| dbo:abstract |
رينزابرايد (بالإنجليزية: Renzapride) ويعرف بالاسم التجاري رينزابرايد (بالإنجليزية: Renzapride) هو دواء يساعد على تنظيم حركة الأمعاء، ويستخدم لعلاج التهاب المعدة، والارتجاع المعدي المريئي، عسر الهضم، أعراض القولون العصبي. (ar) Renzapride is a prokinetic agent and antiemetic which acts as a full 5-HT4 agonist and partial 5-HT3 antagonist. It also functions as a 5-HT2B antagonist and has some affinity for the 5-HT2A and 5-HT2C receptors. Renzapride was being developed by Alizyme plc of the United Kingdom. In May 2016, EndoLogic LLC, a US-based pharmaceutical and medical device company, acquired the US and worldwide patent rights to Renzapride. Endologic confirmed the cardiac safety of renzapride through a “Thorough QTc” study and sold the rights to Atlantic Healthcare plc in 2019, a specialist pharmaceutical company. Atlantic Healthcare is focusing on the development of renzapride for the management of gastrointestinal (GI) motility in a number of rare diseases, including systemic scleroderma and cystic fibrosis, both of which are associated with chronic GI motility problems and for which there are no approved therapies. (en) |
| dbo:casNumber |
109872-41-5 112727-80-7 |
| dbo:chEMBL |
289753 |
| dbo:fdaUniiCode |
6H0SNK4GNT 9073C0W4E9 |
| dbo:pubchem |
3086547 |
| dbo:thumbnail |
wiki-commons:Special:FilePath/Renzapride.svg?width=300 |
| dbo:wikiPageID |
2239896 (xsd:integer) |
| dbo:wikiPageLength |
8927 (xsd:nonNegativeInteger) |
| dbo:wikiPageRevisionID |
1115979742 (xsd:integer) |
| dbo:wikiPageWikiLink |
dbr:5-HT3 dbr:Antiemetic dbr:Prokinetic_agent dbc:Abandoned_drugs dbc:Chloroarenes dbc:Nitrogen_heterocycles dbc:Phenol_ethers dbr:Receptor_antagonist dbr:Irritable_bowel_syndrome dbr:Agonist dbr:5-HT2B_receptor dbc:5-HT3_antagonists dbc:Benzamides dbc:Anilines dbc:Heterocyclic_compounds_with_2_rings dbr:5-HT2A dbr:5-HT2C dbr:5-HT4 |
| dbp:atcPrefix |
none (en) |
| dbp:c |
16 (xsd:integer) |
| dbp:casNumber |
109872 (xsd:integer) 112727 (xsd:integer) |
| dbp:chembl |
289753 (xsd:integer) |
| dbp:chemspiderid |
16736758 (xsd:integer) |
| dbp:cl |
1 (xsd:integer) |
| dbp:h |
22 (xsd:integer) |
| dbp:index2Label |
HCl (en) |
| dbp:iupacName |
4 (xsd:integer) |
| dbp:iupharLigand |
244 (xsd:integer) |
| dbp:n |
3 (xsd:integer) |
| dbp:o |
2 (xsd:integer) |
| dbp:pubchem |
3086547 (xsd:integer) |
| dbp:smiles |
Clc1ccCN[C@@H]3CC[N@]2C[C@@H]3CCC2 (en) |
| dbp:stdinchi |
1 (xsd:integer) |
| dbp:stdinchikey |
GZSKEXSLDPEFPT-IINYFYTJSA-N (en) |
| dbp:unii |
6 (xsd:integer) 9073 (xsd:integer) |
| dbp:verifiedfields |
changed (en) |
| dbp:verifiedrevid |
464380859 (xsd:integer) |
| dbp:watchedfields |
changed (en) |
| dbp:wikiPageUsesTemplate |
dbt:Drugbox dbt:Reflist dbt:Serotonergics dbt:Short_description dbt:Cascite dbt:Chemspidercite dbt:Drugbankcite dbt:Ebicite dbt:Fdacite dbt:Stdinchicite dbt:Antiemetics dbt:Propulsives |
| dcterms:subject |
dbc:Abandoned_drugs dbc:Chloroarenes dbc:Nitrogen_heterocycles dbc:Phenol_ethers dbc:5-HT3_antagonists dbc:Benzamides dbc:Anilines dbc:Heterocyclic_compounds_with_2_rings |
| gold:hypernym |
dbr:Agent |
| rdf:type |
owl:Thing dul:ChemicalObject dbo:ChemicalSubstance wikidata:Q8386 yago:WikicatAnilines yago:WikicatNitrogenHeterocycles yago:Abstraction100002137 yago:AliphaticCompound114601294 yago:Amine114739004 yago:Aniline114754505 yago:Chemical114806838 yago:Compound114818238 yago:Element114840755 yago:HeterocyclicCompound115025397 yago:Material114580897 yago:Matter100020827 yago:MethaneSeries114951377 yago:OrganicCompound114727670 yago:Part113809207 yago:PhysicalEntity100001930 yago:Quintessence114847103 yago:Relation100031921 dbo:Drug yago:Substance100019613 yago:WikicatPhenolEthers |
| rdfs:comment |
رينزابرايد (بالإنجليزية: Renzapride) ويعرف بالاسم التجاري رينزابرايد (بالإنجليزية: Renzapride) هو دواء يساعد على تنظيم حركة الأمعاء، ويستخدم لعلاج التهاب المعدة، والارتجاع المعدي المريئي، عسر الهضم، أعراض القولون العصبي. (ar) Renzapride is a prokinetic agent and antiemetic which acts as a full 5-HT4 agonist and partial 5-HT3 antagonist. It also functions as a 5-HT2B antagonist and has some affinity for the 5-HT2A and 5-HT2C receptors. Renzapride was being developed by Alizyme plc of the United Kingdom. In May 2016, EndoLogic LLC, a US-based pharmaceutical and medical device company, acquired the US and worldwide patent rights to Renzapride. Endologic confirmed the cardiac safety of renzapride through a “Thorough QTc” study and sold the rights to Atlantic Healthcare plc in 2019, a specialist pharmaceutical company. (en) |
| rdfs:label |
رينزابرايد (ar) Renzapride (en) |
| owl:sameAs |
freebase:Renzapride yago-res:Renzapride wikidata:Renzapride dbpedia-ar:Renzapride dbpedia-sh:Renzapride dbpedia-sr:Renzapride https://global.dbpedia.org/id/4rXaU |
| prov:wasDerivedFrom |
wikipedia-en:Renzapride?oldid=1115979742&ns=0 |
| foaf:depiction |
wiki-commons:Special:FilePath/Renzapride.svg |
| foaf:isPrimaryTopicOf |
wikipedia-en:Renzapride |
| is dbo:wikiPageWikiLink of |
dbr:Benzamide dbr:Prokinetic_agent dbr:5-HT3_antagonist dbr:5-HT3_receptor dbr:5-HT4_receptor dbr:5-HT_receptor dbr:C16H22ClN3O2 dbr:List_of_drugs:_Re |
| is foaf:primaryTopic of |
wikipedia-en:Renzapride |
