Tourmaline (original) (raw)
| ID | Species | Reference | Link | Year | Locality | Pressure (GPa) | Temp (K) |
|---|---|---|---|---|---|---|---|
| 0000221 | Fluor-buergerite | Tippe A, Hamilton W C (1971) A neutron-diffraction study of the ferric tourmaline, buergerite American Mineralogist 56 101-113 |  |
1971 | Mexquitic, San Luis Potosi, Mexico | 0 | 293 |
| 0018672 | Fluor-buergerite | Barton R (1969) Refinement of the crystal structure of buergerite and the absolute orientation of tourmalines Acta Crystallographica B25 1524-1533 |  |
1969 | Mexquitic, San Luis Potosi, Mexico | 0 | 293 |
| 0018787 | Fluor-buergerite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Mapimi, Durango, Mexico | 0 | 293 | |
| 0000045 | Dravite | Hamburger G E, Buerger M J (1948) The structure of tourmaline American Mineralogist 33 532-540 | |
1948 | de Kalb, New York, USA | 0 | 293 |
| 0000739 | Dravite | Foit F F, Rosenberg P E (1979) The structure of vanadium-bearing tourmaline and its implications regarding tourmaline solid solutions American Mineralogist 64 788-798 | |
1979 | Silver Knob, Mariposa County, California, USA | 0 | 293 |
| 0001551 | Dravite | Hawthorne F C, MacDonald D J, Burns P C (1993) Reassignment of cation site occupancies in tourmaline: Al-Mg disorder in the crystal structure of dravite American Mineralogist 78 265-270 | |
1993 | Osarar, Narok District, Kenya | 0 | 293 |
| 0002913 | Dravite | Camara F, Ottolini L, Hawthorne F C (2000) Crystal chemistry of three tourmalines by SREF, EMPA and SIMS American Mineralogist 87 1437-1442 | |
2000 | Madagascar | 0 | 293 |
| 0004680 | Dravite | Bosi F (2008) Disordering of Fe2+ over octahedrally coordinated sites of tourmaline American Mineralogist 93 1647-1653 | |
2008 | Uto Island, south of Stockholm, Sweden | 0 | 293 |
| 0018457 | Dravite | Hughes J M, Rakovan J, Ertl A, Rossman G R, Baksheev I, Bernhardt H-J (2011) Dissymmetrization in tourmaline: the atomic arrangement of sectorally zoned triclinic Ni-bearing dravite The Canadian Mineralogist 49 29-40 | 2011 | Berezovskoe gold deposit, Middle Urals, Russia | 0 | 293 | |
| 0019716 | Dravite | Bacik P, Uher P, Ertl A, Jonsson E, Nysten P, Kanicky V, Vaculovic T (2012) Zoned REE-enriched dravite from a granitic pegmatite in Forshammar Bergslagen Province, Sweden: An EMPA, XRD and LA-ICP-MS study The Canadian Mineralogist 50 825-841 | 2012 | Forshammar Bergslagen Province, Sweden | 0 | 293 | |
| 0007038 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Olkhon (Lake Baikal), Siberia | 0 | 293 | |
| 0007039 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Olkhon (Lake Baikal), Siberia | 0 | 293 | |
| 0007040 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Beresov Mine, Siberia | 0 | 293 | |
| 0007041 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Beresov Mine, Siberia | 0 | 293 | |
| 0007042 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Haddam, Connecticut, U.S.A. | 0 | 293 | |
| 0007043 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Haddam, Connecticut, U.S.A. | 0 | 293 | |
| 0007044 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Zillerthal, Tyrol, Austria | 0 | 293 | |
| 0007048 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Arendal, Norway | 0 | 293 | |
| 0007053 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Cruziero, Minas Gerais, Brazil | 0 | 293 | |
| 0007054 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Lake Baikal, Siberia | 0 | 293 | |
| 0007055 | Dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Lake Baikal, Siberia | 0 | 293 | |
| 0007080 | Dravite | Marschall H R, Ertl A, Hughes J M, McCammon C A (2004) Metamorphic Na- and OH-rich disordered dravite with tetrahedral boron, associated with omphacite, from Syros, Greece: chemistry and structure European Journal of Mineralogy 16 817-823 | 2004 | Syros, Greece | 0 | 293 | |
| 0020154 | Dravite | Vereshchagin O S, Rozhdestvenskaya I V, Frank-Kamenetskaya O V, Zolotarev A A (2014) Ion substitutions and structural adjustment in Cr-bearing tourmalines European Journal of Mineralogy 26 309-321 | 2014 | Shabrovskoe ore district, Middle Urals, Russia | 0 | 293 | |
| 0020155 | Dravite | Vereshchagin O S, Rozhdestvenskaya I V, Frank-Kamenetskaya O V, Zolotarev A A (2014) Ion substitutions and structural adjustment in Cr-bearing tourmalines European Journal of Mineralogy 26 309-321 | 2014 | Shabrovskoe ore district, Middle Urals, Russia | 0 | 293 | |
