Faxeladol (original) (raw)
Faxeladol (INN, USAN) (code names GRTA-9906, GRTA-0009906, EM-906, GCR-9905, GRT-TA300) is an opioid analgesic which was developed by Grünenthal GmbH but was never marketed for medical use anywhere in the world. It is related to tramadol and ciramadol, and was developed shortly after tramadol in the late 1970s. Similarly to tramadol, it was believed faxeladol would have analgesic, as well as antidepressant effects, due to its action on serotonin and norepinephrine reuptake. In various studies in the 1970s alongside tramadol, faxeladol was seen to be slightly more potent than tramadol, but with a higher rate of sudden seizures than tramadol, which is known to cause seizures without warning in some users.
.png?width=300)
| Property | Value |
|---|---|
| dbo:abstract | Faxeladol (INN, USAN) (code names GRTA-9906, GRTA-0009906, EM-906, GCR-9905, GRT-TA300) is an opioid analgesic which was developed by Grünenthal GmbH but was never marketed for medical use anywhere in the world. It is related to tramadol and ciramadol, and was developed shortly after tramadol in the late 1970s. Similarly to tramadol, it was believed faxeladol would have analgesic, as well as antidepressant effects, due to its action on serotonin and norepinephrine reuptake. In various studies in the 1970s alongside tramadol, faxeladol was seen to be slightly more potent than tramadol, but with a higher rate of sudden seizures than tramadol, which is known to cause seizures without warning in some users. (en) |
| dbo:casNumber | 433265-65-7 |
| dbo:fdaUniiCode | C04V6SGK8H |
| dbo:kegg | D10007 |
| dbo:pubchem | 9813414 |
| dbo:thumbnail | wiki-commons:Special:FilePath/Faxeladol_Structural_Formulae_(1R,2R).png?width=300 |
| dbo:wikiPageID | 13660108 (xsd:integer) |
| dbo:wikiPageLength | 2631 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID | 1082990447 (xsd:integer) |
| dbo:wikiPageWikiLink | dbr:Profadol dbc:Analgesics dbc:Phenols dbr:Ciramadol dbr:Bromadol dbr:Antidepressant dbr:Tramadol dbr:Analgesic dbr:Norepinephrine dbc:Synthetic_opioids dbr:International_Nonproprietary_Name dbr:Tapentadol dbr:Grünenthal_GmbH dbr:Opioid dbr:Seizure dbr:Serotonin dbr:United_States_Adopted_Name dbr:Reuptake dbr:Thiobromadol |
| dbp:atcPrefix | None (en) |
| dbp:c | 15 (xsd:integer) |
| dbp:casNumber | 433265 (xsd:integer) |
| dbp:chemspiderid | 7989164 (xsd:integer) |
| dbp:h | 23 (xsd:integer) |
| dbp:iupacName | 3 (xsd:integer) |
| dbp:kegg | D10007 (en) |
| dbp:n | 1 (xsd:integer) |
| dbp:o | 1 (xsd:integer) |
| dbp:pubchem | 9813414 (xsd:integer) |
| dbp:smiles | Oc1cccc[C@@H]2CCCC[C@H]2CNC (en) |
| dbp:stdinchi | 1 (xsd:integer) |
| dbp:stdinchikey | JIRYWFYYBBRJAN-ZFWWWQNUSA-N (en) |
| dbp:synonyms | Faxeladol (en) |
| dbp:unii | C04V6SGK8H (en) |
| dbp:verifiedfields | changed (en) |
| dbp:verifiedrevid | 447986858 (xsd:integer) |
| dbp:watchedfields | changed (en) |
| dbp:width | 200 (xsd:integer) |
| dbp:wikiPageUsesTemplate | dbt:Analgesic-stub dbt:Analgesics dbt:Drugbox dbt:Opioidergics dbt:Reflist dbt:Short_description dbt:Cascite dbt:Chemspidercite dbt:Drugbankcite dbt:Fdacite dbt:Keggcite dbt:Stdinchicite |
| dcterms:subject | dbc:Analgesics dbc:Phenols dbc:Synthetic_opioids |
| rdf:type | owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:Abstraction100002137 yago:Chemical114806838 yago:Compound114818238 yago:Material114580897 yago:Matter100020827 yago:OrganicCompound114727670 yago:Part113809207 yago:Phenol114989545 yago:PhysicalEntity100001930 yago:Relation100031921 dbo:Drug yago:Substance100019613 yago:WikicatPhenols umbel-rc:DrugProduct |
| rdfs:comment | Faxeladol (INN, USAN) (code names GRTA-9906, GRTA-0009906, EM-906, GCR-9905, GRT-TA300) is an opioid analgesic which was developed by Grünenthal GmbH but was never marketed for medical use anywhere in the world. It is related to tramadol and ciramadol, and was developed shortly after tramadol in the late 1970s. Similarly to tramadol, it was believed faxeladol would have analgesic, as well as antidepressant effects, due to its action on serotonin and norepinephrine reuptake. In various studies in the 1970s alongside tramadol, faxeladol was seen to be slightly more potent than tramadol, but with a higher rate of sudden seizures than tramadol, which is known to cause seizures without warning in some users. (en) |
| rdfs:label | Faxeladol (en) |
| owl:sameAs | freebase:Faxeladol yago-res:Faxeladol wikidata:Faxeladol dbpedia-sh:Faxeladol dbpedia-sr:Faxeladol https://global.dbpedia.org/id/4jj8U |
| prov:wasDerivedFrom | wikipedia-en:Faxeladol?oldid=1082990447&ns=0 |
| foaf:depiction | wiki-commons:Special:FilePath/Faxeladol_Structural_Formulae_(1R,2R).png |
| foaf:isPrimaryTopicOf | wikipedia-en:Faxeladol |
| is dbo:wikiPageWikiLink of | dbr:Profadol dbr:List_of_opioids dbr:Ciramadol dbr:BDPC dbr:C-8813 dbr:C15H23NO dbr:Opioid dbr:List_of_drugs:_Fa |
| is foaf:primaryTopic of | wikipedia-en:Faxeladol |
