| dbo:abstract |
بليكاميسين (بالإنجليزية: Plicamycin) هو دواء يُستعمل في علاج: * * ابيضاض المحببات المزمن * سرطان الخصية * فرط كالسيوم الدم (ar) Plicamycin (INN, also known as mithramycin; trade name Mithracin) is an antineoplastic antibiotic produced by Streptomyces plicatus. It is an RNA synthesis inhibitor. The manufacturer discontinued production in 2000. Several different structures are currently reported in different places all with the same chromomycin core, but with different stereochemistry in the glycoside chain, a 1999 study has re-investigated the compound and proposed a revised structure. (en) La plicamicina (o mitramicina) è un antibiotico antineoplastico prodotto da , e . È un inibitore della sintesi dell'RNA. (it) |
| dbo:casNumber |
18378-89-7 |
| dbo:chEMBL |
509846 |
| dbo:drugbank |
DB06810 |
| dbo:fdaUniiCode |
NIJ123W41V |
| dbo:kegg |
D00468 |
| dbo:pubchem |
5284610 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Plicamycin.svg?width=300 |
| dbo:wikiPageExternalLink |
https://web.archive.org/web/20151122093256/http:/pharmacy.mc.uky.edu/cpri/snpa.php |
| dbo:wikiPageID |
13039895 (xsd:integer) |
| dbo:wikiPageLength |
7542 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1120043328 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:Antibiotic dbr:Intravenous_therapy dbr:Antineoplastic dbc:DNA_replication_inhibitors dbr:Paget's_disease_of_bone dbr:Center_for_Pharmaceutical_Research_and_Innovation dbr:Chromatin dbr:International_Nonproprietary_Name dbr:Testicular_cancer dbr:Chronic_myeloid_leukemia dbr:Streptomyces_plicatus dbr:Gene_transcription dbr:Hypercalcemia |
| dbp:atcPrefix |
L01 (en) |
| dbp:atcSuffix |
DC02 (en) |
| dbp:c |
52 (xsd:integer) |
| dbp:casNumber |
18378 (xsd:integer) |
| dbp:chembl |
509846 (xsd:integer) |
| dbp:chemspiderid |
4447655 (xsd:integer) |
| dbp:drugbank |
DB06810 (en) |
| dbp:h |
76 (xsd:integer) |
| dbp:iupacName |
-5 (xsd:integer) |
| dbp:kegg |
D00468 (en) |
| dbp:legalStatus |
discontinued (en) |
| dbp:legalUs |
Rx-only (en) |
| dbp:o |
24 (xsd:integer) |
| dbp:pregnancyUs |
X (en) |
| dbp:pubchem |
5284610 (xsd:integer) |
| dbp:routesOfAdministration |
dbr:Intravenous_therapy |
| dbp:smiles |
CO[C@H]C1Cc2cc3ccccc3cc2C[C@H]1O[C@H]1C[C@@H][C@H][C@@H]O1 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
CFCUWKMKBJTWLW-GWRQQDNDSA-N (en) |
| dbp:synonyms |
Aureolic acid; Mithracin; Antibiotic LA 7017; Mithramycin A; Mitramycin; Plicatomycin (en) |
| dbp:unii |
NIJ123W41V (en) |
| dbp:verifiedfields |
changed (en) |
| dbp:verifiedrevid |
464208709 (xsd:integer) |
| dbp:width |
300 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Chemotherapeutic_agents dbt:Drugbox dbt:Reflist dbt:Short_description dbt:Cascite dbt:Chemspidercite dbt:Drugbankcite dbt:Ebicite dbt:Fdacite dbt:Keggcite dbt:Stdinchicite dbt:Xenobiotic-sensing_receptor_modulators dbt:Drugs.com |
| dct:subject |
dbc:DNA_replication_inhibitors |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatDNAReplicationInhibitors yago:Inhibitor114724436 yago:Matter100020827 yago:PhysicalEntity100001930 dbo:Drug yago:Substance100020090 umbel-rc:DrugProduct |
| rdfs:comment |
بليكاميسين (بالإنجليزية: Plicamycin) هو دواء يُستعمل في علاج: * * ابيضاض المحببات المزمن * سرطان الخصية * فرط كالسيوم الدم (ar) Plicamycin (INN, also known as mithramycin; trade name Mithracin) is an antineoplastic antibiotic produced by Streptomyces plicatus. It is an RNA synthesis inhibitor. The manufacturer discontinued production in 2000. Several different structures are currently reported in different places all with the same chromomycin core, but with different stereochemistry in the glycoside chain, a 1999 study has re-investigated the compound and proposed a revised structure. (en) La plicamicina (o mitramicina) è un antibiotico antineoplastico prodotto da , e . È un inibitore della sintesi dell'RNA. (it) |
| rdfs:label |
بليكاميسين (ar) Plicamicina (it) Plicamycin (en) |
| owl:sameAs |
freebase:Plicamycin yago-res:Plicamycin wikidata:Plicamycin dbpedia-ar:Plicamycin http://azb.dbpedia.org/resource/میترامایسین dbpedia-cy:Plicamycin dbpedia-fa:Plicamycin dbpedia-it:Plicamycin dbpedia-sh:Plicamycin dbpedia-sr:Plicamycin dbpedia-vi:Plicamycin https://global.dbpedia.org/id/3cRpD |
| prov:wasDerivedFrom |
wikipedia-en:Plicamycin?oldid=1120043328&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Plicamycin.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Plicamycin |
| is dbo:wikiPageRedirects of |
dbr:C52H76O24 dbr:ATC_code_L01DC02 dbr:ATCvet_code_QL01DC02 dbr:Mithracin dbr:Mithramycin dbr:Mithramycin_A dbr:Mitramycin dbr:Aureolic_acid dbr:Plicatomycin |
| is dbo:wikiPageWikiLink of |
dbr:List_of_compounds_with_carbon_numbers_50+ dbr:Sp1_transcription_factor dbr:Hypercalcaemia dbr:California_Proposition_65_list_of_chemicals dbr:C52H76O24 dbr:Cell_synchronization dbr:List_of_MeSH_codes_(D04) dbr:List_of_MeSH_codes_(D09) dbr:ATC_code_L01DC02 dbr:ATCvet_code_QL01DC02 dbr:ATC_code_L01 dbr:List_of_drugs:_Pj–Pra dbr:Mithracin dbr:Mithramycin dbr:Mithramycin_A dbr:Mitramycin dbr:Aureolic_acid dbr:Plicatomycin |
| is foaf:primaryTopic of |
wikipedia-en:Plicamycin |