| 0020156 | Dravite | Vereshchagin O S, Rozhdestvenskaya I V, Frank-Kamenetskaya O V, Zolotarev A A (2014) Ion substitutions and structural adjustment in Cr-bearing tourmalines European Journal of Mineralogy 26 309-321 | 2014 | Shabrovskoe ore district, Middle Urals, Russia | 0 | 293 | |
| 0020157 | Dravite | Vereshchagin O S, Rozhdestvenskaya I V, Frank-Kamenetskaya O V, Zolotarev A A (2014) Ion substitutions and structural adjustment in Cr-bearing tourmalines European Journal of Mineralogy 26 309-321 | 2014 | Umba Valley, Tanzania | 0 | 293 | |
| 0019011 | Dravite | Schmetzer K, Nuber B, Abraham K (1979) Zur Kristallchemie Magnesium-reicher Turmaline Neues Jahrbuch fur Mineralogie, Abhandlungen 136 93-112 | 1979 | Gerevi Hills, Tanzania | 0 | 293 | |
| 0018789 | Dravite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Moctezuma, Sonora, Mexico | 0 | 293 | |
| 0018792 | Dravite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Yinnietharra, Western Australia | 0 | 293 | |
| 0003949 | Elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003950 | Elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0019363 | Elbaite | Diego Gatta G, Danisi R M, Adamo I, Meven M, Diella V (2012) A single-crystal neutron and X-ray diffraction study of elbaite Physics and Chemistry of Minerals 39 577-588 | 2012 | pegmatite dikes near Sao Jose da Safira, Minas Gerais, Brazil | 0 | 293 | |
| 0019364 | Elbaite | Diego Gatta G, Danisi R M, Adamo I, Meven M, Diella V (2012) A single-crystal neutron and X-ray diffraction study of elbaite Physics and Chemistry of Minerals 39 577-588 | 2012 | pegmatite dikes near Sao Jose da Safira, Minas Gerais, Brazil | 0 | 293 | |
| 0014789 | Elbaite | Nuber B, Schmetzer K (1984) Structural refinement of tsilaisite (manganese tourmaline) Neues Jahrbuch fur Mineralogie, Monatshefte 1984 301-304 | 1984 | Zambia | 0 | 293 | |
| 0005228 | Feruvite | Grice J D, Robinson G W (1989) Feruvite, a new member of the tourmaline group, and its crystal structure The Canadian Mineralogist 27 199-203 | |
1989 | Cuvier Island, New Zealand | 0 | 293 |
| 0020666 | Feruvite | Gadas P, Novak M, Cempirek J, Filip J, Galiova M V, Groat L A, Vsiansky D (2014) Mineral assemblages, compositional variation, and crystal structure of feruvitic tourmaline from a contaminated anatectic pegmatite at Mirosov near Strazek, Moldanubian zone, Czech Republic The Canadian Mineralogist 52 285-301 | 2014 | Mirosov, Moldanubian zone, Czech Republic | 0 | 293 | |
| 0020667 | Feruvite | Gadas P, Novak M, Cempirek J, Filip J, Galiova M V, Groat L A, Vsiansky D (2014) Mineral assemblages, compositional variation, and crystal structure of feruvitic tourmaline from a contaminated anatectic pegmatite at Mirosov near Strazek, Moldanubian zone, Czech Republic The Canadian Mineralogist 52 285-301 | 2014 | Mirosov, Moldanubian zone, Czech Republic | 0 | 293 | |
| 0018788 | Feruvite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Cuvier Island, New Zealand | 0 | 293 | |
| 0001622 | Foitite | MacDonald D J, Hawthorne F C, Grice J D (1993) Foitite, _[Fe2(Al,Fe)]Al6Si6O18(BO3)3(OH)4, a new alkali-deficient tourmaline: Description and crystal structure American Mineralogist 78 1299-1303 | |
1993 | likely White Queen mine, San Diego County, California, USA | 0 | 293 |
| 0005633 | Foitite | Francis C A, Dyar M D, Williams M L, Hughes J M (1999) The occurrence and crystal structure of foitite from a tungsten-bearing vein at Copper Mountain, Taos County, New Mexico The Canadian Mineralogist 37 1431-1438 | |
1999 | Copper Mountain, Taos County, New Mexico | 0 | 293 |
| 0006843 | Foitite | Kahlenberg V, Velickov B (2000) Structural investigations on a synthetic alkali-free hydrogen-deficient Fe-tourmaline (foitite) Locvality: synthetic European Journal of Mineralogy 12 947-953 | 2000 | 0 | 293 | ||
| 0003156 | Olenite | Ertl A, Hughes J M, Prowatke S, Rossman G R, London D, Fritz E A (2003) Mn-rich tourmaline from Austria: structure, chemistry, optical spectra, and relations to synthetic solid solutions Sample BT American Mineralogist 88 1369-1376 | |
2003 | Eibenstein an der Thaya, Lower Austria | 0 | 293 |
| 0003157 | Olenite | Ertl A, Hughes J M, Prowatke S, Rossman G R, London D, Fritz E A (2003) Mn-rich tourmaline from Austria: structure, chemistry, optical spectra, and relations to synthetic solid solutions Sample P6 American Mineralogist 88 1369-1376 | |
