| dbo:abstract |
Brilacidin (formerly PMX-30063), an investigational new drug (IND), is a polymer-based antibiotic currently in human clinical trials, and represents a new class of antibiotics called host defense protein mimetics, or HDP-mimetics, which are non-peptide synthetic small molecules modeled after host defense peptides (HDPs). HDPs, also called antimicrobial peptides, some of which are defensins, are part of the innate immune response and are common to most higher forms of life. As brilacidin is modeled after a defensin, it is also called a defensin mimetic. Brilacidin is an antibiotic that works by disrupting bacterial cell membranes, mimicking defensins that play a role in innate immunity. Several mimics of antimicrobial peptides, both peptides and non-peptides, have been studied, but none have overcome difficulties to reach the market. (en) |
| dbo:alternativeName |
None as of July 2012 (en) |
| dbo:casNumber |
1224095-98-0 |
| dbo:chEMBL |
2219413 |
| dbo:fdaUniiCode |
I1679X069H |
| dbo:kegg |
D10414 |
| dbo:pubchem |
25023695 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Brilacidin.svg?width=300 |
| dbo:wikiPageExternalLink |
http://globenewswire.com/news-release/2012/06/12/479275/259063/en/PolyMedix-Receives-USAN-Approval-for-Generic-Name-of-Brilacidin-for-PMX-30063.html%7Caccess-date=2013-09-19%7Cdate=June https://web.archive.org/web/20150426065637/http:/eccmid.meetingexpert.net/ECCMID_546/StaticContainer/Welcome |
| dbo:wikiPageID |
40308088 (xsd:integer) |
| dbo:wikiPageLength |
27001 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1084693494 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Candida_(fungus) dbr:Methicillin-resistant_Staphylococcus_aureus dbr:Antibiotic dbr:Antimicrobial_peptides dbr:Antimicrobial_resistance dbr:Peptide dbr:In_vitro dbr:Innate_immune_system dbr:Intravenous_therapy dbc:Antibiotics dbc:Experimental_drugs dbc:Guanidines dbc:Pyrrolidines dbc:Trifluoromethyl_compounds dbr:Pseudomonas_aeruginosa dbr:Gram_positive dbr:Amphiphilic dbr:Clinical_trial dbr:Head_and_neck_cancer dbr:Amide dbr:Daptomycin dbr:Escherichia_coli dbr:FDA dbr:Food_and_Drug_Administration_Safety_and_Innovation_Act dbr:Broad-spectrum_antibiotic dbr:Cell_membrane dbr:Foldamer dbr:Defensin_mimetic dbr:Defensins dbc:Pyrimidines dbr:Acinetobacter_baumannii dbr:Staphylococcus_Aureus dbr:Aryl dbr:Polymer dbr:Antibiotic_resistance dbr:Antimicrobials dbr:Klebsiella_pneumoniae dbr:Investigational_new_drug dbr:Host_defense_peptides dbr:Gram_negative dbr:Chemoradiation dbr:Super_bug_(bacteria) dbr:ABSSSI dbr:Intent-to-treat dbr:Stalking_horse_bid |
| dbp:atcPrefix |
none (en) |
| dbp:c |
40 (xsd:integer) |
| dbp:casNumber |
1224095 (xsd:integer) |
| dbp:chembl |
2219413 (xsd:integer) |
| dbp:chemspiderid |
28651526 (xsd:integer) |
| dbp:f |
6 (xsd:integer) |
| dbp:h |
50 (xsd:integer) |
| dbp:iupacName |
N,N'-bis[3-{[5-pentanoyl]amino}-2-[-pyrrolidin-3-yloxy]-5-phenyl]pyrimidine-4,6-dicarboxamide (en) |
| dbp:kegg |
D10414 (en) |
| dbp:n |
14 (xsd:integer) |
| dbp:o |
6 (xsd:integer) |
| dbp:pubchem |
25023695 (xsd:integer) |
| dbp:smiles |
C1CNC[C@@H]1OC2=CNCCCCCNCN (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
QPDYBCZNGUJZDK-DNQXCXABSA-N (en) |
| dbp:tradename |
None as of July 2012 (en) |
| dbp:unii |
I1679X069H (en) |
| dbp:width |
300 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Cite_web dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Fdacite dbt:Antibiotics |
| dcterms:subject |
dbc:Antibiotics dbc:Experimental_drugs dbc:Guanidines dbc:Pyrrolidines dbc:Trifluoromethyl_compounds dbc:Pyrimidines |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatAntibiotics yago:Agent114778436 yago:Antibacterial102716205 yago:Antibiotic102716866 yago:CausalAgent100007347 yago:Drug103247620 yago:Matter100020827 yago:Medicine103740161 yago:PhysicalEntity100001930 dbo:Drug yago:Substance100020090 |
| rdfs:comment |
Brilacidin (formerly PMX-30063), an investigational new drug (IND), is a polymer-based antibiotic currently in human clinical trials, and represents a new class of antibiotics called host defense protein mimetics, or HDP-mimetics, which are non-peptide synthetic small molecules modeled after host defense peptides (HDPs). HDPs, also called antimicrobial peptides, some of which are defensins, are part of the innate immune response and are common to most higher forms of life. As brilacidin is modeled after a defensin, it is also called a defensin mimetic. (en) |
| rdfs:label |
Brilacidin (en) |
| owl:sameAs |
freebase:Brilacidin yago-res:Brilacidin wikidata:Brilacidin dbpedia-sh:Brilacidin dbpedia-sr:Brilacidin https://global.dbpedia.org/id/XzpK |
| prov:wasDerivedFrom |
wikipedia-en:Brilacidin?oldid=1084693494&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Brilacidin.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Brilacidin |
| is dbo:wikiPageRedirects of |
dbr:C40H50F6N14O6 dbr:HDP_mimetic dbr:Host_defense_peptide_mimetic dbr:PMX-30063 |
| is dbo:wikiPageWikiLink of |
dbr:Defensin dbr:Antibiotic dbr:C40H50F6N14O6 dbr:Foldamer dbr:HDP_mimetic dbr:Host_defense_peptide_mimetic dbr:PMX-30063 |
| is foaf:primaryTopic of |
wikipedia-en:Brilacidin |
