dbo:abstract |
Desmethoxyfallypride is a moderate affinity dopamine D2 receptor/D3 receptor antagonist used in medical research, usually in the form of the radiopharmaceuticals desmethoxyfallypride or DMFP(18F) and has been used in human studies as a positron emission tomography (PET) radiotracer. (en) |
dbo:casNumber |
166173-81-5 |
dbo:chEMBL |
428561 |
dbo:fdaUniiCode |
CJD4EF9EME |
dbo:pubchem |
10404663 |
dbo:thumbnail |
wiki-commons:Special:FilePath/Desmethoxyfallypride_18F.svg?width=300 |
dbo:wikiPageExternalLink |
http://www.chemspider.com/Chemical-Structure.7822378.html |
dbo:wikiPageID |
43047182 (xsd:integer) |
dbo:wikiPageLength |
3544 (xsd:nonNegativeInteger) |
dbo:wikiPageRevisionID |
1082745154 (xsd:integer) |
dbo:wikiPageWikiLink |
dbc:Allyl_compounds dbc:Organofluorides dbc:Pyrrolidines dbr:Receptor_antagonist dbc:Radiopharmaceuticals dbc:D2_antagonists dbc:Salicylamide_ethers dbr:Fluorine-18 dbc:Typical_antipsychotics dbr:Dopamine_D2_receptor dbr:Positron_emission_tomography dbr:Radiopharmaceuticals dbr:Radiotracer dbr:(2S)-1-prop-2-enylpyrrolidin-2-yl]methyl]benzamide |
dbp:alt |
Chemical structure of Desmethoxyfallypride (en) |
dbp:atcPrefix |
none (en) |
dbp:c |
19 (xsd:integer) |
dbp:casNumber |
166173 (xsd:integer) |
dbp:chembl |
428561 (xsd:integer) |
dbp:chemspiderid |
8580101 (xsd:integer) |
dbp:drugName |
Desmethoxyfallypride (en) |
dbp:f |
1 (xsd:integer) |
dbp:h |
27 (xsd:integer) |
dbp:iupacName |
5 (xsd:integer) |
dbp:n |
2 (xsd:integer) |
dbp:o |
2 (xsd:integer) |
dbp:pubchem |
10404663 (xsd:integer) |
dbp:smiles |
COC1=CCNC[C@@H]2CCCN2CC=C (en) |
dbp:stdinchi |
1 (xsd:integer) |
dbp:stdinchikey |
VPBJNBUDASILSQ-INIZCTEOSA-N (en) |
dbp:synonyms |
DMFP (en) |
dbp:unii |
CJD4EF9EME (en) |
dbp:width |
240 (xsd:integer) |
dbp:wikiPageUsesTemplate |
dbt:Dopaminergics dbt:Infobox_drug dbt:Reflist |
dct:subject |
dbc:Allyl_compounds dbc:Organofluorides dbc:Pyrrolidines dbc:Radiopharmaceuticals dbc:D2_antagonists dbc:Salicylamide_ethers dbc:Typical_antipsychotics |
gold:hypernym |
dbr:Antagonist |
rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
rdfs:comment |
Desmethoxyfallypride is a moderate affinity dopamine D2 receptor/D3 receptor antagonist used in medical research, usually in the form of the radiopharmaceuticals desmethoxyfallypride or DMFP(18F) and has been used in human studies as a positron emission tomography (PET) radiotracer. (en) |
rdfs:label |
Desmethoxyfallypride (en) |
owl:sameAs |
freebase:Desmethoxyfallypride yago-res:Desmethoxyfallypride wikidata:Desmethoxyfallypride https://global.dbpedia.org/id/m3Nj |
prov:wasDerivedFrom |
wikipedia-en:Desmethoxyfallypride?oldid=1082745154&ns=0 |
foaf:depiction |
wiki-commons:Special:FilePath/Desmethoxyfallypride_18F.svg |
foaf:isPrimaryTopicOf |
wikipedia-en:Desmethoxyfallypride |
foaf:name |
Desmethoxyfallypride (18F) (en) |
is dbo:wikiPageRedirects of |
dbr:C19H27FN2O2 dbr:DMFP |
is dbo:wikiPageWikiLink of |
dbr:Dopamine_receptor_D2 dbr:Brain_positron_emission_tomography dbr:C19H27FN2O2 dbr:List_of_PET_radiotracers dbr:Positron_emission_tomography dbr:DMFP |
is foaf:primaryTopic of |
wikipedia-en:Desmethoxyfallypride |