2003 | Eibenstein an der Thaya, Lower Austria | 0 | 293 |
| 0003445 | Olenite | Hughes J M, Ertl A, Dyar M D, Grew E S, Wieden-beck M, Brandstatter F (2004) Structural and chemical response to varying B content in zoned Fe-bearing olenite from Koralpe, Austria American Mineralogist 89 447-454 | |
2004 | Koralpe, Austria | 0 | 293 |
| 0003446 | Olenite | Hughes J M, Ertl A, Dyar M D, Grew E S, Wieden-beck M, Brandstatter F (2004) Structural and chemical response to varying B content in zoned Fe-bearing olenite from Koralpe, Austria American Mineralogist 89 447-454 | |
2004 | Koralpe, Austria | 0 | 293 |
| 0003447 | Olenite | Hughes J M, Ertl A, Dyar M D, Grew E S, Wieden-beck M, Brandstatter F (2004) Structural and chemical response to varying B content in zoned Fe-bearing olenite from Koralpe, Austria American Mineralogist 89 447-454 | |
2004 | Koralpe, Austria | 0 | 293 |
| 0003448 | Olenite | Hughes J M, Ertl A, Dyar M D, Grew E S, Wieden-beck M, Brandstatter F (2004) Structural and chemical response to varying B content in zoned Fe-bearing olenite from Koralpe, Austria American Mineralogist 89 447-454 | |
2004 | Koralpe, Austria | 0 | 293 |
| 0003449 | Olenite | Hughes J M, Ertl A, Dyar M D, Grew E S, Wieden-beck M, Brandstatter F (2004) Structural and chemical response to varying B content in zoned Fe-bearing olenite from Koralpe, Austria American Mineralogist 89 447-454 | |
2004 | Koralpe, Austria | 0 | 293 |
| 0019525 | Olenite | Ertl A, Giester G, Ludwig T, Meyer H P, Rossman G R (2012) Synthetic B-rich olenite: Correlations of single-crystal structural data American Mineralogist 97 1591-1597 | 2012 | synthetic at 600 C | 0 | 293 | |
| 0019526 | Olenite | Ertl A, Giester G, Ludwig T, Meyer H P, Rossman G R (2012) Synthetic B-rich olenite: Correlations of single-crystal structural data American Mineralogist 97 1591-1597 | 2012 | synthetic at 500 C | 0 | 293 | |
| 0019527 | Olenite | Ertl A, Giester G, Ludwig T, Meyer H P, Rossman G R (2012) Synthetic B-rich olenite: Correlations of single-crystal structural data American Mineralogist 97 1591-1597 | 2012 | synthetic at 400 C | 0 | 293 | |
| 0005693 | Olenite | Hughes J M, Ertl A, Dyar M D, Grew E S, Shearer C K, Yates M G, Guidotti C V (2000) Tetrahedrally coordinated boron in a tourmaline: Boron-rich olenite from Stoffhutte, Koralpe, Austria The Canadian Mineralogist 38 861-868 | |
2000 | Stoffhutte, Koralpe, Austria | 0 | 293 |
| 0005892 | Olenite | Ertl A, Hughes J M, Brandstatter F, Dyar M D, Prasad P S R (2003) Disordered Mg-bearing olenite from a granitic pegmatite at Goslarn, Austria: A chemical, structural, and infrared spectroscopic study The Canadian Mineralogist 41 1363-1370 | |
2003 | Goslarn, Austria | 0 | 293 |
| 0005893 | Olenite | Ertl A, Hughes J M, Brandstatter F, Dyar M D, Prasad P S R (2003) Disordered Mg-bearing olenite from a granitic pegmatite at Goslarn, Austria: A chemical, structural, and infrared spectroscopic study The Canadian Mineralogist 41 1363-1370 | |
2003 | Goslarn, Austria | 0 | 293 |
| 0005974 | Olenite | Ertl A, Pertlik F, Dyar M D, Prowatke S, Hughes J M, Ludwig T, Bernhardt H J (2004) Fe-rich olenite with tetrahedrally coordinated Fe3+ from Eibenstein, Austria: Structural, chemical, and Mossbauer data The Canadian Mineralogist 42 1057-1063 | |
2004 | Eibenstein, Austria | 0 | 293 |
| 0006068 | Olenite | Cempirek J, Novak M, Ertl A, Hughes J M, Rossman G R, Dyar D (2006) Fe-bearing olenite with tetrahedrally coordinated Al from an abyssal pegmatite at Kutna Hora, Czech Republic: structure, crystal chemistry, optical and xanes spectra The Canadian Mineralogist 44 23-60 | |
2006 | Kutna Hora, Czech Republic | 0 | 293 |
| 0006942 | Olenite | Marler B, Borowski M, Wodara U, Schreyer W (2002) Synthetic tourmaline (olenite) with excess boron replacing silicon in the tetrahedral site: II. Structure analysis European Journal of Mineralogy 14 763-771 | 2002 | synthetic | 0 | 293 | |
| 0006943 | Olenite | Marler B, Borowski M, Wodara U, Schreyer W (2002) Synthetic tourmaline (olenite) with excess boron replacing silicon in the tetrahedral site: II. Structure analysis European Journal of Mineralogy 14 763-771 | 2002 | synthetic | 0 | 293 | |
