| dbo:abstract |
Fosmanogepix is an experimental antifungal drug being developed by Pfizer. It is being investigated for its potential to treat various fungal infections including aspergillosis, candidaemia, and coccidioidomycosis. Fosmanogepix is a prodrug and is converted into the active drug form, manogepix, after administration. Manogepix targets the Gwt1 (Glycosylphosphatidylinositol-anchored Wall protein Transfer 1), an enzyme in the glycosylphosphatidylinositol (GPI) anchor biosynthesis pathway. Inhibiting this enzyme prevents the fungi from producing certain proteins essential to its life cycle. This mechanism of action is novel; therefore, if approved, fosmanogepix would become a first-in-class medication. (en) |
| dbo:casNumber |
2091769-17-2 |
| dbo:drugbank |
15183 |
| dbo:fdaUniiCode |
1XQ871489P |
| dbo:kegg |
D11694 |
| dbo:pubchem |
44123754 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Fosmanogepix.svg?width=300 |
| dbo:wikiPageID |
71168243 (xsd:integer) |
| dbo:wikiPageLength |
5699 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1122382887 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Antifungal dbr:Pfizer dbc:Experimental_drugs dbc:Organophosphates dbc:Prodrugs dbr:Coccidioidomycosis dbr:Prodrug dbr:Drug_development dbr:Glycosylphosphatidylinositol dbc:Aminopyridines dbc:Zwitterions dbr:Aspergillosis dbc:Isoxazoles dbc:Antifungals dbr:Mechanism_of_action dbr:Medication dbr:First-in-class_medication dbr:Manogepix dbr:Candidaemia dbr:Inositol_acyltransferase |
| dbp:atcPrefix |
None (en) |
| dbp:c |
22 (xsd:integer) |
| dbp:casNumber |
2091769 (xsd:integer) |
| dbp:chemspiderid |
64853722 (xsd:integer) |
| dbp:date |
November 2022 (en) |
| dbp:drugbank |
15183 (xsd:integer) |
| dbp:h |
21 (xsd:integer) |
| dbp:iupacName |
[2-Amino-3--1-pyridiniumyl]methyl hydrogen phosphate (en) |
| dbp:kegg |
D11694 (en) |
| dbp:legalStatus |
Investigational (en) |
| dbp:n |
4 (xsd:integer) |
| dbp:o |
6 (xsd:integer) |
| dbp:p |
1 (xsd:integer) |
| dbp:pubchem |
44123754 (xsd:integer) |
| dbp:reason |
What are the specific proteins? (en) |
| dbp:smiles |
c1ccncOCc2cccCc3ccc4ccc[n+]COP[O-] (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
JQONJQKKVAHONF-UHFFFAOYSA-N (en) |
| dbp:synonyms |
APX001, APX-001 (en) |
| dbp:unii |
1 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Clarify dbt:Infobox_drug dbt:Reflist dbt:Antiinfective-drug-stub |
| dcterms:subject |
dbc:Experimental_drugs dbc:Organophosphates dbc:Prodrugs dbc:Aminopyridines dbc:Zwitterions dbc:Isoxazoles dbc:Antifungals |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
Fosmanogepix is an experimental antifungal drug being developed by Pfizer. It is being investigated for its potential to treat various fungal infections including aspergillosis, candidaemia, and coccidioidomycosis. (en) |
| rdfs:label |
Fosmanogepix (en) |
| owl:sameAs |
wikidata:Fosmanogepix https://global.dbpedia.org/id/GWLwU |
| prov:wasDerivedFrom |
wikipedia-en:Fosmanogepix?oldid=1122382887&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Fosmanogepix.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Fosmanogepix |
| is dbo:wikiPageWikiLink of |
dbr:Scedosporiosis dbr:Pfizer dbr:Karen_Joy_Shaw dbr:Manogepix |
| is foaf:primaryTopic of |
wikipedia-en:Fosmanogepix |
