MR c np gs np 898 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7CCEC3FE7C70F0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 3853 mt 1420 3853 L 898 4180 mt 1420 4180 L 1420 3853 mt 1420 4180 L 898 3853 mt 898 4180 L 898 4180 mt 1420 4180 L 898 3853 mt 898 4180 L 898 4180 mt 1420 4180 L 898 3853 mt 1420 3853 L 898 3853 mt 898 4180 L 1420 3853 mt 1420 4180 L 1 sg 0 -327 521 0 0 327 1589 3853 4 MP PP -521 0 0 -327 521 0 0 327 1589 3853 5 MP stroke gs 1589 3853 522 328 MR c np gs np 1589 3853 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i FEE7F3EE7C78F878 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 3853 mt 2110 3853 L 1589 4180 mt 2110 4180 L 2110 3853 mt 2110 4180 L 1589 3853 mt 1589 4180 L 1589 4180 mt 2110 4180 L 1589 3853 mt 1589 4180 L 1589 4180 mt 2110 4180 L 1589 3853 mt 2110 3853 L 1589 3853 mt 1589 4180 L 2110 3853 mt 2110 4180 L 1 sg 0 -327 522 0 0 327 2279 3853 4 MP PP -522 0 0 -327 522 0 0 327 2279 3853 5 MP stroke gs 2279 3853 523 328 MR c np gs np 2279 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 071F333F3C78F8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 3853 mt 2801 3853 L 2279 4180 mt 2801 4180 L 2801 3853 mt 2801 4180 L 2279 3853 mt 2279 4180 L 2279 4180 mt 2801 4180 L 2279 3853 mt 2279 4180 L 2279 4180 mt 2801 4180 L 2279 3853 mt 2801 3853 L 2279 3853 mt 2279 4180 L 2801 3853 mt 2801 4180 L 1 sg 0 -327 522 0 0 327 2970 3853 4 MP PP -522 0 0 -327 522 0 0 327 2970 3853 5 MP stroke gs 2970 3853 523 328 MR c np gs np 2970 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F3F677C7878F8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 3853 mt 3492 3853 L 2970 4180 mt 3492 4180 L 3492 3853 mt 3492 4180 L 2970 3853 mt 2970 4180 L 2970 4180 mt 3492 4180 L 2970 3853 mt 2970 4180 L 2970 4180 mt 3492 4180 L 2970 3853 mt 3492 3853 L 2970 3853 mt 2970 4180 L 3492 3853 mt 3492 4180 L 1 sg 0 -327 522 0 0 327 3660 3853 4 MP PP -522 0 0 -327 522 0 0 327 3660 3853 5 MP stroke gs 3660 3853 523 328 MR c np gs np 3660 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0E3F3F7878F8F0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 3853 mt 4182 3853 L 3660 4180 mt 4182 4180 L 4182 3853 mt 4182 4180 L 3660 3853 mt 3660 4180 L 3660 4180 mt 4182 4180 L 3660 3853 mt 3660 4180 L 3660 4180 mt 4182 4180 L 3660 3853 mt 4182 3853 L 3660 3853 mt 3660 4180 L 4182 3853 mt 4182 4180 L 1 sg 0 -327 522 0 0 327 4351 3853 4 MP PP -522 0 0 -327 522 0 0 327 4351 3853 5 MP stroke gs 4351 3853 523 328 MR c np gs np 4351 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E7FEF7C78F8F8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 3853 mt 4873 3853 L 4351 4180 mt 4873 4180 L 4873 3853 mt 4873 4180 L 4351 3853 mt 4351 4180 L 4351 4180 mt 4873 4180 L 4351 3853 mt 4351 4180 L 4351 4180 mt 4873 4180 L 4351 3853 mt 4873 3853 L 4351 3853 mt 4351 4180 L 4873 3853 mt 4873 4180 L 1 sg 0 -327 521 0 0 327 5042 3853 4 MP PP -521 0 0 -327 521 0 0 327 5042 3853 5 MP stroke gs 5042 3853 522 328 MR c np gs np 5042 3853 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 0F18131E38F8F0F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 3853 mt 5563 3853 L 5042 4180 mt 5563 4180 L 5563 3853 mt 5563 4180 L 5042 3853 mt 5042 4180 L 5042 4180 mt 5563 4180 L 5042 3853 mt 5042 4180 L 5042 4180 mt 5563 4180 L 5042 3853 mt 5563 3853 L 5042 3853 mt 5042 4180 L 5563 3853 mt 5563 4180 L 1 sg 0 -327 522 0 0 327 5732 3853 4 MP PP -522 0 0 -327 522 0 0 327 5732 3853 5 MP stroke gs 5732 3853 523 328 MR c np gs np 5732 3853 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 3853] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F33733E38F8F8F0 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 3853 mt 6254 3853 L 5732 4180 mt 6254 4180 L 6254 3853 mt 6254 4180 L 5732 3853 mt 5732 4180 L 5732 4180 mt 6254 4180 L 5732 3853 mt 5732 4180 L 5732 4180 mt 6254 4180 L 5732 3853 mt 6254 3853 L 5732 3853 mt 5732 4180 L 6254 3853 mt 6254 4180 L 1 sg 0 -327 522 0 0 327 898 4286 4 MP PP -522 0 0 -327 522 0 0 327 898 4286 5 MP stroke gs 898 4286 523 328 MR c np gs np 898 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 898 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1F7FEEFC7C181030 {} settransfer gr gr 4 w DO SO 6 w 0 sg 898 4286 mt 1420 4286 L 898 4613 mt 1420 4613 L 1420 4286 mt 1420 4613 L 898 4286 mt 898 4613 L 898 4613 mt 1420 4613 L 898 4286 mt 898 4613 L 898 4613 mt 1420 4613 L 898 4286 mt 1420 4286 L 898 4286 mt 898 4613 L 1420 4286 mt 1420 4613 L 1 sg 0 -327 521 0 0 327 1589 4286 4 MP PP -521 0 0 -327 521 0 0 327 1589 4286 5 MP stroke gs 1589 4286 522 328 MR c np gs np 1589 4286 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 1589 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F7FFE1C18387060 {} settransfer gr gr 4 w DO SO 6 w 0 sg 1589 4286 mt 2110 4286 L 1589 4613 mt 2110 4613 L 2110 4286 mt 2110 4613 L 1589 4286 mt 1589 4613 L 1589 4613 mt 2110 4613 L 1589 4286 mt 1589 4613 L 1589 4613 mt 2110 4613 L 1589 4286 mt 2110 4286 L 1589 4286 mt 1589 4613 L 2110 4286 mt 2110 4613 L 1 sg 0 -327 522 0 0 327 2279 4286 4 MP PP -522 0 0 -327 522 0 0 327 2279 4286 5 MP stroke gs 2279 4286 523 328 MR c np gs np 2279 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2279 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3E63C7FE7C183830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2279 4286 mt 2801 4286 L 2279 4613 mt 2801 4613 L 2801 4286 mt 2801 4613 L 2279 4286 mt 2279 4613 L 2279 4613 mt 2801 4613 L 2279 4286 mt 2279 4613 L 2279 4613 mt 2801 4613 L 2279 4286 mt 2801 4286 L 2279 4286 mt 2279 4613 L 2801 4286 mt 2801 4613 L 1 sg 0 -327 522 0 0 327 2970 4286 4 MP PP -522 0 0 -327 522 0 0 327 2970 4286 5 MP stroke gs 2970 4286 523 328 MR c np gs np 2970 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 2970 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7EFBEF7E0C181830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 2970 4286 mt 3492 4286 L 2970 4613 mt 3492 4613 L 3492 4286 mt 3492 4613 L 2970 4286 mt 2970 4613 L 2970 4613 mt 3492 4613 L 2970 4286 mt 2970 4613 L 2970 4613 mt 3492 4613 L 2970 4286 mt 3492 4286 L 2970 4286 mt 2970 4613 L 3492 4286 mt 3492 4613 L 1 sg 0 -327 522 0 0 327 3660 4286 4 MP PP -522 0 0 -327 522 0 0 327 3660 4286 5 MP stroke gs 3660 4286 523 328 MR c np gs np 3660 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 3660 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 1E77DEFC7C181030 {} settransfer gr gr 4 w DO SO 6 w 0 sg 3660 4286 mt 4182 4286 L 3660 4613 mt 4182 4613 L 4182 4286 mt 4182 4613 L 3660 4286 mt 3660 4613 L 3660 4613 mt 4182 4613 L 3660 4286 mt 3660 4613 L 3660 4613 mt 4182 4613 L 3660 4286 mt 4182 4286 L 3660 4286 mt 3660 4613 L 4182 4286 mt 4182 4613 L 1 