| 0006949 | Olenite | Schreyer W, Hughes J M, Bernhardt H J, Kalt A, Prowatke S, Ertl A (2002) Reexamination of olenite from the type locality: detection of boron in tetrahedral coordination European Journal of Mineralogy 14 935-942 | 2002 | Olenii Range, Kola Peninsula, Russia | 0 | 293 | |
| 0007045 | Olenite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Kwale, Mombasa, Kenya | 0 | 293 | |
| 0007046 | Olenite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Cooma, New South Wales, Australia | 0 | 293 | |
| 0007052 | Olenite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Cruziero, Minas Gerais, Brazil | 0 | 293 | |
| 0007078 | Olenite | Ertl A, Schuster R, Prowatke S, Brandstatter F, Ludwig T, Bernhardt H J, Koller F, Hughes J M (2004) Mn-rich tourmaline and fluorapatite in a Variscan pegmatite from Eibenstein an der Thaya, Bohemian massif, Lower Austria European Journal of Mineralogy 16 551-560 | 2004 | Eibenstein an der Thaya, Bohemian massif, Lower Austria | 0 | 293 | |
| 0018673 | Olenite | Ertl A, Pertlik F, Bernhardt H J (1997) Investigations on olenite with exess boron from Koralpe, Styria, Austria Anzeiger der Osterreichische Akademie der Wissenschaften 134 3-10 | 1997 | Koralpe, Styria, Austria | 0 | 293 | |
| 0001555 | Povondraite | Grice J D, Ercit T S, Hawthorne F C (1993) Povondraite, a redefinition of the tourmaline ferridravite American Mineralogist 78 433-436 | |
1993 | San Francisco mine, Villa Tunari, Bolivia | 0 | 293 |
| 0018783 | Povondraite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | San Francisco mine, Villa Tu nari, Bolivia | 0 | 293 | |
| 0001229 | Schorl | Foit F F (1989) Crystal chemistry of alkali-deficient schorl and tourmaline structural relationships American Mineralogist 74 422-431 | |
1989 | Jack Creek deposit, near Basin, Montana, USA | 0 | 293 |
| 0002238 | Schorl | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample 108749 American Mineralogist 84 922-928 | |
1999 | Madagascar | 0 | 293 |
| 0002241 | Schorl | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample HP2-1 American Mineralogist 84 922-928 | |
1999 | Harney Peak Granite, Custer County, South Dakota, USA | 0 | 293 |
| 0002914 | Schorl | Camara F, Ottolini L, Hawthorne F C (2000) Crystal chemistry of three tourmalines by SREF, EMPA and SIMS American Mineralogist 87 1437-1442 | |
2000 | Alto Lighona pegmatite field, Zambezia, Mozambique | 0 | 293 |
| 0003957 | Schorl | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003958 | Schorl | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003959 | Schorl | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0005111 | Schorl | Fortier S, Donnay G (1975) Schorl refinement showing composition dependence of the tourmaline structure The Canadian Mineralogist 13 173-177 | |
1975 | Andreasberg, Harz, Lower Saxony, Germany | 0 | 293 |
| 0007047 | Schorl | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Bovey Tracy, Devonshire, England | 0 | 293 | |
| 0007050 | Schorl | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Cruziero, Minas Gerais, Brazil | 0 | 293 | |
| 0007051 | Schorl | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Cruziero, Minas Gerais, Brazil | 0 | 293 | |
| 0007056 | Schorl | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Lake Baikal, Siberia | 0 | 293 | |
| 0018784 | Schorl | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Silver Crater, Hastings Co., Ontario, Canada | 0 | 293 | |
| 0018786 | Schorl | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Cross Lake, Manitoba, Canada | 0 | 293 | |
| 0002029 | Rossmanite | Selway J B, Novak M, Hawthorne F C, Cerny P, Ottolini L, Kyser T K (1998) Rossmanite, _(LiAl2)Al6(Si6O18)(BO3)3(OH)4, a new alkali-deficient tourmaline: Description and crystal structure American Mineralogist 83 896-900 | |
1998 | Rozna, Moravia, Czech Republic | 0 | 293 |
| 0003738 | Rossmanite | Ertl A, Rossman G R, Hughes J M, Prowatke S, Ludwig T (2005) Mn-bearing "oxy-rossmanite" with tetrahedrally-coordinated Al and B from Austria: Structure, chemistry, and infrared and optical spectroscopic study Reported formula: (Na.46 Ca.01) (Al2.37 Li.33 Mn2+.25 Fe2+.04 Ti4+.01) Al6 (Si5.47 Al.28 B.25) O18 (BO3)3 [(OH)2.85 O.15] [O.86 (OH).10 F.04] Tourmaline American Mineralogist 90 481-487 | |
2005 | Eibenstein an der Thaya, Lower Austria | 0 | 293 |
