| dbo:abstract |
Mexrenone (code names ZK-32055, SC-25152) is a steroidal antimineralocorticoid of the spirolactone group related to spironolactone that was never marketed. It is the lactonic form of mexrenoic acid (mexrenoate), and mexrenoate potassium (SC-26714), the potassium salt of mexrenoic acid, also exists. In addition to the mineralocorticoid receptor, mexrenone also binds to the glucocorticoid, androgen, and progesterone receptors. Relative to spironolactone, it has markedly reduced antiandrogen activity (approximately one-tenth of the antimineralocorticoid dosage equivalent antiandrogen activity of spironolactone). Eplerenone is the 9-11α-epoxy analogue of mexrenone. (en) |
| dbo:casNumber |
41020-65-9 |
| dbo:fdaUniiCode |
16FTD41OAV |
| dbo:pubchem |
3082529 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Mexrenone.svg?width=300 |
| dbo:wikiPageID |
41576076 (xsd:integer) |
| dbo:wikiPageLength |
4116 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1084549092 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Canrenone dbr:Potassium dbr:Potassium_canrenoate dbr:Epoxide dbr:Androgen_receptor dbr:Antimineralocorticoid dbr:Structural_analog dbc:Abandoned_drugs dbc:Antimineralocorticoids dbc:Pregnanes dbc:Spiro_compounds dbc:Steroidal_antiandrogens dbr:Eplerenone dbr:Lactone dbr:Antiandrogen dbr:Steroid dbr:Progesterone_receptor dbr:Mexrenoate_potassium dbr:Mexrenoic_acid dbc:Spirolactones dbr:Prorenone dbr:Glucocorticoid_receptor dbr:Spironolactone dbr:Mineralocorticoid_receptor dbr:Salt_(chemistry) dbr:Spirolactone |
| dbp:c |
24 (xsd:integer) |
| dbp:casNumber |
41020 (xsd:integer) |
| dbp:chemspiderid |
10257997 (xsd:integer) |
| dbp:h |
32 (xsd:integer) |
| dbp:iupacName |
methyl -10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate (en) |
| dbp:o |
5 (xsd:integer) |
| dbp:pubchem |
3082529 (xsd:integer) |
| dbp:smiles |
COC[C@@H]4C\C1=C\CCC[C@]1[C@H]5CC[C@@]3[C@@H][C@H]45 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
ADZYJDJNIBFOQE-RGKMBJPFSA-N (en) |
| dbp:synonyms |
ZK-32055; SC-25152; 7α-canrenone; (17β-Hydroxy-3-oxo-17α-pregn-4-ene-7α,21-dicarboxylic acid γ-lactone methyl ester) (en) |
| dbp:unii |
16 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Androgen_receptor_modulators dbt:Drugbox dbt:Mineralocorticoid_receptor_modulators dbt:Reflist dbt:Short_description dbt:Steroid-stub dbt:Fdacite dbt:Cardiovascular-drug-stub |
| dcterms:subject |
dbc:Abandoned_drugs dbc:Antimineralocorticoids dbc:Pregnanes dbc:Spiro_compounds dbc:Steroidal_antiandrogens dbc:Spirolactones |
| gold:hypernym |
dbr:Antimineralocorticoid |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatSpiroCompounds yago:WikicatSteroids yago:Abstraction100002137 yago:Chemical114806838 yago:Cognition100023271 yago:Compound105870180 yago:Compound114818238 yago:Concept105835747 yago:Content105809192 yago:Idea105833840 yago:Material114580897 yago:Matter100020827 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:PsychologicalFeature100023100 yago:Relation100031921 dbo:Drug yago:Steroid115057744 yago:Substance100019613 yago:Whole105869584 |
| rdfs:comment |
Mexrenone (code names ZK-32055, SC-25152) is a steroidal antimineralocorticoid of the spirolactone group related to spironolactone that was never marketed. It is the lactonic form of mexrenoic acid (mexrenoate), and mexrenoate potassium (SC-26714), the potassium salt of mexrenoic acid, also exists. In addition to the mineralocorticoid receptor, mexrenone also binds to the glucocorticoid, androgen, and progesterone receptors. Relative to spironolactone, it has markedly reduced antiandrogen activity (approximately one-tenth of the antimineralocorticoid dosage equivalent antiandrogen activity of spironolactone). Eplerenone is the 9-11α-epoxy analogue of mexrenone. (en) |
| rdfs:label |
Mexrenone (en) |
| owl:sameAs |
freebase:Mexrenone yago-res:Mexrenone wikidata:Mexrenone https://global.dbpedia.org/id/ZDS4 |
| prov:wasDerivedFrom |
wikipedia-en:Mexrenone?oldid=1084549092&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Mexrenone.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Mexrenone |
| is dbo:wikiPageWikiLink of |
dbr:Antimineralocorticoid dbr:Eplerenone dbr:Mexrenoate_potassium dbr:Mexrenoic_acid dbr:Prorenone dbr:C24H32O5 dbr:Spironolactone dbr:List_of_steroidal_antiandrogens dbr:Sex_hormone-binding_globulin dbr:Spirolactone dbr:Steroidal_antiandrogen |
| is foaf:primaryTopic of |
wikipedia-en:Mexrenone |
