| dbo:abstract |
Chloroethynylnorgestrel (developmental code name WY-4355) is a steroidal progestin of the 19-nortestosterone group related to norgestrel that was investigated as an oral contraceptive in the 1970s but was never marketed. In combination with mestranol, similarly to ethynerone and anagestone acetate (and certain other progestogens, including progesterone and several other 17α-hydroxyprogesterone derivatives), chloroethynylnorgestrel was found to produce striking mammary tumors in beagle dogs after administration at very high dosages (10- to 25-fold human clinical dosages) for prolonged periods of time. This resulted in the discontinuation of its development, along with that of ethynerone and anagestone acetate, as well as the removal of several progestins, including chlormadinone acetate, medroxyprogesterone acetate, and megestrol acetate, from various markets as contraceptives (although medroxyprogesterone acetate has since been reintroduced). Subsequent research revealed that the risk is species-dependent and unique to canines and that there is no similar risk for humans. (en) |
| dbo:casNumber |
2415-28-3 |
| dbo:fdaUniiCode |
Q2YY22B0SV |
| dbo:pubchem |
22790422 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Chloroethynyl_norgestrel.svg?width=300 |
| dbo:wikiPageID |
51101071 (xsd:integer) |
| dbo:wikiPageLength |
5784 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1084541710 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Progesterone dbr:Progestin dbr:Progestogen dbr:Beagle dbc:Abandoned_drugs dbc:Estranes dbc:Organochlorides dbc:Progestogens dbr:Anagestone_acetate dbr:Medroxyprogesterone_acetate dbr:Megestrol_acetate dbr:Oral_contraceptive dbr:Steroid dbr:Ethynerone dbr:File:Progestin-induced_tumors_in_beagle_dogs.png dbr:Norgestrel dbr:Chlormadinone_acetate dbr:Dog dbr:Mestranol dbr:Mammary_tumor dbr:19-nortestosterone dbr:17α-hydroxyprogesterone |
| dbp:c |
21 (xsd:integer) |
| dbp:casNumber |
2415 (xsd:integer) |
| dbp:chemspiderid |
18503812 (xsd:integer) |
| dbp:cl |
1 (xsd:integer) |
| dbp:h |
27 (xsd:integer) |
| dbp:iupacName |
-14 (xsd:integer) |
| dbp:o |
2 (xsd:integer) |
| dbp:pubchem |
22790422 (xsd:integer) |
| dbp:smiles |
CC[C@]12CC[C@H]3[C@H]CCC4=CCCC[C@H]34 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
MISOWVVRHHLGIK-ZUHHCLADSA-N (en) |
| dbp:synonyms |
Chloroethynyl norgestrel; WY-4355; 17α-Chloroethynyl-13β-ethylgon-4-en-17β-ol-3-one; 17α-Chloroethynyl-18-methylestr-4-en-17β-ol-3-one; 17α-Chloroethynyl-18-methyl-19-nortestosterone (en) |
| dbp:unii |
Q2YY22B0SV (en) |
| dbp:wikiPageUsesTemplate |
dbt:Clear dbt:Drugbox dbt:Genito-urinary-drug-stub dbt:Progesterone_receptor_modulators dbt:Reflist dbt:Short_description dbt:Steroid-stub dbt:Fdacite |
| dcterms:subject |
dbc:Abandoned_drugs dbc:Estranes dbc:Organochlorides dbc:Progestogens |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
Chloroethynylnorgestrel (developmental code name WY-4355) is a steroidal progestin of the 19-nortestosterone group related to norgestrel that was investigated as an oral contraceptive in the 1970s but was never marketed. (en) |
| rdfs:label |
Chloroethynylnorgestrel (en) |
| owl:sameAs |
wikidata:Chloroethynylnorgestrel https://global.dbpedia.org/id/2Wbpo |
| prov:wasDerivedFrom |
wikipedia-en:Chloroethynylnorgestrel?oldid=1084541710&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Chloroethynyl_norgestrel.svg wiki-commons:Special:FilePath/Progestin-induced_tumors_in_beagle_dogs.png |
| foaf:isPrimaryTopicOf |
wikipedia-en:Chloroethynylnorgestrel |
| is dbo:wikiPageRedirects of |
dbr:Chloroethynyl_norgestrel dbr:C21H27ClO2 dbr:Chloro-ethynyl-norgestrel dbr:Chloro-ethynyl_norgestrel dbr:Chloro-ethynylnorgestrel dbr:Chloroethinyl_norgestrel dbr:Chloroethinylnorgestrel dbr:Chloroethynyl-norgestrel dbr:WY-4355 dbr:WY4355 dbr:WY_4355 dbr:Wy-4355 dbr:Wy4355 dbr:Wy_4355 |
| is dbo:wikiPageWikiLink of |
dbr:Chloroethynyl_norgestrel dbr:C21H27ClO2 dbr:Ethynerone dbr:Chlormadinone_acetate dbr:Chloro-ethynyl-norgestrel dbr:Chloro-ethynyl_norgestrel dbr:Chloro-ethynylnorgestrel dbr:Chloroethinyl_norgestrel dbr:Chloroethinylnorgestrel dbr:Chloroethynyl-norgestrel dbr:WY-4355 dbr:WY4355 dbr:WY_4355 dbr:Wy-4355 dbr:Wy4355 dbr:Wy_4355 |
| is foaf:primaryTopic of |
wikipedia-en:Chloroethynylnorgestrel |