| 0003739 | Rossmanite | Ertl A, Rossman G R, Hughes J M, Prowatke S, Ludwig T (2005) Mn-bearing "oxy-rossmanite" with tetrahedrally-coordinated Al and B from Austria: Structure, chemistry, and infrared and optical spectroscopic study Reported formula: (Na.46 Ca.01) (Al2.35 Li.32 Mn2+.28 Fe2+.04 Ti4+.01) Al6 (Si5.51 Al.25 B.24) O18 (BO3)3 [(OH)2.80 O.20] [O.86 (OH).10 F.04] Tourmaline American Mineralogist 90 481-487 | |
2005 | Eibenstein an der Thaya, Lower Austria | 0 | 293 |
| 0018865 | Tsilaisite | Bosi F, Skogby H, Agrosi G, Scandale E (2012) Tsilaisite, NaMn3Al6(Si6O18)(BO3)3(OH)3OH, a new mineral species of the tourmaline supergroup from Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy American Mineralogist 97 989-994 | 2012 | Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy | 0 | 293 | |
| 0018866 | Tsilaisite | Bosi F, Skogby H, Agrosi G, Scandale E (2012) Tsilaisite, NaMn3Al6(Si6O18)(BO3)3(OH)3OH, a new mineral species of the tourmaline supergroup from Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy American Mineralogist 97 989-994 | 2012 | Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy | 0 | 293 | |
| 0019820 | Oxy-vanadium-dravite | Bosi F, Reznitskii L, Sklyarov E V (2013) Oxy-vanadium-dravite, NaV3(V4Mg2)(Si6O18)(BO3)3(OH)3O: Crystal structure and redefinition of the "vanadium-dravite" tourmaline American Mineralogist 98 501-505 | 2013 | Sludyanka complex, southern Baikal region, Russia | 0 | 293 | |
| 0002240 | Oxy-dravite | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample LCW2356 American Mineralogist 84 922-928 | |
1999 | Dunton mine, Newry, Oxford County, Maine, USA | 0 | 293 |
| 0002245 | Oxy-dravite | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample Ru-T18-92 American Mineralogist 84 922-928 | |
1999 | Rumford, Oxford County, Maine, USA | 0 | 293 |
| 0020259 | Oxy-dravite | Bosi F, Skogby H (2013) Oxy-dravite, Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O, a new mineral species of the tourmaline supergroup American Mineralogist 98 1442-1448 | 2013 | Osarara, Narok district, Kenya | 0 | 293 | |
| 0020483 | Oxy-dravite | Gatta G D, Bosi F, McIntyre G J, Skogby H (2014) First accurate location of two proton sites in tourmaline: A single-crystal neutron diffraction study of oxy-dravite Mineralogical Magazine 78 681-692 | 2014 | Osarara, Narok District, Kenya | 0 | 293 | |
| 0020484 | Oxy-dravite | Gatta G D, Bosi F, McIntyre G J, Skogby H (2014) First accurate location of two proton sites in tourmaline: A single-crystal neutron diffraction study of oxy-dravite Mineralogical Magazine 78 681-692 | 2014 | Osarara, Narok District, Kenya | 0 | 293 | |
| 0002239 | Fluor-schorl | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample DLux1 American Mineralogist 84 922-928 | |
1999 | Sebago Granite, North Windham, Oxford County, Maine, USA | 0 | 293 |
| 0002243 | Fluor-schorl | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample SmFalls American Mineralogist 84 922-928 | |
1999 | Small Falls pegmatite, Rumford, Oxford County, Maine, USA | 0 | 293 |
| 0007165 | Fluor-schorl | Ertl A, Kolitsch U, Prowatke S, Dyar M D, Henry D J (2006) The F-analogue of schorl from Grasstein, Trentino - South Tyrol, Italy: crystal structure and chemistry European Journal of Mineralogy 18 583-588 | 2006 | pegmatite at Grasstein, Trentino-South Tyrol, Italy | 0 | 293 | |
| 0007165 | Fluor-schorl | Ertl A, Kolitsch U, Prowatke S, Dyar M D, Henry D J (2006) The F-analogue of schorl from Grasstein, Trentino - South Tyrol, Italy: crystal structure and chemistry European Journal of Mineralogy 18 583-588 | 2006 | pegmatite at Grasstein, Trentino-South Tyrol, Italy | 0 | 293 | |
| 0003941 | Fluor-elbaite | Bosi F, Agrosi G, Lucchesi S, Melchiorre G, Scandale E (2005) Mn-tourmaline from island of Elba (Italy): Crystal chemistry. American Mineralogist 90 1661-1668 | |
2005 | Elba, Italy | 0 | 293 |
| 0003942 | Fluor-elbaite | Bosi F, Agrosi G, Lucchesi S, Melchiorre G, Scandale E (2005) Mn-tourmaline from island of Elba (Italy): Crystal chemistry. American Mineralogist 90 1661-1668 | |
2005 | Elba, Italy | 0 | 293 |
| 0003943 | Fluor-elbaite | Bosi F, Agrosi G, Lucchesi S, Melchiorre G, Scandale E (2005) Mn-tourmaline from island of Elba (Italy): Crystal chemistry. American Mineralogist 90 1661-1668 | |
2005 | Elba, Italy | 0 | 293 |
| 0003944 | Fluor-elbaite | Bosi F, Agrosi G, Lucchesi S, Melchiorre G, Scandale E (2005) Mn-tourmaline from island of Elba (Italy): Crystal chemistry. American Mineralogist 90 1661-1668 | |