sg 0 -327 522 0 0 327 4351 4286 4 MP PP -522 0 0 -327 522 0 0 327 4351 4286 5 MP stroke gs 4351 4286 523 328 MR c np gs np 4351 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 4351 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 3F77FEFC1C181830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 4351 4286 mt 4873 4286 L 4351 4613 mt 4873 4613 L 4873 4286 mt 4873 4613 L 4351 4286 mt 4351 4613 L 4351 4613 mt 4873 4613 L 4351 4286 mt 4351 4613 L 4351 4613 mt 4873 4613 L 4351 4286 mt 4873 4286 L 4351 4286 mt 4351 4613 L 4873 4286 mt 4873 4613 L 1 sg 0 -327 521 0 0 327 5042 4286 4 MP PP -521 0 0 -327 521 0 0 327 5042 4286 5 MP stroke gs 5042 4286 522 328 MR c np gs np 5042 4286 mt 0 328 rl 522 0 rl 0 -328 rl cp c np [522 0 0 328 5042 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7EC7CFFF1C081810 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5042 4286 mt 5563 4286 L 5042 4613 mt 5563 4613 L 5563 4286 mt 5563 4613 L 5042 4286 mt 5042 4613 L 5042 4613 mt 5563 4613 L 5042 4286 mt 5042 4613 L 5042 4613 mt 5563 4613 L 5042 4286 mt 5563 4286 L 5042 4286 mt 5042 4613 L 5563 4286 mt 5563 4613 L 1 sg 0 -327 522 0 0 327 5732 4286 4 MP PP -522 0 0 -327 522 0 0 327 5732 4286 5 MP stroke gs 5732 4286 523 328 MR c np gs np 5732 4286 mt 0 328 rl 523 0 rl 0 -328 rl cp c np [523 0 0 328 5732 4286] cc { [ 1.000000 0.000000 ] exch 1 mul cvi get } settransfer /picstr 1 string def 8 8 1 [8.000000 0 0 8.000000 0 0] L1i 7FFFFEFC1C181830 {} settransfer gr gr 4 w DO SO 6 w 0 sg 5732 4286 mt 6254 4286 L 5732 4613 mt 6254 4613 L 6254 4286 mt 6254 4613 L 5732 4286 mt 5732 4613 L 5732 4613 mt 6254 4613 L 5732 4286 mt 5732 4613 L 5732 4613 mt 6254 4613 L 5732 4286 mt 6254 4286 L 5732 4286 mt 5732 4613 L 6254 4286 mt 6254 4613 L end eplot epage end showpage %%EndDocument endTexFig 0 534 a Fp(Figure)17 b(3:)23 b(F)l(rom)16 b(left)g(to)h(righ)o(t:)23 b(actual)17 b(images)f(from)g(the)h(training)g(set;)g(images)f(sampled) f(from)h(the)0 594 y(generativ)o(e)d(mo)q(dels)h(of)h(trained)f(net)o (w)o(orks;)g(images)g(whose)h(b)q(ottom)f(halv)o(es)g(w)o(ere)g (inferred)f(from)h(their)0 654 y(top)j(halv)o(es.)0 796 y(one)f(for)g(eac)o(h)g(digit)f(class,)h(then)g(used)g(these)f(net)o(w) o(orks)h(to)g(classify)f(the)h(images)f(in)h(the)f(test)h(set.)21 b(The)0 857 y(test)e(images)g(w)o(ere)g(lab)q(eled)g(b)o(y)g(whic)o (hev)o(er)e(net)o(w)o(ork)i(returned)h(the)f(highest)h(v)m(alue)f(of)h Fl(\000)p Fn(L)p Fp(,)g(used)f(as)0 917 y(a)h(stand-in)f(for)h(the)f (true)f(log-lik)o(eliho)q(o)q(d,)h(ln)8 b Fn(P)f Fp(\()p Fn(V)12 b Fp(\).)29 b(The)20 b(mean)d(classi\014cation)i(error)g(rate)h (in)e(these)0 977 y(exp)q(erimen)o(ts)f(w)o(as)j(4)p Fn(:)p Fp(4\045,)g(with)f(a)h(standard)h(deviation)e(of)h(0)p Fn(:)p Fp(2\045.)31 b(These)20 b(results)f(are)h(considerably)0 1037 y(b)q(etter)e(than)i(standard)g(b)q(enc)o(hmarks)d(on)i(this)g (database)h(\(Hin)o(ton)e(et)g(al,)h(1995\),)i(suc)o(h)d(as)i Fn(k)r Fp(-nearest)0 1097 y(neigh)o(b)q(ors)f(\(6.7\045\))g(and)g(bac)o (kpropagation)h(\(5.6\045\).)28 b(They)19 b(also)g(impro)o(v)o(e)d (sligh)o(tly)i(on)h(results)f(from)0 1157 y(the)e(w)o(ak)o(e-sleep)e (learning)i(rule)f(\(4.8\045\))h(in)g(Hemholtz)d(mac)o(hines)h(\(Hin)o (ton)i(et)f(al,)h(1995\))h(and)g(from)e(an)0 1218 y(earlier)g(v)o (ersion)h(\(4.6\045\))g(of)g(the)g(mean)f(\014eld)h(learning)g(rule)g (\(Saul)g(et)g(al,)g(1996\).)73 1278 y(The)j(classi\014cation)f (results)g(sho)o(w)h(that)g(the)g(mean)e(\014eld)h(net)o(w)o(orks)g(ha) o(v)o(e)g(learned)g(noisy)g(but)h(es-)0 1338 y(sen)o(tially)13 b(accurate)i(mo)q(dels)e(of)i(eac)o(h)f(digit)h(class.)21 b(This)14 b(is)h(con\014rmed)e(visually)h(b)o(y)g(lo)q(oking)h(at)g (images)0 1398 y(sampled)20 b(from)h(the)g(generativ)o(e)g(mo)q(del)f (of)i(eac)o(h)f(net)o(w)o(ork;)i(see)f(\014gure)g(3.)37 b(The)22 b(three)f(columns)f(in)0 1458 y(this)h(\014gure)g(sho)o(w:)32 b(\(i\))21 b(actual)g(images)f(from)g(the)h(training)g(set;)i(\(ii\))e Fo(fantasies)g Fp(sampled)f(from)g(the)0 1519 y(generativ)o(e)e(mo)q (dels)g(of)i(trained)f(net)o(w)o(orks;)g(and)h(\(iii\))e(images)g (whose)i(top)f(halv)o(es)g(w)o(ere)f(tak)o(en)h(from)0 1579 y(those)e(in)f(the)g(\014rst)h(column)e(and)i(whose)g(b)q(ottom)f (halv)o(es)g(w)o(ere)f(inferred,)g(or)i Fo(\014l)r(le)n(d)i(in)p Fp(,)d(b)o(y)g(the)g(attrac-)0 1639 y(tor)i(dynamics.)25 b(These)18 b(last)h(images)e(sho)o(w)h(that)h(probabilistic)e(D)o(A)o (Gs)g(can)i(function)f(as)g(asso)q(ciativ)o(e)0 1699 y(memories)10 b(in)k(the)f(same)g(w)o(a)o(y)g(as)i(symmet)o(ric)10 b(neural)k(net)o(w)o(orks,)f(suc)o(h)h(as)g(the)f(Hop\014eld)h(mo)q (del)e(\(1984\).)0 1865 y Fq(5)81 b(Discussion)0 1975 y Fp(In)13 b(this)g(pap)q(er)h(w)o(e)f(ha)o(v)o(e)g(extended)f(the)h (attractor)h(paradigm)f(of)h(neural)f(computation)f(to)i(feedforw)o (ard)0 2035 y(net)o(w)o(orks)23 b(parameterizing)f(probabilistic)h (generativ)o(e)g(mo)q(dels.)43 b(The)24 b(probabilistic)f(seman)o(tics) f(of)0 2095 y(these)i(net)o(w)o(orks)f(\(Lauritzen,)j(1996;)i(Neal,)d (1992;)k(P)o(earl,)c(1988\))g(di\013er)f(in)g(useful)f(resp)q(ects)h (from)0 2156 y(those)18 b(of)f(symmetric)d(neural)j(net)o(w)o(orks,)g (for)g(whic)o(h)g(the)g(attractor)h(paradigm)f(w)o(as)h(\014rst)f (established)0 2216 y(\(Cohen)j(&)g(Grossb)q(erg,)i(1983;)g (Hop\014eld,)e(1982;)j(Geman)18 b(&)i(Geman,)f(1984;)k(Hin)o(ton)c(&)h (Sejno)o(wski,)0 2276 y(1986;)25 b(P)o(eterson)d(&)f(Anderson,)i (1987\).)39 b(Borro)o(wing)21 b(ideas)h(from)e(statistical)i(mec)o (hanics,)e(w)o(e)h(ha)o(v)o(e)0 2336 y(deriv)o(ed)15 b(a)h(mean)f(\014eld)h(theory)g(for)h(appro)o(ximate)d(probabilistic)i (inference.)j(W)l(e)d(ha)o(v)o(e)g(also)h(exhibited)p 0 2418 780 2 v 0 2463 a Ff(examples.)f(The)10 b(w)o(eigh)o(ts)f(w)o (ere)h(adapted)g(using)f(a)g(\014xed)h(learning)f(rate)h(of)f(0.05.)15 b(Mean)10 b(\014eld)g(parameters)f(w)o(ere)h(computed)0 2513 y(b)o(y)k(16)h(iterations)f(of)g(the)i(discretized)g(attractor)f (dynamics,)f(eqs.)g(\(16\))h(and)f(\(18\),)h(with)f Fd(\034)1466 2519 y Fc(\026)1501 2513 y Ff(=)f Fd(\034)1564 2519 y Fc(h)1599 2513 y Ff(=)g(1)i(and)f(a)h(step)g(size)0 2563 y(of)f(\001)p Fd(t)f Ff(=)g(0)p Fd(:)p Ff(25.)20 b(The)15 b(mean)f(\014eld)h(parameters)g(w)o(ere)g(initialized)f(b)o(y)g(a)h (top-do)o(wn)f(pass)h(through)g(the)h(net)o(w)o(ork,)f(setting)0 2613 y Fd(\030)18 2619 y Fc(i)44 2613 y Ff(=)c Fd(\033)q Ff(\()128 2582 y Fk(P)172 2625 y Fc(j)197 2613 y Fd(W)236 2619 y Fc(ij)265 2613 y Fd(\030)283 2619 y Fc(j)301 2613 y Ff(\))i(and)g Fd(\026)435 2619 y Fc(i)461 2613 y Ff(=)f Fd(\030)523 2619 y Fc(i)550 2613 y Ff(for)h(the)h(hidden)f(units.)18 b(The)c(w)o(eigh)o(ts)f Fd(W)1210 2619 y Fc(ij)1253 2613 y Ff(w)o(ere)h(initialized)d(b)o(y)j(random)d(dra)o(ws)j(from)0 2670 