| dbo:abstract |
Estradiol phosphate, or estradiol 17β-phosphate, also known as estra-1,3,5(10)-triene-3,17β-diol 17β-(dihydrogen phosphate), is an estrogen which was never marketed. It is an estrogen ester, specifically an ester of estradiol with phosphoric acid, and acts as a prodrug of estradiol in the body. It is rapidly cleaved by phosphatase enzymes into estradiol upon administration. Estradiol phosphate is contained within the chemical structures of two other estradiol esters, polyestradiol phosphate (a polymer of estradiol phosphate) and estramustine phosphate (estradiol 3-normustine 17β-phosphate), both of which have been marketed for the treatment of prostate cancer. (en) |
| dbo:casNumber |
4995-43-1 |
| dbo:chEMBL |
1642763 |
| dbo:class |
dbr:Estrogen_(medication) dbr:Estrogen_ester |
| dbo:fdaUniiCode |
SKL7PDP588 |
| dbo:pubchem |
66435 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Estradiol_17-phosphate.svg?width=300 |
| dbo:wikiPageID |
56183235 (xsd:integer) |
| dbo:wikiPageLength |
4102 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1120786448 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:List_of_estrogen_esters dbc:Abandoned_drugs dbc:Phosphate_esters dbc:Prodrugs dbc:Steroids dbc:Synthetic_estrogens dbr:Chemical_structure dbr:Ester dbr:Estrogen_(medication) dbr:Estrogen_ester dbr:Enzyme dbr:Prodrug dbr:Prostate_cancer dbr:Estradiol_(medication) dbr:Estramustine_phosphate dbc:Estradiol_esters dbr:Bond_cleavage dbr:Phosphoric_acid dbr:Polyestradiol_phosphate dbr:Polymer dbr:Phosphatase dbr:Normustine dbr:Estradiol_ester |
| dbp:c |
18 (xsd:integer) |
| dbp:casNumber |
4995 (xsd:integer) |
| dbp:chembl |
1642763 (xsd:integer) |
| dbp:chemspiderid |
10043883 (xsd:integer) |
| dbp:class |
dbr:Estrogen_(medication) dbr:Estrogen_ester |
| dbp:h |
25 (xsd:integer) |
| dbp:image |
Estradiol phosphate molecule ball.png (en) |
| dbp:iupacName |
[-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] dihydrogen phosphate (en) |
| dbp:o |
5 (xsd:integer) |
| dbp:p |
1 (xsd:integer) |
| dbp:pubchem |
66435 (xsd:integer) |
| dbp:smiles |
C[C@]12CC[C@H]3[C@H]CCC4=C3C=CCO (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
BBWXLCKRYRQQPL-ZBRFXRBCSA-N (en) |
| dbp:synonyms |
Estradiol 17β-phosphate; Estra-1,3,5-triene-3,17β-diol 17β-; 3-Hydroxyestra-1,3,5-trien-17β-yl phosphate (en) |
| dbp:unii |
SKL7PDP588 (en) |
| dbp:width |
250 (xsd:integer) |
| dbp:wikiPageUsesTemplate |
dbt:Distinguish dbt:Drugbox dbt:Estrogen_receptor_modulators dbt:Genito-urinary-drug-stub dbt:Reflist dbt:Short_description dbt:Steroid-stub dbt:Cascite dbt:Structural_properties_of_selected_estradiol_esters dbt:Estradiol |
| dcterms:subject |
dbc:Abandoned_drugs dbc:Phosphate_esters dbc:Prodrugs dbc:Steroids dbc:Synthetic_estrogens dbc:Estradiol_esters |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 dbo:Drug |
| rdfs:comment |
Estradiol phosphate, or estradiol 17β-phosphate, also known as estra-1,3,5(10)-triene-3,17β-diol 17β-(dihydrogen phosphate), is an estrogen which was never marketed. It is an estrogen ester, specifically an ester of estradiol with phosphoric acid, and acts as a prodrug of estradiol in the body. It is rapidly cleaved by phosphatase enzymes into estradiol upon administration. Estradiol phosphate is contained within the chemical structures of two other estradiol esters, polyestradiol phosphate (a polymer of estradiol phosphate) and estramustine phosphate (estradiol 3-normustine 17β-phosphate), both of which have been marketed for the treatment of prostate cancer. (en) |
| rdfs:label |
Estradiol phosphate (en) |
| owl:differentFrom |
dbr:Polyestradiol_phosphate |
| owl:sameAs |
wikidata:Estradiol phosphate https://global.dbpedia.org/id/2YwHY |
| prov:wasDerivedFrom |
wikipedia-en:Estradiol_phosphate?oldid=1120786448&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Estradiol_phosphate_molecule_ball.png wiki-commons:Special:FilePath/Estradiol_17-phosphate.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Estradiol_phosphate |
| is dbo:wikiPageRedirects of |
dbr:Oestradiol_17β-(dihydrogen_phosphate) dbr:Oestradiol_17β-phosphate dbr:Oestradiol_dihydrogen_phosphate dbr:Oestradiol_phosphate dbr:Estradiol_17β-(dihydrogen_phosphate) dbr:Estradiol_17β-phosphate dbr:Estradiol_dihydrogen_phosphate |
| is dbo:wikiPageWikiLink of |
dbr:List_of_estrogen_esters dbr:Pharmacokinetics_of_estradiol dbr:Estrogen_ester dbr:Estrone_phosphate dbr:Polyestradiol_phosphate dbr:Polytestosterone_phloretin_phosphate dbr:Oestradiol_17β-(dihydrogen_phosphate) dbr:Oestradiol_17β-phosphate dbr:Oestradiol_dihydrogen_phosphate dbr:Oestradiol_phosphate dbr:Estradiol_17β-(dihydrogen_phosphate) dbr:Estradiol_17β-phosphate dbr:Estradiol_dihydrogen_phosphate |
| is owl:differentFrom of |
dbr:Polyestradiol_phosphate |
| is foaf:primaryTopic of |
wikipedia-en:Estradiol_phosphate |