2005 | Elba, Italy | 0 | 293 |
| 0003945 | Fluor-elbaite | Bosi F, Agrosi G, Lucchesi S, Melchiorre G, Scandale E (2005) Mn-tourmaline from island of Elba (Italy): Crystal chemistry. American Mineralogist 90 1661-1668 | |
2005 | Elba, Italy | 0 | 293 |
| 0003946 | Fluor-elbaite | Bosi F, Agrosi G, Lucchesi S, Melchiorre G, Scandale E (2005) Mn-tourmaline from island of Elba (Italy): Crystal chemistry. American Mineralogist 90 1661-1668 | |
2005 | Elba, Italy | 0 | 293 |
| 0003947 | Fluor-elbaite | Bosi F, Agrosi G, Lucchesi S, Melchiorre G, Scandale E (2005) Mn-tourmaline from island of Elba (Italy): Crystal chemistry. American Mineralogist 90 1661-1668 | |
2005 | Elba, Italy | 0 | 293 |
| 0003951 | Fluor-elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003952 | Fluor-elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003953 | Fluor-elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003954 | Fluor-elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003955 | Fluor-elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003956 | Fluor-elbaite | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0019775 | Fluor-elbaite | Bosi F, Andreozzi G B, Skogby H, Lussier A J, Abdu Y, Hawthorne F C (2013) Fluor-elbaite, Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F, a new mineral species of the tourmaline supergroup American Mineralogist 98 297-303 | 2013 | Urubu mine, Minas Gerais, Brazil | 0 | 293 | |
| 0019776 | Fluor-elbaite | Bosi F, Andreozzi G B, Skogby H, Lussier A J, Abdu Y, Hawthorne F C (2013) Fluor-elbaite, Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F, a new mineral species of the tourmaline supergroup American Mineralogist 98 297-303 | 2013 | Urubu mine, Minas Gerais, Brazil | 0 | 293 | |
| 0019777 | Fluor-elbaite | Bosi F, Andreozzi G B, Skogby H, Lussier A J, Abdu Y, Hawthorne F C (2013) Fluor-elbaite, Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F, a new mineral species of the tourmaline supergroup American Mineralogist 98 297-303 | 2013 | Cruzeiro mine, Minas Gerais, Brazil | 0 | 293 | |
| 0019778 | Fluor-elbaite | Bosi F, Andreozzi G B, Skogby H, Lussier A J, Abdu Y, Hawthorne F C (2013) Fluor-elbaite, Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F, a new mineral species of the tourmaline supergroup American Mineralogist 98 297-303 | 2013 | Cruzeiro mine, Minas Gerais, Brazil | 0 | 293 | |
| 0005345 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Nepal | 0 | 293 |
| 0005346 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Nepal | 0 | 293 |
| 0005347 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Nepal | 0 | 293 |
| 0005348 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Nepal | 0 | 293 |
| 0005349 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005350 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005351 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005352 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005353 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005354 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005355 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005356 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005357 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005358 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | Zambia | 0 | 293 |
| 0005359 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | San Diego mine | 0 | 293 |
| 0005360 | Fluor-elbaite | Burns P C, MacDonald D J, Hawthorne F C (1994) The crystal chemistry of manganese-bearing elbaite The Canadian Mineralogist 32 31-41 | |
1994 | San Diego mine | 0 | 293 |
| 0018794 | Fluor-elbaite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Minas Gerais, Brazil | 0 | 293 | |
| 0020261 | Chromo-alumino-povondraite | Bosi F, Skogby H, Halenius U, Reznitskii L (2013) Crystallographic and spectroscopic characterization of Fe-bearing chromo-alumino-povondraite and its relations with oxy-chromium-dravite and oxy-dravite American Mineralogist 98 1557-1564 | 2013 | Sludyanka crystalline complex, Lake Baikal, Russia | 0 | 293 | |
| 0020335 | Chromo-alumino-povondraite | Reznitskii L, Clark C M, Hawthorne F C, Grice J D, Skogby H, Halenius U, Bosi F (2014) Chromo-alumino-povondraite, NaCr3(Al4Mg2)(Si6O18)(BO3)3(OH)3O, a new mineral species of the tourmaline supergroup American Mineralogist 99 1767-1773 | 2014 | Sludyanka, Lake Baikal, Russia | 0 | 293 | |