y(a)g(Gaussian)f(distribution)g(with)h(zero)h(mean)d(and)i(small)e (v)n(ariance.)951 2795 y Fp(12)p eop %%Page: 13 13 13 12 bop 0 50 a Fp(an)24 b(attractor)g(dynamics)e(that)i(con)o(v)o (erges)f(to)h(solutions)g(of)g(the)f(mean)g(\014eld)g(equations)g(and)i (that)0 110 y(generates)16 b(the)g(signals)h(required)e(for)i(unsup)q (ervised)f(learning.)73 170 y(While)e(learning)h(and)h(dynamics)d(ha)o (v)o(e)h(b)q(een)h(t)o(win)g(themes)e(of)i(neural)g(net)o(w)o(ork)g (researc)o(h)f(since)g(its)0 230 y(inception,)f(it)h(often)g(app)q (ears)i(that)e(the)g(\014eld)g(is)g(divided)f(in)o(to)g(t)o(w)o(o)h (camps|one)g(studying)g(symmetri)o(c)0 291 y(net)o(w)o(orks)f(with)g (energy)g(functions,)h(the)f(other)h(studying)f(feedforw)o(ard)h(net)o (w)o(orks)f(that)h(do)f(not)h(in)o(v)o(olv)o(e)0 351 y(iterativ)o(e)c(forms)i(of)g(relaxation.)20 b(In)11 b(our)i(view,)f(this)g(split)f(has)i(prev)o(en)o(ted)d(researc)o(hers)i (from)f(com)o(bining)0 411 y(the)h(b)q(ene\014ts)g(of)h(b)q(oth)g (approac)o(hes)g(to)g(computation.)19 b(W)l(e)12 b(note)g(that)h (despite)e(the)h(strong)i(con)o(v)o(ergence)0 471 y(results)f(a)o(v)m (ailable)g(for)g(symmetri)o(c)d(net)o(w)o(orks,)j(there)g(ha)o(v)o(e)g (b)q(een)g(few)g(applications)g(for)g(these)g(net)o(w)o(orks)0 531 y(in)o(v)o(olving)e(an)o(y)i(signi\014can)o(t)g(elemen)o(t)d(of)j (learning.)20 b(Lik)o(ewise,)11 b(despite)i(the)f(p)q(o)o(w)o(erful)h (learning)f(abilities)0 592 y(of)22 b(feedforw)o(ard)g(net)o(w)o(orks,) g(there)f(ha)o(v)o(e)f(b)q(een)i(few)f(applications)h(in)o(v)o(olving)e (more)g(complex)g(forms)0 652 y(of)i(inference)e(and)i (decision-making.)36 b(In)21 b(the)g(remainder)f(of)i(this)f(section,)h (w)o(e)f(discuss)h(the)f(man)o(y)0 712 y(comp)q(elling)13 b(reasons)k(for)e(com)o(bining)f(these)h(t)o(w)o(o)g(approac)o(hes)h (and)g(suggest)g(ho)o(w)g(this)f(migh)o(t)e(b)q(e)j(done)0 772 y(using)h(the)f(ideas)g(in)g(this)g(pap)q(er.)73 832 y(Let)j(us)h(b)q(egin)f(b)o(y)g(considering)g(feedforw)o(ard)g(net) o(w)o(orks.)30 b(Man)o(y)18 b(practical)h(learning)g(algorithms)0 892 y(ha)o(v)o(e)12 b(b)q(een)g(dev)o(elop)q(ed)g(for)h(feedforw)o(ard) g(net)o(w)o(orks,)f(and)h(n)o(umerous)f(theoretical)g(results)g(are)h (a)o(v)m(ailable)0 953 y(to)j(c)o(haracterize)f(their)g(prop)q(erties)h (for)g(appro)o(ximation)f(and)h(estimation.)k(The)c(usual)g(framew)o (ork)f(for)0 1013 y(feedforw)o(ard)e(net)o(w)o(orks)g(is)g(one)g(of)h (sup)q(ervised)f(learning,)g(or)h(function)f(appro)o(ximation.)19 b(In)13 b(particular,)0 1073 y(a)f(net)o(w)o(ork)f(induces)g(a)h (functional)g(relationship)f(b)q(et)o(w)o(een)g Fn(x)g Fp(and)i Fn(y)g Fp(based)f(on)g(a)g(training)g(set)g(consisting)0 1133 y(of)k(\()p Fn(x;)8 b(y)r Fp(\))15 b(pairs.)22 b(Subsequen)o(t)15 b Fn(x)h Fp(inputs)g(can)g(b)q(e)h(used)f(as)h(queries,)d(and)j(the)f (net)o(w)o(ork)f(in)o(terp)q(olates)h(or)0 1193 y(extrap)q(olates)h(to) f(pro)o(vide)g(a)g(resp)q(onse)h Fn(y)r Fp(.)73 1254 y(Although)k(useful)f(and)h(general,)g(this)g(framew)o(ork)e(also)i (has)g(its)f(limitations.)32 b(In)21 b(particular,)f(it)0 1314 y(is)d(not)h(alw)o(a)o(ys)g(the)f(case)h(that)g(the)f(form)g(of)h (future)f(queries)g(is)g(kno)o(wn)h(in)f(adv)m(ance)h(of)g(training,)f (and)0 1374 y(indeed,)f(as)i(in)f(the)g(classical)g(setting)g(of)h (asso)q(ciativ)o(e)f(memory)l(,)d(it)j(can)g(b)q(e)g(useful)g(to)h (allo)o(w)f(arbitrary)0 1434 y(comp)q(onen)o(ts)g(of)g(the)h(join)o(t)e (\()p Fn(x;)8 b(y)r Fp(\))17 b(v)o(ector)f(to)i(serv)o(e)e(as)j (queries.)k(F)l(or)18 b(example,)d(in)i(con)o(trol)g(and)h(opti-)0 1494 y(mization)c(applications,)i(one)h(w)o(ould)f(lik)o(e)e(to)j(use)f Fn(y)i Fp(as)e(a)h(query)e(and)i(extract)f(a)g(corresp)q(onding)h Fn(x)p Fp(.)k(In)0 1555 y(missing)15 b(data)h(problems,)e(one)i(w)o (ould)g(lik)o(e)e(to)i Fo(\014l)r(l)j(in)d Fp(comp)q(onen)o(ts)f(of)h (the)g Fn(x)g Fp(v)o(ector)e(giv)o(en)h Fn(y)j Fp(or)e(giv)o(en)0 1615 y(other)k(comp)q(onen)o(ts)f(of)h Fn(x)p Fp(.)32 b(In)19 b(applications)h(in)o(v)o(olving)e(diagnosis,)k(mo)q(del)c (critiquing,)h(explanation)0 1675 y(and)e(sensitivit)o(y)e(analysis,)h (one)h(w)o(ould)f(often)h(lik)o(e)d(to)j(\014nd)g(v)m(alues)g(of)f (hidden)h(units)f(that)h(corresp)q(ond)0 1735 y(to)i(particular)f (input)h(or)g(output)g(patterns.)29 b(Finally)l(,)17 b(in)h(problems)f(with)i(unlab)q(eled)f(examples,)f(one)0 1795 y(w)o(ould)g(lik)o(e)d(to)j(do)g(some)f(form)g(of)g(unsup)q (ervised)h(learning.)22 b(In)16 b(our)h(view,)f(these)g(manifold)f (problems)0 1856 y(are)j(b)q(est)h(treated)e(as)i(general)f(inference)f (problems)f(on)j(the)f(database)h(of)g(kno)o(wledge)e(stored)i(b)o(y)e (the)0 1916 y(net)o(w)o(ork.)j(Moreo)o(v)o(er,)15 b(as)h(is)g (suggested)h(b)o(y)e(the)h(heuristic)f(iterativ)o(e)f(tec)o(hniques)g (that)i(ha)o(v)o(e)g(b)q(een)f(em-)0 1976 y(plo)o(y)o(ed)i(to)h(\\in)o (v)o(ert")f(feedforw)o(ard)h(net)o(w)o(orks)f(\(Hoskins)h(et)f(al,)h (1992;)i(Jordan)f(&)f(Rumelhart,)e(1992\),)0 2036 y(w)o(e)e(exp)q(ect)g (issues)g(in)g(dynamical)f(systems)g(to)i(b)q(ecome)d(relev)m(an)o(t)i (when)g(inference)f(is)h(p)q(erformed)f(in)i(an)0 2096 y(\\upstream")h(direction.)73 2156 y(Ev)o(en)j(in)f(the)h(classical)g (setting)g(where)g(feedforw)o(ard)g(net)o(w)o(orks)g(are)g(used)g(for)g (function)g(appro)o(x-)0 2217 y(imation,)g(an)h(inferen)o(tial)e(p)q (ersp)q(ectiv)o(e)h(can)h(b)q(e)g(useful.)32 b(Consider)20 b(t)o(w)o(o)g(logistic)f(hidden)g(units)h(with)0 2277 y(strong)f(p)q(ositiv)o(e)f(connections)g(to)g(a)h(logistic)e(output)i (unit.)27 b(If)18 b(the)f(output)i(unit)f(has)h(a)g(target)f(v)m(alue)0 2337 y(of)h(one,)f(then)g(w)o(e)g(can)g(exploit)f(the)h(fact)g(that)h (only)f(one)g(hidden)g(unit)g(su\016ces)g(to)g(activ)m(ate)g(the)g (out-)0 2397 y(put)j(unit.)34 b(In)20 b(particular,)h(if)f(w)o(e)g(ha)o (v)o(e)g(additional)h(evidence)e(that)i(\(sa)o(y\))f(the)h(\014rst)g (hidden)f(unit)g(is)0 2457 y(activ)m(ated,)i(p)q(erhaps)h(via)e(its)h (connection)f(to)h(another)g(output)g(unit,)h(then)e(w)o(e)g(can)h (infer)f(that)h(the)0 2518 y(second)15 b(hidden)g(unit)g(is)g(not)g (required)f(to)i(b)q(e)f(activ)m(ated,)g(and)h(th)o(us)f(can)g(b)q(e)g (used)h(for)f(other)g(purp)q(oses.)0 2578 y(This)g(explaining-a)o(w)o (a)o(y)f(phenomenon)g(re\015ects)h(an)g(induced)f(correlation)h(b)q(et) o(w)o(een)f(the)h(hidden)g(units,)0 2638 y(and)j(it)g(is)g(natural)g (in)f(man)o(y)g(diagnostic)h(settings)g(in)o(v)o(olving)e(hidden)i (causes)g(\(P)o(earl,)f(1988\).)28 b(It)17 b(and)951 2795 y(13)p eop %%Page: 14 14 14 13 bop 0 50 a Fp(other)15 b(induced)g(correlations)g(b)q(et)o(w)o (een)g(hidden)g(units)g(can)h(b)q(e)f(exploited)f(if)h(w)o(e)g(augmen)o (t)f(our)i(view)f(of)0 110 y(feedforw)o(ard)h(net)o(w)o(ork)g(learning) g(to)g(include)f(an)i(\\upstream")f(inferen)o(tial)f(comp)q(onen)o(t.) 