| 0002246 | Fluor-dravite | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample #32008 American Mineralogist 84 922-928 | |
1999 | Tait farm, Dungannon Township, Hastings County, Ontario, Canada | 0 | 293 |
| 0002915 | Fluor-dravite | Camara F, Ottolini L, Hawthorne F C (2000) Crystal chemistry of three tourmalines by SREF, EMPA and SIMS American Mineralogist 87 1437-1442 | |
2000 | a pegmatite at Minas Gerais, Brazil | 0 | 293 |
| 0018741 | Fluor-dravite | Clark C M, Hawthorne F C, Ottolini L (2011) Fluor-dravite, NaMg3Al6Si6O18(BO3)3(OH)3F, a new mineral species of the tourmaline group from the Crabtree Emerald mine, Mitchell County, North Carolina: Description and crystal structure The Canadian Mineralogist 49 57-62 | 2011 | the Crabtree Emerald mine, Mitchell County, North Carolina, USA | 0 | 293 | |
| 0007049 | Fluor-dravite | Bosi F, Lucchesi S (2004) Crystal chemistry of the schorl-dravite series European Journal of Mineralogy 16 335-344 | 2004 | Olkhon (Lake Baikal), Siberia | 0 | 293 | |
| 0018790 | Fluor-dravite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Bronson Station, Hastings Co., Ontario, Canada | 0 | 293 | |
| 0018791 | Fluor-dravite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Pierrepont, St, Lawrence Co., New York, USA | 0 | 293 | |
| 0002242 | Oxy-schorl | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample O-T16-92 American Mineralogist 84 922-928 | |
1999 | Bald Mountain, Rangeley, Oxford County, Maine | 0 | 293 |
| 0002244 | Oxy-schorl | Bloodaxe E S, Hughes J M, Dyar M D, Grew E S, Guidotti C V (1999) Linking structure and chemistry in the schorl-dravite series Sample Ru-T17-92 American Mineralogist 84 922-928 | |
1999 | Noisy Brook gneiss, Roxbury, Oxford County, Maine, USA | 0 | 293 |
| 0003960 | Oxy-schorl | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0003961 | Oxy-schorl | Bosi F, Andreozzi G B, Federico M, Graziani G, Lucchesi S (2005) Crystal chemistry of the elbaite-schorl series American Mineralogist 90 1784-1792 | |
2005 | Cruziero pegmatite, Minas Gerais, Brazil | 0 | 293 |
| 0018406 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018407 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018408 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018409 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018410 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018411 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018412 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018413 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018414 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018415 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018416 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018417 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018418 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018419 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018420 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018421 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018422 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018423 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018424 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018425 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018426 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018427 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018428 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018429 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018430 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018431 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018432 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018433 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018434 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018435 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018436 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018437 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018438 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018439 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018440 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018441 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018442 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018443 