73 170 y(While)g(classical)g(feedforw)o(ard)h(net)o(w)o(orks)g(are)g(p) q(o)o(w)o(erful)f(learning)h(mac)o(hines)e(and)i(w)o(eak)g(inference)0 230 y(engines,)h(the)g(opp)q(osite)g(can)h(b)q(e)f(said)g(of)h (symmetri)o(c)c(neural)j(net)o(w)o(orks.)24 b(Prop)q(erly)17 b(con\014gured,)g(sym-)0 291 y(metric)10 b(net)o(w)o(orks)i(can)h(p)q (erform)e(inferences)g(as)j(complex)c(as)j(solving)f(the)h(tra)o(v)o (eling)e(salesman)h(problem)0 351 y(\(Hop\014eld)19 b(&)g(T)l(ank,)h (1986\),)h(y)o(et)e(few)g(ha)o(v)o(e)f(emerged)g(in)h(applications)g (in)o(v)o(olving)f(a)i(signi\014can)o(t)f(ele-)0 411 y(men)o(t)g(of)j(learning.)36 b(In)21 b(our)g(view)g(the)g(reasons)h (for)f(this)g(are)h(t)o(w)o(ofold)f(\(P)o(earl,)g(1988\).)38 b(First,)21 b(it)g(is)0 471 y(a)f(general)f(fact)g(that)h(the)f(family) e(of)i(undirected)g(graphical)g(mo)q(dels|of)f(whic)o(h)h(symmetri)o(c) d(neural)0 531 y(net)o(w)o(orks,)22 b(suc)o(h)f(as)i(the)e(Boltzmann)f (mac)o(hine,)g(are)i(a)g(sp)q(ecial)f(case|are)h(less)f(mo)q(dular)g (than)h(di-)0 592 y(rected)16 b(graphical)h(mo)q(dels.)22 b(In)17 b(a)g(directed)f(mo)q(del,)f(no)q(des)j(that)f(are)g(do)o (wnstream)g(from)f(the)g(queried)0 652 y(and)i(observ)o(ed)f(no)q(des)h (can)f(simply)e(b)q(e)j(deleted;)e(they)g(ha)o(v)o(e)h(no)g(e\013ect)g (on)h(the)f(query)l(.)23 b(In)17 b(undirected)0 712 y(net)o(w)o(orks)e (no)g(suc)o(h)g(mo)q(dularit)o(y)e(generally)i(exists|no)q(des)g(are)g (generally)f(coupled)g(via)h(the)g(partition)0 772 y(function.)21 b(Second,)c(in)f(a)g(directed)f(net)o(w)o(ork)h(it)g(is)g(p)q(ossible)h (to)g(use)f(causal)h(in)o(tuitions)f(to)g(understand)0 832 y(represen)o(tation)g(and)h(pro)q(cessing)g(in)f(the)h(mo)q(del.)j (This)d(can)f(often)h(b)q(e)g(an)g(o)o(v)o(erwhelmi)o(ng)d(adv)m(an)o (tage.)0 892 y(Moreo)o(v)o(er,)h(if)h(the)g(domain)g(b)q(eing)h(mo)q (deled)e(has)i(a)g(natural)g(causal)g(structure,)f(then)g(it)g(is)h (natural)g(to)0 953 y(use)f(a)h(directed)e(mo)q(del)g(whic)o(h)g (accords)i(with)f(the)g(observ)o(ed)g(direction)f(of)i(causalit)o(y)l (.)73 1013 y(W)l(e)d(tak)o(e)f(t)o(w)o(o)g(lessons)h(from)f(the)g (previous)g(successes)h(of)g(neural)f(computation:)19 b(\(i\))13 b(from)g(the)g(abil-)0 1073 y(ities)i(of)i(symmetri)o(c)c (net)o(w)o(orks,)j(that)g(complex)f(forms)g(of)i(inference)d(require)h (an)i(elemen)o(t)c(of)k(iterativ)o(e)0 1133 y(pro)q(cessing;)23 b(and)e(\(ii\))f(from)f(the)h(abilities)f(of)i(feedforw)o(ard)g(net)o (w)o(orks,)g(that)f(the)h(capacit)o(y)e(to)i(learn)0 1193 y(is)d(greatly)f(enhanced)h(b)o(y)f(the)h(elemen)o(t)c(of)19 b(directionalit)o(y)l(.)k(W)l(e)18 b(b)q(eliev)o(e)e(that)i(the)g (formalism)d(in)i(this)0 1254 y(pap)q(er)d(com)o(bines)e(the)i(b)q(est) g(asp)q(ects)g(of)g(symmetri)o(c)d(and)j(feedforw)o(ard)g(neural)f(net) o(w)o(orks.)20 b(The)14 b(mo)q(dels)0 1314 y(w)o(e)k(study)h(are)f (represen)o(ted)g(b)o(y)g(directed)f(acyclic)g(graphs)j(and)f(th)o(us)g (ha)o(v)o(e)e(the)i(natural)g(adv)m(an)o(tages)0 1374 y(of)g(mo)q(dularit)o(y)f(and)i(causalit)o(y)e(that)i(accrue)f(to)g (feedforw)o(ard)g(net)o(w)o(orks.)30 b(Moreo)o(v)o(er,)18 b(b)q(ecause)i(they)0 1434 y(are)c(endo)o(w)o(ed)g(with)g (probabilistic)f(seman)o(tics,)f(they)i(also)g(supp)q(ort)i(complex)c (t)o(yp)q(es)i(of)g(inference)e(and)0 1494 y(reasoning.)28 b(This)19 b(allo)o(ws)f(them)f(to)i(b)q(e)g(applied)e(to)i(a)g(broad)g (range)g(of)g(problems)e(in)o(v)o(olving)g(diagno-)0 1555 y(sis,)f(explanation,)g(con)o(trol,)g(optimization,)f(and)i (missing)e(data.)23 b(Our)16 b(formalism)e(also)j(reconciles)e(the)0 1615 y(problems)d(of)i(unsup)q(ervised)f(and)h(sup)q(ervised)g (learning)f(in)g(a)h(manner)e(reminiscen)o(t)f(of)i(the)h(Boltzmann)0 1675 y(mac)o(hine)j(\(Ac)o(kley)g(et)i(al,)h(1985\).)32 b(The)20 b(sup)q(ervised)f(case)g(simply)e(emerges)h(as)i(the)f (limiting)e(case)i(in)0 1735 y(whic)o(h)13 b(all)g(of)h(the)f(input)g (and)i(output)f(units)f(are)h(con)o(tained)f(in)g(the)g(set)h(of)g (visible)e(units.)20 b(Finally)l(,)12 b(as)i(in)0 1795 y(symmetri)o(c)h(neural)j(net)o(w)o(orks,)g(appro)o(ximate)f (probabilistic)g(inference)g(is)g(p)q(erformed)g(b)o(y)h(relaxing)g(a)0 1856 y(con)o(tin)o(uous)13 b(dynamical)d(system.)19 b(Our)13 b(formalism)d(th)o(us)i(preserv)o(es)g(the)g(man)o(y)f(comp)q(elling)g (features)i(of)0 1916 y(the)i(attractor)i(paradigm,)e(including)g(the)g (guaran)o(tees)h(of)g(stabilit)o(y)f(and)h(con)o(v)o(ergence,)e(the)h (p)q(oten)o(tial)0 1976 y(for)i(massiv)o(e)d(parallelism,)f(and)k(the)f (ph)o(ysical)f(analogy)j(of)e(an)h(energy)f(surface.)73 2036 y(Note)i(that)h(our)g(analysis)f(transforms)g(a)h(feedforw)o(ard)f (net)o(w)o(ork)g(in)o(to)g(a)h(recurren)o(t)e(net)o(w)o(ork)h(that)0 2096 y(p)q(ossesses)i(a)f(Ly)o(apuno)o(v)g(function.)27 b(This)19 b(recurren)o(t)e(net)o(w)o(ork)h(\(essen)o(tially)f(eqs.)h (\(12{13\))i(view)o(ed)d(as)0 2156 y(a)i(recurren)o(t)f(net)o(w)o (ork\))g(is)h(not)g(a)g(symmetri)o(c)d(net)o(w)o(ork,)i(and)i(its)e(Ly) o(apuno)o(v)h(function)g(do)q(es)h(not)f(fol-)0 2217 y(lo)o(w)h(directly)f(from)h(the)g(theorems)g(of)g(Cohen)i(and)f (Grossb)q(erg)h(\(1983\))g(and)f(Hop\014eld)f(\(1984\).)36 b(W)l(e)0 2277 y(ha)o(v)o(e)16 b(deriv)o(ed)g(the)h(attractor)h (dynamics)d(for)j(these)f(net)o(w)o(orks)f(b)o(y)h(com)o(bining)e (ideas)i(from)g(statistical)0 2337 y(mec)o(hanics)i(with)i(the)g (probabilistic)f(mac)o(hinery)f(of)i(directed)f(graphical)i(mo)q(dels.) 35 b(Of)21 b(course,)h(one)0 2397 y(can)f(also)h(study)g(recurren)o(t)e (net)o(w)o(orks)h(that)g(p)q(ossess)i(a)f(Ly)o(apuno)o(v)f(function,)h (indep)q(enden)o(t)f(of)g(an)o(y)0 2457 y(underlying)d(probabilistic)g (form)o(ulation.)27 b(In)19 b(fact,)g(Seung)g(et)f(al)h(\(1997\))h (recen)o(tly)d(exhibited)g(a)i(Ly)o(a-)0 2518 y(puno)o(v)f(function)g (for)h(excitatory-inhibitory)d(neural)i(net)o(w)o(orks)g(with)g(a)h (mixture)d(of)i(symmetric)c(and)0 2578 y(an)o(tisymmetri)o(c)d(in)o (teractions.)20 b(In)o(terestingly)l(,)12 b(their)h(Ly)o(apuno)o(v)i (function)f(has)g(a)h(similar)d(structure)i(to)0 2638 y(the)i(one)g(in)g(eq.)g(\(14\).)951 2795 y(14)p eop %%Page: 15 15 15 14 bop 73 50 a Fp(A)11 b(general)g(concern)g(with)g(dynamical)f (approac)o(hes)i(to)g(computation)e(in)o(v)o(olv)o(es)g(the)h(amoun)o (t)f(of)i(time)0 110 y(required)f(to)h(relax)g(to)g(equilibrium.)k (Although)d(w)o(e)e(found)i(empirically)8 b(that)13 b(this)f (relaxation)g(time)e(w)o(as)0 170 y(not)19 b(long)f(for)g(the)g (problem)f(of)h(recognizing)g(handwritten)g(digits)g(\(16)h(iterations) f(of)g(the)g(discretized)0 230 y(di\013eren)o(tial)13 b(equations\),)i(the)g(issue)f(requires)g(further)g(atten)o(tion.)21 b(Bey)o(ond)14 b(general)g(n)o(umerical)e(meth-)0 291 y(o)q(ds)22 b(for)f(sp)q(eeding)h(con)o(v)o(ergence,)e(one)h(ob)o (vious)g(approac)o(h)h(is)f(to)g(consider)g(metho)q(ds)f(for)h(pro)o (viding)0 351 y(b)q(etter)c(initial)f(estimates)g(of)h(the)g(mean)g (\014eld)f(parameters.)24 b(This)17 b(general)g(idea)h(is)f(suggestiv)o (e)g(of)g(the)0 411 y(Helmholtz)d(mac)o(hine)g(of)j(Hin)o(ton)f(et)g (al)h(\(1995\).)23 b(The)17 b(Helmholtz)d(mac)o(hine)g(is)j(a)g(pair)f (of)h(feedforw)o(ard)0 471 y(net)o(w)o(orks,)c(a)h(top-do)o(wn)g (generativ)o(e)e(mo)q(del)g(that)h(corresp)q(onds)i(to)e(the)g(Ba)o(y)o (esian)f(net)o(w)o(ork)h(in)g(\014gure)g(1,)0 531 y(and)19 b(a)g(b)q(ottom-up)g(recognition)g(mo)q(del)e(that)i(computes)f(the)g (conditional)h(statistics)f(of)h(the)f(hidden)0 592 y(units)f(induced)f (b)o(y)g(the)g(input)g(v)o(ector.)22 b(This)17 b(latter)f(net)o(w)o (ork)g(replaces)g(the)g(mean)g(\014eld)g(equations)g(in)0 652 y(our)j(approac)o(h.)27 b(The)18 b(recognition)g(mo)q(del)f(is)h (itself)f(learned,)h(essen)o(tially)e(as)j(a)f(probabilistic)g(in)o(v)o (erse)0 712 y(to)e(the)g(generativ)o(e)f(mo)q(del.)k(This)d(approac)o (h)h(ob)o(viates)f(the)f(need)h(for)g(the)g(iterativ)o(e)e(solution)i (of)g(mean)0 772 y(\014eld)h(equations.)27 b(The)18 b(tradeo\013)h(for) f(this)g(simplicit)o(y)d(is)i(a)i(lac)o(k)e(of)h(theoretical)f(guaran)o (tees,)i(and)f(the)0 832 y(fact)e(that)g(the)g(recognition)g(mo)q(del)f (cannot)h(handle)g(missing)f(data)i(or)f(supp)q(ort)h(certain)f(t)o(yp) q(es)f(of)i(rea-)0 892 y(soning,)i(suc)o(h)f(as)h(explaining)e(a)o(w)o (a)o(y)l(,)h(that)g(rely)f(on)i(the)f(com)o(bination)e(of)j(top-do)o (wn)g(and)g(b)q(ottom-up)0 953 y(pro)q(cessing.)24 b(One)16 b(attractiv)o(e)g(idea,)h(ho)o(w)o(ev)o(er,)e(is)i(to)g(use)g(a)g(b)q (ottom-up)g(recognition)g(mo)q(del)f(to)h(mak)o(e)0 1013 y(initial)i(guesses)i(for)g(the)f(mean)f(\014eld)h(parameters,)g(then)g (to)h(use)g(an)g(attractor)g(dynamics)e(to)h(re\014ne)0 1073 y(these)c(guesses.)73 1133 y(Ev)o(en)k(without)g(suc)o(h)g (enhancemen)o(ts,)f(ho)o(w)o(ev)o(er,)g(w)o(e)h(feel)f(that)i(the)f (attractor)h(paradigm)e(in)h(di-)0 1193 y(rected)d(graphical)h(mo)q (dels)f(is)h(w)o(orth)o(y)g(of)g(further)g(in)o(v)o(estigation.)26 b(A)o(ttractor)17 b(neural)h(net)o(w)o(orks)g(ha)o(v)o(e)0 1254 y(pro)o(vided)i(a)h(viable)f(approac)o(h)i(to)f(probabilistic)f (inference)f(in)i(undirected)e(graphical)i(mo)q(dels)f(\(P)o(e-)0 1314 y(terson)h(&)f(Anderson,)h(1987\),)h(particularly)e(when)g(com)o (bined)e(with)j(deterministic)c(annealing.)33 b(W)l(e)0 1374 y(attribute)24 b(the)f(lac)o(k)g(of)i(learning-based)f (applications)g(for)g(symmetric)c(neural)k(net)o(w)o(orks)f(to)i(their) 0 1434 y(represen)o(tational)15 b(limitations)f(for)i(mo)q(deling)e (causal)i(pro)q(cesses)g(\(P)o(earl,)f(1988\))i(and)g(the)e(p)q (eculiar)g(in-)0 1494 y(stabilities)j(arising)g(from)g(the)h(sleep)f (phase)h(of)g(Boltzmann)e(learning)i(\(Neal,)f(1992\).)30 b(By)18 b(com)o(bining)0 1555 y(the)f(virtues)f(of)i(attractor)f (dynamics)f(with)h(the)g(probabilistic)f(seman)o(tics)f(of)j(feedforw)o (ard)f(net)o(w)o(orks,)0 1615 y(w)o(e)f(feel)f(that)i(a)f(more)f (useful)h(and)h(in)o(teresting)e(mo)q(del)g(emerges.)0 1781 y Fq(A)81 b(Details)25 b(of)i(mean)g(\014eld)f(theory)0 1891 y Fp(In)17 b(this)g(app)q(endix)h(w)o(e)f(deriv)o(e)f(the)h(mean)f (\014eld)h(appro)o(ximation)g(for)g(large,)g(la)o(y)o(ered)f(net)o(w)o (orks)h(whose)0 1951 y(probabilistic)e(seman)o(tics)f(are)h(giv)o(en)g (b)o(y)g(eqs.)g(\(1{2\).)22 b(Starting)16 b(from)f(the)g(factorized)g (distribution)h(for)0 2011 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\),)18 b(eq.)f(\(5\),)h(our)h(goal)f(is)g(to)h(minim)o(iz) o(e)c(the)j(KL)g(div)o(ergence)e(in)i(eq.)f(\(7\),)h(with)g(resp)q(ect) g(to)g(the)0 2071 y(parameters)g Fl(f)p Fn(\026)309 2078 y Fm(i)323 2071 y Fl(g)p Fp(.)30 b(Note)18 b(that)i(this)f(is)g(equiv)m (alen)o(t)e(to)i(maximizi)o(ng)e(the)h(lo)o(w)o(er)g(b)q(ound)j(on)e (ln)8 b Fn(P)f Fp(\()p Fn(V)k Fp(\),)0 2131 y(giv)o(en)k(in)h(eq.)f (\(19\).)73 2192 y(The)e(\014rst)g(term)e(on)i(the)f(righ)o(t)h(hand)g (side)f(of)h(eq.)f(\(7\))h(is)f(simply)f(min)o(us)g(the)h(en)o(trop)o (y)g(of)h(the)f(factorial)0 2252 y(distribution,)j Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)c Fp(\),)16 b(or:)352 2327 y Fk(X)367 2418 y Fm(H)421 2368 y Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\))d(ln)g Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)j Fp(\))j(=)891 2327 y Fk(X)915 2418 y Fm(i)960 2320 y Fk(h)978 2368 y Fn(\026)1007 2375 y Fm(i)1030 2368 y Fp(ln)8 b Fn(\026)1108 2375 y Fm(i)1133 2368 y Fp(+)j(\(1)h Fl(\000)e Fn(\026)1315 2375 y Fm(i)1330 2368 y Fp(\))e(ln\(1)j Fl(\000)g Fn(\026)1531 2375 y Fm(i)1545 2368 y Fp(\))1564 2320 y Fk(i)1592 2368 y Fn(:)257 b Fp(\(22\))0 2511 y(Here,)24 b(for)h(notational)f(con)o(v)o(enience,)f (w)o(e)h(ha)o(v)o(e)f(in)o(tro)q(duced)h(parameters)f Fn(\026)1492 2518 y Fm(i)1530 2511 y Fp(for)h(all)g(the)f(units)h(in)0 2571 y(the)19 b(net)o(w)o(ork,)g(hidden)g Fo(and)h Fp(visible.)29 b(F)l(or)20 b(the)f(visible)f(units,)i(w)o(e)f(use)g(these)h (parameters)e(simply)f(as)0 2632 y(placeholders)f(for)g(the)h (evidence.)i(Th)o(us)e(the)f(visible)f(units)h(are)h(clamp)q(ed)d(to)j (either)e(zero)i(or)f(one,)g(and)951 2795 y(15)p eop %%Page: 16 16 16 15 bop 0 50 a Fp(they)16 b(do)g(not)h(con)o(tribute)f(to)g(the)g(en) o(trop)o(y)g(in)g(eq.)f(\(22\).)73 110 y(Ev)m(aluating)h(the)g(second)g (term)d(on)k(the)e(righ)o(t)g(hand)i(side)e(of)h(eq.)e(\(7\))i(is)g (not)g(as)g(straigh)o(tforw)o(ard)g(as)0 170 y(the)g(en)o(trop)o(y)l(.) k(In)c(particular,)g(for)g(eac)o(h)g(unit,)g(let)827 280 y Fn(z)850 287 y Fm(i)878 280 y Fp(=)930 239 y Fk(X)952 330 y Fm(j)998 280 y Fn(W)1044 287 y Fm(ij)1074 280 y Fn(S)1104 287 y Fm(j)1863 280 y Fp(\(23\))0 432 y(denote)g(its)g(w)o (eigh)o(ted)f(sum)h(of)g(paren)o(ts,)g(and)h(let)e Fn(\033)966 439 y Fm(i)994 432 y Fp(=)f Fn(\033)r Fp(\()p Fn(z)1118 439 y Fm(i)1131 432 y Fp(\))i(denote)g(its)g(squashed)h(top-do)o(wn)g (signal.)0 492 y(F)l(rom)e(eqs.)g(\(1\))i(and)g(\(2\),)f(w)o(e)g(can)g (write)g(the)g(join)o(t)g(distribution)g(in)f(these)h(net)o(w)o(orks)g (as:)491 602 y(ln)8 b Fn(P)f Fp(\()p Fn(S)s Fp(\))42 b(=)770 560 y Fk(X)794 652 y Fm(i)839 602 y Fp([)o Fn(S)882 609 y Fm(i)905 602 y Fp(ln)8 b Fn(\033)982 609 y Fm(i)1006 602 y Fp(+)j(\(1)h Fl(\000)f Fn(S)1190 609 y Fm(i)1204 602 y Fp(\))d(ln\(1)j Fl(\000)g Fn(\033)1404 609 y Fm(i)1418 602 y Fp(\)])412 b(\(24\))691 718 y(=)770 676 y Fk(X)794 768 y Fm(i)839 718 y Fp(\()p Fn(S)888 725 y Fm(i)902 718 y Fn(z)925 725 y Fm(i)950 718 y Fl(\000)10 b Fp(ln)e([1)j(+)g Fn(e)1169 697 y Fm(z)1185 702 y Fh(i)1201 718 y Fp(])o(\))d Fn(:)608 b Fp(\(25\))0 863 y(Note)20 b(that)g(to)g(ev)m(aluate)g(the)g (second)g(term)e(in)h(eq.)g(\(7\),)i(w)o(e)e(m)o(ust)g(a)o(v)o(erage)g (the)h(righ)o(t)g(hand)g(side)g(of)0 