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018444 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018445 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018446 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018447 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018448 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018449 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018450 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0018451 | Fluor-liddicoatite | Lussier A J, Abdu Y, Hawthorne F C, Michaelis V K, Aguiar P M, Kroeker S (2011) Oscillatory zoned liddicoatite from Anjanabonoina, central Madigascar. I. Crystal chemistry and structure by SREF and 11B and 27Al MAS NMR spectroscopy The Canadian Mineralogist 49 63-88 | 2011 | Anjanabonoina, central Madagascar | 0 | 293 | |
| 0006766 | Fluor-liddicoatite | Aurisicchio C, Demartin F, Ottolini L, Pezzotta F (1999) Homogeneous liddicoatite from Madagascar: a possible reference material? First EMPA, SIMS and SREF data European Journal of Mineralogy 11 237-242 | 1999 | Madagascar | 0 | 293 | |
| 0006767 | Fluor-liddicoatite | Aurisicchio C, Demartin F, Ottolini L, Pezzotta F (1999) Homogeneous liddicoatite from Madagascar: a possible reference material? First EMPA, SIMS and SREF data European Journal of Mineralogy 11 237-242 | 1999 | Madagascar | 0 | 293 | |
| 0019734 | Oxy-chromium-dravite | Bosi F, Reznitskii L, Skogby H (2012) Oxy-chromium-dravite, NaCr3(Cr4Mg2)(Si6O18)(BO3)3(OH)3O, a new mineral species of the tourmaline supergroup American Mineralogist 97 2024-2030 | 2012 | Pereval marble quarry, Sludyanka, Lake Baikal, Russia | 0 | 293 | |
| 0020016 | Darrellhenryite | Novak M, Ertl A, Povondra P, Galiova M V, Rossman G R, Pristacz H, Prem M, Giester G, Gadas P, Skoda R (2013) Darrellhenryite, Na(LiAl2)Al6(BO3)3Si6O18(OH)3O, a new mineral from the tourmaline supergroup American Mineralogist 98 1886-1892 | 2013 | Nova Ves near Cesky Krumlov, southern Bohemia, Moldanubian Zone, Czech Republic | 0 | 293 | |
| 0020623 | Fluor-tsilaisite | Bosi F, Andreozzi G B, Agrosi G, Scandale E (2015) Fluor-tsilaisite, NaMn3Al6(Si6O18)(BO3)3(OH)3F, a new tourmaline from San Piero in Campo (Elba, Italy) and new data on tsilaisitic tourmaline from the holotype specimen locality Mineralogical Magazine 79 89-101 | 2015 | Grotta d'Oggi, San Piero in Campo, Elba Island, Italy | 0 | 293 | |
| 0020624 | Fluor-tsilaisite | Bosi F, Andreozzi G B, Agrosi G, Scandale E (2015) Fluor-tsilaisite, NaMn3Al6(Si6O18)(BO3)3(OH)3F, a new tourmaline from San Piero in Campo (Elba, Italy) and new data on tsilaisitic tourmaline from the holotype specimen locality Mineralogical Magazine 79 89-101 | 2015 | Grotta d'Oggi, San Piero in Campo, Elba Island, Italy | 0 | 293 | |
| 0005436 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005437 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005438 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005439 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005440 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005441 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005442 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005443 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0005444 | Fluor-uvite | MacDonald D J, Hawthorne F C (1995) The crystal chemistry of Si=Al substitution in tourmaline The Canadian Mineralogist 33 849-858 | |
1995 | East Africa | 0 | 293 |
| 0018793 | Fluor-uvite | Grice J D, Ercit T S (1993) Ordering of Fe and Mg in the tourmaline crystal structure: The correct formula Neues Jahrbuch fur Mineralogie, Abhandlungen 165 245-266 | 1993 | Gouverneur, St. Lawrence Co., New York, USA | 0 | 293 | |
| 0020018 | Vanadio-oxy-dravite | Bosi F, Skogby H, Reznitskii L, Halenius U (2014) Vanadio-oxy-dravite, NaV3(Al4Mg2)(Si6O18)(BO3)3(OH)3O, a new mineral species of the tourmaline supergroup American Mineralogist 99 218-224 | 2014 | Sludyanka, Lake Baikal, Russia | 0 | 293 | |
| 0020449 | Adachiite | Nishio-Hamane D, Minakawa T, Yamaura J, Oyama T, Ohnishi M, Shimobayashi N (2014) Adachiite, a Si-poor member of the tourmaline supergroup from the Kiura mine, Oita Prefecture, Japan Journal of Mineralogical and Petrological Sciences 109 74-78 | 2014 | Kiura mine, Saiki City, Oita Prefecture, Japan | 0 | 293 |
CIF Raw Data - click here to close