923 y(eq.)d(\(25\))i(o)o(v)o(er)e (the)h(factorial)g(distribution,)f Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\).)27 b(The)18 b(logarithm)f(term)f(in)i(eq.)f (\(25\),)i(ho)o(w)o(ev)o(er,)0 983 y(mak)o(es)c(it)g(imp)q(ossible)g (to)i(compute)d(this)j(a)o(v)o(erage)e(in)h(closed)g(form.)73 1044 y(Clearly)l(,)j(another)g(appro)o(ximation)f(is)h(needed)g(to)g (compute)f(the)h(exp)q(ected)f(v)m(alue)h(of)g(ln[1)13 b(+)g Fn(e)1892 1026 y Fm(z)1908 1031 y Fh(i)1923 1044 y Fp(],)0 1104 y(a)o(v)o(eraged)22 b(o)o(v)o(er)f(the)g(distribution,)i Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\).)38 b(W)l(e)22 b(can)g(mak)o(e)e(progress)j(b)o(y)e(studying)h(the)g(sum)f(of)0 1164 y(inputs,)16 b Fn(z)186 1171 y Fm(i)200 1164 y Fp(,)h(as)g(a)g (random)f(v)m(ariable)h(in)f(its)g(o)o(wn)i(righ)o(t.)k(Under)16 b(the)g(distribution)h Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\),)16 b(the)g(righ)o(t)0 1224 y(hand)g(side)f(of)g(eq.)f(\(23\))i (is)f(a)h(w)o(eigh)o(ted)e(sum)g(of)h(indep)q(enden)o(t)g(random)f(v)m (ariables)h(with)g(means)g Fn(\026)1838 1231 y Fm(j)1871 1224 y Fp(and)0 1284 y(v)m(ariances)k Fn(\026)242 1291 y Fm(j)260 1284 y Fp(\(1)14 b Fl(\000)e Fn(\026)397 1291 y Fm(j)416 1284 y Fp(\).)28 b(The)19 b(n)o(um)o(b)q(er)e(of)i(terms)e (in)i(this)g(sum)e(is)i(equal)f(to)h(the)g(n)o(um)o(b)q(er)e(of)i (hidden)o(t)0 1345 y(units)14 b(in)f(the)h(preceding)f(la)o(y)o(er.)19 b(In)14 b(large)f(net)o(w)o(orks,)h(w)o(e)f(exp)q(ect)g(the)h (statistics)g(of)g(this)f(sum|or)g(more)0 1405 y(precisely)l(,)20 b(the)i(distribution)f Fn(Q)p Fp(\()p Fn(z)659 1387 y Fm(`)657 1417 y(i)675 1405 y Fl(j)p Fn(V)11 b Fp(\)|to)21 b(b)q(e)h(go)o(v)o(erned)f(b)o(y)g(a)g(cen)o(tral)g(limit)e(theorem.)35 b(In)21 b(other)0 1465 y(w)o(ords,)14 b(to)h(a)f(v)o(ery)e(go)q(o)q(d)k (appro)o(ximation,)d Fn(Q)p Fp(\()p Fn(z)886 1472 y Fm(i)899 1465 y Fl(j)p Fn(V)e Fp(\))j(assumes)g(a)g(normal)f(distribution)g (with)h(mean)e(and)0 1525 y(v)m(ariance:)714 1635 y Fl(h)p Fn(z)756 1642 y Fm(i)770 1635 y Fl(i)42 b Fp(=)911 1594 y Fk(X)933 1685 y Fm(j)979 1635 y Fn(W)1025 1642 y Fm(ij)1055 1635 y Fn(\026)1084 1642 y Fm(j)1103 1635 y Fn(;)746 b Fp(\(26\))671 1714 y Fk(D)696 1762 y Fn(\016)r(z)745 1741 y Fj(2)743 1774 y Fm(i)764 1714 y Fk(E)831 1762 y Fp(=)911 1720 y Fk(X)933 1811 y Fm(j)979 1762 y Fn(W)1032 1741 y Fj(2)1025 1774 y Fm(ij)1055 1762 y Fn(\026)1084 1769 y Fm(j)1103 1762 y Fp(\(1)11 b Fl(\000)g Fn(\026)1236 1769 y Fm(j)1255 1762 y Fp(\))p Fn(;)575 b Fp(\(27\))0 1913 y(where)19 b Fl(h\001i)i Fp(is)f(used)g(to)g(denote)f(the)h(exp)q (ected)f(v)m(alue.)32 b(The)19 b(normalit)o(y)f(of)i Fn(Q)p Fp(\()p Fn(z)1528 1920 y Fm(i)1542 1913 y Fl(j)p Fn(V)11 b Fp(\))20 b(emerges)e(in)h(the)0 1974 y Fo(thermo)n(dynamic)e (limit)h Fp(of)f(large,)f(la)o(y)o(ered)f(net)o(w)o(orks)i(where)f(eac) o(h)g(unit)h(receiv)o(es)e(an)i(in\014nite)f(n)o(um)o(b)q(er)0 2034 y(of)k(inputs)g(from)e(the)i(hidden)f(units)g(in)h(the)f (preceding)g(la)o(y)o(er.)30 b(In)19 b(particular,)h(supp)q(ose)h(that) f(unit)f Fn(i)0 2094 y Fp(has)d Fn(N)125 2101 y Fm(i)154 2094 y Fp(paren)o(ts,)e(and)i(that)f(the)g(w)o(eigh)o(ts)f Fn(W)837 2101 y Fm(ij)882 2094 y Fp(are)h(b)q(ounded)h(b)o(y)1226 2056 y Fl(p)p 1268 2056 54 2 v 38 x Fn(N)1307 2101 y Fm(i)1321 2094 y Fl(j)p Fn(W)1381 2101 y Fm(ij)1411 2094 y Fl(j)e Fn(<)f(c)i Fp(for)g(some)f(constan)o(t)h Fn(c)p Fp(.)0 2154 y(Then)g(in)f(the)h(limit)c Fn(N)417 2161 y Fm(i)445 2154 y Fl(!)j(1)p Fp(,)g(the)h(third)f(and)i(higher)e(order) h(cum)o(ulan)o(ts)d(of)1442 2121 y Fk(P)1486 2165 y Fm(j)1513 2154 y Fn(W)1559 2161 y Fm(ij)1589 2154 y Fn(S)1619 2161 y Fm(j)1652 2154 y Fp(v)m(anish)j(for)g(an)o(y)0 2214 y(distribution)20 b(under)g(whic)o(h)f Fn(S)585 2221 y Fm(j)624 2214 y Fp(are)h(indep)q(enden)o(tly)f(distributed)g(binary)h (v)m(ariables.)33 b(The)20 b(assump-)0 2275 y(tion)e(that)210 2236 y Fl(p)p 252 2236 V 39 x Fn(N)291 2282 y Fm(i)305 2275 y Fn(W)351 2282 y Fm(ij)398 2275 y Fn(<)g(c)g Fp(implies)e(that)i (the)g(w)o(eigh)o(ts)g(are)g(uniformly)f(small)f(and)j(ev)o(enly)e (distributed)0 2335 y(throughout)j(the)f(net)o(w)o(ork;)g(it)f(is)h(a)g (natural)h(assumption)e(to)h(mak)o(e)e(for)i(robust,)h(fault-toleran)o (t)f(net-)0 2395 y(w)o(orks)f(whose)h(computing)e(abilities)g(do)h(not) h(degrade)f(catastrophically)g(with)g(random)g(\\lesions")g(in)0 2455 y(the)h(w)o(eigh)o(t)f(matrix.)27 b(Though)20 b(only)f(an)g(appro) o(ximation)f(for)h(\014nite)g(net)o(w)o(orks,)g(in)f(what)i(follo)o(ws) e(w)o(e)0 2515 y(mak)o(e)h(the)h(simplifying)e(assumption)i(that)h Fn(Q)p Fp(\()p Fn(z)927 2522 y Fm(i)940 2515 y Fl(j)p Fn(V)11 b Fp(\))21 b(is)f(gaussian.)35 b(This)21 b(assumption|sp)q (eci\014cally)951 2795 y(16)p eop %%Page: 17 17 17 16 bop 0 50 a Fp(tailored)14 b(to)h(large,)f(la)o(y)o(ered)f(net)o (w)o(orks)h(whose)h(evidence)e(arriv)o(es)g(in)h(the)h(b)q(ottom)f(la)o (y)o(er)1637 32 y Fj(3)1655 50 y Fp(|leads)g(to)h(the)0 110 y(simple)f(mean)h(\014eld)h(equations)g(and)h(attractor)g(dynamics) e(in)h(section)f(3.)73 170 y(The)24 b(asymptotic)f(form)g(of)h Fn(Q)p Fp(\()p Fn(z)707 177 y Fm(i)721 170 y Fl(j)p Fn(V)11 b Fp(\))24 b(and)h(the)e(logarithm)h(term)e(in)i(eq.)f(\(25\))h(motiv)m (ate)f(us)i(to)0 230 y(consider)16 b(the)f(follo)o(wing)h(lemma.)i(Let) e Fn(z)i Fp(denote)e(a)h(Gaussian)g(random)e(v)m(ariable)h(with)g(mean) f Fl(h)p Fn(z)r Fl(i)h Fp(and)0 291 y(v)m(ariance)h Fl(h)p Fn(\016)r(z)260 273 y Fj(2)280 291 y Fl(i)p Fp(,)h(and)g(consider)g (the)f(exp)q(ected)g(v)m(alue,)g Fl(h)p Fp(ln[1)12 b(+)g Fn(e)1233 273 y Fm(z)1253 291 y Fp(])p Fl(i)p Fp(.)25 b(Then,)18 b(for)g(an)o(y)f(real)h(n)o(um)o(b)q(er)e Fn(\030)r Fp(,)0 351 y(w)o(e)g(ha)o(v)o(e)f(the)h(upp)q(er)h(b)q(ound)g (\(Seung,)f(1995\):)520 461 y Fl(h)p Fp(ln[1)11 b(+)g Fn(e)701 440 y Fm(z)721 461 y Fp(])p Fl(i)42 b Fp(=)f Fl(h)p Fp(ln[)p Fn(e)972 440 y Fm(\030)q(z)1008 461 y Fn(e)1031 440 y Fi(\000)p Fm(\030)q(z)1095 461 y Fp(\(1)11 b(+)g Fn(e)1221 440 y Fm(z)1241 461 y Fp(\)])p Fl(i)p Fn(;)556 b Fp(\(28\))796 533 y(=)41 b Fn(\030)r Fl(h)p Fn(z)r Fl(i)13 b Fp(+)e Fl(h)p Fp(ln[)p Fn(e)1120 513 y Fi(\000)p Fm(\030)q(z)1194 533 y Fp(+)g Fn(e)1266 513 y Fj(\(1)p Fi(\000)p Fm(\030)q Fj(\))p Fm(z)1375 533 y Fp(])p Fl(i)p Fn(;)441 b Fp(\(29\))795 606 y Fl(\024)41 b Fn(\030)r Fl(h)p Fn(z)r Fl(i)13 b Fp(+)e(ln)o Fl(h)p Fn(e)1105 585 y Fi(\000)p Fm(\030)q(z)1181 606 y Fp(+)g Fn(e)1253 585 y Fj(\(1)p Fi(\000)p Fm(\030)q Fj(\))p Fm(z)1361 606 y Fl(i)p Fn(;)469 b Fp(\(30\))0 716 y(where)13 b(the)h(last)g(line)f(follo)o(ws)g(from)g(Jensen's)h(inequalit)o(y)l(.) k(Since)13 b Fn(z)j Fp(is)d(Gaussian,)i(it)f(is)f(straigh)o(tforw)o (ard)0 776 y(to)i(p)q(erform)f(the)g(a)o(v)o(erages)g(on)h(the)g(righ)o (t)f(hand)h(side.)20 b(This)15 b(giv)o(es)f(us)h(an)g(upp)q(er)g(b)q (ound)g(on)g Fl(h)p Fp(ln[1)8 b(+)g Fn(e)1898 758 y Fm(z)1917 776 y Fp(])p Fl(i)0 836 y Fp(expressed)16 b(in)g(terms)e(of)j(the)f (mean)f(and)i(v)m(ariance:)446 966 y Fl(h)p Fp(ln[1)11 b(+)g Fn(e)627 945 y Fm(z)646 966 y Fp(])p Fl(i)j(\024)751 932 y Fp(1)p 751 954 25 2 v 751 1000 a(2)780 966 y Fn(\030)803 945 y Fj(2)824 966 y Fl(h)p Fn(\016)r(z)892 945 y Fj(2)911 966 y Fl(i)d Fp(+)g(ln)1039 918 y Fk(h)1059 966 y Fp(1)h(+)f Fn(e)1167 945 y Fi(h)p Fm(z)q Fi(i)p Fj(+\(1)p Fi(\000)p Fj(2)p Fm(\030)q Fj(\))p Fi(h)p Fm(\016)q(z)1395 934 y Fb(2)1411 945 y Fi(i)p Fm(=)p Fj(2)1463 918 y Fk(i)1490 966 y Fn(:)359 b Fp(\(31\))0 1091 y(The)22 b(righ)o(t)g(hand)h(side)f (of)h(eq.)e(\(31\))i(is)f(a)h(con)o(v)o(ex)e(function)h(of)g Fn(\030)j Fp(whose)e(minim)o(um)18 b(o)q(ccurs)k(in)g(the)0 1152 y(in)o(terv)m(al)15 b Fn(\030)i Fl(2)d Fp([0)p Fn(;)8 b Fp(1].)73 1212 y(W)l(e)21 b(can)h(use)f(this)h(lemm)o(a)d(to)j (compute)e(an)i(appro)o(ximate)e(v)m(alue)h(for)h Fl(h)p Fp(ln[1)14 b(+)h Fn(e)1636 1194 y Fm(z)1652 1199 y Fh(i)1667 1212 y Fp(])p Fl(i)p Fp(,)22 b(where)f(the)0 1272 y(a)o(v)o(erage)15 b(is)h(p)q(erformed)e(with)i(resp)q(ect)g(to)g(the)f(distribution,)g Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)c Fp(\).)21 b(This)16 b(is)g(done)g(b)o(y)f(in)o(tro)q(ducing)0 1332 y(an)j(extra)f (parameter,)f Fn(\030)465 1339 y Fm(i)479 1332 y Fp(,)h(for)h(eac)o(h)f (unit)g(in)f(the)h(net)o(w)o(ork,)g(then)g(substituting)h Fn(\030)1550 1339 y Fm(i)1581 1332 y Fp(and)g(the)f(statistics)0 1392 y(of)g Fn(z)79 1399 y Fm(i)110 1392 y Fp(in)o(to)g(eq.)f(\(31\).) 25 b(Note)17 b(that)g(the)g(terms)f(ln)o([1)c(+)g Fn(e)1023 1374 y Fm(z)1039 1379 y Fh(i)1054 1392 y Fp(])17 b(app)q(ear)h(in)e (eq.)h(\(25\))g(with)g(an)h(o)o(v)o(erall)e(min)o(us)0 1453 y(sign;)h(th)o(us,)g(to)g(the)g(exten)o(t)f(that)h Fn(Q)p Fp(\()p Fn(z)721 1434 y Fm(l)719 1465 y(i)734 1453 y Fl(j)p Fn(V)11 b Fp(\))17 b(is)g(w)o(ell)e(appro)o(ximated)h(b)o (y)g(a)i(Gaussian)g(distribution,)e(the)0 1513 y(upp)q(er)22 b(b)q(ound)g(in)g(eq.)e(\(31\))i(translates)g(in)o(to)f(a)h(lo)o(w)o (er)f(b)q(ound)h(on)g Fl(h)p Fp(ln)9 b Fn(P)e Fp(\()p Fn(S)s Fp(\))p Fl(i)p Fp(.)37 b(In)21 b(particular,)h(from)0 1573 y(eq.)15 b(\(25\),)i(w)o(e)f(ha)o(v)o(e:)2 1705 y Fl(h)p Fp(ln)9 b Fn(P)e Fp(\()p Fn(S)s Fp(\))p Fl(i)14 b(\025)266 1664 y Fk(X)282 1755 y Fm(ij)334 1705 y Fn(W)380 1712 y Fm(ij)410 1705 y Fn(\026)439 1712 y Fm(i)454 1705 y Fn(\026)483 1712 y Fm(j)512 1705 y Fl(\000)567 1671 y Fp(1)p 567 1694 V 567 1739 a(2)605 1664 y Fk(X)621 1755 y Fm(ij)673 1705 y Fn(W)726 1685 y Fj(2)719 1717 y Fm(ij)749 1705 y Fn(\030)772 1685 y Fj(2)770 1717 y Fm(i)793 1705 y Fn(\026)822 1712 y Fm(j)840 1705 y Fp(\(1)e Fl(\000)f Fn(\026)974 1712 y Fm(j)992 1705 y Fp(\))g Fl(\000)1072 1664 y Fk(X)1096 1755 y Fm(i)1140 1705 y Fp(ln)1189 1645 y Fk(\032)1220 1705 y Fp(1)h(+)f Fn(e)1328 1651 y Fk(P)1371 1695 y Fh(j)1388 1685 y Fp([)1401 1680 y Fm(W)1434 1685 y Fh(ij)1462 1680 y Fm(\026)1483 1685 y Fh(j)1499 1680 y Fj(+)1531 1667 y Fb(1)p 1532 1673 16 2 v 1532 1693 a(2)1552 1680 y Fj(\(1)p Fi(\000)p Fj(2)p Fm(\030)1645 1685 y Fh(i)1657 1680 y Fj(\))p Fm(W)1709 1669 y Fb(2)1704 1692 y Fh(ij)1731 1680 y Fm(\026)1752 1685 y Fh(j)1769 1680 y Fj(\(1)p Fi(\000)p Fm(\026)1849 1685 y Fh(j)1865 1680 y Fj(\))1879 1684 y Fp(])1895 1645 y Fk(\033)1934 1705 y Fn(:)1863 1807 y Fp(\(32\))0 1867 y(Note)17 b(that)i(the)e(b)q(ound)i(in)f(eq.)f(\(32\))h(do)q(es)h(not)f (hold)g(rigorously)g(for)g(\014nite)f(net)o(w)o(orks;)h(rather,)g(it)f (has)0 1927 y(b)q(een)11 b(deriv)o(ed)e(in)i(the)g(thermo)q(dynamic)d (limit)g(where)j Fn(Q)p Fp(\()p Fn(z)1078 1934 y Fm(i)1092 1927 y Fl(j)p Fn(V)g Fp(\))g(is)f(describ)q(ed)h(b)o(y)f(a)i(normal)e (distribution.)73 1987 y(The)22 b(ob)s(jectiv)o(e)d(function)j(for)f (the)h(mean)e(\014eld)h(appro)o(ximation)g(is)g(the)g(di\013erence)g (of)h(eqs.)e(\(22\))0 2048 y(and)g(\(32\);)h(these)e(expressions)g (corresp)q(ond)h(to)f(the)g(\014rst)h(t)o(w)o(o)f(terms)e(of)j(eq.)e (\(7\).)30 b(The)20 b(di\013erence)e(of)0 2108 y(these)f(t)o(w)o(o)g (equations)h(is)f(in)g(fact)h(the)f(Ly)o(apuno)o(v)h(function,)f Fn(L)p Fp(,)g(from)g(eq.)f(\(14\).)26 b(This)17 b(can)h(b)q(e)f(sho)o (wn)0 2168 y(b)o(y)f(app)q(ealing)h(to)f(the)g(de\014nition)g(of)h Fn(h)733 2175 y Fm(i)763 2168 y Fp(in)f(eq.)f(\(11\))i(and)g(b)o(y)f (noting)g(that)568 2234 y Fk(Z)610 2293 y Fn(\033)r Fp(\()p Fn(h)p Fp(\))8 b Fn(dh)41 b Fp(=)h(ln[1)11 b(+)g Fn(e)1050 2272 y Fm(h)1072 2293 y Fp(])p Fn(;)763 b Fp(\(33\))518 2343 y Fk(Z)560 2402 y Fn(\033)590 2381 y Fi(\000)p Fj(1)637 2402 y Fp(\()p Fn(\026)p Fp(\))8 b Fn(d\026)42 b Fp(=)g Fn(\026)8 b Fp(ln)g Fn(\026)k Fp(+)f(\(1)g Fl(\000)g Fn(\026)p Fp(\))d(ln\(1)k Fl(\000)f Fn(\026)p Fp(\))p Fn(;)431 b Fp(\(34\))p 0 2508 780 2 v 56 2538 a Fg(3)75 2553 y Ff(One)13 b(can)g(also)f(pro)q(ceed)j(without)d(making)e(this)j (assumption,)e(as)i(in)g(Saul)f(et)h(al)f(\(1996\),)g(to)g(deriv)o(e)i (appro)o(ximations)0 2603 y(for)g(non-la)o(y)o(ered)f(net)o(w)o(orks.) 951 2795 y Fp(17)p eop %%Page: 18 18 18 17 bop 0 50 a Fp(where)13 b Fn(\033)168 32 y Fi(\000)p Fj(1)214 50 y Fp(\()p Fn(\026)p Fp(\))h(=)g(ln)396 2 y Fk(h)443 28 y Fm(\026)p 421 38 67 2 v 421 67 a Fj(1)p Fi(\000)p Fm(\026)492 2 y Fk(i)525 50 y Fp(is)e(the)h(in)o(v)o(erse)f (sigmoid)f(function.)20 b(Th)o(us)14 b(w)o(e)e(ha)o(v)o(e)g(deriv)o(ed) g(the)h(Ly)o(apuno)o(v)0 116 y(function)k(b)o(y)g(ev)m(aluating)g(the)g (KL)h(div)o(ergence)d(in)i(eq.)f(\(6\).)24 b(It)17 b(follo)o(ws)g(that) h(the)f(Ly)o(apuno)o(v)g(function)0 176 y(measures)i(the)h(discrepancy) f(b)q(et)o(w)o(een)g(the)g(distributions)h Fn(Q)p Fp(\()p Fn(H)t Fl(j)p Fn(V)11 b Fp(\))20 b(and)h Fn(P)7 b Fp(\()p Fn(H)t Fl(j)p Fn(V)k Fp(\))20 b(in)g(terms)e(of)i(the)0 237 y(mean)15 b(\014eld)h(parameters,)f Fl(f)p Fn(\026)556 244 y Fm(i)570 237 y Fn(;)8 b(\030)613 244 y Fm(i)627 237 y Fl(g)p Fp(.)22 b(Optimal)14 b(v)m(alues)i(for)h(these)f (parameters)f(are)h(found)h(b)o(y)f(minimi)o(z-)0 297 y(ing)e Fn(L)p Fp(;)h(in)f(particular,)g(computing)f(the)i(gradien)o (ts)f Fn(@)s(L=@)s(\026)1107 304 y Fm(i)1135 297 y Fp(and)h Fn(@)s(L=@)s(\030)1364 304 y Fm(i)1393 297 y Fp(and)f(equating)h(them)e (to)h(zero)0 357 y(leads)i(to)h(the)f(mean)f(\014eld)h(equations,)g (eqs.)f(\(8{9\).)0 501 y Fe(Ac)n(kno)n(wledgemen)n(ts)0 594 y Fp(W)l(e)24 b(are)g(grateful)g(to)g(H.)f(Seung)h(for)h(man)o(y)d (useful)i(discussions)g(ab)q(out)h(attractor)g(dynamics)d(and)0 654 y(Ly)o(apuno)o(v)i(functions.)42 b(W)l(e)24 b(also)f(thank)h(Hin)o (ton)f(et)g(al)g(\(1995\))i(for)f(sharing)g(their)f(prepro)q(cessing)0 714 y(soft)o(w)o(are)16 b(for)h(images)e(of)i(handwritten)f(digits.)0 881 y Fq(References)0 1033 y Fp(Ac)o(kley)l(,)h(D.,)i(Hin)o(ton,)g(G.,) g(and)g(Sejno)o(wski,)g(T.)g(1985.)31 b(A)19 b(learning)g(algorithm)f (for)h(Boltzmann)f(ma-)0 1093 y(c)o(hines.)i Fo(Co)n(gnitive)f(Scienc)n (e)f Fa(9)p Fp(,)e(147{169.)0 1196 y(Amit,)e(D.)i(1989.)22 b Fo(Mo)n(deling)c(Br)n(ain)f(F)l(unction)p Fp(.)23 b(Cam)o(bridge)15 b(Univ)o(ersit)o(y)f(Press,)i(Cam)o(bridge.)0 1299 y(Binder,)f(J.,)g (Koller,)g(D.,)g(Russell,)g(S.,)g(and)i(Kanaza)o(w)o(a,)f(K.)g(1997.)22 b(Adaptiv)o(e)15 b(probabilistic)g(net)o(w)o(orks)0 1360 y(with)h(hidden)g(v)m(ariables.)21 b Fo(Machine)d(L)n(e)n(arning)e Fa(29)p Fp(,)g(213{244.)0 1463 y(Bun)o(tine,)22 b(W.)h(1994.)41 b(Op)q(erations)24 b(for)e(learning)h(with)f(graphical)h(mo)q(dels.)39 b Fo(Journal)23 b(of)g(A)o(rti\014cial)0 1523 y(Intel)r(ligenc)o(e)d(R) n(ese)n(ar)n(ch)15 b Fa(2)p Fp(,)h(159-225.)0 1626 y(Cohen,)c(M.)f(and) g(Grossb)q(erg,)j(S.)d(1983.)21 b(Absolute)10 b(stabilit)o(y)g(of)i (global)f(pattern)h(formation)e(and)i(parallel)0 1686 y(memory)g(storage)k(b)o(y)e(comp)q(etitiv)o(e)e(neural)j(net)o(w)o (orks.)20 b Fo(IEEE)c(T)l(r)n(ansactions)g(on)h(Systems,)f(Man,)h(and)0 1746 y(Cyb)n(ernetics)g Fa(13)p Fp(,)f(815{826.)0 1849 y(Co)q(op)q(er,)h(G.)f(1990.)22 b(Computational)16 b(complexit)o(y)c (of)k(probabilistic)f(inference)f(using)i(Ba)o(y)o(esian)f(b)q(elief)0 1910 y(net)o(w)o(orks.)21 b Fo(A)o(rti\014cial)d(Intel)r(ligenc)o(e)h Fa(42)p Fp(,)d(393-405.)0 2013 y(Da)o(y)o(an,)24 b(P)l(.,)f(Hin)o(ton,) f(G.,)h(Neal,)g(R.,)g(and)g(Zemel,)d(R.)i(1995.)41 b(The)22 b(Helmholtz)e(mac)o(hine.)37 b Fo(Neur)n(al)0 2073 y(Computation)16 b Fa(7)p Fp(,)g(889{904.)0 2176 y(F)l(rey)l(,)22 b(B.,)f(Hin)o(ton,)h (G.,)g(and)g(Da)o(y)o(an,)h(P)l(.)e(1996.)39 b(Do)q(es)23 b(the)e(w)o(ak)o(e-sleep)g(algorithm)f(pro)q(duce)i(go)q(o)q(d)0 2236 y(densit)o(y)g(estimators?)40 b(In)23 b(T)l(ouretzky)l(,)g(D.,)h (Mozer,)f(M.,)g(and)h(Hasselmo,)e(M.,)i(eds.)41 b Fo(A)n(dvanc)n(es)24 b(in)0 2296 y(Neur)n(al)18 b(Information)f(Pr)n(o)n(c)n(essing)g (Systems)f Fa(8)p Fp(.)22 b(MIT)15 b(Press,)h(Cam)o(bridge,)f(MA.)0 2399 y(Geman,)27 b(S.,)h(and)f(Geman,)h(D.)e(1984.)52 b(Sto)q(c)o(hastic)27 b(relaxation,)h(Gibbs)e(distributions,)i(and)f (the)0 2460 y(Ba)o(y)o(esian)14 b(restoration)i(of)f(images.)20 b Fo(IEEE)c(T)l(r)n(ansactions)h(on)f(Pattern)h(A)o(nalysis)g(and)f (Machine)h(Intel-)0 2520 y(ligenc)n(e)h Fa(6)p Fp(,)e(721{741.)951 2795 y(18)p eop %%Page: 19 19 19 18 bop 0 50 a Fp(Hin)o(ton,)16 b(G.,)h(Da)o(y)o(an,)g(P)l(.,)f(F)l (rey)l(,)g(B.,)g(and)h(Neal,)f(R.)h(1995.)25 b(The)17 b(w)o(ak)o(e-sleep)f(algorithm)g(for)h(unsup)q(er-)0 110 y(vised)f(neural)g(net)o(w)o(orks.)k Fo(Scienc)n(e)f Fa(268)p Fp(,)c(1158{116)q(1.)0 213 y(Hop\014eld,)i(J.)g(1984.)27 b(Neurons)18 b(with)g(graded)g(resp)q(onses)h(ha)o(v)o(e)d(collectiv)o (e)f(computational)i(prop)q(erties)0 273 y(lik)o(e)e(those)i(of)g(t)o (w)o(o-state)g(neurons.)24 b Fo(Pr)n(o)n(c)n(e)n(e)n(dings)17 b(of)h(the)g(National)h(A)n(c)n(ademy)e(of)h(Scienc)n(es,)i(USA)d Fa(81)p Fp(,)0 333 y(3088{3092.)0 437 y(Hop\014eld,)i(J.,)h(and)g(T)l (ank,)g(D.)g(1986.)32 b(Computing)19 b(with)h(neural)f(circuits:)26 b(a)20 b(mo)q(del.)30 b Fo(Scienc)n(e)21 b Fa(233)p Fp(,)0 497 y(625{633.)0 600 y(Hoskins,)15 b(D.,)g(Hw)o(ang,)h(J.,)f(and)h(V)l (agners,)f(J.)g(1992.)23 b(Iterativ)o(e)14 b(in)o(v)o(ersion)g(of)i (neural)f(net)o(w)o(orks)g(and)h(its)0 660 y(application)g(to)h (adaptiv)o(e)e(con)o(trol,)h Fo(IEEE)h(T)l(r)n(ansactions)h(on)g(Neur)n (al)f(Networks,)i(3)p Fp(,)c(292{301.)0 763 y(Jordan,)21 b(M.,)f(and)g(Rumelhart,)e(D.)i(1992.)33 b(F)l(orw)o(ard)20 b(mo)q(dels:)28 b(Sup)q(ervised)19 b(learning)g(with)h(a)g(distal)0 823 y(teac)o(her.)g Fo(Co)n(gnitive)f(Scienc)n(e)p Fp(,)e Fo(16)p Fp(,)f(307{354.)0 926 y(Ko)q(c)o(h,)i(C.,)f(Marro)q(quin,)h (J.,)g(and)g(Y)l(uille,)e(A.)h(1986.)27 b(Analog)18 b(\\neuronal")h (net)o(w)o(orks)e(in)h(early)f(vision.)0 987 y Fo(Pr)n(o)n(c)n(e)n(e)n (dings)f(of)i(the)g(National)g(A)n(c)n(ademy)f(of)g(Scienc)n(es,)i(USA) e Fa(83)p Fp(,)f(4263{4267)q(.)0 1090 y(Lauritzen,)g(S.)g(1996.)22 b Fo(Gr)n(aphic)n(al)17 b(Mo)n(dels)p Fp(.)k(Oxford)16 b(Univ)o(ersit)o(y)d(Press,)k(Oxford.)0 1193 y(Lewic)o(ki,)e(M.,)g(and) i(Sejno)o(wski,)f(T.)g(1996.)23 b(Ba)o(y)o(esian)16 b(unsup)q(ervised)g (learning)g(of)h(higher)f(order)h(struc-)0 1253 y(ture.)37 b(In)22 b(Mozer,)g(M.,)g(Jordan,)i(M.,)e(and)g(P)o(etsc)o(he,)f(T.,)i (eds.)38 b Fo(A)n(dvanc)n(es)23 b(in)g(Neur)n(al)f(Information)0 1313 y(Pr)n(o)n(c)n(essing)17 b(Systems)g Fa(9)p Fp(.)k(MIT)16 b(Press,)g(Cam)o(bridge,)e(MA.)0 1416 y(Metrop)q(olis,)g(N.,)g(Rosen)o (bluth,)g(A.,)g(Rosen)o(bluth,)g(M.,)f(T)l(eller,)h(A.,)f(and)i(T)l (eller,)e(E.)i(1953.)22 b(Equation)15 b(of)0 1476 y(state)g (calculations)f(for)h(fast)g(computing)f(mac)o(hines.)k Fo(Journal)e(of)g(Chemic)n(al)g(Physics)e Fa(21)p Fp(,)h(1087{1092.)0 1579 y(Neal,)g(R.)h(1992.)22 b(Connectionist)17 b(learning)f(of)g(b)q (elief)f(net)o(w)o(orks.)21 b Fo(A)o(rti\014cial)d(Intel)r(ligen)q(c)n (e)h Fa(56)p Fp(,)d(71{113.)0 1683 y(P)o(arisi,)f(G.)h(1988.)23 b Fo(Statistic)n(al)c(Field)f(The)n(ory)p Fp(.)i(Addison-W)l(esley)l(,) 15 b(Redw)o(o)q(o)q(d)i(Cit)o(y)l(,)e(CA.)0 1786 y(P)o(earl,)24 b(J.)g(1988.)44 b Fo(Pr)n(ob)n(abilistic)25 b(R)n(e)n(asoning)f(in)g (Intel)r(ligent)k(Systems)p Fp(.)43 b(Morgan)25 b(Kaufmann,)f(San)0 1846 y(Mateo,)16 b(CA.)0 1949 y(P)o(eterson,)22 b(C.,)h(and)f (Anderson,)h(J.)e(1987.)39 b(A)21 b(mean)g(\014eld)g(theory)g(learning) h(algorithm)e(for)i(neural)0 2009 y(net)o(w)o(orks.)f Fo(Complex)d(Systems)f Fa(1)p Fp(,)f(995{1019.)0 2112 y(Saul,)g(L.,)g(Jaakk)o(ola,)g(T.,)g(and)h(Jordan,)g(M.)e(1996.)24 b(Mean)16 b(\014eld)g(theory)g(for)g(sigmoid)g(b)q(elief)f(net)o(w)o (orks.)0 2172 y Fo(Journal)i(of)h(A)o(rti\014cial)g(Intel)r(ligenc)o(e) i(R)n(ese)n(ar)n(ch)15 b Fa(4)p Fp(,)h(61{76.)0 2275 y(Seung,)j(H.)f(1995.)30 b(Annealed)18 b(theories)g(of)h(learning.)28 b(In)18 b(Oh,)h(J.-H.,)f(Kw)o(on,)h(C.,)f(and)i(Cho,)f(S.,)f(eds.)0 2336 y Fo(Neur)n(al)23 b(Networks:)35 b(The)24 b(Statistic)n(al)g(Me)n (chanics)f(Persp)n(e)n(ctive,)j(Pr)n(o)n(c)n(e)n(e)n(dings)c(of)h(the)g (CTP-PRSRI)0 2396 y(Joint)17 b(Workshop)g(on)h(The)n(or)n(etic)n(al)f (Physics)p Fp(.)k(W)l(orld)16 b(Scien)o(ti\014c,)e(Singap)q(ore.)0 2499 y(Seung,)e(H.,)g(Ric)o(hardson,)g(T.,)g(Lagarias,)i(J.,)d(and)h (Hop\014eld,)g(J.)f(Minimax)f(and)i(Hamiltonian)e(dynamics)0 2559 y(of)18 b(excitatory-inhibitory)e(net)o(w)o(orks.)25 b(In)17 b(Jordan,)i(M.,)e(Kearns,)g(M.,)g(and)h(Solla,)g(S.,)f(eds.)25 b Fo(A)n(dvanc)n(es)0 2619 y(in)18 b(Neur)n(al)f(Information)h(Pr)n(o)n (c)n(essing)f(Systems)f Fa(10)p Fp(.)21 b(MIT)16 b(Press,)g(Cam)o (bridge,)f(MA.)951 2795 y(19)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF